Flavors &

Fragrances

Feel inspired
with exceptional aroma materials
driving artistic achievement

Feel it.

SAFC® Flavors & Fragrances

Feel it.
The perfect blend of products
and services to bring your
creativity to life.

The essence of
your success
With the industry’s widest selection of avor and fragrance raw materials in stock,
SAFC can deliver over 1,600 aroma chemicals anywhere in the world. Whether your
creation requires certied Food-grade, Natural, Kosher or Halal materials, SAFC can
provide them on time, in the quantities needed, and with uncompromised quality.
Accelerate research, streamline manufacturing, and reduce
supply chain risk with SAFC’s:
• Vast selection of avor raw materials
• Exceptional quality, documentation and track record in regulatory
compliance
• On-time delivery through a global network that includes ofces in
40 countries
• Ready-to-ship packages to 25 kg or customizable options
Available materials include:






More than 1,600 aroma raw materials (new products added monthly)
More than 350 food-grade-certied products
1,100 Kosher Parve-certied products
525 Halal-certied products
More than 400 Food Chemicals Codex listings
250 naturals
170 essential oils

Table of contents
Product types and certifications...........................................................................2
Quality and risk management.............................................................................. 3
Customized services............................................................................................ 4
General information............................................................................................... 5
Products................................................................................................................. 7
Indexes............................................................................................................... 131
Food-grade certified products.................................................................. 132
Naturals and essential oils......................................................................... 135
FEMA.......................................................................................................... 137
Organoleptic properties............................................................................ 145
Catalog number/hazard information........................................................ 170
Trademarks.................................................................................................. 192

Key to product listings
1.

Product name

9.

2.

Formula weight

3.

Indicates material meets specifications
in the Food Chemicals Codex

10. Reference to Perfume and Flavor
Chemicals (Aroma Chemicals by
Steffen Artander)

4.

Synonym

5.

Cross reference entry

6.

FEMA number: Flavor and Extract
Manufacturer’s Association of the
United States

7.
8.

12. Council of Europe number

19. Product is an essential oil

13. Kosher grade: material is only kosher
when bearing the kosher seal

2

3

4

20. Catalog number

5

21. Reference to Fenaroli’s Handbook of
Flavor Ingredients, 3rd Edition by
T.E. Fura and N. Bellance
Note: Contact your local SAFC representative for
current pricing information.
Vanillin

7

6

8

> Copra oil, see Coconut oil Page 1

Ethanal
[75‑07‑0] FEMA 2003 Flavis 5.001 CoE Nr 89
CH3CHO C2H4O FW 44.05

Arc. 3; Fen. 3

 natural, ≥99%, FCC, FG
Halal, Kosher
Organoleptic: ethereal; coffee; wine-like
May form a small amount of trimer

Dimethyl sulfide
DMS

predominantly trans

[75‑18‑3] FEMA 2746 Flavis 12.006 CoE Nr 483c
(CH3)2S C2H6S FW 62.13

 85%

Kosher, NI
Organoleptic: sulfurous; vegetable
400 g

W200336-1.9KG-K

1.9 kg

W200336-12KG-K

12 kg

8

Copra oil; Coconut fat; Coconut oil from Cocos
nucifera

W274615-1KG-K

1 kg

W274615-25KG-K

25 kg

33, 50 (2008)
W395701

4-Hydroxy-3-methoxybenzaldehyde

Cyclotene

 virgin, Certified organic (NOP/EU)

 98%, FCC, FG

[121‑33‑5] FEMA 3107 Flavis 5.018
4-(HO)C6H3-3-(OCH3)CHO C8H8O3 FW 152.15

from (Cocos nucifera)
Philippines origin

Organoleptic: caramel; maple; smoky; nutty; coffee
Halal, Kosher, NI

W530155-SAMPLE

W270008-SAMPLE-K

18

Feel inspired at safcglobal.com

11

Organoleptic: caramel; chocolate; sweet; vanilla
Arc. 3067; Fen. 792

 ≥97%, FCC, FG

12

CoE Nr 107

W270008-25KG-K

17

10

Vanillin

Methyl cyclopentenolone

[8001‑31‑8]

5 kg

FEMA 3957 Flavis 8.114

Lit. cited: 1. Mosciano, Gerard, Perfum. Flavor. 3rd ed.,

W274615-SAMPLE-K

[765‑70‑8] FEMA 2700 CoE Nr 758 C6H8O2
FW 112.13

W530155-5KG

9

Possible uses: lamb, mutton, goat, ripe cheeses,
shell fish, meaty chicken.1
Natural occurrence: strawberry, capsicum frutescens, chicken fat, boiled mutten1

 redistilled, ≥99%, FCC

W200336-400G-K

Coconut oil

2-Octenoic acid
[1871‑67‑6] CH3(CH2)4CH=CHCO2H C8H14O2
FW 142.20

Arc. 1060; Fen. 562

W200336-SAMPLE-K

19

18. Indicates material meets National Organic
Program (NOP) and/or European Union
(EU) standards for organic products

11. Food-grade certified

Acetaldehyde

20

17. New product listing

14. Indicates product is certified as Halal
by the Islamic Food and Nutrition
®
Chemical
Abstracts
Service
(CAS
)
Extract Data: #2545, FnF Front Matter Key to Listings UNP 07/27/11
Council of America
Registry Number
15. Organoleptic properties
Formula

1

21

16. Product is derived from a natureidentical source

Flavis number

Halal, Kosher, NI

25 kg

16

W310700-SAMPLE-K

15

14

13

1

SAFC ingredients meet natural criteria through US Title 21.com/flavors-fragrances Halal products and certification SAFC offers 525 Halal products certified by the Islamic Food and Nutrition Council of America (IFANCA).com/flavors-fragrances How to order Contact your local SAFC representative. Kosher products and certification Take your choice of 1. Natural products Support the natural designation of your product with independent verification of raw materials and complete records that track place of origin. certified by Rabbi Gershon Segal. (see outside back cover of this catalog) or SAFC Flavors & Fragrances at: Telephone Toll-free +1-800-227-4563 International +1-414-438-3850 Fax +1-414-438-4216 Global Email Sales ff@sial. 1334/2008. Halal certificates can be downloaded at: safcglobal.com Customer Service safcff@sial. Organic materials are also tested for compliance to European Union (EU) and United States of America National Organic Program (NOP) standards by the Midwest Organic Services Association.com Online safcglobal. and EU Regulation No.100 Kosher Parve products. Section 101. see back cover. Each complies with European General Food Law Regulations EU 1334/2008.SAFC® Flavors & Fragrances Product types and certifications Food-grade materials Choose from an industry-leading range of more than 350 enhanced-quality food-grade materials. SAFC stakes its reputation on adhering to the most stringent and continually evolving global industry regulations so you can develop new taste technologies with confidence.22(i)(4). EU 178/2002. Article 3(2)(c). Expiration-dated batch lots are free of restricted starting materials and brought from point of manufacture to your receiving dock in accordance with the latest regulations. WI 53209 USA . Kosher certificates can be downloaded at: safcglobal. All products are independently tested for naturalness by the University of Georgia.com/flavors-fragrances Mail SAFC Flavors & Fragrances 6000 N. and US Regulation 21 CFR 110. SAFC’s range of natural ingredients includes: • • • • 2 Certified Organics USA-certified naturals European-certified naturals Essential oils To contact your local SAFC representative. Teutonia Avenue Milwaukee.

ISO 9001:2000 certificates GMO statements Natural certificates Halal certificates Allergen statements Additive statements 3 .Quality and risk management Your order will be shipped from AIB-audited and ISO 9001:2008-accredited facilities in the USA or Europe. SAFC’s high-quality chemicals are underpinned by state-of-the-art technology and quality control. with ample regulatory documentation to support end use.com Worldwide certification SAFC’s dedicated compliance team monitors and anticipates evolving global regulatory needs to ensure your raw materials satisfy national and international safety and quality regulations. Available documentation: • • • • • • • • • • • Specification sheets MSDS statements Certificates of compliance Food-grade certificates Kosher certificates AIB. specifications and food certificates SAFC’s fully compliant global distribution network gives you on-time delivery and raw materials that meet all national and international regulations. SAFC can work with you to customize a streamlined supply chain that delivers consistently high-quality materials in whatever quantities you require. including certificates of analysis. Feel inspired at safcglobal. including: • Heavy-metal testing in accordance with EU 88/388 • Naturalness testing in accordance with USA and European standards • Customized testing available on request • Strict confidentiality • Efficient change control notification processes available for critical raw materials • All the supporting documentation you need (many available online).

You can count on SAFC to deliver fit-for-purpose quantities in packaging designed to fulfill your needs. see back cover. chocolate or meaty notes (ref: W600008) • Esters Kit Fruity. 90.SAFC® Flavors & Fragrances Customized services Speak to SAFC about tailoring supply services to meet your most demanding research or manufacturing deadlines and budgets. SAFC can blend difficult materials. Ask us about customized packaging and returnable containers. 800 or 1. Sample services help you optimize your formulation Packaging services: flexible and convenient Design and improve flavor formulations with sample materials before committing to commercial-scale production. offers complete confidentiality. . 400. We offer small samples of every product to help you minimize risk when developing new flavors and fragrances. mint or waxy notes (ref: W600024) • Beverage Study Kit Contains notes to detect poor or over-fermented processing (ref: W600016) 4 To contact your local SAFC representative.000 L Acetaldehyde containers • Kosher-certified stainless steel containers Blending services: save manufacturing time and effort Simplify your logistics and reduce costs by ordering pre-blended flavors and fragrances made to your precise proprietary specifications. and tests both raw materials and end product to ensure you receive the highest quality. including: Samples are: • Listed as a separate stock-keeping unit for each product in the catalog • Available for a nominal fee • Provided on a lot-specific basis Kits for cost-effective testing and exploration Kits contain 24 products in 2–3 g bottles: • Heterocycles Kit Roasted. • Custom packaging in 18. 200. floral.

Buyer will verify SAFC’s assay of the products. use. in foods. Buyer expressly represents and warrants to SAFC that Buyer will properly test. be introduced into interstate commerce. furnished by SAFC. drugs. SAFC’s warranties made in connection with any sale shall not be effective if SAFC has determined. relabeled or used as starting material or components of other products. now and hereinafter enacted. LOSS OF PRODUCTS OF BUYER OR OTHER USE OR ANY LIABILITY OF BUYER TO A THIRD PARTY ON ACCOUNT OF SUCH LOSS. drugs. DOWN TIME. in SAFC’s catalog. commercial. manufacture. or cosmetics.com Buyer has the responsibility to verify the hazards and to conduct any further research necessary to learn the hazards involved in using products purchased from SAFC. THIS WARRANTY IS EXCLUSIVE. regardless of their nature. INCLUDING PERSONAL INJURY OR PROPERTY DAMAGE. medical devices. that Buyer has misused the products in any manner. etc. Buyer acknowledges that the products have not been tested by SAFC for safety and efficacy in food. as prepayment is required on the initial order. The purity and physical constants stated herein are typical values. unless otherwise stated. Other ordering methods may incur additional service charges. Most high purity (>99. analytical data. WITHOUT LIMITATION. they may vary slightly from batch to batch. No products purchased from SAFC shall. or any other use. Any price reductions will be automatically applied to your invoice. LOSS OF REVENUE OR PROFITS. unless otherwise stated in SAFC literature furnished to Buyer. AND SAFC MAKES NO OTHER WARRANTY.9%) elements and salts are provided with a data sheet giving an actual lot analysis showing ppm levels of metallic impurities. EVEN IF SAFC HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH DAMAGE INCLUDING. under Sections 404. UNLESS SUCH PERSONAL INJURY OR PROPERTY DAMAGE IS CAUSED BY SAFC’S GROSS NEGLIGENCE. Buyer also has the duty to warn Buyer’s customers and any auxiliary personnel (such as freight handlers. since SAFC’s products are. if applicable. furnished by SAFC relating to the use of the products and not misuse the products in any manner. Warranties and disclaimers SAFC warrants that its products shall conform to the description of such products as provided by SAFC through SAFC’s catalog. If you place your order by phone. medical devices. upon the return of such products in accordance with SAFC’s instructions. Specifications and specific lot analyses are available to registered users on our website. Price changes Shipment will be made promptly even if prices have been nominally increased. or has failed to use the products in accordance with instructions. are not to be used for any other purposes. For more information about SAFC’s terms and conditions of sale. SAFC SHALL NOT IN ANY EVENT BE LIABLE FOR INCIDENTAL. please review the following. Variations in hydration or other factors may affect the gross assay of such products. Our New Account department will then verify this information. ­LIABILITY FOR LOSS OF USE. please have a credit card available.General information Open a SAFC® account When you are ready to place your order. be considered to be foods.com for current pricing. All claims must be brought within one (1) year of shipment. Use of products SAFC products are intended primarily for laboratory research purposes and. call our Order/Customer Service number and supply the SAFC service representative with your shipping and billing information. drug. Buyer ­further warrants to SAFC that any material produced with products from SAFC shall not be adulterated or misbranded within the meaning of the Federal Food. If the products purchased from SAFC are to be repackaged. All chemicals listed are subjected to exacting testing in our Quality Control Laboratories for determination of purity. Feel inspired at safcglobal. OR FOR ANY LABOR OR ANY OTHER EXPENSE. Buyer realizes that. at SAFC’s sole discretion. 505. in its sole discretion. along with taking the products for your order. or cosmetics for humans or animals. they may not be on the Toxic Substances Control Act (TSCA) inventory. please reference our quoted prices or our pro forma number. Pricing Prices are subject to change and are inclusive of our electronic e-commerce ordering methods. as well as validate your intended use of our products. you should review our invoices and packing slips. or for commercial purposes. Drug and Cosmetic Act and shall not be materials which may not. FAILURE TO REALIZE SAVINGS. For information regarding the appropriate uses of SAFC products. We guarantee our written quotations for 90 days. has failed to use the products in accordance with industry standards and practices. unless otherwise stated on product labels. unless otherwise stated. if any. including but not limited to. The SAFC service representative will ask you some questions about your general business. This forms the basis for the “nines” notation that we use to be consistent with purity designations in the industry. or other literature. EXPRESS OR IMPLIED. DAMAGE OR LOSS OCCASIONED BY SUCH PRODUCT. medical devices. INCLUDING ANY IMPLIED WARRANTY OF MER­CHANTABILITY OR ­FITNESS FOR ANY PARTICULAR PURPOSE. LOSS OF WORK IN PROGRESS. in vitro diagnostic purposes. or 512 of the Act. and market any products purchased from SAFC and/or materials produced with products purchased from SAFC in accordance with the practices of a reasonable person who is an expert in the field and in strict compliance with all applicable laws and regulations. or you may obtain a copy of our terms and conditions by contacting our Customer Service Department. or in other literature furnished to Buyer. To further expedite the process. Buyer assumes responsibility to assure that the products purchased from SAFC are approved for use under TSCA. Buyer agrees to comply with instructions. Purity Quality is an essential criterion for every SAFC product. if any. 5 . Please visit safcglobal. SAFC’s sole and exclusive liability and Buyer’s exclusive remedy with respect to products proved to SAFC’s satisfaction to be defective or non-conforming shall be replacement of such products without charge or refund of the purchase price. CONSEQUENTIAL OR SPECIAL DAMAGES OF ANY KIND RESULTING FROM ANY USE OR FAILURE OF THE PRODUCTS. we will confirm our current pricing at that time. cosmetic. When placing your order. intended primarily for research purposes.) of any risks involved in using or handling the products.

For collect shipments. Please inspect your packages immediately upon receipt and notify us promptly of any damage or discrepancies. You can choose other forwarders to handle your orders. we will take quick and appropriate action to correct the problem. may be necessary for safe delivery of certain hazardous chemicals. To help prevent delays in customs. or email. we will only ship our products through an International Air Transport Association (IATA)-approved freight forwarder. Hazardous items and items that require ice for shipment incur additional charges. Place orders through your nearest SAFC office. or instruction manuals. Minimize the number of shipments by consolidating the products that require air freight shipment. A return authorization will ensure the safe and proper handling of material and enable us to expedite a resolution. • Any transportation and handling charges quoted or invoiced include charges in addition to actual freight costs. unless alternative instructions are provided when the original order is placed. refrigerated or frozen products. If you place orders by mail. customs and other regulations may prevent us from doing this in your country. compliant formats. backorders can be consolidated with future shipments. in our judgment.S. we have the ability to provide you not only with quality products. We strive to ship all orders without delay and to minimize delivery costs within these regulatory guidelines. In some instances. it is unnecessary to send a confirmation copy.U. and outlining first-aid treatment in case of accidental contact. Please note. Please instruct us accordingly when placing your order. and books. Back-ordered items are shipped FCA shipping point when they become available. Submit orders once to avoid duplication. Whenever possible. and fax number on your purchase order. administrative. Returns accepted for items ordered in error may be subject to a 20% processing fee. such as poison packs or metal over-pack cans. The volume of our international shipments results in very competitive rates from our freight forwarders. Shipment of authorized returns should be made within 30 days of the issuance of the RMA. SAFC consolidates air freight to minimize shipping costs. reagents and standards which have passed their expiration dates. we pay the transportation and handling costs in advance. such orders are delivered on a collect basis. Special packaging. Should an item be shipped to you incorrectly as the result of an error on our part. please include your account number with your preferred carrier to ensure proper billing. hazardous materials cannot be included with wet or dry ice air freight shipments. To contact your local SAFC representative. Our service representatives are happy to assist you with the status of your order. weight. Product documentation As a manufacturer in the life science and high technology markets. Confirm your acceptance of air freight costs on your order. include your account number with your designated carrier. Product information documents • • • • Product Bulletins Use Instructions Application Notes Testing Methods Product quality documents • • • Current Product Specifications Lot-Specific Certificates of Analysis Lot-Specific Certificates of Origin Material Safety Data Sheets (MSDS) • • Available in U. parts. please contact the Customer Service department to obtain a Return Material Authorization (RMA) and shipping instructions. All special packaging. identifying any hazardous properties. and fax ­number as well. 6 Domestic shipping information All orders are shipped FCA shipping point. We can bill individual departments separately. in order to maintain the quality of our products and continue to provide competitive prices. and E. Shipping conditions may differ from our recommended storage temperatures. The customer is responsible for prompt customs clearance. We will do our best to fulfill requests to return material. will not deliver a product safely. see back cover. fax. Transportation charges will vary with the destination. Orders containing hazardous and wet or dry ice items will incur two separate air freight charges. Prior to returning any items. telephone number. These items include: diagnostic reagents. We will ship under conditions that ensure the quality of the product. and freight charges are available upon request at order entry and are indicated on our invoices. but we cannot predict time lost in customs offices or in route. products missing labels.com/safety . in 14 languages Our MSDS clearly defines each product by stating its composition. They are commonly shipped via air freight. However. • • • Include a contact name. ­custom products or special orders. Visit safcglobal. and content of each shipment. In general. These costs are added to your invoice. • Back-ordered items are shipped and invoiced separately as they become available. To minimize freight costs. Wet ice/dry ice shipping information Recommended long-term storage is indicated on the website as follows: 2-8 °C Refrigerator/cooler –20 °C Freezer (implies –10 to –25 °C) –70 °C Ultracold freezer (implies –60 to –100 °C) –196 °C Under liquid nitrogen Not all items requiring long-term cold storage need to be shipped in ice. include the broker’s name. Consolidate orders from different departments within your institution. For orders shipped through our designated carriers.SAFC® Flavors & Fragrances Return policy Our Customer Service department is available to assist you should a problem arise with your order. if necessary. We estimate the amount of dry or wet ice needed. telephone number. certain items may not be returned for credit. but also the technical knowledge and support to back them up. please include name and telephone or fax number of person to contact upon arrival. however. computer software and equipment removed from their original packaging. All orders prepared for shipment outside the contiguous USA are FCA shipping point. For collect shipments. You can help us process your orders quickly and efficiently in a variety of ways: • • We reserve the right to change a requested method of shipment if it does not comply with regulations or. International shipping information Numerous restrictions and regulations govern the international transport of chemical products. Consolidate your orders. If you use a broker or agent to clear your shipments through customs. Items returned without prior authorization may not be accepted.

Products • More than 1.com 7 .100 Kosher Parve-certified products • 525 Halal-certified products • More than 400 Food Chemicals Codex listings • 250 naturals • 170 essential oils Feel inspired at safcglobal.600 aroma raw materials (new products added monthly) • More than 350 food-grade certified products • 1.

17  50 wt. Fen. Kosher Arc. 16.2% BHT as stabilizer Acetanisole Halal. 24. NI W200905-SAMPLE-K [64‑19‑7] FEMA 2006 Flavis 8. FCC. see Lauric acid Page 74  natural.002 CoE Nr 0002 CH3CO2H C2H4O2 FW 60. Fen.1-Dimethoxyethane Page 36 [7493‑57‑4] CH3CH(OCH2CH2C6H5)OCH2CH2CH3 C13H20O2 FW 208. 12. see Methyl β-naphthyl ketone Page 89 Organoleptic: leafy. % in ethanol Organoleptic: honey. hawthorne. 2 Organoleptic: ethereal Kosher  natural W200328-SAMPLE-K Halal. NI Arc. wine-like Kosher W200301-1. 13.05 12 kg 1 kg W332615-4KG W200506-SAMPLE-K Glacial acetic acid W200301-12KG-K 100 g W332615-1KG Methyl phenyl ketone W200301-SAMPLE-K W200301-2KG-K W332615-100G Organoleptic: butter. ethereal contains 0.08 W200409-SAMPLE [100‑06‑1] CH3OC6H4COCH3 C9H10O2 FW 150. see Acetal Page 8 Acetaldehyde dimethyl acetal.05 CoE Nr 737 CH3COCH3 C3H6O FW 58. see Nonyl acetate Page 99 Organoleptic: almond. herbaceous. 6 W508454-100G W508454-1KG 1 kg W200611-SAMPLE-K W508454-10KG 10 kg W508454-25KG 25 kg W200611-1KG-K 1 kg W200611-10KG-K 10 kg W200611-25KG-K 25 kg Place an order with your local SAFC representative (see back for contacts).5KG-K 19. 7 400 g [67‑64‑1] FEMA 3326 Flavis 7. 18. FG W200905-1KG-K 1 kg W200905-10KG-K 10 kg W200905-25KG-K 25 kg Acetovanillone Apocynin. sweet.20 Acetaldehyde phenethyl propyl acetal  ≥98%. 3  natural. 4′-Methoxyacetophenone W200336-SAMPLE-K > Acetoacetic ester. see 1. ethereal Arc. FCC 4-Acetylanisole. Kosher Organoleptic: ethereal. FG Halal.SAFC® Flavors & Fragrances Abl > ABL.1-Diethoxyethane W200344-12KG 12 kg [105‑57‑7] FEMA 2002 Flavis 6. Fen. nutty. sweet.05 W332607-SAMPLE W200336-1. 15 [98‑86‑2] CH3COC6H5 C8H8O FW 120. NI Acetic acid 1. 8 [498‑02‑2] HOC6H3(OCH3)COCH3 C9H10O3 FW 166. fruity. 4′-Hydroxy-3′-methoxyacetophenone Halal.001 CoE Nr 35 CH3CH(OC2H5)2 C6H14O2 FW 118. 28 W200603-1KG-K 1 kg W200603-5KG-K 5 kg W200603-10KG-K 10 kg W200603-25KG-K 25 kg  ≥98% Flavis 7.9KG-K 1. Kosher. ≥97% Organoleptic: ethereal. see Octyl acetate Page 102  natural. floral Halal. see Benzyl acetate Page 17 Acetic acid 3-methylbutyl ester.016 CoE Nr 511 W200204-20KG 20 kg Acetaldehyde Ethanal [75‑07‑0] FEMA 2003 Flavis 5.05  35 wt. green. % in isopropanol W200387-1KG 1 kg 4 kg Acetophenone Arc. coffee. ≥99. 6 W200204-4KG 4 kg  ≥95% W200204-8KG 8 kg FEMA 2004 Flavis 6. Kosher W200328-12KG-K 12 kg W517607-1KG W200220-SAMPLE-K W200328-22KG-K 22 kg W517607-5KG 5 kg W200328-30KG-K 30 kg W517607-10KG 10 kg W200220-100G-K 100 g W200220-1KG-K 1 kg W200220-4KG-K 4 kg W200220-5KG-K 5 kg Halal. FCC W200506-5KG-K 5 kg FEMA 2009 Flavis 7. Fen. see Ethyl acetoacetate Page 42 Acetol.5%. 13 Arc.001 CoE Nr 89 CH3CHO C2H4O FW 44. 3. FCC 100 g W332607-1KG W200409-1KG 1 kg W332607-8KG 8 kg W200409-5KG 5 kg W332607-20KG 20 kg W332615-SAMPLE  ≥98%. see Hydroxyacetone Page 65 2-Acetonaphthone.142 Organoleptic: vanilla NI W508454-SAMPLE  FCC. floral.17 W200336-400G-K Acetone  ≥99%. green. FG Acetoacetanilide [102‑01‑2] CH3COCH2CONHC6H5 C10H11NO2 FW 177. Fen.9 kg 1 kg  natural. vanilla Halal.001 CH3CHO C2H4O FW 44. see Isoamyl acetate Page 67 Acetic acid octyl ester. coffee. NI  ≥98% W517607-SAMPLE > Acetaldehyde diethyl acetal. FG FEMA 2005 Flavis 7.17 W200603-SAMPLE-K Arc. Fen. FCC Kosher W200360-771KG-K 771 kg W200360-30LB-K 30 lb W200360-350LB-K 350 lb W200360-700LB-K 700 lb  ≥99%. ≥99%.004 CoE Nr 138 W200506-25KG-K 25 kg > Acetate C-9. 50 wt. 100 g . 1. caramel. wine-like May form a small amount of trimer 1 kg Organoleptic: apple. 16.15 W200506-1KG-K 1 kg  ≥98%. % ethanol W200344-SAMPLE Acetal W200344-2KG 2 kg Acetaldehyde diethyl acetal. FG 8 > Acetic acid benzyl ester.038 CoE Nr 570 2 kg W200301-19.5 kg Acetaldehyde solution [75‑07‑0] FEMA 2003 Flavis 5.9 kg W200336-12KG-K 12 kg  ≥99%. % in H2O W200379-1KG 1 kg  40 wt.9KG-K NI W200409-100G Arc. Fen. Kosher. Fen. tart Arc.30 W200204-SAMPLE W200204-1KG 1 kg Arc. 6. FCC. Kosher.

288 Organoleptic: berry Kosher 6-Acetyl-1. 3. Kosher Organoleptic: meaty Halal. FCC Organoleptic: nutty Kosher.049 CoE Nr 11293 W379715-100G-K Acetylpyrazine Organoleptic: oily. FG FEMA 3527 Flavis 15.5-dimethylfuran [10599‑70‑9] C8H10O2 FW 138.099 C8H10O4 FW 170.. 15 FEMA 3964 Flavis 14.. 468  ≥85%.082  ≥98%.038 CoE Nr 2315 [1193‑79‑9] C7H8O2 FW 124. see 2′-Methoxyacetophenone Page 79 4-Acetylanisole.024 CoE Nr 11603  ≥98% Halal. nutty Kosher W325104-5KG-K 5 kg W360902-25G-K 25 g W325104-10KG-K 10 kg W360902-100G-K 100 g W339105-SAMPLE-K W325104-25KG-K 25 kg W360902-1KG-K 1 kg 3-Acetyl-2.. hazelnut Halal. Kosher. FCC. see Methyl β-naphthyl ketone Page 89 2-Acetylphenol. mixture of isomers [54300‑08‑2] C8H10N2O FW 150.... see 1-Octen-3-yl acetate Page 101 4-(p-Acetoxyphenyl)-2-butanone  ≥96% W325007-25G-K 25 g W325007-100G-K 100 g W325007-1KG-K 1 kg > Acetylformaldehyde..083 CoE Nr 11038 W325104-SAMPLE-K W325104-100G-K 100 g  ≥99%. NI W325104-1KG-K 1 kg FEMA 3391 Flavis 13.18 3-Acetylpyridine Methyl 3-pyridyl ketone [350‑03‑8] C7H7NO FW 121. see 2-Acetylpyrazine Page 9 Fen..7-hexamethyltetralin W365203-SAMPLE-K W365203-100G-K 100 g W365203-1KG-K 1 kg W526401-SAMPLE W365203-5KG-K 5 kg W526401-1KG > 2-Acetylaniline..com Organoleptic: nutty. sweet.. FG > 2-Acetylnaphthalene.039 CoE Nr 2316 W396400-SAMPLE-K Fen. FG Halal.0% W352705-SAMPLE-K W379700-SAMPLE-K W352705-25G-K 25 g Kosher. 22 2-Acetylpyrazine FEMA 3250 Flavis 14..1. nutty. vegetable Halal.046 CoE Nr 11373 4-hydroxy-2..4. fruity  98%. see 1-Phenyl-1.2.14 Fen.3-Hexanedione Page 60  ≥98% FEMA 3126 Flavis 14.Acetylpyrrole 4-Acetoxy-2. vegetable Halal.18 Kosher Organoleptic: berry. see Pyruvaldehyde solution Page 116 2-Acetylfuran. NI W379715-500G-K W379715-SAMPLE-K [22047‑25‑2] C6H6N2O FW 122. 46. FG [32974‑92‑8] C8H10N2O FW 150.5-dimethylthiophene 2-Acetyl-1-methylpyrrole Strawberry acetate [2530‑10‑1] C8H10OS FW 154.14  ≥98%. Kosher FEMA 3424 Flavis 14. NI W396400-25G-K 25 g W396400-100G-K 100 g W342408-SAMPLE-K W396400-250G-K 250 g W342408-100G-K 100 g W396400-1KG-K 1 kg W342408-1KG-K 1 kg W342408-5KG-K 5 kg W342408-10KG-K 10 kg W342408-25KG-K 25 kg > 2-Acetylpyrrole.5(6)-dimethylpyrazine.5-dimethyl-3(2H)-furanone . FG 2-Acetyl-5-methylfuran FEMA 3251 Flavis 14.. Kosher. NI FEMA 3609 Flavis 13. see 2-Furyl methyl ketone Page 54 O-Acetylguaiacol.. 20  ≥98% FEMA 3327 Flavis 14. see 2.12  ≥99%. NI Fen. see 2′-Hydroxyacetophenone Page 65 Acetylpyrazine. Kosher. see 2′-Aminoacetophenone Page 12 2-Acetylanisole. Kosher. 20 W339105-100G-K 100 g W339105-250G-K 250 g 2-Acetyl-3-methylpyrazine W339105-1KG-K 1 kg [23787‑80‑6] C7H8N2O FW 136.15 [4166‑20‑5] FEMA 3797 Flavis 13. Fen.5-dimethyl-3(2H)furanone 3-Acetyl-2.032 CoE Nr 2286 Organoleptic: chocolate. Kosher. Kosher FEMA 3184 Flavis 14. meaty. 14 W312606-SAMPLE-K W312606-100G-K 100 g W312606-250G-K 250 g W312606-1KG-K 1 kg W312606-5KG-K 5 kg 2-Acetylpyridine 1 kg W526401-5KG 5 kg W526401-10KG 10 kg Methyl 2-pyridyl ketone [1122‑62‑9] C7H7NO FW 121. FG W325007-SAMPLE-K > 3-Acetoxy octene.23 [932‑16‑1] C7H9NO FW 123. sweet Halal.16  ≥99% Fen. NI W318418-SAMPLE-K W318418-25G-K 25 g W379700-100G-K 100 g W352705-100G-K 100 g W318418-100G-K 100 g W379700-1KG-K 1 kg W352705-1KG-K 1 kg W318418-1KG-K 1 kg W379700-5KG-K 5 kg W379700-25KG-K 25 kg 2-Acetyl-3-ethylpyrazine  natural (US).2-propanedione Page 109 Acetyl butyryl. 15  ≥99%. nutty.4. NI W332704-SAMPLE-K W332704-25G-K 25 g W332704-100G-K 100 g W332704-1KG-K 1 kg Feel inspired at safcglobal.16 Fen. see Acetanisole Page 8 Acetyl benzoyl.066 CoE Nr 10921 W360902-SAMPLE-K Organoleptic: meaty.. see Methyl 2-pyrrolyl ketone Page 93 9 .15 2-Acetyl-3.14  ≥98% Organoleptic: oily Halal.055 CoE Nr 11294 Organoleptic: caramel.. ≥90%. see 2-Methoxyphenyl acetate Page 80 FEMA 3652 Flavis 9. FG Arc.

026 CoE Nr 26 FEMA 3817 Flavis 15. analytical standard. 17 Place an order with your local SAFC representative (see back for contacts). FCC (S)-2-Aminopropionic acid. see Octanal Page 100 Aldehyde C9.04 FEMA 2012 Kosher.024 1 kg Kosher contains 0. see γ-Undecalactone Page 127 Aldehyde C-16.18 [9002‑18‑0] (C12H18O9)n  ≥98%  FCC Flavis 15.719 CoE Nr 254 FEMA 3818 Flavis 17. see Heptanal Page 57 Aldehyde C8. see Sodium alginate Page 118 Allspice. see Buchu leaf oil. NI W503509-SAMPLE-K W503509-250G-K 250 g W503509-1KG-K 1 kg W503509-5KG-K 5 kg > 2-Acetyltoluene.SAFC® Flavors & Fragrances Acetylthiazole > Acid Red 26. see Nonanal Page 98 Aldehyde C-10.18 Hexanedioic acid [124‑04‑9] HOOC(CH2)4COOH C6H10O4 FW 146. 40 W381810-5KG-K 5 kg W202002-SAMPLE-K W381810-10KG-K 10 kg Kosher W381810-SAMPLE-K W381810-1KG-K 10 Organoleptic: fruity. see 2′-Methylacetophenone Page 81 Acetyl tributyl citrate. see 1-Hexadecanol Page 59 Aldehyde C-3. herbaceous.09  ≥99%.10% alpha-tocopherol. see Sodium alginate Page 118 Alginic acid sodium salt from brown algae.0% (HPLC) W381829-100G 100 g W381829-1KG 1 kg 25 mg 1 kg W325201-5KG 5 kg W325201-10KG 10 kg > C5 alcohol. Fen.20 Arc. see 4-Pentenoic acid Page 105 Allylacetic acid methyl ester. see Bis(2-ethylhexyl) adipate Page 19 Agar Methyl-2-thienyl ketone Gum agar. see 1-Decanol Page 33 Alcohol C11. see Agar Page 10 Agathosma betulina.002  analytical standard. 1131. FCC [7493‑63‑2] C10H11NO2 FW 177. see Buchu leaf oil. sweet NI  ≥98%.16 β-Alanine β-Ala.14 Arc. 530 FEMA 2411 CoE Nr 184 Organoleptic: alcohol. W202002-100G-K 100 g W202002-1KG-K 1 kg W202002-5KG-K 5 kg . 3-Aminopropionic acid Acrylamide-d3 Standard solution Fen. Crenulata Page 20 AITC. Brilliant Crocein MOO W201201-100G 100 g W201201-1KG 1 kg W201201-5KG 5 kg > Agar-agar.20  ≥98% FEMA 2020 Flavis 9. NI W241105-SAMPLE-K W241105-1KG-K DL-Alanine 1 kg W241105-5KG-K 5 kg W241105-10KG-K 10 kg Allyl anthranilate (±)-2-Aminopropionic acid [302‑72‑7] CH3CH(NH2)COOH C3H7NO2 FW 89. L-α-Aminopropionic acid [5413‑75‑2] C22H14N4Na2O7S2 FW 556. green. hazelnut. see Undecanoic acid Page 127 Acid Red 73 8 Crocein Scarlet MOO. see Methyl 4-pentenoate Page 91 4-Allylanisole Chavicol methyl ether. see Undecyl alcohol Page 128 Alcohol C12. fruity. minty. 16 [107‑95‑9] NH2CH2CH2COOH C3H7NO2 FW 89. see Tributyl 2-acetylcitrate Page 125 Acetyl valeryl.6%.01  ≥98% W325201-SAMPLE Adipic acid  ≥99. for food analysis 72834-5ML-F 5 mL > Acrylic acid ethyl ester. Estragole [140‑67‑0] H2C=CHCH2C6H4OCH3 C10H12O FW 148. see Ethyl acrylate Page 42 W332801-100G-K 100 g W332801-1KG-K 1 kg W332801-5KG-K 5 kg 2-Acetyl-2-thiazoline 8 [29926‑41‑8] C5H7NOS FW 129. see Ethyl 3-methyl-3-phenylglycidate Page 48 Aldehyde C-18. vanilla Kosher. see Nonyl alcohol Page 99 Alcohol C10. see γ-Nonalactone Page 98 Algin. FG FEMA 3328 Flavis 15. FCC  ≥96% Fen. see 2-Methyl-3-furanthiol acetate Page 86 2-Acetylthiophene 1 kg > Adipic acid di(2-ethylhexyl) ester. Betulina Page 20 Agathosma crenulata.001 W325201-1KG FEMA 2011 Flavis 8. see Amyl alcohol Page 13 Alcohol C-6. see Pimenta berry oil Page 111 Pimenta berry oil Page 111 Pimenta leaf oil Page 111 Allylacetic acid.02 CoE Nr 4041 Organoleptic: chocolate. see Decanal Page 33 Aldehyde C12. Agar-agar [88‑15‑3] C6H6OS FW 126.3-Heptanedione Page 57 Acid C-11. 54. Brilliant crocein scarlet MOO.09  ≥99% FEMA 3818 Flavis 17.3-naphthalenedisulfonic acid disodium salt. see Hexyl alcohol Page 63 Hexyl alcohol Page 63 C-7 alcohol. see 1-Octanol Page 100 Alcohol C9. Fen. see Lauryl alcohol Page 74 Alcohol C-16.09 [122775‑19‑3]  ≥99%. 36 NI W381718-SAMPLE W201103-SAMPLE W381718-5G 5g W201103-1KG W381718-100G 100 g W201103-5KG 5 kg W381718-500G 500 g W201103-10KG 10 kg > 3-(Acetylthio)-2-methylfuran. see Propionaldehyde Page 113 Aldehyde C7. 7-Hydroxy-8-(4-phenylazophenylazo)-1. see β-Alanine Page 10 L-Alanine [56‑41‑7] C3H7NO2 FW 89. Kosher. for food analysis W381829-SAMPLE ≥97. see 2. synthetic as antioxidant Fen. meaty Halal.48 49823-25MG FEMA 3252 Flavis 17. Acid Red 73. see Heptyl alcohol Page 58 Alcohol C8. NI W332801-SAMPLE-K  ~500 mg/L in acetonitrile. sweet. see Lauric aldehyde Page 74 Aldehyde C14. see Ponceau Xylidine Page 112 2-Acetylthiazole [24295‑03‑2] C5H5NOS FW 127. see Allyl isothiocyanate Page 11 β-Ala.

peach allyl β-ionone.004 CoE Nr 360 Organoleptic: caramel. 83 FEMA 2034 Flavis 12. berry. 85. meaty. 53  ≥98%. see Methyl eugenol Page 86 W203408-500G-K 500 g W203408-1KG-K 1 kg W203408-5KG-K 5 kg W203408-10KG-K 10 kg Allyl isovalerate > 4-Allylguaiacol..22 Halal.. Fen. FG W203009-100G 100 g FEMA 2026 Flavis 9. alliaceous (onion. Fen. NI available only in USA FEMA 2030 Flavis 13.... 79 [1866‑31‑5] C6H5CH=CHCO2CH2CH=CH2 C12H12O2 FW 188. pineapple Kosher  ≥98%...054 CoE Nr 280  ≥80% W203211-1KG-K 1 kg Organoleptic: apricot... see Allyl octanoate Page 11 Allyl cinnamate [7493‑69‑8] (C2H5)2CHCO2CH2CH=CH2 C9H16O2 FW 156. 42 FEMA 2022 Flavis 9... Fen. 67. . see Allyl hexanoate Page 11 Allyl caprylate. FCC. 48  ≥99% Arc...... woody Halal..41 CoE Nr 281 W203300-5KG-K 5 kg Allyl isothiocyanate Oil of mustard..com W204501-1KG-K W203203-1KG-K 1 kg W203203-4KG-K 4 kg W203203-20KG-K 20 kg W203718-1KG-K 1 kg W203718-9KG-K 9 kg W203718-20KG-K 20 kg 11 . FG Arc. pineapple.244 CoE Nr 2181 CH3(CH2)4CO2CH2CH=CH2 C9H16O2 FW 156.489 CoE Nr 2098  ≥97%..15 Allyl 2-furoate Arc. Fen. fruity Fen..2-dimethoxybenzene.. 70.36 Organoleptic: apricot. Fen... AITC [57‑06‑7] CH2=CHCH2NCS C4H5NS FW 99. 874.. Kosher W204501-SAMPLE-K  ≥90% W203106-SAMPLE-K FEMA 3655 Flavis 4. pineapple W203718-SAMPLE-K W203203-SAMPLE-K Feel inspired at safcglobal.29 W203408-SAMPLE-K Arc.741 CoE Nr 334 W202207-SAMPLE W202207-100G 100 g W202207-1KG 1 kg W202207-5KG 5 kg 100 g W203300-1KG-K 1 kg FEMA 2029 Flavis 9. 57  ≥99% FEMA 2037 Flavis 9.. 51 [4230‑97‑1] CH3(CH2)6CO2CH2CH=CH2 C11H20O2 FW 184.. fatty. Kosher W203009-5KG 5 kg W202606-SAMPLE-K W202606-1KG-K 1 kg W202606-5KG-K 5 kg W202606-10KG-K 10 kg > 4-Allyl-1. Kosher..061 CoE Nr 2040 > Allyl caproate. 41 [2179‑57‑9] CH2=CHCH2SSCH2CH=CH2 C6H10S2 FW 146.... ethereal.. butter.... Kosher Arc.. Kosher Allyl 2-ethylbutyrate Allyl 3-phenylacrylate [79‑78‑7] C16H24O FW 232. 13%  ≥98% Organoleptic: oily. sweet Diallyl disulfide W203211-SAMPLE-K Arc..23 W365505-SAMPLE W365505-25G 25 g W365505-100G 100 g W365505-1KG 1 kg Allyl hexanoate 1 kg W204501-4KG-K 4 kg W204501-9KG-K 9 kg > 4-Allyl-2-methoxyphenol. FG Organoleptic: fatty. Fen.... peach Kosher FEMA 2028 Flavis 12. FCC Arc...Allyloctanoate Allyl butyrate  natural.17 Organoleptic: pineapple. 52 Organoleptic: floral. Fen. wine-like..051 CoE Nr 11214 W203106-1KG-K 1 kg Organoleptic: meaty NI W203106-4KG-K 4 kg W203106-9KG-K 9 kg [6627‑88‑9] H2C=CHCH2C6H2(OCH3)2OH C11H14O3 FW 194. 72. 77.119 CoE Nr 400 Organoleptic: banana. 102. sweet Halal. Fen. 52 [4208‑49‑5] C8H8O3 FW 152.. banana. FCC.15  ≥93%. Kosher. see Eugenol Page 51 Allyl octanoate Allyl caprylate Allyl caproate [123‑68‑2] FEMA 2032 Flavis 9.28 Arc.27 W203211-25G-K 25 g  ≥98% Arc.. FCC. Fen.008 CoE Nr 485 W203211-4KG-K 4 kg Organoleptic: green..6-dimethoxyphenol W203300-SAMPLE-K W203300-100G-K W202908-SAMPLE Organoleptic: balsam.25 Arc.097 CoE Nr 369 4-Allyl-2.... 49 [2705‑87‑5] C6H11CH2CH2CO2CH2CH=CH2 C12H20O2 FW 196..22 Arc.. cherry.. ≥98%. fruity. FG Organoleptic: apple. spicy. 47 W203211-100G-K 100 g FEMA 2021 Flavis 9.20 Allyl heptanoate [142‑19‑8] CH3(CH2)5CO2CH2CH=CH2 C10H18O2 FW 170..498 CoE Nr 2223 W203009-1KG 1 kg Organoleptic: waxy. fruity Kosher FEMA 2031 Flavis 9. 86. 50 FEMA 2045 Flavis 9. Fen... see Eugenol Page 51 [2835‑39‑4] (CH3)2CHCH2CO2CH2CH=CH2 C8H14O2 FW 142. 98. fruity Fen.025 CoE Nr 2110  ≥98% Allyl cyclohexanepropionate Halal. 71. sweet Halal. pineapple.22 Arc.. garlic) Halal.. FCC Allyl disulfide [2051‑78‑7] CH3CH2CH2CO2CH2CH=CH2 C7H12O2 FW 128.. sweet.. NI W202118-SAMPLE-K Allyl-α-ionone W202118-1KG-K 1 kg W202800-SAMPLE-K W202118-4KG-K 4 kg W202800-100G-K 100 g W202118-9KG-K 9 kg W202800-1KG-K 1 kg  ≥65% W202800-5KG-K 5 kg FEMA 2033 Flavis 7. FCC. 45 W203009-SAMPLE  ≥98%.

. floral. Fen. sweet..101 CoE Nr 11436 Organoleptic: honey.. jam. see L-Isoleucine Page 71 (S)-2-Amino-4-methylpentanoic acid. 92.493 CoE Nr 2183 [551‑93‑9] H2NC6H4COCH3 C8H9NO FW 135. garlic)  ≥99% W203807-SAMPLE-K W332909-SAMPLE [6790‑58‑5] C16H28O FW 236. see Butylamine Page 21 (±)-2-Aminobutane...SAFC® Flavors & Fragrances Allylphenoxyace Allyl phenoxyacetate S-Allyl thiopropionate (−)-Ambroxide [41820‑22‑8] C2H5COSCH2CH=CH2 C6H10OS FW 130.. Kosher W203904-100G 100 g W204307-100G 100 g W203904-1KG 1 kg W204307-1KG 1 kg W390607-SAMPLE-K W203904-5KG 5 kg W204307-5KG 5 kg W390607-100G-K 100 g W390607-1KG-K 1 kg W390607-5KG-K 5 kg > Allyl 3-phenylacrylate.088 CoE Nr 2174 Organoleptic: horseradish.21 W205001-25G-K 25 g W205001-100G-K 100 g W205001-1KG-K 1 kg Place an order with your local SAFC representative (see back for contacts).. Fen. apricot. see LTyrosine Page 127 (S)-α-Aminoisovaleric acid.. see DL-Valine Page 129 (±)-2-Amino-4-(methylmercapto)butyric acid.9]tri decane [7493‑74‑5] C6H5OCH2CO2CH2CH=CH2 C11H12O3 FW 192.. 876.18 Arc.. (±)-Isopropanolamine [78‑96‑6] CH3CH(OH)CH2NH2 C3H9NO FW 75.. see DLMethionine Page 79 DL-2-Amino-3-methylpentanoic acid. <10% W396508-SAMPLE W396508-1KG 1 kg W396508-10KG 10 kg W396508-25KG 25 kg ... see DL-Valine Page 129 (R)-2-Amino-3-mercaptopropionic acid.04. sweet [8007‑69‑0] Allyl sulfide  Certified organic (NOP/EU) Diallyl sulfide [592‑88‑1] (CH2=CHCH2)2S C6H10S FW 114.21 Arc. see L-Cysteine Page 32 1-Amino-3-methylbutane.. alliaceous (onion. see Glycine Page 56 [1797‑74‑6] C6H5CH2CO2CH2CH=CH2 C11H12O2 FW 176. 63  ≥99%  ≥97% 2-Acetylaniline FEMA 2039 Flavis 9.233 CoE Nr 2094 Organoleptic: apple. 58 Fen.. sweet Page 12 Almond oil.11 W205001-SAMPLE-K 12 1. see Propylamine Page 113 DL-1-Amino-2-propanol (±)-1-Amino-2-propanol.. sweet 8 Almond oil from Prunus dulcis. ethereal Kosher Arc. see DL-Methionine Page 79 1-Aminopentane.16 Organoleptic: honey. see (±)-sec-Butylamine Page 21 Aminoethane. 60 8 [8013‑76‑1]  FG.5... 91. green  ≥98% W203904-SAMPLE W204307-SAMPLE 2′-Aminoacetophenone FEMA 3906 Flavis 11... natural FEMA 2046  ≥99% from Prunus armeniaca Kosher Organoleptic: almond FEMA 2040 Flavis 9. Kosher.. 99.. see L-Arginine Page 15 (S)-2-Amino-3-(4-hydroxyphenyl)propionic acid. 59 Arc. see L-Valine Page 128 (±)-α-Aminoisovaleric acid. 1391 FEMA 2038 Flavis 9. see Isobutylamine Page 69 DL-2-Amino-4-(methylthio)butanoic acid.3S)-2-Amino-3-methylpentanoic acid.. green.. garlic) Halal.  ≥90% FEMA 3965 2-amino-1-propanol . wine-like France origin > 1-Aminobutane..21 Kosher Kenya origin Arc.. see L-Leucine Page 75 1-Amino-2-methylpropane.701 CoE Nr 228 FEMA 3329 Flavis 12.. see Isopentylamine Page 71 L-2-Amino-3-methylbutanoic acid.3. see L-Phenylalanine Page 108 (±)-2-Amino-3-phenylpropionic acid.. see L-Glutamic acid Page 56 (S)-2-Amino-3-phenylpropionic acid. see Tyramine Page 127 (S)-2-Amino-5-guanidinopentanoic acid.5.. sweet Organoleptic: berry..39 FEMA 3471 Organoleptic: floral NI W203807-1KG-K 1 kg W332909-25G 25 g W203807-5KG-K 5 kg W332909-100G 100 g W347108-25G 25 g W203807-10KG-K 10 kg W332909-1KG 1 kg W347108-100G 100 g W347108-1KG 1 kg Allyl tiglate Allyl phenylacetate W347108-SAMPLE > Aminoacetic acid.. sweet Kosher Organoleptic: coffee..0... Almond oil. see Allyl cinnamate Page 11 Allyl propionate > Almond oil from Prunus dulcis. pineapple. see Almond oil.21 [7493‑71‑2] CH3CH=C(CH3)CO2CH2CH=CH2 C8H12O2 FW 140..9-Tetramethyl-13-oxatricyclo[8.... see Amylamine Page 13 (S)-2-Aminopentanedioic acid.. NI W204218-SAMPLE-K W204218-100G-K 100 g W204218-1KG-K 1 kg W204218-4KG-K 4 kg 1 kg Ambrette seed absolute [8015‑62‑1] FEMA 2050 CoE Nr 228n from Hibiscus abelmoschus Kosher Organoleptic: musty. see L-Valine Page 128 DL-2-Amino-3-methylbutanoic acid. see Taurine Page 121 4-(2-Aminoethyl)phenol.. Fen.. alliaceous (onion.14 Fen. 62  ≥99%  ≥95% Arc.79 CoE Nr 2162 FEMA 2043 Flavis 9.. Fen.008 Halal. FG W530119-1KG-K FEMA 2042 Flavis 12. 93 W204600-SAMPLE-K W204005-SAMPLE-K W204005-1KG-K 1 kg W204005-4KG-K 4 kg W204005-9KG-K 9 kg W204600-100G-K 100 g W204600-500G-K 500 g Almond oil.. see DL-Isoleucine Page 71 (2S. see Ethylamine solution Page 42 2-Aminoethanesulfonic acid. see DL-Phenylalanine Page 108 1-Aminopropane... bitter [2408‑20‑0] C2H5CO2CH2CH=CH2 C6H10O2 FW 114. 61 W530119-SAMPLE-K  ≥97%.

16  ≥99.4-decadienoic acid γ-lactone W205605-8KG 8 kg [27593‑23‑3] C10H14O2 FW 166.044 CoE Nr 270  ≥98%. wine-like Fen.34 FEMA 2061 Flavis 5. FG W205605-4KG 4 kg FEMA 2068 Flavis 9.16 Arc. cherry.031 CoE Nr 10967 W206806-1KG 1 kg W206806-4KG 4 kg Organoleptic: almond. FG Arc. lily. NI Arc. Fen. 82 W207209-SAMPLE W207209-100G 100 g W207209-1KG 1 kg W207209-5KG 5 kg 13 . Fen. 76  20 wt. 74 Organoleptic: banana. ≥98%. ethereal. NI  ≥96%.22 W205605-20KG 20 kg Organoleptic: ethereal.14 FEMA 2074 Flavis 9.159 CoE Nr 497 5-Hydroxy-2.03 CoE Nr 79 W206504-1KG 1 kg Arc. 77 Amyl acetate Banana essence. see L-Aspartic acid Page 15 Ammonium sulfide solution 8 Amyl butyrate Amyl hexanoate [540‑18‑1] C9H18O2 FW 158. 86 FEMA 2079 Flavis 9.15 FEMA 2056 Flavis 2. sweet NI Arc. 86 W206504-SAMPLE n-Amyl alcohol. Used as test odorant in studies of olfactory function and in studies of the psychosocial effects of odor. ≥97% Pentyl acetate W207403-9KG W207926-SAMPLE W207926-1KG 1 kg W207926-4KG 4 kg W207926-9KG 9 kg > Amyl propionate. Fen.04 CoE Nr 514 Amyl formate Organoleptic: sweet.29  mixture of isomers. see Amyris oil Page 14  ≥98% FEMA 2072 Flavis 13.065 CoE Nr 315 Organoleptic: pineapple Halal. 144. Kosher FEMA 2079 Flavis 9. 84 FEMA 2059 Flavis 9. Kosher W205915-9KG-K 9 kg W207403-100G 100 g W205915-20KG-K 20 kg W207403-1KG 1 kg [12135‑76‑1] (NH4)2S H8N2S FW 68. see L-Alanine Page 10 (±)-2-Aminopropionic acid. 136. 148. NI W205303-SAMPLE-K W205303-1KG-K 1 kg W205303-5KG-K 5 kg W205303-25KG-K 25 kg α-Amylcinnamaldehyde [122‑40‑7] C6H5CH=C[(CH2)4CH3]CHO C14H18O FW 202. see 1-Pentanethiol Page 104  ≥98% W206105-SAMPLE-K  ≥99% Organoleptic: banana. pineapple Halal.04 CoE Nr 128 [628‑63‑7] CH3COO(CH2)4CH3 C7H14O2 FW 130. see DL-Alanine Page 10 3-Aminopropionic acid. earthy NI 20 kg [638‑25‑5] CH3(CH2)6CO2(CH2)4CH3 C13H26O2 FW 214. 142.34  ≥98%.002 CoE Nr 482 W205915-1KG-K 1 kg W207403-SAMPLE Organoleptic: sulfurous Halal.com W369608-100G-K 100 g W369608-250G-K 250 g W369608-1KG-K 1 kg > Amyris Balsamifera. Fen. 125. see L-Alanine Page 10 (S)-2-Aminopropionic acid. mushroom. 82 W205605-SAMPLE W207918-SAMPLE W207918-1KG 1 kg W207918-4KG 4 kg W207918-9KG 9 kg Amyl octanoate. 75 W206504-5KG 5 kg  ≥99% W206504-10KG 10 kg [71‑41‑0] CH3(CH2)4OH C5H12O FW 88. Organoleptic: jasmine. see β-Alanine Page 10 (S)-(+)-Aminosuccinic acid. 136. see Amyl alcohol Page 13 Amylamine FEMA 3696 Flavis 10. Fen. fruity. 76 [540‑07‑8] CH3(CH2)4CO2(CH2)4CH3 C11H22O2 FW 186. 117. FG W206806-SAMPLE > n-Amyl alcohol. Fen.025 CoE Nr 2109 Organoleptic: oily. 178 W424201-SAMPLE W424201-100G 100 g W424201-1KG 1 kg > n-Amylamine. see Isoamyl propionate Page 68 2-Amyl pyridine. Fen. 1-Pentanol Organoleptic: wine-like. % in H2O W205915-SAMPLE-K FEMA 2053 Flavis 16. coconut. mixture of isomers C13H26O2 FW 214. see Amylamine Page 13 Feel inspired at safcglobal. sweet Halal.112 CoE Nr 393 Organoleptic: alcohol. fatty Fen.18 9 kg W207403-20KG N-Amyl octanoate  mixture of cis and trans.22 FEMA 4242 Flavis 11. 1-Aminopentane. FG Arc. Pentyl alcohol. Kosher. 79 W504009-8KG 8 kg  mixture with Amyl hydrocinnamyl alcohol W504009-20KG 20 kg FEMA 2065 Flavis 2. 172. earthy Halal. FCC Organoleptic: sweet.112 CoE Nr 393 W206105-1KG-K 1 kg W206105-5KG-K 5 kg Flavis 9.021 CoE Nr 211 W206105-10KG-K 10 kg α-Amylcinnamyl alcohol W504009-SAMPLE 2-Benzylidene-1-heptanol W504009-500G 500 g W504009-1KG 1 kg [101‑85‑9] C6H5CH=C[(CH2)4CH3]CH2OH C14H20O FW 204. Fen. vanilla NI [638‑49‑3] HCO2(CH2)4CH3 C6H12O2 FW 116. Kosher.24 n-Pentyl hexanoate Arc. 149. NI W206806-9KG 9 kg W369608-SAMPLE-K Pentylamine.021 Arc. jasmine NI Amyl alcohol > Amyl mercaptan.0% Amyl 2-furoate [1334‑82‑3] C10H14O3 FW 182. Fen.29 Arc. n-Amylamine [110‑58‑7] CH3(CH2)4NH2 C5H13N FW 87.31 W504009-4KG 4 kg Arc. see DL-1-Amino-2-propanol Page 12 L-α-Aminopropionic acid.Amyrisbalsamife > (±)-1-Amino-2-propanol. see 2-Pentylpyridine Page 105 6-Amyl-α-pyrone W205605-1KG 1 kg  ≥95%. sweet Halal.

16-(5α)Androsten3α-ol [1153‑51‑1] C19H30O FW 274. basil. 241.43 W208800-100G-K 100 g W267007-5KG-K 5 kg W267007-10KG-K 10 kg W267007-25KG-K 25 kg W267007-SAMPLE Arc. chocolate. nutty NI Arc. see Bois de rose Page 20 Anis alcohol. cinnamon.012 CoE Nr 731 1 kg W517100-5KG-K 5 kg W517100-10KG-K 10 kg > Amy vinyl carbinol acetate. Aubépine [123‑11‑5] CH3OC6H4CHO C8H8O2 FW 136. 94 This material may darken on storage FEMA 3293 Flavis 10. see Thiamine hydrochloride Page 123  ≥97% Organoleptic: floral. cherry. FCC Organoleptic: anise. sweet Kosher W506400 from Illicium verum Hook. cinnamon. f.02-0. 3-Keto-5α. sweet. Organoleptic: almond. herbaceous. Fen. FCC 8 FEMA 2088 > 16-(5α)Androsten-3α-ol. (also Badiane) W209619-SAMPLE W209619-1KG 1 kg W209619-10KG 10 kg W209619-25KG 25 kg  Certified organic (NOP/EU) NI Organoleptic: almond.SAFC® Flavors & Fragrances Amyrisoil Amyris oil α-Angelica lactone m-Anisaldehyde [8015‑65‑4] CoE Nr 33 4-Hydroxy-3-pentenoic acid γ-lactone.15 FEMA 2670 Flavis 5. anise. see 1-Octen-3-yl acetate Page 101 5α-Androst-16-en-3α-ol 3α-Hydroxy-5α-androst-16-ene. NI contains 0. 4-Propenylanisole [4180‑23‑8] CH3CH=CHC6H4OCH3 C10H12O FW 148. star anise.16-androstene. balsam. vanilla. 239. Fen. Kosher. 235 Angelica seed oil  ≥98% 8 Angelica oil W505900-SAMPLE > 16-(5α)Androsten-3-one. 8 W209624-SAMPLE-K 1 kg .04% BHT as stabilizer [8015‑64‑3]  natural from Angelica archangelica Kosher Organoleptic: earthy W267007-SAMPLE-K 16-(5α)Androsten-3-one. fennel. sweet Kosher NI Fen.44 W513105-SAMPLE W329304-SAMPLE-K W329304-100G-K 100 g W329304-250G-K 250 g W329304-1KG-K 1 kg Angelica root oil 1g 5α-Androst-16-en-3-one 8 1 kg W513105-5KG 5 kg p-Anisaldehyde 4-Methoxybenzaldehyde. Fen.015 CoE Nr 103 Natural occurrence: Vanilla.10  ≥97% W517100-SAMPLE-K Halal. woody. hawthorne. Anise oil Salicylaldehyde methyl ether. black currant.129 CH3OC6H4CHO C8H8O2 FW 136. Fen. see Angelica root oil Page 14 Angelica seed oil Page 14 Angelica oil  ≥98% W510718-1G Flavis 5. 89  natural Anise seed oil FEMA 2090 from Angelica archangelica Kosher Organoleptic: pepper [8007‑70‑3] Fen. see Dillweed oil Page 36 Aneurine hydrochloride.158  ≥98%. 456 W208604-10KG-K 10 kg > Anethum graveolens. 2-Methoxybenzaldehyde W208604-SAMPLE-K 1 kg > Anise oil. minty Halal. see Anise seed oil Page 14 [8015‑64‑3] > Aniba Rosaeodora.01 CoE Nr 183 14 100 g W513105-1KG  ≥97. hawthorne. 236. Androstenone W208800-SAMPLE-K W208800-10G-K 10 g W267007-1KG-K [18339‑16‑7] C19H28O FW 272.15 CoE Nr 238n W208604-5KG-K 5 kg Arc. berry. Kosher Organoleptic: woody Haiti origin [591‑12‑8] C5H6O2 FW 98. fruity. cranberry. Kosher Organoleptic: oily.15 1 kg Place an order with your local SAFC representative (see back for contacts).5%. 1864.20 Arc. see 5α-Androst-16-en-3α-ol Page 14 Androstenone. 1112 > Angelica oil. see Anisyl alcohol Page 15 FEMA 2086 Flavis 4. FG W517100-1KG-K [591‑31‑1] CH3OC6H4CHO C8H8O2 FW 136. 44  ≥99%. spicy. 98  Certified organic (NOP/EU) W209000-SAMPLE-K W209000-25G-K 25 g W209000-250G-K 250 g FEMA 2094 from (Pimpinella anisum) Kosher W209417-SAMPLE-K W209417-1KG-K o-Anisaldehyde 1 kg [135‑02‑4] FEMA 4077 Flavis 5. 5-Methyl-2 (3H)-furanone 3-Methoxybenzaldehyde from Amyris balsamifera. see 5α-Androst-16-en-3-one Page 14 trans-Anethole trans-1-Methoxy-4-(1-propenyl)benzene. creamy. see 5α-Androst-16-en-3-one Page 14 W513105-100G Arc. spicy Kosher Vietnam origin W407701-SAMPLE-K W209624-1KG-K W407701-1KG-K 1 kg Anise star oil [68952‑43‑2] FEMA 2096 W208604-1KG-K 8 Anise seed oil.

247. Kosher Organoleptic: honey. see Celery seed oil Page 26 Apocynin.15 Natural Occurrence: Anise. vanilla. N-(L-α-Aspartyl)-L-phenylalanine methyl ester L-Aspartic Organoleptic: floral. 259 Organoleptic: caramel.5%. vanilla Halal.071 W394505-SAMPLE W394505-1KG 1 kg W394505-10KG 10 kg W394505-25KG 25 kg > p-Anisic acid methyl ester.005 W210218-5KG-K 5 kg W365601-SAMPLE > Antiscorbutic factor. m-Methylsalicylic acid FEMA 3944 Flavis 8. vanilla Halal. L-Threoascorbic acid.10  ≥98% 100 g W210218-1KG-K 1 kg FEMA 3656 Flavis 17.20 Arc. Anis alcohol. sweet.706 CoE Nr 233  ≥98%. Kosher Fen. see Aspartame Page 15 Aubépine. see Aspartame Page 15 Asp-Phe-OMe. see Tarragon oil Page 121  ≥97% [7549‑33‑9] C2H5CO2CH2C6H4OCH3 C11H14O3 FW 194.128 CoE Nr 66 CH3OC6H4CH2OH C8H10O2 FW 138. FCC [122‑91‑8] HCO2CH2C6H4OCH3 C9H10O3 FW 166. lilac. vanilla Halal. FG W381918-SAMPLE FEMA 2101 Flavis 9. butter. NI > 1 kg [74‑79‑3] H2NC(=NH)NH(CH2)3CH(NH2)CO2H C6H14N4O2 FW 174.17  ≥97%. honey. sweet. FCC FEMA 2097 Flavis 4. fruity.20 W374008-SAMPLE W209708 W325501-1KG (S)-2-Amino-5-guanidinopentanoic acid Anisyl phenylacetate Arc. 103 W210901-1KG 1 kg W210901-10KG 10 kg W210901-25KG 25 kg W374008-25G 25 g W374008-100G 100 g W374008-1KG 1 kg Anisyl propionate  ≥98% Feel inspired at safcglobal. cheese. NI Anisyl acetate [104‑21‑2] CH3CO2CH2C6H4-4-(OCH3) C10H12O3 FW 180. FCC. Kosher. Kosher. Aspartame. sweet. plum. ≥98%. sweet Halal. creamy.15  ≥99% FEMA 3945 Flavis 8. hyacinth. bourbon. NI Fen. Vitamin C FEMA 2098 Flavis 9.14  ≥99%. Kosher. 102 W381918-5KG 5 kg W381918-10KG 10 kg W210102-SAMPLE-K W210102-100G-K 100 g W210102-1KG-K 1 kg W210102-5KG-K 5 kg 5 kg W209805-10KG-K 10 kg > Anisylacetone. Fen. 246.30 (S)-(+)-Aminosuccinic acid. vanilla  ≥98% W209910-SAMPLE-K 3-Methoxybenzoic acid. (S)-Aminobutanedioic acid W210218-SAMPLE-K [9036‑66‑2] FEMA 3254 W209902-25KG-K Asp-Phe methyl ester. see Aspartame Page 15 Asp-Phe methyl ester. Methyl phenyl ether [100‑66‑3] CH3OC6H5 C7H8O FW 108. floral. NI 1 kg acid FEMA 3740 Flavis 9. see Methyl p-anisate Page 81 Anisole Methoxybenzene. chocolate.Aubepine  natural. fruity. see Anisyl alcohol Page 15 4-Methoxybenzyl formate 4-Methoxybenzoic acid [5328‑37‑0] C5H10O5 FW 150. for food analysis W210218-100G-K W209902-SAMPLE-K 10 kg [22839‑47‑0] HOOCCH2CH(NH2)CONHCH(CH2C6H5)COOCH3 C14H18N2O5 FW 294. see Benzaldehyde Page 16 Artimisia Dracunculus. Fen. fruity. see L-Ascorbic acid Page 15 Apium Graveolens.13 FEMA 3255 W209910-100G-K Anisyl formate p-Anisic acid L-(+)-Arabinose W325406-SAMPLE 5 kg 15 . Anise alcohol [105‑13‑5] FEMA 2099 Flavis 2. see D-Isoascorbic acid Page 68 FEMA 3819 Flavis 17.092 W394440-SAMPLE W394440-100G 100 g W394440-1KG 1 kg W394440-5KG 5 kg 100 g W209910-1KG-K 1 kg W209910-5KG-K 5 kg [100‑09‑4] CH3OC6H4CO2H C8H8O3 FW 152. floral. FCC. 104 Polyarabinogalactan W209902-10KG-K Aspartame 47135 Arc.019 CoE Nr 209 W209805-1KG-K acid. 45 NI  ≥90%. ethereal Kosher.032 CoE Nr 2056 Organoleptic: alcohol. FG W209902-1KG-K L-Ascorbic [50‑81‑7] C6H8O6 FW 176. see Acetovanillone Page 8 W365601-1KG 1 kg W365601-5KG 5 kg > N-(L-α-Aspartyl)-L-phenylalanine methyl ester.145 CoE Nr 426 W209805-5KG-K > Artificial essential oil of almond. FG m-Anisic acid [586‑38‑9] CH3OC6H4CO2H C8H8O3 FW 152. FCC Organoleptic: almond. coumarin. see p-Anisaldehyde Page 14 (+)-Arabinogalactan W325406-5KG 25 kg  analytical standard. cherry.com 500 mg acid [56‑84‑8] HO2CCH2CH(NH2)CO2H C4H7NO4 FW 133. p-Anisyl alcohol.12 FEMA 2102 Flavis 9.003 Arc.23 1 kg 1 kg Antiscorbutic factor. Asp-Phe-OMe. 249. 99  ≥99% L-Arginine > p-Anisyl alcohol. 100  FCC W210901-SAMPLE Organoleptic: anise Fen. 254 4-Methoxybenzyl propionate W209805-SAMPLE-K D-Araboascorbic  ≥98. Fen. see 4-(4-Methoxyphenyl)-2-butanone Page 80 Anisyl alcohol 4-Methoxybenzyl alcohol. Halal.087 CoE Nr 354 W381918-1KG Organoleptic: floral.16 Arc.

3-dihydroxypropyl) ether Page 19 Balm leaves oil 8 Melissa oil W211901-1KG 1 kg W211901-10KG 10 kg  Certified organic (NOP/EU) from (Ocimum basillicum. orange. herbaceous.032 CoE Nr 2226 W213004-1KG-K 25 g Fen. ≥98%. see Bisphenol A (3-chloro-2-hydroxypropyl) glycidyl ether Page 19 BADGE-HCl-H2O. linalol type 1 kg > Basil oil. Thiophenol [108‑98‑5] C6H5SH C6H6S FW 110. natural 25 g Organoleptic: nutty. fruity. Kosher Organoleptic: sweet.α-Dimethoxytoluene  ≥98% W530131-SAMPLE-K Bay oil W211300-SAMPLE 16 Basil oil. see Phenylacetic acid Page 108 1. Spanish  Certified organic (NOP/EU) [8015‑73‑4] W212717-SAMPLE-K from (Persea armeniaca) Kosher South Africa origin  FG. Fen. 133 4-Methyl-2-phenyl-1. apricot. honey. methyl chavicol type [8024‑32‑6] 8 . 124 10 kg 1 kg 100 g [8015‑73‑4] 5 kg W212806-10KG-K W212202-1KG-K W212628-100G Basil oil. floral Kosher. comoric type 1 kg W212806-5KG-K  ≥97% W212628-25G 100 g W212806-1KG-K 250 g FEMA 2120 W212000-100G-K W212806-SAMPLE-K W212202-250G-K  FG. peach. Kosher Basil oil. see Dihydrocoumarin Page 35 1.20 [8015‑73‑4] W212000-SAMPLE-K Arc. see Quinoline Page 117 Benzeneacetic acid. 2937. garlic) W361607-SAMPLE W212709-1KG-K 1 kg W212709-10KG-K 10 kg W212709-25KG-K 25 kg Place an order with your local SAFC representative (see back for contacts).013 CoE Nr 101 C6H5CHO C7H6O FW 106. NI Arc. see Bisphenol A diglycidyl ether Page 20 BADGE-H2O.3-dihydroxypropyl) glycidyl ether Page 20 BADGE-2HCl. natural W212717-100G-K 100 g FEMA 2119 W212717-1KG-K 1 kg W211901-SAMPLE W212717-5KG-K 5 kg W212717-25KG-K 25 kg W530127-SAMPLE-K W530127-1KG-K 1 kg > Aza-2-cycloheptanone.3-Benzodioxole-5-carboxaldehyde. mixture of isomers from Pimenta racemosa Kosher Organoleptic: spicy West Indies origin Beeswax absolute breche from Abies balsamea Organoleptic: woody Basil extract. see Bisphenol A (2. see Bisphenol A bis(3-chloro-2-hydroxypropyl) ether Page 19 BADGE-HCl.3-dioxolane FEMA 2126 W530333-SAMPLE [1125‑88‑8] C6H5CH(OCH3)2 C9H12O2 FW 152.3-Benzenediol. spicy Comores origin 1 kg W213004-5KG-K W361607-1KG Benzaldehyde Artificial essential oil of almond FEMA 2119 CoE Nr 308n FEMA 2130 Flavis 6. see Bisphenol A (3-chloro-2-hydroxypropyl) (2. 132 Halal. 1 kg > Benzodihydropyrone.003 CoE Nr 37 [2568‑25‑4] C10H12O2 FW 164. citrus FEMA 2122 CoE Nr 334c W211300-10G 10 g W211300-100G 100 g Balsam fir absolute 8 Fir balsam [8024‑15‑5]  natural W530333-100G 100 g W530333-1KG 1 kg 8 Kosher W212202-5KG-K 5 kg W213004-SAMPLE-K from honeycomb of the bee Apis mellifera L. Spanish. 268. cherry.031  ≥98%. methyl chavicol type) Kosher India origin W530131-1KG-K  natural [8006‑78‑8] FEMA 2113 Fen. sweet Arc. Fen. (Apidae).08 CoE Nr 11585 Organoleptic: alliaceous (onion.19 Benzaldehyde propylene glycol acetal. 274.18 Arc.SAFC® Flavors & Fragrances Avocadooil Avocado oil 8 8  natural. see Benzyl alcohol Page 17 Benzenethiol Phenyl mercaptan. see Docosanoic acid tryptamide Page 41 Benzalacetone. see Docosanoic acid tryptamide Page 41 [8014‑71‑9] Benzaldehyde dimethyl acetal α. FCC from Ocimum basilicum L. see ε-Caprolactam Page 25 Azole. see Pyrrole Page 116 BADGE. see Piperonal Page 112 2-Benzofurancarboxaldehyde W312800 W212709-SAMPLE-K W211907-SAMPLE-K 5 kg W213004-10KG-K [4265‑16‑1] C9H6O2 FW 146. NI W211907-250G-K 250 g W211907-1KG-K 1 kg W211907-5KG-K 5 kg 10 kg > 1-Benzazine. FCC. Fen. see Resorcinol Page 117 Benzenemethanol. see Benzylideneacetone Page 18 [100‑52‑7] FEMA 2127 Flavis 5.12 Organoleptic: almond. Kosher. 135  ≥98% FEMA 3616 Flavis 12. FG Halal. see Basil oil. vanilla France origin from Ocimum basilicum L. methyl chavicol type Page 16 BAT.14 Flavis 13. (Ethanol extraction of honeycomb) Organoleptic: apple. 134 W212202-SAMPLE-K W212628-SAMPLE W212000-25G-K FEMA 2128 Flavis 6. 127 from Melissa officinalis Organoleptic: lemon. green W212628-1KG 1 kg > Behenic acid tryptamide. Kosher Organoleptic: leafy. Fen. 271.

145 Halal. see Phenethyl alcohol Page 106 Benzyl carbinyl anthranilate. NI W214000-5KG-K Arc. FCC W213713-SAMPLE-K FEMA 2134 Flavis 7. NI [95‑16‑9] C7H5NS FW 135.Benzylcarbinylt Benzoic acid [65‑85‑0] FEMA 2131 Flavis 8. 139 W213403-SAMPLE-K Organoleptic: apricot. see Phenethyl formate Page 107 Benzyl carbinyl isovalerianate.032 CoE Nr 166 W213713-100G-K 100 g Organoleptic: apricot. cherry.2-Benzopyrone.5%. FCC Kosher W213128-SAMPLE-K W213128-100G-K 100 g W213128-1KG-K 1 kg W213128-5KG-K 5 kg > Benzoic acid sodium salt.3-Benzopyridine. floral. see Phenethyl 2methylbutyrate Page 107 Benzyl carbinyl formate. sweet Benzyl acetate W213810-SAMPLE-K Acetic acid benzyl ester W213810-100G-K 100 g [140‑11‑4] FEMA 2135 Flavis 9. see Benzyl benzoate Page 17  ≥96% W213802-SAMPLE-K W325600-1KG 1 kg W325600-10KG 10 kg  natural. 140  ≥99%. NI W213705-SAMPLE-K W213705-1KG-K 1 kg W213705-10KG-K 10 kg W213705-25KG-K 25 kg Halal. FCC. FCC Halal.12 Arc. sweet. Sumatra Kosher France origin W213500-SAMPLE-K W213314-SAMPLE-K Benzoin resin absolute. Fen. cheese. 143 from Styrax tonkinensis Kosher  ≥98%. JSFA W213748 17 . cheese. ≥99%.051 CoE Nr 277 CH3CH2CH2CO2CH2C6H5 C11H14O2 FW 178. pear. FG Arc. Fen. cherry. FCC. jasmine.727 CoE Nr 262 C6H5COOCH2C6H5 C14H12O2 FW 212. Fen. Kosher  ≥99%.22 Organoleptic: berry. Siam Kosher Organoleptic: balsam France origin W213306-SAMPLE-K W213306-1KG-K 1 kg W213306-5KG-K 5 kg Benzoin resinoid 8 FEMA 2133 5 kg W213519-SAMPLE-K W214000-10KG-K 10 kg W213519-100G-K 100 g W213519-1KG-K 1 kg W213519-5KG-K 5 kg > Benzylacetic acid. FCC.021 CoE Nr 21 C6H5COOH C7H6O2 FW 122. 141 Benzoin resin absolute  ≥99%. Siam W213500-1KG-K 1 kg W213500-10KG-K 10 kg W213500-25KG-K 25 kg from gum benzoin. Kosher. Kosher. ≥99%.19 W213101-SAMPLE-K Fen. 286.com 1 kg  natural. Kosher. Fen. FG Organoleptic: apple. see Coumarin Page 30 Coumarin.17 W213810-1KG-K 1 kg W213810-5KG-K 5 kg Arc. NI [9000‑05‑9] FEMA 2133 from gum benzoin. Kosher Organoleptic: floral. FCC W325600-25KG 25 kg Halal.14  natural Arc. Fen. see Phenethyl phenylacetate Page 107 Benzyl carbinyl salicylate. Kosher Organoleptic: floral. FCC Organoleptic: almond. ≥99. FG > 1-Benzopyran-2-one. fruity Halal. FCC. jasmine.014 CoE Nr 204 CH3COOCH2C6H5 C9H10O2 FW 150. plum Halal. fruity. see Phenethyl isovalerate Page 107 Benzyl carbinyl phenylacetate. NI W213713-1KG-K 1 kg W213713-5KG-K 5 kg W213403-1KG-K 1 kg W213403-10KG-K 10 kg W213403-25KG-K 25 kg Feel inspired at safcglobal. see Coumarin Page 30 Coumarin. 292. FCC. apricot. see 3-Phenylpropionic acid Page 110 Benzyl alcohol  ≥99%. Chinese Page 30 2. FG W214000-1KG-K [100‑51‑6] FEMA 2137 Flavis 2. NI W213101-1KG-K 1 kg W213101-10KG-K 10 kg FEMA 3256 Flavis 15. citrus. see Sodium benzoate Page 119 Benzoic acid benzyl ester. see Phenethyl anthranilate Page 106 Benzyl carbinyl cinnamate. see Indole Page 66 Benzyl benzoate Benzoic acid benzyl ester [120‑51‑4] FEMA 2138 Flavis 9.01 CoE Nr 58 C6H5CH2OH C7H8O FW 108. 276. butter. sweet Benzenemethanol [9000‑05‑9] Benzyl butyrate [103‑37‑7] FEMA 2140 Flavis 9. grapefruit. 293. berry. see Quinoline Page 117 1. floral. see Phenethyl salicylate Page 108 Benzyl carbinyl tiglate. 280. sweet Halal. floral. Chinese Page 30 1H-Benzo[b]pyrrole. pineapple. see Phenethyl cinnamate Page 107 Benzyl carbinyl ethyl methyl acetate. cherry. peach. plum W214019-SAMPLE-K W214019-25G-K 25 g W214019-100G-K 100 g W214019-1KG-K 1 kg > Benzyl carbinol. Fen.5%. 136  ≥99. Kosher. strawberry. ≥98%. FG [9000‑72‑0] FEMA 2133 1 kg  ≥99%. Kosher Organoleptic: fruity. Kosher. see Phenethyl tiglate Page 108  natural. FG W213300-SAMPLE-K W213300-100G-K 100 g W213300-1KG-K 1 kg Benzophenone Diphenyl ketone [119‑61‑9] (C6H5)2CO C13H10O FW 182.23 W214000-SAMPLE-K  natural. ≥98%. 144 Benzothiazole Organoleptic: balsam Halal. peach Kosher.24 Arc. walnut Halal.016 CoE Nr 11594 W213101-25KG-K 25 kg NI W213802-1KG-K W325600-SAMPLE W213802-5KG-K 5 kg W213802-10KG-K 10 kg  natural. plum. 290.

152 W214108-SAMPLE-K Benzyl ether W214906-1KG-K 1 kg W214906-5KG-K 5 kg W214906-10KG-K 10 kg Benzyl propionate FEMA 4428 Flavis 12. papaya and endive1 Possible applications: Mustard. Fen. see α-Amylcinnamyl alcohol Page 13 Benzyl isobutyl ketone. 314. see 2-Methyl-1-phenyl-2-propanol Page 92 W288101-SAMPLE-K W288101-1KG-K 1 kg W288101-10KG-K 10 kg W288101-25KG-K 25 kg > 4. see Benzyl isothiocyanate Page 18 Organoleptic: jasmine. jam.004 CoE Nr 2150 Organoleptic: almond. fruity Halal. smoky. cherry.738 CoE Nr 331 Natural occurrence: Soybeans and Virginia tobacco.4′-Benzylidenebis(N.102 Natural occurrence: watercress.N-dimethylaniline). see Benzyl isovalerate Page 18 Benzyl-2-methyl propionate. strawberry.27 Arc.39 W215201-SAMPLE-K W215201-1KG-K 1 kg W215201-5KG-K 5 kg W215201-10KG-K 10 kg Benzyl mercaptan α-Toluenethiol. 156 W214115-1KG-K Benzyl isothiocyanate W214906-SAMPLE-K 8 Isothiocyanotaomethylbenzene.23 Organoleptic: earthy.005 CoE Nr 477 Arc. chocolate. banana.26 W214108-10KG-K 10 kg FEMA 2371 Flavis 3. 414 W214701-SAMPLE-K Arc. NI Arc.28 [122‑57‑6] C6H5CH=CHCOCH3 C10H10O FW 146. see 4-Methyl-1-phenyl-2-pentanone Page 92 Benzyl disulfide Dibenzyl disulfide [150‑60‑7] C6H5CH2SSCH2C6H5 C14H14S2 FW 246. green Kosher W361704-SAMPLE-K W361704-1KG-K 1 kg W361704-5KG-K 5 kg W361704-10KG-K 10 kg 5 kg W214701-10KG-K 10 kg CoE Nr 301 > Benzyl 3-methylbutyrate. ≥97%. Benzyl mustard oil [622‑78‑6] C6H5CH2NCS C8H7NS FW 149. NI 1 kg W214108-5KG-K 5 kg [103‑50‑4] (C6H5CH2)2O C14H14O FW 198. pineapple Halal. Gerard Mosciano. peach. 325. 332 Kosher Organoleptic: herbaceous. sweet.426 C11H14O2 FW 178. pineapple. chocolate. sweet Kosher Fen. vanilla. meaty. FCC. Perfum.024 CoE Nr 158  ≥98%. W215007-1KG-K 1 kg W215007-10KG-K 10 kg W215007-25KG-K 25 kg . creamy. horseradish.1 Organoleptic: cabbage Lit. FG W214108-1KG-K  ≥98%. cherry.20 Arc. 148 Benzyl isobutyrate  98% Organoleptic: meaty Kosher. Fen. fruity. Fen.19 [103‑38‑8] (CH3)2CHCH2CO2CH2C6H5 C12H16O2 FW 192.081 CoE Nr 4077 [103‑28‑6] FEMA 2141 Flavis 9. 1553 FEMA 2152 Flavis 9. jasmine. sweet Kosher W237108-1KG-K 1 kg W237108-5KG-K 5 kg W237108-10KG-K 10 kg Benzyl formate Arc. 879. vegetative nuances for cabbage. Organoleptic: almond. Kosher. Fen. NI W215007-SAMPLE-K W442800-SAMPLE W442800-25G 25 g W442800-100G 100 g > Benzyl 2-hydroxybenzoate. NI W214507-SAMPLE-K W214507-1KG-K 1 kg W214507-5KG-K 5 kg W214507-10KG-K 10 kg [102‑16‑9] C6H5CH2CO2CH2C6H5 C15H14O2 FW 226. 58-59 (2009) [122‑63‑4] FEMA 2150 Flavis 9. woody Halal. 294. cinnamon. 146  ≥99% Arc.458 CoE Nr 453 Organoleptic: apricot. floral. fruity. sweet Kosher. 157  ≥98%. 338. see Benzyl salicylate Page 19 18 Organoleptic: apple. FG W214115-SAMPLE-K W237108-SAMPLE-K 1 kg  ≥97%. 34 (1). pineapple Kosher Fen. Fen. floral. Flavor. 346  ≥98% FEMA 2881 Flavis 7. Kosher. fruity  ≥98%.15 Benzyl phenylacetate  natural (US). 153 Place an order with your local SAFC representative (see back for contacts).705 CoE Nr 232 W214115-100G-K Organoleptic: honey. 150  ≥95%. 318. tropical papaya mouthfeel effects. spicy.20 Arc. berry. NI Benzyl-2-methyl propionate FEMA 3617 Flavis 12. see Benzyl isobutyrate Page 18 Benzyl mustard oil. FCC Organoleptic: apple. Fen. radish and watercress. see Leucomalachite Green Page 75 2-Benzylidene-1-heptanol. 299. Fen. Methyl styryl ketone Benzyl 3-methylbutyrate [103‑41‑3] C6H5CH=CHCOOCH2C6H5 C16H14O2 FW 238. herbaceous.21  98% [104‑57‑4] HCO2CH2C6H5 C8H8O2 FW 136. floral. fruity. cited: 1.077 CoE Nr 344 Organoleptic: apricot. 307. jam. herbaceous.25 Arc. nasturtium.SAFC® Flavors & Fragrances Benzylcinnamate Benzyl cinnamate Benzylideneacetone Benzyl isovalerate Cinnamic acid benzyl ester Benzalacetone. Fen.132 CoE Nr 413 C2H5CO2CH2C6H5 C10H12O2 FW 164. balsam. floral. floral. anise. FCC W214701-1KG-K W214701-5KG-K Dibenzyl ether Arc. FCC FEMA 2142 Flavis 9. FCC FEMA 2149 Flavis 9. FCC FEMA 2145 Flavis 9. 42  99% FEMA 2147 Flavis 12. α-Tolyl mercaptan [100‑53‑8] C6H5CH2SH C7H8S FW 124. Kosher. sweet Kosher. butter. NI W214205-SAMPLE-K W214205-1KG-K 1 kg W214205-5KG-K 5 kg W214205-10KG-K 10 kg > Benzyl dimethyl carbinol.

2-[4-(3-Chloro-2-hydroxypropyloxy)phenyl]-2-[4(2.2′dimethyldifuran W215309-4KG-K 4 kg [28588‑75‑2] C10H10O2S2 FW 226. sweet Kosher Fen. J.2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane.016 Kosher 250 mg 2. Chromatographia 34.S. garlic).3-dihydroxypropyl) ether Page 20 2. W387800-2. see Butylated hydroxytoluene Page 21 Biebrich scarlet R fat soluble. J. Sci. Losada et al. 30.S. Lebensmittelunters. Chromatographia 34.. Organoleptic: cheese. green NI W387800-1KG-K Biphenyl 11 (1992) 2. see Butylated hydroxyanisole Page 21 BHT.013 CoE Nr 10978 W387800-100G-K 100 g Organoleptic: geranium. M. earthy. 67 (1992) 3.21 Natural Occurrence: Truffles cheese. sweet ≥97. Geb. Biedermann et al.2-Bis[4-(glycidyloxy)phenyl]propane.752 CoE Nr 436 [103‑23‑1] [-CH2CH2CO2CH2CH(C2H5)(CH2)3CH3]2 C22H42O4 FW 370. P.. P.2. Mitt.6-Diisopropylphenol Page 36 Bergamot oil 11 (1992) 2.P. Kosher Arc. cited: 1.0% (HPLC) Standard for determination of toxic BADGE and derivatives in canned food1. spicy Halal. cited: 1.2-Bis[4-(2. Chromatogr. alliaceous (onion. see 2. Fen. shittake mushrooms.118 CH3SCH2SCH3 C3H8S2 FW 108. J. for food analysis W215481-SAMPLE-K W215481-1KG-K 1 kg W215481-5KG-K 5 kg > 2. Dimethylthiomethane W215317-SAMPLE W215317-1KG 1 kg W215317-4KG 4 kg > BHA.23 250 mg  analytical standard. FG FEMA 3878 [92‑52‑4] C6H5C6H5 C12H10 FW 154.3′-Dithio-2.57 W215104-SAMPLE-K W215104-1KG-K 1 kg  ≥99% W215104-5KG-K 5 kg W519006-SAMPLE W215104-10KG-K 10 kg [8007‑75‑8] FEMA 2153  Italy origin W519006-1KG 1 kg Bis(2-Methyl-3-furyl) disulfide Kosher W215309-SAMPLE-K W215309-1KG-K 1 kg 2-Methyl-3-furyl disulphide. J.3-dihydroxypropoxy)phenyl]methane.24 Arc. see Bisphenol A bis(2.3-dihydroxypropyloxy)phenyl]propane. jasmine.3-dihydroxypropyl) ether FEMA 3259 Flavis 13. Gandara et al. Chromatogr.com 19 . (Non-sensitizing) W325900-SAMPLE-K 25 g W325900-100G-K 100 g W325900-1KG-K 1 kg Formaldehyde dimethyl mercaptal.3 Lit. Agric. horseradish. Fresenius Z.32 W215325-1KG-K 1 kg W215325-4KG-K 4 kg W215325-9KG-K 9 kg  Ivory Coast origin. see Bisphenol A diglycidyl ether Page 20 2.2.33 Kosher  analytical standard. 345. J. see Bisphenol A bis(3-chloro-2-hydroxypropyl) ether Page 19 Bis[4-(2. J.6-Bis(isopropyl)phenol. 47. 67 (1992) 3.Bisphenolachlor  natural.0% (HPLC) Standard for determining toxic monomers released from polymers of the inner coating of cans1. BADGE-HCl-H2O Kosher W215325-SAMPLE-K [5581‑32‑8] C21H28O6 FW 376. cited: 1. 340  ≥98%. Chem.0% (HPLC) Standard for determining toxic monomers released from polymers of the inner coating of cans1. and lobster. 90. for food analysis ≥95.3-dihydroxypropyl) ether Page 19 Bis(2-ethylhexyl) adipate FEMA 2151 Flavis 9. ≥98%. 157 Bisphenol A bis(3-chloro-2-hydroxypropyl) ether [68917‑50‑0] BADGE-2HCl. see Sudan IV Page 120 [1618‑26‑4] Flavis 12. 1965 (1999) 2. Anal. for food analysis > 2.2 Lit.2-Bis[4-(2. sweet Kosher ≥97. Gandara et al. rectified 15136-250MG  analytical standard. Chem. Fresenius Z.3-dihydroxypropyl) ether Adipic acid di(2-ethylhexyl) ester.3 Lit. Hyg.44 Bisphenol A (3-chloro-2-hydroxypropyl) (2. Losada et al.2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane  sweet FEMA 2154 W215015-SAMPLE-K W215015-25G-K 25 g W215015-100G-K 100 g W215015-1KG-K 1 kg Benzyl salicylate Benzyl 2-hydroxybenzoate [118‑58‑1] 2-(HO)C6H4CO2CH2C6H5 C14H12O3 FW 228. 345. FCC Birch oil Organoleptic: berry.5KG-K 1 kg 2. 2.P. 1077.E. 527 (1993) [227947‑06‑0] C21H27ClO5 FW 394.89 W325900-25G-K Bis(methylthio)methane from synthetic Organoleptic: fruity. 30.. 527 (1993) Bisphenol A bis(2. 162 W387800-SAMPLE-K  ≥99% W387800-25G-K 25 g FEMA 3129 Flavis 1.. Biles et al. see Bisphenol F bis(2. Sci.3-dihydroxypropoxy)phenyl]propane 15137-250MG  98%  Italy origin.5 kg W312908-SAMPLE W312908-1KG 1 kg  ≥99% W312908-5KG 5 kg W508772 W312908-10KG 10 kg Feel inspired at safcglobal.. Anal. FCC [4809‑35‑2] C21H26Cl2O4 FW 413. 3. Food Chem. DOA Organoleptic: floral. 177 (1999) 92427-25MG 25 mg 92427-100MG 100 mg  ≥99%..3-dihydroxypropoxy)phenyl]propane.

Chromatographia 34..™ 332 [1675‑54‑3] C21H24O4 FW 340. Chromatogr. Chem. Losada et al. J. Food Chem.3-dihydroxypropyl) glycidyl ether BADGE-H2O..017 CoE Nr 207 W216900-100G-K 100 g Organoleptic: woody. Kosher Organoleptic: spicy India origin 73124-25MG 25 mg W284505-SAMPLE-K 73124-100MG 100 mg Bisphenol A diglycidyl ether 4.7-Trimethylbicyclo[2. 2. 2.4′-Isopropylidenediphenol diglycidyl ether.E. M.SAFC® Flavors & Fragrances Bisphenolachlor Bisphenol A (3-chloro-2-hydroxypropyl) glycidyl ether BADGE-HCl.1]hept-2-yl acetate Flavis 12. 30. M. Sci. Losada et al.E. Agric.0% (HPLC) Standard for determining toxic monomers released from polymers of the inner coating of cans. 345. parapara ≥95. natural FEMA 2169 from Barosma crenulata Kosher Organoleptic: minty black current like odor W216900-SAMPLE-K  ≥97% FEMA 2159 Flavis 9. Biles et al. J. Fresenius Z. Lebensmittelunters. ortho-para. P. Fresenius Z.022 CoE Nr 725 Halal. Mitt. see Butyraldehyde Page 24 Butanedioic acid.2. 11 (1992) 2.2.4-Dimercaptobutane [1191‑08‑8] HS(CH2)4SH C4H10S2 FW 122. 333.0% (HPLC. Gandara et al. 345... J.. cited: 1. BADGE. woody Brazil origin W530345-250G-K 250 g Buchu leaf oil. natural FEMA 2169 Bois de rose from Barosma betulina Kosher Rosewood oil [8015‑77‑8] FEMA 2156 W530345-SAMPLE-K W530345-25G-K 25 g from Aniba rosaeodora Ducke Kosher Organoleptic: floral.25  ≥99%.P. E. 170 W216900-500G-K 500 g > Butanal. see Acid Red 73 Page 10 Buchu leaf oil. see Bran absolute Page 20 250 mg Place an order with your local SAFC representative (see back for contacts). 177 (1999) 73417-25MG 25 mg 73417-100MG 100 mg Bisphenol F bis(2.2 Lit. Betulina 1 kg Agathosma betulina W284505-5KG-K 5 kg [68650‑46‑4] W284505-10KG-K 10 kg 8  FG. total assay of the 3 isomers) Standard for determining toxic monomers released from polymers of the inner coating of cans1. cited: 1.3 Lit.1. Chem. J.4-Butanedithiol Tetramethylene dimercaptan. 2-[4-(2.39  analytical standard. for food analysis ≥95. Biedermann et al. 527 (1993) 15138-500MG-F 500 mg Bisphenol A (2. P. for food analysis mixture of 3 isomers ortho-ortho.3-dihydroxypropyl) ether Bis[4-(2. cited: 1. 67 (1992) 3. see Succinic acid Page 120 W215902-SAMPLE W215902-1KG 1 kg W215902-5KG 5 kg W215902-10KG 10 kg 1.103 [5655‑61‑8] C12H20O2 FW 196. Chromatographia 34. see Neroli extract Page 103 Orange flower absolute Page 103 Bitter orange oil. 11 (1992) 2.7.R.848 W520802-100G 100 g W520802-1KG 1 kg Kosher Organoleptic: meaty W408001-SAMPLE-K W408001-1KG-K 1 kg W408001-5KG-K 5 kg W408001-10KG-K 10 kg > Boswellia carterii. Kosher France origin W521108-SAMPLE-K FEMA 2845 W521108-100G-K 100 g W521108-1KG-K 1 kg 1965 (1999) 2. 67 (1992) 3. 1. 1965 (1999) 2. Geb. 177 (1999) from Piper nigrum L. 47. Anal.3-Dihydroxypropyloxy)phenyl]2-[4-(glycidyloxy)phenyl]propane [76002‑91‑0] C21H26O5 FW 358. Geb. Fen. Agric. Crenulata 8 Agathosma crenulata W215600-SAMPLE-K W215600-1KG-K 1 kg W215600-4KG-K 4 kg W215600-9KG-K 9 kg Bornyl acetate [76‑49‑3] C12H20O2 FW 196. cited: 1. Lebensmittelunters.2-Bis[4-(glycidyloxy)phenyl]propane.41  analytical standard. J.2. from Triticum estivum Halal. Kosher W347701-SAMPLE-K W347701-25G-K 25 g W347701-100G-K 100 g W347701-1KG-K 1 kg .. 527 (1993) 15142-250MG 20 > Bitter orange flower. Hyg.25 (−)-Bornyl acetate  ≥97% endo-(1S)-1. J.29 [68650‑46‑4]  FG.29 W520802-SAMPLE  95% W520802-25G 25 g FEMA 4080 Flavis 9. for food analysis Fen. D. for food analysis ≥95.87 ≥90% (HPLC) Standard for determination of toxic BADGE and derivatives in canned food1. Biles et al. FG FEMA 3477 Flavis 12. sweet NI Arc. 90. J.3 Lit. Hyg.. 1510 Piper Nigrum Bran absolute Bran [68916‑76‑7] Black pepper oil [13836‑48‑1] C21H25ClO4 FW 376. J. Anal.S. see Frankincense oil Page 102 Olibanum oil Page 102 Bran. Paraguay Page 106 W284505-1KG-K > Brilliant Crocein MOO. Food Chem. 90. 2-[4-(3-Chloro-2-hydroxypropyloxy) pheny]-2-[4-(glycidyloxy)phenyl]propane [8006‑82‑4]  analytical standard.. see Petitgrain oil.3-Butanedithiol [4532‑64‑3] CH3CH(SH)CH(SH)CH3 C4H10S2 FW 122. Biedermann et al.2 Lit. Gandara et al. Mitt. Chromatogr.S. Sci. see Acid Red 73 Page 10 Brilliant crocein scarlet MOO.43  analytical standard.P. 30.3-dihydroxypropoxy)phenyl]methane [72406‑26‑9] C19H24O6 FW 348. 47.0% (HPLC) Standard for determination of toxic BADGE and derivatives in canned food1.

see Butyl alcohol Page 21 1-Butanol.16 (±)-2-Aminobutane Arc. 189 [13952‑84‑6] CH3CH2CH(NH2)CH3 C4H11N FW 73. 183 W217816-SAMPLE-K  ≥99. 191 W218405-25KG-K 25 kg  ≥99% Butyl benzoate FEMA 3130 Flavis 11. cheese. BHA Butyl alcohol 1-Butanol.005 Organoleptic: banana. FCC W217018-SAMPLE-K W217018-1KG-K Halal. fruity. FG 2-Butanethiol [7756‑96‑9] 2-(H2N)C6H4CO2(CH2)3CH3 C11H15NO2 FW 193.24 [25013‑16‑5] (CH3)3CC6H3(OCH3)OH C11H16O2 FW 180. NI [136‑60‑7] C6H5COOCH2CH2CH2CH3 C11H14O2 FW 178. FCC Butylated hydroxytoluene CoE Nr 52 2.5%. sweet. NI W218308-SAMPLE-K  ≥99.264 CoE Nr 10525 Organoleptic: berry. 2.9%. Kosher Fen. 488.104 W217417-100G-K 100 g W509434-SAMPLE W217417-1KG-K 1 kg 1 kg W217417-4KG-K 4 kg W509434-4KG 4 kg W217417-9KG-K 9 kg W509434-8KG 8 kg sec-Butyl mercaptan. see Butylamine Page 21 Feel inspired at safcglobal.5%. Fen. sweet Kosher [513‑53‑1] CH3CH2CH(SH)CH3 C4H10S FW 90. 184  ≥98%. 184 W333204-SAMPLE-K W333204-100G-K 100 g W333204-1KG-K 1 kg W333204-5KG-K 5 kg Arc.35 W515000-SAMPLE-K W515000-1KG-K 1 kg W515000-5KG-K 5 kg W515000-10KG-K 10 kg 21 . FCC. Fen. FCC  ≥98. Fen. garlic) NI W347809-SAMPLE 1 sample Butyl anthranilate W217409-SAMPLE-K W347809-1KG 1 kg W217409-1KG-K 1 kg W347809-4KG 4 kg W217409-9KG-K 9 kg W347809-8KG 8 kg W217409-20KG-K 20 kg FEMA 2181 Flavis 9. ≥98%.19 (±)-sec-Butylamine [123‑86‑4] FEMA 2174 Flavis 9.5% CoE Nr 194 FEMA 4240 Flavis 11. Mercaptan C4 [109‑79‑5] CH3(CH2)3SH C4H10S FW 90.004 CH3COO(CH2)3CH3 C6H12O2 FW 116. fishy Halal.23 W313009-SAMPLE-K Arc. 192  ≥99%  natural.11 Kosher Arc. 2(3)-t-Butylhydroquinone monomethyl ether. green Kosher. FCC  natural. FG W217816-1KG-K 1 kg FEMA 2170 Flavis 7.01 CoE Nr 526 Organoleptic: alliaceous (onion. NI W217808-SAMPLE-K W217808-1KG-K 1 kg W217808-4KG-K 4 kg W217808-8KG-K 8 kg W217808-20KG-K 20 kg Butylamine FEMA 3332 Flavis 9.5%. Butylhydroxytoluene Organoleptic: medicinal.14 W218405-10KG-K 10 kg Fen.717 CoE Nr 252 CoE Nr 194c Organoleptic: plum. 194 W218405-SAMPLE-K 1-Aminobutane. 193 1 kg W217018-8KG-K 8 kg W217018-20KG-K 20 kg Butan-3-one-2-yl butanoate [84642‑61‑5] CH3CH2CH2CO2CH(CH3)COCH3 C8H14O3 FW 158. DBPC. 182 Arc. vanilla Kosher.004 CH3(CH2)3OH C4H10O FW 74. Kosher. 403 W313009-1KG-K 1 kg  ≥98% W313009-4KG-K 4 kg Flavis 9.19 Halal.779 W313009-8KG-K 8 kg Kosher W313009-20KG-K 20 kg > n-Butylamine. Kosher.Butylbenzoate 1-Butanethiol Butyl acetate Butyl mercaptan. see Butyl alcohol Page 21 W218103-SAMPLE-K W218103-100G-K 100 g W218103-1KG-K 1 kg W218103-5KG-K 5 kg Butylated hydroxyanisole 2(3)-t-Butyl-4-hydroxyanisole. n-Butanol [71‑36‑3] FEMA 2178 Flavis 2. sweet Kosher Fen. Kosher Organoleptic: fruity  ≥98% W217417-SAMPLE-K Flavis 12. NI W424001 FEMA 3478 Flavis 12. Ethyl methyl ketone CoE Nr 52c [78‑93‑3] C2H5COCH3 C4H8O FW 72. 469  ≥98.6Di-tert-butyl-p-cresol. 389.19 Fen.com [128‑37‑0] [(CH3)3C]2C6H2(CH3)OH C15H24O FW 220.003 CoE Nr 524 Organoleptic: meaty. FCC FEMA 2183 Methyl ethyl ketone.14  ≥98%  ≥99%. 400.6-Di-tert-butyl-4-methylphenol. Fen.24 Arc. BHT.053 CoE Nr 753 W218308-100G-K 100 g W217816-4KG-K 4 kg W218308-1KG-K 1 kg W217816-8KG-K 8 kg W218308-5KG-K 5 kg Organoleptic: ethereal Halal. ≥99. 471  ≥99%. Fen. 382. 190 2-Butanone Arc. FCC FEMA 2184 Kosher Fen.12 Arc. Mercaptan C4 W509434-1KG > Butanoic acid 1-octen-3-yl ester. see 1-Octen-3-yl butyrate Page 101 n-Butanol. MEK. n-Butylamine W218405-1KG-K 1 kg [109‑73‑9] CH3(CH2)3NH2 C4H11N FW 73. 2020.

413.22  natural (US). FCC Arc. 85 FEMA 2188 Flavis 9.21 Butyl heptanoate [5454‑28‑4] CH3(CH2)5CO2(CH2)3CH3 C11H22O2 FW 186.416 CoE Nr 291 Organoleptic: musty. FCC Arc. 470  ≥99% FEMA 2203 Flavis 9.091 CoE Nr 363 Organoleptic: apple. FCC. Kosher. sweet Arc.063 CoE Nr 313 Organoleptic: fruity. pear Halal. see 2-Methyl-3-heptanone Page 87 . spicy. see Butylated hydroxyanisole Page 21  ≥99% Kosher Organoleptic: pineapple Organoleptic: woody. banana Kosher. 419.13  mixture of cis and trans isomers. FG W507318-SAMPLE CoE Nr 268 Organoleptic: apple. see Butylated hydroxyanisole Page 21 2(3)-t-Butyl-4-hydroxyanisole.26  ≥98%. Fen. coconut. wine-like NI W333301-SAMPLE-K W219010-1KG-K W333301-100G-K 100 g W219010-5KG-K 5 kg W219606-SAMPLE W333301-1KG-K 1 kg W333301-5KG-K 5 kg > Butyl caproate. NI W220108-SAMPLE-K W220108-1KG-K 1 kg W220108-4KG-K 4 kg W220108-9KG-K 9 kg > 2(3)-t-Butylhydroquinone monomethyl ether. marigold. woody. Fen. 475.23 Arc.163 CoE Nr 501 W219010-100G-K 100 g 1 kg Organoleptic: plum. Fen.024 CoE Nr 10083 Organoleptic: herbaceous Kosher. FCC [32263‑00‑6] C10H16N2 FW 164. creamy. see Butylated hydroxytoluene Page 21 3-Butylidenephthalide Butyl formate [551‑08‑6] C12H12O2 FW 188. wine-like Kosher. see 3-Heptanol Page 57 Butyl ethyl ketone. SPF [94‑26‑8] HOC6H4CO2(CH2)3CH3 C11H14O3 FW 194.3-Dimethyl-5-(1-methylpropyl)pyrazine. 2. minty Kosher. Kosher Kosher W220302-1KG W530511-SAMPLE-K W220302-5KG 5 kg W220302-10KG 10 kg W219002-SAMPLE-K W219002-1KG-K 1 kg W219002-5KG-K 5 kg W219002-10KG-K 10 kg W219002-25KG-K 25 kg W530511-100G-K 100 g W530511-500G-K 500 g > Butyl ethyl carbinol. 440 [626‑82‑4] CH3(CH2)4CO2(CH2)3CH3 C10H20O2 FW 172. 86 CoE Nr 2107c [592‑84‑7] HCOO(CH2)3CH3 C5H10O2 FW 102. Fen. see Musk ketone Page 96 Butyl butyryllactate [7492‑70‑8] FEMA 2190 Flavis 9.5-dinitroacetophenone. 434.754 CoE Nr 525 Arc. citrus. 87 CoE Nr 2107  98% W220302-SAMPLE Organoleptic: butter. > Butyl isopropyl ketone. 452. woody.042 CH3CH2CH2COO(CH2)3CH3 C8H16O2 FW 144. 196 Organoleptic: creamy.3Dimethyl-5-sec-butylpyrazine  ≥98%. waxy Halal. 462. berry. Fen.095 CoE Nr 11044 22 Butyl hexanoate W218804-1KG-K 1 kg W326100-100G-K 100 g W219908-100G 100 g W218804-5KG-K 5 kg W326100-1KG-K 1 kg W219908-1KG 1 kg W218804-9KG-K 9 kg W326100-5KG-K 5 kg W219908-4KG 4 kg W326100-10KG-K 10 kg Place an order with your local SAFC representative (see back for contacts). peach. fruity W524018-SAMPLE W218626-SAMPLE-K W218626-1KG-K 1 kg W524018-1KG 1 kg W218626-4KG-K 4 kg W524018-5KG 5 kg W218626-8KG-K 8 kg W524018-10KG 10 kg > 4-tert-Butyl-2. 417. green. see 3-Heptanone Page 58 1 kg > Butylhydroxytoluene. cheese.3-dimethylpyrazine 8 Butyl 4-hydroxybenzoate Butyl paraben. 86 W507318-100G 100 g W507318-1KG 1 kg W507318-5KG 5 kg W507318-10KG 10 kg o-tert-Butylcyclohexyl acetate. NI W218618-SAMPLE-K W218618-1KG-K 1 kg W218618-9KG-K 9 kg W218618-20KG-K 20 kg  natural. creamy Kosher Arc. mixture of isomers [88‑41‑5] (CH3)3CC6H10OC(O)CH3 C12H22O2 FW 198. ≥98%.30 CoE Nr 268c  ≥98% FEMA 2201 Flavis 9. see Butyl hexanoate Page 22 2-sec-Butylcyclohexanone [14765‑30‑1] C2H5CH(CH3)C6H9(=O) C10H18O FW 154. NI  ≥97% W219010-SAMPLE-K FEMA 2196 Flavis 9. 197 2. Fen.491 CH3CH(O2CCH2CH2CH3)CO2(CH2)3CH3 C11H20O4 FW 216.29 Arc. herbaceous W218804-SAMPLE-K W326100-SAMPLE-K W219908-SAMPLE FEMA 3261 Flavis 7. NI Organoleptic: apple.SAFC® Flavors & Fragrances Butylbutyrate Butyl butyrate 4-tert-Butylcyclohexyl acetate [109‑21‑7] FEMA 2186 Flavis 9.25 NI Fen. ≥98% Butyl isobutyrate [97‑87‑0] (CH3)2CHCO2(CH2)3CH3 C8H16O2 FW 144. 89  ≥97%. ≥96% Organoleptic: butter. NI  ≥98% FEMA 2199 Flavis 9.25 W219606-1KG 1 kg W219606-5KG 5 kg W219606-20KG 20 kg  mixture of diastereomers. 205 FEMA 3333 Flavis 10. cheese.6-dimethyl-3.27 5-sec-Butyl-2. banana. p-Hydroxybenzoic acid n-butyl ester. 412. Fen. Fen. 200 Arc. vanilla.21  ≥98% Butyl caproate Arc. ≥98% Formic acid butyl ester Arc.

22 1 kg W221503-4KG-K 4 kg W221503-8KG-K 8 kg > 2-sec-Butylthiazole. 216 1 kg FEMA 2211 Flavis 9. Fen. 890. FG Organoleptic: chocolate. Fen. sweet Halal.064 [98‑54‑4] (CH3)3CC6H4OH C10H14O FW 150. 483. 554.25 FEMA 2206 Flavis 9. peach Halal.1 CoE Nr 376 Organoleptic: oily Arc. ethereal Organoleptic: apple. rose Kosher Butyl levulinate Organoleptic: butter. FG Arc.42 W391808-20KG 20 kg W221600-SAMPLE-K Butyl phenylacetate Arc. Fen.Butylvinylcarbi Butyl isovalerate Butyl 2-methylbutyrate [109‑19‑3] (CH3)2CHCH2COO(CH2)3CH3 C9H18O2 FW 158. tropical. wine-like Kosher W221600-1KG-K 1 kg W221600-4KG-K 4 kg W221600-9KG-K 9 kg Butyl valerate [591‑68‑4] CH3(CH2)3CO2(CH2)3CH3 C9H18O2 FW 158. see 2-Hexanol Page 60 (±)-5-Butyl-4-methyldihydro-2(3H)-furanone. FCC W220604-100G 100 g W220604-1KG 1 kg FEMA 2209 Flavis 9.com W221104-1KG-K 1 kg W221104-9KG-K 9 kg W221104-20KG-K 20 kg 23 . 92  ≥98%. 482.24 Arc. fruity  ≥95% FEMA 2215 Flavis 12. pineapple. Fen. Fen. see 2-Methoxy-3-(1-methylpropyl)pyrazine Page 79 Feel inspired at safcglobal. 211 W339315-SAMPLE-K W221503-SAMPLE-K  ≥97% > Butyl methyl carbinol. NI W221805-SAMPLE-K FEMA 3650 Flavis 9. 213 W220906-10KG-K 10 kg  ≥97% Organoleptic: fruity [590‑01‑2] C2H5CO2(CH2)3CH3 C7H14O2 FW 130.23 5 kg W365009-10KG 10 kg W221805-1KG-K 1 kg W339318-SAMPLE-K W221805-4KG-K 4 kg W339318-1KG-K 1 kg W221805-9KG-K 9 kg W339318-4KG-K 4 kg Dibutyl sulfide W221805-20KG-K 20 kg W339318-9KG-K 9 kg [544‑40‑1] CH3(CH2)3S(CH2)3CH3 C8H18S FW 146. 220 W220906-SAMPLE-K [2052‑15‑5] CH3COCH2CH2CO2(CH2)3CH3 C9H16O3 FW 172. 542. 519.38 Arc. Kosher W220507-SAMPLE-K 4-tert-Butylphenol W220507-1KG-K 1 kg W220507-5KG-K 5 kg W220507-10KG-K 10 kg  ≥99% W220507-25KG-K 25 kg FEMA 3918 Flavis 4. NI  ≥99% W365009-SAMPLE  ≥97%. ethereal. 507. see Butyl 4-hydroxybenzoate Page 22 FEMA 2205 CoE Nr 372 Organoleptic: creamy.519 CoE Nr 10534 Organoleptic: apple. raspberry NI W221708-1KG 1 kg W221708-4KG 4 kg W221708-9KG 9 kg > Butyl vinyl carbinol. see 1-Hepten-3-ol Page 58 W221104-SAMPLE-K > Butyl mercaptan. 481. NI Organoleptic: banana. 541. chocolate.763 W365009-1KG Flavis 9. ethereal. 210 Butyl salicylate [15706‑73‑7] FEMA 3393 CH3CH2CH(CH3)COOCH2CH2CH2CH3 C9H18O2 FW 158. NI Arc. see 1-Butanethiol Page 20 sec-Butyl mercaptan. see 2-Butanethiol Page 21 2-sec-Butyl-3-methoxypyrazine.007 CoE Nr 484 (−)-Butyl L-lactate W339315-1KG-K [34451‑19‑9] CH3CH(OH)CO2(CH2)3CH3 C7H14O3 FW 146. Butyl dodecanoate W391808-9KG 9 kg FEMA 2216 Flavis 9.24 Fen.124 CoE Nr 405 W220701-5KG 5 kg W220701-10KG 10 kg Kosher. Fen. Kosher. see Whiskey lactone Page 130 7-Butyl-2-oxepanone. 212  ≥98%. 219 W391808-SAMPLE Butyl laurate W221503-1KG-K W391808-1KG 1 kg  ≥98% Lauric acid butyl ester. Kosher. FG FEMA 2218 Flavis 9. ≥98%. see Butyl (S)-(−)-lactate Page 23 Butyl (S)-(−)-lactate 1 kg W365009-5KG Butyl sulfide  natural (US).148 CoE Nr 466 Arc. see 2-(1-Methylpropyl)thiazole Page 93 Butyl 10-undecenoate [109‑42‑2] H2C=CH(CH2)8CO2(CH2)3CH3 C15H28O2 FW 240. FCC. herbaceous. fruity Halal.18 W220701-SAMPLE W220701-1KG W221708-SAMPLE Butyl propionate FEMA 2207 Flavis 9. see ε-Decalactone Page 33 Butyl paraben.24 Arc.449 CoE Nr 444 [2052‑14‑4] C11H14O3 FW 194.238 CoE Nr 2103 [106‑18‑3] CH3(CH2)10COO(CH2)3CH3 C16H32O2 FW 256.787 CoE Nr 2159 W220604-4KG 4 kg Organoleptic: honey. 212  ≥99% [122‑43‑0] C6H5CH2CO2(CH2)3CH3 C12H16O2 FW 192.18 W339315-100G-K Organoleptic: green. alliaceous (onion.29 > (−)-Butyl L-lactate. Fen. Fen. 219 Kosher Organoleptic: apple. garlic) Kosher.436 CoE Nr 374 Arc. Fen.22 W220906-1KG-K 1 kg  ≥98% W220906-5KG-K 5 kg FEMA 2217 Flavis 9.

23 Arc. see Camphor white oil Page 24 Canola oil  95%. FCC  natural. ethereal. see Ethyl butyrate Page 44 W223115-1KG-K Rapeseed oil W222119-1KG-K W222119-SAMPLE-K Camphor white oil FEMA 2229 CoE Nr 2227 Natural occurrence: Carrot. 549.2. 228 W221910-SAMPLE-K 1 kg W526606-10KG-K [8008‑51‑3] FEMA 2231 CoE Nr 130 FEMA 2224 Flavis 16. 222 W526606-25KG-K W223115-SAMPLE-K W221910-25G-K Butyric acid 10 kg Kosher Fen. beer. vanilla W504904-SAMPLE W221902-1KG-K 1 kg W221902-4KG-K 4 kg W221902-8KG-K 8 kg W221902-10KG-K 10 kg 1.17 (Anh) Organoleptic: cheese Arc.7-Trimethylbicyclo[2. NI Organoleptic: medicinal.11  99% FEMA 2228  ≥99% W222801-100G CoE Nr 5 Kosher. marjoram. The sample provides an excellent means of standardizing your lipid procedures and comparing your results to other samples. 5 kg . carrot. FCC. Fen.23 Arc.193 W504904-25G 25 g W221902-SAMPLE-K W504904-100G 100 g W504904-1KG 1 kg Kosher W526606-SAMPLE-K Organoleptic: cherry. Fen. 547. Fen. Fen.1] heptane [5794‑03‑6] C10H16 FW 136.7. NI Flavis 7. chocolate. tarragon. see 4-Hydroxybutanoic acid lactone Page 65 Butyrone. Organoleptic: vanilla Kosher. NI 100 g (+)-Camphene W222100-SAMPLE-K W222100-1KG-K 1 kg W222100-10KG-K 10 kg W222100-25KG-K 25 kg (1R)-2. FG 25 kg [68606‑83‑7] [114460‑21‑8] (CH3COO)2Ca · xH2O C4H6CaO4 · xH2O FW 158.20 [76‑22‑2] C10H16O FW 152. A certificate of composition is provided with the standard.5% W527211-SAMPLE W527211-1KG 1 kg W527211-10KG 10 kg W527211-25KG 25 kg > γ-Butyrolactone.11 [495‑40‑9] C6H5COCH2CH2CH3 C10H12O FW 148. woody. parsley and pepper.003 CoE Nr 91 CH3CH2CH2CHO C4H8O FW 72. NI Halal. nutmeg.1]heptan-2-one [123‑72‑8] FEMA 2219 Flavis 5. 565. Fen. meaty. 221 Arc. dill. 558. FCC  natural. ≥99%. Organoleptic: apple. fennel. ≥95% 24 (±)-Camphor 1 kg W223018-5KG-K 5 kg W223018-10KG-K 10 kg Place an order with your local SAFC representative (see back for contacts). Kosher.016 CoE Nr 11741 Organoleptic: fruity. cooked rice. see 4-Heptanone Page 58 9 kg Canaga oil Cananga oil Cananga Odorata FEMA 2232 Organoleptic: floral. 1000 mg 8 Kosher Switzerland origin FEMA 2230 Flavis 7.SAFC® Flavors & Fragrances Butyraldehyde Butyraldehyde Butyrophenone Butanal Phenyl propyl ketone 1. ethereal Kosher W526606-1KG-K Camphora oil. creamy. vanilla Arc.19 W221902-20KG-K W222402-SAMPLE-K 25 g W222402-1KG-K 1 kg W221910-100G-K 100 g W222402-10KG-K 10 kg W221910-1KG-K 1 kg W222402-25KG-K 25 kg Calcium acetate hydrate [107‑92‑6] FEMA 2221 Flavis 8. Cinnamomum Camphora Sieb Caffeine  anhydrous.005 CH3CH2CH2COOH C4H8O2 FW 88. 238 CoE Nr 5c W222119-5KG-K 5 kg W222909-SAMPLE-K W222119-10KG-K 10 kg W222909-1KG-K 1 kg W222119-25KG-K 25 kg W222909-4KG-K 4 kg W222909-8KG-K 8 kg D-Camphor Butyric anhydride [106‑31‑0] (CH3CH2CH2CO)2O C8H14O3 FW 158.19  ≥97. woody Kosher Indonesia origin W223204-SAMPLE-K W223204-1KG-K 1 kg W223204-5KG-K 5 kg > Cananga Odorata.7-Trimethylxanthine 20 kg [58‑08‑2] C8H10N4O2 FW 194. for food analysis  Certified organic (NOP/EU)  ≥97% Kosher. pear. fruity.215 CoE Nr 140 W530228-SAMPLE-K W530228-5KG-K W223018-SAMPLE-K W223018-1KG-K  analytical standard. Kosher > Camphora oil. 553  ≥98%  ≥99% Natural occurrence: Apple. 562.3.2. see Canaga oil Page 24 Cananga oil. 243 from synthetic Taiwan origin Halal. 103 Organoleptic: butter 4 kg W223115-9KG-K 46961 [464‑49‑3] C10H16O FW 152.23 Butanoic anhydride 1 kg W223115-4KG-K [120962‑03‑0] 1 kg > Butyric acid ethyl ester. white bread. thyme.2-Dimethyl-3-methylenebicyclo[2. vegetable Kosher. pear. see Canaga oil Page 24 Our characterized canola oil sample is intended for use as a control or check sample for fatty acid methyl ester (FAME) analyses. meaty. NI Arc.

mixture of cis and trans Page 25 Carvol. 2876.22 Arc. Kosher.029 [562‑74‑3] C10H18O FW 154.25 Organoleptic: lemon FEMA 2248 Flavis 2.5-dihydrofuran-2-one solution Page 38 Caraway. 4-Terpinenol 500 g L-Carveol. Fen. see β-Cyclodextrin Page 31 Caraway oil Carum carvi L. marjoram. 255 Guatemala origin 1 kg W224820-5KG-K 5 kg D-Carvone FEMA 2249 Flavis 7. warm. mixture of isomers [99‑48‑9] C10H16O FW 152. (−)-Carvone.1. herbaceous.8-dien-2-one. 264 [6485‑40‑1] C10H14O FW 150. NI Arc. see Octanal Page 100 Caramel furanone. Carvol  ≥95%. nutmeg and spearmint. see L-Carvone Page 25 (R)-(−)-Carvone.. lime. grapefruit. see Methyl decanoate Page 85 Caprinaldehyde. see Decanoic acid Page 33 Capric acid ethyl ester. 578. (R)-(−)-Carvone. lime. pepper. (R)-5-Isopropenyl-2-methyl-2-cyclohexenone. 3.072 CoE Nr 2229c from Daucus carota L. Organoleptic: grapefruit. grapefruit.0]hept-3-ene 4-Terpinenol [13466‑78‑9] C10H16 FW 136. minty. pepper. see γ-Hexalactone Page 59 δ-Caprolactone. FG FEMA 2247 Flavis 2.23 FEMA 3821 Flavis 1. see 3-Carene Page 25 Aza-2-cycloheptanone. peppermint oil. basil.16 Carob absolute 8 [84961‑45‑5]  99% FEMA 4235 Flavis 16. green W224111-SAMPLE-K W224111-100G-K 100 g W224111-1KG-K 1 kg W224111-5KG-K 5 kg  Certified organic (NOP/EU) 8 W224123-SAMPLE-K W224123-500G-K 100 g W224820-1KG-K  ≥96% W224502-SAMPLE-K [8000‑66‑6] FEMA 2241 W224820-100G-K [2244‑16‑8] C10H14O FW 150. lemon. see Hexanoic acid Page 60 Caproic acid ethyl ester. 266 W224928-SAMPLE-K > (−)-Carvene. cranberry. fruity. FCC W224707-SAMPLE-K W224707-100G-K 100 g W224707-1KG-K 1 kg W224707-5KG-K 5 kg > (−)-Carveol.072 CoE Nr 2229  ≥92%. see δ-Hexalactone Page 59 Capryl acetate. see L-Carveol. Kosher. 262 FEMA 2245 Flavis 4. woody Halal. W224300-100G-K 100 g W224300-500G-K 500 g [562‑74‑3] C10H18O FW 154.23 100 g W224928-1KG-K 1 kg W224928-5KG-K 5 kg L-Carvone p-Mentha-6. herbaceous Halal. spicy. spicy. ≥92% [8015‑88‑1] FEMA 2244 FEMA 2248 Flavis 2. Kosher France origin W224405-SAMPLE-K W224405-100G-K 100 g W224405-1KG-K 1 kg W224405-5KG-K 5 kg > Carum carvi L. see Methyl octanoate Page 90 sec-Caprylic alcohol. warm Kosher W423501-5KG 5 kg W224300-SAMPLE-K W423501-SAMPLE > γ-Caprolactone.22 Fen. coriander. 2876. 67 Carvacrol  FCC 5-Isopropyl-2-methylphenol Organoleptic: caraway. see Ethyl hexanoate Page 45 Caproic acid methyl ester. NI Arc. Fen. lemon. marjoram. cocoa. basil. Organoleptic: chocolate. nutmeg and spearmint.) Kosher Fen. see Octanoic acid Page 100 Caprylic acid methyl ester. Kosher. natural Natural Occurrence: Anise. herbaceous. see (S)-(−)-Limonene Page 75  FCC Organoleptic: cinnamon. p-Mentha-6. see Decanal Page 33 Caproaldehyde. 579.7. 2-Oxohexamethyleneimine [105‑60‑2] C6H11NO FW 113. floral.8-dien-2-one  ≥98%. lemon. herbaceous. see 1-Octanol Page 100 2-Octanol Page 100 Caprylic acid. FCC > CARBITOL®. see 4. 266  ≥97%. 573. peppermint oil. grapefruit. Fen. citrus. (S)-5-Isopropenyl-2methyl-2-cyclohexenone. sweet. spicy Kosher [499‑75‑2] (CH3)2CHC6H3(CH3)OH C10H14O FW 150. cranberry.7-Trimethylbicyclo[4.147 Organoleptic: minty. mixture of isomers.052 NI W423501-1KG 1 kg from Ceratonia siliqua Organoleptic: sweet. woody Kosher Arc. see 2-Octanol Page 100 Caprylic aldehyde. NI Arc.5-Dimethyl-3-hydroxy-2.031 CoE Nr 2055 from Elettaria cardamomum (L. cocoa. 265 > (−)-Carvone.062 CoE Nr 2027 Organoleptic: minty. Fen. 238 FEMA 2243 W224847-SAMPLE W224847-250G 250 g W224847-1KG 1 kg W224847-5KG 5 kg W382108 > δ3-Carene. see Hexanal Page 60 Caproic acid. 579 W224901-SAMPLE-K W224901-1KG-K 1 kg W224901-5KG-K 5 kg W224901-10KG-K 10 kg 25 . see L-Carvone Page 25 Feel inspired at safcglobal. black currant. black currant. see n-Decyl acetate Page 34 Hexyl acetate Page 63 Capryl alcohol. see Di(ethylene glycol) ethyl ether Page 34 Natural Occurrence: Anise. (+)-Carvone. lemon.8-dien-2-ol.5-Dimethyl-3-hydroxy-2. see L-Carvone Page 25 FEMA 2238 W223816 4-Carvomenthenol 4-Carvomenthenol. see Propyl hexanoate Page 114 ε-Caprolactam 3-Carene 4-Carvomenthenol 3 δ -Carene.146 CoE Nr 146 W224502-100G-K 100 g W224502-1KG-K 1 kg W224502-5KG-K 5 kg Organoleptic: caraway Kosher Arc. Fen. herbaceous Halal.22 Halal. coriander.Carvone > Capric acid.com W224928-100G-K FEMA 2249 Flavis 7. lime. woody.25 Carrot seed oil  natural. see Ethyl decanoate Page 44 Capric acid methyl ester. (−)-Carveol. NI Cardamom Oil W224820-SAMPLE-K (S)-(+)-Carvone.5-dihydrofuran-2-one Page 38 4. see Caraway oil Page 25 [8000‑42‑8] Fen. mixture of cis and trans p-Mentha-6. see Methyl hexanoate Page 87 Caproic acid propyl ester. lime. FCC  FG.

01. see Hexacosanoic acid tryptamide Page 59 Cetyl alcohol.11. see D-Carvone Page 25 (+)-Carvone. 583.10S)-9Methylene-4. see 1-Hexadecanol Page 59 . Atlas type 1 kg W521507-5KG 5 kg W521507-10KG 10 kg  FCC W227102-SAMPLE-K 1 kg 8  Certified organic (NOP/EU) from (Cedrus atlantica) Kosher France origin W530143-SAMPLE-K 26 W521507-1KG from Apium graveolens L.8-Tetramethyltri cyclo[5. Fen. green Halal. green Arc.6R. woody. see D-Carvone Page 25 Cassia oil (−)-Carvyl acetate (1RS.143 CoE Nr 424 W521205-10KG-K 10 kg Organoleptic: minty. NI W521418-1KG-K (+)-Cedryl acetate W234605-25G-K [8001‑79‑4] W521418-SAMPLE-K Cedryl acetate W234605-SAMPLE-K Castor oil from Juniperus mexicana Kosher USA origin > (+)-Cedrol.12-trimethyl-5-oxatri cyclo[8.171 Fen.35 [68606‑81‑5] FEMA 2346 25 g W234605-100G-K 100 g W234605-1KG-K 1 kg  ≥80%. (1R. see Cedrol Page 26 from Ribes nigrum L. W227102-250G-K 250 g W227102-1KG-K 1 kg W227102-4KG-K 4 kg W227102-8KG-K 8 kg > Cerasin Red. 584. sweet. Fen.27 Arc. spicy USA origin from Juniperus mexicana Schiede  cassia oil W522406-SAMPLE CoE Nr 401n W522406-1KG 1 kg W522406-10KG 10 kg W522406-25KG 25 kg Halal. Kosher.6]dodecane 1 kg W521418-5KG-K > (+)-Cedryl acetate. ≥98%. Kosher. Kosher China origin FEMA 2250 Flavis 9.04.5R)-5-Isopropenyl-2-methyl-2-cyclohexenyl acetate [97‑42‑7] C12H18O2 FW 194.6.4R.37 Kosher USA origin Flavis 2.2. NI W225800-1KG-K 1 kg W225800-5KG-K 5 kg W225002-SAMPLE-K W225800-10KG-K 10 kg W225002-100G-K 100 g W225002-1KG-K 1 kg W225002-10KG-K 10 kg [77‑53‑2] C15H26O FW 222.043 W226718-1KG W509647-100G 100 g W509647-1KG 1 kg W509647-5KG 5 kg Cedarwood oil. Organoleptic: sage USA origin  95% 10 kg [8015‑90‑5] [8007‑20‑3] FEMA 2267 [1139‑30‑6] C15H24O FW 220. 267  mixture of cis and trans. Fen.2R.40 Flavis 9. FG  Certified organic (NOP) from (Ricinus communis) India origin W225207-SAMPLE-K W226318-SAMPLE W225207-1KG-K 1 kg W225207-9KG-K 9 kg W225207-20KG-K 20 kg W226318-5KG Flavis 16.11-trimethylbicyclo[7. see β-Caryophyllene Page 26 β-Caryophyllene (−)-trans-Caryophyllene. Organoleptic: spicy Kosher India origin [8023‑85‑6] W530143-1KG-K W521507-SAMPLE FEMA 2271 > CAT. spicy Halal.9S)-8-Methylene4.5]undecan-8-ol  redistilled W521205-SAMPLE-K (−)-Carvyl propionate Cedrol 1 kg Place an order with your local SAFC representative (see back for contacts). FG Cedarwood oil.8R)-2.5S. FCC.1. fruity.6. see Sudan III Page 120 Cerotinic acid tryptamide.2. (1S. Texas [8007‑80‑5] FEMA 2258 [68990‑83‑0] from Cinnamomum cassia Blume Organoleptic: cinnamon.7R. see Hexacosanoic acid tryptamide Page 59 W226718-SAMPLE W509647-SAMPLE [77‑54‑3] C17H28O2 FW 264. trans-(1R. 582. see Cedryl acetate Page 26 Cedar leaf oil (−)-Caryophyllene oxide > Cassia oil.215 CoE Nr 2063 W225800-SAMPLE-K Organoleptic: minty.0]undec-4-ene [87‑44‑5] C15H24 FW 204. 268 Cassis bourgens absolute W225118-SAMPLE-K W225118-25G-K 25 g W225118-100G-K 100 g W225118-1KG-K 1 kg > (−)-trans-Caryophyllene.SAFC® Flavors & Fragrances Carvone > (S)-(+)-Carvone. FCC. 269 FEMA 2252 Flavis 1. 284 5 kg from Thuja occidentalis L. Kosher Organoleptic: berry.35 5 kg W521418-10KG-K Celery seed oil Methyl 2-hexynoate (−)-Epoxycaryophyllene.0.3. sweet Kosher Arc.12.007 CoE Nr 2618 (+)-Cedrol.12  redistilled W521205-1KG-K 1 kg  ≥97% W521205-5KG-K 5 kg FEMA 2251 Flavis 9. see Cinnamon bark oil Page 27 8 FEMA 2263 Organoleptic: woody.

German Page 27 Chamomile oil. Fen. Chinese Page 30 Chrysanthemum monocarboxylic acid ethyl ester. spicy Halal. blue. It is also a building block for several agrochemicals (miticides) or for derivatives like cinnamic alcohol. 113 from Ormenis multicaulis Kosher Morocco origin W228818-1KG-K 100 g [14371‑10‑9] C6H5CH=CHCHO C9H8O FW 132. Organoleptic: cinnamon.3-dihydroxypropyl) ether Page 19 2H-Chromen-2-one. clove. Kosher Nepal origin Arc. 301  natural. blue W227307-25G-K > Champaca wood oil. NI W365807-100G trans-3-Phenyl-2-propenal Chamomile oil. trans-3-Phenylacrylic acid  FG W365807-SAMPLE W227307-SAMPLE-K W227315-100G-K 1-Isopropyl-4-methyl-7-oxabicyclo[2. see Chamomile absolute Page 27 Chamomile oil. FCC FEMA 2286 Flavis 5.1]heptane Organoleptic: spicy. ceylon type Page 28 Cinnamon bark oil Cinnamomum. FG  Certified organic (NOP/EU) Cinnamic acid. ≥93%. blue. German chamomile [8002‑66‑2] FEMA 2273 [470‑67‑7] C10H18O FW 154. Kosher Sri Lanka origin FEMA 2286 CoE Nr 102 W229105-SAMPLE-K Buildingblock . ≥99%. 298 Chamomile oil.Cinnamonlea Chamomile absolute 8 Chamomile oil. see Cassia oil Page 26 Cinnamomum Zeylanicum. clove. see Coumarin Page 30 Coumarin.16 Arc. lisinopril and ramipril). cinnamonitrile.16 [68916‑68‑7] Organoleptic: cinnamon. Kosher. 619. sweet.3dihydroxypropyloxy)phenyl]propane. Hungarian. Kosher from Matricaria chamomilla L. FCC from Cinnamonum zeylanicum Blume W229210-SAMPLE-K W228605-1KG-K 1 kg W229210-1KG-K 1 kg W227501-100G-K 100 g W228605-10KG-K 10 kg W229210-5KG-K 5 kg W227501-1KG-K 1 kg W228605-25KG-K 25 kg W229210-10KG-K 10 kg > Cinnamic acid. FCC from Cinnamonum zeylanicum Blume Organoleptic: sweet. 615. Fen. German 8 Chamomile oil. spicy Halal. blue. 299 > Cinnamic acid benzyl ester. blue Page 27 Chamomile oil. Hungarian. see Guaiac wood oil Page 57 Chavicol methyl ether. see Cinnamon oil. Moroccan CoE Nr 22 Halal. see Bisphenol A (3-chloro-2hydroxypropyl) glycidyl ether Page 19 2-[4-(3-Chloro-2-hydroxypropyloxy)phenyl]-2-[4-(2. German Page 27 W521302-SAMPLE-K W521302-100G-K 100 g W521302-1KG-K 1 kg Chamomile oil.4-Cineole Arc. Hungarian. see Benzyl cinnamate Page 18 Cinnamomum. 3-phenylpropanol. floral. FG CoE Nr 22c from cassia oil Organoleptic: cinnamon. Chamomile oil. sweet Halal. Kosher. spicy. Roman [8015‑92‑7] FEMA 2275 from Anthemis nobilis L Kosher 10 kg W228818-25KG-K 25 kg W228826-25G-K 25 g W365807-1KG 1 kg W228826-100G-K 100 g W365807-4KG 4 kg W228826-1KG-K 1 kg W228826-5KG-K 5 kg > 1. Hungarian. NI from Matricaria chamomilla L. Chamomile oil. rich W530358-SAMPLE-K W530358-100G-K 100 g > Chamomile oil. see Camphor white oil Page 24 Cinnamomum Cassia. Kosher Organoleptic: floral. vanilla Halal.007 CoE Nr 11225  natural.25 25 g W227307-100G-K 100 g W227307-1KG-K 1 kg Chamomile oil. 3-phenylpropionylaldehyde (fragrances and as an alternative to enalapril.com 1 kg 27 .8-Cineole. see Chamomile absolute Page 27 Chamomile oil. Fen. Fen.Cinnamaldehyde is an unsaturated aldehyde so it can easily react to many different compounds to be used in a wide range of fragrance compositions. 619. warm. Cassia oil [8015‑91‑6] FEMA 2291  Certified organic (NOP/EU) W228613-100G-K 100 g W228613-1KG-K 1 kg from Cinnamonum zeylanicum Kosher W228613-5KG-K 5 kg W229140-SAMPLE-K W229140-1KG-K trans-Cinnamaldehyde 8 1 kg  FCC  ≥98%. spicy.16 FEMA 3658 Flavis 3. German chamomile [8002‑66‑2]  natural (US) from Matricaria chamomilla L. floral W228613-SAMPLE-K W227315-SAMPLE-K  ≥99%. see 4-Allylanisole Page 10 2-[4-(3-Chloro-2-hydroxypropyloxy)pheny]-2-[4-(glycidyloxy)phenyl]propane. see Cinnamon bark oil Page 27 Cinnamomum Camphora Sieb. see Bisphenol A (3chloro-2-hydroxypropyl) (2. German chamomile [8002‑66‑2] 100 g > Chamomile oil. 617.014 CoE Nr 102c FEMA 2273 [140‑10‑3] FEMA 2288 C6H5CH=CHCOOH C9H8O2 FW 148.2. Kosher Organoleptic: honey. Kosher Egypt origin trans-Cinnamic acid W228818-SAMPLE-K 1. see Eucalyptol Page 51 Cinnamaldehyde 3-Phenylprop-2-enal [104‑55‑2] C6H5CH=CHCHO C9H8O FW 132. honey. NI W228605-SAMPLE-K W227501-SAMPLE-K 1 kg W228818-10KG-K W228826-SAMPLE-K Arc. vanilla Halal. see Ethyl chrysanthemate Page 44 W229105-250G-K 250 g W229105-1KG-K 1 kg Cinnamon leaf oil [8015‑91‑6] FEMA 2292 Kosher  Ceylon origin. ceylon type Page 27 Cinnamon oil. see trans-Cinnamic acid Page 27  Certified organic (NOP/EU) 8 W229208-SAMPLE-K W229208-1KG-K Feel inspired at safcglobal.

Kosher W230316-SAMPLE-K 28 Place an order with your local SAFC representative (see back for contacts). fruity Kosher W230103-SAMPLE-K W230103-100G-K 100 g W230103-1KG-K 1 kg W230103-5KG-K 5 kg Citral Geranial and neral mixture. 633. Kosher W229318-SAMPLE-K trans-Cinnamyl isovalerate W230200-SAMPLE-K W229318-1KG-K 1 kg W229601-SAMPLE-K W229318-5KG-K 5 kg W229601-1KG-K 1 kg W229318-10KG-K 10 kg W229601-5KG-K 5 kg W229318-25KG-K 25 kg W229601-10KG-K 10 kg Cinnamyl cinnamate. wine-like Kosher FEMA 2296 CoE Nr 279 Organoleptic: balsam. Kosher. ceylon type Cinnamyl alcohol Cinnamyl isobutyrate [103‑59‑3] (CH3)2CHCO2CH2CH=CHC6H5 C13H16O2 FW 204.085 CoE Nr 352 CoE Nr 109 Organoleptic: balsam. 309  ≥95%. 648. 306  ≥98%. honey. Fen. 629. NI W229806-SAMPLE-K W229806-100G-K 100 g W229806-1KG-K 1 kg W229806-5KG-K 5 kg Organoleptic: balsam. FCC FEMA 2302 CoE Nr 454 Organoleptic: balsam. sour.02 (CH3)2C= CHCH2CH2C(CH3)=CHCHO C10H16O FW 152. 630. Fen.739 CoE Nr 332 Organoleptic: almond.018 CoE Nr 208 Organoleptic: floral. 636. NI W230308-SAMPLE-K W229903-SAMPLE-K W229903-100G-K 100 g W229903-1KG-K 1 kg W229903-5KG-K 5 kg W230308-1KG-K 1 kg W230308-9KG-K 9 kg W230308-20KG-K 20 kg  natural. 644. Fen. Fen. mixture of isomers [122‑69‑0] C6H5CH=CHCO2CH2CH=CHC6H5 C18H16O2 FW 264. blueberry. Fen. rose. spicy. W230316-1KG-K 1 kg W230316-4KG-K 4 kg W230316-9KG-K 9 kg . green. ≥95%. ≥96% FEMA 2299 Flavis 9. berry. FCC FEMA 2292 FEMA 2294 Flavis 2. 618. 303 Arc. sweet Kosher. 315  mixture of cis and trans. pear. jasmine. sweet Halal. Fen. herbaceous Kosher Halal. FCC CoE Nr 109c from Litsea cubeba Pers. balsamic Kosher. 310 W230200-100G-K 100 g W230200-1KG-K 1 kg W230200-5KG-K 5 kg trans-Cinnamyl propionate [78761‑38‑3] C2H5CO2CH2CH=CHC6H5 C12H14O2 FW 190.SAFC® Flavors & Fragrances Cinnamonoilceyl Cinnamon oil. 311  FCC  ≥98%  ≥97%.7-Dimethyl-2. fruity. NI W229202-SAMPLE-K W229407-1KG-K 1 kg W229709-1KG-K FEMA 2297 Flavis 9. hyacinth. rose. fruity. fruity Halal. grape. sweet Kosher W229709-SAMPLE-K W229407-SAMPLE-K 1 kg W229202-1KG-K 1 kg W229407-5KG-K 5 kg W229709-5KG-K 5 kg W229202-5KG-K 5 kg W229407-10KG-K 10 kg W229709-10KG-K 10 kg W229407-25KG-K 25 kg Cinnamyl acetate [103‑54‑8] CH3CO2CH2CH=CHC6H5 C11H12O2 FW 176.47 CoE Nr 496 Organoleptic: balsam. FCC FEMA 2293 Flavis 9. Fen. FCC [5392‑40‑5] FEMA 2303 Flavis 5. Fen.26 [69121‑78‑4] (CH3)2CHCH2CO2CH2CH=CHC6H5 C14H18O2 FW 218. Kosher. NI trans-Cinnamyl butyrate [78761‑39‑4] CH3CH2CH2CO2CH2CH=CHC6H5 C13H16O2 FW 204.18 Fen. 312 Arc. 314  ≥97% FEMA 2301 CoE Nr 414  ≥95% FEMA 2298 Flavis 9. Fen. 626.32 Arc. woody. Fen.23 Organoleptic: lemon Arc. honey.26 Cinnamomum zeylanicum 3-Phenyl-2-propen-1-ol [8015‑91‑6] [104‑54‑1] C6H5CH=CHCH2OH C9H10O FW 134. 307 Arc.29 Arc. 3. spicy.24 Arc. floral.017 CoE Nr 65 Organoleptic: cinnamon Kosher Sri Lanka origin Organoleptic: balsam. 311  ≥92%. 306. floral.6-octadienal Cinnamyl formate [104‑65‑4] HCO2CH2CH=CHC6H5 C10H10O2 FW 162. 649. balsam. nutty. FCC  ≥96%. cinnamon. carnation.21 Arc.19 Arc.

078 CoE Nr 345 W230812-SAMPLE-K W230812-20KG-K 10 kg 1 kg W231118-9KG-K  FCC 8 kg W230618-25KG-K W231118-SAMPLE-K Arc. Fen. Fen. NI W231401-SAMPLE-K W231401-1KG-K 1 kg W231401-4KG-K 4 kg W231401-9KG-K 9 kg Citronellyl isobutyrate [97‑89‑2] (CH3)2CHCO2CH2CH2CH(CH3)CH2CH2CH =C(CH3)2 C14H26O2 FW 226. Cymbopogon winterianus Organoleptic: lemon Kosher Indonesia origin [7549‑37‑3] (CH3)2C=CHCH2CH2C(CH3)= CHCH(OCH3)2 C12H22O2 FW 198. 330  ≥90%. 122 FEMA 2305 Flavis 6.129 C2H5CO2CH2CH2CH(CH3)CH2CH2CH=C(CH3)2 C13H24O2 FW 212.Citronellylprop  natural. citrus.011 CoE Nr 59 W231304-1KG-K 1 kg W231304-4KG-K 4 kg W231304-9KG-K 9 kg Organoleptic: geranium. Fen. 651.421 CoE Nr 296 Arc. 671.7-Dimethyl-6-octenoic acid Page 39 CoE Nr 110 Organoleptic: cherry.004 CoE Nr 38 Organoleptic: oily. 321 Citral dimethyl acetal  ≥99% W230901-1KG-K 1 kg W230901-4KG-K 4 kg W230901-9KG-K 9 kg > L-Citronellol.33 Organoleptic: fruity. Cymbopogon winterianus W230502-100G-K 25 g W509205-100G  FCC Citronella oil. Java Page 29 (±)-Citronellal (±)-3. FCC W231304-SAMPLE-K FEMA 2309 Flavis 2.com W231606-1KG-K 1 kg W231606-4KG-K 4 kg W231606-9KG-K 9 kg 29 . 327 4 kg W230618-10KG-K Organoleptic: lemon. 669. β-Rhodinol Organoleptic: lemon. 691. 657.25 Arc. Fen. FCC [106‑22‑9] (CH3)2C=CHCH2CH2CH(CH3)CH2CH2OH C10H20O FW 156.12 Arc. citrus. see 3. honey.30 mixture of cis and trans Arc. ≥85%.5%. 323 Organoleptic: fruity. 318  ≥99. rose Kosher.012 CoE Nr 202 W230804-1KG-K Citronella grass oil. rose Arc.30 FEMA 2308 3. 321 Arc. plum. see Sodium citrate dihydrate Page 119 Citronella grass oil. NI W230901-SAMPLE-K  ≥80% 9 kg W231118-20KG-K FEMA 2314 Flavis 9. FCC Citral diethyl acetal (S)-(−)-β-Citronellol CoE Nr 110c [7492‑66‑2] C14H26O2 FW 226.36 Arc. Fen. 683. 325 W230804-SAMPLE-K  ≥95% W509205-SAMPLE [150‑84‑5] CH3CO2CH2CH2CH(CH3)CH2CH2CH= C(CH3)2 C12H22O2 FW 198. lemon. Chinese 85/35 Citronella grass oil. see Citronella oil. rose Kosher. 85/35% Organoleptic: lemon Indonesia origin origin W230812-1KG-K 1 kg 20 kg W230618-SAMPLE-K  Certified organic (NOP/EU) 25 kg > Citric acid trisodium salt dihydrate. 652.005 CoE Nr 39 Organoleptic: lemon Halal. Kosher W230405-SAMPLE-K W230405-100G-K 100 g W230405-1KG-K 1 kg W230405-4KG-K 4 kg W230715-1KG 1 kg W230715-4KG 4 kg W230715-8KG 8 kg Citronella oil. rose. green Halal. Fen. 317  ≥93% [7540‑51‑4] (CH3)2C= CHCH2CH2CH(CH3)CH2CH2OH C10H20O FW 156. rose Kosher  ≥95%. FCC CoE Nr 410 Kosher. citrus.7-Dimethyl-6-octen-1-ol. Chinese 85/35 Page 29 Citronella oil. Java W230502-SAMPLE-K W509205-25G Arc. Fen.28 W230812-4KG-K W230618-1KG-K W509205-1KG W231118-1KG-K Kosher NI FEMA 2306 CoE Nr 20c 100 g FEMA 2311 Flavis 9. 328 Citronellol  ≥92%.021 (CH3)2C= CHCH2CH2CH(CH3)CH2CHO C10H18O FW 154. Fen. sweet Kosher W230707-SAMPLE-K W230707-1KG-K 1 kg W230707-4KG-K 4 kg W230707-8KG-K 8 kg 20 kg Organoleptic: apricot.27 FEMA 2313 Flavis 9. NI W231606-SAMPLE-K Feel inspired at safcglobal. green Fen. Kosher 100 g W230502-1KG-K 1 kg W230502-4KG-K 4 kg Citric acid [77‑92‑9] HOC(COOH)(CH2COOH)2 C6H8O7 FW 192. green.6-octadienal dimethyl acetal Flavis 2. rose Kosher Citronellyl formate W230812-8KG-K 1 kg 1 kg [105‑85‑1] HCO2CH2CH2CH(CH3)CH2CH2CH= C(CH3)2 C11H20O2 FW 184. Fen.36 (S)-3.27 W230715-SAMPLE FEMA 2304 Flavis 6. see Rhodinol Page 117 Citronellyl propionate [141‑14‑0] FEMA 2316 Flavis 9. 675.7-Dimethyl-6-octenal [106‑23‑0] FEMA 2307 Flavis 5. 658. 321  natural. FCC 1 kg W230804-4KG-K 4 kg [8000‑29‑1] FEMA 2308 Kosher Fen. peach.229 Citronellyl acetate [8000‑29‑1] Fen. 321 8 W230840-SAMPLE-K W230840-1KG-K 1 kg > Citronellic acid.7-Dimethyl-2.

SAFC® Flavors & Fragrances
Citronellylprop
 natural (US), ≥80%

 Certified organic (NOP/EU)

W231614-SAMPLE
W231614-25G

25 g

W231614-100G

100 g

W231614-1KG

1 kg

Citronellyl tiglate, mixture of isomers
[255714‑11‑5] CH3CH=
C(CH3)CO2CH2CH2CH(CH3)CH2CH2CH=C(CH3)2
C15H26O2 FW 238.37

Arc. 693

Fen. 351

W232314-1KG-K

1 kg

> Clove oil, see Clove bud oil Page 30
Coconut fat, see Coconut oil Page 30

Coconut oil

8

Copra oil; Coconut fat; Coconut oil from Cocos
nucifera
[8001‑31‑8]

Philippines origin

Flavis 9.34

Organoleptic: fruity; rose
Kosher
contains 0.10% alpha-tocopherol, synthetic as antioxidant
W500607-SAMPLE-K
W500607-100G-K

100 g

W500607-1KG-K

1 kg

W500607-4KG-K

4 kg

Citronellyl valerate
[7540‑53‑6]
CH3(CH2)3CO2CH2CH2CH(CH3)CH2CH2CH=C(CH3)2
C15H28O2 FW 240.38

Arc. 694; Fen. 331

W530155-SAMPLE
W530155-5KG

5 kg

> Coconut oil from Cocos nucifera, see Coconut oil
Page 30

W233404-1KG-K

1 kg

W233404-4KG-K

4 kg

W233404-8KG-K

8 kg

W233404-20KG-K

20 kg

Cornmint oil

[8016‑21‑5]

from Vitis vinifera

W521701-SAMPLE-K

 white

W521701-1KG-K

1 kg

FEMA 2332

W521701-10KG-K

10 kg

Organoleptic: fruity; wine-like
France origin

 chinese type

Organoleptic: honey; herbaceous; rose
NI

W233218-1KG

1 kg

 green, natural

8

FEMA 2331

Organoleptic: wine-like

W231703-100G

100 g

W231703-1KG

1 kg

W233100-SAMPLE

W231703-4KG

4 kg

W233100-25G

25 g

W233100-250G

250 g

from Mentha arvensis
Organoleptic: minty; camphoraceous
China origin
W521604-SAMPLE-K
W521604-1KG-K

1 kg

W521604-10KG-K

10 kg

 Certified organic (NOP/EU)

8

> Commiphora Erythraea, see Opoponax oil Page 103
Commiphora molmol spp., see Myrrh oil Page 96
Conyrine, see 2-Propylpyridine Page 116

W421906-SAMPLE-K

FEMA 2322

from Eugenia caryophyllata
Kosher
Organoleptic: spicy
W232200-SAMPLE-K
W232200-100G-K

100 g

W232200-500G-K

500 g

 natural
FEMA 2336

from Copaifera, South American spp.
Kosher
Brazil origin

from Saussurea lappa Clarke
Organoleptic: violet
Kosher
France origin

W521809-SAMPLE-K

[8000‑34‑8] FEMA 2323

1 kg

W521809-10KG-K

10 kg

W233609-25G-K

25 g

25 kg

W233609-100G-K

100 g

W233609-1KG-K

1 kg

Coumarin

[9000‑12‑8]

Fen. 337

1,2-Benzopyrone; 1-Benzopyran-2-one; 2HChromen-2-one

from Copaifera, South American spp.
Kosher

 natural (US), FCC
Organoleptic: clove; woody; spicy
Halal, Kosher
Indonesia origin

[91‑64‑5] C9H6O2 FW 146.14

W521906-SAMPLE-K

W232300-SAMPLE-K
1 kg

W232300-5KG-K

5 kg

W232300-10KG-K

10 kg

W233609-SAMPLE-K

W521809-1KG-K

Copaiba balsam, bleached

Oil of cloves; Clove oil; Eugenia spp.

Costus oil

[8001‑61‑4]

W521809-25KG-K

Clove bud oil

1 kg

[8023‑88‑9]

Copaiba balsam oil

 natural, FG

8

India origin

W421906-1KG-K

[84961‑50‑2]

W232300-1KG-K

W233404-SAMPLE-K

from Mentha arvensis
Organoleptic: minty; camphoraceous
China origin

Grape seed oil

FEMA 2317 Flavis 9.151 CoE Nr 469

Clove bud extract

from Coriandrum sativum L.
Organoleptic: fruity; sweet
Kosher
Russia origin

 redistilled

100 g

> Citrus Aurantifolia Swingle, see Lime oil Page 75
Citrus lemon, see Lemon oil Page 75

FEMA 2334

Kosher

Cognac oil

W233218-100G

W231703-SAMPLE

 FCC

[68917‑18‑0] FEMA 4219

W233218-SAMPLE

 ≥85%

Coriander oil
[8008‑52‑4]

W232314-SAMPLE-K

 virgin, Certified organic (NOP/EU)

 ≥96%

30

8

Kosher
Madagascar origin

CoE Nr 410c

Arc. 704; Fen. 131

W521906-1KG-K

1 kg

W521906-10KG-K

10 kg

 ≥98%

W521906-25KG-K

25 kg

W504300

> Copra oil, see Coconut oil Page 30

Place an order with your local SAFC representative (see back for contacts).

> Coumarin, see Coumarin, Chinese Page 30

Cyclohexyldisul
Coumarin, Chinese

Cuminaldehyde

Cyclohexanecarboxylic acid

1,2-Benzopyrone; Coumarin; 1-Benzopyran-2-one;
2H-Chromen-2-one

4-Isopropylbenzaldehyde

Hexahydrobenzoic acid

[91‑64‑5] C9H6O2 FW 146.14

[122‑03‑2] (CH3)2CHC6H4CHO C10H12O FW 148.20

[98‑89‑5] C6H11CO2H C7H12O2 FW 128.17

Arc. 753; Fen. 363

 ≥98%

 ≥98%, FCC

FEMA 3531 Flavis 8.06 CoE Nr 11911

FEMA 2341 Flavis 5.022 CoE Nr 111

Organoleptic: fruity; fatty
Kosher, NI

Arc. 704; Fen. 131
from synthetic
China origin

Organoleptic: oily; woody
Halal, Kosher, NI

W526509-SAMPLE

W353108-SAMPLE-K

W526509-1KG

1 kg

W234109-SAMPLE-K

W353108-100G-K

100 g

W526509-5KG

5 kg

W234109-1KG-K

1 kg

W353108-1KG-K

1 kg

W526509-10KG

10 kg

W234109-5KG-K

5 kg

W353108-5KG-K

5 kg

W234109-10KG-K

10 kg

> Creosol, see 2-Methoxy-4-methylphenol Page 79

Cumin seed oil

o-Cresol

8

[8014‑13‑9]

2-Methylphenol

FEMA 3909 Flavis 7.148

FEMA 2343

 ≥99%

W390909-SAMPLE

from Cuminum cyminum
Kosher

FEMA 3480 Flavis 4.027 CoE Nr 618

Organoleptic: musty; medicinal
Kosher, NI

W234300-SAMPLE-K

W348007-SAMPLE-K
W348007-1KG-K

1 kg

W348007-10KG-K

10 kg

W348007-25KG-K

25 kg

W234300-100G-K

100 g

W234300-1KG-K

1 kg

β-Cyclocitral
2,6,6-Trimethyl-1-cyclohexene-1-carboxaldehyde
[432‑25‑7] C10H16O FW 152.23

m-Cresol
[108‑39‑4] CH3C6H4OH C7H8O FW 108.14

Arc. 707
FEMA 3530 Flavis 4.026 CoE Nr 617

W363928-SAMPLE-K

Organoleptic: woody; ethereal; medicinal
Halal, Kosher, NI
W353000-SAMPLE-K
W353000-1KG-K

1 kg

W353000-10KG-K

10 kg

W353000-25KG-K

25 kg

p-Cresol

25 g
100 g

W402826-SAMPLE

 ≥98%
FEMA 2337 Flavis 4.028 CoE Nr 619

Organoleptic: medicinal
Kosher, NI
W233706-1KG-K

1 kg

W233706-5KG-K

5 kg

W233706-10KG-K

10 kg

W233706-25KG-K

25 kg

> p-Cresyl acetate, see p-Tolyl acetate Page 124
Crocein Scarlet MOO, see Acid Red 73 Page 10
Cumic alcohol, see 4-Isopropylbenzyl alcohol Page 71

Cyclohexyl acetate
[622‑45‑7] CH3COOC6H11 C8H14O2 FW 142.20

W234907-1KG-K

1 kg

W234907-5KG-K

5 kg

W234907-10KG-K

10 kg

Cyclohexyl butyrate
[1551‑44‑6] CH3CH2CH2CO2C6H11 C10H18O2
FW 170.25

Arc. 784; Fen. 137

W402826-25G

25 g

W402826-100G

100 g

> Cyclodithalfarol-705, see 2,5-Dimethyl-2,5-dihydroxy-1,4dithiane Page 37
Cycloheptaamylose, see β-Cyclodextrin Page 31

W233706-SAMPLE-K

> Cyclohexapyrazine, see 5,6,7,8-Tetrahydroquinoxaline
Page 123

> Cyclohexylacetic acid, see Cyclohexaneacetic acid
Page 31

Cycloheptaamylose; Cyclomaltoheptaose; Schardinger β-Dextrin; Caraway

[106‑44‑5] CH3C6H4OH C7H8O FW 108.14

Arc. 708; Fen. 358

1 kg

β-Cyclodextrin

4-Methylphenol

25 kg

W234907-SAMPLE-K

W363928-100G-K

[7585‑39‑9] C42H70O35 FW 1134.98
FEMA 4028

W390909-25KG

Organoleptic: musty; fatty; fruity; sweet
Halal, Kosher

W363928-25G-K
W363928-1KG-K

10 kg

FEMA 2349 Flavis 9.027 CoE Nr 217

FEMA 3639 Flavis 5.121 CoE Nr 10326

 ≥98%

1 kg

W390909-10KG

 ≥98%, FG

 ≥90%, FG
Organoleptic: fruity; minty; green
Halal, Kosher, NI

W390909-1KG

Arc. 781; Fen. 136

Arc. 760

3-Methylphenol

[108‑94‑1] C6H10(=O) C6H10O FW 98.14

 99.8%

 natural, FG

[95‑48‑7] CH3C6H4OH C7H8O FW 108.14

Cyclohexanone

Cyclohexaneacetic acid
Cyclohexylacetic acid
[5292‑21‑7] C6H11CH2CO2H C8H14O2 FW 142.20

Arc. 772; Fen. 134

 ≥98%
FEMA 2351 Flavis 9.23 CoE Nr 2082

Organoleptic: apple; pineapple
Kosher
W235105-SAMPLE-K
W235105-1KG-K

1 kg

W235105-5KG-K

5 kg

W235105-10KG-K

10 kg

> Cyclohexyl disulfide, see Dicyclohexyl disulfide Page 34

 ≥98%
FEMA 2347 Flavis 8.034 CoE Nr 34

Organoleptic: jasmine
W234702-SAMPLE

Feel inspired at safcglobal.com

W234702-25G

25 g

W234702-100G

100 g

W234702-1KG

1 kg

31

SAFC® Flavors & Fragrances
Cyclohexylisova
Cyclohexyl isovalerate

> DBPC, see Butylated hydroxytoluene Page 21

p-Cymene

Cyclohexyl 3-methylbutanoate

1-Isopropyl-4-methylbenzene; 4-Isopropyltoluene

[7774‑44‑9] (CH3)2CHCH2CO2C6H11 C11H20O2
FW 184.28

[99‑87‑6] CH3C6H4CH(CH3)2 C10H14 FW 134.22

Arc. 808; Fen. 375

Arc. 819; Fen. 380

 ≥97%, FCC

 ≥98%

Arc. 820; Fen. 388

FEMA 2356 Flavis 1.002 CoE Nr 620

FEMA 2355 Flavis 9.464 CoE Nr 459

Organoleptic: fruity; green; sweet

Organoleptic: citrus
Kosher, NI

W235504-SAMPLE

W235601-SAMPLE-K

 FG
FEMA 3135 Flavis 5.14 CoE Nr 2120

W235504-1KG

1 kg

W235601-1KG-K

W235504-5KG

5 kg

W235601-8KG-K

8 kg

W235504-10KG

10 kg

W235601-20KG-K

20 kg

> Cyclohexyl 3-methylbutanoate, see Cyclohexyl isovalerate
Page 32

1 kg

Cypress oil

8

[8013‑86‑3]

Cyclohexyl propionate

 natural

 ≥99%

Typically used in citrus colognes, fougeres, chypres
and aldehydic-type fragrance applications
from Cupressus sempervirens
Kosher

FEMA 2354 Flavis 9.14 CoE Nr 421

W530362-SAMPLE-K

[6222‑35‑1] C2H5CO2C6H11 C9H16O2 FW 156.22

Arc. 805; Fen. 139

Organoleptic: banana; pineapple; sweet
Kosher
W235407-SAMPLE-K
W235407-1KG-K

1 kg

W235407-5KG-K

5 kg

W235407-10KG-K

10 kg

> Cyclomaltoheptaose, see β-Cyclodextrin Page 31

Cyclopentanethiol
Cyclopentyl mercaptan
[1679‑07‑8] C5H9SH C5H10S FW 102.20

W530362-500G-K

500 g

W530362-1KG-K

1 kg

L-Cysteine

(R)-2-Amino-3-mercaptopropionic acid

FEMA 3262 Flavis 12.029 CoE Nr 2321

Organoleptic: meaty; vegetable; alliaceous (onion,
garlic)
Kosher, NI
Fen. 378
W326208-SAMPLE-K
W326208-25G-K

25 g

W326208-100G-K

100 g

W326208-1KG-K

1 kg

Decahydro-2-naphthol
2-Decalol
[825‑51‑4] C10H17OH C10H18O FW 154.25

 mixture of isomers, 97%
W507105-SAMPLE
W507105-100G

100 g

W507105-1KG

1 kg

W507105-5KG

5 kg

 ≥98%, FCC, FG

NI

FEMA 2360 Flavis 10.017 CoE Nr 2230

W326305-100G

100 g

W326305-1KG

1 kg

W326305-5KG

5 kg

Damascenone
[23696‑85‑7] C13H18O FW 190.28

 natural, 1.1-1.3 wt. % (190 proof ethanol),
FG
FEMA 3420 Flavis 7.108

W342017-25G-K

25 g

1 kg

W342017-100G-K

100 g

W391018-5KG-K

5 kg

W342017-1KG-K

1 kg

W391018-10KG-K

10 kg

Davana oil

8

[8016‑03‑3]

 natural
FEMA 2359

from Artemisia pallens
Kosher
Organoleptic: sweet; fruity
W235900-SAMPLE-K

32

5 kg

[706‑14‑9] C10H18O2 FW 170.25

W391018-1KG-K

> Cyclotene, see Methyl cyclopentenolone Page 85
Cymbopogon winterianus, see Citronella oil, Chinese 85/35
Page 29
Citronella oil, Java Page 29

1 kg

W313505-5KG-K

FEMA 3263 Flavis 17.033

W342017-SAMPLE-K

W391018-SAMPLE-K

100 g

W313505-1KG-K

 ≥97%

Kosher

 ≥99%

W313505-100G-K

Fen. 381

FEMA 3910 Flavis 7.149

[120‑92‑3] C5H8(=O) C5H8O FW 84.12

W313505-SAMPLE-K

4-Hydroxydecanoic acid γ-lactone; γ-Decanolactone

Natural occurrence: Apple juice, apricot, black
currant, grape, raspberry, strawberry, cognac, rum,
whiskey and scotch.
Halal, Kosher
Organoleptic: apple; herbaceous; woody; nutty;
citrus; rose; wine-like; smoky

Cyclopentanone

Organoleptic: fatty; citrus; meaty
Halal, Kosher, NI
contains 0.50% alpha-tocopherol, synthetic as antioxidant

γ-Decalactone

[52‑90‑4] HSCH2CH(NH2)CO2H C3H7NO2S
FW 121.16

W326305-SAMPLE

 ≥97%

trans,trans-2,4-Decadienal
[25152‑84‑5] CH3(CH2)4CH=CHCH=CHCHO
C10H16O FW 152.23

W235900-25G-K

25 g

W235900-100G-K

100 g

Place an order with your local SAFC representative (see back for contacts).

Organoleptic: peach
Halal, Kosher, NI
Arc. 828; Fen. 390
W236004-SAMPLE-K
W236004-1KG-K

1 kg

W236004-5KG-K

5 kg

W236004-10KG-K

10 kg

(+)-γ-Decalactone
 natural, ≥97%, FG
FEMA 2360 Flavis 10.017 CoE Nr 2230c

Organoleptic: peach
Halal, Kosher
Arc. 828; Fen. 390
W236012-SAMPLE-K
W236012-25G-K

25 g

W236012-100G-K

100 g

W236012-250G-K

250 g

W236012-1KG-K

1 kg

Fen. see Decahydro-2-naphthol Page 32 25 g W396605-100G-K W236608-SAMPLE-K W236411-SAMPLE-K 25 g W396605-25G-K  ≥92%. FCC Decanal 100 g Fen. citrus. 2146  natural. cassava. creamy. orange. FG Natural Occurrence: Sherry. white wine. Halal. FCC Natural occurrence: Sherry.33 Arc. NI contains 0. sweet Kosher FEMA 4271 Flavis 7. (±)-6-Pentyltetrahydro-2H-pyran-2-one.25 8 Methyl octyl ketone [693‑54‑9] CH3(CH2)7COCH3 C10H20O FW 156. citrus Halal. fatty.15 W366005-SAMPLE-K W236217-SAMPLE-K W427100-1KG Arc. meaty Kosher. FCC. peach. 842 [5579‑78‑2] C10H18O2 FW 170.25  ≥98%  ≥97% FEMA 2363 Flavis 6. 829. 393  ≥95%. coconut. floral. NI [112‑31‑2] FEMA 2362 Flavis 5.50% alpha-tocopherol. 403  ≥90%. Kosher 100 g Organoleptic: orange. citrus. fruity. rose Halal. peach. Kosher. NI 1 kg W236403-5KG-K 5 kg W236403-10KG-K 10 kg W236403-25KG-K 25 kg  ≥99% W236411-1KG-K FEMA 3613 Flavis 10. (±)-δ-Pentyl-δ-valerolactone. green NI Arc. FG FEMA 3660 Flavis 8. sweet Kosher. 833. 399 n-Decyl alcohol. Kosher. mango. citrus. see δ-Decalactone Page 33 W236209-SAMPLE-K W396605-1KG-K Organoleptic: orange Kosher.007 CoE Nr 621 C10H18O2 FW 170. see Ethyl trans-2decenoate Page 44 33 . 394 [928‑80‑3] Flavis 7. floral. see δ-Decalactone Page 33 (±)-5-Decanolide. waxy.27 [705‑86‑2] FEMA 2361 Flavis 10. δ-Decanolactone [7779‑41‑1] CH3(CH2)8CH(OCH3)2 C12H26O2 FW 202. Acid C10 [334‑48‑5] FEMA 2364 Flavis 8. Fen. floral. cassava. Kosher. Organoleptic: butter. 395 Arc. white wine. Alcohol C10 Arc. fatty Kosher Arc. waxy. FCC W236403-1KG-K Halal.01 CH3(CH2)8CHO C10H20O FW 156. 391  ≥98%. FCC FEMA 3264 Flavis 5. FCC CoE Nr 98 Organoleptic: waxy.065 CoE Nr 10090  ≥98% Halal. citrus. coconut. loganberry and fresh plum. fatty.28 FEMA 2365 Flavis 2.25  ≥90%.029 W236411-5KG-K 5 kg W361305-SAMPLE W236411-10KG-K 10 kg 1 kg 1g W361305-1KG 1 kg 1-Decanol [112‑30‑1] CH3(CH2)9OH C10H22O FW 158. ≥98%. Fen. 835. FCC. wine-like Kosher Organoleptic: floral.151 CH3(CH2)6COC2H5 C10H20O FW 156. NI contains 0. ≥92% CoE Nr 98c W427100-SAMPLE W236217-25G-K 25 g W236217-100G-K 100 g W236217-1KG-K 1 kg Feel inspired at safcglobal. NI W236101-SAMPLE-K W236101-1KG-K 1 kg W236101-5KG-K 5 kg W236101-10KG-K 10 kg  natural. butter.024 CoE Nr 73 Caprinaldehyde.011 CoE Nr 11 CH3(CH2)8COOH C10H20O2 FW 172. Kosher.191 CoE Nr 2009 Organoleptic: oily.10% alpha-tocopherol. green. mango. wine-like W236306-SAMPLE-K W236306-100G-K 100 g W236306-1KG-K 1 kg W236306-4KG-K 4 kg 25 g W236128-100G-K 100 g W236128-1KG-K 1 kg ε-Decalactone Capric acid.27 Fen. Fen. sweet. 841. 840 Organoleptic: fatty. 396 > 2-Decalol. NI W236209-1KG-K 1 kg W236209-8KG-K 8 kg W236209-20KG-K 20 kg 1 kg Flavis 5. Kosher Organoleptic: apricot. 5-Hydroxydecanoic acid δ-lactone. FG 7-Butyl-2-oxepanone W361305-25G  ≥97% trans-2-Decenal  natural. creamy. Decyl aldehyde Organoleptic: fatty. wine-like Halal. fruity. synthetic as antioxidant Organoleptic: floral. nutty.25 W361305-100G FEMA 3966 [3913‑81‑3] CH3(CH2)6CH=CHCHO C10H18O FW 154.Decenoicacideth Decanal dimethyl acetal δ-Decalactone 3-Decanone (±)-5-Decanolide. FG W361305-1G W503800 W396605-SAMPLE-K Decanoic acid W236403-SAMPLE-K W236128-SAMPLE-K W236128-25G-K Ethyl heptyl ketone 2-Decanone 9-Decenoic acid [14436‑32‑9] H2C=CH(CH2)7CO2H C10H18O2 FW 170. herbaceous. synthetic as antioxidant  ≥98%.137 CoE Nr 2297 W326402-SAMPLE-K W326402-25G-K 25 g 1 kg W326402-100G-K 100 g W236500-8KG-K 8 kg W326402-1KG-K 1 kg W236500-20KG-K 20 kg W236500-1KG-K > γ-Decanolactone.25  ≥98%. 398 W236608-200G-K 200 g W236608-1KG-K 1 kg W236608-4KG-K 4 kg cis-4-Decenal [21662‑09‑9] CH3(CH2)4CH=CHCH2CH2CHO C10H18O FW 154. fatty. loganberry and fresh plum. plum.com 1 kg W366005-25G-K 25 g W366005-100G-K 100 g W366005-1KG-K 1 kg > trans-2-Decenoic acid ethyl ester.26 Fen. NI Fen. see γ-Decalactone Page 32 δ-Decanolactone.009 CoE Nr 43 Organoleptic: orange. sweet. FCC.27 W236500-SAMPLE-K Arc. plum. fruity. ≥98%. floral. green.

Organoleptic: jasmine. see Piperazine Page 112 Dibenzyl disulfide. 406  ≥95% FEMA 2367 Flavis 9. see LOrnithine hydrochloride Page 103 Diamyl ketone. fatty. see L-Lysine Page 76 (S)-2. see 1-Decanol Page 33 Decyl aldehyde. see Butylated hydroxytoluene Page 21 2.136  97% Organoleptic: cheese.6-Diaminocaproic acid. Fen. rose Kosher. see Di(ethylene glycol) ethyl ether Page 34 Diethyl ketone. meaty.E. see Allyl disulfide Page 11 Diallyl sulfide.6-Di-tert-butyl-p-cresol. cucumber.3-Diphenyl-2-propanone Page 40 2. see Acetal Page 8 Diethylacetic acid.18 Arc. 848.012 W409301-SAMPLE W236802-SAMPLE-K W236802-1KG-K 1 kg W236802-4KG-K 4 kg W236802-9KG-K 9 kg [5454‑19‑3] C2H5CO2(CH2)9CH3 C13H26O2 FW 214.5-Diaminopentanoic acid monohydrochloride. synthetic as antioxidant W353205-SAMPLE-K W353205-100G-K 100 g W353205-1KG-K 1 kg W353205-4KG-K 4 kg n-Decyl acetate Capryl acetate [112‑17‑4] CH3CO2(CH2)9CH3 C12H24O2 FW 200.009 CoE Nr 199  ≥99% > Diethylene glycol monoethyl ether.127 CoE Nr 408 [111‑90‑0] C2H5OCH2CH2OCH2CH2OH C6H14O3 FW 134. fat replacers and lard.27 [5454‑09‑1] CH3CH2CH2CO2(CH2)9CH3 C14H28O2 FW 228. peach.5% FEMA 4093 Flavis 12. 909  ≥96% Flavis 9.34 W430400-SAMPLE Arc. Diethylene glycol monoethyl ether. fruity. citrus NI W505005-SAMPLE Dicyclohexyl disulfide W505005-1KG 1 kg Organoleptic: orange. earthy FEMA 2368 Flavis 9. dairy flavors such as milks creams and cheeses. Possible application (Flavor): Apricot. Fen. .R. USed in mandarin. see LOrnithine hydrochloride Page 103 (S)-(+)-2. 407 FEMA 3824 Flavis 2. see 2-Ethylbutyric acid Page 44 Decyl butyrate [51100‑54‑0] CH3(CH2)6CH(OH)CH=CH2 C10H20O FW 156.028 CoE Nr 2320 Organoleptic: berry. 904 W236918-SAMPLE 1 kg 3-Decen-2-one [10519‑33‑2] CH3(CH2)5CH=CHCOCH3 C10H18O FW 154. see Neohesperidin dihydrochalcone Page 96 D. ≥97% Natural occurrence: Mushrooms.121 CoE Nr 11751 [25395‑31‑7] (CH3COOCH2)2CHOH C7H12O5 FW 176.25  ≥98. 408 8 1 kg W409301-5KG 5 kg CARBITOL®.17 [57074‑37‑0] CH3(CH2)4CH=CH(CH2)3OH C10H20O FW 156. 851.27  97% [110‑81‑6] (C2H5)2S2 C4H10S2 FW 122.1-Diethoxyethane. green. pineapple.25 Arc. see Butyl sulfide Page 23 FEMA 2374 CoE Nr 382 Organoleptic: fruity Halal. see L-Glutamine Page 56 (S)-2. tangerine. see Benzyl disulfide Page 18 Dibenzyl ether. see 3-Pentanone Page 105 Diethyl malate Glycerol diacetate FEMA 3532 Flavis 7. fruity. Ethyldiglycol.047 CoE Nr 273 W382418-SAMPLE Organoleptic: waxy. 419  ≥97% W500615-SAMPLE W500615-1KG 1 kg W500615-10KG 10 kg W500615-25KG 25 kg > Diallyl disulfide.27 Organoleptic: ethereal. see Bisphenol A diglycidyl ether Page 20 Diacetin  predominantly trans. see Decanal Page 33 34 100 g W409301-1KG Di(ethylene glycol) ethyl ether  ≥96% cis-4-Decen-1-ol W409301-100G > Diethylenediamine. 404 > 1-(4-((2-O-[6-Deoxy-α-L-mannopyranosyl]-β-D-glucopyranosyl)oxy)-2. citrus Kosher W382418-25G 25 g W382418-100G 100 g W382418-1KG 1 kg trans-2-Decen-1-ol 8 [18409‑18‑2] CH3(CH2)6CH=CHCH2OH C10H20O FW 156. green. NI Cyclohexyl disulfide W505005-5KG 5 kg W236705-SAMPLE-K [2550‑40‑5] (C6H11S-)2 C12H22S2 FW 230. see 6-Undecanone Page 128 1. garlic) W344818-SAMPLE W344818-25G 25 g W344818-100G 100 g W344818-1KG 1 kg Place an order with your local SAFC representative (see back for contacts). citrus. Fen. see Butylated hydroxytoluene Page 21 Dibutyl sulfide. see Benzyl ether Page 18 Dibenzyl ketone. pear. 908. see 1. grapefruit and other citrus flavors. alliaceous (onion. 2(2-Ethoxyethoxy)ethanol. waxy. earthy.SAFC® Flavors & Fragrances Decenol 1-Decen-3-ol > 1.4-Diazacyclohexane.™ 332.19 Arc.17 Organoleptic: ethereal [7554‑12‑3] C2H5O2CCH2CH(OH)CO2C2H5 C8H14O5 FW 190. waxy. Fatty notes in chicken. watermelon. NI contains 0.6-Di-tert-butyl-4-methylphenol. 1546.6-dihydroxyphenyl)-3-[3-hydroxy-4-methoxyphenyl]-1-propanone. vegetable Kosher. Fen. Diethylene glycol ethyl ether FEMA 2369 Flavis 9.351 Organoleptic: banana.10% alpha-tocopherol. wine-like  97% W236918-100G 100 g FEMA 4349 W236918-1KG 1 kg W509043-SAMPLE W434900-SAMPLE W236918-4KG 4 kg W509043-1KG 1 kg W509043-10KG 10 kg W509043-25KG 25 kg W434900-1KG Arc.5-Diaminopentanoic acid hydrochloride. 864.32 Arc. NI W237418-SAMPLE W237418-100G 100 g W237418-1KG 1 kg W237418-5KG 5 kg Diethyl maleate Maleic acid diethyl ester [141‑05‑9] C2H5OCOCH=CHCOOC2H5 C8H12O4 FW 172. pear. musty.37  ≥98% Arc.43 W505005-10KG 10 kg W236705-1KG-K 1 kg W236705-4KG-K 4 kg W236705-9KG-K 9 kg > n-Decyl alcohol. and tropical fruits. vegetable. Fen.5-Diamino-5-oxopentanoic acid. see Piperazine Page 112 Decyl propionate FEMA 4304 Diethyl disulfide Ethyl disulfide  ≥94% FEMA 3448 Flavis 12. see Allyl sulfide Page 12 (S)-2. fatty.

432 [352‑93‑2] (C2H5)2S C4H10S FW 90.131 CoE Nr 11060 > (+)-Diethyl L-tartrate. Benzodihydropyrone  ≥99%. 424 W237604-1KG-K 1 kg W362603-5KG FEMA 3763 Flavis 7.31 Organoleptic: fruity.26 W376302-SAMPLE-K W237604-SAMPLE-K W237604-10KG-K 5 kg Organoleptic: green. earthy Kosher. 934. floral.4-Dihydro-1-benzopyran-2-one. 425 Arc.3-Diethylpyrazine [15707‑24‑1] C8H12N2 FW 136. wine-like Kosher.24 (+)-Diethyl L-tartrate. NI W313602-SAMPLE-K W313602-25G-K 25 g W313602-100G-K 100 g W313602-1KG-K 1 kg D-Dihydrocarvone. FCC W356506-SAMPLE-K FEMA 2376 Flavis 9. FCC. see Diethyl L-tartrate Page 35 Difurfuryl disulfide.16 Ethyl sulfide FEMA 3336 Flavis 14. FCC.2′-(Thiodimethylene)difuran Page 123 Dihydroanethole. Kosher. 436 W237809-5KG-K 5 kg W362603-SAMPLE 2. quince Halal.446 CoE Nr 440 [17283‑81‑7] C13H22O FW 194. grape.3-Dihydro-5. vegetable. L-(+)-Tartaric acid diethyl ester  ≥99% [87‑91‑2] [-CH(OH)CO2C2H5]2 C8H14O6 FW 206.17  mixture of isomers. vanilla Halal. Organoleptic: almond. NI Fen. chocolate.009 CoE Nr 535 Natural occurrence: Sweet clover and deertongue. NI [119‑84‑6] C9H8O2 FW 148.5% W237809-SAMPLE-K W517909-SAMPLE W237809-100G-K 100 g W237809-1KG-K 1 kg Organoleptic: woody Fen. earthy W237507-25KG 25 kg W237701-SAMPLE-K Organoleptic: fruity Halal. coconut. see L-Dihydrocarvyl acetate Page 35 W376302-100G-K 100 g W376302-1KG-K 1 kg W376302-5KG-K 5 kg > 4. see Dihydrocoumarin Page 35 Fen. 914. mixture of isomers  ≥98%.Dihydromethylfu Diethyl malonate Diethyl succinate L-Dihydrocarvyl acetate [123‑25‑1] C2H5OCOCH2CH2COOC2H5 C8H14O4 FW 174.3-Diethyl-5-methylpyrazine [18138‑04‑0] C9H14N2 FW 150. waxy. 422 W237701-1KG-K W237701-5KG-K 5 kg W237701-10KG-K 10 kg W237701-25KG-K 25 kg W238007-100G-K 100 g W238007-1KG-K 1 kg W238007-5KG-K 5 kg Dihydrocoumarin 3.128 CoE Nr 4001 Sebacic acid diethyl ester W362603-100G Arc. Halal. wine-like. 159  ≥98% FEMA 3136 Flavis 14. Fen. Fen. meaty. 426 W512206-SAMPLE W512206-1KG 1 kg W512206-10KG 10 kg W512206-25KG 25 kg W238104-SAMPLE-K > (±)-2. see 2-Methyltetrahydrofuran-3-one Page 93 4. fruity.19 Organoleptic: hazelnut. Fen. see 3-Methyl-3-pentanol Page 91 2. minty Kosher NI Arc. NI Organoleptic: medicinal. NI  98% FEMA 3869 Flavis 12. ≥95% FEMA 2377 Flavis 9. FG Malonic acid diethyl ester [105‑53‑3] CH2(COOC2H5)2 C7H12O4 FW 160. 915. 928. 927.2′-(Dithiodimethylene)difuran Page 41 Difurfuryl monosulfide.35 100 g W362603-1KG  ≥98% [7764‑50‑3] C10H16O FW 152.056 CoE Nr 11303 FEMA 2380 Flavis 9. nutty. FCC Diethyl sebacate 1 kg > (−)-Dihydrocarvyl acetate. 910. brandy. Kosher W356506-1KG-K 1 kg W356506-5KG-K 5 kg 1 kg 10 kg W237604-25KG-K 25 kg Feel inspired at safcglobal.5-Dihydro-2-methyl-3(2H)-furanone.29 W333603-100G-K 100 g W382501-SAMPLE W333603-250G-K 250 g W382501-100G 100 g W333603-1KG-K 1 kg W382501-1KG 1 kg W238104-1KG-K W382501-4KG 4 kg W238104-5KG-K 5 kg W238104-10KG-K 10 kg Diethyl phthalate Diethyl L-tartrate [84‑66‑2] C6H4-1. tobacco Halal. 1260 Arc. minty. peach. musty. apricot. see (±)-γ-Valerolactone Page 128 35 . 1080 [110‑40‑7] C2H5OCO(CH2)8COOC2H5 C14H26O4 FW 258.2-(CO2C2H5)2 C12H14O4 FW 222. Fen.23 FEMA 3565 Flavis 7.444 CoE Nr 438 FEMA 2375 Flavis 9. herbaceous.005 CoE Nr 534 Organoleptic: hazelnut.com Dihydrojasmone 3-Methyl-2-pentyl-2-cyclopenten-1-one [1128‑08‑1] CH3(CH2)4C5H4(CH3)(=O) C11H18O FW 166. cranberry. see 2.19 Arc. Hydrocoumarin. cocoa.5-Dihydro-5-methyl-2(3H)-furanone. 431  ≥98%  ≥99%.475 CoE Nr 623 W356506-100G-K 100 g Organoleptic: melon. 166  ≥90%  ≥99. floral. grape. see Naringenin Page 96 Dihydroeugenol. Kosher. whiskey and wine. 420 Arc.7-dihydroxy-2-(4-hydroxyphenyl)-4H-1benzopyran-4-one. winelike. 954 p-Menth-8-en-2-one  ≥97%. FG FEMA 2381 Flavis 13. see 2. 916.216 CoE Nr 2064 1 kg Diethyl sulfide  ≥97% [20777‑49‑5] C12H20O2 FW 196. Fen. Kosher.22 Fen. see p-Propyl anisole Page 113 3. sweet. meaty Kosher. NI W237507-SAMPLE > Diethyl methyl carbinol. Fen. vanilla. see 2-Methoxy-4-propylphenol Page 81 Dihydro-β-ionone  ≥99% FEMA 2378 Flavis 9. fruity Kosher Fen. creamy.113 W333603-SAMPLE-K W238007-SAMPLE-K Arc. Fen.4-Dihydro-1-benzopyran-2-one.19 FEMA 3626 Flavis 7.19 (−)-Dihydrocarvyl acetate Arc.14 Organoleptic: herbaceous. pear.49 CoE Nr 2106 W237507-1KG 1 kg W237507-10KG 10 kg Natural Occurrence: Apple. NI Organoleptic: apple.

5-Dihydroxy-1. Fen.5-dimethyl-1. see 1. 1719.4-Dimethoxybenzene Dimethylhydroquinone.008 W379905-SAMPLE W382604-100G Fen. 441 [151‑10‑0] C6H4(OCH3)2 C8H10O2 FW 138. Tetrahydrothiophen-3-one 1.3-Dihydroxypropyloxy)phenyl]-2-[4-(glycidyloxy) phenyl]propane.016 CoE Nr 189 Dillweed oil 4. Kosher Organoleptic: floral.144 Arc. ≥97% 1.1-Dimethoxyoctane  97% FEMA 2798 Flavis 6.6-Dimercaptohexane.27  ≥99% Flavis 2. 448  ≥98%. see Bisphenol A (2.5-dihydroxy-1.012 CoE Nr 2337 Arc.015 CoE Nr 510 W342602-100G 100 g W342602-1KG 1 kg W342602-4KG 4 kg 1.7-Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4chromanone. see 2.4-dithiane Page 37 2.15 Dimethylresorcinol.24 Arc. Kosher 2. sweet NI W379808-SAMPLE-K 1 kg W510424-SAMPLE W379808-5KG-K 5 kg W510424-25G 25 g W379808-10KG-K 10 kg W510424-100G 100 g W510424-1KG 1 kg DL-2.8-Octanedithiol Page 100 1. see 1.16  mixture of isomers. 2. see Veratraldehyde Page 129 Pyrocatechol dimethyl ether.4-Dimethoxybenzaldehyde.20 Arc. Propofol Anethum graveolens 3-Thiophanone. alliaceous (onion.3-dihydroxypropyl) glycidyl ether Page 20 Diisobutyl ketone. Kosher.4-Dihydroxybenzoic acid 1 kg W238503-5KG-K Arc. see Safranal Page 118  ≥98%.5-Dihydro-3(2H)-thiophenone 36 > (2S)-5. 170 W238503-1KG-K W505102-SAMPLE Fen.028 [91‑16‑7] C6H4(OCH3)2 C8H10O2 FW 138.4-Butanedithiol Page 20 1.076 1 kg W238600-5KG-K NI 3′.4′-Dimethoxyacetophenone  ≥97% 1.3-Dimercaptopropane. see Saccharin hemicalcium salt Page 117 (±)-Dihydro-5-propyl-2(3H)-furanone. garlic) Organoleptic: spicy Kosher Hungary origin W326607-SAMPLE-K W238309-SAMPLE-K W238600-SAMPLE-K W238600-1KG-K W238309-1KG-K W238309-5KG-K 5 kg W326607-250G-K 250 g W238309-10KG-K 10 kg W326607-1KG-K 1 kg 1 kg > 1.28 Organoleptic: creamy.3-Dihydro-2. see DL-Tartaric acid Page 121 2.6-trimethylbenzaldehyde. earthy Halal.3-Propanedithiol Page 112  ≥98% Halal. meaty. Fen.6-Bis(isopropyl)phenol.3-Dimethoxybenzene FEMA 2385 Flavis 4. FG  FCC Halal.5-Dimethyl2. see 2.4-Dimercaptobutane.SAFC® Flavors & Fragrances Dihydromyrcenol Dihydromyrcenol [18479‑58‑8] H2C=CHCH(CH3)(CH2)3C(CH3)2OH C10H20O FW 156.12 FEMA 2542 Flavis 6. Dimethyl acetal  ≥97.8-Dimercaptooctane. see 1. see γ-Dodecalactone Page 41 2. Mercaptoacetaldehyde dimer 10 kg > (2.2-Dimethoxyethyl)benzene.9-Nonanedithiol Page 98 1.6-Hexanedithiol Page 60 1. NI 25 g [89‑86‑1] (HO)2C6H3CO2H C7H6O4 FW 154. 170 W326607-25G-K > 2. see γ-Heptalactone Page 57 [2078‑54‑8] [(CH3)2CH]2C6H3OH C12H18O FW 178. see 1. 964 2. see Hesperetin Page 59 Hesperetin Page 59 2-[4-(2.2. sulfurous NI 100 g W382604-1KG 1 kg W382604-5KG 5 kg W379905-1KG  ≥97% FEMA 3426 Flavis 6. 2796.27 W505102-25G 25 g W505102-100G 100 g W505102-1KG 1 kg Fen.12 10 kg FEMA 2386 Flavis 4.5-Dihydroxy-2. see 1.6-Dimethyl-4-heptanone Page 38 1 kg W379905-5KG 5 kg W379905-10KG 10 kg Place an order with your local SAFC representative (see back for contacts).1-Dimethoxyheptane Heptanal dimethyl acetal [10032‑05‑0] CH3(CH2)5CH(OCH3)2 C9H20O2 FW 160. 978 FEMA 3798 Flavis 8. 170 [10022‑28‑3] H3C(CH2)6CH(OCH3)2 C10H22O2 FW 174.4-Dithiane-2.3-Dihydroxybutanedioic acid.4-dithiane.062 CoE Nr 10320 Organoleptic: meaty.034 CoE Nr 2059 100 g β-Resorcylic acid 5 kg W238503-10KG-K  99% W326607-100G-K 2. Veratrole [40018‑26‑6] C4H8O2S2 FW 152. Resorcinol dimethyl ether Organoleptic: coconut. hazelnut.16 FEMA 2383 FEMA 3266 Flavis 15.1-Dimethoxyethane Acetaldehyde dimethyl acetal. vanilla W382604-SAMPLE [534‑15‑6] CH3CH(OCH3)2 C4H10O2 FW 90.5-Dihydroxy-1.25 W254201-100G 100 g W254201-1KG 1 kg 1. W279801 .4-dithiane. NI Organoleptic: butter.6-Diisopropylphenol W516406-SAMPLE W516406-1KG 1 kg W516406-4KG 4 kg W516406-8KG 8 kg > (±)-Dihydro-5-octyl-2(3H)-furanone. see Phenylacetaldehyde dimethyl acetal Page 108 W379808-1KG-K > 5 kg W238600-10KG-K W342602-SAMPLE [1131‑62‑0] (CH3O)2C6H3COCH3 C10H12O3 FW 180. 3078  ≥99% FEMA 3826 FEMA 3799 Flavis 4. fatty Kosher.3-Dihydro-3-oxobenzisosulfonazole.16 W238503-SAMPLE-K  ≥97% [8006‑75‑5] [1003‑04‑9] C4H6OS FW 102. woody.9-Dimercaptononane. FG [150‑78‑7] C6H4(OCH3)2 C8H10O2 FW 138. Hydroquinone dimethyl ether Organoleptic: fennel.5-diol.5% 1.2-Dimethoxybenzene 1.4-dithiane > 3.

4-dithiane-2.3-Dimethylacrolein.5-Dimethyl-2. sweet NI Fen.1]hept-2-en-2-carboxaldehyde.1-Dimethylallyl alcohol. garlic). see 5-sec-Butyl-2.1. 2. 171 FEMA 3828 Flavis 4.781 2-(CH3NH)C6H4CO2CH3 C9H11NO2 FW 165. meaty Halal. 175 Kosher. FG W382809-SAMPLE FEMA 3137 Flavis 4. FG FEMA 3269 Flavis 7.1-Dimethoxyethane Page 36 [85‑91‑6] FEMA 2718 Flavis 9.04 > α. 176  ≥97%. see Methyl isoeugenol Page 88 3. see 3-Methyl-2-butenal Page 83 trans-2. cherry.11 Organoleptic: almond. see (−)-Myrtenyl acetate Page 96 2. NI W271802-100G-K 25 g W238708-100G-K 10 kg [13494‑06‑9] C7H10O2 FW 126. 173 25 g 100 g W238708-1KG-K 1 kg FEMA 3427 Flavis 5.6-Dimethylbicyclo[3. grape.3-Dimethylacrylic acid. 983.2-cyclopentadione W271810-25G-K  ≥96%  ≥97%  ≥97% W271810-SAMPLE-K 2′.5-dihydroxy-p-dithiane.6-Dimethylbicyclo[3.006 [55704‑78‑4] FEMA 3450 C6H12O2S2 FW 180. see (1R)-(−)-Myrtenal Page 96 (1R)-6.5-Dimethyl-2. Kosher.3-Dimethyl-5-sec-butylpyrazine.5dihydroxy-1. NI W313718-SAMPLE-K W313718-100G-K 100 g W313718-500G-K 500 g W313718-1KG-K 1 kg W313718-5KG-K 5 kg W313718-10KG-K 10 kg > 1.16  ≥97% Arc. spicy.18 W238708-SAMPLE-K  ≥90% Arc.1]hept-2-ene-2-methyl acetate. Fen. NI Fen.com 1 kg W513806-5KG 3. Cyclodithalfarol-705.15 100 g W238708-25G-K 5 kg W513806-10KG CoE Nr 2105 W271810-100G-K FEMA 2387 Flavis 7.15 [89‑74‑7] (CH3)2C6H3COCH3 C10H12O FW 148.082 Organoleptic: alliaceous (onion. 172 W271810-1KG-K 1 kg 2.23 Flavis 15. herbaceous Halal. Fen. orange Arc.3-Dimethylacrolein.2-Dimethoxy-4-propenylbenzene.19 [91‑10‑1] (CH3O)2C6H3OH C8H10O3 FW 154.4-dithiane W342718-SAMPLE 2.Dimethyldihydro 2. see 1.4-Dimethyl-1. 2106 Fen. 173 W342718-1KG 1 kg W326704-SAMPLE-K 2.5-diol.4-dithiane Page 37 37 . see trans-2-Methyl-2-butenoic acid Page 83 3. 1223 3.036 CoE Nr 2233 W382809-25G 25 g W382809-100G 100 g W382809-1KG 1 kg Organoleptic: smoky.4-Dimethoxystyrene Dimethyl anthranilate  technical grade FEMA 3138 Flavis 4.5-dihydroxy-1.023 CoE Nr 157 2. 987. woody.20 Arc. 2778. meaty Kosher Fen.1. see 3-Methyl-2-butenal Page 83 3.4-dithiane. Kosher.1-Dimethoxy-2-phenylpropane. meaty Kosher W345001-SAMPLE-K Organoleptic: sulfurous Halal.3-Dimethylacrylaldehyde.4′-Dimethylacetophenone [68039‑49‑6] (CH3)2C6H7CHO C9H14O FW 138.4-Dimethyl-5-acetylthiazole Organoleptic: anise.6-Dimethylbenzenethiol W326704-25G-K 25 g W326704-100G-K 100 g W326704-1KG-K 1 kg > trans-2.5-Dimethyl-2. Kosher Organoleptic: coffee. see 2-Phenylpropionaldehyde dimethyl acetal Page 110 1. 2.3dimethylpyrazine Page 22 Fen.6-Dimethylthiophenol  95% [118‑72‑9] (CH3)2C6H3SH C8H10S FW 138.076 CoE Nr 2234 Halal.3-dimethyl ether [6738‑23‑4] (CH3)2C6H3OCH3 C9H12O FW 136.29 2. sweet Kosher [15764‑16‑6] (CH3)2C6H3CHO C9H10O FW 134.011 CoE Nr 2336 W342718-100G 100 g Organoleptic: nutty.075 CoE Nr 2234 100 g W271802-1KG-K 1 kg W326801-SAMPLE-K W271802-5KG-K 5 kg W326801-25G-K 25 g W326801-100G-K 100 g W326801-1KG-K 1 kg CoE Nr 756c Kosher Fen.2-cyclopentadione [13494‑07‑0] C7H10O2 FW 126.063  ≥98%. see trans-2-Methyl-2-butenal Page 83 3. sweet NI W326909-SAMPLE-K W326909-25G-K 25 g W326909-100G-K 100 g W326909-1KG-K 1 kg 2.19 Organoleptic: blossom.3-dimethyl allyl acetate.5-Dimethyl-1. 463  ≥95% FEMA 3666 Flavis 12. Kosher NI W366609-SAMPLE-K W366609-25G-K 25 g W366609-100G-K 100 g W366609-1KG-K 1 kg W345001-25G-K 25 g W345001-100G-K 100 g W345001-1KG-K 1 kg > 2. Fen. see 2. see 2-Methyl-3-buten-2-ol Page 83 3.6-Dimethoxyphenol 2. ≥98% W313801 2. see Benzaldehyde dimethyl acetal Page 16 Dimethyl acetal.4-Dimethyl-3-cyclohexenecarboxaldehyde W513806-SAMPLE W271802-SAMPLE-K [6380‑23‑0] (CH3O)2C6H3CH=CH2 C10H12O2 FW 164.5-dimethyl-1.4-Dimethylbenzaldehyde Organoleptic: floral.α-Dimethoxytoluene.4-Dimethylanisole Pyrogallol 1.5dihydroxy-p-dithiane W342718-25G 25 g FEMA 3267 Flavis 15.5Dimethyl-1. see 3-Methyl-2-buten-1-ol Page 83 Feel inspired at safcglobal.3-Dimethylallyl alcohol. 523  ≥97% FEMA 3268 Flavis 7.5-Dihydroxy-2.21 W513806-1KG Methyl N-methylanthranilate  natural. see Prenyl acetate Page 112 1.5-Dimethyl-2. 1-Mercaptopropanone (dimer).20 > (1R)-6.

see 1.03 CoE Nr 11834 Natural occurrence: Fenugreek seed. maple. fruity. 182  ≥97% FEMA 3664 Flavis 13. 179  ≥99% FEMA 3537 Flavis 7. peach. 480.24 Arc.5.5-diol.3-dimethylpyrazine Page 22 2.5-dihydrofuran-2-one solution 2. tobacco W353701-SAMPLE 100 g W366404-100G-K [28664‑35‑9] C6H8O3 FW 128.09 Organoleptic: citrus W366501-25G 25 g W366501-100G 100 g W366501-1KG 1 kg > (±)-2. mossy. watermelon. wine-like. nutty.5S)-6. see Valencene Page 128 2. see 5-Isobutyl-2. see 5-Isobutyl-2. Fen. maple.7-Dimethyl-2. wine-like. Sugar lactone 4.7-Dimethyl-2.3dimethylpyrazine Page 69 3.5-Dimethyl-3-hydroxy-2.3-Dimethyl-5-(1-methylpropyl)pyrazine.6-octadienal.5R)-4a. fennel.2-Dimethyl-5-(1-methylpropen-1-yl) tetrahydrofuran Ocimene quintoxide.6-octadienal dimethyl acetal. % in propylene glycol > (1R)-2.6-Dimethyl-2-methylenebicyclo[3. 2-Ethyl-2. celery. FG FEMA 3536 Flavis 12.6.6-Dimethyl-4-heptanone W362107-25G W238902-SAMPLE-K W363405-SAMPLE-K [625‑86‑5] C6H8O FW 96. 498 Arc.5-Dimethyl-2-isobutyl-3-thiazoline DMDS.026 CoE Nr 2175 FEMA 2389 Flavis 5.5-Dimethyl-1.25  ≥98% FEMA 3665 Flavis 13.3-Dimethyl-5-isobutylpyrazine. Kosher Organoleptic: cantaloupe. see (−)-β-Pinene Page 111 2.13 FEMA 3621 Flavis 15. green. see Linalool Page 75 2.5-Dimethyl-2.03 C6H8O3 FW 128.074 CoE Nr 2006 Organoleptic: vegetable Kosher W353604-SAMPLE-K W353604-1KG-K 1 kg W353604-5KG-K 5 kg W353604-10KG-K 10 kg > 2.5% Arc.4a. earthy. tobacco  mixture of isomers. vanilla 25 g W362107-100G W366404-SAMPLE-K Caramel furanone.2-Dimethyl-5-(1-methylpropen-1-yl)tetrahydrofuran Page 38 2.5-dimethylthiazole.6-octadienenitrile [5146‑66‑7] (CH3)2C=CHCH2CH2C(CH3)=CHCN C10H15N FW 149. see 2. roasted Virginia tobacco. see Citral Page 28 3.1]heptane.5-dimethylthiazoline [76788‑46‑0] FEMA 3620 C7H13NS FW 143. see Citral dimethyl acetal Page 29 3. grape. coffee W362001 2. see Ethyl chrysanthemate Page 44 2. (±)-2. Organoleptic: caramel.7-Dimethyl-3-hydroxy-1. NI 100 g Fen.2-Dimethyl-3-methylenebicyclo[2. see 5-sec-Butyl2.3-dimethylpyrazine Page 69 38 W362107-1KG W366404-1KG-K Organoleptic: caramel.6-Dimethyl-5-heptenal 4.5-Dimethyl-3-isopropenyl-1.4-Dimethoxybenzene Page 36 4. Isovalerone [108‑83‑8] (CH3)2CHCH2COCH2CH(CH3)2 C9H18O FW 142. Sotolon.5-Dimethyl-2-ethyl-3-thiazoline.15 Fen.13 Natural Occurrence: Fenugreek seed. celery.SAFC® Flavors & Fragrances Dimethyldisulfi Dimethyl disulfide 2. see 2.05 W363413-100G-K 100 g W512508-1KG 1 kg W363413-1KG-K 1 kg W512508-4KG 4 kg W363413-5KG-K 5 kg W512508-9KG 9 kg > 2. 1006. Kosher W353701-200G 200 g W353701-1KG 1 kg W363421-100G-K 100 g W353701-4KG 4 kg W363421-1KG-K 1 kg W363421-5KG-K 5 kg W363421-SAMPLE-K  10 wt. Sugar lactone FEMA 3634 Flavis 10.2-Dimethyl-5-(1-methyl-1-propenyl)tetrahydrofuran.3. rice wine.032 Place an order with your local SAFC representative (see back for contacts). Fen. coffee.5-dimethyl-3-thiazoline.3-Dimethyl-5-(2-methylpropyl)pyrazine. FG W366404-5KG-K 5 kg FEMA 3634 Flavis 10. vegetable  ≥99% Flavis 13. meaty.5-Dimethylfuran May contain a suitable antioxidant Halal. potato.5-dihydrofuran-2-one Diisobutyl ketone.30 [624‑92‑0] CH3SSCH3 C2H6S2 FW 94. coffee. maple.089 Organoleptic: caramel.2-Dimethyl-5-(1-methyl1-propenyl)tetrahydrofuran [7416‑35‑5] C10H18O FW 154. % in propylene glycol Organoleptic: ethereal.4. peach. sulfurous. grapefruit. cucumber.1]heptane. 1011.25  97% FEMA 3620 Flavis 15.13  3 wt.03 Artificial Kosher Organoleptic: chocolate. ≥97% W363413-SAMPLE-K W512508-SAMPLE Flavis 16.5dihydroxy-1. meaty.22  ≥96. meaty Kosher.6-octadiene.122 CoE Nr 11914 1 kg > (3R. nutty. lemon. see 4-Hydroxy-2.5-Dimethyl-4-methoxy-3(2H)-furanone [4077‑47‑8] C7H10O3 FW 142. nutty. wine-like. roasted Virginia tobacco and rice wine. see (+)-Camphene Page 24 (1S.029 CoE Nr 2208 Kosher. NI W501905 W238902-100G-K 100 g W238902-1KG-K 1 kg W238902-4KG-K 4 kg > Dimethylhydroquinone. NI W363405-25G-K 25 g W363405-100G-K 100 g W363405-250G-K 250 g W363405-1KG-K 1 kg Caramel furanone.4aS.7octahydronaphthalene. mixture of isomers 2-Ethyl-4. vegetable. seedy.5dihydro-4. mushroom. Kosher. Sotolon.2. sake.2-Dimethyl-3-(1-isobutenyl)cyclopropane-1-carboxylic acid ethyl ester.2. meaty.1. musty.5-Dimethyl-3-hydroxy-2. . 180  ≥98% W362107-SAMPLE  FCC. woody.5dimethyl-3(2H)-furanone Page 65 (±)-3. 181 1 kg  ≥97%.4-dithiane Page 37 4.4-dithiane-2.23 Organoleptic: fennel. tobacco Halal. smoky.20 [106‑72‑9] (CH3)2C=CHCH2CH2CH(CH3)CHO C9H16O FW 140.5-Dimethyl-4-hydroxy-3(2H)-furanone. Methyl disulfide Melonal [65894‑83‑9] C9H17NS FW 171.7-Dimethyl-2. 2-Ethyl-4. Fen. melon.

1032. FCC (R)-(+)-N. nutty.6-octadien-3-yl acetate. plum Halal. Fen. see 2-Methyl-1-phenyl-2propanol Page 92 (R)-(+)-N.N-Dimethyl-1-phenylethylamine W239100-SAMPLE-K [123‑32‑0] C6H8N2 FW 108.23  97% FEMA 4248 Flavis 11.com 250 g W327301-1KG-K 1 kg 2. Kosher W327301-SAMPLE-K W354007-1KG-K  ≥95%. medicinal. Kosher. NI α. see (±)-Citronellal Page 29 FEMA 3272 Flavis 14. 992. see Geranic acid Page 55 (R)-(−)-3.7-Dimethyl-6-octenal.021 CoE Nr 2211 Organoleptic: green.14 W327107-100G-K 100 g W327107-1KG-K 1 kg W327107-5KG-K 5 kg W327107-10KG-K 10 kg W512109-100G 100 g W512109-1KG 1 kg W512109-5KG 5 kg > Dimethylresorcinol. Fen.4-Dimethylphenol.3.7-Dimethyl-1.014 NI Citronellic acid [502‑47‑6] (CH3)2C=CHCH2CH2CH(CH3)CH2CO2H C10H18O2 FW 170.6-octadien-1-ol.02 CoE Nr 2210 FEMA 2394 Flavis 9.4-Xylenol Page 130 1. see Nerol Page 96 trans-3.6-octadien-1-ol.232 CoE Nr 2084 Halal.3-Dimethylpyrazine 1 kg W239208-5KG-K 5 kg W239208-10KG-K 10 kg Feel inspired at safcglobal. see (S)-(−)-β-Citronellol Page 29 2.227 CoE Nr 2077 Organoleptic: meaty. 1826 Dimethyl phthalate Organoleptic: fatty. coffee Halal. smoky NI > (S)-3.6-octadienyl acetate.6-octadien-3-ol. 187. coffee.7-Dimethyl-2.4-Xylenol Page 130 2. FCC. FCC.6-Dimethylphenol.7-Dimethyl-1. Fen. NI Organoleptic: meaty. 190  ≥98%.6-octadienoic acid.20 [5910‑89‑4] C6H8N2 FW 108.α-Dimethylphenethyl butyrate 2. Fen. FG FEMA 3540 Flavis 14. 185  ≥98%.3. NI W239208-SAMPLE-K W327301-50G-K [2379‑55‑7] C10H10N2 FW 158.3-Dimethoxybenzene Page 36 39 .7-Dimethyl-2. floral.2-(CO2CH3)2 C10H10O4 FW 194.7-Dimethyl-2. Kosher. nutty Halal.7-Dimethyl-2. Kosher.7-Dimethyl-6-octenoic acid Arc. meaty Halal. woody remainder 2.25  ≥94% FEMA 3142 Flavis 8. sweet Kosher. 197  ≥98%. see Neryl acetate Page 97 trans-3. Kosher W239402-SAMPLE-K W327204-SAMPLE-K W239402-1KG-K 1 kg W327204-100G-K 100 g W239402-5KG-K 5 kg W327204-500G-K 500 g W239402-10KG-K 10 kg W327204-1KG-K 1 kg > 2.6-Lutidine [108‑48‑5] C7H9N FW 107.15 1 kg W354007-5KG-K 5 kg W354007-10KG-K 10 kg 2. see Geranyl acetate Page 55 3. see Geraniol Page 55 3. see Linalyl acetate Page 76 trans-3.7-Dimethyl-1. see Ocimene Page 99 (±)-3.31 Arc.6-octatriene. coffee.5-Xylenol Page 130 2.14 Arc.7-Dimethyl-1. FG FEMA 2392 Flavis 9.05 CoE Nr 11323 Organoleptic: fruity.25 Arc.6-octadien-1-yl acetate. see 2.28 Arc. see Ocimene Page 99 3.108 W512109-SAMPLE W327107-SAMPLE-K W239208-1KG-K 50 g W327301-250G-K  ≥97% Organoleptic: almond. NI W314218-SAMPLE Arc.3-Dimethylquinoxaline Flavis 14. nutty. see Geranyl acetate Page 55 cis-3. NI W354007-SAMPLE-K Fen. Fen. 1056.5-Dimethylpyrazine [10094‑34‑5] CH3CH2CH2CO2C(CH3)2CH2C6H5 C14H20O2 FW 220. see Linalool Page 75 cis-3.α-Dimethylphenethyl acetate [108‑50‑9] C6H8N2 FW 108.036 CoE Nr 616 25 g W508500-SAMPLE W314218-100G 100 g W508500-1KG 1 kg W314218-1KG 1 kg W508500-10KG 10 kg W314218-5KG 5 kg W508500-25KG 25 kg 2. FG  ≥95%.N.α-Trimethylbenzylamine [19342‑01‑9] C6H5CH(CH3)N(CH3)2 C10H15N FW 149.065 CoE Nr 11381 [131‑11‑3] C6H4-1. pear Halal.5-Dimethylphenol.6-Dimethylpyridine W424801-SAMPLE W424801-25G 3. Kosher.7-Dimethyl-6-octen-1-ol.6-Dimethylpyrazine 2. 991. see 2.1-Dimethyl-2-phenylethyl alcohol. 191  ≥99% DMP  ≥99% α.7-Dimethyl-1.6-Xylenol Page 130 3.6-octadien-3-ol. Fen. 188 W239100-1KG-K 1 kg W239100-4KG-K 4 kg W239100-8KG-K 8 kg > 3.Dimethylresorci > 3.6-octadien-1-yl acetate. see 2. 189  ≥98%.18 Arc.6-dimethylpyrazine Organoleptic: herbaceous.7-Dimethyl-1-octanol [106‑21‑8] (CH3)2CH(CH2)3CH(CH3)CH2CH2OH C10H22O FW 158.026 CoE Nr 75 Organoleptic: rose. FCC FEMA 3273 Flavis 14. see 3.6-octatrien.7-Dimethyl-2. 1055.14 FEMA 3271 Flavis 14. FCC FEMA 2391 Flavis 2. 1051 [151‑05‑3] C12H16O2 FW 192. see L-Linalool Page 76 (±)-3.7-Dimethyl-2.4-Dimethylphenol. see 1. green.

13 Arc. vegetable Halal.α-Dimethylstyrene [1195‑32‑0] CH3C6H4C(CH3)=CH2 C10H12 FW 132. FG FEMA 3542 Flavis 7. 196 [75‑18‑3] FEMA 2746 Flavis 12. 1059. Kosher.5-Dimethylthiazole p. FG FEMA 2397 Flavis 7. Succinic acid disodium salt [150‑90‑3] NaOOCCH2CH2COONa C4H4Na2O4 FW 162. 1081. Dibenzyl ketone [102‑04‑5] (C6H5CH2)2CO C15H14O FW 210.064  98% Kosher FEMA 2396 Flavis 9. green. see Sodium phosphate dibasic Page 119 Disodium succinate Sodium succinate dibasic. Kosher. FCC. synthetic as antioxidant W314404-SAMPLE-K W314404-25G-K 25 g W314404-100G-K 100 g W314404-1KG-K 1 kg Dimethyl succinate Dipentene [3581‑91‑7] C5H7NS FW 113.27 Arc. Diphenyl oxide  ≥98% [101‑84‑8] (C6H5)2O C12H10O FW 170. meaty NI Kosher W524905-SAMPLE-K W327409-SAMPLE W524905-1KG-K 25 g W524905-8KG-K 8 kg W327409-100G 100 g W524905-20KG-K 20 kg W327409-1KG 1 kg > Dipentyl ketone. Kosher Organoleptic: sulfurous. 2207. 880.001 Organoleptic: nutty. Fen.23  ≥97%  mixture of isomers FEMA 3274 Flavis 15.6-Dimethylbenzenethiol Page 37 Dimethyl trisulfide Dimethyl sulfide [3658‑80‑8] CH3SSSCH3 C2H6S3 FW 126. Fen. see 2. NI contains 0.10-Dimethyl-5.006 CoE Nr 483c (CH3)2S C2H6S FW 62. 1060. p-Mentha-1. 199  ≥99% > 2. FG Arc.18 (±)-Limonene.9-undecadien-2-one Geranylacetone. wine-like Kosher. 194 [138‑86‑3] C10H16 FW 136.10% alpha-tocopherol. Kosher Organoleptic: plastic. see Diphenyl ether Page 40 1. 562 Kosher.20 Arc. ≥99%. see 4-Heptanone Page 58 Disodium hydrogen phosphate. rose. NI Organoleptic: sulfurous.035 CoE Nr 2201 1. meaty NI W327700-1KG-K W503401-SAMPLE 40 FEMA 3667 Flavis 4.017 CoE Nr 11606 Flavis 1. redistilled W327506-100G-K 100 g W327506-250G-K 250 g W327506-1KG-K 1 kg 6. Fen.3-Diphenylacetone. Kosher. synthetic as antioxidant W354201-SAMPLE-K W354201-100G-K 100 g W354201-1KG-K 1 kg W354201-9KG-K 9 kg [541‑58‑2] C5H7NS FW 113.8-diene Fen. woody. see Phenyl disulfide Page 109 > Dimethylthiomethane.086 CoE Nr 2054 Halal.3-Diphenyl-2-propanone  ≥98%.9-undecadien-2one W274658 [3796‑70‑1] (CH3)2C=CHCH2CH2C(CH3)= CHCH2CH2COCH3 C13H22O FW 194.01 CoE Nr 2260 Halal.14 Diphenyl ether [638‑02‑8] C6H8S FW 112. see 1. green Kosher. FG Organoleptic: meaty. see 6-Undecanone Page 128 1. vegetable FEMA 3275 Flavis 12. vegetable  ≥97%.4-Dimethylthiazole Organoleptic: apple. see Sodium phosphate dibasic Page 119 Disodium phosphate. ≥99%. 1 kg W327700-5KG-K 5 kg W327700-10KG-K 10 kg . 6. 2254.26 DMS Arc.123 CoE Nr 11088 W274623-SAMPLE-K W274623-25G-K 25 g W274623-100G-K 100 g W274623-1KG-K 1 kg > Dimethyl sulfoxide. see Benzophenone Page 17 Diphenyl oxide. Fen.6-Dimethylthiophenol. FCC 1 kg W327409-25G W503401-25G 25 g W503401-100G 100 g W503401-1KG 1 kg Place an order with your local SAFC representative (see back for contacts). seedy W239704-SAMPLE-K W239704-100G-K 100 g W239704-1KG-K 1 kg W239704-5KG-K 5 kg > Dipropyl disulfide. NI Flavis 15.3-Diphenyl-2-propanone Page 40 Diphenyl disulfide. NI contains 0.10-Dimethyl-5. see Bis(methylthio)methane Page 19 2. Kosher.113  ≥95% Halal.3-Diphenylacetone.21 Arc. see Methyl sulfoxide Page 93 2.5-Dimethylthiophene Succinic acid dimethyl ester [106‑65‑0] CH3OCOCH2CH2COOCH3 C6H10O4 FW 146. 200  ≥98%. alliaceous (onion. NI W515507-25G-K 25 g W515507-100G-K 100 g W515507-1KG-K 1 kg W239607-SAMPLE-K W239607-1KG-K 1 kg W239607-10KG-K 10 kg W239607-25KG-K 25 kg Arc. 203  ≥98% FEMA 3277 Flavis 8.05 Fen. 193 Flavis 15. NI  redistilled. see Propyl disulfide Page 114 Dipropyl ketone. NI W366706-SAMPLE-K W366706-1KG-K 1 kg W366706-10KG-K 10 kg W366706-25KG-K 25 kg > Diphenyl ketone.18 Organoleptic: geranium.013 CoE Nr 539 W327506-SAMPLE-K W274615-SAMPLE-K W274615-1KG-K 1 kg W274615-5KG-K 5 kg W274615-9KG-K 9 kg W274615-25KG-K 25 kg  ≥99%.10% alpha-tocopherol. 1432 Halal.062 W327700-SAMPLE-K Organoleptic: coffee.SAFC® Flavors & Fragrances Dimethylstyrene 4. garlic) Halal. 193  ≥98% FEMA 3144 Flavis 1. Fen.31  natural.445 CoE Nr 439 W515507-SAMPLE-K Organoleptic: fruity. Fen.19 Phenyl ether.

Epoxidizedlinse
Disperse Blue 35

> Dodecanal, see Lauric aldehyde Page 74
Dodecanoic acid, see Lauric acid Page 74
1-Dodecanol, see Lauryl alcohol Page 74
(±)-4-Dodecanolide, see γ-Dodecalactone Page 41
(±)-5-Dodecanolide, see δ-Dodecalactone Page 41

2,2′-(Dithiodimethylene)difuran

[12222‑75‑2]

Difurfuryl disulfide; Furfuryl disulfide

 analytical standard, for food analysis

[4437‑20‑1] C10H10O2S2 FW 226.32

Dye standard for the assay of allergy-releasing dyes
in textiles1,2
Lit. cited: 1. K.L. Hatch, H.I. Maibach, J. Am. Acad.

 ≥95%, FG

Dermatol. 12, 1079 (1985)
2. J. Am. Acad. Dermatol. 32, 631 (1995)
17992-5G

5g

trans-2-Dodecenal

FEMA 3146 Flavis 13.05 CoE Nr 11480

Halal, Kosher
Organoleptic: meaty
NI
Arc. 918; Fen. 205

[20407‑84‑5] CH3(CH2)8CH=CHCHO C12H22O
FW 182.30

Arc. 1110; Fen. 207

 ≥93%, FCC

W314609-SAMPLE-K

Disperse Orange 1

FEMA 2402 Flavis 5.144 CoE Nr 124

W314609-100G-K

100 g

4-(4-Nitrophenylazo)diphenylamine

W314609-250G-K

250 g

[2581‑69‑3] O2NC6H4N=NC6H4NHC6H5
C18H14N4O2 FW 318.33

W314609-1KG-K

1 kg

 analytical standard, for food analysis
≥96.0% (HPLC)
29173-25MG

25 mg

Disperse Orange 3
4-(4-Nitrophenylazo)aniline
[730‑40‑5] CI 11005 O2NC6H4N=NC6H4NH2
C12H10N4O2 FW 242.23

 analytical standard, for food analysis
≥96.0% (HPLC)
53882-25MG

25 mg

N-Ethyl-N-(2-hydroxyethyl)-4-(4-nitrophenylazo)
aniline
[2872‑52‑8] CI 11110 C16H18N4O3 FW 314.34

 analytical standard, for food analysis
≥96.0% (HPLC)
25 mg

Disperse Yellow 3

[7367‑79‑5] C32H54N2O FW 482.78

 analytical standard, for food analysis
12094-100MG-F

100 mg

> N-Docosanoyltryptamine, see Docosanoic acid tryptamide
Page 41

[2832‑40‑8] CI 11855 C15H15N3O2 FW 269.30

 analytical standard, for food analysis
≥96.0% (HPLC)
25 mg

> 3,4-Dithiahexane, see Diethyl disulfide Page 34

1,4-Dithiane

(±)-4-Dodecanolide; (±)-γ-Octyl-γ-butyrolactone;
(±)-Dihydro-5-octyl-2(3H)-furanone
Arc. 1102; Fen. 206

W240206-100G-K

100 g

W240206-1KG-K

1 kg

W240206-5KG-K

5 kg

> Dodecyl acetate, see Lauryl acetate Page 74
Dodecyl alcohol, see Lauryl alcohol Page 74
Dodecyl aldehyde, see Lauric aldehyde Page 74
Lauric aldehyde Page 74

2-Dodecylcyclobutanone
[35493‑46‑0] C16H30O FW 238.41

 analytical standard, for food analysis
≥95% (GC)
44197-5MG

trans-11-Eicosenoic acid
[62322‑84‑3] C20H38O2 FW 310.51

 analytical standard, for food analysis
10823-50MG

[9000‑75‑3]

FEMA 2400 Flavis 10.019 CoE Nr 2240

 natural

Organoleptic: musty; fatty; fruity
Halal, Kosher, NI

FEMA 2407

W240001-SAMPLE-K
W240001-100G-K

100 g

W240001-1KG-K

1 kg

W240001-5KG-K

5 kg

from Canarium luzonicum
Kosher
France origin
W240702-SAMPLE-K
W240702-1KG-K

5 kg

W240702-10KG-K

10 kg

Organoleptic: alliaceous (onion, garlic); fishy
NI

[713‑95‑1] C12H22O2 FW 198.30

Arc. 1103; Fen. 207

Epoxidized linseed oil

W383104-SAMPLE

 ≥98%, FCC, FG

Linseed oil, epoxidized; ELO

FEMA 2401 Flavis 10.008 CoE Nr 624

[8016‑11‑3]

25 g

W383104-100G

100 g

W383104-1KG

1 kg

> 1,4-Dithiane-2,5-diol, see 2,5-Dihydroxy-1,4-dithiane
Page 36
Dithienyl disulfide, see 2-Thienyl disulfide Page 123

Feel inspired at safcglobal.com

Natural occurrence: Blue cheese, heated butter,
pork fat, rum, sherry and cheeses.
Organoleptic: butter; cheese; coconut; creamy; oily;
peach; wine-like
Halal, Kosher, NI
W240109-SAMPLE-K

1 kg

W240702-5KG-K

FEMA 3831 Flavis 15.066

W383104-25G

50 mg

> Elainic acid, see Oleic acid Page 102

(±)-5-Dodecanolide; (±)-δ-Heptyl-δ-valerolactone;
(±)-6-Heptyltetrahydro-2H-pyran-2-one; 5-Hydroxydodecanoic acid δ-lactone

 ≥97%

5 mg

Elemi Resin

 ≥97%, FCC

δ-Dodecalactone

[505‑29‑3] C4H8S2 FW 120.24

W240206-SAMPLE-K

≥98.0% (GC)

γ-Dodecalactone

[2305‑05‑7] C12H22O2 FW 198.30

N-[4-(2-Hydroxy-5-methylphenylazo)phenyl]
acetamide; 4-(2-Hydroxy-5-methylphenylazo)acetanilide

11344-25MG

Docosanoic acid tryptamide
N-[2-(3-Indolyl)ethyl]docosanamide; N-Docosanoyltryptamine; Behenic acid tryptamide; BAT

≥99.0% (HPLC)

Disperse Red 1

11074-25MG

> Divinylenimine, see Pyrrole Page 116
DMDS, see Dimethyl disulfide Page 38
DMH, see 1,6-Hexanedithiol Page 60
DMP, see Dimethyl phthalate Page 39
DMS, see Dimethyl sulfide Page 40
DMSO, see Methyl sulfoxide Page 93
DOA, see Bis(2-ethylhexyl) adipate Page 19
DOA Plasticizer, see Bis(2-ethylhexyl) adipate Page 19

Organoleptic: orange; fatty; herbaceous
Kosher, NI

> ELO, see Epoxidized linseed oil Page 41
Enanthic acid, see Heptanoic acid Page 57

 analytical standard, for food analysis
Qualitative standard for the determination of ELO in
foods with HPLC-MS or GC-MS. ELO is currently still
employed as plasticizer and HCl scavenger in
foamed PVC used in cap linings
epoxides .................................................................. ~9%

W240109-1KG-K

1 kg

06681-500MG-F

W240109-5KG-K

5 kg

06681-2.5G-F

W240109-10KG-K

10 kg

500 mg
2.5 g

41

SAFC® Flavors & Fragrances
Epoxidizedsoyab
Epoxidized soya bean oil

 ≥99%, FCC

4-Ethoxyphenol

CoE Nr 240

Soybean oil, epoxidized; ESBO

Hydroquinone monoethyl ether

[8013‑07‑8]

[622‑62‑8] C2H5OC6H4OH C8H10O2 FW 138.16

 analytical standard, for food analysis

 99%

Qualitative standard for the determination of ESBO
in foods with HPLC-MS or GC-MS. ESBO is
currently still employed as plasticizer and HCl
scavenger in foamed PVC used in cap linings

FEMA 3695 Flavis 4.037

expoxides ................................................................ ~7%
43956-500MG-F
43956-2.5G-F

500 mg
2.5 g

> (−)-Epoxycaryophyllene, see (−)-Caryophyllene oxide
Page 26
1,2-Epoxyethylbenzene, see Styrene oxide Page 120
1,8-Epoxy-p-menthane, see Eucalyptol Page 51
Erythorbic acid, see D-Isoascorbic acid Page 68
D-Isoascorbic acid Page 68
ESBO, see Epoxidized soya bean oil Page 42
Estragole, see 4-Allylanisole Page 10
Estragon oil, see Tarragon oil Page 121
Ethanal, see Acetaldehyde Page 8
Ethanethioic acid, S-(2-methyl-3-furanyl) ester, see 2-Methyl3-furanthiol acetate Page 86

Ethanethiol

8

Ethyl mercaptan; Mercaptan C2

W241504-SAMPLE-K
W241504-1KG-K

W369501

3-Ethoxypropionaldehyde diethyl acetal
1,1,3-Triethoxypropane

5 kg

W241504-10KG-K

10 kg

W241504-25KG-K

25 kg

Ethyl 2-acetyl-3-phenylpropionate

[7789‑92‑6] C2H5OCH2CH2CH(OC2H5)2 C9H20O3
FW 176.25
Flavis 6.097

 ≥97%

W507725-SAMPLE

FEMA 2416 Flavis 9.501 CoE Nr 2241

W507725-25G

25 g

W507725-100G

100 g

W507725-1KG

1 kg

2-Ethoxythiazole
[15679‑19‑3] C5H7NOS FW 129.18

Fen. 213

Organoleptic: balsam; jasmine; fruity
Arc. 1163; Fen. 214
W241601-SAMPLE
W241601-25G

25 g

W241601-100G

100 g

W241601-1KG

1 kg

Ethyl acrylate

 ≥99%
FEMA 3340 Flavis 15.021 CoE Nr 11611

 ≥97%

Organoleptic: meaty; nutty
Kosher

Arc. 1142; Fen. 216

FEMA 4258 Flavis 12.017

W334006-SAMPLE-K

W425800-SAMPLE

W334006-25G-K

25 g

[140‑88‑5] CH2=CHCOOC2H5 C5H8O2 FW 100.12

 ≥99.5%, FCC

W425800-1KG

1 kg

W334006-100G-K

100 g

W425800-9KG

9 kg

W334006-1KG-K

1 kg

Ethanethiol solution

[141‑78‑6] FEMA 2414 Flavis 9.001 CoE Nr 191
CH3COOC2H5 C4H8O2 FW 88.11

 10 wt. % in propylene glycol

Kosher
Arc. 1137; Fen. 213

Flavis 12.017
W527505-SAMPLE
W527505-1KG

1 kg

W527505-10KG

10 kg

W527505-25KG

25 kg

Organoleptic: anise; ethereal; pineapple
1 pkg
1 kg

W241407-10KG-K

10 kg

Arc. 1135; Fen. 211

W241407-20KG-K

20 kg

 ≥99%

W241407-186KG-K

186 kg

FEMA 2413 Flavis 5.056 CoE Nr 626

 natural, ≥99%, FCC

Organoleptic: spicy; sweet
Kosher
100 g

W241318-500G-K

500 g

W241318-1KG-K

1 kg

W241318-5KG-K

5 kg

> 2-(2-Ethoxyethoxy)ethanol, see Di(ethylene glycol) ethyl ether
Page 34
3-Ethoxy-4-hydroxybenzaldehyde, see Ethyl vanillin
Page 51
2-Ethoxynaphthalene, see Nerolin bromelia Page 97
2-Ethoxy-3(5 or 6)-methylpyrazine, mixture of isomers, see
2-Methyl-3(5 or 6)-ethoxypyrazine, mixture of isomers
Page 90

10 kg

W241806-25KG-K

25 kg

Monoethylamine; Aminoethane
[75‑04‑7] C2H5NH2 C2H7N FW 45.08

 70 wt. % in H2O
FEMA 4236 Flavis 11.015
W423601-SAMPLE

Ethyl anthranilate
[87‑25‑2] H2NC6H4CO2C2H5 C9H11NO2 FW 165.19

W241415-SAMPLE-K

W241318-100G-K

1 kg

W241806-10KG-K

Ethyl 2-aminobenzoate

Organoleptic: pineapple; ethereal

W241318-SAMPLE-K

W241806-1KG-K

Ethylamine solution

W241407-SAMPLE-K
W241407-1KG-K

[10031‑82‑0] C2H5OC6H4CHO C9H10O2 FW 150.17

Organoleptic: fruity
Kosher, NI
contains ≤220 ppm MEHQ as antioxidant

> 2-Ethylacrylic aldehyde, see trans-2-Pentenal Page 105

 ≥99%, FCC

W241407-186KGPW-K

4-Ethoxybenzaldehyde

FEMA 2418 Flavis 9.037 CoE Nr 245

W241806-SAMPLE-K

Ethyl acetate

C2H6S FW 62.13

1 kg

W241504-5KG-K

Acrylic acid ethyl ester

[75‑08‑1] C2H5SH C2H6S FW 62.13

W241415-1KG-K

1 kg

Arc. 1154; Fen. 217

W241415-5KG-K

5 kg

 ≥96%, FCC

W241415-10KG-K

10 kg

Ethyl acetoacetate

FEMA 2421 Flavis 9.716 CoE Nr 251

Organoleptic: blossom; grape; sweet
Halal, Kosher, NI
W242101-SAMPLE-K

Acetoacetic ester
[141‑97‑9] FEMA 2415 Flavis 9.402
CH3COCH2COOC2H5 C6H10O3 FW 130.14

Arc. 1138; Fen. 214

 natural, 99%, FG

W242101-1KG-K

1 kg

W242101-10KG-K

10 kg

W242101-25KG-K

25 kg

> Ethyl-N-amylcarbinol, see 2-Octanol Page 100
Ethyl amyl ketone, see 3-Octanone Page 101

CoE Nr 240c

Halal, Kosher
Organoleptic: fruity; ethereal
W241512-SAMPLE-K

42

Organoleptic: ethereal; sweet
Kosher, NI

W241512-100G-K

100 g

W241512-1KG-K

1 kg

W241512-5KG-K

5 kg

Place an order with your local SAFC representative (see back for contacts).

Ethylbutenoate
Ethyl p-anisate

 natural, ≥99%, FCC

2-Ethylbenzenethiol

[94‑30‑4] CH3OC6H4CO2C2H5 C10H12O3 FW 180.20

2-Ethylthiophenol

Arc. 1153; Fen. 217

[4500‑58‑7] C2H5C6H4SH C8H10S FW 138.23

 ≥97%, FCC

 ≥94%

FEMA 2420 Flavis 9.714 CoE Nr 249

FEMA 3345 Flavis 12.054 CoE Nr 11666

Organoleptic: anise; fruity
Halal, NI

Kosher
Fen. 269

W242004-SAMPLE

W334502-SAMPLE-K

Natural Occurrence: Feijoa, guava, plum, raspberry,
rum, strawberry, Virginia tobacco.
Kosher
Organoleptic: anise; balsam; cherry; cranberry;
grape; fruity; floral; plum; raspberry; strawberry;
vanilla; wine-like; minty; spicy
W242217-SAMPLE-K
W242217-25G-K

25 g

1 kg

W334502-25G-K

25 g

W242217-100G-K

100 g

W242004-5KG

5 kg

W334502-100G-K

100 g

W242217-1KG-K

1 kg

W242004-10KG

10 kg

W334502-1KG-K

1 kg

W242004-1KG

> Ethyl anthranilate, see Ethyl 2-aminobenzoate Page 42

4-Ethylbenzaldehyde
[4748‑78‑1] C2H5C6H4CHO C9H10O FW 134.18

Arc. 1156; Fen. 218

Ethyl benzoate

Ethyl trans-2-butenoate

[93‑89‑0] FEMA 2422 Flavis 9.726 CoE Nr 261
C6H5COOC2H5 C9H10O2 FW 150.17

Arc. 1159; Fen. 218

 ≥99%, FCC

 ≥97%

Natural occurrence: Feijoa, guava, plum, raspberry,
rum, strawberry, Virginia tobacco.
Organoleptic: anise; banana; berry; cherry; grape;
floral; plum; vanilla; minty
Kosher, NI

FEMA 3756 Flavis 5.068 CoE Nr 705

Organoleptic: almond; sweet
Kosher, NI
W375608-SAMPLE-K

> α-Ethylbenzyl alcohol, see 1-Phenyl-1-propanol Page 109

Ethyl crotonate
[623‑70‑1] CH3CH=CHCOOC2H5 C6H10O2
FW 114.14

Arc. 1196; Fen. 223

 ≥96%, FG
FEMA 3486 Flavis 9.248 CoE Nr 2244

Organoleptic: ethereal; wine-like
Halal, Kosher, NI
W348600-SAMPLE-K

W375608-1KG-K

1 kg

W242209-SAMPLE-K

W375608-5KG-K

5 kg

W242209-1KG-K

1 kg

W348600-1KG-K

10 kg

W242209-10KG-K

10 kg

W348600-4KG-K

4 kg

W242209-25KG-K

25 kg

W348600-10KG-K

10 kg

W348600-20KG-K

20 kg

W375608-10KG-K

1 kg

Feel it.
Confidence that comes naturally.

Natural products start with natural ingredients. Be sure of the quality and origin
of yours with SAFC’s leading selection of U.S. and European certified materials,
tested for naturalness at the University of Georgia, and full traceability.
Contact your SAFC representative or visit safcglobal.com/flavors-fragrances

Feel inspired at safcglobal.com

43

mixture of isomers Page 38 Ethyl dimethyl dioxolane acetate CoE Nr 10574 Natural occurrence: Apple. see Triethyl citrate Page 125 Ethyl crotonate. green. waxy Kosher contains 0. FCC CoE Nr 264 W243000-SAMPLE-K Organoleptic: banana. 1208. sweet Halal. 1200. NI W314803-SAMPLE-K  mixture of isomers. Kosher Organoleptic: cinnamon. Halal. Organoleptic: apple.025 CoE Nr 215 Arc. banana. ≥92%. ethereal. grape. Kosher Organoleptic: banana.29 Fen.5-dimethylthiazoline.039 CH3CH2CH2C(O)OC2H5 C6H12O2 FW 116. spicy. Fen. pineapple Halal. sweet W243108-SAMPLE W243108-100G 100 g W243108-1KG 1 kg W243108-5KG 5 kg Ethyl 2-trans-4-cis-decadienoate W242918-SAMPLE  ≥98%.5-dimethyl-3-thiazoline. waxy Halal. ≥95% W242500-SAMPLE W314811-SAMPLE-K Organoleptic: wine-like. NI W242705-SAMPLE-K W243000-1KG-K 1 kg W243000-10KG-K 10 kg W243000-25KG-K 25 kg W242705-1KG-K 1 kg W242705-4KG-K 4 kg  natural. mixture of isomers Page 38 Ethyl disulfide. oily. FCC Organoleptic: cinnamon.2-Dimethyl-3-(1-isobutenyl)cyclopropane-1carboxylic acid ethyl ester.73 CoE Nr 323 C6H5CH=CHCOOC2H5 C11H12O2 FW 176. FCC FEMA 2429 Flavis 8. plum. Fen. 8 [6290‑17‑1] C9H16O4 FW 188. see 3-Heptanone Page 58 [103‑36‑6] FEMA 2430 Flavis 9. Fen. grape. ethereal W242713-SAMPLE-K W242713-1KG-K 1 kg W242713-4KG-K 4 kg W242713-9KG-K 9 kg W242713-20KG-K 20 kg 2-Ethylbutyric acid Diethylacetic acid [88‑09‑5] (C2H5)2CHCO2H C6H12O2 FW 116.28 Arc.5-Dimethyl-2-ethyl-3thiazoline. sour NI W242918-1KG 1 kg W242918-5KG 5 kg W242918-10KG 10 kg W242918-25KG 25 kg > γ-Ethyl-γ-butyrolactone. see Diethyl disulfide Page 34 Ethyl dodecanoate. NI W243205-SAMPLE-K W243205-1KG-K 1 kg W243205-4KG-K 4 kg W243205-9KG-K 9 kg W243205-20KG-K 20 kg  natural. pear Halal. creamy. musty. ≥97% FEMA 4294 Flavis 6. 1188. wine-like W243213-SAMPLE-K W243019-100G-K 100 g W243019-1KG-K 1 kg W243019-5KG-K 5 kg > Ethyl citrate. sweet W506109-SAMPLE W314811-25G-K 25 g W314811-100G-K 100 g W314811-1KG-K 1 kg W242500-100G 100 g W242500-1KG 1 kg W506109-100G 100 g 4 kg W506109-1KG 1 kg Capric acid ethyl ester.283 CoE Nr 10577 Organoleptic: peach. 220 2.16 Arc. FG Organoleptic: fatty. fatty [3025‑30‑7] FEMA 3148 Flavis 9. FCC. ethereal.059 CH3(CH2)8COOC2H5 C12H24O2 FW 200.29 FEMA 2425 Flavis 9. NI  ≥98%. pear brandy and quince. FCC Kosher Organoleptic: grape. 1169. see Ethyl hexanoate Page 45 2-Ethylcaproic acid. oily. 221 Arc.5-dimethylthiazole. see 4. Kosher Organoleptic: apple. see 4. ≥85%. peach. see 4.488 CoE Nr 2095 FEMA 3641 Flavis 9. mixture of isomers Page 38 2-Ethyl-4. pear brandy and quince. FG W242705-9KG-K 9 kg W242705-20KG-K 20 kg Halal.26 CH3(CH2)4CH =CHCH=CHCO2C2H5 C12H20O2 FW 196. 222  ≥98%. 1180.16 Arc. synthetic as antioxidant W364118-SAMPLE-K W364118-100G-K 100 g W364118-1KG-K 1 kg W364118-5KG-K 5 kg > 2-Ethyl-2. wine-like. 1187 Organoleptic: apricot.5-Dimethyl-2ethyl-3-thiazoline. oily.5-dihydro-4. 1178. plum. sweet CoE Nr 264c Halal. see Ethyl octanoate Page 49 CoE Nr 309 Organoleptic: grape. FCC Ethyl decanoate Arc. pineapple. Ethyl caprate W506109-5KG 5 kg [110‑38‑3] FEMA 2432 Flavis 9.SAFC® Flavors & Fragrances Ethylbutylaceta 2-Ethylbutyl acetate  natural.21 Butyric acid ethyl ester [105‑54‑4] FEMA 2427 Flavis 9. ≥98%. FG CoE Nr 309c W243019-SAMPLE-K  natural. Kosher.32 W242500-4KG > Ethyl butyl ketone. ethereal. sweet. 226  ≥99%  ≥95% FEMA 2431 Flavis 9. FG Ethyl chrysanthemate [10031‑87‑5] CH3CO2CH2CH(C2H5)2 C8H16O2 FW 144.045 CoE Nr 2001 Organoleptic: berry. herbaceous. Fen.5-Dimethyl-2-ethyl-3thiazoline. citrus. pear. caramel. see γ-Hexalactone Page 59 Ethyl butyrylacetate. earthy  mixture of cis and trans.087 W429400-SAMPLE W429400-1KG W314803-100G-K 100 g W314803-250G-K 250 g W314803-1KG-K 1 kg W314803-5KG-K 5 kg Place an order with your local SAFC representative (see back for contacts). Kosher. see Ethyl trans-2-butenoate Page 43 W243213-100G-K 100 g W243213-1KG-K 1 kg W243213-4KG-K 4 kg W243213-9KG-K 9 kg Ethyl trans-2-decenoate trans-2-Decenoic acid ethyl ester Ethyl cyclohexanepropionate [7367‑88‑6] CH3(CH2)6CH=CHCO2C2H5 C12H22O2 FW 198. 225 Ethyl cinnamate Ethyl butyrate 44 Natural Occurrence: Apple.21 Arc. 222  ≥98%. 225  ≥80%. ≥98%. 224 Fen. Kosher. see Ethyl 3-oxohexanoate Page 49 Ethyl caprate.22 1 kg > 2-Ethyl-4. Kosher. Chrysanthemum monocarboxylic acid ethyl ester  ≥98% [97‑41‑6] C12H20O2 FW 196. fruity. Fen.30 [10094‑36‑7] C11H20O2 FW 184. see Ethyl heptanoate Page 45 . see Ethyl decanoate Page 44 Ethyl caproate. sweet. pear. wine-like. Fen. see 2-Ethylhexanoic acid Page 45 Ethyl caprylate. pear. see Ethyl laurate Page 47 Ethyl enanthate.10% alpha-tocopherol.

NI W354309-1KG-K 1 kg W243507-SAMPLE-K W354309-5KG-K 5 kg W243507-25G-K 25 g W354309-10KG-K 10 kg W243507-100G-K 100 g W243701-1KG-K 1 kg W243507-1KG-K 1 kg W243701-4KG-K 4 kg > Ethylene glycol monophenylether isobutyrate.19 W243906-SAMPLE-K W243906-1KG-K 1 kg W243906-4KG-K 4 kg W243906-9KG-K 9 kg W243906-20KG-K 20 kg Halal. FCC W243701-9KG-K  natural.21 Arc. peach. see Ethyl sorbate Page 50 2-Ethylcaproic acid [149‑57‑5] CH3(CH2)3CH(C2H5)CO2H C8H16O2 FW 144. FG W243914-1KG-K 1 kg FEMA 2436 Flavis 4.21  ≥99% Flavis 8. see Ethyl 3-(furan-2-yl)propionate Page 45 4-Ethylguaiacol Halal. pineapple. vanilla Kosher Organoleptic: meaty. ≥98%. Kosher Organoleptic: apple.095 CoE Nr 10208 9 kg W243701-20KG-K CoE Nr 365c  ≥98%  ≥97%. see 2Phenoxyethyl isobutyrate Page 108 2-Ethylfenchol Ethyl 3-(furfurylthio)propionate [94278‑27‑0] C10H14O3S FW 214. FCC. Kosher.19  ≥95% Arc.06 CoE Nr 310 CH3(CH2)4COOC2H5 C8H16O2 FW 144. plum Kosher. see 3-Decanone Page 33 Ethyl hexadecanoate. sweet Kosher. Kosher. NI  natural. 231  ≥98%  ≥97%.24 FEMA 3543 Flavis 9. earthy. Fen. NI Organoleptic: smoky. animal Kosher W243728-SAMPLE-K W243728-100G-K 100 g W349100-SAMPLE-K W367400-SAMPLE-K W243728-1KG-K 1 kg W243728-4KG-K 4 kg W349100-100G-K 100 g W367400-25G-K 25 g W349100-1KG-K 1 kg W367400-100G-K 100 g W349100-5KG-K 5 kg W367400-1KG-K 1 kg Ethyl 2-furoate Ethyl formate Formic acid ethyl ester Ethyl furan-2-carboxylate [109‑94‑4] FEMA 2434 Flavis 9.14 Arc. 1183. 1214.30 W243701-SAMPLE-K Organoleptic: berry. 234 W243914-SAMPLE-K  ≥98%.28 20 kg Kosher Organoleptic: fruity FEMA 3674 Flavis 13.08 [614‑99‑3] C7H8O3 FW 140. see Ethyl palmitate Page 49 Ethyl trans. NI Organoleptic: fruity.533 CoE Nr 10571  ≥98% Organoleptic: musty. Fen. Kosher. 1255.093 FEMA 3491 Flavis 2. NI Organoleptic: apple. 235  ≥98%. FG CoE Nr 339c > Ethyl 3-(2-furyl)propanoate. pineapple Kosher W354309-SAMPLE-K Organoleptic: berry. banana. 1236. ethereal. Fen. Fen. FG W501301-SAMPLE-K W501301-100G-K 100 g W243418-1KG-K 1 kg W501301-1KG-K 1 kg W243418-10KG-K 10 kg W501301-5KG-K 5 kg W243418-25KG-K 25 kg  natural. FCC. see Ethyl 2-furoate Page 45 Feel inspired at safcglobal.com 45 . NI W243418-SAMPLE-K Ethyl hexanoate Ethyl caproate. FCC Fen. coffee. ethereal. wine-like Halal. 1251. ≥98%.092 CoE Nr 11706 W243604-5KG-K 5 kg Organoleptic: coffee.trans-2. Fen. 232 > Ethyl heptyl ketone. lime. sweet.072 HCOOC2H5 C3H6O2 FW 74. pineapple. sweet Kosher FEMA 2435 Flavis 13. FG CoE Nr 365 Organoleptic: green. 232 [106‑30‑9] FEMA 2437 Flavis 9.4-hexadienoate. ≥80%. Fen. 233 [18368‑91‑7] C12H22O FW 182. FCC.122 CoE Nr 339 Organoleptic: floral. wine-like Halal. FG Flavis 13. FG W243604-SAMPLE-K Arc. meaty W243914-9KG-K 9 kg 2-Ethylhexanoic acid W243604-100G-K 100 g  ≥99% W243604-1KG-K 1 kg FEMA 3673 Flavis 13. Kosher W243434-SAMPLE-K W243434-100G-K 100 g W243434-1KG-K 1 kg W243434-5KG-K 5 kg 2-Ethylfuran [3208‑16‑0] C6H8O FW 96.Ethylhexanoicac Ethylene brassylate Ethyl 3-(furan-2-yl)propionate Ethyl heptanoate [105‑95‑3] C15H26O4 FW 270. 1240 Arc. FCC. melon. 234  ≥98%. 220 [10031‑90‑0] C9H12O3 FW 168. Caproic acid ethyl ester [123‑66‑0] FEMA 2439 Flavis 9.008 CoE Nr 176 W243914-4KG-K 4 kg Halal.078 W367303-SAMPLE-K W367303-25G-K 25 g W367303-100G-K 100 g W367303-1KG-K 1 kg W515302-SAMPLE W515302-1KG 1 kg W515302-9KG 9 kg W515302-20KG 20 kg > Ethyl furan-2-carboxylate.13 [2785‑89‑9] C2H5C6H3-2-(OCH3)OH C9H12O2 FW 152. Fen. wine-like Arc.36 Ethyl 3-(2-furyl)propanoate Ethyl enanthate Arc. banana. Kosher. 1235. plum Halal. 1237.093 CH3(CH2)5COOC2H5 C9H18O2 FW 158.022 CoE Nr 2091 Arc. FCC.

1260. NI W315214-SAMPLE-K W315214-100G-K 100 g W315214-1KG-K 1 kg W315214-5KG-K 5 kg > N-Ethyl-N-(2-hydroxyethyl)-4-(4-nitrophenylazo)aniline. Kosher NI W342807-SAMPLE-K W342807-100G-K 100 g W342807-1KG-K 1 kg W342807-5KG-K 5 kg W342807-10KG-K 10 kg  ≥99% W342807-25KG-K 25 kg Flavis 9.191 Organoleptic: grape.16  ≥98% FEMA 3342 Flavis 9. FG CoE Nr 288  50 wt.023 CoE Nr 4005 W315303-SAMPLE-K CoE Nr 10596 Arc. see Ethyl salicylate Page 50 [698‑10‑2] C7H10O3 FW 142. 237 > Ethyl hydrocinnamate. Kosher.21 > Ethyl hexyl ketone.057 CoE Nr 759 W242802-SAMPLE-K Organoleptic: chocolate. FCC. see Disperse Red 1 Page 41 46 FEMA 3153 Flavis 10. FG Organoleptic: caramel. NI  ≥97%. 240 [5405‑41‑4] FEMA 3428 Flavis 9. Octisalate [118‑60‑5] (HO)C6H4CO2CH2CH(C2H5)(CH2)3CH3 C15H22O3 FW 250. NI Organoleptic: spicy W354503-SAMPLE-K W315109-SAMPLE-K W367605-SAMPLE W354503-100G-K 100 g W315109-1KG-K 1 kg W367605-25G 25 g W354503-250G-K 250 g W315109-4KG-K 4 kg W367605-100G 100 g W354503-1KG-K 1 kg W315109-8KG-K 8 kg W367605-1KG 1 kg W354503-5KG-K 5 kg Ethyl trans-3-hexenoate [2396‑83‑0] C2H5CH=CHCH2CO2C2H5 C8H14O2 FW 142. 241  ≥98%. Kosher. 236 Ethyl 3-hydroxyhexanoate [2305‑25‑1] CH3CH2CH2CH(OH)CH2CO2C2H5 C8H16O3 FW 160.15 Ethyl 3-hydroxybutyrate Fen. smoky Halal. NI FEMA 3152 Flavis 7. Kosher. NI W334200-100G-K 100 g W334200-1KG-K 1 kg W334200-5KG-K 5 kg 2-Ethylhexyl acetate [103‑09‑3] H3CCO2CH2CH(C2H5)(CH2)3CH3 C10H20O2 FW 172.20 Fen. see Ethyl lactate Page 47 2-Ethyl-3-hydroxy-4H-pyran-4-one. 1262 Kosher  97%. strawberry Halal. see 3-Nonanone Page 98 2-Ethylhexyl salicylate  ≥97% Organoleptic: green. FG W334200-SAMPLE-K 5-Ethyl-3-hydroxy-4-methyl-2(5H)-furanone Place an order with your local SAFC representative (see back for contacts).082 CoE Nr 11763  ≥92% Organoleptic: oily.413 (CH3)2CHCOOC2H5 C6H12O2 FW 116.16 Arc. Kosher W362301-SAMPLE-K W362301-25G-K 25 g W362301-100G-K 100 g W362301-1KG-K 1 kg > Ethyl 2-hydroxypropionate. NI FEMA 3676 Flavis 9. mixture of isomers [27538‑10‑9] C7H10O3 FW 142. rose. 1270  ≥98%.26 Halal. sweet Kosher. maple Halal. FG Fen.539 Organoleptic: grape. Fen.535 CoE Nr 4101 FEMA 3151 Flavis 2. fruity Octyl salicylate. maple. 1179. fruity Halal. smoky Halal. see Ethyl 3-phenylpropionate Page 49 Ethyl 2-hydroxybenzoate. sweet Fen.15 Fen.522 CH3CH(OH)CH2COOC2H5 C6H12O3 FW 132.33 W510408-SAMPLE W510408-25G 25 g  ≥99% W510408-100G 100 g Kosher W510408-1KG 1 kg W514500-SAMPLE-K W514500-1KG-K 1 kg W514500-10KG-K 10 kg W514500-25KG-K 25 kg 3-Ethyl-2-hydroxy-2-cyclopenten-1-one solution W315303-100G-K 100 g W315303-250G-K 250 g W315303-1KG-K 1 kg 2-Ethyl-4-hydroxy-5-methyl-3(2H)-furanone. 238 Organoleptic: pineapple Halal.23 [94133‑92‑3] CH3CH= C(CH3)CO2CH(C2H5)(CH2)4CH3 C13H24O2 FW 212. Kosher. coffee. citrus. 237  ≥99% FEMA 3545 Flavis 9. see Ethyl maltol Page 47 Ethyl isobutyrate [97‑62‑1] FEMA 2428 Flavis 9. Fen. Kosher.SAFC® Flavors & Fragrances Ethylhexanol 2-Ethyl-1-hexanol 1-Ethylhexyl tiglate Isooctyl alcohol 3-Octyl tiglate [104‑76‑7] CH3(CH2)3CH(C2H5)CH2OH C8H18O FW 130. W242802-1KG-K 1 kg W242802-4KG-K 4 kg W242802-8KG-K 8 kg W242802-9KG-K 9 kg W242802-20KG-K 20 kg .33 Arc. % in propylene glycol Organoleptic: citrus. FG FEMA 3623 Organoleptic: caramel. 240  ≥97%.21 Arc.381  natural 8 W342815-SAMPLE W514705-SAMPLE-K W514705-1KG-K 1 kg W514705-9KG-K 9 kg W514705-20KG-K 20 kg W342815-250G 250 g W342815-1KG 1 kg Ethyl (±)-2-hydroxycaproate [52089‑55‑1] CH3(CH2)3CH(OH)CO2C2H5 C8H16O3 FW 160.

Kosher. 244 W327905-SAMPLE-K  ≥98%. Fen.17 [7452‑79‑1] FEMA 2443 Flavis 9. garlic) Kosher. ≥98%.com  natural.013 Organoleptic: green. Framidice 3. 1277. 245 FEMA 3279 Flavis 12.047 CoE Nr 692 [97‑64‑3] FEMA 2440 Flavis 9. FCC.099 CH3(CH2)10COOC2H5 C14H28O2 FW 228. Lauric acid ethyl ester N-Ethyl-p-methane-3-carboxamide. Kosher. fruity Arc.14 FEMA 3280 Flavis 14. 248  ≥98%. see Ethanethiol Page 42 W244015-1KG-K 1 kg W242810-25G-K 25 g W244015-5KG-K 5 kg W242810-100G-K 100 g W244015-10KG-K 10 kg W242810-1KG-K 1 kg N-Ethyl-2-isopropyl-5-methylcyclohexanecarboxamide Ethyl laurate [39711‑79‑0] C13H25NO FW 211.409 CH3CH2CH(CH3)COOC2H5 C7H14O2 FW 130. green. vegetable. 1745. green 2-Ethyl-3-hydroxy-4H-pyran-4-one W244317-SAMPLE-K FEMA 3487 Flavis 7. see Ethyl tiglate Page 50 W244317-100G-K 100 g W244317-1KG-K 1 kg W244317-4KG-K 4 kg W244317-20KG-K 20 kg > Ethyl methyl ketone. see N-Ethyl-2-isopropyl5-methylcyclohexanecarboxamide Page 47 W244104-1KG-K 1 kg W345501-100G-K 100 g W244104-4KG-K 4 kg W345501-1KG-K 1 kg W244104-9KG-K 9 kg 2-Ethyl-3-methoxypyrazine W345501-5KG-K 5 kg W244104-20KG-K 20 kg [25680‑58‑4] C7H10N2O FW 138. FCC. Kosher. ≥98%. FCC  natural. Kosher Arc. Kosher Organoleptic: fruity. FCC.37 CoE Nr 375  99% [19788‑49‑9] CH3CH(SH)CO2C2H5 C5H10O2S FW 134. Kosher W244015-SAMPLE-K W242810-SAMPLE-K > Ethyl menthane carboxamide. FCC CoE Nr 265c  ≥99%.34 Organoleptic: grape.046 CoE Nr 11469 [106‑33‑2] FEMA 2441 Flavis 9.Ethylmethylketo  natural. NI W348708-1KG-K 1 kg W244007-SAMPLE-K W348708-5KG-K 5 kg W348708-25KG-K 25 kg  ≥98%. NI Ethyl 2-methylbutyrate Ethyl 4-oxopentanoate [539‑88‑8] CH3COCH2CH2COOC2H5 C7H12O3 FW 144. FG Halal.447 CoE Nr 442 (CH3)2CHCH2COOC2H5 C7H14O2 FW 130. FCC 1 kg Ethyl levulinate Ethyl isovalerate [108‑64‑5] FEMA 2463 Flavis 9. sweet. FCC. FG FEMA 3455 Flavis 16.435 CoE Nr 373 CoE Nr 265 Organoleptic: apple. alliaceous (onion. NI Arc. FG W244007-1KG-K 1 kg W244007-5KG-K 5 kg W244007-25KG-K 25 kg Feel inspired at safcglobal. Fen.17 W345501-25KG-K 25 kg Ethyl isothiocyanate 8 Ethyl mustard oil [542‑85‑8] C2H5NCS C3H5NS FW 87. FCC CoE Nr 288c Kosher Halal. floral Halal. pineapple. FG FEMA 2442 Flavis 9. Kosher. 245 W348708-SAMPLE-K W348708-100G-K 100 g Halal. Fen. FG Halal. 243  ≥98%. NI W246301-4KG-K 4 kg W244201-SAMPLE W246301-20KG-K 20 kg W246301-SAMPLE-K  natural. Kosher W246328-SAMPLE-K W246328-100G-K 100 g W246328-1KG-K 1 kg W246328-4KG-K 4 kg W244309-1KG-K 1 kg 1 kg W244309-4KG-K 4 kg W244201-5KG 5 kg W244309-9KG-K 9 kg W244201-10KG 10 kg W244309-20KG-K 20 kg W244201-25KG 25 kg Ethyl maltol Halal. ≥98%. fruity. see N-Ethyl-2-isopropyl-5methylcyclohexanecarboxamide Page 47 Ethyl mercaptan. 243 Organoleptic: caramel Halal. NI W246301-1KG-K 1 kg Organoleptic: apple. FCC. 1292. 1276. plum Halal. meaty. Fen. 244 Arc.18 Arc.14 Ethyl lactate > Ethyl trans-2-methyl-2-butenoate. ≥98%. Fen. NI Kosher W244104-SAMPLE-K W345501-SAMPLE-K Fen. 1278.433 CoE Nr 371 CH3CH(OH)COOCH2CH3 C5H10O3 FW 118. see 2-Butanone Page 21 47 . ≥98%. FCC. floral W514403-SAMPLE-K W514403-25G-K 25 g W244112-100G-K 100 g W514403-100G-K 100 g W244112-1KG-K 1 kg W514403-1KG-K 1 kg W244112-4KG-K 4 kg W244112-SAMPLE-K  97% FEMA 4420 W442000-SAMPLE W442000-1KG  ≥99%  natural.20  ≥95% Ethyl dodecanoate. Menthol Carboxamide WS-3 Ethyl 2-mercaptopropionate W327905-100G-K 100 g W327905-1KG-K 1 kg W327905-5KG-K 5 kg > N-Ethyl-p-methane-3-carboxamide. green Halal. FCC. ethereal. 1362. FG  ≥98%. Ethyl menthane carboxamide.112 CoE Nr 375c Kosher Kosher Organoleptic: fruity.18 Organoleptic: apple Arc. FG Ethyl 2-hydroxypropionate W244309-SAMPLE-K W244201-1KG [4940‑11‑8] C7H8O3 FW 140.13 Organoleptic: butter. Fen.

vegetable. soapy Halal. Fen. FCC. Kosher. sweet.07 .SAFC® Flavors & Fragrances Ethylmethylpent Ethyl 2-methylpentanoate 2-Ethyl-5(6)-methylpyrazine [39255‑32‑8] CH3CH2CH2CH(CH3)CO2C2H5 C8H16O2 FW 144. 252 Fen. 251 Organoleptic: banana.033 CoE Nr 11612 W244503-9KG-K 9 kg W244503-20KG-K 20 kg Arc.527 CoE Nr 10613 W334308-100G-K Ethyl myristate FEMA 3546 Flavis 14.20 Ethyl pelargonate  ≥98% [123‑29‑5] CH3(CH2)7COOC2H5 C11H22O2 FW 186. earthy. 255  ≥98%  ≥98%  ≥99%. Ethyl tetradecanoate NI FEMA 3489 Flavis 9.10% alpha-tocopherol. fruity. ethereal FEMA 3155 Flavis 14. NI 2-Ethyl-4-methylthiazole W348902-100G-K 100 g W348902-1KG-K 1 kg [15679‑12‑6] C6H9NS FW 127.22 Fen. Ethyl α-(methylthio)acetate Ethyl nonanoate [4455‑13‑4] CH3SCH2CO2C2H5 C5H10O2S FW 134. see Ethyl stearate Page 50 48 8 Flavis 16. NI  ≥98%. Fen.18 [53399‑81‑8] H2C=CHCH2CH(CH3)CO2C2H5 C8H14O2 FW 142. 1312. NI W244708-SAMPLE-K W244708-1KG-K Place an order with your local SAFC representative (see back for contacts).006 CoE Nr 548 W383503-100G 100 g W383503-1KG 1 kg W383503-5KG 5 kg > Ethyl α-(methylthio)acetate. green Halal. potato Halal. NI Fen. 254 W244503-1KG-K 1 kg  ≥98%.24 > Ethyl 2-naphthyl ether.21 W244503-SAMPLE-K W348902-4KG-K 4 kg Fen. 251 Organoleptic: nutty.17 [13327‑56‑5] CH3SCH2CH2CO2C2H5 C6H12O2S FW 148.42 Arc. Fen. 1310. Kosher.053 CoE Nr 11476 Kosher Organoleptic: pineapple W315400-SAMPLE-K W348805-SAMPLE W315400-25G-K 25 g W348805-200G 200 g W315400-100G-K 100 g W348805-250G 250 g W315400-1KG-K 1 kg W348805-1KG 1 kg W348805-4KG 4 kg 5-Ethyl-2-methylpyridine 5-Ethyl-2-picoline Ethyl 2-methyl-4-pentenoate Fen. FCC FEMA 3154 FEMA 3488 Flavis 9. see Ethyl isothiocyanate Page 47 Ethyl isothiocyanate Page 47 [104‑90‑5] C8H11N FW 121. 253 W315508-SAMPLE-K W315508-100G-K 100 g W315508-1KG-K 1 kg W315508-5KG-K 5 kg  10-20 wt.066 CoE Nr 11385  ≥98% W334308-SAMPLE-K > Ethyl mustard oil. FG Ethyl nitrite solution [109‑95‑5] C2H5ONO C2H5NO2 FW 75. garlic).17 Organoleptic: hazelnut.122  ≥98%. see Ethyl (methylthio)acetate Page 48 Ethyl (methylthio)acetate Page 48 Arc. 250 Fen.107 CoE Nr 388 Organoleptic: oily.526 CoE Nr 10616 FEMA 3343 Flavis 12. Organoleptic: apricot. 1 kg W244708-9KG-K 9 kg W244708-20KG-K 20 kg > Ethyl octadecanoate. FG FEMA 2447 Flavis 9. FCC. coffee. see Nerolin bromelia Page 97 W244406-SAMPLE-K W244406-1KG-K 1 kg W244406-5KG-K 5 kg W244406-10KG-K 10 kg 2-Ethyl-3-methylpyrazine [15707‑23‑0] C7H10N2 FW 122.29 Natural Occurrence: Apple and melon. % in ethanol W244601 (Methylthio)acetic acid ethyl ester.015 CoE Nr 6002 W368008-25G-K 25 g Organoleptic: strawberry. 256  ≥98%. wine-like. Kosher.017 Ethyl (methylthio)acetate FEMA 3835 Flavis 12. synthetic as antioxidant W348902-SAMPLE-K 100 g W334308-1KG-K 1 kg W334308-5KG-K 5 kg Myristic acid ethyl ester. FCC FEMA 2445 Flavis 9.20 Kosher Organoleptic: citrus. Kosher. alliaceous (onion.21 Ethyl 3-(methylthio)propionate [36731‑41‑6] C7H10N2 FW 122.104 CoE Nr 385 Organoleptic: waxy. FCC W368008-SAMPLE-K FEMA 2444 Flavis 16. sweet Kosher W368008-100G-K 100 g W368008-1KG-K 1 kg Ethyl 3-methyl-3-phenylglycidate [77‑83‑8] C12H14O3 FW 206. nutty Halal. 253  ≥96% Fen. green Kosher contains 0. 257  ≥98%. FG W244503-4KG-K 4 kg FEMA 3680 Flavis 15. 1306. pineapple NI W354600-SAMPLE W354600-1KG 1 kg W354600-5KG 5 kg W354600-10KG 10 kg [124‑06‑1] CH3(CH2)12COOC2H5 C16H32O2 FW 256.

FCC W315605-SAMPLE-K W245402-100G 100 g W245402-1KG 1 kg W245402-5KG 5 kg > Ethyl phenyl ketone. Kosher. NI W244902-SAMPLE-K W244902-1KG-K 1 kg W244902-4KG-K 4 kg W244902-8KG-K 8 kg W244902-9KG-K 9 kg W244902-20KG-K 20 kg Natural occurrence: Burley and Virginia tobacco.26 W368318-5KG 5 kg  ≥98% > Ethyl 4-oxopentanoate. 1332. Fen. Fen. see Propiophenone Page 113 Ethyl 3-phenylpropionate Ethyl hydrocinnamate [2021‑28‑5] C6H5CH2CH2COOC2H5 C11H14O2 FW 178. beer. caramel. FCC. strawberry Halal Arc. wine-like W245518-SAMPLE W245518-250G 250 g W245518-1KG 1 kg W245518-5KG 5 kg > 5-Ethyl-2-picoline. mossy W244910-4KG-K 4 kg W368318-SAMPLE 4-Ethyloctanoic acid FEMA 3683 Flavis 9.111 CH3(CH2)6COOC2H5 C10H20O2 FW 172. 262 Fen. waxy. wine-like Halal. FG trans-2-Octenoic acid ethyl ester 5 kg W315605-10KG-K [121‑39‑1] C11H12O3 FW 192. Kosher. 264  ≥98% FEMA 2455 Flavis 9. Kosher W364304-SAMPLE-K W364304-100G-K 100 g W245100-5KG-K 5 kg W245100-10KG-K 10 kg  natural (US). woody. ≥92% FEMA 2454 Flavis 16. see 3-Octanone Page 101 10 kg Ethyl phenylacetate [101‑97‑3] C6H5CH2COOC2H5 C10H12O2 FW 164. FG W364304-1KG-K 1 kg Kosher W364304-5KG-K 5 kg W245115-1KG-K W245115-100G-K Ethyl trans-4-octenoate W245115-SAMPLE-K [78989‑37‑4] C10H18O2 FW 170.542 W368318-100G 100 g W368318-1KG 1 kg [16493‑80‑4] CH3(CH2)3CH(C2H5)(CH2)2CO2H C10H20O2 FW 172. winelike W244910-SAMPLE-K [3249‑68‑1] CH3CH2CH2COCH2COOC2H5 C8H14O3 FW 158. pineapple. 261  ≥98% 100 g W244910-1KG-K 1 kg Organoleptic: berry. FG FEMA 3156 Flavis 4. Fen.285 CoE Nr 10617 W245100-1KG-K 1 kg Organoleptic: fatty. honey. cider and grape brandy. green Halal. apple. 1340. pineapple. beef. Kosher. coffee.com 49 .48 Organoleptic: waxy Arc.018 CoE Nr 11844 Organoleptic: caramel.20 FEMA 2452 Flavis 9. Palmitic acid ethyl ester [628‑97‑7] FEMA 2451 Flavis 9. see Rum Ether Page 117 FEMA 3800 Flavis 8. Kosher. see 5-Ethyl-2-methylpyridine Page 48 W526304-SAMPLE-K W526304-100G-K 100 g W526304-1KG-K 1 kg W526304-4KG-K 4 kg Feel inspired at safcglobal.1 CoE Nr 2246 Organoleptic: alcohol. 259  ≥98%  ≥95%. 1185. raspberry. see Ethyl valerate Page 51 Ethyl pentyl carbinol. grapefruit. NI W245208-SAMPLE-K W245208-1KG-K 1 kg W245208-5KG-K 5 kg W245208-10KG-K 10 kg Ethyl 3-phenylglycidate  mixture of cis and trans.21 Ethyl palmitate W380008-SAMPLE-K 1 kg W315605-5KG-K  ≥98%. mixture of isomers Ethyl caprylate 4-Ethylphenol [123‑07‑9] C2H5C6H4OH C8H10O FW 122. medicinal Halal.19 Fen. fruity. floral. pineapple Halal.079 Kosher W380008-25G-K 25 g W380008-100G-K 100 g W380008-1KG-K 1 kg Ethyl-trans-2-octenoate Ethyl hexadecanoate.784 CoE Nr 2156 Natural occurrence: Apple.16 [106‑32‑1] FEMA 2449 Flavis 9. Fen. synthetic as antioxidant > Ethyl pelargonate.19 Arc. 228 Arc. FCC Ethyl butyrylacetate W244910-100G-K W315605-1KG-K Arc. cooked beef. 1329. chocolate. guava fruit. green.747 CoE Nr 429 Organoleptic: ethereal. see Ethyl levulinate Page 47 Ethyl oxyhydrate. Organoleptic: anise. 263 Ethyl 3-oxohexanoate  natural. fruity. melon. FG CoE Nr 392 Organoleptic: apricot. pear.25  ≥98% Kosher NI contains 0. melon. Kosher NI W245100-SAMPLE-K  ≥98% W245100-250G-K 250 g FEMA 3643 Flavis 9. apricot. tobacco Halal. floral. earthy. sweet. ≥98%. papaya. ≥95%. cherry.26 [55031‑15‑7] C8H12N2 FW 136. coffee. see Ethyl nonanoate Page 48 Ethyl pentanoate.193 CoE Nr 634 CH3(CH2)14COOC2H5 C18H36O2 FW 284. rum.022 CoE Nr 550 FEMA 3149 Flavis 14. 1325 [7367‑82‑0] CH3(CH2)4CH=CHCO2C2H5 C10H18O2 FW 170.25 Halal. corn. Swiss cheese. cheese. cocoa. Organoleptic: almond. grapefruit.Ethylpicoline Ethyl octanoate 2-Ethyl-3(5 or 6)-dimethylpyrazine. 1339. pear. 264 W245402-SAMPLE  ≥95%. Fen. NI  ≥98%. peanut.23 Arc.10% alpha-tocopherol. pineapple. see 2-Octanol Page 100 3-Octanol Page 100 Ethyl pentyl ketone. NI W314900-SAMPLE-K W314900-100G-K 100 g W314900-250G-K 250 g W314900-1KG-K 1 kg CoE Nr 392c Kosher Organoleptic: banana. rose.

265 Ethyl sorbate [536‑78‑7] C7H9N FW 107. 268  ≥98% FEMA 2460 Flavis 9. fruity.13 Arc.21 CoE Nr 745 Organoleptic: green.17 Arc.SAFC® Flavors & Fragrances Ethylpropionate Ethyl propionate 3-Ethylpyridine [105‑37‑3] FEMA 2456 Flavis 9. Fen.121 CH3CH2COOC2H5 C5H10O2 FW 102. FCC FEMA 2458 Flavis 9. FG Arc. FCC. Fen. Kosher Organoleptic: fruity. Kosher. dried bonito. 1356. FG  ≥97%. 1352. 268 W245712-100G-K 100 g  ≥98% W328103-100G-K 100 g W245712-1KG-K 1 kg FEMA 3282 Flavis 12. meaty. Fen.15 Ethyl trans.trans-2. see 2-Ethylbenzenethiol Page 43  ≥99%. see Ethyl myristate Page 48 Ethyl thioacetate [625‑60‑5] CH3COSC2H5 C4H8OS FW 104.018 CoE Nr 11665 W328103-250G-K 250 g W245712-5KG-K 5 kg W328103-1KG-K 1 kg Organoleptic: coffee. woody. FG W245909-SAMPLE-K [111‑61‑5] CH3(CH2)16COOC2H5 C20H40O2 FW 312.022 CoE Nr 2213 W245909-100G-K Arc. sweet. vegetable Halal. krill. 1348. peanut. 266 [2396‑84‑1] CH3CH=CHCH=CHCO2C2H5 C8H12O2 FW 140.17 W328200-100G 100 g W328200-1KG 1 kg Arc. 1351. smoky. ≥95% Organoleptic: fruity. see Diethyl sulfide Page 35 Ethyl tetradecanoate. Stearic acid ethyl ester [617‑35‑6] FEMA 2457 Flavis 9.194 CoE Nr 635 Ethyl stearate Ethyl pyruvate W245704-SAMPLE 2-Ethylpyrazine  ≥97% Fen. nutty Halal. Kosher Organoleptic: butter. FG CoE Nr 402c Halal. fruity Halal W246018-SAMPLE 50 Place an order with your local SAFC representative (see back for contacts). 265 FEMA 2459 Flavis 9. wine-like.061 CoE Nr 11386 CoE Nr 402 Halal. 266  natural. earthy Halal.14 5 kg Organoleptic: waxy NI W349003-SAMPLE W245704-250G 250 g W245704-1KG 1 kg W245704-10KG 10 kg W245704-25KG 25 kg W349003-250G 250 g W349003-1KG 1 kg W349003-5KG 5 kg > Ethyl sulfide. see 2-Ethylpyrazine Page 50 Ethylpyrazine [13925‑00‑3] C6H8N2 FW 108. FCC. ethereal W245615-SAMPLE-K W245615-100G-K 100 g W245615-1KG-K 1 kg W245615-5KG-K 5 kg > Ethyl propyl carbinol. sweet. musty. Kosher. fruity. raspberry. sweet Halal. wine-like W245607-SAMPLE-K Natural occurrence: Coffee.442 CH3COCOOC2H5 C5H8O3 FW 116. sweet. see 3-Hexanone Page 60 Ethylpyrazine.53 Arc. NI Ethyl octadecanoate. garlic) NI W328103-5KG-K 5 kg Ethyl salicylate W328200-SAMPLE Ethyl 2-hydroxybenzoate W328200-25G 25 g [118‑61‑6] 2-(HO)C6H4CO2C2H5 C9H10O3 FW 166. NI Ethyl trans-2-methyl-2-butenoate W245801-SAMPLE-K W245801-1KG-K 1 kg W245801-10KG-K 10 kg W245801-25KG-K 25 kg [5837‑78‑5] CH3CH=C(CH3)CO2C2H5 C7H12O2 FW 128. alliaceous (onion. NI Organoleptic: caramel.748 CoE Nr 432 Ethyl tiglate Organoleptic: floral. Organoleptic: caramel. pineapple.17 W245712-SAMPLE-K W328103-SAMPLE-K 1 kg W245909-5KG-K FEMA 3490 Flavis 9. ethereal Kosher.12 Fen. coffee. musty. 1344. Kosher. tea and Virginia tobacco. vegetable. cooked chicken. Kosher. ≥97%. W246018-100G 100 g W246018-1KG 1 kg W246018-5KG 5 kg . Fen. see 3-Hexanol Page 60 Ethyl propyl ketone.4-hexadienoate Fen. Fen. Fen. minty. 1350.495 CoE Nr 2185 Organoleptic: caramel. NI Organoleptic: ethereal. vegetable. tobacco. 267 FEMA 3394 Flavis 14. NI 100 g W245909-1KG-K  ≥97% CoE Nr 430 CoE Nr 430c FEMA 3281 Flavis 14. balsamic Halal. NI W339407-SAMPLE-K W245607-1KG-K 1 kg W245607-10KG-K 10 kg W339407-100G-K 100 g W245607-20KG-K 20 kg W339407-1KG-K 1 kg W339407-5KG-K 5 kg  natural. 258  ≥97%  ≥98%.18  ≥98%. 267 > 2-Ethylthiophenol.

Fen. see Eucalyptus oil citriodora Page 51 Organoleptic: apple Halal. laurel. Kosher. 4-Allylguaiacol [97‑53‑0] FEMA 2467 Flavis 4.24  ≥98%. 271  ≥97% FEMA 3492 Flavis 9. see Eucalyptus oil Page 51 Eucalyptus globulus Labillardiere. FG W530089-SAMPLE-K FEMA 3382 Flavis 7.3.019 CoE Nr 108 Organoleptic: sweet. see Clove bud oil Page 30 W338206-25G-K 25 g W349208-1KG 1 kg W338206-80G-K 80 g W349208-4KG 4 kg W338206-1KG-K 1 kg Eucalyptol 1. minty. NI Arc.147 CH3(CH2)3COOC2H5 C7H14O2 FW 130. rosemary and sweet marjoram. vanilla. 616. see 1-Penten-3-ol Page 105 Feel inspired at safcglobal. FCC W246700-1KG-K FEMA 2465 Flavis 3. see Eucalyptus oil Page 51 Eucalyptus maculata Citriodora. vanilla Halal. radiata Undecanoic acid ethyl ester 1-Penten-3-one [627‑90‑7] CH3(CH2)9CO2C2H5 C13H26O2 FW 214.274 CoE Nr 10633 Organoleptic: coconut NI W349208-SAMPLE Kosher  ≥95%. fruity. 272 Kosher  natural. clove. 273 W246700-SAMPLE-K W246107-SAMPLE  ≥99%.3-Trimethyl-2-oxabicyclo[2. waxy. NI Ethyl pentanoate W246506-SAMPLE-K [539‑82‑2] FEMA 2462 Flavis 9. pepper. 271 [470‑82‑6] C10H18O FW 154. FCC Organoleptic: balsam. Fen. Organoleptic: citrus. Kosher. 1360. FG 1 kg W530165-5KG-K Eucalyptus maculata Citriodora 5 kg [85203‑56‑1] Kosher China origin W523402-SAMPLE-K W523402-1KG-K 1 kg W523402-9KG-K 9 kg W523402-20KG-K 20 kg 51 . cranberry.12 Arc. fruity. 1359. Kosher. spicy. 274  ≥98%.18 W246506-1KG-K 1 kg W246506-10KG-K 10 kg W246506-20KG-K 20 kg Arc.8Epoxy-p-menthane. Fen. ≥98%. woody. fruity Arc.25 Halal.17 FEMA 2464 Flavis 5. FCC W246719-SAMPLE-K W246905-SAMPLE-K  80-85% Arc. 1369. herbaceous. fruity W246215-1KG-K W246215-100G-K W246215-SAMPLE-K Ethylvanillin. 1. see Ethyl vanillin Page 51 Ethyl vinyl carbinol. pepper Kosher. 1361.2.Evening primrose oil Ethyl undecanoate Ethyl vinyl ketone Eucalyptus oil. Fen. spicy Arc. FG Organoleptic: musty.003 CoE Nr 171 4-(H2C=CHCH2)C6H3-2-(OCH3)OH C10H12O2 FW 164. FCC W246603-1KG-K Ethyl vanillin  natural. sweet.20 Organoleptic: cinnamon. 641 W349208-100G  ≥97% 8 [92201‑64‑4] 2-Methoxy-4-(2-propenyl)phenol. NI W246204-SAMPLE-K W246204-1KG-K 1 kg W246204-9KG-K 9 kg W246204-20KG-K 20 kg Yo-shu oil. ≥98% FEMA 2469 Flavis 9. NI contains BHT as stabilizer > Eugenia spp.8-Cineole FEMA 2461 Flavis 9. Fen. 272  ≥98%. FG CoE Nr 465 > Eucalyptus Globulus Labilardiere. Fen. Kosher W246409-1KG-K 1 kg W246409-10KG-K 10 kg W246409-25KG-K 25 kg > Ethylvanillin.02 CoE Nr 210 Eucalyptus oil [84625‑32‑1] FEMA 2466  natural (US). 274 1 kg W246905-5KG-K 5 kg W246603-SAMPLE-K W246905-10KG-K 10 kg 1 kg W246603-5KG-K 5 kg W246603-10KG-K 10 kg > Eugenyl methyl ether.2]octane. see Methyl eugenol Page 86 Eugenyl acetate [93‑28‑7] C12H14O3 FW 206. see Methyl eugenol Page 86 Methyl eugenol Page 86 Evening primrose oil [90028‑66‑3] W246611-1KG-K 1 kg W246611-5KG-K 5 kg W246611-10KG-K 10 kg  Certified organic (NOP/EU) from (Oenothera biennis) Kosher China origin W530165-SAMPLE-K Eucalyptus oil citriodora W246409-SAMPLE-K W246719-1KG-K W246905-1KG-K W246611-SAMPLE-K  ≥98%.001 CoE Nr 182 W246700-5KG-K 5 kg W246700-10KG-K 10 kg W246107-100G 100 g W246107-1KG 1 kg W246107-4KG 4 kg Ethyl valerate Natural occurrence: Cardamom. fatty. clove.. sweet Kosher NI Arc. 14.34 [1629‑58‑9] C2H5COCH=CH2 C5H8O FW 84. 121 China origin Kosher Organoleptic: apple.com 1 kg W246719-5KG-K 5 kg W246719-10KG-K 10 kg > Eugenol methyl ether. 4-Allyl-2-methoxyphenol. 1363. 1. Fen.102 CoE Nr 11179 W530089-1KG-K Organoleptic: vegetable Halal. Eucalyptus globulus Labillardiere Kosher Fen. FCC. 70-75%. 3-Ethoxy-4-hydroxybenzaldehyde [121‑32‑4] C2H5OC6H3(OH)CHO C9H10O3 FW 166.237 CoE Nr 2102 1 kg Eugenol W338206-SAMPLE-K 100 g Ethyl 10-undecenoate  Certified organic (NOP/EU) Fen.

orange. 2-Acetylpyrazine (Aldrich W312606) 5-10 g 2-Acetylpyridine (Aldrich W325104) 5-10 g 2-Acetylthiazole (Aldrich W332801) 5-10 g 2-Acetylthiophene (Aldrich W503509) 5-10 g 2. 277 from Foeniculum vulgare Mill. clove.29  ≥85% Arc.11-Trimethyl-2.5. see Fenchyl alcohol Page 52 (−)-Fenchone.5-Trimethylthiazole (Aldrich W332518) 5-10 g W600024-1KT 1 kit . Organoleptic: anise.Canadian W518301-100G 100 g W518301-1KG 1 kg W518301-5KG 5 kg > Fir balsam. floral. grape.37  FCC Arc.3-Trimethylbicyclo[2.25 W248010-1KG-K W383902-SAMPLE-K 52 Fir needle oil. Organoleptic: herbaceous. lime.3.35 FEMA 3839 Flavis 1. 278  ≥96% FEMA 2480 W248010-SAMPLE-K 100 g W248010-5KG-K 5 kg 1 kg W248010-10KG-K 10 kg W383902-4KG-K 4 kg Fennel oil [8006‑84‑6] 3.3-Dimethylpyrazine (Aldrich W327107) 5-10 g 2. 1385 trans-4-Hydroxy-3-methoxycinnamic acid  ≥98% [537‑98‑4] HOC6H3(OCH3)CH=CHCO2H C10H10O4 FW 194. 123 [4602‑84‑0] (CH3)2C=CHCH2CH2C(CH3)= CHCH2CH2C(CH3)=CHCH2OH C15H26O FW 222.6. mixture of isomers Fenchyl acetate. herbaceous. sweet. see Balsam fir absolute Page 16 Place an order with your local SAFC representative (see back for contacts).1]heptan-2-one. dulce DC.23 W248606-100G-K 100 g W248606-1KG-K 1 kg Ferulic acid Arc.6. orange peel and oil.4. Organoleptic: apple.3-Trimethyl-2-norbornanone. Heterocycles [84625‑40‑1] from Trigonella foenum-graecum L. orange.10-dodecatrien-1-ol Fen. (1R)-1. ginger thyme beef. see L-Turpentine Page 127 W383902-1KG-K  mixture of isomers. ≥95% [8021‑29‑2] 1 kg W383902-100G-K Farnesol Fir needle oil. Kosher.5-Dimethylpyrazine (Aldrich W327204) 5-10 g 2. balsam.3.3. NI W247804-SAMPLE-K W247804-100G-K 100 g W247804-250G-K 250 g W247804-1KG-K 1 kg FEMA 2482 W248207-SAMPLE-K W248207-250G-K 250 g W248207-1KG-K 1 kg W248207-5KG-K 5 kg  natural [7787‑20‑4] C10H16O FW 152. Esters Components Allyl tiglate (Aldrich W204307) 5-10 g Ethyl butyrate (Aldrich W242705) 5-10 g Ethyl heptanoate (Aldrich W243701) 5-10 g Ethyl hexanoate (Aldrich W243906) 5-10 g Ethyl octanoate (Aldrich W244902) 5-10 g Ethyl propionate (Aldrich W245607) 5-10 g Ethyl valerate (Aldrich W246204) 5-10 g Furfuryl butyrate (Aldrich W501700) 5-10 g Furfuryl heptanoate (Aldrich W503304) 5-10 g Furfuryl pentanoate (Aldrich W339709) 5-10 g Furfuryl propionate (Aldrich W334618) 5-10 g Hexyl butyrate (Aldrich W256803) 5-10 g Hexyl tiglate (Aldrich W500909) 5-10 g Isopropyl butyrate (Aldrich W293504) 5-10 g Isopropyl tiglate (Aldrich W322903) 5-10 g Methyl butyrate (Aldrich W269301) 5-10 g Propyl butyrate (Aldrich W293407) 5-10 g Benzyl butyrate (Aldrich W214000) 5-10 g Allyl butyrate (Aldrich W202118) 5-10 g Components W248606-SAMPLE-K (−)-1.and β- 3. 1. green Kosher contains 0. mixture of isomers C15H24 FW 204. Fen. pear.6-Dimethylpyrazine (Aldrich W327301) 5-10 g 4. woody. 1387. lavender. cloves. 1380.3-Diethylpyrazine (Aldrich W313602) 5-10 g 2. Organoleptic: anise. 279 Flavis 5. synthetic as antioxidant FEMA 3390 Flavis 9. (1R)(−)-Fenchone. Fen. mandarin and lime peel. sweet Kosher France origin L-Fenchone W519901-1KG-K W600008 Fenugreek absolute FEMA 2486 > Fat Ponceau G. see L-Fenchone Page 52 5 kg W519901-9KG-K 9 kg Flavors and Fragrances Kit No. grapefruit juice. spicy Kosher Spain origin FEMA 2478 Flavis 2.269 CoE Nr 11769 W523518-SAMPLE-K Organoleptic: sweet NI W523518-1KG-K 1 kg W523518-5KG-K 5 kg W339008-SAMPLE W339008-1KG 1 kg W339008-5KG 5 kg W339008-10KG 10 kg Fenchyl alcohol 8 Fenchol Arc.5-Dimethylthiazole (Aldrich W327409) 5-10 g 2-Ethoxythiazole (Aldrich W334006) 5-10 g 2-Ethyl-3-methylpyrazine (Aldrich W315508) 5-10 g 2-Ethylpyrazine (Aldrich W328103) 5-10 g 2-Furyl methyl ketone (Aldrich W316318) 5-10 g 2-Isobutyl-3-methoxypyrazine (Aldrich W313203) 5-10 g 2-Isobutylthiazole (Aldrich W313408) 5-10 g 2-Methoxy-3-methylpyrazine (Aldrich W318302) 5-10 g 2-Methoxypyrazine (Aldrich W330205) 5-10 g 2-Methylpyrazine (Aldrich W330906) 5-10 g Methyl 2-pyrrolyl ketone (Aldrich W320218) 5-10 g 4-Methylthiazole (Aldrich W371602) 5-10 g 2.6-Tetramethylpyrazine (Aldrich W323705) 5-10 g Thiazole (Aldrich W361518) 5-10 g 2. whiskey basil. anise seed and balsam of Peru. pear Halal. grapefruit.3.18 Organoleptic: sweet. Fen. oily. vanilla Kosher  ≥99% W518301-SAMPLE W507709-SAMPLE-K W507709-100G-K 100 g W507709-1KG-K 1 kg W507709-5KG-K 5 kg > (1R)-(−)-Fenchone.3-Trimethyl-2-norbornanyl acetate [8021‑28‑1] [19317‑11‑4] C15H24O FW 220.3.029 CoE Nr 78 Natural occurrence: Apricot. mixture of α.10% alpha-tocopherol. see L-Fenchone Page 52 from Abies sibirica Ledeb.35 [13851‑11‑1] C12H20O2 FW 196. see Sudan IV Page 120 Fat Soluble Sudan. nutmeg and basil.SAFC® Flavors & Fragrances Farnesalmixture Farnesal. 1386. (−)-Fenchone 1 kg W519901-5KG-K Flavors and Fragrances Kit No. ginger. var.7. grapefruit juice. Kosher Russia origin Siberian origin > Fir oil.148  ≥96% from Abies balsamea Kosher Canada origin W401900-SAMPLE W401900-25G 25 g W401900-100G 100 g W401900-1KG 1 kg Farnesene.11-Trimethyl-2.7. see Sudan III Page 120 Fenchol. apricot.5-Trimethylpyrazine (Aldrich W324418) 5-10 g 2. see Sudan III Page 120 Fat Ponceau R or 4.2. 2. peach.04 Natural occurrence: Apple.10-dodecatrienal 1. Siberian W519901-SAMPLE-K [1632‑73‑1] C10H18O FW 154. papaya.

NI Organoleptic: banana Halal. 284  ≥98% FEMA 2491 Flavis 13.025 CoE Nr 25 CoE Nr 2065 Organoleptic: sour Kosher. 284  ≥99%. 283 > Formic acid butyl ester. see Methyl formate Page 86 4-Formyl-2-methoxyphenyl acetate. fruity Kosher W249106-1KG-K Fen. see 3-Furancarboxaldehyde Page 53 Furan-2-carboxaldehyde. Frankincense. sweet. Fen. horseradish. 1416. NI  ≥98% FEMA 3161 Flavis 13. see Furfural Page 53 3-Furancarboxaldehyde from (Linum usitatissimum) Kosher China origin [498‑60‑2] C5H4O2 FW 96. Fen. see 4-Hydroxy-2.13 CoE Nr 638 Organoleptic: grape Kosher. Kosher.051 CoE Nr 4112  FCC. Beverage Study Fumaric acid Furfuryl acetate [110‑17‑8] HOOCCH=CHCOOH C4H4O4 FW 116. NI Arc. Fen. alliaceous (onion. ≥98%. 280 W315818-100G-K 100 g W315818-1KG-K 1 kg W248703-5KG-K 5 kg W248703-10KG-K 10 kg W248703-25KG-K 25 kg Frankincense oil 8 Olibanum oil. 3.10 Arc.001 CoE Nr 1 W315818-25G-K 25 g Halal.14 3-Ethylpyridine (Aldrich W339407) 5-10 g Isoamyl acetate (Aldrich W205508) 5-10 g trans-2-Nonenal (Aldrich W321303) 5-10 g Hexanoic acid (Aldrich W255904) 5-10 g Acetic acid (Aldrich W200611) 5-10 g Eugenol (Aldrich W246700) 5-10 g Phenol (Aldrich W322318) 5-10 g Isovaleric acid (Aldrich W310204) 5-10 g Lactic acid (Aldrich W261106) 5-10 g Octanoic acid (Aldrich W279900) 5-10 g Heptyl acetate (Aldrich W254703) 5-10 g Isoamyl hexanoate. FCC  ≥98%. 282 Arc. Boswellia carterii [8016‑36‑2] 5 kg Furfuryl alcohol 2-(Hydroxymethyl)furan [98‑00‑0] C5H6O2 FW 98.. garlic) W248908-5KG-K 5 kg W316105-SAMPLE W248908-10KG-K 10 kg W316105-25G 25 g W248908-25KG-K 25 kg W316105-100G 100 g W316105-1KG 1 kg W248908-1KG-K  natural.032 CoE Nr 2248 W248908-SAMPLE-K 1 kg Organoleptic: meaty.19 Flavis 13. see Vanillin acetate Page 129 Framidice 3. mixture of isomers (Aldrich W207500) 5-10 g m-Cresol (Aldrich W353000) 5-10 g Furfuryl mercaptan (Aldrich W249300) 5-10 g 4-Ethylguaiacol (Aldrich W243604) 5-10 g Methyl cyclopentenolone (Aldrich W270008) 5-10 g 2. woody. NI W600016-1KT W501603-SAMPLE Components 1 kit Flax seed oil 8 Linseed oil [8001‑26‑1] W249009-SAMPLE-K W248800-1KG-K 1 kg W249009-1KG-K W248800-10KG-K 10 kg W249009-5KG-K 5 kg W248800-25KG-K 25 kg W249009-10KG-K 10 kg > 2-Furaldehyde. NI W501700-100G-K 100 g W501700-1KG-K 1 kg [98‑01‑1] FEMA 2489 Flavis 13.128 C7H8O3 FW 140. sweet Kosher. FCC [1883‑78‑9] C8H12OS FW 156. ≥98% Halal. 1413. coffee.08 W501700-5KG-K 5 kg Furfuryl isopropyl sulfide  ≥98%. coffee.07 [623‑17‑6] FEMA 2490 Flavis 13. Organoleptic: butterscotch. FCC FEMA 2816 Kosher Organoleptic: almond.019 CoE Nr 2023 1 kg W249106-5KG-K 5 kg W249106-10KG-K 10 kg W249106-25KG-K 25 kg Furfuryl butyrate [623‑21‑2] C9H12O3 FW 168. Kosher Formic acid  natural.018 C5H4O2 FW 96. see Ethyl formate Page 45 Formic acid methyl ester. FG W315818-SAMPLE-K FEMA 2487 Flavis 8.5-dimethyl-3(2H)-furanone Page 65 2-Furanmethanethiol. see Frankincense oil Page 102 Olibanum oil Page 102 W249017-100G-K  ≥99% W248703-SAMPLE-K 1 kg Organoleptic: banana.03 W248703-1KG-K CoE Nr 2065c W249106-SAMPLE-K [59020‑90‑5] C6H6O2S FW 142. 1415.08  ≥97% W501603-25G 25 g W501603-100G 100 g W501603-1KG 1 kg 5 kg > Foeniculum vulcare Mill. see Bis(methylthio) methane Page 19  ≥97% FEMA 3158 Flavis 13. see Furfural Page 53 3-Furaldehyde. Furan-2-carboxaldehyde  Certified organic (NOP/EU) Kosher 100 g W249017-1KG-K W501700-SAMPLE-K Furfural Arc. 1411.25 CoE Nr 2014 Fen.6-Dimethoxyphenol (Aldrich W313718) 5-10 g Benzaldehyde (Aldrich W212709) 5-10 g Butyric acid (Aldrich W222100) 5-10 g Ethyl hexanoate (Aldrich W243906) 5-10 g 2. Fen. 286 Organoleptic: almond. woody W248924-SAMPLE-K W281623-SAMPLE-K W281623-1KG-K 1 kg W249017-5KG-K 2-Furaldehyde. Kosher. 282 [64‑18‑6] HCOOH CH2O2 FW 46. see Butyl formate Page 22 Formic acid ethyl ester. see Furfuryl mercaptan Page 54  Certified organic (NOP/EU) W530238-5KG-K W248800-SAMPLE-K 1 kg Feel inspired at safcglobal. 1410. NI 2-Furanmethanethiol formate W530238-SAMPLE-K 1 kg W249017-SAMPLE-K 3-Furaldehyde > Furaneol. tropical.18 Natural Occurrence: Cooked chicken.Furfurylisoprop Flavors and Fragrances Kit No. see Fennel oil Page 52 Formaldehyde dimethyl mercaptal. Fen. FG FEMA 2488 Flavis 8.3-Pentanedione (Aldrich W284106) 5-10 g Acetoin (Aldrich W200808) 5-10 g Arc. ethereal Halal. Kosher. wine-like.com W248924-1KG-K 1 kg W248924-5KG-K 5 kg W248924-10KG-K 10 kg 53 . see N-Ethyl-2-isopropyl-5-methylcyclohexanecarboxamide Page 47 Frankincense.

roasted almonds and peanuts. see Tannic acid Page 121 Garlic oil. FG FEMA 3346 Flavis 13. Furfuryl valerate [36701‑01‑6] C10H14O3 FW 182. garlic) Kosher W250104-5KG 5 kg W334707-SAMPLE-K > Gallotannin. roasted chicken. 289 Arc.068 CoE Nr 10647 Organoleptic: musty. nutty Kosher. 1421 Arc. Kosher. nutty. roasted pork.063 CoE Nr 11484 W250104-1KG 1 kg Organoleptic: coffee. potato. cooked beef. Fen.033 CoE Nr 2250 [1438‑91‑1] C6H8OS FW 128. coffee.22 Fen. herbaceous. 13  ≥99%. Darkens on storage Organoleptic: caramel. see Furfuryl mercaptan Page 54 [1438‑94‑4] C9H9NO FW 147. cooked beef and pork. % Diallyl trisulfide (FEMA #3265) 5-13 wt.2′-(Thiodimethylene)difuran Page 123 Furfuryl thioacetate  ≥97% W316318-1KG-K [13678‑68‑7] C7H8O2S FW 156. NI W328308-SAMPLE-K W328308-100G-K 100 g W328308-1KG-K 1 kg W328308-5KG-K 5 kg > Furfuryl methyl disulfide. 39. 290 Fen. earthy. % Diallyl disulfide (FEMA #2028) 10-13 wt. coffee FEMA 3160 Flavis 13. spicy Halal. coffee. 289  ≥97% FEMA 3397 Flavis 13. yogurt and wheat bread.19 W249408-SAMPLE-K W334618-100G-K 1-Furfurylpyrrole W249300-SAMPLE-K W249300-1KG-K W334618-SAMPLE-K > S-Furfuryl thioacetate. NI Organoleptic: woody.053 CoE Nr 11482 Organoleptic: coffee Kosher NI W316202-25G-K 25 g W316202-100G-K 100 g W316202-1KG-K 1 kg W316008-SAMPLE-K 25 g W316008-100G-K 100 g W316008-1KG-K 1 kg Furfuryl pentanoate 2-Furfuryl pentanoate. spicy.17 Fen. 290 2-Furyl methyl ketone  ≥98% Furfuryl 3-methylbutanoate 2-Acetylfuran FEMA 3284 Flavis 13.5 kg 100 g W334618-1KG-K 1 kg W249408-100G-K 100 g W334618-5KG-K 5 kg W249408-1KG-K 1 kg W249408-5KG-K 5 kg > 2-Furylmethanethiol.17 Fen. chocolate. fruity NI W339709-SAMPLE W339709-100G 100 g W339709-1KG 1 kg W339709-5KG 5 kg 1 kg  natural (US). 288 CoE Nr 4113 S-Furfuryl thioacetate FEMA 3162 Flavis 13. % Allyl disulfide (FEMA #2042) Kosher W530316-SAMPLE-K W530316-1KG-K 54 Place an order with your local SAFC representative (see back for contacts).057 CoE Nr 10642 Organoleptic: berry Kosher. NI Fen. 2-Furylmethanethiol [623‑19‑8] C8H10O3 FW 154. 287  ≥98%. green Kosher NI [13678‑60‑9] C10H14O3 FW 182.034 CoE Nr 2252 FEMA 2493 Flavis 13. cocoa. see Furfuryl pentanoate Page 54  artificial 30-50 wt. garlic). ≥97%. meaty Halal. FG  ≥99%  ≥97%.11 Organoleptic: vegetable. see Furfuryl pentanoate Page 54 Furfuryl pentanoate Page 54 > 2-Furfuryl pentanoate. NI Fen.5KG-K 1 kg 2. sulfurous. coffee. FG W328405-SAMPLE-K FEMA 3283 Flavis 13.134 CoE Nr 2317 [1192‑62‑7] FEMA 3163 Flavis 13.16 [623‑30‑3] C7H6O2 FW 122. Organoleptic: almond. 291 Natural occurrence: Coffee. 1 kg W530316-5KG-K 5 kg W530316-10KG-K 10 kg . Fen. see Furfuryl thioacetate Page 54 W316315-100G-K W316315-500G-K W316315-SAMPLE-K Galbanum oil [8023‑91‑4] FEMA 2501 Furfuryl thiopropionate [59020‑85‑8] C8H10O2S FW 170. FG W316202-SAMPLE-K W316008-25G-K Natural occurrence: Burley tobacco.026 CoE Nr 2202 Organoleptic: floral. see Methyl furfuryl disulfide Page 86 Furfuryl methyl sulfide W328405-25G-K 25 g W328405-100G-K 100 g W328405-1KG-K 1 kg > Furfuryl sulfide.22 Fen. 291 W250104-SAMPLE  ≥98% W250104-100G 100 g FEMA 3347 Flavis 13. caramel. see Garlic oil blend Page 54 W334707-25G-K 25 g W334707-100G-K 100 g W334707-1KG-K 1 kg Garlic oil blend 8 Garlic oil [8000‑78‑0] > Furfuryl valerate. 1417. fishy. tobacco Halal. smoky. tea. sweet.054 C6H6O2 FW 110. beef. 286  ≥98% Arc. Kosher. see 2. raisins. chestnuts. waxy. tamarind.062 CoE Nr 10646 FEMA 2494 Flavis 13. NI W249300-2. Kosher. and popcorn. alliaceous (onion.20 W316318-5KG-K 5 kg  ≥98% W316318-10KG-K 10 kg Kosher Organoleptic: cocoa. oily.12 [98‑02‑2] C5H6OS FW 114. alliaceous (onion.23 from synthetic Fen. NI W316318-SAMPLE-K Kosher. musty.SAFC® Flavors & Fragrances Furfurylmercapt Furfuryl mercaptan Furfuryl propionate 3-(2-Furyl)acrolein 2-Furanmethanethiol.

23  85% FEMA 4121 Flavis 8. wine. FG 1 kg Organoleptic: apple.. Fen.. floral.. rose.. <30% W250716-SAMPLE-K W250716-1KG-K 1 kg W250716-4KG-K 4 kg W250716-9KG-K 9 kg W250406-SAMPLE-K W250406-25G-K 25 g W250406-100G-K 100 g Genet extract 8 [90131‑21‑8] Geranium absolute 8 Geranium oil  natural FEMA 2505 W530376-SAMPLE-K from Spartium junceum L. sweet Halal... rose. trans-3. FG [106‑29‑6] FEMA 2512 Flavis 9. green.. sweet Kosher NI W251402-SAMPLE-K > Geranium oil.. see 6... sweet Halal. 295 Geranyl butyrate [8000‑46‑2] from Pelargonium graveolens Kosher W250500-10G [105‑87‑3] FEMA 2509 Flavis 9..1 Natural occurrence: tea. see 4-Hydroxybutanoic acid lactone Page 65 Genet absolute W250708-1KG-K 1 kg W250708-9KG-K 9 kg W250708-20KG-K 20 kg  natural. 33. Flavor.9-undecadien-2-one Page 40  FCC CoE Nr 274 Organoleptic: apple. synthetic as antioxidant Lit. Kosher China origin Arc.... cited: 1.. sweet  natural trans-3. Mosciano. 66 (2008) W412101-SAMPLE-K W412101-100G-K 100 g W412101-1KG-K 1 kg W250902-SAMPLE-K W250902-1KG-K 1 kg W250902-5KG-K 5 kg W250902-10KG-K 10 kg Organoleptic: lavender. honey. rose.011 CoE Nr 201 CH3CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2 C12H20O2 FW 196. FCC. berry.. 294  ≥97%. Fen.. Fen.. NI W250309-5KG-K 5 kg W250708-SAMPLE-K W250309-10KG-K 10 kg W250309-SAMPLE-K W250309-1KG-K > GBL.7-Dimethyl-2. 296 FEMA 2514 Flavis 9. ripe fruit and melon notes. spicy Kosher France origin β-citronellol . fruity.. 296 W250500-SAMPLE Geranium extract  FCC. Gerard. rose..6-octadien-1-ol FEMA 2503 [106‑24‑1] FEMA 2507 Flavis 2. see Geranium absolute Page 55 Geranium oil.. floral. Kosher... minty.34  natural.... cranberry.. NI Organoleptic: lemon. <35% W251208-SAMPLE-K  natural..... east-Indian.. sweet Kosher.. 1446.. apricot.. see Citral Page 28 from Pelargonium graveolens Kosher Organoleptic: floral 3.26 from Pelargonium graveolens Kosher China origin  FCC Arc.1 Kosher.10% alpha-tocopherol.. Perfum. Organoleptic: apple.. FCC Kosher Organoleptic: fruity..6-octadienoic acid [459‑80‑3] (CH3)2C=CHCH2CH2C(CH3)=CHCO2H C10H16O2 FW 168..6-octadien-1-yl acetate W530382-SAMPLE-K W251208-1KG-K 1 kg W251208-4KG-K 4 kg W251208-9KG-K 9 kg  natural W530382-25G-K 25 g W530382-100G-K 100 g > Geranium oil. Chinese Page 55 CoE Nr 274c Organoleptic: apple.081 Possible uses: orange... fruity.. see Palmarosa oil Page 104 Feel inspired at safcglobal. raspberry.10-Dimethyl-5... Kosher... NI Arc. Fen. citrus. FG 10 g Arc. fruity. tea. 8. NI citronellyl and neryl butyrates .7Dimethyl-2..7-Dimethyl-2... Chinese Geraniol Geranyl acetate  FCC trans-3. tomato.29  natural. rose.. rose.. sweet Kosher W250910-SAMPLE-K W250910-100G-K 100 g W250910-1KG-K 1 kg W250910-5KG-K 5 kg > Geranylacetone. 1426..25 from Allium sativum L.com W251402-1KG-K 1 kg W251402-5KG-K 5 kg W251402-10KG-K 10 kg 55 .. Chinese Geranium oil [8000‑46‑2] W251216-100G-K 100 g W251216-1KG-K 1 kg W251216-4KG-K 4 kg Geranyl formate  natural FEMA 2508 [105‑86‑2] C11H18O2 FW 182. apricot.. FG Geranic acid Organoleptic: fruity.7-Dimethyl-2.048 CH3CH2CH2CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2 C14H24O2 FW 224... wine-like contains 0... 1430.. ≥97% CoE Nr 60 [8023‑80‑1] FEMA 2504 from Spartium junceum L... mint.... Organoleptic: sweet.... honey W530376-100G-K 100 g W530376-1KG-K 1 kg 8 [8000‑46‑2] > Geranial and neral mixture...012 (CH3)2C= CHCH2CH2C(CH3)=CHCH2OH C10H18O FW 154...... berry.Geranylformate Garlic oil. woody... rose... 1436..076 CoE Nr 343 W250813-SAMPLE-K W250813-1KG-K 1 kg W250813-4KG-K 4 kg Organoleptic: green..6-octadienyl acetate.. sweet Kosher W251216-SAMPLE-K Geranium oil.... rose.....

.14 FEMA 3684 Flavis 17... Glycocoll [56‑40‑6] NH2CH2COOH C2H5NO2 FW 75. 1467 from Zingiber officinale Roscoe W252108-SAMPLE W252108-250G 250 g W252108-1KG 1 kg 1 kg W253006-9KG-K  natural Kosher 56 Fen. Fen.. 307 > Glu. Kosher. 1461.149 CoE Nr 409c Arc.005 CoE Nr 173 W251712-25G-K 25 g W512303-10KG-K 10 kg Halal. 138  natural.. melon.... FCC W328707-25KG 25 kg W251607-SAMPLE-K FEMA 3285 W251607-100G-K 100 g > Glycocoll. 301 W328707-10KG 10 kg citronellyl phenylacetate . see L-Glutamine Page 56 W253006-1KG-K Organoleptic: fruity. Kosher W251704-SAMPLE-K W251704-1KG-K 1 kg W251704-5KG-K 5 kg W251704-10KG-K 10 kg [56‑85‑9] H2NCOCH2CH2CH(NH2)CO2H C5H10N2O3 FW 146..453 CoE Nr 448 Organoleptic: apple.31 1 kg W328502-5KG-K 5 kg W328502-10KG-K 10 kg W328502-25KG-K 25 kg > L-Glutamic Grapefruit oil.. sweet Arc. 2-Methoxyphenol. synthetic as antioxidant W251801-SAMPLE-K W251801-1KG-K 1 kg W251801-4KG-K 4 kg W251801-9KG-K 9 kg Geranyl phenylacetate [102‑22‑7] C6H5CH2CO2CH2CH=C(CH3)CH2CH2CH =C(CH3)2 C18H24O2 FW 272.38 Arc. see Tripropionin Page 126 Glycine Aminoethanoic acid.. Fen. Florida FEMA 2530 from Citrus paradisi Macf. blue Page 27 Chamomile oil.07 Fen.09  >99%.. NI contains 0. herbaceous. FG W512303-SAMPLE-K W251712-SAMPLE-K FEMA 2532 Flavis 4. NI Arc. herbaceous.. fruity.. FG Tribenzoin FEMA 2522 FEMA 2518 Flavis 9.5%. Pyrocatechol monomethyl ether [90‑05‑1] (CH3O)C6H4OH C7H8O2 FW 124.. 299 [56‑86‑0] HO2CCH2CH2CH(NH2)CO2H C5H9NO4 FW 147... 308 Kosher  natural... see Diacetin Page 34 Glyceryl triacetate......812 W252204-250G-K 250 g W252204-1KG-K 1 kg W252204-4KG-K 4 kg W252204-5KG-K 5 kg W252204-10KG-K 10 kg > Glyceryl tripropionate.. Fen.5-Diamino-5-oxopentanoic acid.5%. Kosher China origin  FCC  95% FEMA 3398 Flavis 9. (S)-2-Aminopentanedioic acid Organoleptic: honey.37 Arc. spicy Halal. Kosher Organoleptic: medicinal. Glycerin [56‑81‑5] HOCH2CH(OH)CH2OH C3H8O3 FW 92.. see Chamomile absolute Page 27 Chamomile oil.10% alpha-tocopherol. see Cognac oil Page 30 Cognac oil Page 30 Guaiacol Catechol monomethyl ether. see L-Glutamic acid Page 56 D-Glucitol.. Kosher Fen.SAFC® Flavors & Fragrances Geranylisovaler Geranyl isovalerate > Glycerol diacetate. 1454 from (Zinziber officionale roscoe) Organoleptic: lemon.14 Flavis 5. ≥98%. 1466. see Glycine Page 56 Kosher.2. see Glycerol Page 56 > German chamomile. FG.. 1 kg W253200-5KG-K 5 kg W253200-10KG-K 10 kg W253200-25KG-K 25 kg . see Triacetin Page 125 Ginger oil [109‑20‑6] (CH3)2CHCH2CO2CH2CH= C(CH3)CH2CH2CH=C(CH3)2 C15H26O2 FW 238. rose..13 W328707-SAMPLE W328707-1KG 1 kg Arc.. 306 W339806 W252204-SAMPLE-K L-Glutamic [614‑33‑5] C6H5CO2CH(CH2O2CC6H5)2 C24H20O6 FW 404..3-Propanetriol... 299 L-Glutamine  FCC (S)-2.  ≥95%. FCC  natural FEMA 2525 FEMA 2521 Kosher.... vegetable Halal. rose Halal. L-Glutamic acid 5-amide CoE Nr 409 Halal. Fen. woody... 25%  ≥98. FCC. Aminoacetic acid. see D-Sorbitol Page 119  ≥98. 1456. FCC FEMA 3287 Flavis 17.. rose..034 CoE Nr 4118 acid Organoleptic: sweet NI FEMA 2516 Flavis 9.41 W252506-SAMPLE-K W252506-1KG-K 1 kg W252506-10KG-K 10 kg W252506-25KG-K 25 kg Place an order with your local SAFC representative (see back for contacts). berry.. citrus. NI W251607-1KG-K 1 kg W328502-SAMPLE-K W251607-5KG-K 5 kg W328502-1KG-K Geranyl propionate [105‑90‑8] FEMA 2517 Flavis 9. smoky W251712-100G-K 100 g W512303-25KG-K 25 kg W253200-SAMPLE-K W251712-1KG-K 1 kg W512303-1KG-K 1 kg W253200-1KG-K > Glycerin. woody. 298 [8007‑08‑7] Glyceryl tribenzoate Fen. German Page 27 Ginger extract 8 [84696‑15‑1] Glycerol 1. Kosher Florida origin W253006-SAMPLE-K acid 5-amide. 1472.704 CoE Nr 231 Glu.007 W368401-1KG 1 kg Glutaric dialdehyde solution 9 kg W253006-20KG-K 20 kg > Grape seed oil.128 C2H5CO2CH2CH=C(CH3)CH2CH2CH=C(CH3)2 C13H22O2 FW 210.

045 CoE Nr 554 Organoleptic: oily. 315 W316407-SAMPLE-K W316407-100G-K 100 g W316407-250G-K 250 g W316407-1KG-K 1 kg  ≥97% FEMA 3288 Flavis 2.40 W254304-100G-K Heptyl mercaptan. sweet Halal. butter. oily.27 Organoleptic: caramel. Enanthic acid Heptanal Kosher 100 g W254304-1KG-K [1639‑09‑4] CH3(CH2)6SH C7H16S FW 132. 1500. 1 kg W254304-5KG-K Oenanthic acid.028 CH3(CH2)5COOH C7H14O2 FW 130. 314 ≥99. from Helichrysum italicum Kosher Organoleptic: rich.com W328804-250G-K 250 g W328804-1KG-K 1 kg W328804-4KG-K 4 kg W328804-8KG-K 8 kg 57 . Fen.0% (HPLC)  ≥97%.20 Organoleptic: cinnamon. NI Arc. 1504. see Styrax Page 120 Hazelnut ketone. rose and other bases. Fen. Fen. Fen. 47.17 from Bulnesia sarmienti Lor. fruity. FG FEMA 2535 Flavis 9. hazelnut. chypre.1-Dimethoxyheptane Page 36 W334804-1KG-K 1 kg W334804-10KG-K 10 kg W334804-20KG-K 20 kg  natural.27 γ-Heptalactone (±)-4-Heptanolide. 312  ≥98%  ≥98%. muguet. see Heptyl alcohol Page 58 trans. see 1. see Heptanal Page 57 Heptanal dimethyl acetal. 309 Arc. Kosher Organoleptic: rose Paraguay origin  analytical standard.031 CoE Nr 117 W254002-4KG Fragrance: Provides an interesting effect in ambre. Kosher > 1-Heptanal. see Undecanoic acid Page 127  98% FEMA 4259 Flavis 12. nutty Halal. Enanthaldehyde. Oenanthaldehyde. fatty Kosher. honey 5 kg CoE Nr 28  ≥92%. 311 2-Heptanol  ≥88% Methyl pentyl carbinol FEMA 3164 CoE Nr 2123 [543‑49‑7] CH3(CH2)4CH(OH)CH3 C7H16O FW 116. see 5-Methyl-2-hepten-4-one. berry. FCC [90045‑56‑0] Flavor: Modifier for selected fruit flavors.4-Heptadienal W334812-5KG-K 5 kg [4313‑03‑5] C2H5CH=CHCH=CHCHO C7H10O FW 110.02 CoE Nr 2253 W253502-SAMPLE-K W253901-SAMPLE-K W253502-100G-K 100 g W253901-100G-K 100 g W253502-1KG-K 1 kg W253901-1KG-K 1 kg W253502-5KG-K 5 kg W253901-5KG-K 5 kg Heptaldehyde.4-Heptandienal Fen. NI W328804-SAMPLE-K Feel inspired at safcglobal. fatty. NI W254002-1KG 1 kg 8 kg  natural W254002-20KG 20 kg 25 g W530394-100G-K 100 g > Helichrysum oil. Fen. FG 41905 FEMA 2543 Flavis 7. 312 Organoleptic: oily. plum and fig. including raspberry.Heptanol Guaiac wood oil Heptadecanoic acid tryptamide Champaca wood oil 2. FCC. N-Heptadecanoyltryptamine.4-Heptadienal. coconut.13 W425900-SAMPLE W425900-100G 100 g W425900-500G 500 g Heptanoic acid [111‑14‑8] FEMA 3348 Flavis 8. 1494. earthy Kosher. (±)-γ-Propyl-γ-butyrolactone. see trans.711 CoE Nr 238 FEMA 2539 Flavis 10. Margaric acid tryptamide. meaty Kosher Guaicwood acetate Organoleptic: apple. cheese. predominantly trans Page 87 Helichrysum oil 8 Arc. 1502.4-Heptandienal Page 57 W254304-SAMPLE-K W253405-1KG-K 1 kg W253405-10KG-K 10 kg W253405-25KG-K 25 kg Guaiacyl phenylacetate [4112‑89‑4] C6H5CH2CO2C6H4-2-(OCH3) C15H14O3 FW 242. NI C17H28O2 FW 264.trans-2.15 > 1-Heptanol. 1-Heptanal. (±)-Dihydro-5-propyl-2(3H)-furanone [105‑21‑5] C7H12O2 FW 128. Fen. Kosher.17 Arc.18 Arc. see Heptadecanoic acid tryptamide Page 57 2.trans-2. 1477. herbaceous. pineapple Halal. MAT [8016‑23‑7] FEMA 2534 [232257‑97‑5] C27H44N2O FW 412.65 Acetyl valeryl [96‑04‑8] CH3(CH2)3COCOCH3 C7H12O2 FW 128. see Piperonal Page 112 Hendecane. Aldehyde C7 [111‑71‑7] CH3(CH2)5CHO C7H14O FW 114.3-Heptanedione N-[2-(3-Indolyl)ethyl]heptadecanamide. Mercaptan C7 Organoleptic: smoky. fruity.19 W522007-SAMPLE-K W522007-1KG-K 1 kg W522007-5KG-K 5 kg W522007-10KG-K 10 kg > Gum storax. lily. see Immortelle absolute Page 57 Heliotropin. see Undecane Page 127 Hendecanoic acid. 314  97% W334804-SAMPLE-K W254002-SAMPLE 4 kg W530394-25G-K 8 W334804-SAMPLE W254002-8KG W530394-SAMPLE-K 1-Heptanethiol Organoleptic: sour NI FEMA 2540 Flavis 5.064 CoE Nr 2044 W253405-SAMPLE-K > N-Heptadecanoyltryptamine. for food analysis Arc. woody. ≥98% Organoleptic: cheese Kosher W334812-SAMPLE-K W334812-100G-K 100 g W334812-1KG-K 1 kg 2.

1905. Kosher. green. apricot. green. Fen. papaya. 1506. NI W328915-500G-K W254800-1KG-K 1 kg W328915-SAMPLE-K W254800-4KG-K 4 kg cis-4-Heptenal solution 3-Heptanone C7H12O FW 112.021 CoE Nr 70 Organoleptic: vegetable. cabbage. Fen. butter.17 Organoleptic: apricot. 321  ≥98% FEMA 3165 Flavis 5. see γ-Heptalactone Page 57 W316504-SAMPLE-K [110‑43‑0] CH3(CH2)4COCH3 C7H14O FW 114. 316  ≥98%. vanilla. fatty.24  ≥98%. oily. 317  natural. % in triethyl citrate. musty. malt. natural (US) FEMA 3289 W254509-1KG 1 kg 1-Hepten-3-ol W254509-4KG 4 kg Butyl vinyl carbinol W254509-8KG 8 kg [4938‑52‑7] CH3(CH2)3CH(OH)CH=CH2 C7H14O FW 114. FG Methyl pentyl ketone W254711-25G-K W316504-200G-K Arc. fatty. Scotch. coconut. strawberry. butter. spearmint. green. 322 W412901-SAMPLE Arc. ≥98% FEMA 2547 Flavis 9. nutty. fruity. 1503. vegetable. wine-like. fatty. NI FEMA 2545 Flavis 7. dried bonito. citrus. citrus.19 Arc. coffee and brandy.022 CoE Nr 212 [6728‑31‑0] CH3CH2CH=CHCH2CH2CHO C7H12O FW 112.50% alpha-tocopherol. peppermint.044 CoE Nr 544 Natural occurrence: Banana cranberry papaya potato.19 Arc. see Heptyl acetate Page 58 Heptyl alcohol 1-Heptanol [111‑70‑6] CH3(CH2)6OH C7H16O FW 116. Fen.1-0.20 [18829‑55‑5] CH3(CH2)3CH=CHCHO C7H12O FW 112. . coffee. cooked beef. meaty.19 W254908-4KG-K 4 kg  ≥97% W254908-9KG-K 9 kg Kosher W254606-1KG 1 kg W519030-SAMPLE-K W254606-4KG 4 kg W519030-100G-K 100 g W254606-8KG 8 kg W519030-1KG-K 1 kg Place an order with your local SAFC representative (see back for contacts). herbaceous. Fen. Fen. FG cis-4-Heptenal FEMA 2547 Flavis 9. banana. tea. Organoleptic: banana. macadamia nut. 1513. milk.19 4-Heptanone  ≥97% FEMA 4129 Flavis 2.003 CoE Nr 137 W328915-50G-K W254800-SAMPLE-K Organoleptic: ethereal. FG FEMA 2544 Flavis 7. peppermint. Organoleptic: apple. FCC. vegetable. meaty Kosher. cinnamon. synthetic as antioxidant W254703-4KG-K 4 kg W328901-SAMPLE-K W254401-SAMPLE-K 25 g W254711-100G-K W316504-1KG-K  ≥98%.19 8 kg W254800-20KG-K 20 kg Heptyl butyrate [5870‑93‑9] CH3CH2CH2CO2(CH2)6CH3 C11H22O2 FW 186. 1521. Fen. fruity Halal. peanut.155 Butyrone. apricot. vegetable Kosher. minty Halal. fishy. Organoleptic: apple.17 Arc.29  ≥98% W412901-25G 25 g  ≥97% W412901-100G 100 g FEMA 2546 Flavis 7. Kosher.15 CoE Nr 730 Organoleptic: apple. Scotch spearmint. tobacco.17 Ethyl butyl ketone. Organoleptic: butter. Kosher. FCC. Butyl ethyl ketone [106‑35‑4] CH3(CH2)3COC2H5 C7H14O FW 114. and wine. FCC FEMA 2548 Flavis 2. strawberry. Dipropyl ketone [123‑19‑3] (CH3CH2CH2)2CO C7H14O FW 114. boiled potato. NI W254401-1KG-K 1 kg W254401-8KG-K 8 kg W254401-20KG-K 20 kg 100 g W254711-1KG-K 1 kg Heptyl acetate 200 g 1 kg n-Heptyl acetate W316504-4KG-K 4 kg [112‑06‑1] C9H18O2 FW 158. coffee. FG. pear. 315  ≥95% Kosher Arc. wheat bread.002 CoE Nr 136 Organoleptic: banana. vegetable. 321 W254703-SAMPLE-K FEMA 3289 Flavis 5.022 CoE Nr 212c Arc. sweet Kosher W254908-SAMPLE-K cis-3-Hepten-1-ol W254908-1KG-K 1 kg [1708‑81‑2] C7H14O FW 114. strawberry NI 58 Heptyl acetate trans-2-Heptenal FEMA 2549 Flavis 9. roasted peanut. krill. spicy. fruity. 1090.058 CoE Nr 2034 W412901-1KG 1 kg W254606-SAMPLE W254800-8KG-K Arc. woody. Kosher. nutty. 1513. 1505. sweet Halal. 318 2-Heptanone W328901-100G-K 100 g W328901-200G-K 200 g W328901-1KG-K 1 kg W254703-9KG-K 9 kg W254703-20KG-K 20 kg > n-Heptyl acetate. woody Halal. oily. NI contains 0. 316  96% W254509-SAMPLE  10 wt. minty NI W354708-SAMPLE W354708-100G 100 g W354708-1KG 1 kg W354708-4KG 4 kg > (±)-4-Heptanolide.166 CoE Nr 504 Organoleptic: green. Fen.085 CoE Nr 2124 W254703-1KG-K 1 kg Natural occurrence: Butter. beer. cheese. spicy. mushroom. NI contains 0. butter. 317 Natural occurrence: Baked potato. Fen. 1173. Fen.5% alpha-tocopherol as antioxidant W254711-SAMPLE-K FEMA 3547 Flavis 2. green Natural occurrence: Apple.SAFC® Flavors & Fragrances Heptanol 3-Heptanol Butyl ethyl carbinol [589‑82‑2] CH3(CH2)3CH(OH)CH2CH3 C7H16O FW 116. fish.20  ≥97%. lemon. pineapple. NI Arc.

14 Arc.14 FEMA 3922 25 mg W413201-SAMPLE-K [1222‑05‑5] C18H26O FW 258. synthetic as antioxidant W392200-SAMPLE-K W392200-25G-K 25 g W392200-100G-K 100 g W392200-1KG-K 1 kg Fen. 2. 1575.trans-2.7.4. FCC.10% alpha-tocopherol. Sorbaldehyde [142‑83‑6] CH3CH=CHCH=CHCHO C6H8O FW 96. N-Hexacosanoyltryptamine. NI Organoleptic: herbaceous.com 59 .074 CoE Nr 341 FEMA 2555 Flavis 10. green.trans-2.10% alpha-tocopherol. see 2-Nonanol Page 98 Heptyl methyl ketone. Cerotinic acid tryptamide.28  ≥95% FEMA 4313 W431300-5G 5g W431300-50G 50 g W431300-1KG 1 kg Hexacosanoic acid tryptamide N-[2-(3-Indolyl)ethyl]hexacosanamide.6-Hexamethyl-s-trithiane.trans-2.6.7-Trihydroxy-4-methoxyflavanone. Fen.39 Sorbyl acetate Arc. green NI W520608-SAMPLE W520608-1KG 1 kg W342904-SAMPLE W520608-10KG 10 kg W520608-25KG 25 kg W342904-100G 100 g W342904-1KG 1 kg W342904-4KG 4 kg > Hexahydropyridine. see Piperidine Page 112 Hexahydrothymol. CAT [152766‑96‑6] C36H62N2O FW 538. 328  ≥98% FEMA 3167 Flavis 10. see 1-Heptanethiol Page 57 Heptyl methyl carbinol. 1577 W255602-100G-K 100 g W255602-1KG-K 1 kg W255602-5KG-K 5 kg W255602-10KG-K 10 kg δ-Hexalactone δ-Caprolactone  ≥97% [823‑22‑3] C6H10O2 FW 114. FCC  ≥98%.085 Arc. apple. 326  ≥98%  ≥98% [1516‑17‑2] CH3(CH=CH)2CH2OC(O)CH3 C8H12O2 FW 140. plum Halal. fatty. 1540.41 52206-25MG trans. citrus.6-Hexanedithiol Page 60 2. (2S)-5. wine-like Kosher contains 0. Organoleptic: almond. Fen.003 CoE Nr 180  97% Organoleptic: apple. see Hexacosanoic acid tryptamide Page 59 Sorbic aldehyde.6. waxy NI W413201-100G-K 100 g W413201-1KG-K 1 kg 1.89  analytical standard.4. see Trithioacetone Page 127 W255408-SAMPLE W255408-1KG 1 kg W255408-5KG 5 kg W255408-10KG 10 kg Feel inspired at safcglobal. 327 1.Hexamethyltrith Heptyl formate trans. Fen. see 7-Methoxycoumarin Page 79 Hesperetin 8 3′. Fen.18 FEMA 2552 Flavis 9.7Dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-4chromanone [69097‑99‑0] C16H14O6 FW 302. see DL-Menthol Page 78 γ-Hexalactone 2. animal NI FEMA 4132 Flavis 9. 1590.4-Hexadienal Organoleptic: pineapple. naranjilla fruit. Cetyl alcohol [36653‑82‑4] CH3(CH2)15OH C16H34O FW 242.4-Hexadienoic acid γ-Caprolactone.4. sweet W392103-5KG 5 kg W255602-SAMPLE-K W392103-10KG 10 kg W392103-SAMPLE W392103-1KG trans. Fen.01 CoE Nr 641 W316709-SAMPLE W316709-100G 100 g W316709-1KG 1 kg W316709-5KG 5 kg > Hexamethylene dimercaptan.021 CoE Nr 2254 1 kg Halal.5.7-Hexadecadiene  analytical standard. NI contains 0.13 Arc. 324 Arc.0% (HPLC) 00864 > N-Hexacosanoyltryptamine. see δ-Dodecalactone Page 41 (±)-δ-Heptyl-δ-valerolactone.8-Hexahydro-4.2.40  ≥95% Sorbic alcohol [125110‑62‑5] CH2=CH(CH2)4CH=CH(CH2)7CH3 C16H30 FW 222.4-Hexadien-1-ol [17102‑64‑6] CH3CH=CHCH=CHCH2OH C6H10O FW 98. herbaceous. γ-Ethyl-γ-butyrolactone [110‑44‑1] CH3CH=CHCH=CHCOOH C6H8O2 FW 112. for food analysis ≥90% (GC) > Hexadecanoic acid.7. see 1. Kosher Organoleptic: musty.009 CoE Nr 57 Organoleptic: floral. 1574. 326  ≥99% FEMA 2554 Flavis 2.44 Arc. see δ-Dodecalactone Page 41 Herniarin.6. sweet.4-Hexadienoic acid Sorbic acid.21 [7779‑50‑2] C16H28O2 FW 252.057 CoE Nr 640 Organoleptic: floral. FG FEMA 3924 Flavis 8. 327 FEMA 2556 Flavis 10. synthetic as antioxidant Natural occurrence: Raw and cooked asparagus.3.8. 105.6.14  ≥99%.4-Hexadienyl acetate ω-6-Hexadecenlactone [112‑23‑2] HCO2(CH2)6CH3 C8H16O2 FW 144.13 [695‑06‑7] C6H10O2 FW 114. Kosher. see 2-Nonanone Page 98 (±)-6-Heptyltetrahydro-2H-pyran-2-one.8-hexamethylcyclopenta[g]-2-benzopyran solution  50% in diethyl phthalate FEMA 3429 Flavis 5.573 W255203-SAMPLE-K W255505-SAMPLE W255203-1KG-K 1 kg W255505-25G 25 g W255203-4KG-K 4 kg W255505-100G 100 g W255203-9KG-K 9 kg W255505-1KG 1 kg > Heptyl mercaptan. see Palmitic acid Page 104 1-Hexadecanol Palmityl alcohol. wine-like Kosher. for food analysis ≥98.

16 Arc.. pear. see Hexyl alcohol Page 63 2. Fen. trans-2-Hexenal [6728‑26‑3] FEMA 2560 Flavis 5.. 1598. FG > trans-2-Hexenal.. creamy.31 Fen. plum.... DMH Ethyl propyl ketone [1191‑43‑1] HS(CH2)6SH C6H14S2 FW 150. Kosher 100 g  50% in triacetin..075 CoE Nr 2008 [623‑37‑0] CH3CH2CH2CH(OH)CH2CH3 C6H14O FW 102. Kosher Organoleptic: fatty..17 Organoleptic: caramel. 332 Fen. fruity. vegetable. Kosher > Hexanedioic acid. fruity. NI Organoleptic: fatty... Fen.096 CoE Nr 4125 Organoleptic: grape. apple. strawberry. oily.. Hexyl aldehyde [66‑25‑1] FEMA 2557 Flavis 5.6-Hexanedithiol Caproaldehyde. earthy. 326. apple. green Fen. pineapple.. ≥98%.067 CoE Nr 11486 Organoleptic: fatty.4-Hexanedione 60 3-Hexanone  ≥97% W316814-100G-K 100 g W316814-250G-K 250 g W316814-1KG-K 1 kg Organoleptic: alcohol. meaty Halal..018 CoE Nr 152 Organoleptic: butter... 333 W256102-SAMPLE-K Fen. ≥95%... FCC CoE Nr 9c Halal... 31. orange. green W255726-SAMPLE-K W255726-25G-K 25 g W255726-100G-K 100 g W255726-1KG-K 1 kg Leaf aldehyde. FCC.. 328 Hexamethylene dimercaptan.. wine-like NI W329002-SAMPLE W329002-25G 25 g W255718-1KG-K 1 kg W349518-25G-K 25 g W329002-100G 100 g W255718-4KG-K 4 kg W349518-100G-K 100 g W329002-1KG 1 kg W255718-8KG-K 8 kg W349518-1KG-K 1 kg W255718-20KG-K 20 kg  natural.. FG CoE Nr 9 Organoleptic: almond. synthetic as antioxidant Arc.163 W255807-5KG-K 5 kg W513601-SAMPLE W255807-10KG-K 10 kg [4437‑51‑8] CH2CH2COCOCH2CH3 C6H10O2 FW 114.. Fen.. Acid C6 CoE Nr 96c trans-2-Hexen-1-al [142‑62‑1] FEMA 2559 Flavis 8... FG  ≥95%. green Halal. 331 W316814-SAMPLE-K W256110-1KG-K FEMA 2561 Flavis 5. ≥90% W255904-SAMPLE-K CoE Nr 96 W255904-1KG-K 1 kg hexenoic acid . FG W255912-SAMPLE-K W255912-1KG-K 1 kg Acetyl butyryl W255912-10KG-K 10 kg Organoleptic: almond.... see trans-2-Hexen-1-al Page 60 trans-2-Hexen-1-al Page 60 Hexanoic acid Caproic acid. green. Kosher Organoleptic: apple. 331 > 1-Hexanol. FG  ≥97%... sweet Halal.. NI  natural. see 2-Hexanol Page 60 1 kg Halal. FG CoE Nr 96 FEMA 3495 Flavis 12..16  ≥97% FEMA 3290 Flavis 7. Aldehyde C6.17 W255807-250G-K 250 g  ≥98% W255807-1KG-K 1 kg Flavis 2.... FG Ethyl propyl carbinol FEMA 3168 Flavis 7..10% alpha-tocopherol. 1084.14 Organoleptic: cheese..16 Halal. medicinal NI W316814-4KG-K 4 kg W335118-SAMPLE FEMA 3351 Flavis 2.. 329 W513601-100G 100 g W513601-1KG 1 kg W513601-4KG 4 kg > (±)-2-Hexanol.14 W255912-25KG-K 25 kg W256110-SAMPLE-K Arc..077 CoE Nr 2255 25 g W256110-100G-K [6789‑80‑6] CH3CH2CH2CH=CHCHO C6H10O FW 98. 328 W255904-5KG-K 5 kg W256005-SAMPLE-K W255904-10KG-K 10 kg W256005-1KG-K 1 kg W255904-25KG-K 25 kg W256005-4KG-K 4 kg W255734-25G 25 g W255734-100G 100 g W255734-1KG 1 kg  natural. ethereal.. see Adipic acid Page 10 W256005-8KG-K 8 kg W256005-20KG-K 20 kg  natural. sweet. vegetable Halal.008 CH3(CH2)4CHO C6H12O FW 100. Kosher [3848‑24‑6] CH3CH2CH2COCOCH3 C6H10O2 FW 114.3-Hexanedione  ≥93%.SAFC® Flavors & Fragrances Hexanal Hexanal 1..089 CoE Nr 4123 W335118-100G 100 g W335118-1KG 1 kg W335118-4KG 4 kg Place an order with your local SAFC representative (see back for contacts). 1.. green. ethereal. FCC. minty. 1592. 1599. W256102-25G-K 25 g W256102-100G-K 100 g W256102-1KG-K 1 kg . NI Halal. 330  ≥97%. 331 Arc.14 Arc.. vegetable contains 0.. floral... creamy. green Halal. Fen.. 789  ≥98%.... Kosher. Fen.. FCC.073 CoE Nr 748 CH3CH2CH2CH=CHCHO C6H10O FW 98. grape. Butyl methyl carbinol 3.. FG 2-Hexanol FEMA 2558 Flavis 7. Kosher W255718-SAMPLE-K W349518-SAMPLE-K [589‑38‑8] CH3CH2CH2COC2H5 C6H12O FW 100.6-Dimercaptohexane. Kosher. Fen.. lilac..14 3-Hexanol  ≥90% W256110-25G-K cis-3-Hexenal solution (±)-2-Hexanol.. <3% Organoleptic: fatty. Kosher.009 CH3(CH2)4COOH C6H12O2 FW 116. 1596. coffee Halal. fatty. sour Arc. Kosher. Fen. NI W255807-SAMPLE-K [626‑93‑7] CH3(CH2)3CH(OH)CH3 C6H14O FW 102..

wine-like. fatty. tomato. peach. Kosher. pepper Kosher W435600-SAMPLE-K W435600-100G-K 100 g W435600-1KG-K 1 kg W392405-SAMPLE-K W392405-100G-K 100 g W392405-1KG-K 1 kg W392405-4KG-K 4 kg Feel inspired at safcglobal. Kosher. see D-Isoascorbic acid 1-Hexen-3-ol cis-3-Hexen-1-ol Organoleptic: green Halal. strawberry and tomato. FCC. blueberry. 334 W256323-100G-K 100 g W256323-1KG-K 1 kg W335207-2G 2g W256323-4KG-K 4 kg W335207-25G 25 g W335207-100G 100 g W335207-1KG 1 kg 8 trans-3-Hexen-1-ol trans-3-Hexenol [928‑97‑2] C2H5CH=CHCH2CH2OH C6H12O FW 100. 337 W435100-SAMPLE  ≥98%. banana. green. fruity. NI Fen. almond.056 CoE Nr 750 C2H5CH=CHCH2CH2OH C6H12O FW 100. Organoleptic: alcohol.Hexenonepredomi trans-2-Hexenoic acid 4-Hexen-1-ol trans-2-Hexen-1-ol [13419‑69‑7] CH3CH2CH2CH=CHCO2H C6H10O2 FW 114. wine-like Kosher contains alpha-tocopherol. and black tea. >98%.048 CoE Nr 718 Organoleptic: ethereal Halal. FCC. NI Fen. see cis-3-Hexenyl acetate Page 62 trans-3-Hexenoic acid FEMA 3170 CoE Nr 2256 4-Hexen-1-ol.16 W335207-SAMPLE > 4-Hexen-3-one. FG W360805-SAMPLE-K  98% > 4-Hexen-1-ol.054 CoE Nr 11777 FEMA 2562 CoE Nr 69 FEMA 3430 CoE Nr 2295 Organoleptic: musty. Kosher. see 4-Hexen-1-ol Page 61 W256307-SAMPLE-K [4798‑44‑1] CH3CH2CH2CH(OH)CH=CH2 C6H12O FW 100. fatty.16 W317004-SAMPLE-K Arc. NI W316903-5KG-K 5 kg W256218-SAMPLE-K W316903-SAMPLE-K W256218-250G-K 250 g W256218-1KG-K 1 kg [1577‑18‑0] C2H5CH=CHCH2CO2H C6H10O2 FW 114. 338 W316903-100G-K 100 g W316903-1KG-K 1 kg Natural occurrence: Raspberry. red and white wines. synthetic as antioxidant [928‑96‑1] FEMA 2563 Flavis 2. Fen. see 4-Hexen-3-one Page 61 Arc. NI Halal. cognac. Kosher W256323-SAMPLE-K 25 g 100 g W360805-1KG-K 1 kg cis-2-Hexen-1-ol 4-Hexen-3-one 1 kg FEMA 3608 Flavis 2. green tea. herbaceous Halal. black currant. vegetable. FG  ≥96%.16 Organoleptic: cheese Kosher contains 0. predominantly trans. sour cherry. see 5-Hexen-1-ol Page 61 5-Hexen-1-ol [821‑41‑0] HOCH2(CH2)3CH=CH2 C6H12O FW 100.10% alpha-tocopherol. french fried potato. minty. FG  ≥96%. synthetic as antioxidant  ≥90% FEMA 3924 Flavis 2. hop oil. FG FEMA 3169 Flavis 8. see trans-3-Hexen-1-ol Page 61 3-Hexen-1-ol. vegetable.16 Arc. green.1% alpha-tocopherol. 335 Arc. 336 [928‑92‑7] CH3CH=CH(CH2)3OH C6H12O FW 100. strawberry.16  ≥98%. Organoleptic: apple. 1607 [928‑94‑9] CH3CH2CH2CH=CHCH2OH C6H12O FW 100. 1603. synthetic 8 5-Hexenol  ≥92% FEMA 3352 Flavis 7. ethereal. sweet Halal. raspberry.14 W256307-20KG-K 20 kg Halal. wine-like. NI 4 kg 4-Hexen-3-one.156 Natural Occurrence: Fresh and cooked apple.104 CoE Nr 10220 W360805-100G-K 1 kg W256307-4KG-K  ≥98% W360805-25G-K FEMA 4351 W256307-1KG-K  natural. 1604. apple. Fen. predominantly trans W256307-8KG-K 8 kg [2497‑21‑4] CH3CH=CHCOC2H5 C6H10O FW 98.14 [928‑95‑0] CH3CH2CH2CH=CHCH2OH C6H12O FW 100. peach.16 Fen. FCC W435100-1KG W317004-100G-K 100 g W317004-1KG-K 1 kg W317004-5KG-K 5 kg > D-erythro-Hex-2-enoic Page 68 acid γ-lactone. Fen.16 Organoleptic: banana.com 61 . predominantly trans. butter. apple. kiwi. orange. predominantly trans W343005-SAMPLE-K W343005-25G-K 25 g W343005-100G-K 100 g W343005-1KG-K 1 kg W343005-1KG 1 kg > 5-Hexenol. papaya.14 W256218-8KG-K 8 kg  ≥98% > trans-3-Hexenol. Kosher. 1606. 813  97% FEMA 4356 Kosher contains 0. orange.

herbaceous. strawberry and tea... Kosher... 1613.. synthetic as antioxidant W340200-100G-K 100 g W340200-1KG-K 1 kg W340200-4KG-K 4 kg W317101-SAMPLE-K [65405‑80‑3] CH3CH=CHCO2CH2CH2CH=CHC2H5 C10H16O2 FW 168.10% alpha-tocopherol..27 CoE Nr 2166  ≥94% [3681‑71‑8] FEMA 3171 Flavis 9. 341 > (3Z)-C-3-Hexenyl acetate. <5% 100 g W368806-100G-K 25 g W368903-100G-K [61931‑81‑5] CH3CH(OH)CO2CH2CH2CH=CHC2H5 C9H16O3 FW 172. fruity. spearmint.. see cis-3-Hexenyl acetate Page 62 Organoleptic: melon Kosher cis-3-Hexenyl isobutyrate cis-3-Hexenyl crotonate W317128-SAMPLE-K 62 Can be used to modify cis-3-Hexenyl acetate or as part of fruity-green topnote complexes in fragrance applications. peach. Chinese quince.566 W317101-200G-K 200 g W317101-1KG-K 1 kg W317101-5KG-K 5 kg W398209-SAMPLE W398209-100G 100 g  natural W398209-1KG 1 kg Kosher W398209-5KG 5 kg W317128-25G-K 25 g W317128-100G-K 100 g W317128-1KG-K 1 kg [33467‑73‑1] HCO2CH2CH2CH=CHC2H5 C7H12O2 FW 128. waxy. Fen. 340  ≥98%.. green Halal.. Organoleptic: apple. green cis-3-Hexenyl benzoate W368903-SAMPLE-K W392901-SAMPLE-K cis-3-Hexenyl formate Arc.23 FEMA 3982 Flavis 9..29 FEMA 3402 Flavis 9. synthetic as antioxidant FEMA 3403 Flavis 9. grape. NI W368806-1KG-K W368903-1KG-K Fen..30  ≥98%. Kosher. green. nutty.....25 Arc.. 340 W340308-SAMPLE-K W340308-100G-K 100 g W340308-1KG-K 1 kg W340308-4KG-K 4 kg cis-3-Hexenyl cis-3-hexenoate 3-Hexen-1-ol.. black currant.. 1620.. wine-like... vegetable. vegetable contains 0.. peach. strawberry. Fen..197 CH3CO2CH2CH2CH=CHC2H5 C8H14O2 FW 142.. 1616. (3Z)-C-3-Hexenyl acetate.. lovage root and chermoya fruit. Fen.... NI contains 0.. sweet..17 [25152‑85‑6] C6H5CO2CH2CH2CH=CHC2H5 C13H16O2 FW 204.20 [53398‑83‑7] CH3CH2CH2CO2CH2CH= CHCH2CH2CH3 C10H18O2 FW 170.26 Fen.563 Natural Occurrence: Guava.396  ≥98%. green. green. FCC  ≥96% Arc.. NI Organoleptic: banana. black tea. pineapple.10% alpha-tocopherol.SAFC® Flavors & Fragrances Hexenylacetate trans-2-Hexenyl acetate trans-2-Hexenyl butyrate cis-3-Hexenyl hexanoate [2497‑18‑9] CH3CO2CH2CH=CHCH2CH2CH3 C8H14O2 FW 142. meaty Kosher contains 0. fresh plum. pear. raspberry... NI Organoleptic: vegetable. Halal. 359 1 kg 5 kg W368806-SAMPLE-K 5 kg  >98% FEMA 3929 Flavis 9. herbaceous Halal. NI contains 0. melon peach... Organoleptic: apple. Kosher NI Arc.806 CoE Nr 11778 100 g 100 g cis-3-hexen-1-ol . 338 Natural Occurrence: High bush cranberry. synthetic as antioxidant FEMA 3689 Flavis 9.271 CoE Nr 11779 W256404-SAMPLE-K W392618-100G-K 100 g W392618-1KG-K 1 kg W256404-100G-K 100 g W256404-1KG-K 1 kg W256404-5KG-K 5 kg W256404-9KG-K 9 kg cis-3-Hexenyl acetate W392618-SAMPLE-K cis-3-Hexenyl butyrate [16491‑36‑4] CH3CH2CH2CO2CH2CH2CH=CHC2H5 C10H18O2 FW 170. minty Kosher W392901-100G-K 100 g W392901-1KG-K 1 kg FEMA 3690 Flavis 9. green.22 FEMA 3353 Flavis 9. mango. ethereal..10% alpha-tocopherol. green. Fen. pear.. strawberry chicken fat.. wine-like Halal.. Organoleptic: fruity. Fen. orange. banana.. cheese.25 [31501‑11‑8] CH3(CH2)4CO2CH2CH2CH=CHC2H5 C12H22O2 FW 198.10% alpha-tocopherol. tomato and Virginia tobacco.... 341 FEMA 2564 Flavis 9. 1609.291 Arc. pear. Organoleptic: apple... Leaf acetate  ≥98% [61444‑38‑0] C2H5CH=CHCH2CO2CH2CH2CH= CHC2H5 C12H20O2 FW 196. FG Natural Occurrence: Apple.. synthetic as antioxidant Place an order with your local SAFC representative (see back for contacts). strawberry.196 CoE Nr 643 FEMA 3926 Flavis 9.. vegetable Halal.24 CoE Nr 2153 W335304-100G-K  ≥97% W368903-25G-K cis-3-Hexenyl lactate  ≥94% Kosher.20 Organoleptic: butter. green Kosher.. Organoleptic: apple.. 343 FEMA 3688 Flavis 9.. banana.25  ≥98% W335304-1KG-K W368806-5KG-K 1 kg W335304-SAMPLE-K Organoleptic: woody.. FCC.545 CoE Nr 10681 W335304-5KG-K 1 kg [41519‑23‑7] (CH3)2CHCO2CH2CH=CHCH2CH2CH3 C10H18O2 FW 170. FG CoE Nr 644 W340200-SAMPLE-K Natural occurrence: Apple. Kosher W369004-SAMPLE-K W369004-100G-K 100 g W369004-1KG-K 1 kg W369004-5KG-K 5 kg . Kosher. 1608...

399 CoE Nr 2344 1 kg Hexyl trans-2-butenoate Hexyl crotonate W349801-100G-K 100 g W393118-100G-K 100 g W349801-1KG-K 1 kg W393118-1KG-K 1 kg [19089‑92‑0] CH3CH=CHCO2(CH2)5CH3 C10H18O2 FW 170.26 Organoleptic: balsam.17 W256811-1KG 1 kg Arc. Fen. FG cis-3-Hexenyl salicylate CoE Nr 53c [53398‑85‑9] C2H5CH(CH3)CO2CH2CH2CH=CHC2H5 C11H20O2 FW 184. sweet Kosher. fresh plums. earthy. NI W256706-SAMPLE-K W256706-2KG-K Feel inspired at safcglobal. FCC  ≥97% W256714-100G-K 100 g FEMA 3497 Flavis 9.29 FEMA 3354 Flavis 9. Kosher. synthetic as antioxidant W256714-4KG-K 4 kg W349704-SAMPLE-K W509876-100G-K 100 g W509876-SAMPLE-K W349704-100G-K 100 g W509876-1KG-K 1 kg W349704-1KG-K 1 kg W509876-5KG-K 5 kg W349704-4KG-K 4 kg [35154‑45‑1] (CH3)2CHCH2CO2CH2CH2CH=CHC2H5 C11H20O2 FW 184. 1632.28 > Hexyl aldehyde.559 W369101-5KG-K 5 kg W369101-10KG-K 10 kg Organoleptic: apple. green Kosher.768 CoE Nr 645 [67883‑79‑8] CH3CH=C(CH3)CO2CH2CH2CH= CHC2H5 C11H18O2 FW 182. pear. pepper. Fen. FG W335401-4KG-K 4 kg Organoleptic: herbaceous. 343 Arc. 345 W335401-1KG-K 1 kg FEMA 3633 Flavis 9. 349 W256501-10KG-K 10 kg  ≥98%. Kosher FEMA 3691 Flavis 9. vegetable. NI W256501-SAMPLE-K 1 kg [2639‑63‑6] FEMA 2568 Flavis 9.57 W256714-1KG-K 1 kg Natural occurrence: Apricot. 344 [142‑92‑7] FEMA 2565 Flavis 9. herbaceous.564 W256528-100G-K 100 g Kosher W256528-1KG-K 1 kg  natural. Fen.25 W349801-9KG-K 9 kg W393118-5KG-K 5 kg Fen. FG W256501-20KG-K 20 kg Halal. NI Arc. see Hexyl hexanoate Page 64  ≥98%.com 2 kg W256706-5KG-K 5 kg W256706-20KG-K 20 kg 63 . cherry. NI Capryl acetate Fen.Hexylcaproate cis-3-Hexenyl 2-methylbutanoate  natural. Fen.10% alpha-tocopherol. FCC cis-3-Hexenyl propionate Hexyl butyrate W256803-SAMPLE-K CoE Nr 196c W256803-1KG-K [33467‑74‑2] C9H16O2 FW 156.10% alpha-tocopherol. Kosher. 1636. synthetic as antioxidant CoE Nr 196 W335401-9KG-K 9 kg W363308-SAMPLE-K W363308-100G-K 100 g W363308-1KG-K 1 kg W363308-5KG-K 5 kg W335401-SAMPLE-K Organoleptic: apple. Organoleptic: apple. 349 cis-3-Hexenyl phenylacetate  ≥95%.26 W256501-5KG-K 5 kg Arc. minty Kosher. 1597. Fen. mossy. sweet. woody. NI Organoleptic: apricot. 342  ≥97%.805 CoE Nr 10682  ≥98%. Fen.26 Arc. 1645. FCC FEMA 3498 Flavis 9. floral. NI contains 0. ≥98% W393304-SAMPLE-K W256528-4KG-K 4 kg Organoleptic: pineapple. fatty. FCC. green Kosher W349801-SAMPLE-K W393118-SAMPLE-K Arc. see Hexanal Page 60 Hexyl benzoate [6789‑88‑4] C6H5CO2(CH2)5CH3 C13H18O2 FW 206.28 [65405‑77‑8] 2-(HO)C6H4CO2CH2CH2CH=CHC2H5 C13H16O3 FW 220. 347  ≥98% cis-3-Hexenyl tiglate cis-3-Hexenyl 3-methylbutanoate Halal. pineapple. black and green tea.266 CoE Nr 10688 Organoleptic: pineapple Kosher. Kosher  >97% W256528-SAMPLE-K FEMA 3933 Flavis 9. pepper. woody. green Kosher Organoleptic: banana. ≥98%. sweet Halal. 346 > Hexyl caproate.22 Halal. 1630 W369101-SAMPLE-K  ≥97% W369101-1KG-K FEMA 3931 Flavis 9. ≥98%. 1628 W256714-SAMPLE-K  ≥97%.21  ≥99% Arc. FCC Hexyl acetate [42436‑07‑7] C6H5CH2CO2CH2CH2CH=CHC2H5 C14H18O2 FW 218.854 CoE Nr 2345 Flavis 9. woody.006 CH3COO(CH2)5CH3 C8H16O2 FW 144. sweet Kosher NI contains 0. sweet W393304-100G-K 100 g W393304-1KG-K 1 kg W393304-5KG-K 5 kg 1 kg W256803-9KG-K 9 kg W256803-20KG-K 20 kg W256811-SAMPLE Hexyl alcohol W256811-25G 25 g 1-Hexanol W256811-100G 100 g [111‑27‑3] FEMA 2567 Flavis 2.045 CoE Nr 271 CH3CH2CH2CO2(CH2)5CH3 C10H20O2 FW 172. 1642. waxy. green Kosher. FCC CoE Nr 53 Organoleptic: green. herbaceous. spearmint.28 Arc.005 CH3(CH2)5OH C6H14O FW 102. FCC. NI Organoleptic: balsam. sweet W256501-1KG-K  natural. 1622.

see Hexyl salicylate Page 64 1 kg W520306-10KG Flavis 9. 1674. green. Fen. 352 W257215-1KG-K  natural (US). 1653.26 Organoleptic: grape. 355  ≥95% W317215-SAMPLE-K  ≥97%. Fen.10% alpha-tocopherol. Fen. Kosher. 348 [10032‑15‑2] FEMA 3499 C2H5CH(CH3)CO2(CH2)5CH3 C11H22O2 FW 186. green Halal. fatty. floral. cheese. lily.113 CoE Nr 394 Halal. see 2. 1685. green. FG Hexyl caproate Flavis 9. 1682  ≥97% W500909-SAMPLE-K W350001-100G  ≥98%. apricot. see Hexyl 2-methylbutanoate Page 64 Hexyl methyl ketone. chamomile oil.6.887 FEMA 3500 Flavis 9. wine-like Arc.32 W349909-4KG-K 4 kg [6259‑76‑3] C13H18O3 FW 222. melon. green Kosher. 1650. Fen. 355  ≥97% Flavis 9.581 W520306-SAMPLE Kosher Organoleptic: sweet. vegetable Halal. ≥97%.29 W257206-9KG-K W257215-SAMPLE-K Kosher Organoleptic: musty. oily. FG Organoleptic: herbaceous. see Hexyl isothiocyanate Page 64 Hexyl octanoate [1117‑55‑1] CH3(CH2)6CO2(CH2)5CH3 C14H28O2 FW 228. see 2-Phenylpropionaldehyde Page 110 Hydratropic aldehyde dimethyl acetal. musty. green. sweet. see 2-Phenylpropyl butyrate Page 110 Hydratropyl isobutyrate. see 2-Octanone Page 100 Hexyl-2-methylpropionate. plum.529 CoE Nr 10692 Organoleptic: apple NI W257215-100G-K W520306-1KG Hexyl tiglate [10032‑13‑0] (CH3)2CHCH2CO2(CH2)5CH3 C11H22O2 FW 186.041 CoE Nr 129 Hexyl isothiocyanate Organoleptic: jasmine. Fen. 348 W317215-100G-K Arc.SAFC® Flavors & Fragrances Hexylcinnamalde  natural (US). 1651. vegetable 20 kg W349909-1KG-K W257206-1KG-K  natural (US). green Kosher contains 0. see Hexyl isobutyrate Page 64 n-Hexyl mustard oil. Kosher.25 W256900-1KG-K 1 kg W256900-5KG-K 5 kg W256900-10KG-K 10 kg > Hexyl crotonate. ethereal. Kosher.18 Arc.161 CoE Nr 499 W257001-1KG-K 8 n-Hexyl mustard oil. 352 100 g W350001-1KG 1 kg W350001-4KG 4 kg > Hexyl 2-methylbutyrate. pear. ≥97%. 1679.37 Arc. FG α-Hexylcinnamaldehyde [101‑86‑0] C6H5CH=C[(CH2)5CH3]CHO C15H20O FW 216. pineapple. plum. NI Organoleptic: vegetable. NI Flavis 9.28 W349909-9KG-K 9 kg  >98% Flavis 9. fruity Hexyl 2-hydroxybenzoate Arc. ≥95%. FCC. Fen. Fen. green.066 CoE Nr 316 Natural occurrence: Apple. 350 Flavis 9. see 2-Phenylpropyl isobutyrate Page 110 . 1-Isothiocyanatohexane W256900-SAMPLE-K 64 Hexyl propionate Kosher W317209-1KG-K 1 kg W257508-SAMPLE-K W317209-4KG-K 4 kg W257508-1KG-K 1 kg W317209-9KG-K 9 kg W257508-4KG-K 4 kg W257508-9KG-K 9 kg Place an order with your local SAFC representative (see back for contacts).139 CoE Nr 420 W257615-1KG-K  ≥95%. pear. see Hexyl trans-2-butenoate Page 63 Hexyl formate  95% FEMA 4422 W442200-5G W442200-100G 5g 100 g Hexyl 2-methylbutanoate Hexyl 2-methylbutyrate [629‑33‑4] HCO2(CH2)5CH3 C7H14O2 FW 130. ≥97%.507 CoE Nr 4132  natural (US). fruity. FG FEMA 2569 Flavis 5. Kosher. NI W257001-SAMPLE-K 1 kg W257001-9KG-K 9 kg W257001-20KG-K 20 kg Hexyl hexanoate [6378‑65‑0] FEMA 2572 CH3(CH2)4CO2(CH2)5CH3 C12H24O2 FW 200. NI W257605-SAMPLE-K Organoleptic: fruity. NI Arc. NI W317209-SAMPLE-K W520306-25KG 25 kg [16930‑96‑4] CH3CH=C(CH3)CO2(CH2)5CH3 C11H20O2 FW 184. apricot. 1646. FG 9 kg W257605-20KG-K Hexyl salicylate W349909-SAMPLE-K W349915-SAMPLE-K 1 kg W257605-9KG-K W257615-100G-K W349915-100G-K W257206-SAMPLE-K W257605-1KG-K W257615-SAMPLE-K  ≥97%. see 2-Phenylpropionaldehyde dimethyl acetal Page 110 Hydratropyl butyrate. gruyere cheese. W500909-100G-K 100 g W500909-1KG-K 1 kg W500909-4KG-K 4 kg > HMF. sweet Kosher contains 750-3000 ppm BHT as stabilizer [4404‑45‑9] CH3(CH2)5NCS C7H13NS FW 143. 1663. 353  ≥97% Organoleptic: fruity.6-Trimethyl-1-cyclohexene-1acetaldehyde Page 126 Hydratropaldehyde. creamy. Organoleptic: apple. FG FEMA 2570 Flavis 9. FG 10 kg Organoleptic: fruity.478 CoE Nr 646 FEMA 2575 Flavis 9. hops. see 5-(Hydroxymethyl)furfural Page 66 β-Homocyclocitral.29 Arc. fruity W349915-1KG-K Hexyl 3-methylbutanoate 9 kg  ≥99% W257206-20KG-K 20 kg Hexyl isobutyrate Hexyl-2-methylpropionate [2349‑07‑7] FEMA 3172 (CH3)2CHCO2(CH2)5CH3 C10H20O2 FW 172. waxy Halal. Fen. green Kosher. melon.24 Arc. fruity. FG 1 kg 1 kg Kosher Organoleptic: fruity.32 W317215-1KG-K [2445‑76‑3] FEMA 2576 C2H5CO2(CH2)5CH3 C9H18O2 FW 158. passion fruit.28 Arc. synthetic as antioxidant W350001-SAMPLE > Hexyl 2-hydroxybenzoate.

GBL. chicken. raspberry. meaty. Fen. chocolate.04 W398608 4-Hydroxybenzyl alcohol [623‑05‑2] HOC6H4CH2OH C7H8O2 FW 124. see 3-Phenylpropyl isovalerate Page 110 Hydrocinnamyl propionate. roasted filbert and strawberry. grape. see 3-Phenyl-1-propanol Page 110 Hydrocinnamyl isobutyrate.012 CoE Nr 100 FEMA 3984 Flavis 5. peach. 1-Hydroxy-2-propanone [116‑09‑6] CH3COCH2OH C3H6O2 FW 74. see Syringaldehyde Page 120 4-Hydroxy-2.15 Arc. Fen. see 3-Phenylpropyl isobutyrate Page 110 Hydrocinnamyl isovalerate.09 Kosher Hydroxycitronellal dimethyl acetal  ≥95%.5-dimethyl-3(2H)-furanone FEMA 3987 Flavis 2.165 W398705-SAMPLE W398705-100G 100 g W398705-1KG 1 kg W398705-5KG 5 kg > 2-Hydroxybiphenyl. FCC. clove. Organoleptic: almond. 359  ≥98% Arc. meaty. Fen.006 CoE Nr 615 W317454-SAMPLE-K Organoleptic: caramel Kosher. FCC  Muriatic acid 32 wt. strawberry. grape. Strawberry furanone [3658‑77‑3] FEMA 3174 Flavis 13. pineapple. herbaceous. Organoleptic: almond. tomato. FCC > Hydroxybenzene. see Propyl 4-hydroxybenzoate Page 114 [96‑48‑0] C4H6O2 FW 86.011 CoE Nr 45 W258504-SAMPLE-K > p-Hydroxybenzoic acid n-butyl ester. sweet Arc.18 Arc. FG  ≥98%. NI W288705-SAMPLE-K W288705-1KG-K 1 kg W288705-5KG-K 5 kg W288705-10KG-K 10 kg > Hydrocinnamic acid. earthy.12 [107‑75‑5] C10H20O2 FW 172. plum. honey. Kosher FEMA 3291 Flavis 10.Hydroxydimethyl Hydrochloric acid solution 4-Hydroxybenzaldehyde Hydroxycitronellal Hydrogen chloride solution [123‑08‑0] HOC6H4CHO C7H6O2 FW 122.5-Dimethyl-4-hydroxy-3(2H)-furanone. FCC [99‑96‑7] HOC6H4CO2H C7H6O3 FW 138.5-dimethoxybenzaldehyde. 2580. Fen.047 20 (degrees baume) Kosher Kosher Organoleptic: lily.26 [7647‑01‑0] HCl HCl Arc. 1723. see 4-Hydroxybutanoic acid lactone Page 65 4-Hydroxybutyric acid lactone.124 CoE Nr 4136 Organoleptic: hawthorne. 2. hyacinth. 1726  ≥95%. green Halal.4-decadienoic acid γ-lactone.12 4-Hydroxybutyric acid lactone. NI W329118-SAMPLE-K 2-Acetylphenol Organoleptic: floral. see Salicylic acid Page 118 Natural occurrence: Cinnamon. see 4-Hydroxybutanoic acid lactone Page 65 W317454-100G-K 100 g W317454-1KG-K 1 kg 4-Hydroxy-2. sweet. roasted almond. sweet NI W354805-SAMPLE 1 kg W354805-5KG 5 kg W354805-10KG 10 kg W258504-1KG-K 1 kg W258504-5KG-K 5 kg W258504-10KG-K 10 kg > 5-Hydroxy-2. 358 W530574 W398403-1KG-K 1 kg W258318-1KG W398403-5KG-K 5 kg W258318-5KG 5 kg W398403-10KG-K 10 kg W258318-10KG 10 kg FW 36.01 CoE Nr 536 C6H8O3 FW 128. 99 W446207-SAMPLE-K FEMA 2585 Flavis 6. Fen.5-dimethyl-3(2H)-furanone solution [3658‑77‑3] C6H8O3 FW 128. sweet Halal. see Methyl 4-hydroxybenzoate Page 87 2-Hydroxybenzoic acid methyl ester. see γ-Decalactone Page 32 5-Hydroxydecanoic acid δ-lactone. see Butyl 4-hydroxybenzoate Page 22 p-Hydroxybenzoic acid methyl ester.08 CI 11101 FEMA 4462  ≥99% FEMA 3986 Flavis 8. musty. NI W317403-SAMPLE-K W317403-100G-K 100 g W317403-1KG-K 1 kg  natural. 1728. coffee Kosher W317411-SAMPLE-K > 3α-Hydroxy-5α-androst-16-ene. 363  ≥98%. see Dihydrocoumarin Page 35 Hydroquinone dimethyl ether. see Methyl salicylate Page 93 4-Hydroxybenzoic acid propyl ester. ≥98%. see Phenol Page 108 2-Hydroxybenzoic acid.13 Arc. see 3-Phenylpropionic acid Page 110 Hydrocinnamyl alcohol.01 Natural Occurrence: Coffee. Kosher. Fen. caramel. see 1. 552. herbaceous. γ-Butyrolactone. see 2-Phenylphenol Page 109 DL-Hydroxybutanedioic acid. see 4-Ethoxyphenol Page 42 Hydroxyacetone 8 Acetol.13  10 wt. vegetable.08 CoE Nr 2013 W354805-1KG W258318-SAMPLE W398403-SAMPLE-K W329118-1KG-K 1 kg W329118-10KG-K 10 kg W329118-25KG-K 25 kg > γ-Hydroxybutyric acid lactone. see 5α-Androst-16-en-3α-ol Page 14 2-Hydroxybenzaldehyde. 668  ≥90%. FCC  ≥97% FEMA 2583 Flavis 5.14 W446207-1KG-K 1 kg W446207-5KG-K 5 kg 2′-Hydroxyacetophenone [118‑93‑4] HOC6H4COCH3 C8H8O2 FW 136. % in propylene glycol FEMA 3174 Flavis 13.com W317411-1KG-K 1 kg W317411-5KG-K 5 kg W317411-10KG-K 10 kg 65 .46 Hydrocinnamaldehyde 3-Phenylpropionaldehyde [104‑53‑0] C6H5CH2CH2CHO C9H10O FW 134. see 3-Phenylpropyl propionate Page 110 Hydrocoumarin. γ-Hydroxybutyric acid lactone  ≥95%. see δ-Decalactone Page 33 4-Hydroxy-3. spicy Kosher. see 6-Amyl-αpyrone Page 13 4-Hydroxydecanoic acid γ-lactone. cinnamon. FCC Halal. 1731. guava. 1025. see Salicylaldehyde Page 118 Feel inspired at safcglobal. cherry. Kosher Arc. FG 1 kg [141‑92‑4] C12H26O3 FW 218. beer and oregano. malt. FG Organoleptic: strawberry.4-Dimethoxybenzene Page 36 Hydroquinone monoethyl ether. 357  ≥98% FEMA 3548 Flavis 7.33 4-Hydroxybenzoic acid FEMA 2887 Flavis 5. fermented soy sauce. % in H2O. see DL-Malic acid Page 76 4-Hydroxybutanoic acid lactone Furaneol.

dried bonito. caramel. see Hyssop oil Page 66 Illicium verum. FCC Raspberry ketone  ≥98% 66 > 4-(2-Hydroxy-5-methylphenylazo)acetanilide. see Tyramine Page 127 3-(4-Hydroxyphenyl)-L-alanine.139 FEMA 2591 Organoleptic: butter. see δ-Nonalactone Page 98 4-Hydroxy octanoic acid. see Tyramine Page 127 1-Hydroxy-2-propanone. 1760. Organoleptic: butter.6-Xylenol Page 130 2-Hydroxy-p-xylene. see (±)-γ-Valerolactone Page 128 4-Hydroxy-3-pentenoic acid γ-lactone. FG Halal. see δ-Dodecalactone Page 41 2-Hydroxyethyl methyl sulfide. see Tricosanoic acid tryptamide Page 125 α-Ionone 4-(2. see 2-(Methylthio)ethanol Page 94 5-(2-Hydroxyethyl)-4-methylthiazole. fishy. jasmine. 5Hydroxymethyl-2-furaldehyde. animal. see (1S. see Vanillin Page 129 4-Hydroxy-3-methoxybenzoic acid. see DL-Malic acid Page 76 3-Hydroxy-3. Fen. ≥98%. FG 8 W259411-SAMPLE-K W259105-SAMPLE-K W501808-25G-K 100 g 5 kg Hyssop oil 1g Natural occurrence: Burley tobacco.10 Kosher 8 FEMA 2593 Flavis 14. Kosher Arc. raspberry. see Acetovanillone Page 8 4-Hydroxy-3-methoxybenzaldehyde. 369  ≥98%.4-Xylenol Page 130 Hyssopus officinalis Arc. floral. Fen.085 W363501-1KG-K 100 g W259200-500G-K 1 kg  97% 25 g W259200-100G-K W258806-1KG-K 25 g 100 g W259200-SAMPLE-K W259306-1KG-K 100 g W363501-100G-K from Helichrysum angustifolium Kosher Organoleptic: spicy. lactone. raspberry. see 2-Methoxy-4-methylphenol Page 79 2-Methoxy-4-methylphenol Page 79 2-Hydroxy-5-methylanisole. see Vanillyl alcohol Page 129 trans-4-Hydroxy-3-methoxycinnamic acid.2-diol Page 75 5-Hydroxynonanoic acid. and wine. see 2-Methyl-3-buten-2-ol Page 83 5-Hydroxymethyl-2-furaldehyde. see Heptadecanoic acid tryptamide Page 57 N-[2-(3-Indolyl)ethyl]hexacosanamide.6. see 2. sweet > 5-[(1E)-2-(4-Hydroxyphenyl)ethenyl]-1. violet W259403-SAMPLE-K W259403-100G-K 100 g W259403-1KG-K 1 kg W259403-5KG-K 5 kg  natural (US). see 2-Methoxy-4-methylphenol Page 79 2-Hydroxy-4-methylbenzaldehyde [698‑27‑1] HOC6H3(CH3)CHO C8H8O2 FW 136. cherry. see Docosanoic acid tryptamide Page 41 N-[2-(3-Indolyl)ethyl]heptadecanamide. NI 5-Hydroxymethyl-2-furancarboxaldehyde. earthy. 1777. NI W258806-5KG-K [67‑47‑0] C6H6O3 FW 126. vanilla.10-dodecatriene. see 2. see Anise star oil Page 14 Imidole. see Ferulic acid Page 52 4-Hydroxy-3-methoxytoluene. grape. see α-Angelica lactone Page 14 4-Hydroxyphenethylamine.6. see Tetracosanoic acid tryptamide Page 122 N-[2-(3-Indolyl)ethyl]tricosanamide. 1751 [8006‑83‑5]  ≥99%  Certified organic (NOP/EU) Flavis 13. see Disperse Yellow 3 Page 41 N-[4-(2-Hydroxy-5-methylphenylazo)phenyl]acetamide.091 CoE Nr 2130 Immortelle absolute Helichrysum oil  ≥99%. vegetable Kosher. see Maltol Page 77 3-Hydroxy-2-methyl-4-pyrone solution. wine-like. see Pyrrole Page 116 Place an order with your local SAFC representative (see back for contacts).5-Xylenol Page 130 4-Hydroxy-o-xylene. butter. FG Organoleptic: berry. fatty. W259411-25G-K 25 g W259411-100G-K 100 g W259411-1KG-K 1 kg . see Vanillic acid Page 129 4-Hydroxy-3-methoxybenzyl alcohol. ≥84%. woody W259306-100G-K W258814-100G-K W363501-25G-K FEMA 2592 250 g W258814-25G-K W363501-SAMPLE-K  natural W258806-250G-K W258814-SAMPLE-K W363501-SAMPLE [90045‑56‑0] W259306-SAMPLE-K W258806-SAMPLE-K [19322‑27‑1] C4OH2OCH3OH C5H6O3 FW 114. FCC.4R)(+)-Limonene-1.3-benzenediol.2S. sweet Kosher. see Acid Red 73 Page 10 1 kg > Hyssopus officinalis. see 4-Methyl-5-thiazoleethanol Page 94 4′-Hydroxy-3′-methoxyacetophenone.30 Halal. see Lactic acid Page 74 (±)-2-Hydroxysuccinic acid.055 CoE Nr 755 HOC6H4CH2CH2COCH3 C10H12O2 FW 164. tea.4-Xylenol Page 130 4-Hydroxy-m-xylene. see L-Tyrosine Page 127 7-Hydroxy-8-(4-phenylazophenylazo)-1. fish. Kosher Organoleptic: raspberry. see γ-Octalactone Page 100 15-Hydroxypentadecanoic acid lactone. woody. rum. musty. malt.6-Trimethyl-2-cyclohexenyl)-3-buten-2-one [127‑41‑3] FEMA 2594 Flavis 7.3-naphthalenedisulfonic acid disodium salt. see Hydroxyacetone Page 65 2-Hydroxypropionic acid. see Furfuryl alcohol Page 53 5-Hydroxymethyl-2-furancarboxaldehyde.15 Fen.7. 365 4-(4-Hydroxyphenyl)-2-butanone Kosher Arc. FCC W369705-SAMPLE-K W369705-25G-K 25 g W369705-100G-K 100 g W369705-1KG-K 1 kg > 3-Hydroxy-3-methyl-1-butene. 373  ≥90%. see Maltol solution Page 77 (+)-1-Hydroxyneodihydrocarveol. see 5-(Hydroxymethyl) furfural Page 66 2-(Hydroxymethyl)furan. see Resveratrol Page 117 2-(4-Hydroxyphenyl)ethylamine.SAFC® Flavors & Fragrances Hydroxydodecano > 5-Hydroxydodecanoic acid δ-lactone. cheese. see Disperse Yellow 3 Page 41 3-Hydroxy-2-methyl-4-pyrone. see 2. see 3. see ω-Pentadecalactone Page 104 4-Hydroxypentanoic acid lactone. musty Kosher Kosher 8 25 g W501808-100G-K 100 g W501808-1KG-K 1 kg W259105-1KG-K > N-[2-(3-Indolyl)ethyl]docosanamide. see 5-(Hydroxymethyl)furfural Page 66 4-Hydroxy-5-methyl-3-furanone Organoleptic: fruity. see Nerolidol Page 96 2-Hydroxy-m-xylene.20 FEMA 3697 Flavis 5.15 1 kg 1 kg 5-(Hydroxymethyl)furfural Indole 1H-Benzo[b]pyrrole 10 kg W258814-1KG-K 1 kg 500 g W259306-10KG-K FEMA 3635 Flavis 13. honey. coffee.11-trimethyl-1. see Hexacosanoic acid tryptamide Page 59 N-[2-(3-Indolyl)ethyl]tetracosanamide.007 CoE Nr 560 [5471‑51‑2] FEMA 2588 Flavis 7.11 W501808-1G-K [120‑72‑9] C8H7N FW 117. egg. chocolate. HMF W259306-25KG-K 25 kg  natural (US).007 CoE Nr 141 C13H20O FW 192.

.. FG  ≥98%..... ≥97%..... see Isoamyl octanoate Page 68 Isoamyl alcohol Organoleptic: oily.. Kosher...... sweet.29 Arc.. Fen.. FCC... bourbon whiskey... 1778. NI Organoleptic: sweet Kosher... 147....... minty. papaya. Acetic acid 3-methylbutyl ester [123‑92‑2] FEMA 2055 Flavis 9.. ≥97%. woody. FG W207500-1KG-K 2-methylbutyl acetate . ≥98% FEMA 2075 Flavis 9. 379  natural. 373 W205710-4KG-K 4 kg W206326-100G-K 100 g  predominantly trans. see Isopropyl alcohol Page 71 IPM. FG Organoleptic: banana........30 FEMA 2595 CoE Nr 142 Natural occurrence: Tobacco.003 CoE Nr 51 (CH3)2CHCH2CH2OH C5H12O FW 88. 132.. floral. 119.... raspberry. FG [7779‑65‑9] FEMA 2063 Flavis 9...... honey Halal. honey.. berry. 375  ≥95%.... green. Fen..29 2-methylbutyl isobutyrate . FCC.... NI Arc... FG FEMA 2075 Flavis 9. Fen.... FCC W205532-1KG-K 1 kg Natural Occurrence: Melon. papaya. 70% isoamyl isobutyrate basis  ≥97% W206318-1KG-K 1 kg W206318-10KG-K 10 kg W350710-100G-K 100 g W206318-25KG-K 25 kg W350710-1KG-K 1 kg W350710-4KG-K 4 kg W350710-SAMPLE-K 67 ... green Kosher W207519-SAMPLE-K W207519-100G-K 100 g W207519-1KG-K 1 kg W207519-4KG-K 4 kg Isoamyl isobutyrate [2050‑01‑3] FEMA 3507 Flavis 9.... 377 CoE Nr 294 W350702-SAMPLE-K W350702-1KG-K 1 kg W350702-4KG-K 4 kg Halal.. 173. mixture of isomers C11H22O2 FW 186. ≥97%. Fen. pineapple... see Isopropyl myristate Page 72 IPM 100..... sweet. NI W207500-SAMPLE-K  ≥98%.. see Isopropyl myristate Page 72 IPM-EX. fruity. pear Halal.. Fen. NI W207500-9KG-K 9 kg W205508-SAMPLE-K W206008-SAMPLE-K W207500-20KG-K 20 kg W205508-1KG-K 1 kg W206008-1KG-K W205508-4KG-K 4 kg W206008-9KG-K 9 kg W205508-9KG-K 9 kg W206008-20KG-K 20 kg W205508-20KG-K 20 kg  natural.055 CoE Nr 282 CH3CH2CH2CO2CH2CH2CH(CH3)2 C9H18O2 FW 158.. NI Organoleptic: almond... berry.. violet.07 CoE Nr 320 Organoleptic: apple.. Isopentyl alcohol W206016-20KG-K 20 kg [123‑51‑3] FEMA 2057 Flavis 2... orange.742 CoE Nr 335 C6H5CH=CHCO2CH2CH2CH(CH3)2 C14H18O2 FW 218.29 Isoamyl butyrate [106‑27‑4] FEMA 2060 Flavis 9. FCC... whiskey Halal. Fen.. ≥97% Kosher W205710-SAMPLE-K W205710-1KG-K 1 kg W206326-SAMPLE-K Arc. papaya. 378  mixture of isomers.. 98%. melon..25 Arc.... peach. Kosher Organoleptic: banana. Kosher Organoleptic: apple..6-Trimethyl-1-cyclohexenyl)-3-buten-2-one  natural. jack fruit.755 CoE Nr 562 Organoleptic: plum Halal... rose...48 Organoleptic: apricot. sweet W205532-SAMPLE-K W206016-100G-K 100 g W206016-1KG-K 1 kg W206016-4KG-K 4 kg 3-Methyl-1-butanol..... banana.... FCC.. grape brandy. 30% > IPA. tropical.. 143.. honey. sweet Halal. see Isopropyl myristate Page 72 IPM-R.. pineapple Halal. Fen.. 70% isoamyl acetate basis.. whiskey..... Kosher Arc. see Isopropyl myristate Page 72 [110‑45‑2] HCOOCH2CH2CH(CH3)2 C6H12O2 FW 116... 30% Organoleptic: apricot.. vegetable W259500-SAMPLE-K W259500-1KG-K 1 kg W259500-10KG-K 10 kg W259500-20KG-K 20 kg Isoamyl formate > Isoamylamine.. Kosher Arc.. see Isopentylamine Page 71 Isopentyl formate Isoamyl benzoate [94‑46‑2] C6H5CO2CH2CH2CH(CH3)2 C12H16O2 FW 192. Halal.... Fen.. 126... FG 1 kg  natural. mixture of isomers C11H22O2 FW 186.162 CoE Nr 500 FEMA 2058 Flavis 9.com 1 kg Isoamyl hexanoate..15 > Isoamyl caprylate. ≥98%.16 1 kg W205818-5KG-K 5 kg W205818-10KG-K 10 kg W206903-SAMPLE W206903-1KG 1 kg W206903-9KG 9 kg W206903-20KG 20 kg Isoamyl hexanoate... 20% W205532-9KG-K 9 kg W206016-SAMPLE-K W205532-20KG-K 20 kg Halal.. grape brandy. pineapple.24 Arc. hop oil. hop oil.. roasted almond.Isoamylisobutyr  natural. balsam. Fen. Kosher... Kosher.. Kosher.... 137.. wine-like.07 CoE Nr 320 Organoleptic: apple. 30% Organoleptic: chocolate Arc.. tea and spearmint.. Kosher W350702-9KG-K 9 kg W206318-SAMPLE-K  natural. FCC 2-methylbutyl benzoate . FG β-Ionone 4-(2. raspberry. green W205532-4KG-K 4 kg 2-methylbutyl butyrate ... 377  ≥98%... grape.... R=H or CH3 C18H36O4 FW 316.. 376 Isoamyl cinnamate  ≥98% W205702-SAMPLE-K W205702-1KG-K 1 kg W205702-4KG-K 4 kg W205702-8KG-K 8 kg W205702-20KG-K 20 kg Feel inspired at safcglobal.024 CoE Nr 214 CH3COOCH2CH2CH(CH3)2 C7H14O2 FW 130.. ≥98%..... grape... 376 FEMA 2069 Flavis 9. 138... jam... banana......... orange juice. FCC W205710-8KG-K 8 kg W206326-1KG-K 1 kg W205710-20KG-K 20 kg W206326-5KG-K 5 kg [79‑77‑6] C13H20O FW 192. NI W205818-SAMPLE-K W205818-1KG-K Isoamyl acetate Isopentyl acetate.... 483 Isoamyl 3-phenyl propenoate  ≥98%. 80% isoamyl butyrate basis..419 (CH3)2CHCO2CH2CH(R)CH(R)CH3..6..18 Arc. peach..

malt.. apple and strawberry. mango. Fen..21 1 kg Organoleptic: apricot. apricot. winelike. see Phthalide Page 111 Isoborneol Kosher Organoleptic: apple. Kosher..SAFC® Flavors & Fragrances Isoamylisovaler Isoamyl isovalerate Isoamyl octanoate [659‑70‑1] FEMA 2085 Flavis 9. ≥98% W208515-100G-K 100 g W208515-1KG-K 1 kg mixture of isoamyl octanoate and 2-methylbutyl octanoate Organoleptic: fruity Halal W208515-4KG-K 4 kg W208019-SAMPLE W208515-SAMPLE-K Isoamyl laurate W208019-100G 100 g W208019-1KG 1 kg [6309‑51‑9] CH3(CH2)10CO2CH2CH2CH(CH3)2 C17H34O2 FW 270. wintergreen. <30% Arc... pineapple. 209  ≥99%.. 1130. FCC FEMA 2410 CoE Nr 30c Kosher W241008-SAMPLE-K W241008-1KG-K 1 kg W241008-5KG-K 5 kg W241008-10KG-K 10 kg > D-(−)-Isoascorbic acid. beer. see D-Isoascorbic acid Page 68 1-Isobenzofuranone.. Fen. banana. 213. 383 W207802-4KG 4 kg  natural. fruity. Fen. NI contains 200 ppm BHT as stabilizer Fen. 200. banana.25 Organoleptic: apple. bourbon whiskey... mixture of isomers Page 68  ≥97% FEMA 2077 Flavis 9.443 CoE Nr 431 W208302-SAMPLE W208302-25G 25 g W208302-100G 100 g W208302-1KG 1 kg Isoamyl salicylate W208000-SAMPLE W208000-1KG 1 kg  natural.. woody Kosher... 213. wine-like. 218. Organoleptic: apple. Organoleptic: apple. Fen. tomato. see Isoamyl propionate. waxy. mixture of isomers Isoamyl propionate.. 380 [2035‑99‑6] FEMA 2080 Flavis 9. soapy.12 CoE Nr 401 CH3(CH2)6CO2CH2CH2CH(CH3)2 C13H26O2 FW 214. Fen. sweet NI W208507-SAMPLE-K W208507-1KG-K 1 kg W208507-9KG-K 9 kg W208507-20KG-K 20 kg [7779‑72‑8] CH3COCO2CH2CH2CH(CH3)2 C8H14O3 FW 158.. FCC W501018-4KG 4 kg FEMA 2082 Flavis 9.. apricot.. 381 > Isoamyl 3-phenyl propenoate.136 CoE Nr 417 D-Isoascorbic acid D-(−)-Isoascorbic acid. white and red wine.. FCC W207802-1KG 1 kg Arc.059 CoE Nr 2020 Organoleptic: vanilla. Amyl propionate [105‑68‑0] C2H5CO2CH2CH2CH(CH3)2 C8H16O2 FW 144. 384  natural.. sweet Halal. floral. NI Natural occurrence: Scotch. green. green.. 225 W501018-SAMPLE W501018-100G 100 g Arc. 145. pear [124‑76‑5] C10H18O FW 154.. apricot. wine. FCC  ≥98% Organoleptic: apple. wine-like NI [7779‑70‑6] CH3(CH2)7CO2CH2CH2CH(CH3)2 C14H28O2 FW 228...21 W207802-SAMPLE W208418-SAMPLE [105‑68‑0] C2H5CO2CH2CH2CH(CH3)2 C8H16O2 FW 144.25  ≥95% W208213-SAMPLE-K W208213-100G-K 100 g W208213-1KG-K 1 kg W208213-4KG-K 4 kg FEMA 2158 Flavis 2. plum. citrus. 383  ≥97% FEMA 2083 Flavis 9. Kosher W208000-9KG 9 kg Arc. Organoleptic: beer...136 CoE Nr 417 Natural occurrence: Fresh apple. banana. brandy. 1 kg W215805-5KG-K 5 kg W215805-10KG-K 10 kg . grape brandy. creamy. D-Araboascorbic acid. spicy Organoleptic: fruity. pineapple.. 382  ≥98%. green. waxy.19 Arc. whiskey. apple wine. ≥98%. sweet.. 191... see 3-Methyl-1-butanethiol Page 82 Isoamyl 2-methylbutyrate. tomato. D-erythro-Hex-2-enoic acid γ-lactone. white and plum wines.37 W208205-4KG 4 kg Arc. 229. FCC W208000-4KG 4 kg [87‑20‑7] 2-(HO)C6H4CO2CH2CH2CH(CH3)2 C12H16O3 FW 208. herbaceous.. whiskey. Fen.... wine-like W208205-1KG FEMA 2078 Flavis 9.26 Isoamyl pyruvate Isoamyl caprylate Arc..11 CoE Nr 391 FEMA 2084 Flavis 9. FCC W207802-9KG 9 kg FEMA 2082 Flavis 9.463 CoE Nr 458 (CH3)2CHCH2CO2CH2CH2CH(CH3)2 C10H20O2 FW 172. see 3-Methylbutyl 2-methylbutanoate Page 84 Isoamyl nonanoate Isoamyl propionate W208418-1KG 1 kg W208418-10KG 10 kg W208418-25KG 25 kg Isoamyl tiglate [41519‑18‑0] CH3CH=C(CH3)CO2CH2CH2CH(CH3)2 C10H18O2 FW 170..12 Arc. 384 W215805-SAMPLE-K W215805-1KG-K 68 Place an order with your local SAFC representative (see back for contacts).25 Arc. 381 W208205-9KG 9 kg Isoamyl propionate. Fen.34 2-methylbutyl isovalerate .. mango. wine-like Halal. Erythorbic acid [89‑65‑6] C6H8O6 FW 176. Fen. floral NI Organoleptic: grape. see Isoamyl cinnamate Page 67 Isoamyl propionate. coconut. ≥98%. grape.. sweet.45 W208019-4KG 4 kg Arc..751 CoE Nr 435  ≥97% Amyl propionate W208205-SAMPLE  ≥96%  mixture of isoamyl and 2-methylbutyl salicylates. rum NI W207705-SAMPLE W207705-100G 100 g W207705-1KG 1 kg W207705-4KG 4 kg > Isoamyl mercaptan. ≥98%. 217. Fen. 383 W501018-1KG 1 kg  ≥98%.103 CoE Nr 379 Natural occurrence: Rum.

388 W219304-1KG-K 1 kg FEMA 2180 Flavis 9. see Isobutyl alcohol Page 69 FEMA 4239 Flavis 11. sweet. Fen.002 Isobutyl acetate NI [110‑19‑0] FEMA 2175 Flavis 9. Kosher Organoleptic: apple. FCC.408 CoE Nr 247 W219304-5KG-K 5 kg W219304-10KG-K 10 kg Organoleptic: sweet. grape brandy.23 2. beer. FG Isobutyl crotonate FEMA 2197 Flavis 9.21 Arc. Fen. fig. pear. pineapple. pear. sweet Halal. 390.16 Arc. NI Organoleptic: fruity. pear. FG CoE Nr 269 Organoleptic: fruity.3Dimethyl-5-isobutylpyrazine Arc. NI W219703-1KG-K W219703-9KG-K 9 kg W343218-SAMPLE-K W219703-20KG-K 20 kg Fen. Fen. Kosher. NI W218707-SAMPLE-K W217905-SAMPLE-K W217905-2KG-K 2 kg W218707-1KG-K W217905-8KG-K 8 kg W218707-9KG-K 1 kg 9 kg W217905-20KG-K 20 kg W218707-20KG-K 20 kg [2756‑56‑1] C13H22O2 FW 210.31  natural. 383.273 CoE Nr 10706 W219703-SAMPLE-K Organoleptic: fruity Kosher. grape. 2. sweet Halal. FCC Arc. fig. floral. Kosher. pear. floral. 453. banana. wine-like Halal. ≥98%. Kosher Arc. Fen. grape brandy. 390 Feel inspired at safcglobal. banana. FCC. minty W217514-SAMPLE-K W217514-1KG-K 1 kg W217514-4KG-K 4 kg W217514-9KG-K 9 kg Organoleptic: fruity.14  99% > Isobutanol.131 CoE Nr 412 W217913-1KG-K 1 kg W218715-SAMPLE-K W217913-4KG-K 4 kg W218715-100G-K 100 g W217913-8KG-K 8 kg W218715-1KG-K 1 kg W218715-4KG-K 4 kg Kosher Organoleptic: herbaceous. 392 Isobutyl trans-2-butenoate  ≥95%. 414. sherry. FCC. rose Kosher. pineapple.com Isobutyl cinnamate [122‑67‑8] C6H5CH=CHCO2CH2CH(CH3)2 C13H16O2 FW 204. Fen. Fen. 404.13 Arc. grape brandy. 363. cocoa. 389 [54410‑83‑2] C10H16N2 FW 164. Fen. Fen. FG  ≥99%. NI W530526-SAMPLE-K W530526-100G-K 100 g W218502-SAMPLE-K W530526-500G-K 500 g W218502-1KG-K 1 kg W218502-5KG-K 5 kg W218502-10KG-K 10 kg Isobutyl formate [542‑55‑2] HCO2CH2CH(CH3)2 C5H10O2 FW 102. 396. 386 Kosher CoE Nr 269c  ≥92% W217913-SAMPLE-K FEMA 2163 Flavis 9. Organoleptic: apple. banana. pineapple. ethereal. FCC. see Isobutyl trans-2-butenoate Page 69 W218006 Isobutyl benzoate 5-Isobutyl-2. grape.12  ≥90% FEMA 2160 Flavis 9. rum and vinegar. 388  ≥98%. ethereal. 424 [7779‑81‑9] CH3CH=C(CH3)CO2CH2CH(CH3)2 C9H16O2 FW 156. FG W423901-SAMPLE FEMA 2193 Flavis 9. FG CoE Nr 195c Natural Occurrence: Apple. 354. Kosher. 2-Methyl-1-propanol Arc.3-Dimethyl-5-(2-methylpropyl)pyrazine. see Isobutyl hexanoate Page 69 1-Amino-2-methylpropane [78‑81‑9] (CH3)2CHCH2NH2 C4H11N FW 73. banana. sweet Halal.29 Isobutanol. ≥97%. pineapple.3-dimethylpyrazine 8 [120‑50‑3] C6H5CO2CH2CH(CH3)2 C11H14O2 FW 178. NI W217506-SAMPLE-K W217506-1KG-K 1 kg W217506-4KG-K 4 kg W217506-9KG-K 9 kg W217506-20KG-K 20 kg  natural. ethereal Halal. FCC. FCC  natural. strawberry and wine. Halal. NI FEMA 3432 Flavis 9. peach. vegetable available only in EU > Isobutyl crotonate.757 CoE Nr 567 Kosher Organoleptic: chocolate.734 CoE Nr 327 W423901-1KG 1 kg Isobutyl angelate  ≥98%.20  ≥98%.Isobutylformate Isobornyl acetate Isobutyl alcohol Isobutyl butyrate [125‑12‑2] C12H20O2 FW 196. 385 [78‑83‑1] FEMA 2179 Flavis 2. sherry. strawberry and wine. Kosher. 390 Arc. wine-like. vanilla W216305-SAMPLE-K W216305-1KG-K 1 kg W216305-10KG-K 10 kg W216305-25KG-K 25 kg Kosher Isobutylamine > Isobutyl caproate. FG CoE Nr 195 Natural occurrence: Apple.001 CoE Nr 49 (CH3)2CHCH2OH C4H10O FW 74.164 CoE Nr 502 [73545‑15‑0] CH3CH=CHCO2CH2CH(CH3)2 C8H14O2 FW 142. pineapple.043 CH3CH2CH2CO2CH2CH(CH3)2 C8H16O2 FW 144. cocoa. Organoleptic: fruity. ≥99%.005 CH3COOCH2CH(CH3)2 C6H12O2 FW 116.218 CoE Nr 2066 Kosher W216003-SAMPLE-K W216003-1KG-K 1 kg W216003-10KG-K 10 kg W216003-25KG-K 25 kg Isobornyl propionate [539‑90‑2] FEMA 2187 Flavis 9. FCC Natural occurrence: Apple. 387  ≥98%.26 W343218-100G-K 100 g W343218-1KG-K 1 kg W343218-4KG-K 4 kg 1 kg 69 .25  ≥98%  97% FEMA 2185 Flavis 9.22 W219304-SAMPLE-K W219304-100G-K 100 g Arc.

musty. strawberry Kosher.064 CH3(CH2)4CO2CH2CH(CH3)2 C10H20O2 FW 172. 510. FG W218901-4KG-K [24683‑00‑9] C9H14N2O FW 166.006 (CH3)2CHCO2H C4H8O2 FW 88.21 250 g W313408-1KG-K [78‑84‑2] FEMA 2220 Flavis 5.75 CoE Nr 434 Kosher Halal. 398 FEMA 2208 Flavis 2. FCC  ≥98% FEMA 3132 Flavis 14. see 4-Methylpentanoic acid Page 91 . Organoleptic: chocolate.004 (CH3)2CHCHO C4H8O FW 72. 397 W313203-100G-K 100 g W313203-500G-K 500 g W313203-1KG-K 1 kg 2-Isobutyl-4-methyl-1.3-dioxolane 8 [18433‑93‑7] C8H16O2 FW 144. 58-59 (2009) W428600-SAMPLE 1 kg Halal. NI 4 kg W222003-8KG-K  ≥99%. pepper. 420. 396  ≥97% 1 kg W313408-5KG-K Arc. 395  ≥98% Halal. ethereal Kosher NI W218901-SAMPLE-K W221007-SAMPLE-K W221007-1KG-K 1 kg W218901-9KG-K 9 kg W221007-10KG-K 10 kg W221007-25KG-K 25 kg [540‑42‑1] CH3CH2CO2CH2CH(CH3)2 C7H14O2 FW 130. FCC  ≥98%.23  mixture of isomers.18 Arc. sweet. 398  ≥99%. honey.044 Halal. see Piperonyl isobutyrate Page 112 Isocaproic acid. 415. ≥95% α-Isobutylphenethyl alcohol  98% W220213-100G-K 100 g W220213-1KG-K 1 kg W220213-4KG-K 4 kg Isobutyl isobutyrate Arc. Fen. Kosher W222011-SAMPLE-K W222011-25G-K 25 g W222011-100G-K 100 g W222011-1KG-K 1 kg Isobutyric acid [79‑31‑2] FEMA 2222 Flavis 8.065 CoE Nr 2031c Isobutyl phenylacetate [97‑85‑8] (CH3)2CHCO2CH2CH(CH3)2 C8H16O2 FW 144. woody Lit. 394 Organoleptic: musty.013 CoE Nr 4143 Fen. Kosher W313408-100G-K Isobutyraldehyde 4-Methyl-1-phenyl-2-pentanol CoE Nr 314c 70 2-Isobutylthiazole CoE Nr 6c FEMA 2213 Flavis 9. pineapple and cocoa nuances. 407. chocolate. dairy products. Fen. NI  natural. creamy. NI W313203-SAMPLE-K 8 kg W222003-20KG-K CoE Nr 6 FEMA 2212 Flavis 9.21 Possible applications: Italian cheeses. pineapple.SAFC® Flavors & Fragrances Isobutylhexanoa > Isobutyl methyl ketone.4-methylenedioxybenzyl ester. woody. Kosher Organoleptic: green. dairy applications.417 CoE Nr 292 Organoleptic: grape.23 2-Isobutyl-3-methylpyrazine Fen.788 CoE Nr 2160 W218901-1KG-K > Isobutyl mercaptan.25  ≥98%. Kosher 1 kg 2-Isobutyl-3-methoxypyrazine  ≥98% FEMA 2210 Flavis 9. 548. green.22 FEMA 3134 Flavis 15. Perfum. Organoleptic: butter.11 Arc. Kosher Arc. FG [13925‑06‑9] C9H14N2 FW 150. ≥99%. see 2-Methyl-1-propanethiol Page 92 5 kg W222003-SAMPLE-K Arc.26 Arc.125 CoE Nr 406 Organoleptic: green.11 Arc.043 CoE Nr 11338 1 kg W222003-4KG-K 2-Methylpropionic acid Isobutyl propionate  ≥99%. ≥97% 20 kg Natural occurrence: Roman chamomile.1 Organoleptic: apple. pineapple. see 4-Methyl-2-pentanone Page 91 Isobutyl hexanoate Isobutyl caproate [105‑79‑3] FEMA 2202 Flavis 9. Flavor. 399 W221201-1KG-K 1 kg W222208-SAMPLE-K W221201-4KG-K 4 kg W222208-1KG-K W221201-9KG-K 9 kg W222208-5KG-K 5 kg W222208-10KG-K 10 kg W222208-25KG-K 25 kg Isobutyl salicylate 1 kg  natural. Gerard Mosciano. Fen. FG W222003-1KG-K CoE Nr 92c 4 kg Fen. Kosher W313408-SAMPLE-K W313300-SAMPLE-K W313300-25G-K 25 g W220205-1KG 1 kg W313300-100G-K 100 g W220205-9KG 9 kg W313300-1KG-K 1 kg W220205-20KG 20 kg  natural. vegetable Halal. 520. 395 Organoleptic: banana Kosher. apple. cited: 1. floral W220841-25G 25 g W220841-100G 100 g [102‑13‑6] C6H5CH2CO2CH2CH(CH3)2 C12H16O2 FW 192. 396 W220213-SAMPLE-K 100 g W313408-250G-K 2-Methylpropionaldehyde [7779‑78‑4] C12H18O FW 178.135 W428600-1KG W221201-SAMPLE-K [87‑19‑4] C11H14O3 FW 194. spicy Halal. Fen. Fen. Fen. FCC FEMA 2189 Flavis 9. W222216-100G-K 100 g W222216-1KG-K 1 kg W222216-5KG-K 5 kg > Isobutyric acid 3. vegetable NI  ≥99% CoE Nr 314 Organoleptic: apple. 34 (1). green NI W220205-SAMPLE FEMA 3133 Flavis 14. herbaceous. 550.27 Organoleptic: apple Halal. Kosher. musty. 96%. 530 W222216-SAMPLE-K W221309-SAMPLE-K W221309-1KG-K 1 kg W221309-5KG-K 5 kg W221309-10KG-K 10 kg Place an order with your local SAFC representative (see back for contacts). Fen. FCC FEMA 4286 Flavis 6. 394 [18640‑74‑9] C7H11NS FW 141. NI Organoleptic: floral Kosher.22 CoE Nr 92 Natural occurrence: Cocoa. strawberry. waxy.

20 [443‑79‑8] CH3CH2CH(CH3)CH(NH2)COOH C6H13NO2 FW 131. see Cuminaldehyde Page 31 4-Isopropylbenzyl alcohol 3. see L-Carvone Page 25 (S)-5-Isopropenyl-2-methyl-2-cyclohexenone. FCC FEMA 3295 Flavis 17.2S. wine-like. FCC W321907-1KG Organoleptic: floral. see (1S.7%.5%.3S)-2-Amino-3-methylpentanoic acid Flavis 2.Isopropylbenzyl Isoeugenol DL-Isoleucine Isopropenyl acetate 2-Methoxy-4-propenylphenol DL-2-Amino-3-methylpentanoic [97‑54‑1] CH3OC6H3(CH=CHCH3)OH C10H12O2 FW 164.53  >95% [536‑60‑7] (CH3)2CHC6H4CH2OH C10H14O FW 150. vegetable. 401 1-Amino-3-methylbutane. peas.2-diol Page 75 (1R. 410  ≥99. NI > Isopropylacetone. Fen.11.32 1 kg W415201-4KG Isopropyl acetate FEMA 3219 Flavis 11. spicy Halal. ≥99%. Fen.4R)-(+)-4-Isopropenyl-1-methylcyclohexan-1.5R)-5-Isopropenyl-2-methyl-2-cyclohexenyl acetate. sweet W355305-10KG 10 kg W247707-SAMPLE W355305-20KG 20 kg 100 g W247707-1KG 1 kg W247707-5KG 5 kg 1 kg W292605-9KG-K 9 kg W292605-20KG-K 20 kg 2-Propanol. 407 FEMA 3553 Flavis 7. see 2-Ethyl-1-hexanol Page 46 Isopent-2-enyl acetate. Isoamylamine [107‑85‑7] (CH3)2CHCH2CH2NH2 C5H13N FW 87. tobacco NI > Isoeugenyl methyl ether. spicy.03 CoE Nr 220 Organoleptic: carnation. green.13 W321907-100G [92666‑21‑2] C6H5CH2OC6H3-2-(OCH3)-4-CH= CHCH3 C17H18O2 FW 254.4R)-(+)-Limonene-1.2S. see (S)(−)-Perillaldehyde Page 106 (1S. spicy. woody. FCC W519200-SAMPLE-K W519200-1KG-K 1 kg W527602-100G 100 g W519200-4KG-K 4 kg W527602-1KG 1 kg W519200-8KG-K 8 kg > Isopropanol. citrus. 313. ethereal Kosher. macadamia nuts. Fen.10 Arc. 403  99% FEMA 2468 Flavis 4.039 CoE Nr 88 L-Isoleucine  ≥98. see Isoamyl acetate Page 67 Isopentyl alcohol. waxy. see Isopropyl alcohol Page 71 (±)-Isopropanolamine. 409 100 g FEMA 3698 CoE Nr 522 4 kg W415201-9KG [108‑21‑4] CH3COOCH(CH3)2 C5H10O2 FW 102. rose. see (−)-Isopulegol Page 73 (S)-4-Isopropenyl-1-methyl cyclohexene.2-diol.21 Natural occurrence: Burley tobacco. FCC. FCC FEMA 2929 Flavis 2.17 acid 1-Methylvinyl acetate [108‑22‑5] CH3CO2C(CH3)=CH2 C5H8O2 FW 100. FCC A mixture of 4 stereoisomers.com Organoleptic: floral Kosher. Fen. Isopropanol. see (S)(−)-Limonene Page 75 (R)-5-Isopropenyl-2-methyl-2-cyclohexenone. see DL-1-Amino-2-propanol Page 12 Feel inspired at safcglobal. mixture of cis and trans Organoleptic: banana. nutty.5.004 CoE Nr 172 Organoleptic: clove.5%.24  ≥98%. 752. Organoleptic: berry.5-Trimethyl-2-cyclohexen-1-one W369802-100G-K 100 g W369802-1KG-K 1 kg W369802-5KG-K 5 kg Arc. sweet. see Isoamyl formate Page 67 3. see Isoamyl alcohol Page 67 Isoeugenyl acetate [93‑29‑8] C12H14O3 FW 206. herbaceous.5R)-2-Isopropenyl-5-methylcyclohexanol. see 4-Methyl-2-pentanone Page 91 [78‑59‑1] C9H14O FW 138.71 CoE Nr 237 W355305-5KG 5 kg Organoleptic: apple. see Methyl isoeugenol Page 88 FEMA 2926 Flavis 9. cranberry. honey. sweet. 401 W321907-4KG 4 kg  ≥98% > Isopentyl formate.7. FG Isopentylamine FEMA 2470 Flavis 9.126 CoE Nr 4011 W355305-SAMPLE  ≥97% W355305-1KG 1 kg FEMA 2477 Flavis 9. 15. Fen. Fen. spicy Halal.001 CoE Nr 512 W321907-SAMPLE trans-Isoeugenyl benzyl ether W415201-1KG [67‑63‑0] (CH3)2CHOH C3H8O FW 60.003 CoE Nr 193 W292605-1KG-K Isophorone W369802-SAMPLE-K > (S)-4-Isopropenyl-cyclohexene-1-carboxaldehyde. 2611. Kosher 9 kg Arc. 1376.2S.16 Arc. Fen. see D-Carvone Page 25 (1RS. sweet Halal. 406 W247006-SAMPLE-K W247006-1KG-K 1 kg W247006-5KG-K 5 kg W247006-10KG-K 10 kg  ≥98% Organoleptic: vanilla Halal. 128. sec-Propyl alcohol. 2658. NI W292907-SAMPLE-K Isophytol W292907-1KG-K 1 kg W292907-8KG-K 8 kg W292907-20KG-K 20 kg > 4-Isopropylbenzaldehyde. saffron. Kosher.17 Kosher FEMA 2933 Flavis 2. Fen. Kosher Arc.33 Isoeugenyl phenylacetate.22 (2S. NI  ≥98.15-Tetramethyl-1-hexadecen-3-ol Cumic alcohol [505‑32‑8] C20H40O FW 296. wine and osmanthus.12  mixture of cis and trans.168  ≥97% [73‑32‑5] C2H5CH(CH3)CH(NH2)CO2H C6H13NO2 FW 131.01 CoE Nr 10127 W415201-SAMPLE W246808-SAMPLE-K W329509-SAMPLE FEMA 4152 Flavis 9. 411 W293318-SAMPLE-K W293318-100G-K 100 g W293318-1KG-K 1 kg W293318-5KG-K 5 kg 71 . 2661. NI Arc. camphoraceous.079 CoE Nr 4146 Organoleptic: butter Halal. see (−)-Carvyl acetate Page 26  ≥99%.822 W246808-1KG-K 1 kg W329509-25G 25 g W246808-5KG-K 5 kg W329509-100G 100 g W246808-10KG-K 10 kg W329509-1KG 1 kg > Isooctyl alcohol. cinnamon. woody. Kosher. 400 W247707-100G W292605-SAMPLE-K Isopropyl alcohol  ≥97% [120‑24‑1] C6H5CH2CO2C6H3-2-(OCH3)-4-(CH= CHCH3) C18H18O3 FW 282. sweet. roasted filbert. see Prenyl acetate Page 112 Isopentyl acetate. IPA Arc. NI 1 kg Arc. fruity. Fen.

see Terpinolene Page 121 Isopropyl isothiocyanate 8 Isopropyl mustard oil [2253‑73‑8] (CH3)2CHNCS C4H7NS FW 101. NI W355518-SAMPLE-K W355518-100G-K 100 g W355518-1KG-K 1 kg W355518-5KG-K 5 kg > Isopropyl mustard oil.4Cineole Page 27 2-Isopropyl-5-methylphenol. passion fruit. sweet. 2687. see Carvacrol Page 25 W340618-100G-K 100 g W340618-1KG-K 1 kg W340618-4KG-K 4 kg Place an order with your local SAFC representative (see back for contacts). meaty NI W369918-4KG-K 4 kg Isopropyl palmitate W369918-9KG-K 9 kg Isopropyl hexadecanoate W382701-SAMPLE > Isopropyl methyl carbinol.11  98% 2-Isopropyl-4-methylthiazole FEMA 2944 Flavis 9.2. IPM. see Bisphenol A diglycidyl ether Page 20 (R)-2-Isopropylidene-5-methylcyclohexanone.5R)-2-Isopropyl-5-methylcyclohexanol. Kosher.5R)-2-Isopropyl-5-methylcyclohexanone. see Thymol Page 124 5-Isopropyl-2-methylphenol.50% alpha-tocopherol.044 CoE Nr 11234 FEMA 3406 Flavis 5.18 Arc. see α-Terpinene Page 121 1-Isopropyl-4-methyl-1.25 [88‑69‑7] (CH3)2CHC6H4OH C9H12O FW 136.45  ≥98% W293903-1KG-K 1 kg [66576‑71‑4] C2H5CH(CH3)CO2CH(CH3)2 C8H16O2 FW 144.1]heptane. nutty.107 CoE Nr 10361 Organoleptic: berry Kosher.31 W382701-100G 100 g W382701-1KG 1 kg W382701-5KG 5 kg FEMA 3556 Flavis 9. 2678. wine-like Kosher FEMA 3699 Flavis 9. papaya. 2726. IPM-EX. FG FEMA 2939 Flavis 9. fruity Halal. Fen. see Isopropyl isothiocyanate Page 72 Myristic acid isopropyl ester. see Isopropyl palmitate Page 72 4. NI W293504-SAMPLE-K W293504-1KG-K 1 kg W293504-9KG-K 9 kg W293504-20KG-K 20 kg W294401-100G 100 g W294401-1KG 1 kg > Isopropyl hexadecanoate. IPM 100. see LMenthone Page 78 Isopropyl disulfide [4253‑89‑8] [(CH3)2CH]2S2 C6H14S2 FW 150. see (R)(+)-Pulegone Page 116 4-Isopropylidene-1-methylcyclohexene. NI contains 0. see L-Menthol Page 78 2-Isopropyl-5-methylcyclohexanol. see 1. green Halal. 412  ≥98%. banana.165  ≥98% FEMA 2935 Flavis 9. 418 Isopropyl 2-methylbutyrate W293903-SAMPLE-K [15679‑13‑7] C7H11NS FW 141. meaty. 417  ≥98%  ≥95% FEMA 3461 Flavis 4. see 2-Propanethiol Page 113 1-Isopropyl-4-methylbenzene.21 W293903-5KG-K 5 kg Fen. cinnamon.026 Organoleptic: earthy. garlic).606 W515604-SAMPLE W515604-1KG 1 kg W515604-9KG 9 kg W515604-20KG 20 kg 2-Isopropylphenol 2-Isopropyl-5-methyl-2-hexenal [35158‑25‑9] (CH3)2CHCH2CH=C[CH(CH3)2]CHO C10H18O FW 154.105 CoE Nr 386 1 kg [142‑91‑6] CH3(CH2)14COOCH(CH3)2 C19H38O2 FW 298. IPM-R [110‑27‑0] CH3(CH2)12COOCH(CH3)2 C17H34O2 FW 270.4-cyclohexadiene. melon.4′-Isopropylidenediphenol diglycidyl ether.109 W369918-1KG-K 1 kg Organoleptic: sulfurous. alliaceous (onion. see DL-3-Methyl-2-butanol Page 83 1-Isopropyl-4-methyl-1. NI Organoleptic: oily.SAFC® Flavors & Fragrances Isopropylbutyra Isopropyl butyrate Isopropyl formate [638‑11‑9] CH3CH2CH2CO2CH(CH3)2 C7H14O2 FW 130. Fen.041 CoE Nr 267 Natural occurrence: Apple.547 W355690-SAMPLE-K Kosher. waxy. 412 [625‑55‑8] HCO2CH(CH3)2 C4H8O2 FW 88. Organoleptic: medicinal NI W346101-SAMPLE W346101-1KG 1 kg W346101-10KG 10 kg W346101-25KG 25 kg .732 CoE Nr 325 1 kg > Isopropyl mercaptan. waxy. kiwi. Fen. Kosher Arc. cherry.19 Fen. Organoleptic: creamy. see DL-Menthol Page 78 (2S. ethereal. see p-Cymene Page 32 Organoleptic: balsam. Isopropyl tetradecanoate.17 Isopropyl cinnamate  97% Isopropyl 3-phenylpropenoate [7780‑06‑5] C6H5CH=CHCO2CH(CH3)2 C12H14O2 FW 190.2S.3-cyclohexadiene. pineapple. rum and strawberry.23 Isopropyl myristate W442500-SAMPLE W442500-1KG > 1-Isopropyl-4-methyl-7-oxabicyclo[2. FG FEMA 3555 Flavis 15. see γ-Terpinene Page 121 (1R.50  ≥90% Flavis 9. 417 Arc. green Kosher. sweet. pineapple. synthetic as antioxidant W340618-SAMPLE-K 72 Fen. 416 W293903-10KG-K 10 kg  ≥98% Organoleptic: cheese.24 FEMA 4425  ≥96%. green W355690-1KG-K W355690-8KG-K 8 kg  ≥96% W369918-SAMPLE-K W355690-20KG-K 20 kg FEMA 3827 Flavis 12. 418 Fen.

.25 Arc.. see 2. see Jojoba oil Page 73 Halal.23 W295604-SAMPLE from Jasminum grandiflorum L. Halal... 1788. ≥95% Jasmone..com 73 .13 [8022‑96‑6] Arc. see p-Cymene Page 32 CoE Nr 8 Organoleptic: cheese.. cis-3-Methyl-2-(2-pentenyl)-2-cyclopenten-1-one CoE Nr 94c [488‑10‑8] C11H16O FW 164. NI (−)-Isopulegol (1R. Fen. 424 > Jojoba liquid wax.4S)-p-Menth-8-en-3-ol [89‑79‑2] C10H18O FW 154.2S. wine-like southern Europe origin W260401-SAMPLE-K  Morocco origin W260401-100G-K 100 g W260401-1KG-K 1 kg  Certified organic (NOP/EU) 8 Nepal origin from Jasminum grandiflorum L. ≥98%. mixture of isomers [89‑49‑6] C12H20O2 FW 196...008 (CH3)2CHCH2COOH C5H10O2 FW 102.067 CoE Nr 2033 Organoleptic: minty Halal [61789‑91‑1] W310204-SAMPLE  Certified organic (NOP/EU) W310204-1KG 1 kg W310204-5KG 5 kg W310204-10KG 10 kg W530293-SAMPLE-K W310204-20KG 20 kg W530293-1KG-K  natural. Kosher W296236-SAMPLE 8 Jojoba oil from Simmondsia chinensis. sweet Kosher 8 Organoleptic: jasmine..5R)-2-Isopropenyl-5-methylcyclohexanol.. 2768.. see Isopropyl cinnamate Page 72 Isopropyl tetradecanoate. 3-Methylbutanoic acid W319600-1KG-K 1 kg W319600-5KG-K 5 kg W322903-100G-K 100 g W322903-1KG-K 1 kg [503‑74‑2] FEMA 3102 Flavis 8.24 Organoleptic: fruity Kosher Arc... pepper... 421 W269212-25G-K 25 g  ≥98% W269212-100G-K 100 g FEMA 3229 Flavis 9. 481  natural...29 Arc.. pineapple. Fen..006 (CH3)2CHCH2CHO C5H10O FW 86. NI trans isomer .....786 CoE Nr 2158  ≥97% Organoleptic: honey. peach..... see cis-Jasmone Page 73 cis-Jasmone  natural. ethereal. Kosher.. herbaceous. NI W260000-SAMPLE W260000-10G 10 g W269204-SAMPLE-K W260000-100G 100 g W295604-100G 100 g W295604-1KG 1 kg W269204-1KG-K 1 kg W295604-5KG 5 kg W269204-4KG-K 4 kg W269204-8KG-K 8 kg W269204-20KG-K 20 kg > Isopropyl 3-phenylpropenoate. Kosher  FCC Organoleptic: berry. wine-like. rose NI CoE Nr 94 [4861‑85‑2] C6H5CH2CO2CH(CH3)2 C11H14O2 FW 178.. FG  ≥99% FEMA 2600 FEMA 2956 Flavis 9. <15% W319600-SAMPLE-K Isovaleric acid W322903-SAMPLE-K W319600-100G-K 100 g 3-Methylbutyric acid. Fen.3R... (1R. see Hexyl isothiocyanate Page 64 Isothiocyanotaomethylbenzene...13 W322903-5KG-K 5 kg Arc. Fen.....6-Dimethyl-4-heptanone Page 38 FEMA 2965 CoE Nr 2067 Kosher USA origin 1 kg > Jojoba oil from Simmondsia chinensis. 422  ≥99% FEMA 2962 Flavis 2. sour Kosher. Fen. 2771...... Fen.20 > Jasmone. FG W269212-SAMPLE-K FEMA 3196 Flavis 7.094 Fen.513 CoE Nr 10733 W269212-1KG-K 1 kg Organoleptic: minty.... see Benzyl isothiocyanate Page 18 100 g > Isovalerone. Kosher Organoleptic: jasmine W260404-SAMPLE-K W260404-1KG-K W259802-SAMPLE-K W259802-25G-K 25 g W259802-100G-K 100 g W259802-1KG-K 1 kg 1 kg > Jasmine oil... see Isopropyl myristate Page 72 Isopropyl tiglate [1733‑25‑1] CH3CH=C(CH3)CO2CH(CH3)2 C8H14O2 FW 142. see Jojoba oil Page 73 Jojoba oil  ≥99%. 420 Arc. woody. 423  ≥95% W310212-100G-K Jasmin absolute Jasmine oil Organoleptic: sweet Kosher [8022‑96‑6] W296503 FEMA 2598 > 1-Isothiocyanatohexane. 3057.. FCC > 4-Isopropyltoluene.. FG W310212-SAMPLE-K W296236-1KG 1 kg W296236-9KG 9 kg W310212-250G-K 250 g W296236-20KG 20 kg W310212-1KG-K 1 kg W310212-5KG-K 5 kg Isopulegyl acetate. Organoleptic: floral Organoleptic: fruity. 3053. fruity Halal. 2736..Juniperberryoil Isopropyl phenylacetate Isovaleraldehyde Jasmin extract 3-Methylbutyraldehyde Jasmine oil [590‑86‑3] FEMA 2692 Flavis 5.... 425  ≥85%... Jojoba bean oil Juniper berry oil [8002‑68‑4] FEMA 2604 from Juniperus communis L. Jojoba liquid wax. animal Halal. spicy. see Jasmin absolute Page 73 Jasmin extract Page 73 Feel inspired at safcglobal...

SAFC® Flavors & Fragrances
Ketoandrostene
> 3-Keto-5α,16-androstene, see 5α-Androst-16-en-3-one
Page 14
α-Ketobutyric acid, see 2-Oxobutyric acid Page 103
2-Ketobutyric acid, see 2-Oxobutyric acid Page 103
α-Ketoisocaproic acid sodium salt, see 4-Methyl-2-oxopentanoic acid sodium salt Page 90
Ketoisophorone, see 4-Oxoisophorone Page 103
α-Ketoisovaleric acid sodium salt, see 3-Methyl-2-oxobutanoic acid sodium salt Page 90
Ketoleucine sodium salt, see 4-Methyl-2-oxopentanoic acid
sodium salt Page 90
Ketone Moschus, see Musk ketone Page 96
α-Ketopropionic acid, see Pyruvic acid Page 116
Ketovaline sodium salt, see 3-Methyl-2-oxobutanoic acid
sodium salt Page 90

Lauric aldehyde

Lavender absolute

Dodecyl aldehyde; Laurinaldehyde; Dodecanal;
Lauraldehyde; Aldehyde C12

[8000‑28‑0]

[112‑54‑9] FEMA 2615 Flavis 5.011
CH3(CH2)10CHO C12H24O FW 184.32

FEMA 2620

DL-Lactic

acid; 2-Hydroxypropionic acid

[50‑21‑5] FEMA 2611 CH3CH(OH)COOH C3H6O3
FW 90.08

from Lavandula angustifolia L.
Organoleptic: herbaceous

 ≥95%, FCC

W262000-SAMPLE

CoE Nr 99

W262000-100G

100 g

W262000-1KG

1 kg

Organoleptic: herbaceous; waxy; floral; sweet
Halal, Kosher, NI

> Lavender oil, see Lavender oil 40/42% fleurs Page 74

W261505-1KG-K

1 kg

W261505-4KG-K

4 kg

W261505-8KG-K

8 kg

W261505-20KG-K

20 kg

Contains approximately equal amounts of D- and Lisomers.
Arc. 1792; Fen. 426

 natural, ≥95%, FCC, FG

 85%, FCC
CoE Nr 4

Halal, Kosher
Organoleptic: floral; sweet; herbaceous; waxy

Halal, Kosher, NI

W261513-SAMPLE-K

W261106-SAMPLE-K

W261513-100G-K

100 g

W261106-1KG-K

1 kg

W261513-1KG-K

1 kg

W261106-10KG-K

10 kg

W261513-4KG-K

4 kg

W261106-25KG-K

25 kg

 natural, ≥85%
Remaining 15% contains: water, higher oligomers of
lactic acid and other FEMA GRAS components
Organoleptic: fatty
Halal, Kosher
W261114-SAMPLE-K
W261114-1KG-K

1 kg

W261114-5KG-K

5 kg

W261114-10KG-K

10 kg

>

Lauric acid

 ≥98%

W262218-SAMPLE-K

FEMA 2616 Flavis 9.01 CoE Nr 200

W262218-1KG-K

1 kg

Organoleptic: citrus; rose
Kosher, NI

W262218-4KG-K

4 kg

Lavender oil synthetic

W261602-1KG-K

1 kg

Organoleptic: floral; herbaceous

W261602-4KG-K

4 kg

W512850-SAMPLE

W261602-9KG-K

9 kg

W512850-1KG

1 kg

W512850-4KG

4 kg

W512850-8KG

8 kg

 ≥98%, FCC, FG

 ≥98%
FEMA 2617 Flavis 2.008 CoE Nr 56

W261408-5KG-K

5 kg

W261408-10KG-K

10 kg

W261408-25KG-K

25 kg

 natural, ≥98%, FCC
CoE Nr 12c

W261718-SAMPLE-K

FEMA 2624

5 kg

W261416-10KG-K

10 kg

1 kg

Kosher

W261718-4KG-K

4 kg

W262440-SAMPLE-K

W261718-8KG-K

8 kg

W262440-1KG-K

W261718-20KG-K

20 kg

> Lauric acid butyl ester, see Butyl laurate Page 23
Lauric acid ethyl ester, see Ethyl laurate Page 47
Lauric acid methyl ester, see Methyl laurate Page 88

74

Place an order with your local SAFC representative (see back for contacts).

8

 Certified organic (NOP/EU)

W261718-1KG-K

1 kg

W261416-5KG-K

Lemongrass oil
[8007‑02‑1]

W261416-SAMPLE-K
W261416-1KG-K

> Lavender spike oil, see Spike lavender oil Page 119
Leaf acetate, see cis-3-Hexenyl acetate Page 62
Leaf aldehyde, see trans-2-Hexen-1-al Page 60
trans-2-Hexen-1-al Page 60
Lemongrass oil, see Lemongrass oil, East Indian Page 74

Halal, Kosher, NI
Organoleptic: coconut; honey; fatty; earthy; soapy;
waxy

> Lavandula officinalis Labiatae, see Lavender oil 40/42% fleurs
Page 74

Kosher

Lavender oil 40/42% fleurs

Arc. 1113; Fen. 428

Arc. 1108; Fen. 428

1 kg

1 kg

from Lavandula officinalis Chaix
Kosher
Organoleptic: lavender; spicy
Russia origin

[112‑66‑3] CH3CO2(CH2)11CH3 C14H28O2
FW 228.37

[112‑53‑8] CH3(CH2)11OH C12H26O FW 186.33

W261408-1KG-K

W262235-1KG-K

FEMA 2622

Dodecyl acetate

Organoleptic: fatty
Arc. 1107; Fen. 427

W261408-SAMPLE-K

from (Lavandula angustifolia)
Kosher
eastern Europe origin

Fen. 166

1-Dodecanol; Dodecyl alcohol; Alcohol C12

Halal, Kosher, NI

 Certified organic (NOP/EU)

[8000‑28‑0]

[143‑07‑7] FEMA 2614 Flavis 8.012
CH3(CH2)10COOH C12H24O2 FW 200.32

CoE Nr 12

Fen. 166

Lavender oil
> Laurinaldehyde, see Lauric aldehyde Page 74

Lauryl alcohol

Dodecanoic acid; ABL

8

W262235-SAMPLE-K

W261602-SAMPLE-K

DL-Lactic acid, see Lactic acid Page 74
LAT, see Tetracosanoic acid tryptamide Page 122
Lauraldehyde, see Lauric aldehyde Page 74

Lavender oil
[8000‑28‑0]

FEMA 2622

CoE Nr 99c

Lauryl acetate

CoE Nr 4c

 natural

Arc. 1105; Fen. 427

W261505-SAMPLE-K

Lactic acid

8

1 kg

Linalool
Lemongrass oil, East Indian

L-Leucine

(R)-(+)-Limonene

Lemongrass oil

(S)-2-Amino-4-methylpentanoic acid

 ≥93%

[8007‑02‑1]

[61‑90‑5] (CH3)2CHCH2CH(NH2)CO2H C6H13NO2
FW 131.17

FEMA 2633 Flavis 1.045 CoE Nr 491

from Cymbopogon citratus DC. and Cymbopogon
flexuosus
Kosher
India origin

 ≥98.5%, FCC

Organoleptic: lemon; orange; citrus; sweet
Kosher, NI
Arc. 1800; Fen. 430

FEMA 3297 Flavis 17.012 CoE Nr 10482

W263303-SAMPLE-K

Kosher, NI

W263303-1KG-K

W329703-SAMPLE-K

W262404-SAMPLE-K

W263303-8KG-K

8 kg

W329703-100G-K

100 g

W263303-20KG-K

20 kg

 natural

Fen. 429

FEMA 2624

W262404-1KG-K

1 kg

W329703-1KG-K

1 kg

W262404-9KG-K

9 kg

W329703-5KG-K

5 kg

W262404-20KG-K

20 kg

Leucomalachite Green

Lemongrass oil
[8007‑02‑1]

 rectified, Guatemala origin
from Cymbopogon citratus DC. and Cymbopogon
flexuosus
Kosher

8

1 kg

W523100-4KG-K

4 kg

W523100-9KG-K

9 kg

Lemon oil

[5989‑54‑8] C10H16 FW 136.23

[129‑73‑7] C6H5CH[C6H4N(CH3)2]2 C23H26N2
FW 330.47

 ≥95%, FCC

 analytical standard

Organoleptic: herbaceous; minty; camphoraceous
Kosher

Flavis 1.046

≥98.0% (HPLC)
69669-25MG

25 mg

1 kg

W504505-4KG-K

4 kg

4-Oxovaleric acid; 4-Oxopentanoic acid

W504505-8KG-K

8 kg

[123‑76‑2] CH3COCH2CH2COOH C5H8O3
FW 116.12

> (±)-Limonene, see Dipentene Page 40

(1S,2S,4R)-(+)-Limonene-1,2-diol

 ≥97%, FG
Organoleptic: wine-like
Halal, Kosher, NI

from Citrus limon (L.) Burm. F.
Kosher
Organoleptic: lemon; sour
Fen. 169

W262706-SAMPLE-K
W262706-1KG-K

W262501-SAMPLE-K

8

(+)-1-Hydroxyneodihydrocarveol; (1S,2S,4R)-(+)-4Isopropenyl-1-methylcyclohexan-1,2-diol;
(1S,2S,4R)-(+)-p-Menth-8-en-1,2-diol; (1S,2S,4R)8-p-Menth-8-ene-1,2-diol; (+)-(1S,2S,4R)-Limonene
glycol

FEMA 2627 Flavis 8.023 CoE Nr 23

 rectified, Argentina origin

W504505-SAMPLE-K
W504505-1KG-K

Levulinic acid

Arc. 1798; Fen. 429

[8008‑56‑8] FEMA 2625

(S)-(−)-Limonene
(−)-Carvene; (S)-4-Isopropenyl-1-methyl cyclohexene; (−)-p-Mentha-1,8-diene

4,4′-Benzylidenebis(N,N-dimethylaniline)

W523100-SAMPLE-K
W523100-1KG-K

1 kg

1 kg

[38630‑75‑0] C10H18O2 FW 170.25

 ≥97%

W262706-5KG-K

5 kg

W262501-1KG-K

1 kg

W262706-10KG-K

10 kg

FEMA 4409

W262501-5KG-K

5 kg

W262706-25KG-K

25 kg

W440900-1G

1g

W440900-25G

25 g

W440900-100G

100 g

 cold-pressed, California origin

> N-Lignoceroyltryptamine, see Tetracosanoic acid tryptamide
Page 122

from (Citrus limon)
Organoleptic: lemon; sour
Halal, Kosher
Fen. 169

> (+)-(1S,2S,4R)-Limonene glycol, see (1S,2S,4R)(+)-Limonene-1,2-diol Page 75
(−)-Linalool, see L-Linalool Page 76

Lime oil
[8008‑26‑2]

W262528-SAMPLE-K

Kosher

W262528-1KG-K

1 kg

 expressed, Mexico or Tahiti origin

W262528-5KG-K

5 kg

FEMA 2631

 Certified organic (NOP/EU)

8

Linalool
(±)-3,7-Dimethyl-1,6-octadien-3-ol; (±)-3,7Dimethyl-3-hydroxy-1,6-octadiene

from Citrus aurantifolia

[78‑70‑6] (CH3)2C=CHCH2CH2C(CH3)(OH)CH=CH2
C10H18O FW 154.25

Kosher
Italy origin

W263117-SAMPLE-K
W263117-1KG-K

1 kg

Arc. 1803; Fen. 431

W262533-SAMPLE-K

W263117-9KG-K

9 kg

 ≥97%, FCC, FG

W263117-20KG-K

20 kg

W262533-1KG-K

1 kg

Lemon oil, terpeneless

8

[68648‑39‑5]

 purified by distillation, FCC, Mexico origin

Organoleptic: lemon; orange; floral; citrus; sweet
Halal, Kosher, NI

FEMA 2631

W263508-SAMPLE-K

from Citrus aurantifolia Swingle (rutaceae)
Organoleptic: lime
Fen. 175

 natural, FG
FEMA 2626

from Citrus limonum

W263508-1KG-K

W263109-SAMPLE-K

W262600-SAMPLE
W262600-500G

500 g

W262600-1KG

1 kg

> Lepidine, see 4-Methylquinoline Page 93

FEMA 2635 Flavis 2.013 CoE Nr 61

W263109-1KG-K

1 kg

W263109-4KG-K

4 kg

 Certified organic (NOP/EU)

1 kg

W263508-9KG-K

9 kg

W263508-20KG-K

20 kg

8

Cold pressed
Mexico origin

W530106-SAMPLE-K
W530106-1KG-K

Feel inspired at safcglobal.com

1 kg

75

SAFC® Flavors & Fragrances
Linalool
L-Linalool

Linalyl formate

(−)-Linalool; (R)-(−)-3,7-Dimethyl-1,6-octadien-3-ol

Litsea cubeba oil

[115‑99‑1] HCO2C(C=CH2)(CH3)CH2CH2CH=
C(CH3)2 C11H18O2 FW 182.26

Arc. 1803

 FCC

 natural, ≥80%

FEMA 2642 Flavis 9.08 CoE Nr 347

W517208-SAMPLE-K

FEMA 2635 CoE Nr 61

Organoleptic: green; herbaceous; citrus; woody
Halal, Kosher, NI

W517208-1KG-K

1 kg

W517208-4KG-K

4 kg

W517208-9KG-K

9 kg

Organoleptic: floral; woody
Kosher
Fen. 431
W263516-1KG-K

1 kg

W263516-4KG-K

4 kg

W263516-9KG-K

9 kg

3,7-Dimethyl-1,6-octadien-3-yl acetate
[115‑95‑7] FEMA 2636 Flavis 9.013 CoE Nr 203
CH3CO2C(CH=CH2)(CH3)CH2CH2CH=C(CH3)2
C12H20O2 FW 196.29

Arc. 1806; Fen. 433

1 kg

W264202-4KG-K

4 kg

W264202-9KG-K

9 kg

Linalyl isovalerate

synthetic
Organoleptic: floral; fruity; pear; sweet
Kosher, NI
1 kg

W263605-9KG-K

9 kg

W263605-20KG-K

20 kg

 natural, ≥80%

Arc. 1825; Fen. 437

 ≥95%
FEMA 2646 Flavis 9.454 CoE Nr 449

W264601-100G

100 g

W264601-1KG

1 kg

W264601-4KG

4 kg

Linalyl propionate
[144‑39‑8] C2H5CO2C(CH=CH2)(CH3)CH2CH2CH=
C(CH3)2 C13H22O2 FW 210.31

100 g

W263613-1KG-K

1 kg

W263613-4KG-K

4 kg

Linalyl benzoate
[126‑64‑7] C17H22O2 FW 258.36
FEMA 2638 Flavis 9.771 CoE Nr 654

Arc. 1809; Fen. 434

 ≥93%
Organoleptic: banana
Halal, Kosher, NI

NI
W384704-SAMPLE

W264504-9KG-K

9 kg

W384704-100G

100 g

W384704-1KG

1 kg

W384704-5KG

5 kg

250 g

W263907-1KG-K

1 kg

W263907-4KG-K

4 kg

W263907-9KG-K

9 kg

Macadamia oil

8

[438545‑25‑6]

 Certified organic (NOP/EU)

 ≥99%

from (Macadamia integrifolia)
Kosher
Kenya origin

FEMA 3380 Flavis 8.041 CoE Nr 694

W530179-SAMPLE-K

W338001-25G

25 g

W338001-100G

100 g

W338001-1KG

1 kg

W263907-SAMPLE-K
W263907-250G-K

> 2,6-Lutidine, see 2,6-Dimethylpyridine Page 39

4 kg

> Linseed oil, see Flax seed oil Page 53
Linseed oil, epoxidized, see Epoxidized linseed oil
Page 41
Lipid Crimson, see Sudan IV Page 120

FEMA 2639 Flavis 9.05 CoE Nr 276

1 kg

W264504-4KG-K

W338001-SAMPLE

[78‑36‑4] CH3CH2CH2CO2C(CH=
CH2)(CH3)CH2CH2CH=C(CH3)2 C14H24O2
FW 224.34

W265101-1KG-K

FEMA 3847 Flavis 17.026

NI

Linalyl butyrate

100 g

1 kg

Fen. 608
1 kg

25 g

W265101-100G-K

W264504-1KG-K

[60‑33‑3] CH3(CH2)4CH=CHCH2CH=CH(CH2)7CO2H
C18H32O2 FW 280.45

W263818-SAMPLE-K

W265101-25G-K

 ≥97%

W264504-SAMPLE-K

cis-9,cis-12-Octadecadienoic acid

Organoleptic: gardenia; jasmine
Halal, Kosher
Arc. 1808; Fen. 434

W265101-SAMPLE-K

[56‑87‑1] H2N(CH2)4CH(NH2)CO2H C6H14N2O2
FW 146.19

Organoleptic: herbaceous; pear; sweet
Halal, Kosher, NI

Linoleic acid

 ≥95%

Natural occurrence: Lovage root.
from Levisticum officinale Koch
Kosher
Organoleptic: cheese; fruity; vegetable; herbaceous; sweet; walnut; green; meaty; earthy
France origin

(S)-2,6-Diaminocaproic acid

FEMA 2645 Flavis 9.13 CoE Nr 411

W263613-100G-K

1 kg

L-Lysine

 ≥92%, FCC, FG

W263613-SAMPLE-K

W384606-SAMPLE-K

Lovage oil

Arc. 1821; Fen. 439

Organoleptic: floral; fruity; sweet
Kosher

8

[8016‑31‑7]
FEMA 2651

W264601-SAMPLE

W263605-SAMPLE-K

 Certified organic (NOP/EU)

Vietnam origin

W384606-1KG-K

Organoleptic: apple; fruity; sage; sweet
NI

 ≥97%, FCC

W263818-1KG-K

W264202-1KG-K

[1118‑27‑0] (CH3)2CHCH2CO2C(CH=
CH2)(CH3)CH2CH2CH=C(CH3)2 C15H26O2
FW 238.37

Linalyl acetate

W263605-1KG-K

Arc. 1815; Fen. 435

W264202-SAMPLE-K

W263516-SAMPLE-K

76

[68855‑99‑2] FEMA 3846

Kosher
from Litsea cubeba Pers.
China origin

[126‑91‑0] (CH3)2C=CHCH2CH2C(CH3)(OH)CH=CH2
C10H18O FW 154.25

Place an order with your local SAFC representative (see back for contacts).

W530179-1KG-K

1 kg

Magnesium phosphate hydrate
[53408‑95‑0] Mg3(PO4)2·xH2O Mg3O8P2 · xH2O
FW 262.86 (Anh)
W515701-SAMPLE
W515701-1KG

1 kg

W515701-5KG

5 kg

W515701-10KG

10 kg

> Maleic acid diethyl ester, see Diethyl maleate Page 34

8-dien-2-ol. orange. Kosher. Certified organic (NOP/EU) W266309-SAMPLE-K W265616-1KG W317705-SAMPLE-K W317705-250G-K  1 wt. see Terpinyl isobutyrate.2S.2-diol Page 75 (1R.4R)-(+)-p-Menth-8-en-1. see Balm leaves oil Page 16 Melonal.2S. Organoleptic: cherry.3-diene.6. 440  ≥98%.7-Tetrahydro-3. fruity.com Organoleptic: grape Kosher W317713-SAMPLE-K  sweet.036 Natural occurrence: Peppermint and penny royal oil. NI Organoleptic: berry W317705-100G-K [118‑71‑8] C6H6O3 FW 126.2S. FG W265624-SAMPLE-K W265624-100G-K 100 g W265624-1KG-K 1 kg W265624-5KG-K 5 kg 100 g 250 g W265721-4KG 4 kg W317705-1KG-K 1 kg W317705-5KG-K 5 kg Marjoram oil  mixture of cis and trans. see D-Dihydrocarvone. minty. 181 2-(1-Mercapto-1-methylethyl)-5-methylcyclohexanone. FG W265713-100G-K 100 g CoE Nr 148 W265713-1KG-K 1 kg Organoleptic: chocolate Halal. see 2-Butanone Page 21 Melaleuca alternifolia.4S)-p-Menthan-3-one. 440 W265713-SAMPLE-K  FCC. see γ-Terpinene Page 121 p-Mentha-1. waxy Halal. see α-Terpinene Page 121 p-Mentha-1. citrus. orange.22  Certified organic (NOP/EU) from (Citrus reticulata) Kosher Italy origin  ≥99% 8 [8008‑31‑9] FEMA 3764 Flavis 10.4S)-p-Menth-8-en-3-ol.8-dien-2-one. creamy.4R)-8-p-Menth-8-ene-1.4R)(+)-Limonene-1.5. see Heptadecanoic acid tryptamide Page 57 Halal.2-diol Page 75 (1S.8-diene-7-ol. jam Halal.525 CoE Nr 10739 Organoleptic: caramel. mixture of isomers Page 122 p-Menth-1-en-8-yl-propionate. see (1S. citrus. grape.6-dimethylbenzofuran Page 122 Menthol.8-diene.20 Fen. see L-Menthone Page 78 Mentha Spicata deterpinized. see 2.11 Natural Occurrence: Mandarin peel.6-Dimethyl-5-heptenal Page 38 (S)-p-Mentha-1. Kosher W346209-SAMPLE-K W346209-100G-K 100 g W346209-250G-K 250 g W346209-1KG-K 1 kg Feel inspired at safcglobal. Mentha arvensis.Menthol DL-Malic acid DL-Hydroxybutanedioic acid Mandarin green oil acid.11 Arc. Organoleptic: berry.4(8)-diene. Spanish [8016‑33‑9] 1 kg W265616-5KG 5 kg W265616-10KG 10 kg from Thymus mastichina Kosher Spain origin W523208-SAMPLE-K Maltyl isobutyrate [65416‑14‑0] C10H12O4 FW 196. mixture of cis and trans Page 25 p-Mentha-6. peach. see Spearmint oil Page 119 [118‑71‑8] FEMA 2656 Flavis 7.014 Fen.4R)(+)-Limonene-1. see Dipentene Page 40 (S)-(−)-Limonene Page 75 p-Mentha-1. FG FEMA 3462 Flavis 9. natural. % in benzyl alcohol W265616-SAMPLE Halal.09 Kosher W265734-SAMPLE-K W265734-1KG-K W265501-SAMPLE-K W265501-1KG-K 1 kg W265501-5KG-K 5 kg W265501-10KG-K 10 kg  ≥99% FEMA 2657 FEMA 2655 Flavis 8. 1831. 8-Mercaptomenthone Arc. see (−)-Isopulegol Page 73 (S)-p-Menth-1-en-8-ol. ≥94%.014 C6H6O3 FW 126. see (1S.2-diol. see (S)-(−)-Perillaldehyde Page 106 p-Mentha-1. Fen.2-diol.038 C10H18OS FW 186. mixture of isomers Page 121 p-menth-1-en-8-yl-isobutyrate. peach. see (R)-(+)-Pulegone Page 116 (R)-p-Menth-4(8)-en-3-one. see Heptadecanoic acid tryptamide Page 57 MEK. see Tea tree oil Page 121 Melissa oil. 444 W265721-1KG W265721-SAMPLE from (Organum majorana) Kosher Egypt origin Maltol solution [38462‑22‑5] FEMA 3177 Flavis 12.3R. see L-Menthol Page 78 DL-Menthol Page 78 77 . sweet Halal 1 kg Mandarin oil FEMA 2657  Italian. Kosher Fen. waxy > Margaric acid tryptamide. mixture of isomers Page 35 p-menth-1-en-8-yl-formate. Kosher.8-dien-7-al. (±)-2-Hydroxysuccinic [6915‑15‑7] HO2CCH2CH(OH)CO2H C4H6O5 FW 134. FG 1 kg 3-Hydroxy-2-methyl-4-pyrone solution FEMA 2656 Flavis 7. NI W265713-4KG-K 4 kg W265608-SAMPLE-K  Argentina > Malonic acid diethyl ester.31 CoE Nr 11789 from Citrus reticulata Blanco Organoleptic: grape. ≥94% 8 [8015‑01‑8] FEMA 2663 W266309-1KG-K 1 kg Marjoram oil. 1831. see (S)-(−)-Perillyl alcohol Page 106 p-Mentha-6. see Terpinyl formate. see Terpinyl propionate Page 122 Menthofuran. Kosher p-Mentha-8-thiol-3-one W523208-1KG-K 1 kg W523208-4KG-K 4 kg W523208-9KG-K 9 kg > MAT. see α-Terpineol Page 121 p-Menth-4(8)-en-3-one. 440  mixture of cis and trans. see L-Carveol. see Diethyl malonate Page 35 Maltol 3-Hydroxy-2-methyl-4-pyrone W265608-250G-K 250 g W265608-1KG-K 1 kg W265608-5KG-K 5 kg W265608-10KG-K 10 kg W265608-25KG-K 25 kg  natural. fruity. see (R)-(+)-Pulegone Page 116 p-Menth-8-en-2-one.017 Menthalactone [13341‑72‑5] C10H14O2 FW 166. see Terpinolene Page 121 (1S. sour. 444 Fen. Fen.2S. FCC W376418-SAMPLE W376418-25G 25 g W376418-100G 100 g W376418-1KG 1 kg CoE Nr 142 > (1R. see 4. see D-Carvone Page 25 L-Carvone Page 25 W317713-100G-K 100 g W317713-1KG-K 1 kg > p-Menth-1.4-diene.

meaty. ginger and orange juice eucalyptus oil. ≥99%. W385409-SAMPLE-K W385409-25G-K 25 g W385409-100G-K 100 g > 2-(1-Mercapto-1-methylethyl)-5-methylcyclohexanone. FCC 1 kg Organoleptic: sulfurous.455 CoE Nr 450  10 wt. see 2-Methoxythiophenol Page 81 1 kg > Mercaptoethylpyrazine. (1R. 451 W266701-1KG-K FEMA 3502 Flavis 12. mango. Fen.27 Arc. see Pyrazineethanethiol Page 116 8-Mercaptomenthone. see Ethanethiol Page 42 Mercaptan C3. NI Arc. Fen. Menthol [89‑78‑1] C10H20O FW 156. peach. sweet. see N-Ethyl-2-isopropyl-5methylcyclohexanecarboxamide Page 47 (−)-Menthone.5R)-(−)-Menthol.024 CoE Nr 760 100 g [61597‑98‑6] C13H24O3 FW 228. Fen. woody Kosher. mixture of isomers W350206-SAMPLE-K acetate > (1R)-(−)-Menthyl acetate. (−)-Menthol.5R)2-Isopropyl-5-methylcyclohexanone FEMA 2668 CoE Nr 206 W350206-1KG-K 1 kg Natural occurrence: Mentha arvensis. lemon balm.21 FEMA 3748 Organoleptic: alcohol. raspberry.4-dithiane Page 36 2-Mercaptoanisole. raspberry.5R)-(−)-Menthol. FCC Natural occurrence: Mentha species. peppermint. (1R.4S)-p-Menthan-3-one. camphoraceous. Organoleptic: berry. sweet. buchu oil.2S. melon. minty. oily. 451 W350206-25G-K [14073‑97‑3] C10H18O FW 154. mango. fruity. see 2. fruity. herbaceous. raspberry. see p-Mentha-8-thiol-3-one Page 77 3-Mercapto-3-methylbutanol. alliaceous (onion. lemon blam. 1846. tobacco Kosher.2S. FCC FEMA 2665 Flavis 2. % in triacetin Organoleptic: fruity. NI Organoleptic: minty. orange. 1840.27 Arc. 5-Methyl-2-(1-methylethyl) cyclohexanol. see Mercaptopyruvic acid sodium salt Page 79 . minty. ginger and orange juice.SAFC® Flavors & Fragrances Menthol L-Menthol L-Menthyl (1R. tobacco. NI Fen. NI W266590-SAMPLE-K W266590-1KG-K 1 kg W266590-4KG-K 4 kg W266590-9KG-K 9 kg W266590-25KG-K 25 kg  natural. sweet Halal. 447  FCC acetate (1R)-(−)-Menthyl acetate [2623‑23‑6] C12H22O2 FW 198. see 3-Mercapto-3-methylbutan1-ol Page 78 3-Mercapto-3-methylbutan-1-ol 3-Mercapto-3-methylbutanol [34300‑94‑2] C5H12OS FW 120.38  mixture of isomers.015 CoE Nr 63 W266507-SAMPLE-K 2-Mercapto-3-butanol. herbaceous. scotch spearmint. see Propyl mercaptan Page 114 Mercaptan C4. see 1-Pentanethiol Page 104 Mercaptan C7. camphoraceous. herbaceous. 450 W266809-SAMPLE-K W266809-1KG-K 1 kg W266809-10KG-K 10 kg W266809-25KG-K 25 kg 78 Menthyl isovalerate Arc. garlic).33 W266701-SAMPLE-K  ≥97%. 450 W266825-SAMPLE-K W266825-100G-K 100 g W266825-1KG-K 1 kg W266825-5KG-K 5 kg DL-Menthyl W266507-250G-K 250 g W266507-1KG-K 1 kg W266507-4KG-K 4 kg > (1R. NI Fen. meaty. coffee Kosher W329800-SAMPLE-K W329800-25G-K 25 g W329800-100G-K 100 g W329800-1KG-K 1 kg  ≥98%.17 Fen. Fen. FCC Natural Occurrence: Mentha species. Organoleptic: minty.5-Dihydroxy-1.047 CoE Nr 11497 Organoleptic: chocolate. see 1-Heptanethiol Page 57 Mercaptoacetaldehyde dimer. Organoleptic: berry. Kosher. woody W266523-SAMPLE-K W266523-SAMPLE W266523-100G-K 100 g W266523-1KG-K 1 kg W266523-4KG-K 4 kg DL-Menthol 2-Isopropyl-5-methylcyclohexanol. alliaceous (onion. fruity. camphoraceous Kosher. 452  ≥80% FEMA 3298 Flavis 12. FCC FEMA 2668 Natural occurrence: Mentha arvensis. melon. FG [40789‑98‑8] CH3COCH2SHCH3 C4H8OS FW 104. raspberry.30  natural. 1854.047 W329810-SAMPLE W266906-SAMPLE W329810-1KG W266906-100G 100 g W266906-1KG 1 kg W266906-5KG 5 kg L-Menthyl lactate  ≥97% W266701-9KG-K 3-Mercapto-2-butanone 3-Mercapto-2-butanone solution [16409‑46‑4] C15H28O2 FW 240. garlic) Halal. 447  ≥99%. (2S. raspberry. see L-Menthol Page 78 Menthol Carboxamide WS-3. peppermint. Organoleptic: berry. FG W350206-100G-K Arc. scotch spearmint. ≥98%. minty.19  ≥97%. Kosher 25 g Fen. ≥96%. camphoraceous. see p-Mentha-8-thiol-3-one Page 77 3-Mercapto-2-oxopropionic acid sodium salt.17 FEMA 2669 Flavis 9.5R)-2-Isopropyl5-methylcyclohexanol [2216‑51‑5] FEMA 2665 CoE Nr 65c C10H20O FW 156.25 FEMA 2667 CoE Nr 2035 [37887‑04‑0] CH3CH(OH)CH(SH)CH3 C4H10OS FW 106. see 1-Butanethiol Page 20 2-Butanethiol Page 21 Mercaptan C5.2S. spicy. NI > Mercaptan C2.137 Kosher W374806-100G 100 g W374806-1KG 1 kg W374806-5KG 5 kg Place an order with your local SAFC representative (see back for contacts). NI FEMA 3298 Flavis 12. woody. 450 9 kg W266701-20KG-K 20 kg [40789‑98‑8] CH3CH(SH)COCH3 C4H8OS FW 104. 448 Natural occurrence: Mentha species. Fen. woody Halal. eucalyptus oil. mango. oily. 1843. Hexahydrothymol. buchu oil. camphoraceous. woody. see L-Menthyl acetate Page 78 Organoleptic: minty. camphoraceous Kosher. see L-Menthone Page 78 L-Menthone (−)-Menthone. woody. camphoraceous W374806-SAMPLE  ≥98% FEMA 3854 Flavis 12. 1841. minty. orange.

sherry. 455 Herniarin.048 CoE Nr 571 W318000-SAMPLE-K 2-Hydroxy-5-methylanisole. 2-Methoxy-p-cresol.19 W267112-SAMPLE-K W267112-25G-K 25 g W267112-100G-K 100 g W267112-1KG-K 1 kg 2-Methoxy-3-(1-methylpropyl)pyrazine Fen. see 2. see 3-(Methylthio)-1-propanol Page 95  ≥99%. bourbon vanilla. Organoleptic: bacon. meaty. 459 W356700-100G 100 g W356700-1KG 1 kg W343307-25G-K 25 g W356700-5KG 5 kg W343307-100G-K 100 g W343307-1KG-K 1 kg 7-Methoxycoumarin W343307-SAMPLE-K 2-Methoxy-3-methylpyrazine Fen.Methoxynaphthal 2-.11  90% FEMA 3901 W390101 > 2-Mercaptothiophene.17 [23832‑18‑0] C10H18S FW 170. 460 W330108-SAMPLE W515809-SAMPLE W330108-1KG 1 kg W515809-25G 25 g W330108-5KG 5 kg W515809-100G 100 g 10 kg W515809-1KG 1 kg W330108-10KG > Methionol.254  95% Soluble in: Alcohol Organoleptic: earthy. see 2-Methoxy-4-methylphenol Page 79 FEMA 3183 Flavis 14. 4-Methylguaiacol Organoleptic: spicy. sweet. FCC. vegetable. bourbon vanilla. jasmine. FG > 2-Methoxy-p-cresol. floral. FG Natural occurrence: Coffee. chocolate. floral. see Anisole Page 15 p-Methoxybenzoic acid. 456  ≥95% FEMA 3180 Flavis 12. woody. green mate and jasmine flowers.039 CoE Nr 4156 Organoleptic: meaty Halal. see 1-(p-Methoxyphenyl)-2propanone Page 81 4-Methoxybenzyl propionate. see p-Anisic acid Page 15 3-Methoxybenzoic acid. cheese. smoky.21 Natural occurrence: Coffee. mushroom. cheese.4-dithiane Page 37 2-Mercaptopropionic acid Thiolactic acid [79‑42‑5] CH3CH(SH)COOH C3H6O2S FW 106. malt. carnation. 457 2-sec-Butyl-3-methoxypyrazine  ≥98% [24168‑70‑5] C9H14N2O FW 166. see 2-Thiophenethiol Page 123 Mesitol. gruyere cheese. 456 CoE Nr 175c  ≥96%. see p-Anisaldehyde Page 14 Methoxybenzene. spicy. (±)-2Amino-4-(methylmercapto)butyric acid [59‑51‑8] CH3SCH2CH2CH(NH2)COOH C5H11NO2S FW 149. woody. rum.10-Mercaptopinane. see 4-Methyl-3-penten-2-one Page 92 p-Meth-1-en-8-yl-formate. NI W318302-SAMPLE-K W318302-25G-K 25 g W318302-100G-K 100 g W318302-250G-K 250 g W318302-1KG-K 1 kg W318302-5KG-K 5 kg > 2-Methoxynaphthalene. see Nerolin Yara Yara Page 97 Feel inspired at safcglobal.com 79 .5dihydroxy-1. wine-like. see 2. jasmine flowers. vanilla. see Anisyl propionate Page 15 W350303-25G-K 25 g W350303-100G-K 100 g W350303-1KG-K 1 kg > 1-Mercaptopropanone (dimer). green. cocoa.19  natural. pork.007 CH3OC6H3(CH3)OH C8H10O2 FW 138. citrus. 705. meaty. sweet Halal. Methyl umbelliferyl ether  ≥98. green mate.014 CoE Nr 569  ≥98% Fen.31  99% Fen. NI W267104-SAMPLE-K W267104-100G-K 100 g W267104-1KG-K 1 kg W267104-5KG-K 5 kg W267104-10KG-K 10 kg [1504‑74‑1] CH3OC6H4CH=CHCHO C10H10O2 FW 162.141 CoE Nr 2332 Arc. see Terpinolene Page 121 Methional. Fen. 453 [93‑51‑6] FEMA 2671 Flavis 4. Kosher CoE Nr 175 o-Methoxycinnamaldehyde W318000-1KG-K 1 kg W318000-5KG-K 5 kg W318000-10KG-K 10 kg W318000-25KG-K 25 kg Mercaptopyruvic acid sodium salt Sodium mercaptopyruvate. NI W318108-SAMPLE-K W318108-100G-K 100 g W318108-250G-K 250 g W318108-1KG-K 1 kg W318108-5KG-K 5 kg trans-p-Methoxycinnamaldehyde [24680‑50‑0] CH3OC6H4CH=CHCHO C10H10O2 FW 162. 3-Mercapto-2-oxopropionic acid sodium salt [10255‑67‑1] HSCH2COCOONa C3H3NaO3S FW 142. rum. bourbon whiskey.062 CoE Nr 11300 W356700-SAMPLE Organoleptic: green. clove. NI Fen. see Acetanisole Page 8 2-Methoxybenzaldehyde. FG Organoleptic: grapefruit. Kosher. FCC [531‑59‑9] C10H8O3 FW 176.14 FEMA 3301 Flavis 17. creamy. 97% Arc. 459  ≥98%. see m-Anisaldehyde Page 14 4-Methoxybenzaldehyde. see m-Anisic acid Page 15 4-Methoxybenzoic acid. sherry. bourbon whiskey. Kosher. sweet.17 [2847‑30‑5] C6H8N2O FW 124. sulfurous Kosher W416301 W350303-SAMPLE-K > 4′-Methoxyacetophenone. Organoleptic: carnation.5-Dimethyl-2.3-.126 CoE Nr 2266 Organoleptic: almond Halal. tea. jasmine. pork. tea. see o-Anisaldehyde Page 14 3-Methoxybenzaldehyde. medicinal. see p-Anisic acid Page 15 4-Methoxybenzyl alcohol.22 FEMA 3567 CoE Nr 11919  ≥98% Organoleptic: cinnamon. herbaceous NI FEMA 3433 Flavis 14. cocoa. 4-Hydroxy-3-methoxytoluene. clove. malt. mushroom. Creosol. Fen.6-Trimethylphenol Page 126 Mesityl oxide. pepper Halal.14 Fen. see Anisyl alcohol Page 15 4-Methoxybenzyl formate. mesquite. 1868. beer. gruyere cheese. see Anisyl formate Page 15 4-Methoxybenzyl methyl ketone.16 FEMA 4163 Flavis 7. Kosher. spicy. see 3-(Methylthio)propionaldehyde Page 95 DL-Methionine DL-2-Amino-4-(methylthio)butanoic acid. coffee. Kosher.4. mixture of isomers 2′-Methoxyacetophenone 2-Methoxy-4-methylphenol 2-Acetylanisole Pinanyl mercaptan [579‑74‑8] CH3OC6H4COCH3 C9H10O2 FW 150. wine-like Kosher FEMA 3181 Flavis 5. vanilla. medicinal FEMA 3503 Flavis 12. smoky. fruity. coffee Halal.5%. beer.

see Sudan red G Page 120 Feel it.23  ≥98%  ≥98% FEMA 3358 Flavis 14. sweet Halal. FCC. Fen.5 Or 6-Isopropyl-2-methoxypyrazine O-Acetylguaiacol Anisylacetone [93905‑03‑4] C8H12N2O FW 152. Organoleptic: horseradish.17 Fen. woody. NI W368709-SAMPLE W267201-SAMPLE-K W368709-100G 100 g W368709-1KG 1 kg W267201-100G-K 100 g W368709-5KG 5 kg W267201-1KG-K 1 kg W267201-5KG-K 5 kg > 4-Methoxyphenylacetone. Kosher. The strength of a global network.121 CoE Nr 11344 FEMA 3687 Flavis 9. see Guaiacol Page 56 Arc. FG FEMA 2672 Flavis 7. floral.S. raspberry.174 CoE Nr 552 Natural occurrence: Green peas and potatoes. pepper Kosher. 1475.029 CoE Nr 163 Organoleptic: cherry. Contact your SAFC representative or visit safcglobal. earthy. You need a fully compliant supply chain that can make on-time deliveries anywhere in the world.19 [613‑70‑7] CH3CO2C6H4OCH3 C9H10O3 FW 166. 248. 457 Arc. . 308 [104‑20‑1] CH3OC6H4CH2CH2COCH3 C11H14O2 FW 178. 461  ≥98%. Let SAFC customize one just for you from a global network of resources and services that includes AIB audited facilities in Europe and the U. see 1-(p-Methoxyphenyl)-2propanone Page 81 1-(2-Methoxyphenylazo)-2-naphthol. Fen. NI Organoleptic: musty.SAFC® Flavors & Fragrances Methoxyorisopro 2-Methoxy-3(5 or 6)-isopropylpyrazine 2-Methoxyphenyl acetate 4-(4-Methoxyphenyl)-2-butanone 3. peanut. green.com/flavors-fragrances 80 Place an order with your local SAFC representative (see back for contacts). walnut NI W335800-1G-K 1g W335800-25G-K 25 g W335800-100G-K 100 g > 2-Methoxyphenol.

139 FEMA 4316 Flavis 7. see trans-Anethole Page 14 2-Methoxy-4-propenylphenol.251 4-Methoxyphenylacetone. NI > o-Methylacetophenone. FCC Organoleptic: chocolate. 2Acetyltoluene. Fen. meaty. 944.173  ≥97% W510262 FEMA 4159 Flavis 12. NI W267600-1KG 1 kg W267600-5KG 5 kg W267600-10KG 10 kg W267600-20KG 20 kg 1 kg  ≥95%. see Eugenol Page 51 2-Methoxy-4-propylphenol 4-Propylguaiacol. spicy. woody.com W268003-100G-K 100 g W268003-1KG-K 1 kg W268003-5KG-K 5 kg 81 . Fen. NI W267708-SAMPLE-K 1 kg W267708-5KG-K 5 kg W267708-10KG-K 10 kg W267708-25KG-K 25 kg Methyl 4-methoxybenzoate.1 Possible applications: Vanilla. FCC.22 2-Mercaptoanisole. p-Anisic acid methyl ester [121‑98‑2] CH3OC6H4CO2CH3 C9H10O3 FW 166.049 Natural occurrence: Carambola. cherry. wine-like. 1893. almond.022 CoE Nr 156 W267511-25G-K  ≥99%.713 CoE Nr 248 Natural occurrence: Cocoa. 1-(2-Methylphenyl)ethanone W267902-SAMPLE-K W267902-250G-K 250 g W267902-1KG-K 1 kg W267902-5KG-K 5 kg W267902-10KG-K 10 kg 2-Methylanisole [578‑58‑5] CH3C6H4OCH3 C8H10O FW 122. guava. 462  ≥97% 2-Methoxy-4-vinylphenol FEMA 2674 Flavis 7. soapy Kosher. oily. spicy. 1883. tea and sherry.087 CoE Nr 2047 Organoleptic: caramel. earthy.08 Organoleptic: ethereal.Methylanisole 3-(4-Methoxyphenyl)-1-propanol 2-Methoxythiophenol 2′-Methylacetophenone [5406‑18‑8] CH3OC6H4(CH2)3OH C10H14O2 FW 166. woody. fruity Halal. 4-Methoxybenzyl methyl ketone W415901-SAMPLE W415901-25G 25 g [122‑84‑9] CH3OC6H4CH2COCH3 C10H12O2 FW 164. sweet Halal. see 2′-Methylacetophenone Page 81 W330205-1KG-K Arc. Fen. floral.18  ≥96% Organoleptic: caramel.17 Arc.17 W267406-SAMPLE-K Arc. Kosher. sweet. 466 CoE Nr 213c 5 kg 25 g 4′-Methylacetophenone  natural (US) 1 kg 100 g 1 kg Methyl p-anisate W267600-SAMPLE W267619-5KG-K W330205-100G-K W431600-1KG > Methyl allylacetate. 464 FEMA 3302 Flavis 14.054 CoE Nr 11347 W431600-SAMPLE Methyl p-tolyl ketone Halal. Kosher [3149‑28‑8] C5H6N2O FW 110. 1-(2-Tolyl)ethanone. pork. pepper. Perfum. 34 (1). NI Fen.22 Arc. Fen. coumarin and various nut nuances. see Methyl anthranilate Page 82 Methyl o-anisate. Organoleptic: anise. cited: 1. rum. 1908. NI W431600-50G [122‑00‑9] CH3C6H4COCH3 C9H10O FW 134. vanilla Kosher. creamy. fishy. melon. grape brandy. apricot.014 CoE Nr 187 Organoleptic: floral.16 Fen.11 58-59 (2009) FEMA 2675 Flavis 4. clove.009 CoE Nr 177  ≥98% FEMA 3598 Flavis 4. NI W268003-SAMPLE-K Feel inspired at safcglobal. nutty Kosher. Flavor. fruity. Thioguaiacol  99% [7217‑59‑6] CH3OC6H4SH C7H8OS FW 140. o-Methylacetophenone.20 Flavis 2. smoky Halal 1-(p-Methoxyphenyl)-2-propanone 8 Methyl o-tolyl ketone. wine-like Halal. 465 W267406-100G-K 100 g W267406-1KG-K 1 kg W267406-5KG-K 5 kg > trans-1-Methoxy-4-(1-propenyl)benzene. FG Organoleptic: hawthorne. 1891. chocolate. Organoleptic: anise. 469  ≥99% FEMA 2680 Flavis 4.  ≥98% Arc. spicy Kosher. peanut. cherry Lit. Dihydroeugenol [2785‑87‑7] CH3OC6H3(CH2CH2CH3)OH C10H14O2 FW 166. Fen.1 Organoleptic: almond. vanilla. creamy. whiskey. NI [7786‑61‑0] CH3OC6H3(CH=CH2)OH C9H10O2 FW 150.023 CH3COOCH3 C3H6O2 FW 74. mushroom. see Isoeugenol Page 70 2-Methoxy-4-(2-propenyl)phenol. Fen.18 Organoleptic: apple. see Methyl 2-methoxybenzoate Page 88 CoE Nr 213 W267619-1KG-K W330205-25G-K 250 g W267708-1KG-K Methyl acetate W267619-SAMPLE-K W330205-SAMPLE-K 50 g W431600-250G FEMA 2677 Flavis 7. walnut Kosher. Kosher. NI W359807-SAMPLE-K W359807-100G-K 100 g W359807-1KG-K 1 kg W359807-5KG-K 5 kg 2-Methoxypyrazine W267511-SAMPLE-K 25 g W267511-100G-K 100 g W267511-1KG-K 1 kg [79‑20‑9] FEMA 2676 Flavis 9. 469  ≥99% FEMA 2679 Flavis 9. mate. 463 Natural occurrence: Fish. 1895.20 W415901-100G 100 g W415901-500G 500 g W415901-1KG 1 kg Arc. coffee. Gerard Mosciano. 2-Methoxybenzenethiol. 466  ≥99% [577‑16‑2] CH3C6H4COCH3 C9H10O FW 134. see Methyl 4-pentenoate Page 91 Methyl 2-aminobenzoate.

477  ≥95% FEMA 3303 Flavis 12. green. see 2-Methylbenzoxazole Page 82 1 kg W523305-5KG 5 kg W523305-10KG 10 kg > 2-Methylbenzaldehyde. see p-Tolualdehyde Page 124 α−Methyl-benzenepropanol. coffee. lemon. 2176. see 2-Methylbenzoxazole Page 82 2-Methyl-4.21 [93‑92‑5] CH3CO2CH(CH3)C6H5 C10H12O2 FW 164. plum Halal. 2175. fruity. 34 (1).3-benzoxazole Natural Occurrence: Cocoa. 473  ≥98%  ≥99% α-Methylbenzyl propionate FEMA 4398 Flavis 13. 474 W268313-SAMPLE-K CoE Nr 250c α-Methylbenzyl butyrate [3460‑44‑4] CH3CH2CH2CO2CH(CH3)C6H5 C12H16O2 FW 192. rice vanilla. sweet. herbaceous. sweet. Styrallyl alcohol. 470  ≥99%. NI W268402-SAMPLE-K W330302-25G 25 g W330302-100G 100 g W330302-1KG 1 kg 3-Methyl-1-butanethiol W268402-1KG-K 1 kg W268402-5KG-K 5 kg W268402-10KG-K 10 kg [541‑31‑1] (CH3)2CHCH2CH2SH C5H12S FW 104. Kosher. Kosher. green.SAFC® Flavors & Fragrances Methylanisole 4-Methylanisole  ≥99%. see m-Tolualdehyde Page 124 4-Methylbenzaldehyde. see 4-Phenyl-2-butanol Page 109 2-Methylbenzenethiol. FCC. jasmine.25 2-Methylbenzoxazole CoE Nr 250 > (±)-α-Methylbenzyl alcohol.20 Fen. Gerard Mosciano. Methyl phenyl carbinol [98‑85‑1] C6H5CH(OH)CH3 C8H10O FW 122. Fen. FG W268313-100G-K 100 g W268313-1KG-K 1 kg W268313-5KG-K 5 kg [95‑21‑6] C8H7NO FW 133. ≥98%. 472.15  99% Possible applications: Tobacco.16 Arc. grape. coffee. 470 Organoleptic: hyacinth Halal.144 CoE Nr 425 Organoleptic: gardenia. ≥99%. 2-Methyl-1. Halal. 470 [93‑58‑3] FEMA 2683 Flavis 9.16 Kosher  ≥98%.5-benzoxazole. Fen. lemon. cited: 1.154 58-59 (2009) W268216-SAMPLE-K 8 2-Methyl-4. musty.048 CoE Nr 11509 W330302-SAMPLE Organoleptic: apple.15 Organoleptic: fruity Arc. 1910. Fen.725 C6H5COOCH3 C8H8O2 FW 136.231 CoE Nr 2083 W268909-SAMPLE-K Arc. FG Natural occurrence: Cocoa. grapefruit.015 CoE Nr 188 Organoleptic: cedar. vanilla Lit. lime. NI W268100-SAMPLE-K W268518-SAMPLE-K W268518-1KG-K 1 kg CoE Nr 260 W268518-10KG-K 10 kg NI W268518-25KG-K 25 kg W268100-1KG-K 1 kg W268100-5KG-K 5 kg W268305-1KG 1 kg W268100-10KG-K 10 kg W268305-10KG 10 kg W268305-25KG 25 kg CoE Nr 260c [134‑20‑3] FEMA 2682 Flavis 9. strawberry. earthy Kosher Arc. nut nuances for pecan. Flavor. Styrene alcohol. Fen.171 W385808-SAMPLE W385808-100G 100 g W385808-1KG 1 kg W385808-4KG 4 kg .623 FEMA 2686 Flavis 9.3-benzoxazole. 2179. jasmine. earthy Kosher 2-Methyl-1-butanethiol α-Methylbenzyl acetate  ≥98%. 719. lime. musty. camphoraceous Halal. 1912. vanilla. musty. FCC Flavis 9.20 W439800-1KG 1 kg > 2-Methyl-1. lime.5-benzoxazole. floral. cherry. Halal. see α-Methylbenzyl alcohol Page 82 Styrallyl butyrate  natural.178 CoE Nr 573 W523305-SAMPLE Organoleptic: fruity. almond and pistachio.16 Arc. grapefruit. medicinal Arc. see o-Toluenethiol Page 124 W268607-100G-K 100 g W268607-1KG-K 1 kg W268607-5KG-K 5 kg  >98% FEMA 2689 Flavis 9. FCC FEMA 2681 Flavis 4. strawberry and tangerine. Kosher. Isoamyl mercaptan FEMA 3858 Flavis 12. FCC Methyl benzoate [104‑93‑8] CH3C6H4OCH3 C8H10O FW 122. NI W268208-SAMPLE-K W268208-1KG-K 1 kg W268208-5KG-K 5 kg W268208-10KG-K 10 kg  natural (US). gardenia. Kosher W523305-1KG Arc. 473 82 W268607-SAMPLE-K Styrallyl acetate FEMA 2684 Flavis 9. coffee. FCC Methyl 2-aminobenzoate Organoleptic: chocolate. see o-Tolualdehyde Page 124 3-Methylbenzaldehyde. Fen. see 4-Phenyltoluene Page 111 [1878‑18‑8] C2H5CH(CH3)CH2SH C5H12S FW 104.1 Organoleptic: almond. mandarin. (±)-αMethylbenzyl alcohol. strawberry and tangerine. coffee. grape. Fen. W439800-SAMPLE W268216-25G-K 25 g W268216-100G-K 100 g W268216-1KG-K 1 kg Methyl atratate [4707‑47‑5] C10H12O4 FW 196. citrus. 476 W268909-1KG-K 1 kg W268909-5KG-K 5 kg W268909-10KG-K 10 kg > 4-Methylbiphenyl.715 2-(H2N)C6H4CO2CH3 C8H9NO2 FW 151. grapefruit. lemon. jasmine. Fen. apricot. mandarin. Perfum. FCC W268305-SAMPLE Methyl anthranilate FEMA 2685 Flavis 2.064 CoE Nr 2030 Place an order with your local SAFC representative (see back for contacts). 2186. Fen. pineapple. Kosher  ≥98%.21 W268402-25KG-K 25 kg  ≥97% α-Methylbenzyl alcohol (±)-1-Phenylethanol. grape.

. Fen.. 3..21 Fen. 478  ≥99%.531 CoE Nr 10772 (CH3)2CHCH2CO2CH2CH(CH3)C2H5 C10H20O2 FW 172. 3-Hydroxy-3-methyl-1butene W370304-SAMPLE W370304-100G 100 g W370304-1KG 1 kg W370304-4KG 4 kg trans-2-Methyl-2-butenal [497‑03‑0] CH3CH=C(CH3)CHO C5H8O FW 84. see Prenyl acetate Page 112 3-methyl-2-butenyl acetate. winelike. trans-2. 480 FEMA 3599 Flavis 8. Kosher W364428-SAMPLE-K W364428-100G-K 100 g  ≥98% W364428-1KG-K 1 kg Flavis 2.049 CoE Nr 11510  97% W519308-SAMPLE FEMA 3646 Flavis 5. 2950. 1924 3. Scotch spearmint..5% [80‑59‑1] CH3CH=C(CH3)COOH C5H8O2 FW 100.13 W503908-SAMPLE-K NI > 3-methyl-2-buten-1-ol acetate..1-Dimethylallyl alcohol.15  ≥98% FEMA 3703 Flavis 2.124 W519308-1KG 1 kg W364607-SAMPLE W519308-4KG 4 kg W519308-9KG 9 kg Kosher W330418-SAMPLE-K W330418-25G-K 25 g W364607-25G 25 g W330418-100G-K 100 g W364607-100G 100 g W330418-1KG-K 1 kg W364607-1KG 1 kg 2-Methyl-1-butanol trans-2-Methyl-2-butenoic acid [137‑32‑6] FEMA 3998 Flavis 2. see 2-Methylbutyl isovalerate Page 83 Feel inspired at safcglobal..... Prenol Tiglic aldehyde..176 FEMA 3304 Flavis 12.076 C2H5CH(CH3)CH2OH C5H12O FW 88. minty.. Organoleptic: apple...286 CoE Nr 10762 CH3CO2CH2CH(CH3)C2H5 C7H14O2 FW 130.. herbaceous Halal. fatty.13 W364703-SAMPLE-K Organoleptic: green.123 CoE Nr 4162 W364428-4KG-K 4 kg Organoleptic: oily. Fen.095 CoE Nr 2281 Halal.111 W364401-180KG-K 2-Methyl-3-buten-2-ol 1. spicy Halal. FCC Kosher Organoleptic: apple W350613-SAMPLE-K W340707-100G-K 100 g W350613-100G-K 100 g W340707-1KG-K 1 kg W350613-1KG-K 1 kg W340707-5KG-K 5 kg W350613-4KG-K 4 kg > 2-Methylbutyl 3-methylbutanoate. FG W399817-SAMPLE-K W399817-100G-K 100 g W399817-1KG-K 1 kg W399817-4KG-K 4 kg Organoleptic: banana. see DL-3-Methyl-2-butanol Page 83 DL-3-Methyl-2-butanol 3-Methyl-2-butanol. waxy.. 480 Natural occurrence: Peppermint. see Prenyl acetate Page 112 3-methyl-2-buten-1-yl acetate. 984 Flavis 2.3-Dimethylallyl alcohol..13 [107‑86‑8] (CH3)2C=CHCHO C5H8O FW 84. fruity Kosher.. NI  ≥98% W350605-SAMPLE-K FEMA 3647 Flavis 2.. 479 2-Methylbutyl acetate [624‑41‑9] FEMA 3644 Flavis 9..3-Dimethylacrylic acid.12  ≥97%  ≥98% Arc. 1936...15 trans-2.... Tiglic acid  natural.3-Dimethylacrolein.... 477 3-Methyl-3-buten-1-ol 3-Methylcrotonaldehyde..109 CoE Nr 4163 W350605-1KG-K 1 kg Organoleptic: green... FG FEMA 3407 Flavis 5. NI  natural. Prenal [763‑32‑6] CH2=C(CH3)CH2CH2OH C5H10O FW 86..........12 Arc... Kosher  99% Kosher..26 Arc.. sweet.3-Dimethylacrolein 9 kg 180 kg [115‑18‑4] CH2=CHC(CH3)2OH C5H10O FW 86. Tiglinaldehyde... FCC 3-Methyl-2-buten-1-ol Arc. fruity Halal.18  ≥99%. NI W350605-4KG-K 4 kg W350605-9KG-K 9 kg [556‑82‑1] (CH3)2C=CHCH2OH C5H10O FW 86. Kosher.12 Kosher Arc. <2.Methylbutylmeth 3-Methyl-2-butanethiol 3-Methyl-2-butenal [2084‑18‑6] (CH3)2CHCH(SH)CH3 C5H12S FW 104.. Fen. NI W359904-SAMPLE-K  ≥99% Halal W399809-SAMPLE W399809-1KG W364401-SAMPLE-K W359904-100G-K 100 g W364401-1KG-K 1 kg W359904-1KG-K 1 kg W364401-4KG-K 4 kg W359904-5KG-K 5 kg W364401-9KG-K 1 kg W399809-8KG 8 kg W399809-20KG 20 kg > 3-Methyl-1-butanol. 3...com 83 . see Prenyl acetate Page 112 W364703-1KG-K 1 kg tiglic acid .3Dimethylacrylaldehyde. peanut Fen. soapy. sherry and whiskey. herbaceous Kosher NI 2-Methylbutyl isovalerate 2-Methylbutyl 3-methylbutanoate W503908-1KG-K 1 kg W503908-4KG-K 4 kg W503908-8KG-K 8 kg [2445‑77‑4] FEMA 3506 Flavis 9.. 2949... earthy. Kosher. 482  ≥98%.. ≥98%.. see Isoamyl alcohol Page 67 3-Methyl-2-butanol. ≥98.0% W364703-4KG-K 4 kg W340707-SAMPLE-K W364703-8KG-K 8 kg  natural. 985.... Isopropyl methyl carbinol [598‑75‑4] (CH3)2CHCH(OH)CH3 C5H12O FW 88. Fen. ≥94%....064 CoE Nr 10168 Organoleptic: balsam.. FG Arc..

cider.13 [27625‑35‑0] FEMA 3505 Flavis 9..... NI W525405-1KG CoE Nr 263c Halal. woody... peach.. see Isovaleric acid Page 73 DL-2-Methylbutyric acid 2-methylbutyl ester. Kosher Organoleptic: apple. chocolate. coffee Organoleptic: fruity Kosher. sour. FCC FEMA 2697 Flavis 5. green. chocolate.13 Arc.... <5% W350508-SAMPLE-K W269107-SAMPLE-K W350508-100G-K 100 g W269107-100G-K 100 g W350508-1KG-K 1 kg W269107-1KG-K 1 kg W350508-4KG-K 4 kg W269107-4KG-K 4 kg W269107-8KG-K 8 kg  natural. cranberry. herbaceous.. apricot. berry.05 CoE Nr 578 Organoleptic: cinnamon... creamy.. woody Halal. Kosher. Halal. Kosher W269018-SAMPLE-K Natural occurrence: Apple. NI W269506-SAMPLE-K W269506-1KG-K 1 kg W522805-5KG 5 kg W522805-10KG 10 kg α-Methylcinnamaldehyde  ≥98%.... Organoleptic: apple.. NI Organoleptic: chocolate. fruity... FG FEMA 2695 Flavis 8. oriental tobacco... fruity. pineapple... ethereal Halal.. strawberry. 30% [2445‑78‑5] FEMA 3359 Flavis 9.... NI W269301-SAMPLE-K acid 2-methylbutyl ester [116‑53‑0] CH3CH2CH(CH3)COOH C5H10O2 FW 102..... apricot..... 1951. 486  ≥90% FEMA 2691 Flavis 5.. apricot. see Methyl hexanoate Page 87 2-Methylcaproic acid. Fen. 484 Fen. see (±)-γ-Valerolactone Page 128 Methyl caprate. FG FEMA 2690 Flavis 9. wine-like W269514-SAMPLE-K W269514-100G-K 100 g W269514-1KG-K 1 kg W269514-5KG-K 5 kg > 3-Methylbutyric acid.. FG CoE Nr 263 Organoleptic: apple. hyacinth. jasmine. 488 W269700-SAMPLE-K W269700-1KG-K 1 kg W269700-5KG-K 5 kg W269700-10KG-K 10 kg . Kosher Organoleptic: apple W335908-SAMPLE-K 5 kg W525405-10KG 10 kg Methyl cedryl ketone 100 g W335908-1KG-K 1 kg W269328-100G-K 100 g W335908-4KG-K 4 kg W269328-1KG-K 1 kg [32388‑55‑9] C17H26O FW 246. see Methyl decanoate Page 85 Methyl caproate. see 2-Methylbutyl 2-methylbutyrate Page 84 2-Methylbutyl 2-methylbutyrate Page 84 γ-Methyl-γ-butyrolactone... 1941. Fen. whiskey.143 W269328-4KG-K 4 kg W522805-SAMPLE W269328-SAMPLE-K W522805-1KG Organoleptic: apple. wine-like.. Kosher.53 C10H20O2 FW 172...39 W269301-10KG-K 10 kg  >96% Fen. strawberry. grape.046 CoE Nr 2002c Halal.. 484  ≥95%.  ≥97%.. spicy.758 CoE Nr 577 Organoleptic: creamy. sweet Kosher. see 2-Methylhexanoic acid Page 87 Methyl caprylate..39 Flavis 7. cocoa.. see Isovaleraldehyde Page 73 Methyl butyrate 3-methylbutyl 3-methylbutanoate .. strawberry.... cocoa. 1941. 481  natural. vinegar. ≥98%. 70% 3-methylbutyl 2-methylbutanoate basis CoE Nr 10721 Organoleptic: apple. floral 2-Methylbutyric acid W335916-SAMPLE W335916-100G-K 100 g W335916-1KG-K 1 kg [116‑53‑0] C2H5CH(CH3)CO2H C5H10O2 FW 102. see Methyl octanoate Page 90 [623‑42‑7] FEMA 2693 Flavis 9. NI Arc.13 Arc.516 CoE Nr 10773 C2H5CH(CH3)CO2CH2CH(CH3)C2H5 C10H20O2 FW 172. 486  ≥98%.... 1939.. cider..26 Natural Occurrence: Apple. NI isopentanal .... FG FEMA 2695 Flavis 8. grape.. ≥98%. cranberry...SAFC® Flavors & Fragrances Methylbutylmeth 3-Methylbutyl 2-methylbutanoate 2-Methylbutyraldehyde Isoamyl 2-methylbutyrate [96‑17‑3] C2H5CH(CH3)CHO C5H10O FW 86.26 Arc.. grape brandy. grape.. oriental tobacco. sweet Kosher W350516-SAMPLE-K W350516-100G-K 100 g W350516-1KG-K 1 kg W350516-4KG-K 4 kg 2-Methylbutyl 2-methylbutyrate DL-2-Methylbutyric > 3-Methylbutyraldehyde.. FG  natural.038 CH3CH2CH2COOCH3 C5H10O2 FW 102. strawberry. Kosher. 1938. FG Organoleptic: apple Halal. grape brandy..046 CoE Nr 2002 Methyl p-tert-butylphenylacetate 1 kg W525405-5KG W335908-100G-K  natural... sour.. Fen. Fen. cheese. 486 [3549‑23‑3] (CH3)3CC6H4CH2CO2CH3 C13H18O2 FW 206..28 Arc....... cheese. Fen... vinegar and whiskey... apricot.. Kosher..049 CoE Nr 575  ≥98% W269301-1KG-K 1 kg W269301-5KG-K 5 kg Methyl cedryl ether [19870‑74‑7] C16H28O FW 236. pineapple. 482 W269301-20KG-K 20 kg W525405-SAMPLE  ≥90%.... ≥98% 84 (±)-2-Methylbutyric acid 1 kg W269506-5KG-K 5 kg W269018-25G-K 25 g W269506-10KG-K 10 kg W269018-100G-K 100 g W269506-25KG-K 25 kg W269018-1KG-K 1 kg Place an order with your local SAFC representative (see back for contacts). 1934.. rose Halal..13 Arc. Fen. grape..

19 Arc. camphoraceous. 1949. 488 Methyl cyclopentenolone [3008‑43‑3] CH3C6H7(=O)2 C7H10O2 FW 126.179 FEMA 3948 1-Methyl-1.13  ≥97% Fen. Fen. herbaceous. 1965.13  ≥98%.15 1 kg W270008-5KG-K FEMA 3946 Flavis 7. see Terpinyl acetate Page 121 (S)-2-(4-Methyl-3-cyclohexenyl)-2-propanol. 491 [765‑70‑8] FEMA 2700 CoE Nr 758 C6H8O2 FW 112. 494 FEMA 3947 Flavis 7. FG Organoleptic: caramel. Kosher W269905-SAMPLE-K W269905-100G-K 100 g W269905-1KG-K 1 kg W269905-5KG-K 5 kg > 3-Methylcrotonaldehyde. Capric acid methyl ester [110‑42‑9] CH3(CH2)8COOCH3 C11H22O2 FW 186. Kosher. FG FEMA 3305 Flavis 7. 1949. fruity.2-cyclohexanedione [103‑26‑4] C6H5CH=CHCOOCH3 C10H10O2 FW 162.098 CoE Nr 11134  ≥97%. NI Halal. fruity NI W394807-SAMPLE [4313‑57‑9] C7H10 FW 94.com 85 . nutty. 495 FEMA 3360 Flavis 7.18  97% W394718-SAMPLE W394718-100G 100 g W394718-1KG 1 kg W394718-4KG 4 kg 4-Methylcyclohexanone FEMA 3435 Flavis 7.15 5H-5-Methyl-6. synthetic as antioxidant FEMA 3306 Flavis 14.17 6-Methylcoumarin W270008-100G-K [583‑60‑8] CH3C6H9(=O) C7H12O FW 112. FCC. FG Tetrahydro-o-cresol Organoleptic: balsam. FG  natural. Organoleptic: medicinal. coffee Halal.18  ≥98% Fen. buchu oil and heater beef fat.29 Arc. peanut NI W330604-SAMPLE-K W330604-25G-K 25 g W330604-100G-K 100 g W330604-250G-K 250 g W330604-1KG-K 1 kg > (±)-2-(4-Methyl-3-cyclohexenyl)isopropyl acetate.17  ≥99%  ≥99% Flavis 9. coconut.4-cyclohexadiene 250 g W270008-1KG-K  natural (US). Kosher Organoleptic: earthy.536 CoE Nr 11920 Organoleptic: berry. Fen. maple W270015-1KG-K W270015-SAMPLE-K W394602-100G 100 g W394602-1KG 1 kg W394602-5KG 5 kg 3-Methylcyclohexanone W270015-100G-K > 3-Methyl-2-cyclopentenone. Kosher W330507-SAMPLE W269816-SAMPLE-K W269816-25G-K 25 g W269816-100G-K 100 g W269816-1KG-K 1 kg W330507-25G 25 g W330507-100G 100 g W330507-1KG 1 kg 2-Methylcyclohexanone Methyl trans-cinnamate [1754‑62‑7] C6H5CH=CHCO2CH3 C10H10O2 FW 162. strawberry Halal. see 3-Methyl-2-cyclopenten-1one Page 85 3-Methyl-2-cyclopenten-1-one Tetrahydro-m-cresol 3-Methyl-2-cyclopentenone [2758‑18‑1] CH3C5H5(=O) C6H8O FW 96. 490 100 g W270008-250G-K  ≥99% [591‑24‑2] CH3C6H9(=O) C7H12O FW 112.19 Arc. FG FEMA 2699 Flavis 13. creamy. cherry. cornmint oil. 492  ≥98% FEMA 3568 Flavis 9. maple. FG Natural Occurrence: Peppermint oil. FCC  98%. Fen.012 CoE Nr 579 Organoleptic: anise. 443 [23747‑48‑0] C8H10N2 FW 134. 488  ≥98%. creamy W356808-SAMPLE W356808-100G 100 g W356808-1KG 1 kg W356808-5KG 5 kg 5 kg W270008-25KG-K 25 kg Organoleptic: caramel.7-dihydrocyclopenta[b] pyrazine Fen.08 CoE Nr 2311 FEMA 2698 Flavis 9. 1944 Tetrahydro-p-cresol [589‑92‑4] CH3C6H9(=O) C7H12O FW 112. smoky. FCC.10% alpha-tocopherol. NI W269808-SAMPLE-K W269808-1KG-K 1 kg W269808-10KG-K 10 kg W269808-25KG-K 25 kg [92‑48‑8] C10H8O2 FW 160. medicinal Kosher NI contains 0.17 W394602-SAMPLE FEMA 2698 CoE Nr 333 W270008-SAMPLE-K W505501-SAMPLE W394807-100G 100 g W505501-100G 100 g W394807-1KG 1 kg W505501-1KG 1 kg W394807-4KG 4 kg W505501-4KG 4 kg 3-Methyl-2-cyclohexenone [1193‑18‑6] CH3C6H7(=O) C7H10O FW 110. nutty. see α-Terpineol Page 121 Feel inspired at safcglobal.037 CoE Nr 2314 W336009-SAMPLE-K W336009-100G-K 100 g W336009-1KG-K 1 kg W336009-5KG-K 5 kg Halal. ≥98%.251 CoE Nr 2304 Organoleptic: oily. FCC. Kosher.17  ≥99%. minty Arc. licorice.Methyldihydrocy Methyl cinnamate 3-Methyl-1.112 W343502-25G 25 g W343502-100G 100 g Methyl decanoate Methyl caprate. balsamic Halal. penny royal oil.20 Fen.74 CoE Nr 333c Organoleptic: caramel.15 Cyclotene Fen. vanilla. wine-like. NI Halal. see 3-Methyl-2-butenal Page 83  ≥96% W508101-SAMPLE W508101-25G 25 g W508101-100G 100 g W508101-1KG 1 kg Methyl cyclohexanecarboxylate [4630‑82‑4] C6H11CO2CH3 C8H14O2 FW 142.

FG  ≥96% FEMA 4179 Flavis 13.17 FEMA 3704 Flavis 4.4-(Methylenedioxy)benzaldehyde.11 Arc. peach.2′-dimethyldifuran. see Dimethyl disulfide Page 38 Methyl dodecanoate. caramel. vegetable. Kosher.11-trimethylbicyclo[7. 501 NI Fen.001 CoE Nr 119 10 kg 1 kg  ≥80% W247502-SAMPLE-K W247502-10KG-K W336203-1KG-K Arc. apricot.. <0. 504  ≥99% FEMA 3307 Flavis 13. 3-(Acetylthio)-2-methylfuran. sweet Halal.04..0..2.053 Fen.11 W318809-SAMPLE-K Natural occurrence: Anise. 2031. see 2-Butanone Page 21 Methyl eugenol Eugenol methyl ether.05  ≥95% FEMA 2703 Flavis 13. coffee.. malt. meaty Halal. vanilla.055 CoE Nr 11678 25 g W336203-25G-K Methyl 2-furoate  ≥97% W370401-25G W336203-SAMPLE-K Place an order with your local SAFC representative (see back for contacts). meaty. Kosher. 503 W318809-25G-K 5-Methyl-2-furaldehyde 1 kg 100 g [611‑13‑2] C6H6O3 FW 126.064 CoE Nr 11513 FEMA 3408 Flavis 9.. see 2-Methoxy-4-methylphenol Page 79 2-Methoxy-4-methylphenol Page 79 Methyl heptanoate Methyl enanthate [106‑73‑0] CH3(CH2)5COOCH3 C8H16O2 FW 144. see β-Caryophyllene Page 26 (1R.. fruity.. roasted turkey. see α-Angelica lactone Page 14 2-Methylfuran-3-thioacetate. 2026. NI contains 450 ppm BHT as stabilizer Natural occurrence: Coffee. nutmeg. Eugenyl methyl ether [93‑15‑2] H2C=CHCH2C6H3(OCH3)2 C11H14O2 FW 178. see 2-Methyl-3-furanthiol acetate Page 86 2-Methyl-3-furanthiol [28588‑74‑1] C5H6OS FW 114.153 FEMA 2702 Flavis 13.. S-(2-methyl-3-furyl) ethanethioate.. raspberry. clove. 2033..12.6] dodecane. fruity. mushrooms.. musty. FG W370401-SAMPLE Organoleptic: butter. Kosher. basil. green Kosher.11. see Methyl heptanoate Page 86 3. cinnamon.. see Pyruvaldehyde solution Page 116 4-Methylguaiacol. clams. Methyl pyromucate FEMA 3188 Flavis 13. see Piperonal Page 112 trans-(1R.10 [57500‑00‑2] C6H8OS2 FW 160. woody.19 W417901-1KG-K 1 kg W417901-4KG-K 4 kg W417901-9KG-K 9 kg > Methyl furan-2-carboxylate.. potato.21 Arc. raspberry. peach.096 CoE Nr 368 Organoleptic: berry. mixture of cis and trans 2-Methylfuran Methyl furfuryl disulfide Silvan Furfuryl methyl disulfide [534‑22‑5] C5H6O FW 82. wheat bread.03 FEMA 3362 Flavis 13. oily. Organoleptic: anise.3′-Dithio-2. earthy. cinnamon. 497  ≥85%. 502 [24851‑98‑7] C13H22O3 FW 226. see Methyl 2-furoate Page 86 5-Methyl-2(3H)-furanone. 506  ≥99% FEMA 2705 Flavis 9..2. see Methyl laurate Page 88 Methyl enanthate..6R. plum.9S)-8-Methylene-4. malt. see 5-Methylfurfural Page 86 86  ≥98% Flavis 13. cooked rice. banana.. green Kosher W270504-SAMPLE-K Flavis 9. coffee. Fen. see (−)-Caryophyllene oxide Page 26 Methyl ethyl ketone. cocoa. sweet. garlic) Halal. S-(2-methyl-3-furanyl) ester.. Fen. 2076.31 Arc.3% (residual starting material) W270202-SAMPLE-K W270202-100G-K 100 g W270202-1KG-K 1 kg W270202-5KG-K 5 kg W270202-25KG-K 25 kg W330701-25G 25 g W330701-100G 100 g W330701-1KG 1 kg > 2-Methyl-3-furyl disulphide. . NI Organoleptic: almond.002 CoE Nr 358 Organoleptic: berry Kosher W270318-SAMPLE-K W270318-100G-K 100 g W270318-1KG-K 1 kg W270318-5KG-K 5 kg 3-(5-Methyl-2-furyl)butanal [31704‑80‑0] C9H12O2 FW 152.6-dimethoxyphenol [6638‑05‑7] CH3C6H2(OCH3)2OH C9H12O3 FW 168.52 CoE Nr 10785 Kosher. cloves. 649  ≥98%. 2Methyl-3-furyl thioacetate. papaya. 496 Natural occurrence: Jasmine Organoleptic: jasmine. nutty.26  ≥98%  ≥95%. passionfruit. and apricot. pork liver. sweet DMF . spicy. 3. banana. Kosher W370401-100G 100 g W370401-1KG 1 kg > Methyl disulfide. 2046. NI W417901-SAMPLE-K W340804-SAMPLE-K W340804-1KG-K 1 kg W340804-5KG-K 5 kg W340804-10KG-K 10 kg 4-Methyl-2. see 2-Methyl-3-furanthiol acetate Page 86 2-Methyl-3-furyl thioacetate.. creamy. Fen. NI Fen.. see 2-Methyl-3-furanthiol acetate Page 86 Methylglyoxal solution.642 W270504-1KG-K 1 kg W519103-1KG 1 kg W270504-4KG-K 4 kg W519103-10KG 10 kg W270504-9KG-K 9 kg W519103-25KG 25 kg W519103-SAMPLE > 5-Methyl-2-furaldehyde. NI W247502-1KG-K 25 g W336203-100G-K Methyl furan-2-carboxylate.. coconut.SAFC® Flavors & Fragrances Methyldihydroja Methyl dihydrojasmonate.. alliaceous (onion.. see Bis(2-Methyl-3-furyl) disulfide Page 19 S-(2-methyl-3-furyl) ethanethioate.23 Arc.10S )-9-Methylene-4. Fen. coconut. MFT Acetate.0] undec-4-ene. asparagus..058 CoE Nr 10355 Organoleptic: meaty Kosher Fen. grilled beef. 2-Methylfuran-3-thioacetate [55764‑25‑5] FEMA 3973 C7H8O2S FW 156. spicy.20 W247502-25KG-K 25 kg Methyl formate Formic acid methyl ester [107‑31‑3] HCO2CH3 C2H4O2 FW 60. Fen. vegetable W330701-SAMPLE W397301-SAMPLE-K W397301-25G-K 25 g W397301-100G-K 100 g W397301-1KG-K 1 kg 5-Methylfurfural [620‑02‑0] C6H6O2 FW 110.. plum. FCC FEMA 2475 CoE Nr 185 25 g W318809-100G-K 100 g 2-Methyl-3-furanthiol acetate Ethanethioic acid.19 Fen.4R. fishy.. chocolate. Organoleptic: caramel. 501  ≥98% Halal.12-trimethyl-5-oxatricyclo[8. 532 Organoleptic: fruity.

fruity Halal. FG CoE Nr 319 Organoleptic: ethereal. green Arc. see Cedar leaf oil Page 26 Methyl 2-hydroxybenzoate. Kosher W319104-SAMPLE-K W319104-100G-K 100 g CoE Nr 149c W319104-1KG-K 1 kg W270733-SAMPLE-K W319104-5KG-K 5 kg  natural. 507 5-Methyl-2-hepten-4-one. ≥99% W511404-25G 25 g W511404-100G 100 g W511404-1KG 1 kg 6-Methyl-5-hepten-2-one [110‑93‑0] FEMA 2707 Flavis 7.047 CoE Nr 2003 Fen. 500. ethereal.18 FEMA 4000 Flavis 7.139 CoE Nr 2085 2-Methyl-3-heptanone 5-Methyl-5-hexen-2-one CoE Nr 319c [21188‑58‑9] CH3CH2CH2CH(OH)CH2CO2CH3 C7H14O3 FW 146.21 [99‑76‑3] HOC6H4CO2CH3 C8H8O3 FW 152.20 Kosher Organoleptic: oily.069 CH3(CH2)4COOCH3 C7H14O2 FW 130.Methylhydroxyhe 2-Methylheptanoic acid [1188‑02‑9] CH3(CH2)4CH(CH3)CO2H C8H16O2 FW 144.18 Arc. 507 1 kg W271004-5KG-K 5 kg W271004-10KG-K 10 kg Methyl 3-hydroxyhexanoate 1 kg  ≥99%  ≥99%. 2079  ≥97%.20  ≥97% FEMA 2706 Flavis 8.124 W270806-20KG 20 kg W511404-SAMPLE  natural. 513 Methyl caproate. NI Fen.17 W336501 FEMA 3761 Flavis 7. Kosher 100 g W270601-1KG-K 1 kg W376108-SAMPLE-K W270601-5KG-K 5 kg W376108-25G-K 25 g W376108-100G-K 100 g W376108-1KG-K 1 kg [13019‑20‑0] CH3(CH2)3COCH(CH3)2 C8H16O FW 128. FG FEMA 3508 Flavis 9. ethereal Halal. p-Hydroxybenzoic acid methyl ester FEMA 2710 CoE Nr 657c Methyl hexanoate Arc. Caproic acid methyl ester W270806-SAMPLE 6-Methyl-5-hepten-2-ol Methyl paraben. 1945. FCC W271004-SAMPLE-K W270806-1KG [1569‑60‑4] (CH3)2C=CHCH2CH2CH(OH)CH3 C8H16O FW 128. Fen.17  98% FEMA 3364 Flavis 9. 514 Organoleptic: pineapple. NI W270806-4KG 4 kg W270806-9KG 9 kg Flavis 2. Kosher. cheese. 2043. Kosher  98%.21 Arc.21  98% W400009-25G 25 g W400009-100G 100 g W400009-1KG 1 kg W271004-1KG-K  ≥99%. 2040.015 (CH3)2C= CHCH2CH2COCH3 C8H14O FW 126. Fen.035 CoE Nr 582 Halal. FG W270601-SAMPLE-K Organoleptic: butter.15 Kosher. NI Fen.100 Methyl 4-hydroxybenzoate [106‑70‑7] FEMA 2708 Flavis 9. FCC [4536‑23‑6] CH3(CH2)3CH(CH3)COOH C7H14O2 FW 130. Fen. wine-like. pineapple Halal. ≥98%. Kosher W350818-SAMPLE-K W350818-100G-K 100 g W270814-SAMPLE-K W350818-1KG-K 1 kg W350818-5KG-K 5 kg W270814-100G-K 100 g W270814-1KG-K 1 kg W270814-4KG-K 4 kg 2-Methylhexanoic acid 2-Methylcaproic acid  ≥98%. Fen. creamy Halal.18 CoE Nr 149 NI Fen. see Methyl salicylate Page 93 W270601-100G-K Butyl isopropyl ketone [3240‑09‑3] H2C=C(CH3)CH2CH2COCH3 C7H12O FW 112.24  99% > Methyl 2-hexynoate. 509 W400009-SAMPLE FEMA 3365 Flavis 7.267 Kosher Organoleptic: pineapple Feel inspired at safcglobal. FCC W270733-25G-K 25 g W270733-100G-K 100 g W270733-1KG-K 1 kg Methyl trans-3-hexenoate [2396‑78‑3] CH3CH2CH=CHCH2CO2CH3 C7H12O2 FW 128. FG FEMA 3191 Flavis 8. hazelnut Halal. 508 Organoleptic: butter.com W336408-100G-K 100 g W336408-1KG-K 1 kg W336408-5KG-K 5 kg 87 . 510 W270709-SAMPLE-K W270709-1KG-K 1 kg W270709-8KG-K 8 kg W270709-20KG-K 20 kg  ≥99%. herbaceous. predominantly trans Hazelnut ketone [81925‑81‑7] C2H5CH(CH3)COCH=CHCH3 C8H14O FW 126.532 CoE Nr 10812 Organoleptic: oily.

412 CoE Nr 287 Organoleptic: fruity. 758 W271500-SAMPLE W274305-SAMPLE-K W274305-1KG-K 1 kg W274305-5KG-K 5 kg W274305-10KG-K 10 kg 8 [556‑61‑6] CH3NCS C2H3NS FW 73. apricot and tutti-frutti. see 4-Methyl-2-pentanone Page 91 Methyl isobutyrate Methyl 2-methoxybenzoate [556‑24‑1] (CH3)2CHCH2COOCH3 C6H12O2 FW 116. peach. 524 FEMA 2715 Flavis 9. vegetable Kosher W341002-25G-K 250 g 2-Methyl-3-(p-isopropylphenyl)propionaldehyde 1-Methyl-3-methoxy-4-isopropylbenzene Arc. 404 W247618-SAMPLE-K [1076‑56‑8] C11H16O FW 164.647 W400201-1KG Organoleptic: apple. 2093. methyl ester [39924‑52‑2] (O=)C5H6(CH2CH= CHC2H5)CH2CO2CH3 C13H20O3 FW 224.23  ≥98% FEMA 2476 Flavis 4. Fen. Fen. FG W271926-SAMPLE-K FEMA 4019 Flavis 9. FG Fen. sweet.34  ≥98%. musty. 2095.462 CoE Nr 457 FEMA 2717 Flavis 9. creamy. NI Fen. sweet Kosher.5%  ≥97% FEMA 2753 Flavis 9. 2108.16 Methyl o-anisate Arc.521 CoE Nr 10821  98% Possible application (Flavor): Has many flavor uses including plum. Isoeugenyl methyl ether [93‑16‑3] CH3CH=CHC6H3(OCH3)2 C11H14O2 FW 178. ≥98%. floral Kosher. see Dimethyl anthranilate Page 37 Methyl laurate Fen. Fen. FCC.12  97% W442600-1KG Arc. 2027. herbaceous Halal. Kosher  ≥98.16 Arc.483 CH3CH2CH(CH3)COOCH3 C6H12O2 FW 116. Kosher. 1940. herbaceous. 3Oxo-2-(2-pentenyl)cyclopentaneacetic acid. 522 FEMA 3410 Flavis 9. FCC Organoleptic: coconut.045 CoE Nr 133 Methyl 2-methylbutyrate [868‑57‑5] FEMA 2719 Flavis 9. see 3-(Methylthio) propionaldehyde Page 95 FEMA 4426 1 kg contains 10-100 ppm hydroquinone monomethyl ether as inhibitor W400201-SAMPLE 88 W271918-SAMPLE-K W271918-100G-K 100 g W271918-1KG-K 1 kg W271918-4KG-K 4 kg W271918-9KG-K 9 kg W271918-20KG-K 20 kg  natural. 522 W275301-SAMPLE-K FEMA 2694 Flavis 9. 519 W247618-250G-K > 5-Methyl-2-isopropylphenol. earthy. soapy.28 Natural Occurrence: Coffee. Organoleptic: jasmine.30 Methyl isoeugenol 1. Fen.013 CoE Nr 186 Organoleptic: spicy Halal.796 CoE Nr 2192 Organoleptic: apple Kosher.17  ≥99% [547‑63‑7] (CH3)2CHCOOCH3 C5H10O2 FW 102. 1877 [606‑45‑1] CH3OC6H4CO2CH3 C9H10O3 FW 166. see 2-(Methylthio)ethanol Page 94 3-(Methylmercapto)propionaldehyde. synthetic as antioxidant FEMA 3436 Flavis 4.13 Arc. NI Organoleptic: hyacinth. waxy NI Organoleptic: floral.101 CoE Nr 377 FEMA 2743 Flavis 5.24  ≥95%. Lauric acid methyl ester [111‑82‑0] CH3(CH2)10CO2CH3 C13H26O2 FW 214. 517 W343609-SAMPLE-K 25 g W341002-100G-K [103‑95‑7] (CH3)2CHC6H4CH2CH(CH3)CHO C13H18O FW 190. vegetable Halal. see Skatole Page 118 Methyl isobutyl ketone. herbaceous Kosher. nutty. spicy. 2264. french fried potato.10% alpha-tocopherol. NI W269409-SAMPLE-K W269409-1KG-K Methyl isovalerate 1 kg W269409-9KG-K 9 kg W269409-20KG-K 20 kg > Methyl isocaproate. see Methyl 4-methylvalerate Page 89 W275301-1KG-K 1 kg W271705-SAMPLE-K W275301-4KG-K 4 kg W271705-100G-K 100 g W275301-9KG-K 9 kg W271705-1KG-K 1 kg W271705-5KG-K 5 kg Methyl jasmonate Methyl 3-oxo-2-(2-pentenyl)cyclopentaneacetate. melon. Organoleptic: chocolate. 520  ≥98%  ≥90%. Fen. NI contains 0.2-Dimethoxy-4-propenylbenzene. 518 Arc.043 CoE Nr 11245 W341002-SAMPLE-K W343609-100G-K 100 g W343609-1KG-K 1 kg W343609-5KG-K 5 kg 100 g W247618-1KG-K 1 kg W341002-1KG-K 1 kg W247618-10KG-K 10 kg Methyl dodecanoate. Kosher Arc.SAFC® Flavors & Fragrances Methylhydroxyme > Methyl 4-hydroxy-3-methoxybenzoate. coffee. W271926-100G-K 100 g W271926-1KG-K 1 kg W271926-4KG-K 4 kg . see Methyl p-anisate Page 81 1 kg W400201-5KG 5 kg W400201-10KG 10 kg Place an order with your local SAFC representative (see back for contacts). see Thymol Page 124 > Methyl 4-methoxybenzoate. FCC Methyl isothiocyanate > Methyl N-methylanthranilate. NI Arc. Fen. green.5% W442600-SAMPLE CoE Nr 2085 CoE Nr 2085c Methyl methacrylate [80‑62‑6] CH2=C(CH3)COOCH3 C5H8O2 FW 100. see Methyl vanillate Page 95 3-Methylindole. NI Halal. 517  ≥98. Kosher.12 W271500-1KG 1 kg W271500-4KG 4 kg W271500-9KG 9 kg > 2-(Methylmercapto)ethanol.

079 CoE Nr 11924 Natural Occurrence: Cooked beef and tea. wine-like Kosher. fruity W370703-SAMPLE W370703-100G 100 g W370703-1KG 1 kg Organoleptic: pineapple. garlic).18 Methyl isocaproate  ≥98% [2412‑80‑8] (CH3)2CHCH2CH2CO2CH3 C7H14O2 FW 130.4-methylenedioxyphenyl)propanal [1205‑17‑0] C11H12O3 FW 192. Fen. see Methyl 3(methylthio)propionate Page 89 Methyl 2-methylpentanoate W319309-100G-K 100 g W319309-1KG-K 1 kg W319309-5KG-K 5 kg > Methyl 2-naphthyl ether. vanilla Kosher  ≥98%. 2-Acetylnaphthalene. 528 Arc.152 FEMA 3193 Flavis 1.17 W370908-SAMPLE-K W272108-100G 100 g W370908-1KG-K W272108-1KG 1 kg W370908-5KG-K 5 kg W272108-4KG 4 kg W370908-10KG-K 10 kg FEMA 4003 Flavis 12. 531  ≥98%  ≥97% FEMA 2722 Flavis 9. 529  ≥99%. Kosher Organoleptic: chocolate.106 CoE Nr 387 FEMA 2724 Flavis 9.146 W400300-SAMPLE W400300-25G 25 g W400300-100G 100 g W400300-1KG 1 kg > Methyl methylthiofuran. 2120.6-octadiene. peanut. Organoleptic: cheese. NI W272302-SAMPLE-K W272000-SAMPLE-K W272000-250G-K 250 g W272000-1KG-K 1 kg W272000-5KG-K 5 kg Methyl 4-methylvalerate W272302-100G-K 100 g W272302-1KG-K 1 kg W272302-5KG-K 5 kg > Methyl 2-naphthyl ketone. 2′-Acetonaphthone Methyl 3-(methylthio)propionate [93‑08‑3] C10H7COCH3 C12H10O FW 170. coffee. nutty.19 Fen. 529  ≥98%  ≥90% FEMA 3949 Flavis 13. fruity. 2121. coconut. pepper. FG W357308-25G-K W319309-SAMPLE-K FEMA 2720 Flavis 12. see Methyl (methylthio)acetate Page 89 [65505‑17‑1] C6H8OS2 FW 160. NI W394904-SAMPLE-K W394904-25G-K 25 g W394904-100G-K 100 g W394904-1KG-K 1 kg > Methyl S-methylthioglycolate. see Myrcene Page 96 5-Methyl-2-(1-methylethyl)cyclohexanol. NI Organoleptic: coconut. Fen.432 CoE Nr 322 FEMA 3709 Flavis 14. fatty.18 Nicotinic acid methyl ester Arc. grape. Nonanoic acid methyl ester [124‑10‑7] CH3(CH2)12COOCH3 C15H30O2 FW 242. 2128. NI FEMA 3707 Flavis 9. 526 Arc.014 CoE Nr 11009 Natural Occurrence: Cooked beef and tea. strawberry. 2126. NI W272418-SAMPLE-K W272205-SAMPLE-K W272205-1KG-K 1 kg W272418-1KG-K 1 kg W272205-8KG-K 8 kg W272418-4KG-K 4 kg W272205-20KG-K 20 kg W272418-9KG-K 9 kg 89 . floral. Fen. sulfurous. fatty Kosher.40 [1731‑84‑6] CH3(CH2)7COOCH3 C10H20O2 FW 172.071 Organoleptic: herbaceous.002 CoE Nr 428 Organoleptic: fruity.26 FEMA 3573 Flavis 13. see Thymol Page 124 Methyl 2-methyl-3-furyl disulfide 2-Methyl-3-methylthiofuran 1-Methylnaphthalene Methyl methylthiofuran [90‑12‑0] C10H7CH3 C11H10 FW 142. alliaceous (onion. Myristic acid methyl ester Methyl pelargonate. 1946.26 Arc. see Nerolin Yara Yara Page 97 Methyl β-naphthyl ketone 2-Acetonaphthone.14 Methyl tetradecanoate. floral W523909-SAMPLE W523909-100G 100 g W523909-1KG 1 kg W523909-5KG 5 kg > 7-Methyl-3-methylene-1. Methyl S-methylthioglycolate [16630‑66‑3] CH3SCH2COOCH3 C4H8O2S FW 120.549 Organoleptic: hazelnut. sweet NI W370703-4KG 4 kg W272108-SAMPLE Methyl (methylthio)acetate Methyl (methylmercapto)acetate. 530  ≥97%  ≥99% FEMA 2721 Flavis 9.21 Methyl 3-(methylmercapto)propionate [13532‑18‑8] CH3SCH2CH2COOCH3 C5H10O2S FW 134. Fen. sweet. Kosher. Fen. meaty.20 Arc. see Methyl β-naphthyl ketone Page 89 Methyl nicotinate [2177‑77‑7] CH3CH2CH2CH(CH3)CO2CH3 C7H14O2 FW 130. spicy Kosher Organoleptic: earthy Kosher.Methylnonanoate 2-Methyl-3-(3.013 CoE Nr 147 Organoleptic: berry. FCC FEMA 2723 Flavis 7. sulfurous Halal.108 CoE Nr 389 Organoleptic: honey. Fen. sulfurous. 2124. see 2-Methyl-3-methylthiofuran Page 89 Feel inspired at safcglobal. see L-Menthol Page 78 5-Methyl-2-(1-methylethyl)phenol. blossom. 528 Arc. tobacco Kosher. meaty. Methyl 2naphthyl ketone.com 1 kg Methyl nonanoate Methyl myristate  97% [93‑60‑7] C7H7NO2 FW 137. orange. spicy W357308-SAMPLE-K 25 g W357308-100G-K 100 g W357308-1KG-K 1 kg > Methyl (methylmercapto)acetate. nutty.21 Organoleptic: herbaceous. coffee. see Methyl (methylthio) acetate Page 89 Methyl 3-(methylmercapto)propionate.20 [63012‑97‑5] C6H8OS FW 128.

500  99% FEMA 3569 CoE Nr 11325 W356905-SAMPLE-K W356905-25G-K 25 g W356905-100G-K 100 g W356905-1KG-K 1 kg 3-Methyl-2-oxobutanoic acid sodium salt Sodium 3-methyl-2-oxobutyrate. see 4-Methyl-2oxopentanoic acid sodium salt Page 90 90 Place an order with your local SAFC representative (see back for contacts).12 W371203-SAMPLE-K  ≥98% W371203-100G-K 100 g W371203-1KG-K 1 kg FEMA 3870 W371203-4KG-K 4 kg W387001-SAMPLE W272604-SAMPLE-K W272604-1KG-K [65504‑94‑1] C7H10N2O FW 138. 536 FEMA 3574 Flavis 8. pineapple Halal.12  97% FEMA 3871 W387101-25G 25 g > Methyl 3-oxo-2-(2-pentenyl)cyclopentaneacetate.063 CoE Nr 11926 Methyl 3-nonenoate Natural occurrence: Cooked mutton and lamb.25 Organoleptic: fruity. NI W371009-SAMPLE-K W371009-100G-K 100 g W371009-1KG-K 1 kg W371009-4KG-K 4 kg > Methyl nonyl carbinol. violet contains 0. FG FEMA 3710 Flavis 9.24 W272507-1KG-K 1 kg Fen. Ketovaline sodium salt. . meaty. 532 Organoleptic: green. waxy Halal. Kosher.26 cis-12-Octadecenoic acid methyl ester solution [111‑12‑6] CH3(CH2)4C≡CCO2CH3 C9H14O2 FW 154. green. NI Methyl 2-nonynoate 1 kg W272906-5KG-K Organoleptic: almond. 534  99% Methyl trans-2-nonenoate [111‑79‑5] CH3(CH2)5CH=CHCO2CH3 C10H18O2 FW 170.22 Organoleptic: fruity.23 Arc. Fen. vegetable. 2144. 534 W272507-5KG-K 5 kg  ≥98%. see Methyl jasmonate Page 88 4-Methyl-2-oxovaleric acid sodium salt. Kosher Organoleptic: green. mixture of isomers FEMA 2728 Flavis 9. 2139.0% (GC) Halal. citrus Kosher.062 CoE Nr 11925  100 mg/mL in ethanol.17 3-Methyl-2-oxopentanoic acid sodium salt FEMA 3712 Flavis 9.117 CoE Nr 398 Methyl 2-nonenoate FEMA 2729 Flavis 9. 4-Methyl-2-oxovaleric acid sodium salt. FCC. Kosher. see 2-Undecanone Page 128 W357502-25G-K 25 g W357502-100G-K 100 g W357502-1KG-K 1 kg Methyl trans-2-octenoate [111‑80‑8] CH3(CH2)5C≡CCO2CH3 C10H16O2 FW 168. Kosher Arc.21  ≥97% [2733‑86‑0] C19H36O2 FW 296. violet Halal. green Kosher. α-Ketoisovaleric acid sodium salt. earthy. Fen. see 2-Undecanol Page 127 Methyl nonyl ketone.1% alpha-tocopherol Organoleptic: meaty Kosher.299 CoE Nr 11800 > Methyl octyl ketone. musty. Fen. NI W272809-1KG-K  ≥97% W272809-9KG-K 9 kg FEMA 2725 Flavis 9. NI W357405-SAMPLE-K 76064 W357405-25G-K 25 g W357405-100G-K 100 g W357405-1KG-K 1 kg > Methyl 2-nonenoate. see 3-Methyl-2oxobutanoic acid sodium salt Page 90 [3715‑31‑9] C2H5CH(CH3)COCO2Na C6H9NaO3 FW 152. green. 1947. Kosher W272906-100G-K 2-Methyl-3(5 or 6)-ethoxypyrazine.156 CoE Nr 479 Organoleptic: peach. FG ≥96.234 CoE Nr 2099 W272809-20KG-K 20 kg W272507-100G-K 1 kg 100 g [54947‑74‑9] CH3(CH2)3CH(CH3)CH2CH2CO2H C9H18O2 FW 158. mixture of isomers W272809-SAMPLE-K Arc. 536  ≥96% 100 g 1 kg W272604-5KG-K 5 kg Fen. violet Halal. Kosher (±)-4-Methyloctanoic acid W272507-SAMPLE-K 100 g W272906-1KG-K 2-Ethoxy-3(5 or 6)-methylpyrazine.158 CoE Nr 481 4-Methyl-2-oxopentanoic acid sodium salt Sodium 4-methyl-2-oxovalerate. NI [13481‑87‑3] CH3(CH2)4CH=CHCH2CO2CH3 C10H18O2 FW 170.SAFC® Flavors & Fragrances Methylnonanoica 4-Methylnonanoic acid Methyl cis-12-octadecenoate solution 8 Methyl 2-octynoate [45019‑28‑1] CH3(CH2)4CH(CH3)CH2CH2CO2H C10H20O2 FW 172. Fen. Caprylic acid methyl ester [111‑11‑5] CH3(CH2)6COOCH3 C9H18O2 FW 158. αKetoisocaproic acid sodium salt [4502‑00‑5] (CH3)2CHCH2COCOONa C6H9NaO3 FW 152. 2143. plastic. 533  99% FEMA 2726 Flavis 9. Organoleptic: cheese.10  95% W386901-10G 10 g > 3-Methyl-2-oxobutyric acid sodium salt. see Methyl trans-2-nonenoate Page 90 Methyl octanoate W272906-SAMPLE-K Methyl caprylate. FG FEMA 3575 Flavis 8. 3-Methyl2-oxobutyric acid sodium salt [3715‑29‑5] (CH3)2CHCOCOONa C5H7NaO3 FW 138.298 Organoleptic: melon Halal. 2045. Fen. for food analysis  ≥99%. 532 W357502-SAMPLE-K  ≥96%. Ketoleucine sodium salt.49 Arc.24 Arc.25 Fen. see 2-Decanone Page 33 W272604-100G-K 5 kg W386901-SAMPLE [7367‑81‑9] CH3(CH2)4CH=CHCO2CH3 C9H16O2 FW 156. mossy. analytical standard.

2015. Fen.184 W319503-100G 100 g W319503-1KG 1 kg  ≥98%. Kosher. Kosher. Fen. NI W319406-SAMPLE-K W319406-1KG-K 1 kg W346306-SAMPLE-K W319406-4KG-K 4 kg W319406-9KG-K 9 kg W346306-250G-K 250 g W346306-1KG-K 1 kg W346306-10KG-K 10 kg [123‑15‑9] CH3CH2CH2CH(CH3)CHO C6H12O FW 100. FG Organoleptic: green. Fen. FG W509531-SAMPLE W341304-1KG 2-Methyl-2-pentenal Diethyl methyl carbinol Organoleptic: fruity Halal.com W351105-SAMPLE-K FEMA 2731 Flavis 7. NI Fen. sour Halal. NI FEMA 3463 Flavis 8. Methyl allylacetate.16 3-Methylpentanoic acid W319503-SAMPLE  ≥98% FEMA 3511 Flavis 8.16  ≥97% Arc. fruity NI [589‑35‑5] CH3CH2CH(CH3)CH2CH2OH C6H14O FW 102.059 CoE Nr 10148 Organoleptic: cheese Kosher contains 0. Fen. FG W351105-1KG-K 1 kg FEMA 3437 Flavis 8. NI W341304-SAMPLE Methyl 4-pentenoate 4-Pentenoic acid methyl ester. ethereal Kosher. 542 2-Methylvaleric acid. 541 FEMA 3194 Flavis 5. NI W273104-1KG-K 1 kg W273104-4KG-K 4 kg W273104-8KG-K 8 kg W343706-SAMPLE-K W343706-25G-K 25 g W343706-100G-K 100 g W343706-1KG-K 1 kg Feel inspired at safcglobal. herbaceous Halal. see Methyl nonanoate Page 89 2-Methylpentanal Organoleptic: fruity. 539 1 kg W341304-4KG 4 kg W341304-8KG 8 kg > Methyl pentanoate. 2265. wine-like. see Methyl 4-hydroxybenzoate Page 87 Methyl pelargonate.057 CoE Nr 10150 Organoleptic: cheese Halal. NI Arc.14 Fen. Kosher.056 CoE Nr 10149 W273104-SAMPLE-K W351105-5KG-K 5 kg Organoleptic: berry. Kosher.16  ≥99%. (±)-2Methylvaleric acid [77‑74‑7] (CH3CH2)2C(CH3)OH C6H14O FW 102. FG FEMA 3195 CoE Nr 4177 3-Methyl-3-pentanol 2-Methylpentanoic acid 8  ≥99%. Kosher.17 [97‑61‑0] CH3CH2CH2CH(CH3)CO2H C6H12O2 FW 116. 540 [105‑43‑1] CH3CH2CH(CH3)CH2CO2H C6H12O2 FW 116. 4-Methylpentanoic acid. FCC. 582 W275409-SAMPLE-K W275409-100G-K 100 g W275409-1KG-K 1 kg W275409-5KG-K 5 kg  ≥99% W508209-100G-K 100 g W508209-1KG-K 1 kg W508209-4KG-K 4 kg 2-Methyl-4-pentenoic acid [1575‑74‑2] H2C=CHCH2CH(CH3)CO2H C6H10O2 FW 114. 2-Methylpentanoic acid.18 CoE Nr 581 W509531-1KG 1 kg W509531-4KG 4 kg W509531-8KG 8 kg > Methyl paraben. NI W351105-100G-K 100 g  ≥98%. Fen.14 W376205-4KG-K 4 kg  ≥98%.Methylpentenoic Methyl palmitate 4-Methylpentanoic acid Methyl hexadecanoate. creamy. FCC Arc.09 CoE Nr 2129  ≥98%. Allylacetic acid methyl ester 3-Methyl-1-pentanol 2-Methylvaleraldehyde Arc. Isocaproic acid [623‑36‑9] C2H5CH=C(CH3)CHO C6H10O FW 98. synthetic as antioxidant (±)-3-Methylvaleric acid Arc.45  ≥97% 4-Methylvaleric acid. Palmitic acid methyl ester [112‑39‑0] CH3(CH2)14CO2CH3 C17H34O2 FW 270. FCC.14 [646‑07‑1] (CH3)2CHCH2CH2CO2H C6H12O2 FW 116.16 Fen. FCC.031 CoE Nr 31 W508209-SAMPLE-K W319503-10KG 10 kg Organoleptic: cheese. 2157. 543 4-Methyl-2-pentanone Isobutyl methyl ketone. ethereal. green Halal.14 Arc. spicy. 538 Organoleptic: fruity.10% alpha-tocopherol. green Halal.017 CoE Nr 151 91 . see Methyl valerate Page 95 FEMA 4353  ≥95% W435300-1G 1g FEMA 3762 Flavis 2. 2266. 2267 Flavis 9. FG Organoleptic: chocolate.17 [818‑57‑5] C6H10O2 FW 114. fruity Kosher W319503-5KG 5 kg FEMA 2754 Flavis 8. Isopropylacetone [108‑10‑1] (CH3)2CHCH2COCH3 C6H12O FW 100.16 Flavis 2.069 CoE Nr 706 Organoleptic: earthy. 1933. 537  ≥97% FEMA 3413 Flavis 5. Methyl isobutyl ketone.115 CoE Nr 10275 W435300-25G 25 g W435300-100G 100 g W376205-SAMPLE-K trans-2-Methyl-2-pentenoic acid W376205-100G-K 100 g W376205-1KG-K 1 kg [16957‑70‑3] C2H5CH=C(CH3)CO2H C6H10O2 FW 114.

see Tetrahydro-4-methyl-2-(2-methyl-1-propenyl)-2H-pyran Page 122 2-Methylpropionaldehyde. 550 Organoleptic: alliaceous (onion... 2201..134 CoE Nr 415 Organoleptic: apple... Kosher. 2169. 2218. Kosher..099 CoE Nr 10365 W510211-1KG-K 1 kg  ≥90% W510211-4KG-K 4 kg FEMA 3201 Flavis 12......... mixture of cis and trans [26643‑91‑4] (CH3)2CHCH=C(C6H5)CHO C12H14O FW 174... 555 FEMA 3199 Flavis 5.. see 2-Pentanol Page 104 [2179‑60‑4] CH3CH2CH2SSCH3 C4H10S2 FW 122. Benzyl dimethyl carbinol [100‑86‑7] C6H5CH2C(CH3)2OH C10H14O FW 150. NI W274208-SAMPLE-K  98% W274208-1KG-K FEMA 2393 Flavis 2. see 2-Pentanone Page 105 .. Kosher..3-dioxolane..133  ≥92%. see Dihydrojasmone Page 35 Methyl pentyl ketone. mixture of isomers Page 16 1-(2-Methylphenyl)ethanone.025 CoE Nr 159 NI Organoleptic: vegetable.17 Arc. Fen. NI W319902-100G-K 100 g W320102-SAMPLE-K W319902-250G-K 250 g W320102-25G-K 25 g W319902-1KG-K 1 kg W320102-100G-K 100 g W319902-5KG-K 5 kg W320102-1KG-K 1 kg > Methyl phenyl ketone.6% W336807-1KG 1 kg W274003-SAMPLE-K W336807-4KG 4 kg W274003-25G-K 25 g 9 kg W274003-100G-K 100 g W274003-1KG-K 1 kg W336807-9KG > cis-3-Methyl-2-(2-pentenyl)-2-cyclopenten-1-one. 553 2-Methyl-1-phenyl-2-propanol W273309-SAMPLE-K W273309-1KG-K 1 kg W273309-5KG-K 5 kg W273309-10KG-K 10 kg > Methyl phenyl carbinol. see 3-Penten-2-one Page 105 (4S)-2-(2-Methyl-1-propenyl)-4-methyltetrahydropyran... banana..035 W274208-5KG-K 5 kg W239301-SAMPLE W274208-10KG-K 10 kg W274208-20KG-K 20 kg W239301-1KG 1 kg W239301-5KG 5 kg W239301-10KG 10 kg 1-Methylpiperidine Methyl propyl disulfide  ≥98% Kosher  ≥96%... see 2-Heptanone Page 58 β-Methylphenethyl alcohol. sweet Halal... spicy. jasmine..27  ≥98% 1.1-Dimethyl-2-phenylethyl alcohol.... Fen. vanilla 4-methyl-4-penten-2-one . see α-Isobutylphenethyl alcohol Page 70 92 W424401-1KG > 2-Methyl-1-propanol... see m-Cresol Page 31 4-Methylphenol. > Methyl propyl ketone.....101 CoE Nr 11853 W424401-SAMPLE FEMA 2740 Flavis 7..783 CoE Nr 2155 Organoleptic: honey.173 Halal. strawberry Kosher.1 CoE Nr 10366 Organoleptic: chocolate Halal. Fen. see Acetophenone Page 8 4-Methyl-1-phenyl-2-pentanol.24 Fen. NI Methyl phenylacetate  98% Place an order with your local SAFC representative (see back for contacts). see 2′-Methylacetophenone Page 81 Methyl phenyl ether. 546  ≥98%.. Kosher W387401-SAMPLE-K W387401-1KG-K 1 kg W387401-4KG-K 4 kg W387401-8KG-K 8 kg Methyl propionate [554‑12‑1] CH3CH2COOCH3 C4H8O2 FW 88.. see 2-Phenyl-1-propanol Page 109 2-Methylphenol.17 Arc. Kosher 4-methyl-1-phenyl-2-pentanol ..25 Fen.25 [109‑05‑7] C6H13N FW 99. see α-Methylbenzyl alcohol Page 82 4-Methyl-2-phenyl-1.22 FEMA 2742 Flavis 9.. see Isobutyric acid Page 70 Methyl propyl carbinol. see p-Cresol Page 31 4-Methyl-2-phenyl-2-pentenal. FG W510211-SAMPLE-K Arc. 551  ≥90% FEMA 4244 Flavis 14.. see o-Cresol Page 31 3-Methylphenol. 543 Arc... see 2-Heptanol Page 57 3-Methyl-2-pentyl-2-cyclopenten-1-one. see cisJasmone Page 73 Methyl pentyl carbinol..... see Anisole Page 15 5-Methyl-2-phenyl-2-hexenal [21834‑92‑4] (CH3)2CHCH2CH=C(C6H5)CHO C13H16O FW 188....SAFC® Flavors & Fragrances Methylpentenone 4-Methyl-3-penten-2-one 4-Methyl-1-phenyl-2-pentanone 2-Methylpiperidine Mesityl oxide Benzyl isobutyl ketone α-Pipecoline..19  ≥92% FEMA 3874 Flavis 12.. 551  ≥88% [101‑41‑7] C6H5CH2CO2CH3 C9H10O2 FW 150...11 Arc.. ≤10% W336807-SAMPLE Organoleptic: woody. 2-Pipecoline [141‑79‑7] (CH3)2C=CHCOCH3 C6H10O FW 98. FG FEMA 3368 Flavis 7...... NI W320005-SAMPLE-K W320005-100G-K 100 g W320005-1KG-K 1 kg W320005-5KG-K 5 kg 1 kg W424401-4KG 4 kg 2-Methyl-1-propanethiol Isobutyl mercaptan [513‑44‑0] (CH3)2CHCH2SH C4H10S FW 90.019 CoE Nr 585 W510211-8KG-K 8 kg Organoleptic: chocolate Halal. 1...14 [5349‑62‑2] (CH3)2CHCH2COCH2C6H5 C12H16O FW 176. Fen. see Isobutyraldehyde Page 70 FEMA 3200 Flavis 5. FCC FEMA 2733 Flavis 9.. 1856. 2209... see Isobutyl alcohol Page 69 Methyl propenyl ketone. see Benzaldehyde propylene glycol acetal. garlic) Kosher. sweet Halal. NI W319902-SAMPLE-K 1 kg > 2-Methylpropionic acid.. Fen.

2229. pepper. Kosher. green Halal. [7251‑61‑8] C9H8N2 FW 144. Organoleptic: chocolate. alliaceous (onion. FG W504807-1KG W504807-5KG 5 kg [91‑62‑3] C10H9N FW 143. 163 Organoleptic: nutty Kosher  ≥98%. garlic).13 Flavis 14. green Halal. sweet Halal. FG FEMA 3309 Flavis 14.32 Arc. Wintergreen oil. herbaceous NI W357804-SAMPLE-K W320307-SAMPLE-K W509973-SAMPLE W320307-100G-K 100 g W357804-25G-K 25 g W509973-250G 250 g W320307-250G-K 250 g W357804-100G-K 100 g W509973-1KG 1 kg W320307-1KG-K 1 kg W357804-1KG-K 1 kg W509973-5KG 5 kg 2-Methyl-3-propylpyrazine Methyl 2-pyrrolyl ketone Methyl salicylate 2-Hydroxybenzoic acid methyl ester. see 1-Methylpyrrole Page 93 Feel inspired at safcglobal.175 Flavis 14. 556 Organoleptic: tropical.651 W337218-1KG-K 1 kg W513903-5KG 5 kg Organoleptic: oily W504807-SAMPLE Methyl propyl trisulfide 8 [17619‑36‑2] C4H10S3 FW 154. see Dimethyl sulfide Page 40 FEMA 2744 Flavis 14.15 FEMA 2745 Flavis 9.11 Methyl sulfoxide W274402-SAMPLE W274402-100G 100 g DMSO. FG FEMA 3308 Flavis 12. see 3-Acetylpyridine Page 9 Methyl pyromucate. NI [67715‑80‑4] C8H16OS FW 160.19 W504807-10KG 10 kg > Methyl styryl ketone. 557 W320218-5KG-K 5 kg W274518-10KG-K 10 kg  ≥98% > m-Methylsalicylic acid.03 CoE Nr 11540 Flavis 14. vegetable.17 [96‑54‑8] C5H7N FW 81. see Benzylideneacetone Page 18 Methyl sulfide.23 W320218-1KG-K 1 kg W274518-5KG-K 5 kg Fen. garlic) Halal W511609-SAMPLE W387509-SAMPLE W511609-100G 100 g W511609-1KG 1 kg W387509-1KG 1 kg W511609-5KG 5 kg W387509-10KG 10 kg W387509-25KG 25 kg > 2-Methyltetrahydro-3-furanone.3-oxathiane. NI [119‑36‑8] 2-(HO)C6H4CO2CH3 C8H8O3 FW 152. nutty. meaty.19 Methyl octadecanoate.12 Fen.17  ≥99%  ≥97% FEMA 3875 Flavis 12.042 CoE Nr 2339 Halal. 2242 W513903-SAMPLE W337218-SAMPLE-K 1 kg  ≥96% W337218-25G-K 25 g W513903-100G 100 g W337218-100G-K 100 g W513903-1KG 1 kg Flavis 9. FG  ≥99% FEMA 3203 Flavis 14.50 Flavis 14. FG  ≥98%. mixture of cis and trans 1-Methylpyrrole 5-Methylquinoxaline N-Methylpyrrole [13708‑12‑8] C9H8N2 FW 144. musty. Stearic acid methyl ester  ≥99% [112‑61‑8] CH3(CH2)16CO2CH3 C19H38O2 FW 298. nutty. FCC. 561 Arc.749 CoE Nr 433 FEMA 3202 Flavis 14.047 CoE Nr 4035 2-(1-Methylpropyl)thiazole Organoleptic: spicy. NI Methyl stearate Lepidine [491‑35‑0] C10H9N FW 143. herbaceous. see Methyl 2-furoate Page 86 N-Methylpyrrole.Methyltetrahydr 2-Methyl-4-propyl-1. Kosher Organoleptic: woody. 2241.139 Organoleptic: butter.28 Fen.02 W330829-1KG 6-Methylquinoline Supercools easily and remelts slowly at room temperature.028 CoE Nr 2271 FEMA 3578 Flavis 16. Fen. smoky.002 CoE Nr 488 Arc.022 CoE Nr 11598 Natural occurrence: Tomato. Oil of wintergreen. 2231  ≥99%.13 W274402-1KG 1 kg Fen. FCC W502502 Organoleptic: walnut Halal. alliaceous (onion. Solidified product can be re-liquified by warming to room temperature without detriment to the product. NI W274518-SAMPLE-K W320218-SAMPLE-K 2-sec-Butylthiazole W320218-100G-K 100 g W274518-1KG-K [18277‑27‑5] C7H11NS FW 141. see 2-Acetylpyridine Page 9 Methyl 3-pyridyl ketone.027 CoE Nr 2270 Organoleptic: chocolate. see 2-(Methylthio)pyrazine Page 95 Methyl 2-pyridyl ketone.129 Fen. 560 Arc. minty. FG  ≥98%. green.com 1 kg p-Toluquinoline  ≥98%. Methyl 2-hydroxybenzoate [15986‑80‑8] C8H12N2 FW 136. minty Kosher. nutty Halal. 558  50%. see m-Anisic acid Page 15 4-Methylquinoline FEMA 3372 Flavis 15. 559 2-Methylquinoxaline  ≥99%.19 2-Acetylpyrrole  ≥98% [1072‑83‑9] C6H7NO FW 109.023 Organoleptic: coffee. Kosher. Dimethyl sulfoxide W274402-250G 250 g [67‑68‑5] (CH3)2SO C2H6OS FW 78. Kosher. see 2-Methyltetrahydrofuran3-one Page 93 93 . NI W330906-SAMPLE-K W330906-100G-K 100 g W330906-1KG-K 1 kg W330906-5KG-K 5 kg > Methyl pyrazinyl sulfide. NI W330829-SAMPLE 1 kg 2-Methylpyrazine [109‑08‑0] C5H6N2 FW 94. Kosher. Fen.

garlic) Halal.20 Flavis 15. Kosher. 565  ≥98% FEMA 3716 Flavis 15..086 Organoleptic: musty. sulfurous.20 W320404-25KG-K 25 kg Fen. alliaceous (onion.014 CoE Nr 11621 W360007-SAMPLE-K Organoleptic: butter Halal.15 W400408-100G 100 g W400408-1KG 1 kg W400408-5KG 5 kg Methyl 2-thiofuroate [13679‑61‑3] C6H6O2S FW 142. alliaceous (onion.21 Fen...24 FEMA 3787 Flavis 13. 571 3-(Methylthio)butanal FEMA 3512 Flavis 15.... meaty.035 CoE Nr 11627 Organoleptic: potato Halal.20 Fen. sulfurous. see Methyl thiobutyrate Page 94 2-(Methylthio)ethanol 2-(Methylmercapto)ethanol. FG Natural Occurrence: Beef. meaty Halal. NI Organoleptic: nutty. vegetable.. Sulfurol acetate  mixture of cis and trans. FG [656‑53‑1] C8H11NO2S FW 185.. 2-Hydroxyethyl methyl sulfide Organoleptic: butter... Kosher.. alliaceous (onion.. sweet Kosher  ≥97%.. meaty. Kosher.. Kosher.16  ≥98%.. 2243..056 CoE Nr 11687 W400408-SAMPLE Fen... sulfurous W331007-SAMPLE-K W518123-SAMPLE W331007-100G-K 100 g W331007-1KG-K 1 kg W331007-5KG-K 5 kg > 4-Methyl-5-thiazolylethyl acetate. coffee Halal. .023 CoE Nr 11601 W337501-25G-K FEMA 3310 Flavis 12..179 FEMA 3374 Flavis 12. NI [5271‑38‑5] CH3SCH2CH2OH C3H8OS FW 92. FG 2-Methyl-2-thiazoline [2346‑00‑1] C4H7NS FW 101.20 W351202-SAMPLE-K  ≥96%....17  1. S-Methyl thiobutanoate [2432‑51‑1] CH3CH2CH2COSCH3 C5H10OS FW 118.18  ≥97% 100 g W337501-1KG-K 1 kg S-Methyl thiobutyrate....12 [137‑00‑8] C6H9NOS FW 143.. 563 Arc.. Sulfurol  ≥97% [3188‑00‑9] C5H8O2 FW 100. see Ethyl (methylthio) acetate Page 48 Ethyl (methylthio)acetate Page 48 > S-Methyl thiobutyrate..142 CoE Nr 11547 W371602-SAMPLE-K 94 25 g W337501-100G-K Organoleptic: cheese. garlic). FG Organoleptic: cabbage.. garlic) Halal.. alliaceous (onion. Kosher. 570 2-Methyl-3-tetrahydrofuranthiol 4-Methyl-5-thiazoleethanol acetate [57124‑87‑5] C5H10OS FW 118.. % in propylene glycol FEMA 3375 Flavis 12.042 CoE Nr 2338 FEMA 3204 Flavis 15.SAFC® Flavors & Fragrances Methyltetrahydr 2-Methyltetrahydrofuran-3-one 4-Methyl-5-thiazoleethanol 4-(Methylthio)butanol 4.. 565 FEMA 3600 Flavis 12. 566 W320501-100G-K 100 g W378704-100G-K 100 g W320501-1KG-K 1 kg W378704-1KG-K 1 kg W320501-5KG-K 5 kg Organoleptic: sulfurous W550701-SAMPLE W550701-100G 100 g W550701-1KG 1 kg 2-Methyltetrahydrothiophen-3-one [13679‑85‑1] C5H8OS FW 116... ≥97%.015 CoE Nr 11620 Organoleptic: meaty Halal.. Kosher W378704-SAMPLE-K FEMA 3205 Flavis 15.... <4% W337404-100G-K 100 g W337404-250G-K 250 g W337404-1KG-K 1 kg > S-Methyl thiobutanoate.. NI 2-butenal . animal. NI W371602-100G-K 100 g W371602-1KG-K 1 kg W331104-SAMPLE-K W371602-5KG-K 5 kg W331104-25G-K 25 g W331104-100G-K 100 g W331104-250G-K 250 g W331104-1KG-K 1 kg Place an order with your local SAFC representative (see back for contacts)..5-Dihydro-2-methyl-3(2H)-furanone 5-(2-Hydroxyethyl)-4-methylthiazole. Fen.. Organoleptic: caramel... Kosher.. see 2-Acetylthiophene Page 10 (Methylthio)acetic acid ethyl ester.078  ≥97%.... FG FEMA 4004 Flavis 12...16 Organoleptic: fruity... Kosher Fen. garlic) Kosher FEMA 3373 Flavis 13... 571  ≥98% FEMA 3311 Flavis 13.. NI W360007-25G-K 25 g W360007-100G-K 100 g W360007-1KG-K 1 kg W337307-SAMPLE-K W320404-SAMPLE-K W337307-100G-K 100 g W320404-250G-K 250 g W337307-250G-K 250 g W320404-1KG-K 1 kg W337307-1KG-K 1 kg W320404-5KG-K 5 kg W337307-5KG-K 5 kg W320404-10KG-K 10 kg [34047‑39‑7] CH3SCH2CH2COCH3 C5H10OS FW 118... balsamic Kosher NI [16630‑52‑7] CH3CH(SCH3)CH2CHO C5H10OS FW 118.. see 4-Methyl-5-thiazoleethanol acetate Page 94 Methyl-2-thienyl ketone.0 wt..16  ≥99% W337404-SAMPLE-K [693‑95‑8] C4H5NS FW 99.. 563 4-Methyl-5-thiazolylethyl acetate.032 CoE Nr 2328  98% Flavis 13.. FG  ≥98%.18 Fen.057 CoE Nr 11688 Methyl thiobutyrate W320501-SAMPLE-K 25 g [57124‑87‑5]  ≥97% W337501-SAMPLE-K W378704-25G-K 2-Methyl-3-tetrahydrofuranthiol solution 4-Methylthio-2-butanone Organoleptic: creamy. NI Fen. musty... see Methyl thiobutyrate Page 94 Organoleptic: nutty. green Halal. 570 W351202-25G-K 25 g W351202-100G-K 100 g W351202-1KG-K 1 kg 4-Methylthiazole Fen...

soapy. FG FEMA 3438 Flavis 12. cheddar cheese. vegetable. caramel. meaty. green. 572 [3268‑49‑3] CH3SCH2CH2CHO C4H8OS FW 104. NI Methyl 4-hydroxy-3-methoxybenzoate FEMA 3312 Flavis 12.799 CoE Nr 2305 Kosher W510319-SAMPLE-K W510319-25G-K 25 g W510319-100G-K 100 g W510319-1KG-K 1 kg > 1-Methylvinyl acetate. NI W343803-SAMPLE-K W343803-25G-K 25 g W343803-100G-K 100 g W343803-1KG-K 1 kg 3-(Methylthio)hexyl acetate  96% Halal. nutty Kosher.063 CoE Nr 11548 Organoleptic: melon. rose. 574  ≥98% FEMA 3209 Flavis 15. Kosher W320803-25G-K Methyl valerate Arc. 576 FEMA 3376 Flavis 12. 572 Arc. 527  ≥98%.001 CoE Nr 125 Arc. vegetable. vegetable.16 FEMA 2747 Flavis 12. fishy.27 Methionol Fen. earthy. 576  ≥97% Methyl 10-undecenoate [505‑10‑2] CH3S(CH2)3OH C4H10OS FW 106. NI  ≥99% W275204-1KG-K 1 kg W274704-SAMPLE-K W275204-4KG-K 4 kg W275204-9KG-K 9 kg W274704-1KG-K 1 kg W274704-5KG-K 5 kg W274704-25KG-K 25 kg 3-(Methylthio)propyl isothiocyanate [505‑79‑3] CH3S(CH2)3NCS C5H9NS2 FW 147. Kosher. see 2-Methyl-3-furanthiol acetate Page 86 Mimosa absolute. Fen. 586 Organoleptic: vegetable. see 3-Methylpentanoic acid Page 91 4-Methylvaleric acid. citrus. macadamia nut. spicy. Kosher. cooked chicken. 583 W323101-5KG 5 kg  ≥97% 5-Methyl-2-thiophenecarboxaldehyde [13679‑70‑4] C6H6OS FW 126. Kosher. nutty.25 Fen.5% 25 g W275204-SAMPLE-K > 2-Methylvaleric acid. NI W331201-25G-K 25 g W331201-100G-K 100 g W331201-1KG-K 1 kg 2-(Methylthio)pyrazine  ≥96. 582 Natural occurrence: Asparagus.17  ≥99% W331201-SAMPLE-K W320803-SAMPLE-K Organoleptic: fruity. alliaceous (onion. see 2-Methylpentanoic acid Page 91 (±)-3-Methylvaleric acid.18 Flavis 9.com > Methyl Page Methyl Page Methyl Methyl Page 100 g o-tolyl ketone. 10-Undecenoic acid methyl ester [21948‑70‑9] C5H6N2S FW 126.19  ≥98%. pepper Kosher.30 FEMA 3415 Flavis 12.182 CoE Nr 588 Methyl vanillate  ≥98%.19 FEMA 3313 Flavis 15. Fen. 2244. cheese.035 CoE Nr 2290 Fen. vegetable. FG Organoleptic: almond. peanut. see 4′-Methylacetophenone 81 tridecyl ketone. musty.062 CoE Nr 11554 3-(Methylthio)propionaldehyde [51755‑85‑2] C9H18O2S FW 190. see Isopropenyl acetate Page 71 4-Methyl-5-vinylthiazole FEMA 3231 Flavis 14. Kosher. Fen. garlic) Halal. garlic). beans.26 W337609-SAMPLE-K W337609-25G-K 25 g W337609-100G-K 100 g W337609-1KG-K 1 kg (Methylthio)methylpyrazine.236 Kosher W378917-SAMPLE-K W378917-25G-K 25 g W378917-100G-K 100 g W378917-1KG-K 1 kg 4-Methylthio-4-methyl-2-pentanone [23550‑40‑5] CH3SC(CH3)2CH2COCH3 C7H14OS FW 146.18 Fen. baked potato. FG [624‑24‑8] CH3(CH2)3CO2CH3 C6H12O2 FW 116. see 2-Tridecanone Page 125 2-Methylvaleraldehyde. 3-(Methylmercapto)propionaldehyde Fen. creamy.058 CoE Nr 11551 Organoleptic: fruity Kosher [111‑81‑9] CH2=CH(CH2)8CO2CH3 C12H22O2 FW 198.03 CoE Nr 2326 Methyl pyrazinyl sulfide FEMA 2752 Flavis 9. alliaceous (onion. see 4-Methylpentanoic acid Page 91 [3943‑74‑6] HOC6H3(OCH3)CO2CH3 C9H10O4 FW 182.018 CoE Nr 11633 Organoleptic: chocolate. mixture of isomers [67952‑65‑2] C6H8N2S FW 140. 2263. see 7-Methoxycoumarin 79 [1759‑28‑0] C6H7NS FW 125. 578. 573  ≥98% Methyl pentanoate  ≥97%. see 2-Methylpentanal Page 91 Methional. meaty. earthy FEMA 4253 Organoleptic: banana. oily. see Mimosa absolute Moroccan Page 95 95 . nutty Kosher. oily. peanuts and potato chips. Organoleptic: beef.30 Undecylenic acid methyl ester. garlic) Halal. see 2-Methylpentanoic acid Page 91 (±)-2-Methylvaleric acid.21 Fen. 2245. beer. NI W320900-SAMPLE-K W320900-100G-K 100 g W320900-250G-K 250 g W320900-1KG-K 1 kg Feel inspired at safcglobal. honey.034 W320803-100G-K 100 g W323101-100G W320803-1KG-K 1 kg W323101-1KG 1 kg Fen. wine-like W341509-SAMPLE-K W425301-SAMPLE 100 g W425301-100G 100 g W341509-1KG-K 1 kg W425301-1KG 1 kg W341509-5KG-K 5 kg W425301-4KG 4 kg W341509-100G-K > Methyl undecyl ketone. NI Organoleptic: alliaceous (onion.004 CoE Nr 2203 Organoleptic: cherry Halal. Fen. fruity. FG FEMA 3208 Flavis 14.Mimosaabsolute 3-(Methylthio)-1-hexanol 3-(Methylthio)-1-propanol [51755‑66‑9] CH3CH2CH2CH(SCH3)CH2CH2OH C7H16OS FW 148. see 2′-Methylacetophenone 81 p-tolyl ketone. NI W331309-SAMPLE-K W331309-25G-K 25 g W331309-100G-K 100 g W331309-1KG-K 1 kg > MFT Acetate. see 2-Pentadecanone Page 104 umbelliferyl ether. coffee Halal. earthy.17  ≥97% FEMA 3789 Flavis 12.

Fen. pepper.091 CoE Nr 10285 W381101-SAMPLE-K Natural occurrence: Bilberry. buchu oil.1] hept-2-en-2-carboxaldehyde. grape. peach. lime. 2315. laurel. vanilla. strawberry.1. Fen. Kosher. see Myrcene Page 96 Myristicaceae. wine-like. NI W381101-25G-K 25 g W381101-100G-K 100 g W343900-SAMPLE-K Tetradecanoic acid W343900-100G-K 100 g [544‑63‑8] FEMA 2764 Flavis 8. 2295 W276413-10KG-K 10 kg  ≥95% W276413-25KG-K 25 kg FEMA 3765 Flavis 9. sweet FEMA 3439 Flavis 2.302 CoE Nr 10887 W275506-SAMPLE-K > Myristic acid ethyl ester.6-Dimethylbicyclo[3. woody Kosher. see Ethyl myristate Page 48 Myristic acid isopropyl ester. Kosher. β-Myrcene Arc.6-dimethyl-3. (1R)-6.033 W331401 (1R)-(−)-Myrtenal > 2-Naphthyl mercaptan. var. vegetable.25 FEMA 3395 CoE Nr 10379  98% [123‑35‑3] H2C=CHC(=CH2)CH2CH2CH=C(CH3)2 C10H16 FW 136. 590  FCC. NI China origin CoE Nr 16 Organoleptic: oily. 2283. NI W530098-SAMPLE  ≥90%. vanilla. Organoleptic: anise.22  ≥97% [67604‑48‑2] C15H12O5 FW 272. 588  99% FEMA 3314 Flavis 12. basil. woody Halal. (−)-Myrtenal Naringenin Arc. scotch spearment. fruity.7-Trihydroxyflavanone.5. Virginia tobacco.08% dl-alpha tocopherol as stabilizer W339504-SAMPLE-K W276200-SAMPLE-K [19894‑97‑4] C10H16O FW 152. hop oil. (±)-Naringenin.27 from Acacia decurrens Willd. vanilla Kosher.3Dihydro-5. see Methyl myristate Page 89 W275506-25G-K 25 g W275506-100G-K 100 g W275506-1KG-K 1 kg > Monoethylamine. see 2-Naphthalenethiol Page 96 (1R)-2-Pinen-10-al. 2293. FG FEMA 3811 Flavis 16. see Naringenin Page 96 1-(4-((2-O-[6-Deoxy-α-L-mannopyranosyl]-β-Dglucopyranosyl)oxy)-2. minty. see Ethylamine solution Page 42 Muriatic acid. 281 [18486‑69‑6] C10H14O FW 150. waxy Halal. 585 Nerol cis-3.6-octadiene.061 Halal. medicinal.008 CoE Nr 2197 Natural occurrence: Anise seed.6-Dimethylbicyclo[3. myrtle oil.37 W343900-1KG-K 1 kg W343900-5KG-K 5 kg Arc.58 Myrtenol 1 kg W530098-500G Neohesperidin dihydrochalcone W339504-100G-K W276200-1KG-K > β-Myrcene.016 CH3(CH2)12COOH C14H28O2 FW 228. Kosher Organoleptic: orange. honey. France origin Musk ketone Organoleptic: herbaceous.23 Natural occurrence: Cumin seed. raspberry.24 W276618-SAMPLE W522902-SAMPLE W376507-100G-K Thio-2-naphthol (β).7-dihydroxy-2-(4-hydroxyphenyl)-4H-1benzopyran-4-one 7-Methyl-3-methylene-1. FG FEMA 2762 Flavis 1. Fen. see Hydrochloric acid solution Page 65 Myrrh oil [8016‑37‑3] FEMA 2766 [81‑14‑1] (CH3)3CC6(NO2)2(CH3)2COCH3 C14H18N2O5 FW 294. sweet.25 Arc.23 100 g W339504-250G-K 250 g W339504-1KG-K 1 kg Fen. sweet Kosher W276405-100G-K 100 g W276405-1KG-K 1 kg W276405-5KG-K 5 kg W276405-10KG-K 10 kg W276405-25KG-K 25 kg Place an order with your local SAFC representative (see back for contacts).6-octadien-1-ol [106‑25‑2] (CH3)2C=CHCH2CH2C(CH3)=CHCH2OH C10H18O FW 154. FCC Mimosa absolute Moroccan (−)-Myrtenyl acetate Halal. herbaceous. Organoleptic: berry.SAFC® Flavors & Fragrances Mimosaabsolutem  natural.7-Dimethyl-2. dealbata Kosher Organoleptic: floral France origin W276413-5KG-K 5 kg Arc.1.30 W276618-100G 100 g W276618-1KG 1 kg > (−)-Myrtenal. rosemary and thyme. see Nutmeg oil Page 99 Nutmeg oil Page 99 8 4′. gin. W277002-SAMPLE-K W277002-1KG-K 1 kg W277002-4KG-K 4 kg W277002-9KG-K 9 kg . FG from synthetic Organoleptic: citrus Kosher. 586 W276200-8KG-K 8 kg  ≥95% W276200-20KG-K 20 kg Myristic acid > (±)-Naringenin. 2-Naphthyl mercaptan Ketone Moschus. pepper. Fen.5dinitroacetophenone from synthetic China origin W376507-SAMPLE-K 2-Naphthalenethiol from Commiphora spp.1]hept-2-ene-2-methyl acetate W276413-SAMPLE-K [8031‑03‑6] FEMA 2755 W276413-1KG-K 1 kg [1079‑01‑2] C12H18O2 FW 194. see Isopropyl myristate Page 72 Myristic acid methyl ester. juniper berry. green. 586 500 g [20702‑77‑6] C28H36O15 FW 612. (±)-2. peppermint. beer. FCC. woody.058 CoE Nr 2018  FCC. black currant. Kosher Mimosa absolute (1R)-6. 4-tert-Butyl-2.6-dihydroxyphenyl)-3-[3hydroxy-4-methoxyphenyl]-1-propanone  ≥85%. pepper. NI contains 0. scotch spearmint. see (1R)-(−)-Myrtenal Page 96 W522902-1KG 1 kg W522902-5KG 5 kg W522902-10KG 10 kg Myrcene 1 kg W376507-5KG-K 5 kg Fen. minty. 2288. Organoleptic: berry. NI W276405-SAMPLE-K 96 100 g W376507-1KG-K [91‑60‑1] C10H7SH C10H8S FW 160. ≥97% FEMA 2770 Flavis 2.

587 FEMA 2768 Flavis 4.194 CoE Nr 732 Natural occurrence: Avocado.trans-2. citrus. 589 W277800-SAMPLE-K  ≥90% W277401-SAMPLE Nerolin Yara Yara Organoleptic: ethereal. 596  ≥93%. tea. FG FEMA 3766 Flavis 5. Kosher. raspberry. mandarin. nutmeg. NI Organoleptic: green. Brazil nut. see Nerolin bromelia Page 97 2-Methoxynaphthalene. Methyl 2-naphthyl ether from synthetic Organoleptic: floral. 2301. green. Kosher. see Disperse Orange 3 Page 41 4-(4-Nitrophenylazo)diphenylamine. orange. blossom. chicken and pork. cocoa. Fen.trans-2. NI W277207-SAMPLE-K W277207-1KG-K 1 kg W277207-4KG-K 4 kg W277207-9KG-K 9 kg Neroli extract 8 Orange flower bitter. see Methyl nicotinate Page 89 4-(4-Nitrophenylazo)aniline.20 Arc. lemon. 3Hydroxy-3. Kosher. plum.29 Arc. Fen. floral.471 CoE Nr 508 from Citrus aurantium L. synthetic as antioxidant [17587‑33‑6] C2H5CH=CHCH2CH2CH=CHCHO C9H14O FW 138. lilac.167 CoE Nr 505 Neryl isobutyrate  ≥99% W277800-100G-K Violet leaf aldehyde [93‑04‑9] C10H7OCH3 C11H10O FW 158. ≥96%.10-dodecatrien-3-ol. FG from Citrus aurantium Kosher Organoleptic: floral W530412-SAMPLE-K 25 g > Neroli extract. sage. see Orange flower absolute Page 103 Nerolin bromelia 2-Ethoxynaphthalene. NI contains 0. FG [72968‑50‑4] W530412-25G-K Neryl isovalerate Organoleptic: berry. Morocco 3. sweet Kosher contains 0.4-Nonadienal [5910‑87‑2] CH3(CH2)3CH=CHCH=CHCHO C9H14O FW 138. apricot. NI Fen. 2325. grapefruit. fishy. NI Arc. 595 W337706-25G-K 25 g W337706-100G-K 100 g W337706-1KG-K 1 kg trans. fish. grape. green Halal. NI contains 0.22 Arc.21 Organoleptic: orange. sweet. violet. lime.033 CoE Nr 2058 from synthetic Kosher Organoleptic: grape China origin Natural occurrence: Orange juice. citrus. lemon. meaty. Fen. caviar. herbaceous. 2324. sweet [2345‑24‑6] (CH3)2CHCO2CH2CH= C(CH3)CH2CH2CH=C(CH3)2 C14H24O2 FW 224. strawberry.37 FEMA 2771 [3915‑83‑1] (CH3)2CHCH2CO2CH2CH= C(CH3)CH2CH2CH=C(CH3)2 C15H26O2 FW 238. 2339.com  ≥85% FEMA 3212 Flavis 5. pear. spice and buchu oil. Bitter orange flower W277126-25G-K 25 g W277126-100G-K 100 g W277126-1KG-K 1 kg Neryl acetate [141‑12‑8] CH3CO2CH2CH=C(CH3)CH2CH2CH= C(CH3)2 C12H20O2 FW 196. Fen.6-octadien-1-yl acetate  ≥98%.058 CoE Nr 659 Halal. Fen. vegetable. green. strawberry. Organoleptic: melon. see Pararot Page 104 1-(4-Nitrophenylazo)-2-naphthol. Neroline [93‑18‑5] C12H12O FW 172. grape. synthetic as antioxidant W277304-SAMPLE-K W277304-1KG-K 1 kg W277304-4KG-K 4 kg W277304-9KG-K 9 kg Neryl butyrate [999‑40‑6] CH3CH2CH2CO2CH2CH= C(CH3)CH2CH2CH=C(CH3)2 C14H24O2 FW 224.7.10-dodecatriene [8016‑38‑4] [7212‑44‑4] (CH3)2C=CHCH2CH2C(CH3)= CHCH2CH2C(CH3)(OH)CH=CH2 C15H26O FW 222. green Kosher. 591  mixture of cis and trans.34 Arc. 2316.34 Flavis 4. rose Kosher. cooked beef.074 100 g W277800-1KG-K FEMA 2774 Flavis 9. 592 W276804-SAMPLE-K W276804-1KG-K 1 kg W276804-10KG-K 10 kg > Neroline. rose. synthetic as antioxidant Fen. green. 593 cis-3. 591 FEMA 2773 Flavis 9. 2339. waxy. floral.7. milk and roasted peanut.7-Dimethyl-2.10% alpha-tocopherol. see Pararot Page 104  mixture of isomers. Fen. sweet China origin 100 g W277401-1KG 1 kg W277401-4KG 4 kg W525308-10KG 10 kg W525308-25KG 25 kg Feel inspired at safcglobal. fatty. rose. vegetable Arc.21 W277509-SAMPLE-K Organoleptic: vegetable. Fen. 2322.cis-6-Nonadienal FEMA 3377 Flavis 5. Organoleptic: apple.Nonadienal Nerolidol Neroli oil.172 W277509-100G-K 100 g W277509-1KG-K 1 kg W376604-SAMPLE-K W277509-4KG-K 4 kg W376604-25G-K 25 g W376604-100G-K 100 g W376604-1KG-K 1 kg 97 .424 CoE Nr 299 1 kg trans. grapefruit.21 W337706-SAMPLE-K  ≥97% W525308-1KG 4 kg > Nicotinic acid methyl ester. black currant buds. Ethyl 2-naphthyl ether. Kosher France origin Arc. chocolate. 593 W525308-SAMPLE 1 kg W277800-4KG-K [557‑48‑2] C2H5CH=CHCH2CH2CH=CHCHO C9H14O FW 138. oily.213 CoE Nr 2061  natural.10% alpha-tocopherol.6-Nonadienal FEMA 2775 Flavis 9. Halal. lime and bergmot essential oils. raspberry. floral.11-Trimethyl-1.6. peach. honey. waxy Halal. sweet Kosher.11-trimethyl-1.018 CoE Nr 67 Organoleptic: apple. cooked lamb/ mutton.10% alpha-tocopherol. see Disperse Orange 1 Page 41 1-(p-Nitrophenylazo)-2-naphthol.6. orange. FCC.37  FG  ≥92% FEMA 2778 Flavis 9. 595 W321206-SAMPLE-K W321206-25G-K 25 g W321206-100G-K 100 g W321206-1KG-K 1 kg trans-2. 2302. FCC W277401-100G Arc. woody. floral. FCC W277126-SAMPLE-K FEMA 2772 Flavis 2. Fen.

herbaceous CoE Nr 154c W278300-SAMPLE W278300-1KG 1 kg W278300-5KG 5 kg W278300-10KG 10 kg Natural occurrence: Blue cheese. NI W278408-5KG-K 5 kg W344001-SAMPLE-K W278408-10KG-K 10 kg W344001-25G-K 25 g W278408-20KG-K 20 kg W344001-100G-K 100 g W344001-1KG-K 1 kg W278408-1KG-K 98 FEMA 3315 Flavis 2. Fen. Fen.029 CoE Nr 29 W335606-100G-K 100 g W335606-1KG-K 1 kg Organoleptic: cheese. mandarin. herbaceous. 2052. Fen. sulfurous Kosher Lit. lactone  ≥97%  ≥80% (2008) δ-Nonalactone Arc.25 Arc.22 Arc. soapy. citrus. 2346. 2347. vegetable. cucumber. Kosher.26 [1322‑17‑4] CH3(CH2)4CH2CH(OR)CH2CH2OR. Organoleptic: apricot. sweet.22 Pelargonaldehyde. wine-like Halal.39 W278505-5KG-K 5 kg Fen. waxy.10% alpha-tocopherol.cis-6-Nonadienyl acetate Heptyl methyl carbinol FEMA 2782 Flavis 5. Kosher. lime. lemon. fatty.3-Nonanediol acetate.113 CoE Nr 11160 1 kg Organoleptic: cheese. fishy. fatty.014 CoE Nr 2194 Natural occurrence: Butter. Fen. vegetable. FCC. oily. 6. NI contains 0. chicken. butter. violet Halal. waxy Halal. balck currants. cereal. . fishy. see Methyl nonanoate Page 89 γ-Nonanoic lactone. Fen. rose. oily. 2351. cucumber. cheddar cheese. 367  98%. 2350. grapefruit. 597 Arc. FCC. coconut. 598 [124‑19‑6] CH3(CH2)7CHO C9H18O FW 142.9-Nonanedithiol [104‑61‑0] C9H16O2 FW 156. Fen. Organoleptic: cheese. 601  ≥99% Organoleptic: jasmine.cis-6-Nonadien-1-ol [28069‑72‑9] CH3CH2CH=CHCH2CH2CH= CHCH2OH C9H16O FW 140. see Nonyl alcohol Page 99 Place an order with your local SAFC representative (see back for contacts). ≥97%. 598 1. grilled beef. FG FEMA 3356 Flavis 10. Organoleptic: apple. cooked beef. soapy. vegetable. orange. coconut. 2342.24  ≥95%. Mosciano.225 CoE Nr 2075 W351318-SAMPLE-K 5-Hydroxynonanoic acid. oil of rue. herbaceous Kosher. fish. fruity. grapefruit. fatty. see γ-Nonalactone Page 98 1-Nonanol. milk. meaty Halal. fatty. see Nonyl acetate Page 99 2-Nonanone Heptyl methyl ketone Arc. FCC FEMA 2780 Flavis 2. butter. 601  >96%. Kosher. waxy Halal. NI Arc.069 CoE Nr 11558 W278106-SAMPLE-K [628‑99‑9] CH3(CH2)6CH(OH)CH3 C9H20O FW 144. Acid C9 [112‑05‑0] CH3(CH2)7COOH C9H18O2 FW 158. Perfum. pork fat. cited: 1. herbaceous. melon. butter. vegetable. fruity.001 CoE Nr 178 Organoleptic: anise. FCC FEMA 2781 Flavis 10. orange and peach. Flavor. coconut. coconut. meaty.231 CoE Nr 589 Organoleptic: melon. Aldehyde C9 Arc.1 Organoleptic: meaty.29  mixture of isomers. 599 W278505-10KG-K 10 kg  ≥95%  natural. nutty. grape. 2048.24 FEMA 3513 Flavis 12. herbaceous. fish. 33. see trans-2. cheddar cheese.025 CoE Nr 114 Natural occurrence: Apple. Nonyl aldehyde. krill. Organoleptic: butter. green Halal. NI W278505-SAMPLE-K W278505-250G-K 250 g 1. Gerard. waxy Kosher.SAFC® Flavors & Fragrances Nonadienol Nonanal trans-2.24 Arc. pineapple. 600 [821‑55‑6] FEMA 2785 Flavis 7. lemon. Kosher W278513-SAMPLE-K W278513-25G-K 25 g W278513-100G-K 100 g W278513-1KG-K 1 kg W278513-4KG-K 4 kg 3-Nonanone Ethyl hexyl ketone [925‑78‑0] FEMA 3440 CH3(CH2)5COC2H5 C9H18O FW 142. krill.9-Dimercaptononane W278505-1KG-K 1 kg [3489‑28‑9] HS(CH2)9SH C9H20S2 FW 192.22 > Nonanoic acid methyl ester. oily. NI W335606-SAMPLE-K Organoleptic: melon. 597 W278106-1KG-K 1 kg W278106-10KG-K 10 kg W278106-25KG-K 25 kg [3301‑94‑8] C9H16O2 FW 156. R = H or -COCH3 C11H22O3 FW 202. Fen. Fen. Kosher. 2343. FG 2-Nonanol  ≥95%. floral. and white wine. nutty. Kosher. fishy. lime. coconut.24  ≥96% Arc. ≥97% FEMA 3952 Organoleptic: apple. Fen. green Kosher W395218-SAMPLE-K W395218-25G-K 25 g W395218-100G-K 100 g W395218-1KG-K 1 kg γ-Nonanoic lactone  ≥98%. NI W335606-4KG-K 4 kg W278408-SAMPLE-K CoE Nr 154 Natural Occurrence: Blue cheese. green.087 CoE Nr 4149 FEMA 2783 Flavis 9. fish. mixed esters [68555‑65‑7] CH3CH2CH=CHCH2CH2CH= CHCH2OCOCH3 C11H18O2 FW 182. 73 W351318-25G-K 25 g W351318-100G-K 100 g W351318-1KG-K 1 kg Nonanoic acid Pelargonic acid. NI contains tocopherol as stabilizer W278203-SAMPLE-K W278203-1KG-K 1 kg W278203-4KG-K 4 kg W278203-8KG-K 8 kg W278203-20KG-K 20 kg Nonadienyl acetate 1. cheese.02 CH3(CH2)6COCH3 C9H18O FW 142.cis-6-Nonadienyl acetate Page 98 trans-2. 600 FEMA 2784 Flavis 8. citrus. oil of rue. peach. avocado. coconut. FG Flavis 7. FCC Possible uses: mushroom. meat. green NI W331503-SAMPLE W331503-100G 100 g W331503-1KG 1 kg W331503-4KG 4 kg > Nonanol acetate. synthetic as antioxidant W278009-SAMPLE-K W278009-25G-K 25 g W278009-100G-K 100 g W278009-1KG-K 1 kg > Nonadienyl acetate. chicen fat. oily. 2341.

2363. vegetable Kosher.23 Organoleptic: gardenia. 2348. fruity.234 [18829‑56‑6] CH3(CH2)5CH=CHCHO C9H16O FW 140.093 CoE Nr 10294 200 g W321303-1KG-K 1 kg Organoleptic: melon. NI W321303-4KG-K 4 kg W346500-SAMPLE-K cis-6-Nonenal [2277‑19‑2] C2H5CH=CH(CH2)4CHO C9H16O FW 140.Octadienalpredo  natural (US). see 2. Acetate C-9. 604  ≥97% 5 kg W516309-10KG  FCC Nonyl acetate Fen.24 W344015-100G-K  95% W344015-SAMPLE-K FEMA 4412 Flavis 2. trans [5577‑44‑6] CH3CH2CH2CH=CHCH=CHCHO C8H12O FW 124. soapy.25 Arc. fatty.059 CoE Nr 661 Organoleptic: melon.24 Fen. ≥90% W278807-SAMPLE W278807-1KG 1 kg Flavis 1. Myristicaceae 3. Kosher. 2384 W516309-SAMPLE cis-6-Nonen-1-ol  ≥93% [35836‑72‑7] C13H20O2 FW 208. 606  ≥98%. FG 8 cis-3-Nonen-1-ol Organoleptic: leafy. rose Halal. 609  ≥95% FEMA 3721 Flavis 5. Fen.10% alpha-tocopherol. see Methyl cis-12-octadecenoate solution Page 90 2. Kosher W278904-SAMPLE-K W278904-1KG-K 1 kg W278904-8KG-K 8 kg W278904-20KG-K 20 kg > Nonyl aldehyde. 603 1 kg W516309-5KG Fen. 2393. FCC FEMA 2789 Flavis 2. see Linoleic acid Page 76 Octadecanoic acid. 2388  mixture of isomers. see Oleic acid Page 102 cis-12-Octadecenoic acid methyl ester solution. 605  FCC Organoleptic: melon. 605 [8008‑45‑5] from Myristica fragrans Houtt. Kosher.50% alpha-tocopherol.018 W278807-4KG 4 kg W278807-9KG 9 kg Mixture of cis-Ocimene (~70-75%) and Limonene (~20-25%) > N-Nonyl acetate.007 CoE Nr 55 W372005-SAMPLE-K Nutmeg oil. East Indian. NI contains 0. citrus Halal. Fen.22  ≥92%.112 CoE Nr 10292 10 kg FEMA 2793 Fen.24 FEMA 3213 Flavis 5.09 CoE Nr 10292 Organoleptic: melon. 2356. waxy Kosher.7-Dimethyl-1. FG FEMA 3580 Flavis 5.3. vegetable Kosher. 196  ≥93%.com ≥85% trans.2-Dimethyl-5-(1-methylpropen-1yl)tetrahydrofuran Page 38 Ocimum basilicum. ≥97%. FCC FEMA 3379 Flavis 2. sweet. green Halal.7-Dimethyl-1. waxy. Pelargonyl acetate. NI contains 0. fatty Kosher. see Stearic acid Page 119 cis-9-Octadecenoic acid. synthetic as antioxidant W358002-SAMPLE-K W358002-25G-K 25 g W358002-100G-K 100 g W358002-1KG-K 1 kg cis-2-Nonen-1-ol [41453‑56‑9] CH3(CH2)5CH=CHCH2OH C9H18O FW 142.186 CoE Nr 11805  ≥96%. NI contains 0.10% alpha-tocopherol. fatty.cis-12-Octadecadienoic acid. 3.trans isomer Organoleptic: green. predominantly trans. herbaceous W344015-500G [10340‑23‑5] CH3(CH2)4CH=CHCH2CH2OH C9H18O FW 142.29 Arc.30  ≥98% W441200-SAMPLE trans-2-Nonenal (1R)-(−)-Nopyl acetate Organoleptic: citrus. Fen. see Basil oil. see Nutmeg oil Page 99 Ocimene [13877‑91‑3] C10H16 FW 136. see Nonanal Page 98 W353901-SAMPLE W353901-100G 100 g W353901-1KG 1 kg > Ocimene quintoxide. see Nonyl acetate Page 99 1-Nonanol. Organoleptic: spicy Kosher Indonesia origin origin W279307-SAMPLE-K W279307-1KG-K 1 kg W279307-5KG-K 5 kg > Nutmeg oil. synthetic as antioxidant W337900-SAMPLE-K W337900-25G-K 25 g W337900-100G-K 100 g W337900-1KG-K 1 kg Feel inspired at safcglobal. NI Fen.24 W346500-25G-K 25 g W346500-100G-K 100 g W346500-1KG-K 1 kg N-Nonyl acetate.072 CoE Nr 733 Arc. synthetic as antioxidant FEMA 2788 Flavis 9. FG W321303-200G-K W516309-1KG Nutmeg oil [35854‑86‑5] C2H5CH=CH(CH2)5OH C9H18O FW 142. comoric type Page 16 cis-9. 603 W441200-100G 100 g W441200-1KG 1 kg Organoleptic: waxy. 604 W321303-SAMPLE-K FEMA 3465 Flavis 2.18 Arc.008 CoE Nr 198 W372005-25G-K 25 g W372005-100G-K 100 g W372005-1KG-K 1 kg trans-2-Nonen-1-ol [31502‑14‑4] CH3(CH2)5CH=CHCH2OH C9H18O FW 142. Fen. Alcohol C9 [143‑08‑8] CH3(CH2)8OH C9H20O FW 144.3. violet. NI W372102-SAMPLE-K W372102-100G-K 100 g W372102-250G-K 250 g W372102-1KG-K 1 kg 99 .6octatrien Nonyl alcohol FEMA 3720 Flavis 2. Nonanol acetate [143‑13‑5] CH3CO2(CH2)8CH3 C11H22O2 FW 186.22 Arc.4-Octadienal.6-octatriene. East Indian. fruity NI Arc.

SAFC® Flavors & Fragrances Octalactone 1. 612 2-Octanol [1191‑62‑4] HS(CH2)8SH C8H18S2 FW 178. secCaprylic alcohol. FCC. Alcohol C8 100 g W358118-1KG-K 1 kg W358118-8KG-K 8 kg Natural Occurrence: Spearmint oil. NI W280003-4KG-K 4 kg W280208-SAMPLE-K W280003-8KG-K 8 kg W280208-800G-K W280003-20KG-K 20 kg W280208-1KG-K W280208-2. nutty. Kosher. NI  ≥98% FEMA 2802 Flavis 7. Kosher. citrus 8 kg W280100-20KG-K CoE Nr 4023 Organoleptic: oily Halal. FCC. peach Halal. Halal.098 CH3(CH2)4CH(OH)CH2CH3 C8H18O FW 130. waxy. 2403. ≥97%.022 C8H14O2 FW 142. 611  ≥98%.21 Arc. oily. FG W279900-2KG-K 2 kg W279900-10KG-K 10 kg W279900-20KG-K 20 kg W358118-SAMPLE-K W279927-1KG-K W279706-4KG-K 4 kg W279927-5KG-K 5 kg W279706-8KG-K 8 kg W279927-10KG-K 10 kg W279706-20KG-K 20 kg W279927-25KG-K 25 kg 1 kg > γ-Octanoic lactone. Kosher. waxy Halal. FG Octanal [124‑13‑0] FEMA 2797 Flavis 5. Kosher. woody. minty. musty. FG [111‑13‑7] CH3(CH2)5COCH3 C8H16O FW 128. waxy. 2400. Capryl alcohol W280011-1KG-K 1 kg W280011-4KG-K 4 kg W280011-8KG-K 8 kg Place an order with your local SAFC representative (see back for contacts).23 CoE Nr 10c Organoleptic: honey. Kosher [124‑07‑2] FEMA 2799 Flavis 8.01 CH3(CH2)6COOH C8H16O2 FW 144. earthy. 2066. NI W279609-SAMPLE-K W279609-100G-K 100 g W279609-1KG-K 1 kg W279609-5KG-K 5 kg W351407-25G-K 25 g W351407-100G-K 100 g W351407-1KG-K 1 kg Octanoic acid Caprylic acid. pimento leaf and truffle. FCC 1 kg W280100-8KG-K  ≥97%. NI W279706-1KG-K Kosher Organoleptic: honey. Kosher. 609  ≥97%  ≥97%. NI W279927-SAMPLE-K  natural. spicy. Ethylpentylcarbinol. ≥98%.21 W279617-SAMPLE-K Arc. fruity. ≥98%  ≥92%.019 CoE Nr 153 W280003-SAMPLE-K W280003-1KG-K 1 kg Organoleptic: green. 2057. FCC W280208-4KG-K CoE Nr 54c Kosher Organoleptic: orange. FCC Organoleptic: oily. herbaceous.009 CoE Nr 97 CH3(CH2)6CHO C8H16O FW 128.5 kg 4 kg W280208-8KG-K 8 kg W280208-20KG-K 20 kg . see γ-Octalactone Page 100 1-Octanol Octyl alcohol. Ocimum basilicum.20 Fen.21 CoE Nr 54 Arc. Capryl alcohol. pimento leaf and truffle. earthy Halal. oat groats. FCC. oat groats. creamy. Kosher Organoleptic: cheese. FCC.034 CoE Nr 2331 CoE Nr 2274 Ethyl-N-amylcarbinol. Ocimum basilicum. fatty. fatty. 2397. FG 1 kg W279714-SAMPLE-K 20 kg Natural occurrence: Spearmint oil. FG Organoleptic: meaty. FG CoE Nr 10 Organoleptic: cheese Kosher W279706-SAMPLE-K W280100-1KG-K [589‑98‑0] FEMA 3581 Flavis 2. Acid C8 CoE Nr 2274c Halal. Organoleptic: melon.8-Dimercaptooctane [104‑50‑7] FEMA 2796 Flavis 10. 4-Hydroxy octanoic acid 1. herbaceous. Aldehyde C8 [123‑96‑6] CH3(CH2)5CH(OH)CH3 C8H18O FW 130. woody. NI W280100-SAMPLE-K Ethyl pentyl carbinol  natural. citrus Halal. 613 W279617-25G-K 25 g W279617-100G-K 100 g W279617-1KG-K 1 kg FEMA 2801 Flavis 2. 800 g 1 kg 2. 615 Organoleptic: citrus. floral. Fen.36 Arc. Caprylic aldehyde.4-lactone.23  ≥97% FEMA 3514 Flavis 12. woody Halal.8-Octanedithiol γ-Octalactone γ-Octanoic lactone. ≥97%.006 CH3(CH2)7OH C8H18O FW 130. sulfurous Kosher Organoleptic: coconut. herbaceous W358126-SAMPLE-K W358126-100G-K 100 g W358126-1KG-K 1 kg W358126-4KG-K 4 kg 2-Octanone W279714-100G-K 100 g W279714-1KG-K 1 kg [111‑87‑5] FEMA 2800 Flavis 2.23 W279714-4KG-K 4 kg Hexyl methyl ketone  ≥98%. Fen. fruity Kosher. Kosher. Octano-1. 614 3-Octanol W279900-SAMPLE-K Octyl aldehyde. floral W280011-SAMPLE-K 100 W358118-100G-K  natural. NI Arc. Fen. Fen. Fen.5KG-K  natural. spicy. herbaceous. fatty. ≥92%.022 CoE Nr 71 W351407-SAMPLE-K  natural. minty. earthy.

synthetic as antioxidant W341606-SAMPLE-K W341606-100G-K 100 g W341606-1KG-K 1 kg W341606-4KG-K 4 kg 1-Octen-3-yl acetate 3-Acetoxy octene. green Kosher. rum and mushroom. musty. meaty. Flavor. green. thyme.20 predominantly trans  85% FEMA 3957 Flavis 8.1 Natural occurrence: strawberry.023 CoE Nr 72 Natural occurrence: Clover.10% alpha-tocopherol.21 [3391‑86‑4] CH3(CH2)4CH(OH)CH=CH2 C8H16O FW 128.081 CoE Nr 2312 Arc.com W361208-100G-K 100 g W361208-1KG-K 1 kg W361208-4KG-K 4 kg 101 . FCC. vegetable.10% alpha-tocopherol.114 Possible uses: lamb. green NI W280305-SAMPLE-K W280305-1KG-K 1 kg W280305-8KG-K 8 kg W280305-20KG-K 20 kg trans-2-Octenal [2548‑87‑0] CH3(CH2)4CH=CHCHO C8H14O FW 126. mushroom. 617  ≥98%. 124. 1148. strawberry. 615 Arc. Perfum.10% alpha-tocopherol. lemon. Organoleptic: butter. NI W280518-SAMPLE-K W280518-1KG-K 1 kg W280518-4KG-K 4 kg W280518-8KG-K 8 kg W280518-20KG-K 20 kg FEMA 3215 Flavis 5. guava. see Ethyl-trans-2-octenoate Page 49 W351504-25G-K 25 g W351504-100G-K 100 g W351504-1KG-K 1 kg trans-3-Octen-2-one [18402‑82‑9] CH3(CH2)3CH=CHCOCH3 C8H14O FW 126.10% alpha-tocopherol. and beef. sweet.21  98% FEMA 4293 Flavis 1.113 W358207-1KG-K 1 kg Organoleptic: fatty. fish. Fen. Fen. vegetable. vegetable. blueberry. Kosher NI contains 0. earthy. Amy vinyl carbinol acetate W388718-100G-K 100 g W388718-1KG-K 1 kg [2442‑10‑6] C10H18O2 FW 170.282 Natural Occurrence: Passion fruit. cognac.062 CoE Nr 2042 Natural occurrence: Banana. vegetable Halal.Octenylbutyrate 3-Octanone 1-Octen-3-ol 1-Octen-3-one solution Ethyl pentyl ketone. ripe cheeses. chicken. NI FEMA 3887 W321508-SAMPLE-K W321508-100G-K 100 g W321508-1KG-K 1 kg W321508-4KG-K 4 kg 1-Octene 8 [111‑66‑0] CH3(CH2)5CH=CH2 C8H16 FW 112. berry. 617 Organoleptic: cucumber. peas. earthy. FCC cis-5-Octen-1-ol FEMA 3582 Flavis 9. mushroom. nutty. cited: 1. earthy Kosher contains 0. boiled mutten1 Lit.281 CoE Nr 11716 [64275‑73‑6] C2H5CH=CH(CH2)4OH C8H16O FW 128. synthetic as antioxidant W388718-SAMPLE Organoleptic: berry. shell fish. animal. FG [106‑68‑3] CH3(CH2)4COC2H5 C8H16O FW 128. Organoleptic: cheese. potato. melon.21  ≥94% W351504-SAMPLE-K  ≥98% trans-2-Octen-1-ol Arc. meaty chicken. spicy Kosher. fishy. tea. vegetable.25 Fen. herbaceous. capsicum frutescens. orange. fishy Halal.19 CoE Nr 663  97% Organoleptic: spicy. earthy. spicy.21 Organoleptic: lavender Kosher Fen. % in 1-octen-3-ol. Fen. fruity. Organoleptic: citrus. earthy. herbaceous. 50 (2008) W395701 > trans-2-Octenoic acid ethyl ester. green Kosher. butter. FG FEMA 2803 Flavis 7. 33. Halal. Mosciano. waxy. NI contains 0. cooked artichoke. chicken fat. 231. NI contains 0.07 W429300-SAMPLE W429300-1KG 1 kg W429300-5KG 5 kg 2-Octenoic acid [1871‑67‑6] CH3(CH2)4CH=CHCO2H C8H14O2 FW 142. earthy. rosemary and hyssop. herbaceous. vegetable. Kosher. bilberry. mushroom.20 Fen. butter. soybeans. 621 W358207-SAMPLE-K  ≥98% W358207-100G-K 100 g FEMA 3722 Flavis 2. 3rd ed.21 FEMA 3515 Flavis 7.30 Fen. musty. 620  ≥97%. cheese. creamy. synthetic as antioxidant Natural occurrence: Apple. Ethyl amyl ketone Pentyl vinyl carbinol  50 wt. FCC FEMA 3612 Flavis 9. Kosher Organoleptic: banana. peas.10% alpha-tocopherol. herbaceous. mutton. goat. meaty Kosher contains 0.. wheat bread. 619 FEMA 3416 CoE Nr 11170 [18409‑17‑1] CH3(CH2)4CH=CHCH2OH C8H16O FW 128. FG  ≥98%. 622  ≥97%.20 FEMA 2805 Flavis 2. synthetic as antioxidant W361208-SAMPLE-K Feel inspired at safcglobal. Gerard. synthetic as antioxidant W358207-4KG-K 4 kg W372218-SAMPLE-K Butanoic acid 1-octen-3-yl ester W372218-100G-K 100 g W372218-1KG-K 1 kg W372218-4KG-K 4 kg 1-Octen-3-yl butyrate [16491‑54‑6] C12H22O2 FW 198.

see 1-Ethylhexyl tiglate Page 46 Oenanthaldehyde.34 Arc. Kosher.451 CoE Nr 446 Organoleptic: honey. FG Kosher Organoleptic: herbaceous. FCC Organoleptic: melon 100 g W280615-1KG 1 kg W280909-1KG-K 1 kg W280615-4KG 4 kg W280909-4KG-K 4 kg W280909-9KG-K 9 kg Octyl isobutyrate [109‑15‑9] (CH3)2CHCO2(CH2)7CH3 C12H24O2 FW 200. 624 Organoleptic: apple. 627 CoE Nr 2347  ≥98%. Fen.114 CoE Nr 395 W281107-SAMPLE-K > (±)-γ-Octyl-γ-butyrolactone. Kosher.42 Arc. see Heptanoic acid Page 57 Oil of mustard.46  natural (US). oily. see Octyl octanoate Page 102 [112‑32‑3] HCO2(CH2)7CH3 C9H18O2 FW 158. 624  ≥98%. NI Organoleptic: fatty Halal. 2412. sweet Kosher. see Heptanal Page 57 Oenanthic acid. FCC FEMA 2808 Flavis 9. 2440. Fen. Fen. FCC. see Octyl isovalerate Page 102 Olibanum oil Frankincense. FCC. see Frankincense oil Page 102 W281409-1KG W280704-SAMPLE-K 102 4 kg W281107-9KG-K Organoleptic: waxy Kosher. Kosher. 630 FEMA 2809 Flavis 9. fruity.32  ≥98%. 629 Arc. 631 W281506-SAMPLE-K W281506-1KG-K  ≥98% > Octyl alcohol. W281611-100G-K 100 g W281611-1KG-K 1 kg . fruity. see Octanal Page 100  natural. FCC  ≥98% Place an order with your local SAFC representative (see back for contacts). ≥95% Octyl acetate Octyl octanoate CoE Nr 272c Acetic acid octyl ester Octyl caprylate Organoleptic: orange Kosher [112‑14‑1] FEMA 2806 Flavis 9. herbaceous. fruity Halal. Kosher Arc.075 CoE Nr 342 W280615-SAMPLE FEMA 2811 Flavis 9. NI Organoleptic: jasmine. citrus. FG FEMA 2815 Flavis 8. soapy. earthy. fruity W280712-1KG-K 1 kg W280607-SAMPLE-K W280607-1KG-K 1 kg W280607-4KG-K 4 kg W280607-9KG-K 9 kg W280607-20KG-K 20 kg Octyl formate Octyl methanoate Arc. 2422. NI Arc. Kosher France origin W280704-9KG-K 9 kg W281611-SAMPLE-K W280704-20KG-K 20 kg W280704-1KG-K 1 kg W281506-4KG-K > Olibanum oil. fruity.24  natural.126 CoE Nr 407 25 g W280615-100G [4864‑61‑3] FEMA 3583 Flavis 9. see L-Turpentine Page 127 Oil Red 113. FG Arc. warm. woody. minty. citrus. floral W280801-SAMPLE-K n-Octyl-3-methyl butyrate W358315-100G-K [7786‑58‑5] (CH3)2CHCH2CO2(CH2)7CH3 C13H26O2 FW 214. green. 2408. see Octyl formate Page 102 n-Octyl-3-methyl butyrate. FCC. NI 1 kg W281107-4KG-K FEMA 2813 Flavis 9. Fen.SAFC® Flavors & Fragrances Octylacetate  natural (US). 627 FEMA 2814 Flavis 9. Fen. cis-9-Octadecenoic acid W358304-4KG-K 4 kg W280801-4KG-K 4 kg W280801-9KG-K 9 kg [112‑80‑1] CH3(CH2)7CH=CH(CH2)7COOH C18H34O2 FW 282. 2438.013 CoE Nr 13 Octyl isovalerate W358315-1KG-K W358315-SAMPLE-K W281409-SAMPLE 4 kg W281506-10KG-K 10 kg W281506-20KG-K 20 kg 1 kg W281409-4KG 4 kg W281409-9KG 9 kg > Octyl methanoate.046 CH3CH2CH2CO2(CH2)7CH3 C12H24O2 FW 200. see 2-Ethylhexyl salicylate Page 46 3-Octyl tiglate. 623 W280712-SAMPLE-K  ≥98%. 2416. NI W358304-SAMPLE-K 9 kg Octyl propionate [142‑60‑9] C2H5CO2(CH2)7CH3 C11H22O2 FW 186. rose Kosher W280615-25G 3-Octyl acetate Organoleptic: coconut. see Allyl isothiocyanate Page 11 Oil of turpentine. 2411. FG CoE Nr 272 Organoleptic: musty. rose NI Octyl butyrate [110‑39‑4] FEMA 2807 Flavis 9. FG W280712-25G-K 25 g CoE Nr 197 W280712-100G-K 100 g Halal. NI W280909-SAMPLE-K Arc. 2435. see Sudan red G Page 120 Oil Red IV.007 CH3CO2(CH2)7CH3 C10H20O2 FW 172. Fen. ≥97%.473 CoE Nr 593 Organoleptic: creamy. see γ-Dodecalactone Page 41 Octyl caprylate. see Sudan IV Page 120 Oleic acid W358304-100G-K 100 g W358304-1KG-K 1 kg W280801-1KG-K 1 kg Elainic acid. 2406.26 [2306‑88‑9] C16H32O2 FW 256. Fen.32 Arc. see 1-Octanol Page 100 Octyl aldehyde.26 W281107-1KG-K  ≥99% Organoleptic: orange. Fen.254 CH3CO2CH(C2H5)(CH2)4CH3 C10H20O2 FW 172. green Kosher.29 W281301-SAMPLE-K W281301-1KG-K 1 kg W281301-4KG-K 4 kg W281301-9KG-K 9 kg > Octyl salicylate. rose Halal. Boswellia carterii [8016‑36‑2] FEMA 2816 1 kg from Boswellia spp. ≥98%. Fen. 625 CoE Nr 197c  ≥97%.

Bitter orange flower [72968‑50‑4]  natural FEMA 2818 [8028‑48‑6] from Citrus sinensis (L. LOrnithine monohydrochloride. Kosher  FCC W281800-5G-K Propionylformic acid. Ketoisophorone [1125‑21‑9] C9H12O2 FW 152.) Osbeck Halal.Oxoisophorone Olive oil 8 Orange oil [8001‑25‑0] [8008‑57‑9]  extra virgin. see Neroli extract Page 103 Orange flower absolute Page 103 [600‑18‑0] CH3CH2COCOOH C4H6O3 FW 102. Mexican > from Thymus capitatus L. rich 100 g > 2-Oxohexamethyleneimine. Certified organic (NOP/EU) 8 FEMA 2824 Opoponax oil from Commiphora erythrea Kosher Organoleptic: balsam France origin 1 kg Orange terpenes W522600-SAMPLE-K W522600-100G-K 100 g W522600-1KG-K 1 kg Orange flower absolute 8 Neroli extract. sweet Halal. oily. sweet.5 Or 6-Isopropyl-2-methoxypyrazine. Iris germanica Halal. violet.19  ≥98%. 771 Origanum oil [8007‑11‑2] 2-Oxobutyric acid 4-Oxoisophorone 1 kg W522708-8KG-K from Citrus aurantium Kosher Organoleptic: sweet. berry. woody.6. 206 W282529-SAMPLE-K W282529-1KG-K 1 kg  FG W282529-8KG-K 8 kg Kosher W282529-20KG-K 20 kg 1 kg  sweet. Orange flower bitter. α-Ketobutyric acid.) Osbeck Kosher France origin 8 kg W522708-20KG-K 20 kg W281800-SAMPLE-K FEMA 2828 5g W281800-25G-K 25 g > Orange flower bitter. Brazil origin W281719-SAMPLE-K W281719-100G-K 100 g W281719-1KG-K 1 kg FEMA 2817 from synthetic Halal. NI Spain origin W342106-SAMPLE-K W342106-100G-K 100 g W342106-1KG-K 1 kg W342106-5KG-K 5 kg W282812-SAMPLE-K W282812-100G-K 100 g W282812-1KG-K 1 kg W282812-5KG-K 5 kg > 3.) Osbeck Kosher W282537-1KG-K L-Ornithine Orris concrete FEMA 2825 W282537-SAMPLE-K Onion oil. see L-Ornithine hydrochloride W282928-SAMPLE-K  Florida origin W281794-SAMPLE-K Page 103 [8002‑73‑1] FEMA 2829 from Citrus sinensis (L. 631 Organoleptic: caramel.5-Diaminopentanoic acid monohydrochloride FEMA 2825 W530191-SAMPLE-K W530191-5KG-K L-Ornithine W282510-1KG-K 1 kg W419001-100G FEMA 2817 W282510-5KG-K 5 kg W419001-SAMPLE from Allium cepa L. peach.09 Fen. creamy Kosher.5-Diaminopentanoic acid hydrochloride. warm. 2-Ketobutyric acid Fen. grape. Kosher The Netherlands origin W282510-8KG-K 8 kg W282510-20KG-K 20 kg  cold-pressed. Hoffmanns & Link (primary material) Halal.62 from Citrus sinensis (L. see 2-Methoxy-3(5 or 6)-isopropylpyrazine Page 79 Feel inspired at safcglobal. Kosher Mexico origin 1 kg W282537-8KG-K 8 kg W282537-20KG-K 20 kg W281794-100G-K 100 g W281794-1KG-K 1 kg Onion oleoresin 8 FEMA 2825 from Citrus sinensis (L. NI W372307-SAMPLE-K W372307-100G-K 100 g W372307-250G-K 250 g W372307-1KG-K 1 kg 2. vanilla. California origin 5 kg [3184‑13‑2] NH2(CH2)3CH(CO2H)(NH2) · HCl C5H12N2O2 · HCl FW 168. see ε-Caprolactam Page 25 W522708-SAMPLE-K W522708-1KG-K 25 g W282928-100G-K FEMA 3723 Flavis 8. (S)-2.4-dione. Dutch hydrochloride (S)-(+)-2. Kosher Fen. Kosher Organoleptic: apricot. Kosher.com 103 . Certified organic (NOP/EU) Organoleptic: orange.) Osbeck Kosher Fen. 206  99% FEMA 4190 W419001-1KG W282510-SAMPLE-K Onion oil.109 CoE Nr 11200 Organoleptic: musty. sweet from (Olea europaea) Kosher Tunisia origin  cold-pressed.6-Trimethyl-2-cyclohexene-1. see ω-Pentadecalactone Page 104 [8002‑72‑0] W281799-1KG-K monohydrochloride. woody France origin > 1-Oxa-2-cyclohexadecanone.066 W282401-SAMPLE-K W282401-1KG-K W282928-25G-K  ≥97% Kosher Costa Rica origin [8021‑36‑1] from Iris florentina. raspberry. honey. FG FEMA 3421 Flavis 7.

NI W284009-SAMPLE-K 104 100 g W372404-1KG-K 1-Pentanethiol W283823-SAMPLE-K > Palmitic acid ethyl ester. see 1-Hexadecanol Page 59 Palm oil. green Kosher > PEA. Amyl mercaptan FEMA 4333 Flavis 12. see Methyl jasmonate Page 88 2-Oxo-3-phenylpropanoic acid. 2447  FCC. Pentalide [106‑02‑5] C15H28O2 FW 240. FG FEMA 2832 Flavis 8. Fen.191 W433300-SAMPLE [8014‑09‑3] FEMA 2838 W433300-1KG from Pogostemon cablin (Blanco) Benth Kosher Indonesia origin > Pentanoic acid. Pentyl mercaptan. methyl ester.137 CoE Nr 11808 > Pentalide. see Levulinic acid Page 75 PAA. see Phenylacetic acid Page 108 Palmarosa oil 8 Palmarosa oil from Cymbopogon martini. see Palm fruit oil Page 104 W372404-100G-K 100 g W283800-SAMPLE-K W283207-SAMPLE-K Kosher W283606-100G-K Patchouli oil Hexadecanoic acid FEMA 3724 Flavis 7. 15Pentadecanolide. 639  ≥98% FEMA 3316 Flavis 2. see Phenethyl alcohol Page 106 β-PEA. see Valeraldehyde Page 128 W283606-SAMPLE-K W530216-SAMPLE  ≥98% W372404-SAMPLE-K Parsley oil from Petroselinum sativum Hoff Kosher France origin  Certified organic (NOP/EU) > Pentadecanolide. Kosher. east-Indian Pararot [6410‑10‑2] O2NC6H4N=NC10H6OH C16H11N3O3 FW 293. for food analysis refined 70905 > Para Red. Pentadecanolide. see Ethyl palmitate Page 49 Palmitic acid methyl ester. see Nonanoic acid Page 98 Pelargonyl acetate. for food analysis 40446-100MG  FG. W331600-1KG-K 1 kg W331600-4KG-K 4 kg W331600-8KG-K 8 kg > (±)-2-Pentanol.42 Arc. see ω-Pentadecalactone Page 104 ω-Pentadecalactone Page 104 Pentanal.40 Fen. NI Fen. 1-Oxa-2-cyclohexadecanone.004 CoE Nr 181 Organoleptic: berry Halal.40 [8014‑19‑5] W283109-1KG-K 8 1-(4-Nitrophenylazo)-2-naphthol. 1-(p-Nitrophenylazo)-2-naphthol. Methyl propyl carbinol. herbaceous from (Cymbopogon martinii) Kosher Kenya origin FEMA 4334 100 mg Parsley leaf extract  Certified organic (NOP/EU) 8 W433400-SAMPLE ≥97. see Palmarosa oil Page 104 Palm fruit oil 8 Palm oil [2345‑28‑0] CH3CO(CH2)12CH3 C15H30O FW 226. sec-Pentyl alcohol [6032‑29‑7] CH3CH2CH2CH(OH)CH3 C5H12O FW 88. see Amyl alcohol Page 13 1 kg W283800-5KG-K 5 kg W283800-10KG-K 10 kg  Certified organic (NOP/EU) W283823-1KG-K 1 kg 2-Pentanol W283800-1KG-K 8 1 kg (±)-2-Pentanol.014 CoE Nr 14 Halal. Kosher. Fen.28  ≥99%  analytical standard. see Levulinic acid Page 75 3-Oxo-2-(2-pentenyl)cyclopentaneacetic acid. see Methyl palmitate Page 90 Palmityl alcohol. 127. natural 8 1 kg > Palmarosa oil from Cymbopogon martini.38 Arc. see 2-Pentanol Page 104 . see Pyruvic acid Page 116 4-Oxovaleric acid. Para Red W284009-100G-K 100 g W284009-1KG-K 1 kg W284009-5KG-K 5 kg Place an order with your local SAFC representative (see back for contacts). see ω-Pentadecalactone Page 104 15-Pentadecanolide.088 CoE Nr 4201 Organoleptic: oily. see Valeric acid Page 128 1-Pentanol. 636  ≥98% FEMA 2840 Flavis 10. see Phenylpyruvic acid Page 111 2-Oxopropionic acid. see ω-Pentadecalactone Page 104 Methyl tridecyl ketone FEMA 2836 [8002‑75‑3] 1 kg 2-Pentadecanone W530432-SAMPLE-K W283109-SAMPLE-K W530216-5KG W433400-1KG from Petroselinum crispum Kosher Organoleptic: green.SAFC® Flavors & Fragrances Oxopentanoicaci > 4-Oxopentanoic acid.21 W283606-5KG-K 5 kg  98% Mercaptan C5. 636 W530432-25G-K 25 g W530432-100G-K 100 g from (Elaeis guineensis) Colombia origin [8000‑68‑8]  FCC 5 kg Palmitic acid [57‑10‑3] CH3(CH2)14COOH C16H32O2 FW 256. see Pararot Page 104 1 kg W372404-5KG-K 5 kg 8 W283606-1KG-K 1 kg [110‑66‑7] CH3(CH2)4SH C5H12S FW 104. see Phenylpyruvic acid Page 111 2-Oxo-3-phenylpropionic acid. 635 W283207-1KG-K 1 kg W283207-10KG-K 10 kg W283207-25KG-K 25 kg Palm oil [8002‑75‑3]  analytical standard. 811. see Nonyl acetate Page 99 W331600-SAMPLE-K ω-Pentadecalactone 15-Hydroxypentadecanoic acid lactone. Geranium oil. see Nonanal Page 98 Pelargonic acid. see Phenethyl alcohol Page 106 Pelargonaldehyde.0% (HPLC) [8000‑68‑8] FEMA 2831 Pentadecanoic acid [1002‑84‑2] CH3(CH2)13COOH C15H30O2 FW 242.15 Arc.

. 640  ≥96%  ≥95%. musty... NI W430500-SAMPLE-K W430500-100G-K 100 g W321818-SAMPLE-K W430500-1KG-K 1 kg 25 g W321818-100G-K 100 g W321818-1KG-K 1 kg trans-2-Pentenoic acid [13991‑37‑2] C2H5CH=CHCO2H C5H8O2 FW 100...... see Methyl 4-pentenoate Page 91 1-Penten-3-ol > Pentyl acetate. 640  ≥98%. see 2-Pentanol Page 104 Pentylamine. FG [96‑22‑0] CH3CH2COCH2CH3 C5H10O FW 86.. 641  ≥97%.. Kosher contains 0... strawberry. Fen. FG Flavis 13.13 Fen. FG FEMA 4305 Kosher Organoleptic: apple. see Ethyl vinyl ketone Page 51 FEMA 3383 Flavis 14... cheddar cheese.... green Methyl propenyl ketone W338303-SAMPLE [625‑33‑2] CH3CH=CHCOCH3 C5H8O FW 84.044 CoE Nr 666 > (±)-6-Pentyltetrahydro-2H-pyran-2-one.... fishy NI 4-methyl-2-pentanone .. apple... cheese..107 cis isomer . green Halal. sweet Kosher W389323-SAMPLE-K 2-Pentylfuran Ethyl vinyl carbinol [3777‑69‑3] FEMA 3317 C9H14O FW 138. FG 2-Pentylpyridine 2-Amyl pyridine [2294‑76‑0] C10H15N FW 149.. rum.. Kosher... 639  98% Arc... Kosher. ≥97%.. vegetable. cocoa... blue cheese.0% W284203-SAMPLE W284203-100G 100 g W284203-1KG 1 kg W284203-4KG 4 kg W284203-8KG 8 kg W284203-20KG 20 kg FEMA 2843 Flavis 8. 642 W338303-100G 100 g  ≥70% W338303-1KG 1 kg FEMA 3417 Flavis 7.... FG FEMA 2842 Flavis 7..12 W338303-25G 25 g Fen. vegetable Halal.. FCC W401101  ≥98%.12 [1576‑95‑0] C2H5CH=CHCH2OH C5H10O FW 86.. vegetable Halal.084 CoE Nr 2350 NI Organoleptic: butter.658 Organoleptic: fatty.. Organoleptic: alcohol.. cofee. synthetic as antioxidant W284300-SAMPLE-K W284300-25G-K 25 g W284300-100G-K 100 g W284300-1KG-K 1 kg > 4-Pentenoic acid methyl ester.. Allylacetic acid [1576‑85‑8] C7H12O2 FW 128.....17 [107‑87‑9] CH3COCH2CH2CH3 C5H10O FW 86.917 Arc. orange..24  >98% FEMA 3893 Flavis 9. chocolate. see Amyl acetate Page 13 Pentyl alcohol..Pentylvinylcarb 2-Pentanone 4-Pentenoic acid 4-Penten-1-yl acetate Methyl propyl ketone 3-Vinylpropionic acid.. ≤10% W419301 Feel inspired at safcglobal. fruity. potato..... see Amylamine Page 13 2-Pentyl butyrate [60415‑61‑4] C3H7CO2CH(CH3)C3H7 C9H18O2 FW 158..13  ≥98%. NI W331708-SAMPLE-K W331708-25G-K 25 g W510106-1KG 1 kg W358401-100G-K 100 g W331708-100G-K 100 g W510106-4KG 4 kg W358401-200G-K 200 g W331708-1KG-K 1 kg W510106-8KG 8 kg W358401-1KG-K 1 kg W358401-4KG-K 4 kg trans-2-Pentenal cis-2-Penten-1-ol 2-Ethylacrylic aldehyde 8 [1576‑87‑0] C2H5CH=CHCHO C5H8O FW 84. cheese...... NI W341703-SAMPLE-K W341703-25G-K 25 g W341703-100G-K 100 g W341703-1KG-K 1 kg 105 .. 644  ≥97% > 1-Penten-3-one. fish....... Fen... 2452.12  98% FEMA 4193 Flavis 8.059 CoE Nr 10966  ≥99% FEMA 3584 Flavis 2. see Amyl alcohol Page 13 sec-Pentyl alcohol. 2454.099 CoE Nr 4025 Flavis 7.. strawberry.... butter..... 643 Diethyl ketone Arc.. sweet.. NI W510106-SAMPLE W358401-SAMPLE-K Organoleptic: green...10% alpha-tocopherol.21 [616‑25‑1] CH3CH2CH(OH)CH=CH2 C5H10O FW 86.. wine-like.12 Flavis 9. see Amyl hexanoate Page 13 Pentyl mercaptan.06 CoE Nr 11412 3-Penten-2-one Organoleptic: melon. banana. Fen......... vegetable W331715 > n-Pentyl hexanoate. see 1-Octen-3-ol Page 101 Organoleptic: fruity Kosher.13 [591‑80‑0] CH2=CHCH2CH2COOH C5H8O2 FW 100.. Kosher. pineapple. ethereal. whiskey. 2226.. Virginia tobacco.com Color: may darken over time Organoleptic: metallic.13 3-Pentanone 8 Fen. horseradish. see 1-Pentanethiol Page 104 FEMA 3218 CoE Nr 10375 W321818-25G-K  natural (US)... see δ-Decalactone Page 33 (±)-δ-Pentyl-δ-valerolactone. green. green bean. banana. see δ-Decalactone Page 33 Pentyl vinyl carbinol.......23 Fen..054 CoE Nr 754 Natural occurrence: Apple..048 CoE Nr 2004 Organoleptic: butter. <2. fruity Halal.

06 CoE Nr 2024  ≥98%. fruity. β-PEA W211710-SAMPLE-K Organoleptic: camphoraceous. Fen. vegetable. honey. rose. FCC W284815-1KG-K 1 kg Kosher Organoleptic: cinnamon. pineapple. camphoraceous Halal. woody W284815-4KG-K 4 kg W211613-SAMPLE-K W284815-9KG-K 9 kg W211613-1KG-K 1 kg W211613-10KG-K 10 kg W285714-25G-K 25 g W211613-25KG-K 25 kg W285714-100G-K 100 g W285714-1KG-K 1 kg W284815-SAMPLE-K  purified by triple-distillation. minty Kosher USA origin W211710-5KG-K 5 kg W211710-10KG-K 10 kg W284831-SAMPLE-K 1 kg W284831-4KG-K 4 kg Bitter orange oil W284831-9KG-K 9 kg [8014‑17‑3]  Certified organic (NOP/EU) 8 from Mentha piperita L.031 CoE Nr 221 CH3COOCH2CH2C6H5 C10H12O2 FW 164. 936. Organoleptic: camphoraceous. pineapple. olives and lettuce. FCC FEMA 2859 Flavis 9. citrus > 2-Phenethyl acetate. Organoleptic: grape.SAFC® Flavors & Fragrances Peppermintoil Peppermint oil (S)-(−)-Perillyl alcohol [8006‑90‑4] FEMA 2848 p-Mentha-1. FCC Arc. Kosher. grape.22 FEMA 3557 CoE Nr 4154 W285803-1KG-K 1 kg W285803-10KG-K 10 kg W285803-25KG-K 25 kg W523607-4KG-K 4 kg Halal. grape. pineapple. Arctic bramble. Kosher 1 kg > (−)-Perillaaldehyde. Kosher. Organoleptic: minty. NI Organoleptic: honey. 2514. Paraguay W284831-1KG-K W285714-SAMPLE-K Phenethyl alcohol  terpeneless. floral. ≥99%. see Parsley oil Page 104  ≥92% Arc. NI Arc. Benzyl carbinol.723 CoE Nr 258 Organoleptic: chocolate. Fen. apricot. FG 1 kg > Petroselinum Sativum. melon. sweet. wine-like W284807-9KG-K 9 kg W266418-5KG-K 5 kg W285706-SAMPLE-K W284807-SAMPLE-K W266418-SAMPLE-K  FCC W285706-1KG-K Peru balsam from Mentha piperita L.006 CoE Nr 2117 W355704-SAMPLE-K Halal. wine-like. 2512. oily. citrus. see (S)-(−)-Perillaldehyde Page 106 Kosher from Citrus aurantium (S)-4-Isopropenyl-cyclohexene-1-carboxaldehyde. rose  natural. melon. ≥99%. vanilla. honey. minty Halal. caramel. 646 [99‑83‑2] C10H16 FW 136. floral. NI El Salvador origin 2-Phenylethanol. FG Halal. Fen. PEA. Kosher USA origin [8007‑00‑9] FEMA 2116 CoE Nr 298n 1 kg W285706-5KG-K 5 kg W285706-10KG-K 10 kg  natural.8-diene-7-ol 2-Phenethyl acetate. Arctic bramble. sweet Kosher W285609-1KG-K 1 kg W285609-4KG-K 4 kg W285609-8KG-K 8 kg W285609-20KG-K 20 kg Place an order with your local SAFC representative (see back for contacts). pineapple. FCC Organoleptic: green. NI Arc. brandy. herbaceous Halal. 2-Phenylethyl acetate Fen. 645 W523607-1KG-K Paraguay origin (S)-(−)-Perillaldehyde [60‑12‑8] FEMA 2858 Flavis 2. FCC W211710-1KG-K Natural Occurrence: Melon. rose.019 CoE Nr 68 C6H5CH2CH2OH C8H10O FW 122. iris. Kosher Organoleptic: honey. olives and lettuce. 442 [103‑45‑7] FEMA 2857 Flavis 9.29 Arc. NI W284807-1KG-K 1 kg W266418-100G-K 100 g W284807-4KG-K 4 kg W266418-1KG-K 1 kg Natural occurrence: Melon. rose. fruity. green Kosher.20 from Mentha piperita L. sweet. Organoleptic: apple. Kosher. 645 FEMA 2664 Flavis 2. FCC. NI  ≥99%. fruity. FCC Organoleptic: minty. see Phenethyl acetate Page 106 FEMA 2117 CoE Nr 298n W284823-SAMPLE-K 106 Phenethyl acetate  ≥98%. Fen. 644 W355704-5KG-K 5 kg W285609-SAMPLE-K W285811-25G-K 25 g W285811-100G-K 100 g W285811-1KG-K 1 kg Phenethyl anthranilate Benzyl carbinyl anthranilate [133‑18‑6] 2-(H2N)C6H4CO2CH2CH2C6H5 C15H15NO2 FW 241.16 W285803-SAMPLE-K W523607-SAMPLE-K W284843-SAMPLE-K W284843-1KG-K 1 kg Petitgrain oil. grape. fatty Halal. (S)-p-Mentha-1. camphoraceous Kosher USA origin Peru balsam oil W284823-1KG-K 1 kg W284823-4KG-K 4 kg W284823-9KG-K 9 kg from Myroxylon pereirae Klotzsch purified by distillation Kosher. sweet. brandy. honey. Kosher. fruity. rose W523607-9KG-K 9 kg W285811-SAMPLE-K  Certified organic (NOP/EU) 8 W530183-SAMPLE-K W530183-1KG-K 1 kg W355704-100G-K 100 g W355704-1KG-K 1 kg Organoleptic: minty.23 FEMA 2856 Flavis 1. W285900-SAMPLE-K W285900-100G-K 100 g W285900-1KG-K 1 kg W285900-5KG-K 5 kg . 2459. herbaceous. Fen. (−)-Perillaaldehyde [18031‑40‑8] C10H14O FW 150. 2513. 2-Phenylethyl alcohol. 222 [18457‑55‑1] C10H16O FW 152.23  purified by redistillation. FCC α-Phellandrene Organoleptic: cherry. Kosher USA origin  ≥90%.8-dien-7-al.

see Phenethyl hexanoate Page 107 Phenethyl caprylate. 2516. NI 1 kg W322105-SAMPLE-K W286109-5KG-K 5 kg W322105-100G-K 100 g W286109-10KG-K 10 kg W322105-1KG-K 1 kg W322202-100G W322105-10KG-K 10 kg W322202-1KG 1 kg W322202-10KG 10 kg > Phenethyl caproate. 651 FEMA 3221 Flavis 9. FCC FEMA 2863 Flavis 9.538 CoE Nr 10883 Kosher.36 FEMA 2861 Flavis 9. NI W286702-SAMPLE-K W286702-1KG-K W287105-SAMPLE-K W287105-1KG-K 1 kg W287105-10KG-K 10 kg W287105-25KG-K 25 kg 1 kg W286702-5KG-K 5 kg W286702-10KG-K 10 kg > Phenethyl mercaptan.17 Arc. Kosher. green. 2530 [24817‑51‑4] C2H5CH(CH3)CO2CH2CH2C6H5 C13H18O2 FW 206. NI FEMA 3222 Flavis 9. Kosher. 647 Phenethyl 2-methylbutyrate [7149‑32‑8] C13H12O3 FW 216. NI  ≥98%.427 CoE Nr 302 Arc. floral. FG FEMA 2867 Flavis 9. NI W286109-SAMPLE-K W286109-1KG-K Organoleptic: fruity. 2549. NI W286206-1KG-K W286303-SAMPLE-K W286303-1KG-K 1 kg W286303-5KG-K 5 kg W286303-10KG-K 10 kg Phenethyl formate 1 kg W286206-5KG-K 5 kg W286206-10KG-K 10 kg > Phenethyl isopentanoate. see Phenylethyl mercaptan Page 109 Feel inspired at safcglobal.Phenethylpropio Phenethyl benzoate Phenethyl 2-furoate [94‑47‑3] C6H5CO2CH2CH2C6H5 C15H14O2 FW 226. Benzyl carbinyl isovalerianate [140‑26‑1] (CH3)2CHCH2CO2CH2CH2C6H5 C13H18O2 FW 206. rose Halal.25 Benzyl carbinyl cinnamate [103‑53‑7] C6H5CH=CHCO2CH2CH2C6H5 C17H16O2 FW 252.466 CoE Nr 461 W286400-1KG-K 1 kg W286400-5KG-K 5 kg W286400-10KG-K 10 kg Organoleptic: apricot. Fen. fruity W363200-SAMPLE-K W286001-1KG-K 1 kg W286508-100G-K 100 g W286001-5KG-K 5 kg W286508-1KG-K 1 kg W363200-250G-K 250 g W286001-10KG-K 10 kg W286508-5KG-K 5 kg W363200-1KG-K 1 kg W363200-5KG-K 5 kg Phenethyl butyrate Phenethyl hexanoate [103‑52‑6] CH3CH2CH2CO2CH2CH2C6H5 C12H16O2 FW 192. see Phenethyl isovalerate Page 107 Phenethyl isothiocyanate. Fen. Fen.25 Phenethyl octanoate Phenethyl caproate Phenethyl caprylate Arc.261 CoE Nr 10882  ≥99% Organoleptic: banana. rose Kosher. rose Kosher. Fen. 652  ≥96% Organoleptic: fruity. 647 [6290‑37‑5] CH3(CH2)4CO2CH2CH2C6H5 C14H20O2 FW 220. green. fruity. Fen. floral.743 CoE Nr 336 FEMA 2866 Flavis 9. NI Organoleptic: floral. 2548. see Phenethyl octanoate Page 107 Phenethyl cinnamate Phenethyl isobutyrate [103‑48‑0] (CH3)2CHCO2CH2CH2C6H5 C12H16O2 FW 192. 2558. 2515. 652  ≥98%.006 CoE Nr 362 FEMA 2860 Flavis 9. Fen. 648  ≥96% Phenethyl isopentanoate.23 Arc. see 2-Phenylethyl isothiocyanate Page 109 [104‑62‑1] HCO2CH2CH2C6H5 C9H10O2 FW 150. sweet Kosher. rose. FCC Arc. 2519.083 CoE Nr 350 Organoleptic: floral.31  ≥98%. 2522.28  ≥98%  ≥99% Arc. Kosher. rose Kosher. green. 651 FEMA 2865 Flavis 13. FG Organoleptic: rose.27 Arc. 649 W286001-SAMPLE-K W286508-SAMPLE-K  ≥95%. sweet Halal. floral Halal.262 CoE Nr 10884 Organoleptic: grape. Fen. NI Arc. rose Halal.23 Benzyl carbinyl ethyl methyl acetate Arc. hyacinth.31 Arc. FCC. 2529. 649 [5457‑70‑5] CH3(CH2)6CO2CH2CH2 C16H24O2 FW 248.30  ≥98%. Fen. 2517. Fen. FCC Arc. NI Organoleptic: musty Kosher Fen. sweet Halal.168 CoE Nr 506  ≥97%. Fen. 648 FEMA 2862 Flavis 9.28 FEMA 2864 Flavis 9. 650 W322202-SAMPLE Phenethyl phenylacetate Benzyl carbinyl phenylacetate [102‑20‑5] C6H5CH2CO2CH2CH2C6H5 C16H16O2 FW 240. Fen. Kosher W286605-SAMPLE-K W286605-1KG-K 1 kg W286605-5KG-K 5 kg W286605-10KG-K 10 kg Phenethyl propionate Phenethyl isovalerate Benzyl carbinyl formate 100 g Phenylethanol propanoate [122‑70‑3] C2H5CO2CH2CH2C6H5 C11H14O2 FW 178. 2537.707 CoE Nr 234 W286206-SAMPLE-K Organoleptic: sweet Kosher. strawberry. FCC FEMA 3632 Flavis 9. 650 W286400-SAMPLE-K FEMA 2871 Flavis 9.774 CoE Nr 667 Organoleptic: honey.com 107 . herbaceous. FG Arc. 2518. NI Organoleptic: fruity.137 CoE Nr 418  ≥98%.

honey. grape. melon. melon. NI Arc. raisin. hyacinth. nutty. rose Kosher W514802-1KG-K 1 kg W514802-5KG-K 5 kg W514802-10KG-K 10 kg W286818-SAMPLE-K W286818-1KG-K 1 kg W286818-5KG-K 5 kg W286818-10KG-K 10 kg CoE Nr 672 Phenylacetaldehyde α-Tolyaldehyde [122‑78‑1] C6H5CH2CHO C8H8O FW 120. sweet pepper and celery leaves. vegetable.22 Organoleptic: honey. cherry. strawberry. FG Benzyl carbinyl tiglate [55719‑85‑2] CH3CH=C(CH3)CO2CH2CH2C6H5 C13H16O2 FW 204. peanut. Fen. 664  natural. Fen.19 FEMA 3585 Flavis 17. apricot. gruyere. green. vegetable.5%. Kosher. meaty. NI CoE Nr 672c FEMA 2874 Flavis 5. apricot. 2466. Organoleptic: cheese.SAFC® Flavors & Fragrances Phenethylsalicy Phenethyl salicylate Phenoxyethyl propionate Benzyl carbinyl salicylate [87‑22‑9] 2-(HO)C6H4CO2CH2CH2C6H5 C15H14O3 FW 242. rose. cabbage. grape. sweet. peach. green. wine-like W287814-SAMPLE W287814-25G 25 g W287814-100G 100 g W287814-1KG 1 kg > trans-3-Phenylacrylic acid. 655 Phenylacetaldehyde dimethyl acetal  ≥97%. cabbage. 2492. FCC.03 FEMA 3223 Flavis 4.15 Hydroxybenzene Organoleptic: honey. papaya. peach. 2555. 2470.5%. FCC FEMA 2868 Flavis 9.038 C6H5CH2CO2H C8H8O2 FW 136. NI W287601-SAMPLE-K W287601-1KG-K W287806-25KG Organoleptic: sweet NI Arc. FCC FEMA 2874 Flavis 5. 659  ≥97% Kosher  ≥99%. rose. sweet Halal. grape. blackberry. cherry. honey. strawberry. apricot. spicy Halal. berry. grapefruit. papaya. 2467 [103‑82‑2] FEMA 2878 Flavis 8.487 CoE Nr 2089 W287318-SAMPLE 1 kg W287318-5KG 5 kg W287318-10KG 10 kg 25 kg  natural. chocolate.017 CoE Nr 10488 [101‑48‑4] C6H5CH2CH(OCH3)2 C10H14O2 FW 166. 2551. raspberry. asparagus. fruity. floral. potato. grapefruit. NI Fen. see Sudan I Page 120 1-[4-(Phenylazo)phenylazo]-2-naphthol. 654 W322318-SAMPLE-K W322318-1KG-K 1 kg W322318-5KG-K 5 kg W322318-10KG-K 10 kg Natural Occurrence: Apple.018 CoE Nr 10488 Kosher NI W358509-SAMPLE-K W358509-1KG-K 1 kg W358509-5KG-K 5 kg W358509-10KG-K 10 kg DL-Phenylalanine (±)-2-Amino-3-phenylpropionic acid [150‑30‑1] C6H5CH2CH(NH2)COOH C9H11NO2 FW 165. chocolate. peach. green Kosher W287415-SAMPLE-K 2-Phenoxyethyl isobutyrate W287415-25G-K 25 g Ethylene glycol monophenylether isobutyrate W287415-100G-K 100 g [103‑60‑6] (CH3)2CHCO2CH2CH2OC6H5 C12H16O3 FW 208.03 CoE Nr 116 Phenylacetaldehyde solution Phenol 108 PAA. grapefruit.753 CoE Nr 437 W514802-SAMPLE-K Organoleptic: balsam. honey.11 Halal. herbaceous. carnation.2-Dimethoxyethyl)benzene FEMA 2873 Flavis 9. lemon. FCC FEMA 2876 Flavis 6.25 W287415-1KG-K 1 kg Arc. raisin. Fen.15 Phenethyl tiglate  ≥90%. floral. raspberry. Organoleptic: apple. musty. green. strawberry. FCC (2. green Kosher contains 0. Organoleptic: apple. Fen. guava.19 Fen.006 CoE Nr 40 Organoleptic: hyacinth. wines.15 Arc. floral. fruity.10% alpha-tocopherol. honey and tea. 657 W287407-SAMPLE-K W287407-1KG-K 1 kg W287407-5KG-K 5 kg W287407-10KG-K 10 kg Arc. papaya. % in ethanol  ≥99% W287806-SAMPLE (S)-2-Amino-3-phenylpropionic acid [122‑78‑1] C6H5CH2CHO C8H8O FW 120. 654  ≥94% FEMA 2870 Flavis 9. melon.23 Arc.27 Phenylacetic acid [23495‑12‑7] C2H5CO2CH2CH2OC6H5 C11H14O3 FW 194. blackberry. grape. cherry. FCC W372609-SAMPLE  ≥98%. sweet pepper and celery leaves.496 CoE Nr 2186 Organoleptic: herbaceous.041 CoE Nr 11811 W287806-1KG Fen. peanut. synthetic as antioxidant W287008-SAMPLE-K W287008-100G-K 100 g W287008-1KG-K 1 kg W287008-5KG-K 5 kg Natural occurrence: Apple. chocolate. asparagus. 2470. orange peel. passion fruit. mango. vanilla. wine-like Halal. herbaceous.26 Arc. Kosher. W372609-100G 100 g W372609-1KG 1 kg W372609-5KG 5 kg > 1-Phenylazo-2-naphthol. Swiss and cheddar cheeses. bilberry. orange. α-Tolylic acid. bilbery. Fen. berry. 653  ≥98% Arc. orange. 2485. 663  ≥98. orange peel. see trans-Cinnamic acid Page 27 L-Phenylalanine [63‑91‑2] C6H5CH2CH(NH2)CO2H C9H11NO2 FW 165. peach. 10 wt. tomato. Fen. Benzeneacetic acid 1 kg W287601-5KG-K 5 kg W287601-10KG-K 10 kg Place an order with your local SAFC representative (see back for contacts). raspberry. 658 W287318-1KG 10 kg FEMA 3726 Flavis 17. Kosher. cherry. see Sudan III Page 120 . rose 1 kg W287806-10KG  ≥98. ≥99% Natural Occurrence: Guava. hyacinth. 657 [108‑95‑2] C6H5OH C6H6O FW 94. grapefruit. guava. Fen.

193 Halal.Phenylpropanol 4-Phenyl-2-butanol Phenylethyl mercaptan α−Methyl-benzenepropanol [2344‑70‑9] C6H5CH2CH2CH(OH)CH3 C10H14O FW 150. see Phenethyl alcohol Page 106 Phenylethanol propanoate.194 FEMA 3226 Flavis 7. Phenethyl mercaptan Acetyl benzoyl [4410‑99‑5] C6H5CH2CH2SH C8H10S FW 138. floral. see 2-Phenylpropionaldehyde Page 110 109 .24 Arc.037 CoE Nr 86 W322407-25G W322601-SAMPLE-K > (±)-1-Phenylpropanol. sulfurous Kosher 100 g W322601-1KG-K 1 kg W322601-5KG-K 5 kg α-Ethylbenzyl alcohol. 2541. vegetable. pepper NI FEMA 2884 Flavis 2. FG FEMA 3959 W395900-SAMPLE W395900-1KG FEMA 4014 Flavis 12. 2-Phenylethyl mercaptan.079 CoE Nr 2275 W287901 W389404-SAMPLE 2-Phenyl-2-butenal. see Phenylethyl mercaptan Page 109 (±)-1-Phenylethanol. see Phenylethyl mercaptan Page 109 Phenyl mercaptan. (±)-1-Phenylpropanol [93‑54‑9] C2H5CH(C6H5)OH C9H12O FW 136.16  ≥96.24  ≥99%. see Styrene Page 120 Phenylethylene oxide. see Benzenethiol Page 16  ≥97% 1-Phenyl-3-methyl-3-pentanol FEMA 3224 Flavis 5.051 CoE Nr 674 W322504-5KG-K 5 kg Organoleptic: carnation.22 1-Phenyl-1. see 1-Phenyl-1-propanol Page 109  ≥98% W322407-SAMPLE Halal. see Styrene oxide Page 120 5-Phenyl-1-pentanol FEMA 3225 Flavis 12.19 Fen. 198  ≥98% Organoleptic: floral NI Arc.23 Fen. Fen.062 CoE Nr 670 Organoleptic: chocolate. sweet W288403-SAMPLE W288403-1KG 1 kg W288403-5KG 5 kg W288403-10KG 10 kg Benzenepentanol [10521‑91‑2] C6H5(CH2)5OH C11H16O FW 164. see Phenethyl acetate Page 106 2-Phenylethyl alcohol.5%  ≥99% FEMA 2879 Flavis 2. floral.043 CoE Nr 11757 W322601-100G-K 1-Phenyl-1-propanol FEMA 2883 Flavis 2. medicinal Kosher > 2-Phenylethanethiol. Kosher W401404-SAMPLE-K W401404-25G-K 25 g W401404-100G-K 100 g W401404-1KG-K 1 kg Feel inspired at safcglobal. FG FEMA 3894 Flavis 12. green. 2498 W322504-SAMPLE-K  ≥98% W322504-100G-K 100 g W322504-1KG-K 1 kg FEMA 3618 Flavis 2. see Phenethyl alcohol Page 106 Phenylethylene. mixture of cis and trans [4411‑89‑6] CH3CH=C(C6H5)CHO C10H10O FW 146. NI 25 g W322407-100G 100 g W322407-1KG 1 kg Phenyl disulfide Diphenyl disulfide [882‑33‑7] C6H5SSC6H5 C12H10S2 FW 218. 660 W389404-25G 25 g W389404-100G 100 g W389404-1KG 1 kg > 2-Phenylethyl mercaptan.2-propanedione 2-Phenylethanethiol. see Phenethyl propionate Page 107 Phenyl ether.34 Fen. medicinal. see Styrene oxide Page 120 W361801-SAMPLE-K W361801-25G-K 25 g W361801-100G-K 100 g W361801-1KG-K 1 kg 2-Phenylphenol 2-Hydroxybiphenyl [90‑43‑7] C6H5C6H4OH C12H10O FW 170.033 CoE Nr 82 Organoleptic: balsam.21 2-Phenylethyl isothiocyanate  ≥99% Phenethyl isothiocyanate [2257‑09‑2] C6H5CH2CH2NCS C9H9NS FW 163. 666 [579‑07‑7] C6H5COCOCH3 C9H8O2 FW 148.com 1 kg W395900-5KG 5 kg W395900-10KG 10 kg > 2-Phenylpropanal. see Diphenyl ether Page 40 2-Phenylethyl acetate. see α-Methylbenzyl alcohol Page 82 2-Phenylethanol.036  98%.19  ≥97% W288306-SAMPLE W288306-100G 100 g W288306-1KG 1 kg W288306-5KG 5 kg > Phenyloxirane. Kosher Organoleptic: butter. earthy Halal. 664 Organoleptic: earthy.

see Hydrocinnamaldehyde Page 65 [103‑58‑2] (CH3)2CHCO2(CH2)3C6H5 C13H18O2 FW 206. strawberry W289906-SAMPLE W289000-SAMPLE-K W289000-1KG-K 1 kg W289906-100G 100 g W289000-5KG-K 5 kg W289906-1KG 1 kg W289000-10KG-K 10 kg W289906-5KG 5 kg [93‑53‑8] CH3CH(C6H5)CHO C9H10O FW 134. Hydratropic aldehyde dimethyl acetal [65813‑53‑8] (CH3)2CHCO2CH2CH(C6H5)CH3 C13H18O2 FW 206. Kosher NI W289302-SAMPLE-K W288918-SAMPLE-K W288918-100G-K 100 g W289302-1KG-K 1 kg W288918-1KG-K 1 kg W289302-10KG-K 10 kg W288918-10KG-K 10 kg W289302-25KG-K 25 kg 3-Phenylpropyl isovalerate 3-Phenylpropyl acetate [122‑72‑5] CH3CO2(CH2)3C6H5 C11H14O2 FW 178. hyacinth. 670  ≥98% FEMA 2891 Flavis 9. 2588.28 Arc. Fen. Halal. 673  99%  ≥98% FEMA 2889 Flavis 8. FG FEMA 2886 Flavis 5. sweet NI W288500-SAMPLE [501‑52‑0] C6H5CH2CH2COOH C9H10O2 FW 150. 2605. 2589.SAFC® Flavors & Fragrances Phenylpropanol 2-Phenyl-1-propanol (±)-2-Phenyl-1-propanol. Fen. 1707.28 Arc. 668 > 3-Phenylpropyl alcohol. 1708. fruity. Kosher Hydratropyl butyrate W288608-SAMPLE-K W288608-1KG-K 1 kg W288608-5KG-K 5 kg W288608-10KG-K 10 kg > 3-Phenylpropionaldehyde.17 Arc. 1709. sweet Halal. β-Methylphenethyl alcohol 2-Phenylpropionaldehyde dimethyl acetal Hydratropyl isobutyrate [1123‑85‑9] CH3CH(C6H5)CH2OH C9H12O FW 136.485 CoE Nr 2087  ≥97%. FCC. floral. raspberry.19 1.28  ≥97% [90‑87‑9] CH3CH(C6H5)CH(OCH3)2 C11H16O2 FW 180. see 3-Phenyl-1-propanol Page 110  ≥95%. It is used in combination with Heliotropin or Piperonal as a preservative for cosmetic products. > Phenyl propyl ketone. sweet Kosher W289108 110 2-Phenylpropyl isobutyrate Place an order with your local SAFC representative (see back for contacts). 2600.25  ≥97% FEMA 2897 Flavis 9. Kosher Organoleptic: rose. see 3-Phenylpropyl isovalerate Page 110 3-Phenylpropyl propionate Hydrocinnamyl propionate [122‑74‑7] C6H5(CH2)3OCOCH2CH3 C12H16O2 FW 192. FCC FEMA 2885 Flavis 2.31 1 kg Arc.03 CoE Nr 2017 Organoleptic: floral.057 CoE Nr 285 Organoleptic: apricot. sweet FG (meets Japan Food Sanitation Law standards). 673 FEMA 2890 Flavis 9. walnut W289205-SAMPLE-K W288802-SAMPLE W289205-25G-K 25 g W288802-100G 100 g W289205-100G-K 100 g W288802-1KG 1 kg W289205-1KG-K 1 kg W288802-5KG 5 kg 3-Phenylpropyl isobutyrate 3-Phenylpropionic acid 3-Phenyl-1-propanol 3-Phenylpropyl alcohol. spicy. and lily of the valley because of the balsamic odor character.038 CoE Nr 126 2-Phenylpropyl butyrate Organoleptic: floral Halal.073 CoE Nr 2257 Arc. see Butyrophenone Page 24 3-Phenylpropyl-β-methylbutyrate. see Cinnamyl alcohol Page 28  ≥97% FEMA 2892 Flavis 9. 669 Organoleptic: hyacinth Arc. 670 5 kg  ≥98%. 2579.This alcohol a natural fragrance with antimicrobial properties against bacteria and molds. FCC W273201-SAMPLE [80866‑83‑7] CH3CH2CH2CO2CH2CH(C6H5)CH3 C13H18O2 FW 206. 1696. earthy.138 CoE Nr 419 Organoleptic: floral Kosher Arc. see Cinnamaldehyde Page 27 trans-3-Phenyl-2-propenal.18 Arc. Organoleptic: balsam. 672 FEMA 2732 Flavis 2.23 Hydrocinnamyl isovalerate.1-Dimethoxy-2-phenylpropane. Fen. Fen. Benzylacetic acid W288500-1KG > 3-Phenylprop-2-enal. 2-Phenylpropanal Arc.428 CoE Nr 303 Organoleptic: balsam.032 CoE Nr 32 FEMA 2893 Flavis 9. Fen. Fen.24 Arc. Fen. see 2-Phenyl-1-propanol Page 109 FEMA 2888 Flavis 6.031 CoE Nr 80 This alcohol or its ester derivatives are used as fragrance component in fresh flower compositions. Preservative in cosmetics . Fen. FCC W288500-10KG 10 kg Hydratropaldehyde. Fen. see trans-Cinnamaldehyde Page 27 3-Phenyl-2-propen-1-ol. hyacinth. 1700. 674 W289701-SAMPLE-K W289701-100G-K 100 g W289701-1KG-K 1 kg W289701-5KG-K 5 kg . Fen. 667  ≥98%. 669 W288500-5KG 2-Phenylpropionaldehyde Hydrocinnamyl isobutyrate Hydrocinnamic acid. Fen. sweet NI FEMA 2899 CoE Nr 462 Organoleptic: plum. fruity. 544 W273201-1KG 1 kg W273201-5KG 5 kg W273201-10KG 10 kg > (±)-2-Phenyl-1-propanol. 2592. fruity Kosher Organoleptic: spicy. Hydrocinnamyl alcohol [122‑97‑4] C6H5(CH2)3OH C9H12O FW 136.032 CoE Nr 222  ≥99% Kosher Organoleptic: floral.19 Arc. like lilac. 3-Phenylpropyl-βmethylbutyrate [5452‑07‑3] (CH3)2CHCH2CO2(CH2)3C6H5 C14H20O2 FW 220.

2613  98%  ≥97% W389201 Salol [118‑55‑8] 2-(HO)C6H4CO2C6H5 C13H10O3 FW 214. Pimento berry.23 W201800-100G-K 100 g W201800-500G-K 500 g Pimenta oil. see 2-.3-. see 4-Methylbiphenyl Page 111 4-Phenyltoluene 4-Methylbiphenyl [644‑08‑6] C6H5C6H4CH3 C13H12 FW 168. NI Arc.5S)-2(10)-Pinene. spicy Kosher Fen. floral NI FEMA 3892 Flavis 8.5R)-2-Pinene. see (−)-β-Pinene Page 111 Pine needle oil 8 [8021‑29‑2]  natural FEMA 2905 from Pinus spp. Fen. Kosher. FCC W419501-SAMPLE W375101-25G 25 g W419501-1KG 1 kg W375101-100G 100 g W419501-5KG 5 kg W375101-1KG 1 kg Phenylpyruvic acid W290203-1KG-K [7541‑49‑3] CH3[CH(CH3)(CH2)3]3C(CH3)=CHCH2OH C20H40O FW 296. Kosher Organoleptic: turpentine W290017-1KG-K 1 kg W290017-10KG-K 10 kg W290500-SAMPLE-K W290017-25KG-K 25 kg W290500-250G-K 250 g W290500-1KG-K 1 kg > (1S.1]heptane [18172‑67‑3] C10H16 FW 136. (1S. W290238-SAMPLE-K from Pimenta officinalis Lindl. see 2-Methylpiperidine Page 92 2-Pipecoline. (1S. see (1R)-(+)-α-Pinene Page 111 Organoleptic: balsam.1.5S)-2-Pinene.1. Fen. see Pimenta berry oil Page 111 Pimenta berry oil Page 111 Pimenta leaf oil Page 111 Pinanyl mercaptan. Allspice FEMA 3186 Flavis 1. 2619. Kosher Organoleptic: spicy (1R)-(+)-α-Pinene W201800-SAMPLE-K > 4-Phenyltoluene. see (1R)-(+)-α-Pinene Page 111 (1S. mixture of isomers Page 78 (1R)-2-Pinen-10-al. Fen.011 CoE Nr 2292 [8006‑77‑7] FEMA 2901 Organoleptic: chocolate.22 W502200-100G 100 g W502200-1KG 1 kg W502200-4KG 4 kg Pimenta berry oil Arc. % in H2O FEMA 2900 Kosher Arc.6. 676  ≥97%. Pimento berry.15-Tetramethyl-2-hexadecen-1-ol 2-Oxo-3-phenylpropanoic acid.53 [156‑06‑9] C6H5CH2COCOOH C9H8O3 FW 164.23 FEMA 2902 CoE Nr 2113 W290106-SAMPLE-K Phosphoric acid solution (+)-α-Pinene.056 W375101-SAMPLE (−)-α-Pinene (1S)-(−)-α-Pinene. 2619. see 2-Methylpiperidine Page 92 Feel inspired at safcglobal. Kosher. (1S. herbaceous.5S)-2-Pinen-4-one. 2612 W290017-SAMPLE-K [7785‑70‑8] C10H16 FW 136.072 FEMA 4195 Flavis 10.689 [8006‑77‑7] W290300-SAMPLE-K W396001-SAMPLE  natural W290300-1KG-K FEMA 2018 W290300-8KG-K 8 kg W290300-20KG-K 20 kg W396001-1KG 1 kg W396001-5KG 5 kg W396001-10KG 10 kg from Pimenta officinalis Lindl.6-Dimethyl-2-methylenebicyclo[3. Kosher Jamaica origin W290238-1KG-K W318604-25G-K 25 g W290106-100G-K 100 g W318604-100G-K 100 g W290106-1KG-K 1 kg W318604-1KG-K 1 kg W290106-5KG-K 5 kg > Pimenta oil.11. 674 [87‑41‑2] C8H6O2 FW 134. (1R.5S)-2. 676  ≥98%.5R)-2-Pinene  ≥97% Pimenta leaf oil  ≥98% 1 kg 1 kg W290238-8KG-K 8 kg W290238-20KG-K 20 kg > (1S)-(−)-α-Pinene.10-Mercaptopinane.5R)-2.6.5S)-2(10)-Pinene.28 1-Isobenzofuranone Fen. NI Organoleptic: woody FEMA 3960 Flavis 9.1] hept-2-ene.1.com 111 . Kosher. see (1R)-(−)-Myrtenal Page 96  85 wt. NI W290203-SAMPLE-K Phytol 3. FCC FEMA 2903 CoE Nr 2114  ≥99% Pimenta oil. 2620. (1S.5S)-2-Pinene [7785‑26‑4] C10H16 FW 136. (1R.6-Trimethylbicyclo[3.7. see (−)-α-Pinene Page 111 (1S. minty.23 Arc.109 Organoleptic: woody Halal.13  ≥97%  98% FEMA 3751 Flavis 14. see (−)-β-Pinene Page 111 (1R. see Pimenta berry oil Page 111 Pimenta leaf oil Page 111 Pimento berry. 498 W318604-SAMPLE-K Halal.23 Arc. fennel.6-Trimethylbicyclo [3.5S)6. 2607 8 kg W290203-20KG-K 20 kg (−)-β-Pinene W502200-SAMPLE Phenyl salicylate 1 kg W290203-8KG-K > (+)-α-Pinene. Allspice Halal.1]hept-2-ene.Pipecoline 2-(3-Phenylpropyl)pyridine Phthalide [2110‑18‑1] C14H15N FW 197.16 Arc. 2-Oxo-3-phenylpropionic acid FEMA 2902 CoE Nr 2112 8 (1S)-(−)-β-Pinene. see (−)-α-Pinene Page 111 (1S)-(−)-β-Pinene. see (1S)-(−)-Verbenone Page 129 α-Pipecoline.

3. 2641 Polysorbate 60 TWEEN® 60. 680 [9005‑65‑6]  99%  ≥99% Fen. 1490. see Polysorbate 80 Page 112 Polyoxyethylene sorbitan monostearate. 682 FEMA 2911 Flavis 5. see Black pepper oil Page 20 Piperonal 1.14 Arc. 2626. Fen. Isopent-2-enyl acetate [1191‑16‑8] CH3CO2CH2CH=C(CH3)2 C7H12O2 FW 128. Kosher. green Kosher. violet flowers.003 CoE Nr 492 Halal. see Polysorbate 60 Page 112 Polyoxyethylenesorbitan monooleate. NI W331902-SAMPLE-K W331902-100G-K 100 g W331902-1KG-K 1 kg W331902-5KG-K 5 kg > Propanal. FG FEMA 2909 Flavis 14. see 3-Methyl-2-butenal Page 83 Prenol. animal Halal. berry.24 Arc. creamy. wine-like Halal. 2636 W292001-SAMPLE W292001-1KG 1 kg W292001-5KG 5 kg W292001-10KG 10 kg Prenyl acetate W291501-SAMPLE W291501-1KG 1 kg W291501-10KG 10 kg W291501-25KG 25 kg 3-methyl-2-buten-1-yl acetate. 681 W290807-SAMPLE-K  ≥98% W290807-1KG-K 1 kg FEMA 2913 Flavis 9. Kosher Organoleptic: pepper.141 FEMA 2912 Flavis 9. see Propylene glycol Page 114 112 Place an order with your local SAFC representative (see back for contacts). woody. Fen. Fen. animal NI Polysorbate 20 W290904-SAMPLE-K W290904-25G-K 25 g W290904-100G-K 100 g W290904-1KG-K 1 kg > Piper Nigrum. 1.5%. see Piperine Page 112 Polyethylene glycol sorbitan monostearate. see Propionaldehyde Page 113 1. Kosher. NI W420201-SAMPLE-K FEMA 2916 W420201-1KG-K W291609-SAMPLE 1 kg 1 kg W420201-5KG-K 5 kg W291609-10KG 10 kg W420201-10KG-K 10 kg W291609-25KG 25 kg W291609-1KG W291102-SAMPLE-K L-Proline (S)-Pyrrolidine-2-carboxylic acid W291102-1KG-K 1 kg W291102-10KG-K 10 kg Fen. FCC W291102-50KG-K 50 kg FEMA 3318 Flavis 17.01 CoE Nr 675 Organoleptic: floral. Kosher W291706-SAMPLE-K W291218-SAMPLE Piperidine W291218-100G 100 g W291706-1KG-K 1 kg Hexahydropyridine W291218-1KG 1 kg W291706-10KG-K 10 kg [110‑89‑4] C5H11N FW 85.SAFC® Flavors & Fragrances Piperazine Piperazine Piperonyl acetate Polysorbate 80 Diethylenediamine. sweet. for food analysis ≥96. Fen. NI Arc.42  analytical standard. Heliotropin. Fen. 2627.3-Benzodioxole-5-carboxaldehyde. NI Potassium acetate  98% FEMA 2920 Arc. Xylidine ponceau 2R  ≥98% FEMA 4202 Flavis 9.3-dimethyl allyl acetate. FCC. sweet.2-Propanediol. Organoleptic: almond. Polyethylene glycol sorbitan monostearate Fen. 678 Isobutyric acid 3.0% (HPLC) 22308-25MG W291307-SAMPLE-K W291307-25G-K 25 g W291307-100G-K 100 g W291307-1KG-K 1 kg > 1-Piperoylpiperidine.34 [3761‑53‑3] CI 16150 C18H14N2Na2O7S2 FW 480. Polyoxyethylene sorbitan monostearate. violet. floral. dill and sherry. strawberry Halal. see 3-Methyl-2-buten-1-ol Page 83 [9005‑64‑5] FEMA 2915 [9005‑67‑8]  ≥99%.13 Arc. jam Kosher W290807-20KG-K 20 kg Piperine 1-Piperoylpiperidine [94‑62‑2] C17H19NO3 FW 285. 3-methyl-2buten-1-ol acetate. lavender. cherry. burley tobacco.4-(Methylenedioxy)benzaldehyde [120‑57‑0] C8H6O3 FW 150.18 Polyoxyethylenesorbitan monooleate. 680 Natural occurrence: Tahitian vanilla. TWEEN® 80 [110‑85‑0] C4H10N2 FW 86. 3-methyl-2-butenyl acetate. 1487.016 CoE Nr 104 25 mg > Prenal. 3.430 CoE Nr 305 W290807-4KG-K 4 kg W290807-9KG-K 9 kg Organoleptic: berry. camphor wood.019 CoE Nr 10378 [147‑85‑3] C5H9NO2 FW 115.22 CoE Nr 2068 FEMA 2917 W425001 Organoleptic: cherry. 1484.13 Kosher. see Ponceau Xylidine Page 112 Piperonyl isobutyrate FEMA 2908 Flavis 14. Xylidine ponceau.17 Arc. 678  ≥97%. . FCC > Ponceau 2 R. 682 FEMA 4250 Flavis 14. vanilla.4-methylenedioxybenzyl ester [5461‑08‑5] C12H14O4 FW 222.15 W291218-5KG 5 kg W291706-25KG-K 25 kg  ≥99%. herbaceous. 684 W291102-25KG-K 25 kg  ≥98. anise. FG Ponceau Xylidine Acid Red 26. raspberry.692 Organoleptic: apple.4-Diazacyclohexane [326‑61‑4] C10H10O4 FW 194. balsam. see Polysorbate 60 Page 112 Arc. Ponceau 2 R.

2654. Fen. see Tricarballylic acid Page 125 1.04 CoE Nr 599 Organoleptic: cherry NI W292206-100G-K 100 g W358800-25G-K 25 g W292206-1KG-K 1 kg W346918-1KG W358800-100G-K 100 g W292206-5KG-K 5 kg W346918-5KG 5 kg W358800-1KG-K 1 kg W346918-10KG 10 kg W358800-SAMPLE-K > 1-Propanethiol.13  ≥97% [75‑33‑2] (CH3)2CHSH C3H8S FW 76. 688 Isopropyl mercaptan [109‑60‑4] FEMA 2925 Flavis 9. 2652. ≥98%  natural. grape brandy. peanut. fruity.3-Propanetricarboxylic acid. 2646.076 CoE Nr 11929 Organoleptic: meaty Kosher W292206-SAMPLE-K Fen. 2660. Kosher. cheese. vegetable Kosher.002 CH3COOCH2CH2CH3 C5H10O2 FW 102. 691  ≥99%. see 1-Propanol Page 113 sec-Propyl alcohol. 685  ≥96% FEMA 3588 Flavis 12.Propylbutanoate 1. see 2-Oxobutyric acid Page 103 [104‑45‑0] CH3CH2CH2C6H4OCH3 C10H14O FW 150.7% W292451 > 2-Propanol. Kosher. honey. alliaceous (onion. musty. chocolate. medicinal. Trimethylene dimercaptan  ≥99%. 691  ≥99. 689 FEMA 3469 Flavis 7. banana. pear. sweet. FG CoE Nr 192c Propionic acid Halal. see (+/-)-Tetrahydrofurfuryl propionate Page 122 Propionylformic acid. 99%.22 Arc. FCC.5% FEMA 4237 Flavis 11.5%.3-Dimercaptopropane. FG  ≥99% CoE Nr 3 > Propyl alcohol. 687  ≥99% Fen. Kosher Propanoic acid. tea. see Sodium propionate Page 119 N-Propionic acid tetrahydrofurfuryl ester.197 Organoleptic: meaty.002 CoE Nr 90  ≥98% FEMA 3897 Flavis 12.23 FEMA 2922 Flavis 4.10 1 kg > Propofol.003 CH3CH2COOH C3H6O2 FW 74. beer. 924. sake. and tea. see Propionic acid Page 113 1-Propanol Propyl alcohol [71‑23‑8] FEMA 2928 Flavis 2. Organoleptic: almond.3-Propanedithiol Propenyl guaethol Propiophenone 1. creamy. Fen.3-Propanetriol. see Isopropyl alcohol Page 71 4-Propenylanisole. Kosher Organoleptic: alcohol. garlic) NI W389706-SAMPLE W389706-1KG 1 kg W389706-4KG 4 kg W389706-8KG 8 kg > 1. NI W292508-SAMPLE-K W292508-1KG-K 1 kg W292508-4KG-K 4 kg W292508-10KG-K 10 kg W292508-20KG-K 20 kg  natural. Fen. see 2. blue cheese. NI Natural occurrence: Apple.16 FEMA 2923 Flavis 5. sweet. sherry. FCC Ethyl phenyl ketone [109‑80‑8] HS(CH2)3SH C3H8S2 FW 108. whiskey and wine. apricot.2. Fen.com 113 . see Propyl butyrate Page 113 Feel inspired at safcglobal. see Isopropyl alcohol Page 71 CoE Nr 50 Halal. cooked pork.6-Diisopropylphenol Page 36 Propanal 2-Propanethiol W346918-SAMPLE Natural Occurrence: Apple. 690  ≥98% CoE Nr 192 Organoleptic: celery Halal. vanilla. earthy Kosher. 688 Arc. musty. cauliflower.004 CoE Nr 3c W423701-1KG Propylamine W292400-1KG-K 1 kg W292400-10KG-K 10 kg W292400-25KG-K 25 kg 1-Aminopropane [107‑10‑8] CH3CH2CH2NH2 C3H9N FW 59. Organoleptic: alcohol. grape. FG Halal. herbaceous Halal. pear. NI W292303-SAMPLE-K W292303-1KG-K 1 kg W292303-4KG-K 4 kg W292303-8KG-K 8 kg W292303-20KG-K 20 kg Arc. banana. apple.002 CH3CH2CH2OH C3H8O FW 60. sweet Kosher W292419-SAMPLE-K W292826-SAMPLE-K W292826-1KG-K 1 kg W292826-4KG-K 4 kg W292826-8KG-K p-Propyl anisole CoE Nr 3c CoE Nr 50c 8 kg Dihydroanethole W292419-100G-K 100 g W292419-1KG-K 1 kg W292419-5KG-K 5 kg  feed grade.08 W292516-100G-K 100 g W292516-1KG-K 1 kg W292516-4KG-K 4 kg Arc.2. nutty. meaty. FCC.002 CoE Nr 170 [93‑55‑0] C6H5COC2H5 C9H10O FW 134. apple. Kosher Arc. NI W292400-SAMPLE-K W292818-SAMPLE-K  ≥99. Kosher W293008-SAMPLE-K W293008-1KG-K 1 kg W293008-5KG-K 5 kg W293008-10KG-K 10 kg > n-Propyl-n-butanoate. FG FEMA 2930 Flavis 4. 2657. spicy Halal. banana.18 Organoleptic: caramel. ethereal.08 Propyl acetate Arc. see Glycerol Page 56 Propanoic acid. sulfurous. gin. ≥97%.039 CoE Nr 2026 Organoleptic: anise. potato chips. 98. Fen. Propanyl acid. wine-like. Fen. see Propyl mercaptan Page 114 Propionaldehyde [123‑38‑6] CH3CH2CHO C3H6O FW 58. FCC.11  ≥99% W292818-1KG-K 1 kg W292818-4KG-K 4 kg Kosher W423701-8KG 8 kg W292818-8KG-K 8 kg W292443 W423701-20KG 20 kg W292818-20KG-K 20 kg  natural. see trans-Anethole Page 14 1 kg > Propionic acid sodium salt. Acid C3 W292516-SAMPLE-K [79‑09‑4] FEMA 2924 Flavis 8.

16 Organoleptic: pineapple Kosher Propylene glycol  ≥97% W293601-SAMPLE-K Organoleptic: cheese. Kosher Fen. papaya. rum and strawberry.5-Trihydroxybenzoic acid propyl ester. 701 [626‑77‑7] FEMA 2949 Flavis 9. garlic) Halal. Caproic acid propyl ester.4. spicy Halal. 701 3. alliaceous (onion.014 CoE Nr 540 Organoleptic: herbaceous.20 FEMA 2952 Flavis 10. garlic) Halal. Fen. Kosher. 699  ≥97%. n-Propylmercaptan  ≥98% W294926-SAMPLE-K [57‑55‑6] CH3CH(OH)CH2OH C3H8O2 FW 76. > n-Propylmercaptan. green. floral. NI W293407-SAMPLE-K W293407-1KG-K 1 kg W293407-4KG-K 4 kg W293407-9KG-K 9 kg  natural. ethereal. see Propyl hexanoate Page 114 > 4-Propylguaiacol. alliaceous (onion. NI W352101-SAMPLE-K Halal. Fen. 2682. 695 > n-Propyl hexanoate. 1. ≥98% Organoleptic: woody.20 Propyl gallate Arc. see Propyl hexanoate Page 114 W352101-1KG-K 1 kg W352101-2KG-K 2 kg W294004-SAMPLE-K 114 W294004-1KG-K 1 kg W294004-10KG-K 10 kg W294004-25KG-K 25 kg Place an order with your local SAFC representative (see back for contacts). Fen. Propyl paraben [105‑66‑8] FEMA 2934 Flavis 9. 702 Propylene glycol.24 FEMA 2936 Flavis 9.061 CoE Nr 311 CH3(CH2)4CO2CH2CH2CH3 C9H18O2 FW 158.414 CoE Nr 289 Arc. Propyl caproate Arc. NI [107‑03‑9] CH3CH2CH2SH C3H8S FW 76.073 CoE Nr 340 FEMA 2951 Organoleptic: berry. Fen. honey. green.4. 2710. sweet Kosher.5-(HO)3C6H2CO2CH2CH2CH3 C10H12O5 FW 212. passion fruit. sulfurous. Fen. wine-like.071 CoE Nr 11816 FEMA 2940 CoE Nr 4212 Organoleptic: vegetable. ≥90% 1 kg W293601-4KG-K 4 kg W293601-9KG-K 9 kg Propyl mercaptan 1-Propanethiol. 2720.18 [110‑74‑7] HCOOCH2CH2CH3 C4H8O2 FW 88.5%. herbaceous.09 W294926-25G-K 25 g W294926-100G-K 100 g W294926-1KG-K 1 kg  ≥99. FG  ≥98% FEMA 3228 Flavis 12. Mercaptan C3. 692  ≥98% CoE Nr 266 Natural Occurrence: Apple. see Propyl formate Page 114 . wine-like NI W322806-100G-K W322806-SAMPLE-K Propyl isobutyrate n-Propyl-2-methylpropanoate FEMA 3521 Flavis 12. Kosher.20  ≥97%  ≥99% Arc. Fen.04 CH3CH2CH2COOCH2CH2CH3 C7H14O2 FW 130. see Propyl mercaptan Page 114 n-Propyl methanoate. 2696 Organoleptic: pineapple Kosher. Fen. 2676. kiwi. 698 W293415-SAMPLE-K 1 kg W293415-25G-K 25 g W293415-100G-K 100 g W293415-1KG-K 1 kg W294705-1KG-K 1 kg W295205-5KG-K 5 kg W293415-4KG-K 4 kg W294705-5KG-K 5 kg W295205-25KG-K 25 kg W294705-10KG-K 10 kg > (±)-γ-Propyl-γ-butyrolactone. FCC W293601-1KG-K Arc. Fen.31 Arc. 2705. Kosher FEMA 2947 W295205-SAMPLE-K Kosher W295205-100G-K 100 g W294705-SAMPLE-K W295205-1KG-K 1 kg Arc. Organoleptic: apple. 2677. waxy Kosher.2-Propanediol Arc. 694 n-Propyl hexanoate. creamy. 2723. 697 [94‑13‑3] HOC6H4CO2CH2CH2CH3 C10H12O3 FW 180.11 Arc. 2695. banana.SAFC® Flavors & Fragrances Propylbutyrate Propyl butyrate Propyl formate n-Propyl-n-butanoate n-Propyl methanoate 4-Hydroxybenzoic acid propyl ester. NI W295101-SAMPLE W294306-SAMPLE-K W295101-5KG 5 kg W295101-25KG 25 kg W295101-1KG W294306-1KG-K 1 kg W294306-4KG-K 4 kg W294306-9KG-K 9 kg 3-Propylidenephthalide [17369‑59‑4] C11H10O2 FW 174. see γ-Heptalactone Page 57 Propyl caproate.005 CoE Nr 494  FCC. see 2-Methoxy-4-propylphenol Page 81 [644‑49‑5] (CH3)2CHCO2CH2CH2CH3 C7H14O2 FW 130. ≥95% CoE Nr 266c Kosher Organoleptic: ethereal Propyl 4-hydroxybenzoate FEMA 2943 Flavis 9. NI W294918-SAMPLE W294918-1KG 1 kg 100 g W294918-4KG 4 kg W322806-1KG-K 1 kg W294918-9KG 9 kg W322806-5KG-K 5 kg  natural.18 Propyl hexanoate Propyl disulfide Dipropyl disulfide [629‑19‑6] CH3CH2CH2SSCH2CH2CH3 C6H14S2 FW 150. melon. sweet. Tenox PG  ≥96% [121‑79‑9] 3. earthy.

704 Flavis 6.046 CoE Nr 11908 FEMA 3649 Flavis 4. 703 Fen. see Propyl 4-hydroxybenzoate Page 114 o-Propylphenol. see 2-Propylphenol Page 115 p-Propylphenol.com 115 .19 [645‑56‑7] CH3CH2CH2C6H4OH C9H12O FW 136.3-dioxolane. Order your raw materials in the most cost-effective quantities.Propylphenol 2-Propyl-4-methyl-1.05 Organoleptic: medicinal Halal. see 4-Propylphenol Page 115 W352209-SAMPLE Feel it.com/flavors-fragrances Feel inspired at safcglobal.18 [644‑35‑9] CH3CH2CH2C6H4OH C9H12O FW 136. The comfort of packaging customized to fit your needs. mixture of isomers 2-Propylphenol 4-Propylphenol o-Propylphenol p-Propylphenol [4352‑99‑2] C7H14O2 FW 130. Contact your SAFC representative or visit safcglobal.19  ≥98% Fen.095  ≥97%  ≥97% W510866-SAMPLE FEMA 3522 Flavis 4. SAFC offers your choice of ready-to-ship or custom packaging. Kosher W510866-100G 100 g W510866-1KG 1 kg W352209-100G 100 g W510866-4KG 4 kg W352209-1KG 1 kg W364908-SAMPLE-K W352209-5KG 5 kg W364908-25G-K 25 g W364908-100G-K 100 g W364908-1KG-K 1 kg > n-Propyl-2-methylpropanoate. see Propyl isobutyrate Page 114 Propyl paraben. Samples and product development kits are also available. including return-and-refill containers from 18 –1000 L.

064 W401501-SAMPLE-K W295809-SAMPLE-K W295809-1KG-K 1 kg W295809-4KG-K 4 kg W295809-9KG-K 9 kg W401501-100G-K 100 g W401501-1KG-K 1 kg W401501-5KG-K 5 kg Pyrazineethanethiol  natural (US). spicy NI W296309-SAMPLE W296600-SAMPLE-K W296600-1KG-K 1 kg W296600-10KG-K 10 kg W296600-25KG-K 25 kg > Pyrocatechol dimethyl ether. Tetramethyleneimine W338605-100G 100 g W338605-1KG 1 kg W338605-5KG 5 kg Place an order with your local SAFC representative (see back for contacts). scotch spearmint and thyme. p-Menth-4 (8)-en-3-one [89‑82‑7] C10H16O FW 152. Kosher W295817-4KG-K 4 kg W323004-SAMPLE-K [78‑98‑8] CH3COCHO C3H4O2 FW 72. see 1. 2775  ≥99% Arc. FCC CoE Nr 403 Organoleptic: oily.144  ≥99% Kosher FEMA 3523 Flavis 14. fruity. Methylglyoxal solution.008 CoE Nr 604 (R)-(+)-Pulegone (+)-Pulegone.18 W352316-1KG FEMA 3230 Flavis 14. sake. creamy. vanilla. FG 2-Propylpyridine Organoleptic: animal NI > (S)-Pyrrolidine-2-carboxylic acid.164 [110‑86‑1] C5H5N FW 79. % in H2O W323004-25G-K 25 g W323004-100G-K 100 g W323004-1KG-K 1 kg Pyridine FEMA 4065 Flavis 14. coffee.031 CoE Nr 2285 W295817-100G-K Conyrine W352316-SAMPLE Pyruvaldehyde solution  ≥97%. 2742. 707 Natural occurrence: Buchu oil. Virginia tobacco. Kosher  ≥85% FEMA 2963 CoE Nr 2050c 8 kg Arc. Fen.041 CoE Nr 2381 Organoleptic: nutty. 2785. coffee Kosher Azole. Fen. Arc. sulfurous. NI Pyrrolidine [290‑37‑9] C4H4N2 FW 80.10 Organoleptic: green. Fen. wheat bread. see L-Proline Page 112 Pyruvaldehyde.23 Arc. (R)-p-Menth-4(8)-en-3-one.019 CH3COCOOH C3H4O3 FW 88. Divinylenimine.SAFC® Flavors & Fragrances Propylpropionat Propyl propionate Pyrazine [106‑36‑5] FEMA 2958 Flavis 9. vegetable Halal. herbaceous.3-dimethyl ether. see Guaiacol Page 56 Pyrogallol 1.2-Dimethoxybenzene Page 36 Pyrocatechol monomethyl ether. wine-like Kosher. 2776.21 Kosher Organoleptic: wine-like 1 kg Organoleptic: meaty. 711 FEMA 4015 Flavis 14. floral Arc. meaty.12 Arc. 2780. (R)-2-Isopropylidene-5-methylcyclohexanone. α-Ketopropionic acid W296309-100G > (+)-Pulegone.06  40 wt. NI 2-Oxopropionic acid. wine-like Kosher. minty. beef. 710 5 kg  ≥98%. pennyroyal. see 2. fishy Halal. vegetable. fruity. 707 W295817-SAMPLE-K 8 Tetrahydropyrrole. 2786. minty. 708 W406503  ≥99% FEMA 2966 Flavis 14. vegetable. creamy. 706  ≥98%.16 Arc. Fen. ≥80% CoE Nr 19c W297070-SAMPLE-K [109‑97‑7] C4H5N FW 67. ≥98%. Fen.06 Natural Occurrence: Asparagus. 711 100 g  ≥97% 1 kg W352316-8KG Acetylformaldehyde. W297070-25G-K 25 g W297070-100G-K 100 g W297070-1KG-K 1 kg .122 CH3CH2COOCH2CH2CH3 C6H12O2 FW 116. Pyruvic aldehyde W295817-1KG-K [622‑39‑9] C8H11N FW 121. meaty.09 W530274-SAMPLE-K W296902-100G Organoleptic: caramel. 2769. peppermint. 712  ≥97% CoE Nr 19 Organoleptic: caramel. Fen. Fen. native spearmint. ethereal. sweet NI W338605-SAMPLE 116 100 g W296902-500G 500 g W296902-1KG 1 kg W296902-10KG 10 kg [127‑17‑3] FEMA 2970 Flavis 8. lime.6-Dimethoxyphenol Page 37 [8030‑97‑5] Arc. FCC FEMA 3386 Flavis 14. FCC Mercaptoethylpyrazine CoE Nr 403c [35250‑53‑4] C6H8N2S FW 140.09 [123‑75‑1] C4H9N FW 71.001 CoE Nr 105 Pyruvic acid Organoleptic: sour. 2784. 2783. Imidole Kosher China origin W530274-5KG-K FEMA 2967 Pyrrole [8016‑49‑7] W296902-SAMPLE W297003-SAMPLE-K Pyroligneous acid 100 g Pumpkin seed oil Organoleptic: caramel Halal. 710 W296309-1KG 1 kg W296708-SAMPLE W296309-5KG 5 kg W296708-1KG 1 kg W296708-5KG 5 kg W296708-10KG 10 kg 8  Certified organic (NOP/EU) Arc. NI W297003-250G-K 250 g W297003-1KG-K 1 kg W297003-5KG-K 5 kg W297003-10KG-K 10 kg W297003-25KG-K 25 kg  natural. Fen. see (R)-(+)-Pulegone Page 116 FEMA 2969 Flavis 7. see Pyruvaldehyde solution Page 116 Fen. Organoleptic: cinnamon.

... rose. oily. Kosher Fen. see Tetrahydro-4-methyl-2-(2-methyl-1propenyl)-2H-pyran Page 122 Rosewood oil. Kosher W299618-SAMPLE-K Rose absolute W299618-1KG-K 1 kg [8007‑01‑0] FEMA 2988 W299618-4KG-K 4 kg W299618-8KG-K 8 kg from Rosa damascena Kosher Organoleptic: rose France origin Saccharin hemicalcium salt 2..Saccharin Quinine monohydrochloride dihydrate Rhodinol Rosemary oil  90% L-Citronellol [8000‑25‑7] FEMA 2992 FEMA 2976 Flavis 14. 5-[(1E)-2-(4Hydroxyphenyl)ethenyl]-1.. for food analysis 34092-100MG 100 mg Arc. 714  Certified organic (NOP/EU) W298018-SAMPLE-K W298018-25G-K 25 g W298018-100G-K 100 g W298018-1KG-K 1 kg > β-Rhodinol.. see 4-(4-Hydroxyphenyl)-2-butanone Page 66 Resorcinol W379301-100G 100 g W379301-1KG 1 kg W379301-5KG 5 kg Rice bran oil 1.48  analytical standard....5-Trihydroxy-trans-stilbene. 715  Certified organic (NOP/EU) Ethyl oxyhydrate  ≥98% Kosher Mexico origin [8030‑89‑5] FEMA 3589 Flavis 4. 245 W299200-SAMPLE-K W299200-1KG-K 1 kg W299200-4KG-K 4 kg W299200-9KG-K 9 kg Rose oil.16 Arc. see (S)-(−)-β-Citronellol Page 29  ≥97% D-(−)-Ribose FEMA 3470 Flavis 14. rose France origin W347000-5KG 5 kg FEMA 3793 W523704-SAMPLE W347000-10KG 10 kg NI W523704-25G 25 g W379301-SAMPLE W523704-100G 100 g W523704-1KG 1 kg > Rapeseed oil. see Canola oil Page 24 Raspberry ketone.27 from Rosemarinus officinalis L.063 CoE Nr 11364 NI [50‑69‑1] C5H10O5 FW 150.. see Rose absolute. <10% FEMA 2980 CoE Nr 76 W299225-SAMPLE W297607-SAMPLE-K Natural Occurrence: Geranium and citronella oils.3-Benzenediol 8 > (+)-Rose oxide. Moroccan  FG FEMA 2996 Organoleptic: whiskey. Fen.24  analytical standard.047 CoE Nr 11250 NI W530241-5KG-K W358908-SAMPLE W358908-1KG 1 kg W358908-5KG 5 kg W358908-10KG 10 kg > Resorcinol dimethyl ether. Organoleptic: oily.. musty. 2797. Kosher..4′.3-Dimethoxybenzene Page 36 β-Resorcylic acid.... 721 5 kg > Rose absolute.. see Bois de rose Page 20 Rum Ether [108‑46‑3] C6H4-1.com W523801-1KG-K 1 kg W523801-10KG-K 10 kg W523801-25KG-K 25 kg 117 . Kosher Fen.3-(OH)2 C6H6O2 FW 110. FCC Tunisia origin dihydroquinine hydrochloride . Moroccan Page 117 Rose absolute. see 1. wine-like Halal. Organoleptic: lemon.. 2. wine-like Halal. 713 Arc.5H2O FW 467. Fen.13 W347000-SAMPLE Fen..3-benzenediol [501‑36‑0] C14H12O3 FW 228... o-Sulfobenzimide W298816-SAMPLE-K W298816-25G-K 25 g W298816-100G-K 100 g W298816-1KG-K 1 kg [6381‑91‑5] C14H8CaN2O6S2 · 3.11 [68553‑81‑1] Arc... sweet. Fen. 2793... NI W299225-1KG W297607-100G-K 100 g W297607-1KG-K 1 kg W297607-5KG-K 5 kg Quinoline 1-Benzazine. waxy. 1324. see 2. Fen. for food analysis 47840 1000 mg Rose crystals  ≥97% from synthetic Kosher China origin W523801-SAMPLE-K Feel inspired at safcglobal...Turkish W347000-1KG 1 kg  ≥98% from Rosa spp..3-Benzopyridine [91‑22‑5] C9H7N FW 129.4-Dihydroxybenzoic acid Page 36 Resveratrol 3. 720 8 1 kg  FCC Organoleptic: camphoraceous Halal..155 CoE Nr 715 [141‑25‑3] C10H20O FW 156. 2791... 716  mixture of L-citronellol and geraniol. fruity.3-Dihydro-3-oxobenzisosulfonazole.

spicy Halal..112 W338907-25G-K 25 g W338907-100G-K 100 g W338907-1KG-K 1 kg Sage oil [8022‑56‑8] Kosher W398500-1KG-K 1 kg W398500-10KG-K 10 kg W398500-25KG-K 25 kg  Spanish..... Fen.. see 2-Methylfuran Page 86 Skatole W398500-SAMPLE-K > Salol.17 Organoleptic: jasmine..38 [90‑02‑8] 2-(HO)C6H4CHO C7H6O2 FW 122.055 CoE Nr 605 W379401-100G 100 g W379401-1KG 1 kg W530202-5KG 5 kg > Safflower seed oil from Carthamus tinctorius seed...104 CoE Nr 10383 8  Certified organic (NOP/EU) > Salicylaldehyde methyl ether. see Safflower oil Page 118 Safranal 2.. 723 FEMA 3794 Flavis 16.. 2815. colloidal... 769 Sesame oil Sesame oil from Sesamum indicum Place an order with your local SAFC representative (see back for contacts)...... see Sucrose acetate isobutyrate Page 120 Sucrose acetate isobutyrate Page 120 SAIB-SG-ET-10. 727 W302406-1KG-K 1 kg W302406-10KG-K 10 kg W302406-25KG-K 25 kg Sodium alginate W510483-SAMPLE-K W510483-1KG-K 1 kg Alginic acid sodium salt from brown algae... Kosher.. hydrophilic. see Diethyl sebacate Page 35 W300403-SAMPLE-K W300403-1KG-K 1 kg W300403-10KG-K 10 kg W300403-25KG-K 25 kg  ≥88%. FEMA 2015 W201502-SAMPLE W201502-1KG 1 kg W201502-5KG 5 kg .. see o-Anisaldehyde Page 14 Fen.055 Mexico origin  ≥98% W379401-25G 25 g W530202-SAMPLE FEMA 3004 Flavis 5...... <12%  ≥99% W338907-SAMPLE-K W530253-SAMPLE-K W530253-5KG-K [69‑72‑7] 2-(HO)C6H4CO2H C7H6O3 FW 138. Fen. polyuronic acid composed of glucuronic and mannuronic acid residues.2.. FCC FEMA 3005 from Santalum album l.22 Organoleptic: almond. A straight-chain..... animal [8006‑87‑9] from Salvia officinalis L..... see β-Cyclodextrin Page 31 118 W301912-100G W302406-SAMPLE-K [8006‑80‑2] W300100-SAMPLE-K  ≥98% Sodium Acetate Anhydrous W300306-1KG-K  Certified organic (NOP/EU) Arc.12  97% Arc. Kosher.. FCC FEMA 3024 Kosher Fen.. see Sesame oil Page 118 Silvan..12 FEMA 3985 Flavis 8...... 250 [8008‑74‑0] Kosher Mexico origin Salicylic acid FEMA 3389 Flavis 5.... FG Organoleptic: herbaceous Halal. 2846. see Sudan III Page 120 Scarlet Red Scharlach.SAFC® Flavors & Fragrances Saffloweroil Safflower oil 8 Safflower seed oil from Carthamus tinctorius seed [8001‑23‑8]  Certified organic (NOP/EU) Salicylaldehyde (3aR)-(+)-Sclareolide 2-Hydroxybenzaldehyde [564‑20‑5] C16H26O2 FW 250.. NI > Sebacic acid diethyl ester. see Phenyl salicylate Page 111 Fen. Kosher 1 kg W300500-SAMPLE-K W300306-4KG-K 4 kg W300500-25G-K 25 g W300306-9KG-K 9 kg W300500-100G-K 100 g W300500-1KG-K 1 kg 8 FEMA 3001 Sassafras oil from (Saliva officianalis) Kosher W300100-1KG-K 1 kg > SAIB..3-Dihydro-2. Organoleptic: herbaceous Halal... see Sucrose acetate isobutyrate solution Page 120 from Sassafras albidum (Nutt) Nees Kosher Vietnam origin 100 g W301912-500G 500 g W301912-1KG 1 kg W301912-5KG 5 kg  >99%... Algin W510483-5KG-K 5 kg [9005‑38‑3] W510483-10KG-K 10 kg > Scarlet B. Kosher Spain origin 8 3-Methylindole FEMA 3019 Sandalwood oil FEMA 3003 5 kg > Sesame oil from Sesamum indicum...... 726 W301912-SAMPLE  Indonesia origin W300306-SAMPLE-K [83‑34‑1] C9H9N FW 131.6-trimethylbenzaldehyde [116‑26‑7] C10H14O FW 150. see Sudan IV Page 120 Schardinger β-Dextrin. NI 2-Hydroxybenzoic acid β-cyclocitral .

Kosher Organoleptic: floral.015 CoE Nr 15 Kosher NI Fen.5-dihydrofuran-2-one Page 38 4.10 Arc. 263 Arc.trans-2. 730 W303518-SAMPLE-K W303518-1KG-K Feel inspired at safcglobal.Stearicacid Sodium benzoate Sodium propionate Spearmint oil Benzoic acid sodium salt Propionic acid sodium salt [8008‑79‑5] FEMA 3032 [532‑32‑1] C6H5COONa C7H5NaO2 FW 144. sec-Sodium phosphate. Disodium phosphate.trans-2. see Sudan III Page 120 Solvent Yellow 14. 2859 Arc.10 [137‑40‑6] CH3CH2COONa C3H5NaO2 FW 96. see Sodium diacetate Page 119 Sodium hydrogenphosphate. camphoraceous. see 3-Methyl-2-oxobutanoic acid sodium salt Page 90 Sodium 4-methyl-2-oxovalerate. Citric acid trisodium salt dihydrate [6132‑04‑3] HOC(COONa)(CH2COONa)2 · 2H2O C6H5Na3O7 · 2H2O FW 294. 2852  ≥99%.5-Dimethyl-3-hydroxy-2.4-Hexadienal Page 59 Sorbic acid. see Epoxidized soya bean oil Page 42 Lavender spike oil [8016‑78‑2] FEMA 3033 from Lavandula spp.5-dihydrofuran-2-one solution Page 38 Soya oil from Glycine max.09 FEMA 3900 Flavis 16.62 FEMA 3028 W302600-SAMPLE-K W303208-1KG-K W303216-SAMPLE-K Sorbitan monostearate  FCC Halal.48 Arc. see 4-Methyl-2-oxopentanoic acid sodium salt Page 90 Organoleptic: minty.96  ≥99% W239901-SAMPLE W239901-1KG 1 kg W239901-5KG 5 kg > sec-Sodium phosphate. see Sudan I Page 120 Sorbaldehyde.trans-2. FG FEMA 3026 W518905-1KG-K 1 kg W518905-10KG-K 10 kg W518905-25KG-K 25 kg > Sodium succinate dibasic. Kosher. 2863  ≥95%. Kosher Fen. 730 W303224-SAMPLE-K from Mentha spicata L. see trans. Sodium hydrogenphosphate [7558‑79‑4] Na2HPO4 HNa2O4P FW 141. 2860 W390003-SAMPLE  terpeneless 1 kg [50‑70‑4] C6H14O6 FW 182. vanilla Spain origin W303305-SAMPLE-K W303305-1KG-K 1 kg W303305-4KG-K 4 kg W303305-9KG-K 9 kg Stearic acid Octadecanoic acid [57‑11‑4] CH3(CH2)16COOH C18H36O2 FW 284. 727 W302503-SAMPLE-K W302503-1KG-K 1 kg W302503-10KG-K 10 kg W302503-25KG-K 25 kg Sodium citrate dihydrate Sodium citrate tribasic dihydrate. camphoraceous Halal. see trans. see 2. see Sudan IV Page 120 Solvent Red 23. FG  ≥99%.com 8 > SPF.trans-2.073 9 kg W303216-4KG-K D-Glucitol Sodium hydrogen diacetate 4 kg W303208-9KG-K W303216-1KG-K Fen. see Sodium phosphate dibasic Page 119 4 kg W303224-9KG-K 9 kg W303237-1KG-K 1 kg Spike lavender oil 1 kg W302902-10KG-K 10 kg W302902-25KG-K 25 kg > Sorbyl acetate. FCC FEMA 3035 Flavis 8.4-Hexadienyl acetate Page 59 trans. see Soybean oil Page 119 8 Soya oil from Glycine max [8001‑22‑7]  Certified organic (NOP/EU) W530261-SAMPLE-K > Soybean oil. epoxidized. see Sudan II Page 120 Solvent Red 24.06 Fen. green Kosher USA origin Arc.4-Hexadienoic acid Page 59 Sorbic alcohol. see Sodium citrate dihydrate Page 119 Sodium diacetate 4 kg W303216-9KG-K 9 kg  from synthetic Kosher Organoleptic: camphoraceous.17 [126‑96‑5] C4H7NaO4 FW 142. see trans. FCC Kosher FEMA 3025 W518905-SAMPLE-K from Mentha spicata Huds Organoleptic: minty. see Mercaptopyruvic acid sodium salt Page 79 Sodium 3-methyl-2-oxobutyrate. 729 W302600-1KG-K 1 kg W303208-4KG-K [1338‑41‑6] C24H46O6 FW 430.4-Hexadienyl acetate Page 59 Sotolon. green. 723 W303208-SAMPLE-K 1 kg W303518-8KG-K 8 kg W303518-20KG-K 20 kg 119 . green W302805-SAMPLE W302805-1KG 1 kg W302805-5KG 5 kg W302805-10KG 10 kg D-Sorbitol W390003-1KG 1 kg W390003-10KG 10 kg W390003-25KG 25 kg W302902-SAMPLE-K Sodium phosphate dibasic Disodium hydrogen phosphate. 2849  FCC  FCC. see Butyl 4-hydroxybenzoate Page 22 Kosher USA origin FEMA 2399 1 kg W303224-4KG-K W303237-SAMPLE-K W302902-1KG-K Soybean oil W303224-1KG-K  Certified organic (NOP/EU) FEMA 3029 CoE Nr 81c Kosher NI Fen. Trisodium citrate dihydrate.5-Dimethyl-3-hydroxy-2.4-Hexadien-1-ol Page 59 1 kg W302600-10KG-K 10 kg W302600-25KG-K 25 kg > Sodium citrate tribasic dihydrate. FCC > Sodium hydrogen diacetate. Kosher USA origin Halal. see Sodium phosphate dibasic Page 119 Sodium mercaptopyruvate. see Disodium succinate Page 40 Solvent Orange 7. see 4. minty. NI Fen. Kosher India origin  ≥98%.

Fat Soluble Sudan.5-Dimethyl-3-hydroxy-2. 732 FEMA 3038 Flavis 16.15  ≥97% 1 kg W513504-5KG 5 kg W513504-10KG 10 kg W518107-1KG-K 1 kg [126‑13‑6] C40H62O19 FW 846. % in ethanol. nutty. Solvent Red 23.44 SAIB W518018  ≥99% 8 Cerasin Red. NI 25 mg Sunflower seed oil from Helianthus annuus W303801-1KG-K [110‑15‑6] Flavis 8. FG 1-(2-Methoxyphenylazo)-2-naphthol. Fat Ponceau R or 4. see Dimethyl succinate Page 40 Gum storax W513504-1KG  natural. Fen.39 W502715-100G-K 100 g  analytical standard. FEMA 4049 Flavis 5. Kosher. for food analysis  90 wt. Kosher Organoleptic: balsam. sherry.0% (HPLC)  FG  ≥97% > Styrene alcohol. see 4-Hydroxy-2. Phenyloxirane. roasted barley and hardwood smoke.5-Dimethyl-3-hydroxy-2. Solvent Red 24.SAFC® Flavors & Fragrances Stearicacidethy > Stearic acid ethyl ester. 2865. grape. see 4. rum. see Disodium succinate Page 40 Succinic acid dimethyl ester. Oil Red IV. Lipid Crimson. Sudan Red BK W502715-SAMPLE-K Sucrose acetate isobutyrate solution Phenylethylene. FG [842‑07‑9] C6H5N=NC10H6OH C16H12N2O FW 248.5-dimethyl-3(2H)furanone Page 65 Styrallyl acetate. see 4-Methyl-5-thiazoleethanol Page 94 Sulfurol acetate.015 CoE Nr 11022 Organoleptic: medicinal.5-dihydrofuran-2-one solution Page 38 o-Sulfobenzimide. 1-[4(Phenylazo)phenylazo]-2-naphthol.0% (HPLC) Butanedioic acid Arc. 3. smoky W404926-SAMPLE W404926-100G 100 g W404926-1KG 1 kg W404926-5KG 5 kg . see Sudan III Page 120 Sugar lactone.33 W502707-1KG-K 1 kg W502707-2KG-K 2 kg W502707-10KG-K 10 kg W502707-25KG-K 25 kg  analytical standard.5-dimethyl-3(2H)furanone Page 9 Strawberry furanone. Phenylethylene oxide [96‑09‑3] C8H8O FW 120.5Dimethoxy-4-hydroxybenzaldehyde [134‑96‑3] HOC6H2(OCH3)2CHO C9H10O4 FW 182. see 4-Acetoxy-2. see α-Methylbenzyl alcohol Page 82 Styrallyl butyrate. FCC.09 CoE Nr 24 [1229‑55‑6] CI 12150 C17H14N2O2 FW 278. grape brandy. plastic NI contains 10-15 ppm 4-tert-butylcatechol as inhibitor not available in USA W323306 1. Tony Red.2-Epoxyethylbenzene.0% (HPLC) Halal. woody. see Sudan III Page 120 1-Phenylazo-2-naphthol. for food analysis [27216‑37‑1] C40H62O19 FW 846. Sudan R or BB.91 D-(+)-Sucrose 25 mg [85‑83‑6] CI 26105 C24H20N4O FW 380. see α-Methylbenzyl butyrate Page 82 Styrax [8046‑19‑3] FEMA 3037 from Liquidambar spp. see 4-Methyl-5-thiazoleethanol acetate Page 94 octaacetate  analytical standard.4-Xylylazo)-2-naphthol. 2867 Sudan red G  analytical standard. Oil Red 113 91282-25MG 51383-25MG 8 ≥96. Fat Ponceau G. Solvent Yellow 14 25 mg Sudan II [3118‑97‑6] C18H16N2O FW 276.0% (HPLC) 07937-25MG W530285-SAMPLE-K 5 kg > Sunflower seed oil from Helianthus annuus.153 CoE Nr 130 Natural occurrence: Pineapple.5-dihydrofuran2-one Page 38 4. ≥99% 25 mg Place an order with your local SAFC representative (see back for contacts).5-dimethyl-3(2H) furanone Page 8 4-Acetoxy-2. Scarlet B. see Methyl stearate Page 93 Strawberry acetate.024 HOOCCH2CH2COOH C4H6O4 FW 118. fishy Honduras origin W303704-SAMPLE-K W303704-1KG-K 1 kg W303704-5KG-K 5 kg W303704-10KG-K 10 kg Styrene [100‑42‑5] C6H5CH=CH2 C8H8 FW 104. for food analysis W502715-1KG 1 kg ≥96.0% (HPLC) W502715-1KG-K 1 kg 68562-25MG Sucrose acetate isobutyrate FEMA 3233 Flavis 1. for food analysis  ≥99%. 731 W502715-100G 100 g [85‑86‑9] CI 26100 C22H16N4O FW 352. see α-Methylbenzyl alcohol Page 82 Sudan IV  analytical standard.59 Arc.5-dimethoxybenzaldehyde.15 Arc. Biebrich scarlet R fat soluble 67386-25MG Kosher W303801-SAMPLE-K Styrene oxide 8 ≥96. Solvent Orange 7 W502707-SAMPLE-K 8 Kosher China origin W530285-5KG-K Sudan I ≥96. Fen.17  ≥98% 1-(2. for food analysis ≥96. 2868. see Sunflower oil Page 120 Syringaldehyde 4-Hydroxy-3.28 Succinic acid 25 mg > Sudan R or BB. see α-Methylbenzyl acetate Page 82 Styrallyl alcohol.081 CoE Nr 4219 Halal. Vinylbenzene 120 Sudan III Organoleptic: sour Kosher > Succinic acid disodium salt.91 Sucrose octaacetate [126‑14‑7] C28H38O19 FW 678. see Sudan IV Page 120 W518107-SAMPLE-K > W513504-SAMPLE Scarlet Red Scharlach. berry. many different whiskey products. beer. see Sucrose octaacetate Page 120 Sudan G. wine-like. spicy. Sudan G.31 > Sudan Red BK. see Saccharin hemicalcium salt Page 117 Sulfurol. Kosher Sunflower oil 1 kg W303801-10KG-K 10 kg [8001‑21‑6] W303801-25KG-K 25 kg  Certified organic (NOP/EU) D-(+)-Sucrose octaacetate. see Ethyl stearate Page 50 Stearic acid methyl ester. Organoleptic: chocolate.

citrus Kosher NI FEMA 3044 Flavis 8. FCC > (±)-α-Terpinyl acetate.20 FEMA 3042 CoE Nr 74c W304506-1KG-K W304522-SAMPLE-K W390208-1KG-K 1 kg W304522-1KG-K 1 kg W304204-1KG 1 kg W390208-4KG-K 4 kg W304522-5KG-K 5 kg W304204-10KG 10 kg W390208-9KG-K 9 kg W304522-10KG-K 10 kg W304204-25KG 25 kg  Certified organic (NOP/EU) 8 W390215-SAMPLE-K > Tannin. see L-(+)-Tartaric acid Page 121 L-(+)-Tartaric acid diethyl ester. 738  ≥95% FEMA 3049 Flavis 9. FG  ≥98% CoE Nr 62 W381306-SAMPLE-K W381306-1KG-K 1 kg Halal. medicinal.018 W304401-1KG γ-Terpinene W304401-SAMPLE L-(+)-Tartaric 1-Isopropyl-4-methyl-1.015 CoE Nr 205 W355801-8KG-K 8 kg Organoleptic: herbaceous. L-Threaric acid Arc. 2872. grapefruit. NI W381306-5KG-K 5 kg W304506-SAMPLE-K W381306-10KG-K 10 kg Tea tree oil Tannic acid Melaleuca alternifolia Tannin. 734 [99‑85‑4] C10H16 FW 136. and tobacco like notes W304000-SAMPLE-K W304000-100G-K 100 g W304000-500G-K 500 g [10482‑56‑1] FEMA 3045 C10H18O FW 154. 733 W304700-SAMPLE-K > 4-Terpinenol.3-Dihydroxybutanedioic  ≥90% p-Mentha-1.Terpinylbutyrat Tagete oil 8 [8016‑84‑0] Taurine α-Terpineol 2-Aminoethanesulfonic acid  natural (S)-2-(4-Methyl-3-cyclohexenyl)-2-propanol. 1-Isopropyl-4-methyl-1. 2877. orange and mandarin oils. 735 Kosher  ≥96%. Fen.29 Arc.3R)-(+)-Tartaric acid.02 CoE Nr 11025 FEMA 3044 CoE Nr 18 Organoleptic: herbaceous. mixture of isomers [2153‑28‑8] C14H24O2 FW 224.4-diene acid 5 kg W304700-10KG-K 10 kg  ≥95%. (S)-pMenth-1-en-8-ol [107‑35‑7] NH2CH2CH2SO3H C2H7NO3S FW 125. Fen. Fen. black pepper and Scotch spearmint.25 FEMA 3813 Flavis 16.3-diene. p-Menth1. Kosher. herbaceous. 2874. vegetable. 735 W390208-SAMPLE-K W304204-SAMPLE 10 kg CoE Nr 62c Kosher Australia origin Organoleptic: medicinal. see Tricosanoic acid tryptamide Page 125 Feel inspired at safcglobal. pepper W304603-9KG-K 9 kg Terpinyl acetate (±)-2-(4-Methyl-3-cyclohexenyl)isopropyl acetate.23  ≥99.7%.com 1 kg Arc. NI Organoleptic: berry. 2882. citrus Halal.15 FEMA 3040 from Tagetes glandulifera Kosher Organoleptic: herbaceous Fragrance: Provides fruity. 734 W304603-SAMPLE-K  ≥89%. NI Arc.34 1 kg W304409-1KG 1 kg W355909-8KG-K 8 kg W304409-5KG 5 kg W355909-20KG-K 20 kg W304409-10KG 10 kg > (2R. Halal. NI Halal. see Diethyl L-tartrate Page 35 TAT. p-Meth-1-en-8-yl-formate acid FEMA 3046 Flavis 1. 733 1 kg W304506-10KG-K  natural [68647‑73‑4] FEMA 3902 [1401‑55‑4] C76H52O46 FW 1701. sweet.019 CoE Nr 11023 W304603-4KG-K 4 kg Natural occurrence: Celery.09 FEMA 3559 Flavis 1. nutmeg.3cyclohexadiene FEMA 2412 DL-Tartaric Terpinolene 4-Isopropylidene-1-methylcyclohexene. FG W304603-1KG-K 1 kg FEMA 3558 Flavis 1. 2873. FG W304700-1KG-K W304700-5KG-K (2R.052 CoE Nr 278 Organoleptic: apple W304905-SAMPLE W304905-100G 100 g W304905-1KG 1 kg W304905-5KG 5 kg 121 . 2883. Kosher. see Terpinyl acetate Page 121 [87‑69‑4] HO2CCH(OH)CH(OH)CO2H C4H6O6 FW 150.23 > Tenox PG.4(8)-diene. Kosher France origin [99‑86‑5] C10H16 FW 136. Fen. (±)-α-Terpinyl acetate [80‑26‑2] C12H20O2 FW 196. Kosher. Gallotannin W304506-25KG-K 25 kg Kosher Fen. see Propyl gallate Page 114 Arc.23 W241202-SAMPLE-K W241202-1KG-K 1 kg W241202-4KG-K 4 kg W241202-9KG-K 9 kg acid DL-2. fennel. Fen.09 W355801-SAMPLE-K W355801-1KG-K 1 kg  ≥95%  ≥99% W355801-4KG-K 4 kg FEMA 3047 Flavis 9.4-cyclohexadiene. corriander. woody Arc. oregano. FCC. FCC. 737 [133‑37‑9] HOOC(CHOH)2COOH C4H6O6 FW 150.056 Organoleptic: lilac Arc. 736 Estragon oil α-Terpinene [8016‑88‑4]  FCC from Artemisia dracunculus L. see 4-Carvomenthenol Page 25 4-Carvomenthenol Page 25 Fen. NI W355909-SAMPLE-K W304409-SAMPLE W355909-1KG-K Terpinyl butyrate. 2871. Fen. FCC. Fen. spicy.3R)-(+)-Tartaric acid. lemon. camphoraceous. lime. lemon.005 CoE Nr 2115 Organoleptic: plastic Halal. Kosher. see Tannic acid Page 121 W390215-1KG-K Tarragon oil 1 kg [586‑62‑9] C10H16 FW 136. woody. pMentha-1.

1 kg . green. N-Tetracosanoyltryptamine.081 CoE Nr 348 87206-5MG Organoleptic: citrus. mixture of isomers 5 mg 4.016 CoE Nr 2196 Tetrahydromyrcenol Organoleptic: creamy. 1838.5. 2891. 743  ≥97%.22 [2153‑26‑6] C11H18O2 FW 182.028 CoE Nr 77 Organoleptic: coconut.22 p-menth-1-en-8-yl-isobutyrate Organoleptic: cheese. see Tetrahydrofurfuryl acetate Page 122 p-Menth-1-en-8-yl-propionate Tetrahydro-2-furylmethyl acetate [80‑27‑3] C13H22O2 FW 210. N-Propionic acid tetrahydrofurfuryl ester [494‑90‑6] C10H14O FW 150.0% (HPLC) 07347-100MG-F [16409‑43‑1] C10H18O FW 154. 745 W305618-1KG-K 1 kg W305618-10KG-K 10 kg W323608-SAMPLE-K W305618-25KG-K 25 kg W323608-100G-K 100 g Fen.13 FEMA 3056 Flavis 13. see Tetracosanoic acid tryptamide Page 122 δ-Tetradecalactone Organoleptic: vegetable Kosher. Fen. 743  mixture of cis and trans.6. Fen. 741 W323608-1KG-K 1 kg  ≥98%. floral.26 [35493‑47‑1] C18H34O FW 266. Fen. NI W305618-SAMPLE-K Organoleptic: geranium. see (+/-)-Tetrahydrofurfuryl propionate Page 122 Tetrahydro-2-furylmethyl acetate. for food analysis  ≥97%  ≥97% ≥97. 739 W305006-100G W305707-100G-K [637‑65‑0] C8H14O3 FW 158.0% (GC) FEMA 3057 Flavis 13. NI contains 0. 746 Organoleptic: honey. 2887. 2900. Fen. Fen.7-Tetrahydro-3.142 CoE Nr 423  ≥97% FEMA 3060 Flavis 2. see 4-Methylcyclohexanone Page 85 W305200-SAMPLE-K W305200-100G-K 100 g W305200-1KG-K 1 kg W305200-5KG-K 5 kg Terpinyl isobutyrate.31 [637‑64‑9] C7H12O3 FW 144.166 CoE Nr 2069 Arc.28 W359009-SAMPLE-K Arc. 741  ≥95% [7774‑65‑4] C14H24O2 FW 224. Fen. see 3-Methylcyclohexanone Page 85 Tetrahydro-p-cresol. Kosher. see 2-Methylcyclohexanone Page 85 Tetrahydro-m-cresol. 744 Arc.035 CoE Nr 2265 FEMA 3050 Flavis 9.34 FEMA 3235 Flavis 13.02 CoE Nr 2029 100 mg > N-Tetracosanoyltryptamine.46 Arc. 2920 W359009-100G-K 100 g W359009-1KG-K 1 kg  95% W359009-5KG-K 5 kg W516503-SAMPLE W516503-1KG 122 Place an order with your local SAFC representative (see back for contacts).17  ≥95%. (4S)-2-(2-Methyl-1-propenyl)-4methyltetrahydropyran LAT.36 FEMA 3590 Flavis 10. FG W323608-4KG-K 4 kg [2721‑22‑4] C14H26O2 FW 226. synthetic as antioxidant Fen. synthetic as antioxidant > Tetrahydro-o-cresol.19 Organoleptic: musty. 739  analytical standard. earthy Kosher. raspberry. N-Lignoceroyltryptamine Tetrahydro-2-furanmethanol [152766‑94‑4] C34H58N2O FW 510. mixture of isomers > Tetradecanoic acid. NI contains 0. ≥98%  ≥98% FEMA 3236 Flavis 13. NI  ≥85% W305707-SAMPLE-K DL-Tetrahydrofurfuryl propionate.048 CoE Nr 2081 FEMA 3052 Flavis 9. 2889. earthy Halal. herbaceous Halal.425 CoE Nr 300 W305006-SAMPLE W323500-100G 100 g W323500-1KG 1 kg W305006-5KG 5 kg > Tetrahydro-2-furanmethanol.SAFC® Flavors & Fragrances Terpinylformate Terpinyl formate. 2901. FG Arc. pineapple Kosher W305805-SAMPLE-K W305805-100G-K 100 g W305805-1KG-K 1 kg W305805-5KG-K 5 kg > DL-Tetrahydrofurfuryl propionate. honey. Kosher Arc. see Tetrahydrofurfuryl alcohol Page 122 Tetrahydrofurfuryl acetate Terpinyl propionate (+/-)-Tetrahydrofurfuryl propionate Kosher 25 g 1 kg 5 kg FEMA 3058 Flavis 13. see Myristic acid Page 96 Tetrahydrofurfuryl butyrate 2-Tetradecylcyclobutanone p-menth-1-en-8-yl-formate 8 [2217‑33‑6] C9H16O3 FW 172.84 Arc. sweet Kosher. FCC FEMA 3053 Flavis 9. Fen. 2913. minty. waxy Halal. Fen. maple Kosher W306002-SAMPLE W306002-1KG 1 kg W305308-SAMPLE-K W305502-SAMPLE-K W306002-4KG 4 kg W306002-8KG 8 kg Tetrahydrolinalool W305308-100G-K 100 g W305502-100G-K 100 g W305308-1KG-K 1 kg W305502-1KG-K 1 kg W305308-5KG-K 5 kg W305502-5KG-K 5 kg Tetracosanoic acid tryptamide Tetrahydrofurfuryl alcohol Tetrahydro-4-methyl-2-(2-methyl-1propenyl)-2H-pyran (+)-Rose oxide. 746 Organoleptic: fatty.037 CoE Nr 2269  analytical standard. 740 FEMA 3055 Flavis 13. 2899. 2905.6-dimethylbenzofuran Menthofuran Arc.10% alpha-tocopherol. for food analysis ≥99.10% alpha-tocopherol.049 W323500-25G W305006-1KG 1 kg W305707-5KG-K  ≥96% W323500-SAMPLE 100 g 100 g W305707-1KG-K Arc. FCC. pepper Arc. N-[2-(3-Indolyl)ethyl]tetracosanamide. NI [18479‑57‑7] C2H5CH(CH3)(CH2)3C(CH3)2OH C10H22O FW 158. spicy.25 [97‑99‑4] C5H10O2 FW 102. Fen.

.. Kosher Organoleptic: earthy Kosher.. Kosher. musty.5-Dihydro-3(2H)thiophenone Page 36 Tetramethylene dimercaptan.056 CoE Nr 11438 W361518-25G-K W323705-SAMPLE-K 2.7.5. Kosher. NI W377406-SAMPLE-K W377406-100G-K 5.. see (−)-Ambroxide Page 12 [1124‑11‑4] FEMA 3237 Flavis 14.. see 4.6. nutty. ≤2.39 Fen. see 5.11.0.3.027 CoE Nr 4226 W323802-100G 100 g Organoleptic: sour Halal. meaty.. see Theaspirane Page 123 1. see Thioacetic acid Page 123 Thiolactic acid...1. 752  ≥95% FEMA 3323 Flavis 15. FG Organoleptic: chocolate. earthy.6. Difurfuryl monosulfide > (±)-Theaspirane.. see Theaspirane Page 123 Thiacetic acid.6-Tetramethylpyrazine 5 kg 1 kg [67‑03‑8] C12H17ClN4OS · HCl W332100-25G-K 1 kg W421001-5KG W377406-5KG-K Aneurine hydrochloride. see 2-Thiophenethiol Page 123 > (1S.. coffee..4-Tetrahydroquinoline THQ [635‑46‑1] C9H11N FW 133.10.. Kosher..098 CoE Nr 10515 W516007-1KG 1 kg W516007-5KG 5 kg W516007-10KG 10 kg > Tetrahydroquinoxaline.. 751  ≥98%  mixture of cis and trans.... see Cedrol Page 26 Feel inspired at safcglobal.5-Dihydro-3(2H)-thiophenone Page 36 2-Thiophenethiol [288‑47‑1] C3H3NS FW 85.8-Tetramethyltricyclo[5.3. 797 W361518-100G-K W323705-250G-K  ≥98%. Vitamin B1 hydrochloride W332100-SAMPLE-K 100 g W421001-1KG W377406-1KG-K Thiamine hydrochloride FEMA 3321 Flavis 14.5S.Thiophenethiol > Tetrahydropyrrole..11..20 Arc. 2. Thienylmercaptan  ≥99%. woody.25  ≥98%.5]dec-6-ene.31  96% Fen. NI Fen.. see o-Toluenethiol Page 124 5 kg FEMA 3615 Flavis 15.10-Tetramethyl-1-oxaspiro[4. FG [7774‑74‑5] C4H4S2 FW 116.2′-(Thiodimethylene)difuran [13678‑67‑6] C10H10O2S FW 194. see 2-Methoxythiophenol Page 81 Thiolacetic acid..04.199 W421001-SAMPLE Natural occurrence: Black chokeberry.12 Organoleptic: caramel.5] undecan-8-ol.15-Tetramethyl-1-hexadecen-3-ol. 2934. wine-like Halal. ≥85%.8R)-2.8-Tetrahydroquinoxaline Page 123 Cyclohexapyrazine.2. vanilla.15-Tetramethyl-2-hexadecen-1-ol..9]tridecane.4-Butanedithiol Page 20 Tetramethyleneimine. musty. passion fruit juice and cherimoya. coffee Halal.5..com 123 . 753 Fen.10. ≥98%.. grape.19 Fen.19 Thioacetic acid (±)-Theaspirane.2R.008 CoE Nr 2333  natural.. 747 [507‑09‑5] CH3COSH C2H4OS FW 76. coffee Halal.5]dec-6-ene Thiacetic acid [36431‑72‑8] C13H22O FW 194. see 4. Kosher W306207-SAMPLE-K W306207-25G-K 25 g W306207-100G-K 100 g W306207-1KG-K 1 kg Dithienyl disulfide [6911‑51‑9] C8H6S4 FW 230.3. FG FEMA 3238 Flavis 13. FG Organoleptic: cheese Halal. see 2-Mercaptopropionic acid Page 79 Thio-2-naphthol (β)..5.001 CoE Nr 478 W361518-SAMPLE-K 25 g CoE Nr 734 W361518-1KG-K 1 kg 2-Thienyl disulfide 250 g 1 kg W323705-5KG-K 5 kg > Thioguaiacol.8-Tetrahydroquinoxaline 100 g  ≥97%. Kosher. Fen. see Thioacetic acid Page 123 Fen.6..7. FG Organoleptic: chocolate. NI 25 g W332100-100G-K 100 g W332100-1KG-K 1 kg W332100-5KG-K 5 kg > Tetrahydrothiophen-3-one.27 W323802-SAMPLE  ≥98%.018 C8H12N2 FW 136.6. NI > o-Thiocresol.. see 2-Naphthalenethiol Page 96 3-Thiophanone.. garlic) Halal. Kosher.3.. fatty.. FG W516007-SAMPLE FEMA 3774 Flavis 13. minty.01. 753  FG Organoleptic: nutty Halal.9-Tetramethyl-13-oxatricyclo[8.6.7. see Pyrrolidine Page 116 Theaspirane 1.. coffee Halal.0% (Karl Fischer) W332305-SAMPLE-K W323713-SAMPLE-K W332305-1G-K 1g W323713-25G-K 25 g W332305-25G-K 25 g W323713-100G-K 100 g W332305-100G-K 100 g W323713-1KG-K 1 kg > Thienylmercaptan.. 752 2-Mercaptothiophene. FCC W323802-25G 25 g FEMA 3322 Flavis 16. see Phytol Page 111 2. white wine.7.13 100 g W323705-1KG-K Natural occurrence: Coffee. see 1. NI water .... alliaceous (onion.7R. Organoleptic: berry.10-Tetramethyl-1-oxaspiro [4. green. 749 FW 337..028 CoE Nr 11642 2.. NI FEMA 3062 Flavis 15.. see Isophytol Page 71 3.. Tetrahydroquinoxaline [34413‑35‑9] C8H10N2 FW 134.18 FEMA 4210 Flavis 12.. see Pyrrolidine Page 116 3.. vegetable.. raspberry. NI W323802-250G 250 g W323802-1KG 1 kg W332208-SAMPLE-K W332208-1KG-K 1 kg W332208-5KG-K 5 kg W332208-10KG-K 10 kg Thiazole Fen.015 CoE Nr 721 W421001-100G Furfuryl sulfide.. Organoleptic: cheese.6..

wine-like. 756  ≥99%. . FCC [529‑20‑4] CH3C6H4CHO C8H8O FW 120. woody. see trans-2-Methyl-2-butenoic acid Page 83 Tiglic aldehyde. warm W306800-25KG-K 25 kg W530462-SAMPLE-K Tolu balsam from synthetic Kosher W306908-1KG-K W530462-25G-K 25 g W530462-100G-K 100 g > Tony Red. minty. 272 France origin W306509-SAMPLE-K W306801-25G 25 g W306801-100G 100 g W306801-1KG 1 kg m-Tolualdehyde [620‑23‑5] CH3C6H4CHO C8H8O FW 120. see Sudan III Page 120 W306908-SAMPLE-K > Thymus vulgaris. 762  ≥99% FEMA 3077 Flavis 9. Certified organic (NOP/EU) 8 [8037‑19‑2] Place an order with your local SAFC representative (see back for contacts). o-Thiocresol  natural Thyme oil  white. citrus.27 Arc. 2959. see Trimethylamine N-oxide Page 125 1 kg W306908-5KG-K 5 kg W306908-10KG-K 10 kg > α-Toluenethiol. see trans-2-Methyl-2-butenal Page 83 TMANO.17 o-Tolualdehyde 1 kg W306401-1KG-K Halal. 757 Natural occurrence: Buchu oil grapefruit oil. D-beta. FCC FEMA 3066 Flavis 4.029 CoE Nr 115 W307718-5KG 5 kg Arc.22 FEMA 3068 Flavis 5.036 CoE Nr 226 Organoleptic: anise NI W307300-SAMPLE W307300-1KG 1 kg W307300-5KG 5 kg W307300-10KG 10 kg p-Tolyl phenylacetate [101‑94‑0] C6H5CH2CO2C6H4CH3 C15H14O2 FW 226.028 W306802-SAMPLE W306802-25G 25 g 1 kg W306802-100G 100 g W306509-4KG-K 4 kg W306802-1KG 1 kg W306509-9KG-K 9 kg 5 kg > p-Toluquinoline. Kosher Organoleptic: meaty. herbaceous. herbaceous. and licorice. green Kosher Fen. 758 2-Methylbenzaldehyde  white. see 6-Methylquinoline Page 93 α-Tolyaldehyde. see L-(+)-Tartaric acid Page 121 L-Threoascorbic acid. Fen. see 2′-Methylacetophenone Page 81 α-Tolylic acid. 272 Spain origin W306401-SAMPLE-K 8  mixed. spicy. see Benzyl mercaptan Page 18 124 1 kg W324000-5KG-K > 1-(2-Tolyl)ethanone. NI Fen. NI Organoleptic: woody.15 FEMA 3068 Flavis 5. green Kosher. floral. FG FEMA 3240 Flavis 12. Kosher NI Arc. 2-Isopropyl-5-methylphenol [104‑87‑0] CH3C6H4CHO C8H8O FW 120. camphoraceous. smoky. fruity. from synthetic (5% linalool added) Organoleptic: honey. garlic) NI W324000-SAMPLE-K Tocopherols W306540-SAMPLE-K W306540-1KG-K [137‑06‑4] CH3C6H4SH C7H8S FW 124. from (Primary material from Thymus vulgaris and/or Thymus zygis) from synthetic or plant Organoleptic: honey. camphoraceous. D-delta.20 from Nicotiana spp. Fen. see 1. FG Antioxidant used with fats and oils to delay rancidity onset Mixture of D-alpha. rich.4-Tetrahydroquinoline Page 123 L-Threaric acid.006 CoE Nr 174 Organoleptic: cherry Halal.027 CoE Nr 2272 W530455-SAMPLE 8 FEMA 3065 Kosher Albania origin W530455-100G 100 g W530455-1KG 1 kg 1 kg  red FEMA 3064 Natural Occurrence: Thyme. sweet. Kosher W530066-SAMPLE-K W530066-1KG-K W530066-5KG-K 1 kg 5 kg W306401-4KG-K 4 kg W306401-9KG-K 9 kg W306801-SAMPLE Natural Occurrence: Thyme. 739. floral. citrus. Fen. from synthetic Kosher. spicy. see L-Ascorbic acid Page 15 Tobacco absolute  ≥97%. FCC W324000-100G-K [140‑39‑6] CH3CO2C6H4CH3 C9H10O2 FW 150. Fen. see trans-2-Methyl-2-butenal Page 83 Tiglinaldehyde. 5-Methyl-2-(1-methylethyl)phenol. coffee France origin W306800-SAMPLE-K W306606-SAMPLE-K [9000‑64‑0] FEMA 3069 W306606-1KG-K 1 kg W306606-5KG-K 5 kg W306606-10KG-K 10 kg Tonka bean absolute 8 [8046‑22‑8]  natural W306800-1KG-K 1 kg W306800-10KG-K 10 kg from Dipteryx odorata Kosher Organoleptic: coumarin. and D-gammaTocopherols. see Benzenethiol Page 16 THQ.2. alliaceous (onion.709 CoE Nr 236 Organoleptic: hyacinth p-Tolualdehyde W307718-SAMPLE 4-Methylbenzaldehyde 5-Methyl-2-isopropylphenol. woody. earthy. FCC. minty. spicy.026 FEMA 3065 100 g W324000-500G-K Arc. fruity.15 W307718-100G 100 g  ≥97% W307718-1KG 1 kg [89‑83‑8] 2-[(CH3)2CH]C6H3-5-(CH3)OH C10H14O FW 150.SAFC® Flavors & Fragrances Thiophenol > Thiophenol. see Phenylacetaldehyde Page 108 p-Tolyl acetate p-Cresyl acetate FEMA 3073 Flavis 9. 2944. see Benzyl mercaptan Page 18 3-Methylbenzaldehyde W306509-1KG-K Thymol 500 g W324000-1KG-K  ≥98%. 725. see Thyme oil Page 124 Tiglic acid. blackberry. fruity.15 FEMA 3068 Flavis 5. Organoleptic: tobacco [8007‑46‑3] o-Toluenethiol 2-Methylbenzenethiol. see Phenylacetic acid Page 108 α-Tolyl mercaptan. sweet.3.

009 (CH3)3N C3H9N FW 59. % in H2O W308005-10KG 10 kg W338818-4KG-K 4 kg FEMA 3241 CoE Nr 10497 W338818-8KG-K 8 kg Organoleptic: oily. Fen. Tributyrin [60‑01‑5] (CH3CH2CH2COOCH2)2CHOCOCH2CH2CH3 C15H26O6 FW 302. 2262. 766 Organoleptic: waxy. 765  ≥98%  ≥96% FEMA 3388 Flavis 7. herbaceous.3-Triethoxypropane.28 W308315-SAMPLE W308315-1KG 1 kg W308315-5KG 5 kg > 3. 763  ≥95% [10486‑19‑8] CH3(CH2)11CHO C13H26O FW 198. 764 Arc. Kosher.11 Fen. ≥97% 2-Tridecanone Acetyl tributyl citrate [77‑93‑0] FEMA 3083 Flavis 9. FCC  ≥98% > 1. Glyceryl tributyrate. herbaceous Halal.2. see Tricosanoic acid tryptamide Page 125 Triacetin Glyceryl triacetate.5%.34 Arc. Fen.3-Triacetylglycerol. see Resveratrol Page 117 Trimethylamine solution [75‑50‑3] Flavis 11.2.211 CoE Nr 747 W324108-1KG-K W324108-5KG-K FEMA 3082 Flavis 5. NI contains 0. see Propyl gallate Page 114 4′.3-Tributyrylglycerol. FCC.33 Organoleptic: caramel. see Naringenin Page 96 3′. FCC W324108-20KG-K 20 kg  25 wt.7-Trihydroxy-4-methoxyflavanone. fatty Halal 5 kg W324108-10KG-K 10 kg  ≥92%. meaty. FG FEMA 4335 FEMA 2007 Kosher Halal.103 CoE Nr 11194 FEMA 3080 Flavis 9. see Triacetin Page 125 Tribenzoin. 2990 Organoleptic: wine-like. NI W433500-SAMPLE-K W200700-SAMPLE-K W433500-100G-K W200700-1KG-K 1 kg W200700-10KG-K 10 kg W200700-25KG-K 25 kg 8 100 g Tridecanoic acid 8 [638‑53‑9] CH3(CH2)11CO2H C13H26O2 FW 214.81 W424601-20KG 20 kg  analytical standard.36 Arc. Kosher.α-Trimethylbenzyl alcohol [99‑14‑9] (HO2CCH2)2CHCO2H C6H8O6 FW 176. 1.023 Fen.20 Tridecyl aldehyde Arc.2.12 [121‑44‑8] (C2H5)3N C6H15N FW 101. 1.5. 2973.078 CoE Nr 2011  97%.5-Trihydroxybenzoic acid propyl ester.042 CoE Nr 530 W424601-SAMPLE N-[2-(3-Indolyl)ethyl]tricosanamide.3-Tributyrylglycerol. 767 W308005-1KG 1 kg W338818-100G-K 100 g W308005-5KG 5 kg W338818-1KG-K 1 kg  25 wt.511 Organoleptic: wine-like. NI Tributyrin Glycerol tributyrate. 2972.0% (HPLC) 56924-100MG-F 100 mg Feel inspired at safcglobal.3-Triacetoxypropane Tridecanal [102‑76‑1] (CH3COOCH2)2CHOCOCH3 C9H14O6 FW 218.7-Trihydroxyflavanone. 766 W308307-SAMPLE-K W308307-1KG-K 1 kg W308307-10KG-K 10 kg W308307-25KG-K 25 kg  natural. for food analysis ≥99.3-Triacetylglycerol.1. citrus Kosher. creamy. sweet.2.025 NI W424501 p.50% alpha-tocopherol. see Hesperetin Page 59 3. synthetic as antioxidant FEMA 2223 Flavis 9.2.α. Fen.3-Triacetoxypropane. FG 8 Organoleptic: plum.4. see Triacetin Page 125 1.4′. % in propylene glycol Organoleptic: fishy W550132-1KG 1 kg Trimethylamine N-oxide W308218-SAMPLE-K W222305-SAMPLE 1 kg Arc. 1. Fen. wine-like W433600-SAMPLE Tributyl 2-acetylcitrate Ethyl citrate  ≥99%.3-Propanetricarboxylic acid TMANO FEMA 4245 Flavis 11. 768 NI  ≥90% Tricosanoic acid tryptamide FEMA 3242 Flavis 2.5-Trihydroxy-trans-stilbene. see Glyceryl tribenzoate Page 56 Triethyl citrate 1 kg W308218-100G-K 100 g W222305-5KG 5 kg W308218-1KG-K 1 kg [1184‑78‑7] (CH3)3N(O) C3H9NO FW 75. plum. Kosher.com Organoleptic: walnut Halal. sweet NI Organoleptic: spicy.22 W508306-SAMPLE FEMA 4246 Flavis 11. Fen. NI W308005-SAMPLE W338818-SAMPLE-K Arc. TAT W424601-1KG 1 kg W424601-8KG 8 kg [152766‑93‑3] C33H56N2O FW 496. 303 W324108-SAMPLE-K trans-2-Tridecenal [7774‑82‑5] CH3(CH2)9CH=CHCHO C13H24O FW 196.11 W222305-10KG 10 kg W308218-4KG-K 4 kg  98% W222305-1KG > 1. NI W324205-SAMPLE-K W324205-100G-K 100 g W324205-1KG-K 1 kg W324205-5KG-K 5 kg 125 . 2987.2.2.512 CoE Nr 11762 HOC(COOC2H5)(CH2COOC2H5)2 C12H20O7 FW 276. 2971. NI Fen. sweet Halal.34  ≥98. see Tributyrin Page 125 Tricarballylic acid > Tridecyl aldehyde. fishy Kosher.Trimethylbenzyl > N-Tricosanoyltryptamine.34 FEMA 4336 W433600-1KG [77‑90‑7] CH3CO2C[CO2(CH2)3CH3][CH2CO2(CH2)3CH3]2 C20H34O8 FW 402. see 3-Ethoxypropionaldehyde diethyl acetal Page 42 Triethylamine 1.5. N-Tricosanoyltryptamine. see Tridecanal Page 125 1. Kosher.48 1 kg Methyl undecyl ketone [593‑08‑8] CH3(CH2)10COCH3 C13H26O FW 198.19  ≥99%  ≥99.5% [1197‑01‑9] CH3C6H4C(CH3)2OH C10H14O FW 150.

..1.4-dione.. herbaceous NI W324426-100G-K 100 g W324426-1KG-K 1 kg W332402-SAMPLE W332402-1KG 1 kg W332402-8KG 8 kg W332402-20KG 20 kg > (−)-1.3-Propanedithiol Page 112 3.085  ≥95% W396303-SAMPLE Kosher W396303-SAMPLE-K W396303-1KG-K 1 kg W396303-5KG-K 5 kg 2.19 W328618-10KG-K 10 kg  ≥97% W328618-25KG-K 25 kg FEMA 3963 Flavis 4.5-Trimethyl-1-hexanol Organoleptic: peanut Kosher [3452‑97‑9] (CH3)3CCH2CH(CH3)CH2CH2OH C9H20O FW 144..6. NI W520012-5KG > Trisodium citrate dihydrate.7... coffee..1]hept-3-en-2-one...24 Arc.... Gerard Mosciano. see Caffeine Page 24  99% FEMA 4394 Flavis 13. see (R)-(+)-N.4. 10-20% Natural occurrence: Heated beef.39 W524107-SAMPLE W524107-1KG 1 kg W524107-5KG 5 kg W524107-10KG 10 kg 2. hazelnut Halal.. NI Organoleptic: beef β-cyclocitral ....28 Fen..10-dodecatrien-3-ol.... 770  ≥75% FEMA 3474 Flavis 5.3.6-Trimethylbicyclo[3...α-Trimethylbenzylamine....14 Fen..1.026  99% W424701 FEMA 4329 Flavis 4.019 CoE Nr 11650 Organoleptic: chocolate.6.11-Trimethyl-2.5-Trimethylthiazole [13623‑11‑5] C6H9NS FW 127.10-dodecatrienal.NDimethyl-1-phenylethylamine Page 39 (1R)-1.5-Trimethyloxazole Page 126 2.3% Arc.11-Trimethyl-1..4.6.1]hept-2-ene.2....5...32  ≥95% 2. Perfum.. see LFenchone Page 52 1.....3.and β.... see (±)-Camphor Page 24 (1R.19 FEMA 4247 Flavis 11.5.7. 776 > Trimethyl trithioorthoformate...10-dodecatrien-1-ol..7.... FG W520012-1KG 1 kg W352403-1KG-K 1 kg CoE Nr 735 5 kg W352403-4KG-K 4 kg Organoleptic: chocolate... Fen. see Tris(methylthio)methane Page 126 1. see Sodium citrate dihydrate Page 119 W324418-SAMPLE-K 126  ≥98%..6-Trimethyl-1-cyclohexene-1-acetaldehyde β-Homocyclocitral  natural..2.. see Eucalyptol Page 51 Trimethyloxazole.4. Dutch cocoa. autolyzed yeast...1 Possible applications: Chocolate.7-Trimethylbicyclo[2...17 W520012-25G 25 g W352403-SAMPLE-K Fen.SAFC® Flavors & Fragrances Trimethylbenzyl > (R)-(+)-N.....6-Trimethyl-2-cyclohexenyl)-3-buten-2-one. Kosher.6. various savory meaty flavors.6-Trimethyl-1-cyclohexenyl)-3-buten-2-one..5-Trimethylhexanal [5435‑64‑3] (CH3)3CCH2CH(CH3)CH2CHO C9H18O FW 142.. see (1S)-(−)-Verbenone Page 129 endo-(1S)-1... see (−)-αPinene Page 111 3. 3007.6-Trimethyl-1-cyclohexene-1-carboxaldehyde..4.26 2.112 CoE Nr 10338 Halal.. see βIonone Page 67 4-(2. see L-Fenchone Page 52 1.6.3.6-Trimethylphenol 8 W328607 Tripropylamine [102‑69‑2] (CH3CH2CH2)3N C9H21N FW 143.019 C7H10N2 FW 122..6...6.3..25 water .1 Organoleptic: beef...7-Trimethylbicyclo[4.5S)-2.. see Farnesol Page 52 Trimethylene dimercaptan. coffee Halal...5.Page 52 1.3. see 1.0]hept-3-ene.1..21 W324418-100G-K 100 g W324418-1KG-K 1 kg W324418-5KG-K 5 kg Place an order with your local SAFC representative (see back for contacts). Flavor....095 Tris(methylthio)methane W432900-SAMPLE W432900-1KG 1 kg Trimethyl trithioorthoformate [5418‑86‑0] (CH3S)3CH C4H10S3 FW 154..6.1]heptan-2-one. 306  FCC..055 CoE Nr 702 W324426-25G-K 25 g Organoleptic: oily.. see Farnesal..1]hept-2-ene.6-Trimethylbicyclo[3... 3006.3-Trimethyl-2-norbornanone. hazelnut. cited: 1. see Fenchyl acetate. cooked pork.. 776 W520012-100G 100 g W520012-SAMPLE W352403-100G-K 100 g  ≥99%...6. Fen..3.6...... see (1R)(+)-α-Pinene Page 111 (1S..2]octane.27  ≥98% Mesitol [527‑60‑6] (CH3)3C6H2OH C9H12O FW 136..2..7.. ≥80% 3. see Isophorone Page 71 4-(2.6-Trimethylphenol 1 kg W328618-5KG-K 5 kg [2416‑94‑6] (CH3)3C6H2OH C9H12O FW 136. 34 (1)..3-Trimethyl-2-norbornanyl acetate.1]hept-2yl]cyclohexan-1-ol [3407‑42‑9] C16H28O FW 236.. see 2.. FG FEMA 3286 CoE Nr 10657 W439400-SAMPLE W439400-1KG Fen. 773 W324426-SAMPLE-K  ≥85% FEMA 3324 Flavis 2. see Nerolidol Page 96 3. French fries.1]hept-2-yl acetate. NI W332518-SAMPLE-K W332518-25G-K 25 g W332518-100G-K 100 g W332518-1KG-K 1 kg Tripropionin Glyceryl tripropionate [139‑45‑7] Flavis 9.2. see (−)-Bornyl acetate Page 20 3-[5...6.116 CoE Nr 10384  ≥98% Organoleptic: earthy Kosher [14667‑55‑1] FEMA 3244 Flavis 14.11-Trimethyl-2.1. cooked egg and fried chicken. cocoa.169 [472‑66‑2] C11H18O FW 166..263 (C2H5CO2CH2)2CH(O2CC2H5) C12H20O6 FW 260...3-Trimethylbicyclo[2. see βCyclocitral Page 31 2....N.3.2.. FCC.5-Trimethylpyrazine FEMA 3524 Flavis 5. 58-59 (2009) W347418-SAMPLE W347418-25G 25 g W347418-100G 100 g > 2. Kosher...7-Trimethylbicyclo[2... Kosher 1 kg W328618-SAMPLE-K W328618-1KG-K 2.. mixture of isomers Page 52 3.6-Trimethyl-2-cyclohexene-1. ≤0. see αIonone Page 66 3. 773 FEMA 3325 Flavis 15.7.. ....5.1]heptan-2-one.. FG Halal.7.5-Trimethyl-2-cyclohexen-1-one. chocolate Lit....5-Trimethyloxazole 8 Trimethyloxazole [20662‑84‑4] C6H9NO FW 111.5R)-2. malt and toasted bread.3-Trimethyl-2-oxabicyclo[2.6-Trimethylbicyclo[3.6-Trimethylbicyclo[2.7-Trimethylxanthine.5S)-4.. mixture of α. see 4-Oxoisophorone Page 103 3. see 3-Carene Page 25 (1S..

see Polysorbate 60 Page 112 TWEEN® 80. Fen.4-Undecadienal [30361‑29‑6] CH3(CH2)5CH=CHCH=CHCHO C11H18O FW 166. spicy Halal. FCC FEMA 3092 Flavis 5. Oil of turpentine [8006‑64‑2] FEMA 3089 W342203-25G-K 25 g W342203-100G-K 100 g W342203-1KG-K 1 kg  natural (US). 780 W324604-25G 25 g W324604-100G 100 g W324604-1KG 1 kg W329401-SAMPLE-K Feel inspired at safcglobal. synthetic as antioxidant Fir oil. see Polysorbate 80 Page 112 Halal. heated butter. Kosher. 3028. 780 Tyramine 2-(4-Hydroxyphenyl)ethylamine. 2137.007 NI Undecanoic δ-lactone W421501-SAMPLE [710‑04‑3] C11H20O2 FW 184. citrus. Pine oil.011 CoE Nr 688 Natural occurrence: Blackberry.022 NI W309206-SAMPLE-K W347507-25G-K 25 g W373605-100G 100 g W309206-1KG-K 1 kg W347507-100G-K 100 g W373605-1KG 1 kg W309206-4KG-K 4 kg W347507-250G-K 250 g W373605-5KG 5 kg W309206-8KG-K 8 kg W347507-1KG-K 1 kg Trivertal Undecane trans. see Undecane Page 127 W342203-SAMPLE-K L-Turpentine W510505-SAMPLE 500 g  ≥98%. 778 FEMA 3475 Flavis 15. waxy Halal.43 Fen. 3051.31 Arc. milk. Fen. FG Undecanal (S)-2-Amino-3-(4-hydroxyphenyl)propionic acid.50% alpha-tocopherol.26 [27939‑60‑2] C9H14O FW 138. n-Undecane [1120‑21‑4] CH3(CH2)9CH3 C11H24 FW 156. 4-(2-Aminoethyl) phenol. 782  97% FEMA 3246 Flavis 2. coconut. fatty. synthetic Kosher Organoleptic: balsam Brazil origin W510505-1KG > n-Undecane.2. waxy Kosher. Kosher. minty Halal.trans-2.18  99% > Undecanoic acid ethyl ester. Fen. Kosher NI contains 0. Aldehyde C14 W308900-SAMPLE-K 1 kg W510505-4KG [112‑37‑8] CH3(CH2)9COOH C11H22O2 FW 186.002 C11H20O2 FW 184. Fen. NI contains 0. rose. Turpentine. 782 Undecanoic γ-lactone.31 Arc.034 CoE Nr 121 Organoleptic: orange. 781 Fen. FG W324507-100G 100 g W324507-1KG 1 kg W324507-5KG 5 kg CoE Nr 179 > TWEEN® 60. sulfurous. 3024.009 CoE Nr 2334 Natural occurrence: Roast beef. 778  ≥99%. 3022.19 Arc. Fen. ≥98% 1 kg W308900-9KG-K 9 kg W308900-25KG-K 25 kg 8 Undecanoic acid Hendecanoic acid FEMA 3245 Flavis 8. see δ-Undecalactone Page 127 1-Undecanol. 779  ≥98%  ≥99%  ≥90% from synthetic China origin NI FEMA 3422 Flavis 5. NI Arc. 3(4-Hydroxyphenyl)-L-alanine Undecyl aldehyde [60‑18‑4] 4-(HO)C6H4CH2CH(NH2)CO2H C9H11NO3 FW 181.29  ≥96%.21 Hendecane.196 CoE Nr 10385 W524409-SAMPLE W524409-1KG 1 kg W524409-5KG 5 kg W524409-10KG 10 kg Organoleptic: butter. peach.4. coconut and cream Organoleptic: butter. NI  ≥97% W347507-SAMPLE-K W373605-SAMPLE [112‑44‑7] CH3(CH2)9CHO C11H22O FW 170.6-Hexamethyl-s-trithiane [828‑26‑2] C9H18S3 FW 222. Fen. FCC.Undecanol Trithioacetone L-Tyrosine 2. see Undecyl alcohol Page 128 W309109-SAMPLE-K W309109-1KG-K 1 kg W309109-5KG-K 5 kg W309109-10KG-K 10 kg δ-Undecalactone FEMA 4215 Flavis 11.6.28 W421501-25G 25 g W421501-100G 100 g W421501-1KG 1 kg 2-Undecanol Methyl nonyl carbinol [1653‑30‑1] CH3(CH2)8CH(OH)CH3 C11H24O FW 172. see γ-Undecalactone Page 127 Undecanoic δ-lactone. see Ethyl undecanoate Page 51 Undecanoic γ-lactone.com W329401-100G-K 100 g W329401-1KG-K 1 kg W329401-5KG-K 5 kg 127 . earthy. 4-Hydroxyphenethylamine [51‑67‑2] HOC6H4CH2CH2NH2 C8H11NO FW 137. Kosher. sweet.28 W308900-1KG-K 4 kg W510505-8KG Arc.086  >97% W324604-SAMPLE FEMA 3294 Flavis 10.4.025% BHT as stabilizer FEMA 3736 Flavis 17. 3025. earthy Arc.29 γ-Undecalactone from Pinus spp. NI Organoleptic: musty.042 CoE Nr 696 Organoleptic: oily NI W324507-SAMPLE W309101-SAMPLE W309101-500G 8 kg  ≥97% [104‑67‑6] FEMA 3091 Flavis 10. Organoleptic: berry.

. (3R. Fen.6.007 CoE Nr 7 Halal... lime.. Alcohol C11 [112‑42‑5] CH3(CH2)10OH C11H24O FW 172.31 Arc.. see Valencene Page 128 [112‑45‑8] H2C=CH(CH2)8CHO C11H20O FW 168. Fen.013 CoE Nr 757 50 g Organoleptic: anise. lemon.7-octahydronaphthalene  ≥96% [4630‑07‑3] C15H24 FW 204.. synthetic as additive cis-2-undecenal .28 (+)-Valencene.. 4..50% alpha-tocopherol.. see 10-Undecenal Page 128 Place an order with your local SAFC representative (see back for contacts). 789  ≥97% W309508-100G-K 100 g W309508-1KG-K 1 kg Organoleptic: nutty.12 FEMA 3247 Flavis 8.057 CoE Nr 751 Organoleptic: grape.. Kosher. 3031.... see Valeric acid Page 128 10-Undecenoic acid  ≥95% trans-2-Undecenal 128 Valencene cis-8-Undecenal Arc..28  natural. Kosher.4a.. vanilla. 786 [108‑29‑2] C5H8O2 FW 100. see Undecanal Page 127 Undecylenic acid (±)-γ-Valerolactone [112‑38‑9] CI 42650 CH2=CH(CH2)8COOH C11H20O2 FW 184. Fen. fruity. 2140.4. 789 FEMA 3097 Flavis 2.. ≥65% > (+)-Valencene.SAFC® Flavors & Fragrances Undecanone 2-Undecanone Methyl nonyl ketone [112‑12‑9] FEMA 3093 Flavis 7. herbaceous Halal.. 788 Pentanoic acid.. 790  ≥98%.5-Undecatriene. NI W309702-SAMPLE-K  ≥99%.. 788 W526908-SAMPLE-K from oranges Kosher W526908-25G-K 25 g W526908-100G-K 100 g W526908-1KG-K 1 kg 10-Undecenal Undecylenic aldehyde CoE Nr 150c W309311-SAMPLE-K W309311-25G-K 25 g W309311-100G-K 100 g W309311-1KG-K 1 kg 6-Undecanone Dipentyl ketone. FG FEMA 3103 Flavis 10.. Fen.3(E).005 CoE Nr 93 Arc. 1 kg .1-3...13  97% Arc. citrus Halal.26 Fen. 3059.5% W342300-SAMPLE-K W342300-100G-K 100 g W342300-1KG-K 1 kg W342300-4KG-K 4 kg 1 kg > n-Valeric acid.5(E) isomers [16356‑11‑9] CH3(CH2)4(CH=CH)2CH=CH2 C11H18 FW 150.035 CoE Nr 122 Pentanal Organoleptic: fatty. 3033.. NI W324701-1KG 1 kg W310301-SAMPLE-K W324701-10KG 10 kg W310301-1KG-K W324701-20KG 20 kg W310301-5KG-K 5 kg W310301-10KG-K 10 kg > Undecylenic acid methyl ester.016 CH3(CH2)8COCH3 C11H22O FW 170.. FCC W309818-1KG-K 1 kg W309818-4KG-K 4 kg W309818-8KG-K 8 kg W309818-20KG-K 20 kg Valeric acid 1-Undecanol.35 Kosher contains 0.2. waxy. herbaceous. FCC. Kosher... green Kosher contains 0. 786 [110‑62‑3] CH3(CH2)3CHO C5H10O FW 86. woody Halal.249 W402206-100G 100 g W402206-1KG 1 kg W402206-4KG 4 kg 1.. sweet Halal.3.13 W309508-SAMPLE-K FEMA 3098 Flavis 5.5...50% alpha-tocopherol..061 W310107-1KG-K W309702-8KG-K 8 kg W310107-5KG-K 5 kg W310107-10KG-K 10 kg W310107-25KG-K 25 kg Organoleptic: pineapple.017 CoE Nr 11030 Valeraldehyde  ≥90% Kosher Organoleptic: citrus. ≥97%. see Methyl 10-undecenoate Page 95 Undecyl alcohol W402206-SAMPLE FEMA 3443 Flavis 1. see Undecylenic acid Page 128 10-Undecenoic acid methyl ester.5-Dihydro-5-methyl-2 (3H)-furanone..29 Arc.039 CoE Nr 689 [53448‑07‑0] CH3(CH2)7CH=CHCHO C11H20O FW 168. mixture of 1... FCC FEMA 3101 Flavis 8. FCC. Fen. 4-Hydroxypentanoic acid lactone Arc. fruity contains 0... earthy W309702-1KG-K 1 kg  ≥70% W310107-SAMPLE-K W309702-4KG-K 4 kg FEMA 3795 Flavis 1. rose..28 γ-Methyl-γ-butyrolactone. 3049. see Methyl 10-undecenoate Page 95 Undecylenic aldehyde.. 783  ≥98%. Fen.3(E). sweet Kosher Arc.5 (Z) and 1... NI Arc. Fen. Kosher.5-Dimethyl-3-isopropenyl-1..29 FEMA 4022 Flavis 7. 3035.4aS. NI W309508-4KG-K 4 kg W309818-SAMPLE-K > 10-Undecenoic acid. NI Organoleptic: animal. Fen. synthetic as antioxidant W379506-SAMPLE-K W379506-25G-K 25 g W379506-100G-K 100 g W379506-1KG-K 1 kg > Undecyl aldehyde. rose  natural... n-Valeric acid [109‑52‑4] CH3(CH2)3COOH C5H10O2 FW 102.10% alpha-tocopherol.. Kosher. sweet Halal. 0. FG CoE Nr 150 Organoleptic: iris.. 784 W344303-SAMPLE-K W344303-25G-K 25 g W344303-100G-K 100 g W344303-1KG-K 1 kg FEMA 3095 Flavis 5.184 CoE Nr 11827 Halal. Kosher..3. Diamyl ketone [927‑49‑1] CH3(CH2)4CO(CH2)4CH3 C11H22O FW 170. citrus.28 Organoleptic: woody. NI Organoleptic: orange. NI W309303-SAMPLE-K W309303-250G-K 250 g W309303-1KG-K 1 kg W309303-4KG-K 4 kg W309303-8KG-K 8 kg [147159‑49‑7] CH3CH2CH=CH(CH2)6CHO C11H20O FW 168. 785 W324701-SAMPLE  ≥90% W324701-50G FEMA 3423 Flavis 5. synthetic as antioxidant Fen. fruity.. 3052. 3056.5R)-4a.. green.

Vicxylenol
L-Valine

Vanillin acetate

(S)-α-Aminoisovaleric acid; L-2-Amino-3-methylbutanoic acid
[72‑18‑4] (CH3)2CHCH(NH2)CO2H C5H11NO2
FW 117.15

Vanillyl butyl ether

4-Formyl-2-methoxyphenyl acetate
[881‑68‑5] CH3CO2C6H3-4-(CHO)-2-OCH3 C10H10O4
FW 194.18

[82654‑98‑6] 4-(HO)C6H3-3-(OCH3)CH2O(CH2)3CH3
C12H18O3 FW 210.27

Fen. 794

Arc. 49; Fen. 791

 FCC

 ≥96%

 ≥98%

FEMA 3796 Flavis 4.093

Flavis 17.028

FEMA 3108 Flavis 9.035 CoE Nr 225

W379603-SAMPLE

W527718-SAMPLE

Organoleptic: balsam; floral
Kosher, NI

W379603-100G

100 g

W379603-1KG

1 kg

W379603-5KG

5 kg

W527718-100G

100 g

W527718-1KG

1 kg

DL-Valine
DL-2-Amino-3-methylbutanoic

valeric acid

acid; (±)-α-Aminoiso-

[516‑06‑3] (CH3)2CHCH(NH2)COOH C5H11NO2
FW 117.15

W310808-SAMPLE-K
W310808-100G-K

100 g

W310808-1KG-K

1 kg

W310808-5KG-K

5 kg

Vanillin isobutyrate

[120‑14‑9] (CH3O)2C6H3CHO C9H10O3 FW 166.17

Arc. 3065; Fen. 791

[20665‑85‑4] (CH3)2CHCO2C6H3-2-(OCH3)-4-(CHO)
C12H14O4 FW 222.24

 ≥97%

Fen. 794

FEMA 3444 Flavis 17.023

 ≥98%, FG

NI
1 kg

Organoleptic: almond; cherry; chocolate; creamy
Halal, Kosher

W344400-5KG

5 kg

W375403-SAMPLE-K

W344400-10KG

10 kg

W344400-1KG

Vanillic acid
4-Hydroxy-3-methoxybenzoic acid

W375403-100G-K

100 g

W375403-1KG-K

1 kg

W375403-5KG-K

5 kg

> Vanillin methyl ether, see Veratraldehyde Page 129

[121‑34‑6] HOC6H3(OCH3)CO2H C8H8O4
FW 168.15

Vanillylacetone

Arc. 3066

 ≥97%
FEMA 3988 Flavis 8.043

[122‑48‑5] 4-(HO)C6H3-3-(OCH3)CH2CH2COCH3
C11H14O3 FW 194.23

W398802-SAMPLE-K

 ≥98%, FG
Natural occurrence: Essential oils of cymbopogon
and jananensis.
Organoleptic: caramel; cherry; creamy; woody;
citrus; minty
Halal, Kosher, NI
W310905-SAMPLE-K
W310905-1KG-K

1 kg

W310905-5KG-K

5 kg

W310905-10KG-K

10 kg

W310905-25KG-K

25 kg

> Veratrole, see 1,2-Dimethoxybenzene Page 36

Zingerone

Natural Occurrence: Guava, grape, brandy, rum,
whiskey, sherry, red and white wines, Scotch and
Canadian whiskey.
Organoleptic: chocolate; creamy; grape; nutty;
wine-like
Halal, Kosher

Arc. 3077; Fen. 795
FEMA 3109 Flavis 5.017 CoE Nr 106

FEMA 3754 Flavis 9.811

W344400-SAMPLE

Veratraldehyde
Veratraldehyde; Vanillin methyl ether; 3,4Dimethoxybenzaldehyde

(1S)-(−)-Verbenone

Arc. 3101; Fen. 799

(1S,5S)-2-Pinen-4-one; (1S,5S)-4,6,6-Trimethylbicyclo[3.1.1]hept-3-en-2-one

 ≥96%

[1196‑01‑6] C10H14O FW 150.22

Arc. 3079

FEMA 3124 Flavis 7.005 CoE Nr 139

Natural occurrence: Cranberry and ginger.
Organoleptic: clove; creamy; spicy; sweet; animal
Halal, NI

 ≥93%

W312401-SAMPLE

W506907-SAMPLE-K

Organoleptic: minty; spicy; vanilla
Kosher

W398802-100G-K

100 g

W398802-1KG-K

1 kg

W312401-100G

100 g

W506907-100G-K

100 g

W398802-5KG-K

5 kg

W312401-250G

250 g

W506907-1KG-K

1 kg

W398802-10KG-K

10 kg

W312401-1KG

1 kg

W506907-5KG-K

5 kg

Vanillin

Vetiver acetate, Java

Vanillyl alcohol

4-Hydroxy-3-methoxybenzaldehyde

4-Hydroxy-3-methoxybenzyl alcohol; Vanillyl alcohol

[62563‑80‑8]

[121‑33‑5] FEMA 3107 Flavis 5.018
4-(HO)C6H3-3-(OCH3)CHO C8H8O3 FW 152.15

[498‑00‑0] HOC6H3(OCH3)CH2OH C8H10O3
FW 154.16

Arc. 3073

from synthetic
Organoleptic: sweet
USA origin

 ≥98%

W524301-SAMPLE

FEMA 3737 Flavis 2.213 CoE Nr 690

W524301-1KG

Possible uses: vanilla, coconut, cream and other
dairy nuances, coumarin notes.1
Natural occurrence: Beer1
Kosher
Organoleptic: anise
Lit. cited: 1. Mosciano, Gerard, Perfum. Flavor. 5, 34, 51

W524301-5KG

5 kg

W524301-10KG

10 kg

Organoleptic: caramel; chocolate; sweet; vanilla
Arc. 3067; Fen. 792

 ≥97%, FCC, FG
CoE Nr 107

Halal, Kosher, NI
W310700-SAMPLE-K
W310700-1KG-K

1 kg

W310700-10KG-K

10 kg

W310700-25KG-K

25 kg

1 kg

> vic.-m-Xylenol, see 2,6-Xylenol Page 130

(2009)

W373702-SAMPLE-K

 natural, ≥97%, FCC, FG
produced from rice bran ferulic acid
Halal, Kosher

W373702-100G-K

100 g

W373702-1KG-K

1 kg

Soy .............................................................. <0.500 ppm

W373702-5KG-K

5 kg

W310727-SAMPLE-K
W310727-100G-K

100 g

W310727-1KG-K

1 kg

Feel inspired at safcglobal.com

129

SAFC® Flavors & Fragrances
Vinylanisole
2-Vinylanisole

2,4-Xylenol

[612‑15‑7] C6H4(OCH3)CHCH2 C9H10O FW 134.18

 98%

Xylitol

2,4-Dimethylphenol; 4-Hydroxy-m-xylene; asym.-mXylenol
[105‑67‑9] (CH3)2C6H3OH C8H10O FW 122.16

[87‑99‑0] HOCH2[CH(OH)]3CH2OH C5H12O5
FW 152.15

contains ~0.1% t-Butylcatechol as inhibitor

Arc. 3098

W507930-SAMPLE

W324801

 ≥98%

W507930-1KG

Flavis 4.066

W507930-5KG

5 kg

W506206-SAMPLE

W507930-10KG

10 kg

FEMA 3248

> Vinylbenzene, see Styrene Page 120

4-Vinylphenol solution
 10 wt. % in propylene glycol, FG

W506206-1KG

1 kg

W506206-5KG

5 kg

W506206-10KG

10 kg

FEMA 3739 Flavis 4.057 CoE Nr 11257

2,5-Xylenol

Halal, Kosher
W373923-SAMPLE-K
W373923-25G-K

25 g

W373923-100G-K

100 g

W373923-1KG-K

1 kg

> 3-Vinylpropionic acid, see 4-Pentenoic acid Page 105

Violet leaf absolute

from Viola odorata l.
Kosher
Organoleptic: cucumber; green; violet
France origin
W311006-1G-K

1g

W311006-25G-K

25 g

W311006-100G-K

100 g

> Violet leaf aldehyde, see trans-2,cis-6-Nonadienal
Page 97
Vitamin B1 hydrochloride, see Thiamine hydrochloride
Page 123
Vitamin C, see L-Ascorbic acid Page 15
Vitis Vinifera, see Cognac oil Page 30

2,5-Dimethylphenol; 2-Hydroxy-p-xylene; p-Xylenol
[95‑87‑4] (CH3)2C6H3OH C8H10O FW 122.16

W359505-250G-K

250 g

W359505-1KG-K

1 kg

W359505-5KG-K

5 kg

W359505-10KG-K

10 kg

W359505-25KG-K

25 kg

1 kg

W311928-5KG-K

5 kg

FEMA 3249 Flavis 4.042 CoE Nr 11261

 Ylang-ylang oil III
III
1 kg

[95‑65‑8] (CH3)2C6H3OH C8H10O FW 122.16

W380318-100G

100 g

W380318-1KG

1 kg

Arc. 3098; Fen. 798

W380318-5KG

5 kg

 ≥98%

from synthetic
Kosher
Organoleptic: apple; floral; green; earthy; woody;
spicy
W311901-SAMPLE-K
W311901-1KG-K

1 kg

W311901-5KG-K

5 kg

> Ylang-ylang oil II, see Ylang-ylang oil Page 130
Ylang-ylang oil III, see Ylang-ylang oil Page 130
Yo-shu oil, see Eucalyptus oil Page 51
Eucalyptus oil Page 51

Zein

FEMA 3596 Flavis 4.048 CoE Nr 11262

NI

[9010‑66‑6]

from maize

[90045‑28‑6]

W359602-SAMPLE

 China origin

W359602-250G

250 g

FEMA 3113

W359602-1KG

1 kg

from Gaultheria procumbens L.
Kosher
Organoleptic: vanilla

W359602-5KG

5 kg

> Xylidine ponceau, see Ponceau Xylidine Page 112
Xylidine ponceau 2R, see Ponceau Xylidine Page 112
Xylite, see Xylitol Page 130

25 kg

1 kg

W311928-1KG-K

3,4-Dimethylphenol; 4-Hydroxy-o-xylene

W311308-25KG-K

W311942-1KG-K

 ≥99%

3,4-Xylenol

1 kg

W311942-SAMPLE-K

W311928-SAMPLE-K

5 kg

10 kg

8

Arc. 3098; Fen. 798

10 kg

W311308-10KG-K

 extra, Certified organic (NOP/EU)

Kosher
Madagascar origin

[576‑26‑1] (CH3)2C6H3OH C8H10O FW 122.16

W324906-10KG

W311308-1KG-K

5 kg

from synthetic
Kosher

 ≥98%

W311308-SAMPLE-K

1 kg

W311936-5KG-K

2-Hydroxy-m-xylene; vic.-m-Xylenol; 2,6-Dimethylphenol

W324906-5KG

Wintergreen oil

W311936-1KG-K

 Ylang-ylang oil II
II

2,6-Xylenol

W324906-1KG

W380318-SAMPLE

 extra

W311936-SAMPLE-K

Organoleptic: medicinal; sweet
Halal, Kosher, NI

mixture of cis and trans

Organoleptic: coconut; green

from (Cananga odorata)

FEMA 3595 Flavis 4.019 CoE Nr 537

[39212‑23‑2] C9H16O2 FW 156.22

FEMA 3803 Flavis 10.053 CoE Nr 10535

Ylang-ylang oil

 ≥99%

W324906-SAMPLE

(±)-5-Butyl-4-methyldihydro-2(3H)-furanone

> 1-(2,4-Xylylazo)-2-naphthol, see Sudan II Page 120

from synthetic
Halal, Kosher
Organoleptic: floral

Arc. 3098; Fen. 797

Organoleptic: medicinal
NI

Whiskey lactone

1 kg

[8006‑81‑3] FEMA 3119

W359505-SAMPLE-K

[8024‑08‑6]
FEMA 3110

> Wintergreen oil, see Methyl salicylate Page 93
asym.-m-Xylenol, see 2,4-Xylenol Page 130
p-Xylenol, see 2,5-Xylenol Page 130

130

Xylite

Place an order with your local SAFC representative (see back for contacts).

W555025
> Zingerone, see Vanillylacetone Page 129

8

Indexes

Food-grade certified products.............................................. 132
Naturals and essential oils.....................................................135
FEMA..................................................................................... 137
Organoleptic properties........................................................ 145
Catalog number/hazard information..................................... 170
Trademarks........................................................................... 192

Feel inspired at safcglobal.com

131

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 38 2. . . . . . . . . . . . . . . . Name W200204 W200336 W200506 W200603 W200611 W379700 W379715 W325007 W396400 W312606 W325104 W342408 W332801 W202606 W203106 W203203 W203408 W204218 W204600 W205915 W206806 W207403 W369608 W329304 W209902 W209910 W210102 W212000 W211901 W212717 W213101 W213500 W213519 W213705 W213713 W214000 W214108 W214115 W387800 W530345 W216900 W347701 W217018 W217417 W218618 W221805 W339315 W339318 W222119 W224300 W224707 W225002 W225207 W365807 W228613 W228818 W232200 W234300 W363928 W234907 W342017 W313505 W236004 W236012 W236128 W236403 W236411 W366005 W237701 W238104 W326607 W238503 W313718 W326909 W238902 W363405 W327107 W327204 W327301 W274623 W327506 W354201 W239704 W314609 Acetal . . . . . . . . . . . . . . . . . . . . 41 Page Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33 Decanoic acid . . . . . . . Betulina . . . . . . . . . 9 2-Acetylpyridine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 13 Amyl hexanoate . . . . . . . . . . 19 Buchu leaf oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl isobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl acetoacetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Page 41 42 43 44 44 44 44 45 45 45 45 45 45 46 46 46 46 46 47 47 47 47 47 47 47 48 48 48 49 49 49 49 50 50 50 50 51 51 51 51 53 53 54 54 54 54 55 55 55 55 56 56 56 57 57 58 58 58 58 59 60 60 60 60 60 60 60 60 61 61 61 61 62 62 63 63 63 64 64 64 64 64 64 64 . . . . . . . . . . .3-Butanedithiol . 2-Ethylpyrazine . . . 17 Benzyl alcohol . . . . . . . . . . . . . 9 3-Acetylpyridine . . . . . . . . . . . .3-Diphenyl-2-propanone . . . 32 δ-Decalactone . . . . . . . . . . . . . . . . . . Ethyl hexanoate . . . . . . 20 Buchu leaf oil. . . . . . . . . . . . . . . . . . . . . . . . 9 2-Acetyl-3-methylpyrazine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Furfuryl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8 Acetanisole . .trans-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexanal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl 2-trans-4-cis-decadienoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers . . . . . . . . . . .5-dimethyl-3(2H)furanone . . . . .5-dihydrofuran-2-one . . . . . . . . . . . . . 14 Anisyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3-Heptanedione . . . . . . . . . . . . . . . 16 Benzoic acid .3-Dimethoxybenzene . . Hexyl 2-methylbutanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .2′-(Dithiodimethylene)difuran . . . Hexyl alcohol . . . . . . 2-Furyl methyl ketone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl trans-2-butenoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FnF. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5-Dimethyl-1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl isovalerate . . . . . . . . . . . . . . . . . . . . 33 Decanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 trans-Cinnamic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 2. . 11 Allyl heptanoate . . . . . . . . . . . . . . . . . Ethyl valerate . . . . . . . 2-Furyl methyl ketone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9 2-Acetylthiazole . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl 3-hydroxybutyrate . . 33 9-Decenoic acid . . 12 Almond oil. . . . . . . . . . . . . . . . . . . . Crenulata . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Hexenoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Ethyl-3-methylpyrazine . . . . . . . . . . . . . . . . . 21 Butyl butyrate . . . . . . . . Geranyl isovalerate . . . . . . . . . pgd xref SAFC® Flavors & Fragrances Food-grade certified products index 132 Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . US/UN. . . 38 4. . . . . . . . . . . . . . . . .6-Dimethyl-5-heptenal . . . . . . . . . . . . . . . 8 Acetic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23 Butyl 2-methylbutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Ethyl-4-hydroxy-5-methyl-3(2H)-furanone. . . . . . . . . . . . . . . . . . . . . 35 4. . . . . . . . . . . . . Hexyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cis-3-Hexenal solution . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl lactate . . . . . . . . . . . . . . . . . . . . . 27 Cinnamaldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Geranyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35 Dihydrocoumarin . . . . . . . 4-Hexen-1-ol . . . . . . . .10-Dimethyl-5. . . . . . . . . . . . . . . . . . . Name W240109 W241512 W348600 W243019 W314803 W314811 W243205 W243418 W243434 W243604 W243701 W243906 W243914 W342807 W354503 W315303 W362301 W242802 W246301 W246328 W244007 W244104 W244201 W348708 W244309 W315508 W368008 W244708 W244902 W314900 W245100 W245115 W245607 W245615 W328103 W339407 W246204 W246215 W338206 W246700 W248703 W249009 W249300 W334618 W316315 W316318 W250500 W250708 W530382 W250902 W251801 W252204 W253200 W253901 W254304 W254401 W328901 W328915 W254703 W255602 W255718 W255726 W255807 W349518 W255904 W256005 W256110 W256102 W316903 W256218 W256323 W343005 W317101 W340308 W256501 W256714 W256803 W257206 W257215 W317209 W317215 W349909 W349915 W257605 δ-Dodecalactone . . . . Hexanal . . . Place an order with your local SAFC representative (see back for contacts). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .6-Dimethoxyphenol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31 Cyclohexyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 30 Cumin seed oil . . . . . . cis-3-Hexenyl hexanoate . 25 (−)-Carvyl acetate . . . . linalol type . . . . . . . . . . . . . . . . . . . . . . . . . . 31 Damascenone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl nonanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37 3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 40 Dimethyl trisulfide . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Formic acid . . . . . . . . . . . . . Ethyl isobutyrate . . . . 2-Ethyl-4-methylthiazole . . . . . . . . . . . . Heptyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5-Ethyl-3-hydroxy-4-methyl-2(5H)-furanone . . . . . . . Ethyl valerate . . . . . . . . . . . . . . . . . . . . . . . . 31 β-Cyclocitral . . . . . . . . . . . . . . . . . . . . . .6-Dimethylpyrazine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 11 Allyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . γ-Hexalactone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9 2-Acetyl-3-ethylpyrazine . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl 2-methylbutanoate . . . . . . . . . . . . . . . . . . . . . . 16 Benzaldehyde . . . . 33 Diethyl succinate . . . . 0809. . . . . . Ethyl 2-methylbutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ginger oil . . . . . . . . . . . . . . . . . . . . Ethyl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 12 Amyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3-Dimethylpyrazine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl isobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3-Hexanedione . . . . . . . . . . . . . . .9-undecadien-2-one . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzyl isobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl formate . . . . 11 Allyl isothiocyanate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 20 2-Butanone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl palmitate . . . . Ethyl maltol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers . . . . . . . . 15 Basil extract. . . 39 Dimethyl sulfide . Ethyl decanoate . . . . . . . . . . cis-4-Heptenal . 26 1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23 Butyl 2-methylbutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl levulinate . . . . . . γ-Heptalactone . . . . . . . . . . . . . . . . . . . . Furfuryl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4-Ethylguaiacol . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl cinnamate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 20 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 40 1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5-Dimethyl-3-hydroxy-2. . . . . . . . . . 8 Acetaldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Eugenol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 18 Benzyl isobutyrate . 40 2. . . . . . . . . . . . . . . . . . . . . . . Geraniol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9 2-Acetylpyrazine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 24 Carob absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Guaiacol . . . .6-Hexanedithiol . . . . . bitter . . . . . . . . Ethyl laurate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .#2545. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl palmitate . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Hexen-1-al . . . . . . . . . . . . . . . . . . . 15 Anisyl alcohol . . Hexanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . methyl chavicol type . . . . . . . . . . . .5-Dihydro-3(2H)-thiophenone . . . . . . . . . . . . . . 22 Butyl isovalerate . . . . . . . . . . . . . . . . . . . . Ethyl formate . . . . . . . . . . . . . . . . 17 Benzyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . 2-Ethyl-3(5 or 6)-dimethylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 15 Anisyl formate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .4-Decadienal . . . . . . . . . . . . . . . . . . . . . . . . . . . 13 6-Amyl-α-pyrone . 2-Heptanone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36 1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl heptanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. . . . . . . Ethyl vinyl ketone . . . . . . . . . . . 36 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzyl alcohol . . . . . . 37 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 25 L-Carveol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Hexen-1-ol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23 Butyric acid . . . . . . . . . . . . . . . . . . . Geranium extract . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 13 Amyl formate . . . . . . . . . . . . . . . . . . . . . . .4-Cineole . . . . . . . . . . . . . . . . . 10 Allyl cyclohexanepropionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl hexanoate . . 8 Acetic acid . . . . . . . . Hexyl butyrate . . . . . . . . . . . . . . . . . . . . Furfuryl mercaptan . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 11 Allyl sulfide . . . . . cis-3-Hexenyl acetate . . . . . . . . . . .5-dimethyl-3(2H)furanone . . . . . . . . . . . . . . . Genet extract . . . . . . . . . . . . . . . . . . . . . 32 γ-Decalactone . . . . . . . . . . . . . . . . . . . . . . . . 18 Bis(methylthio)methane . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl octanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 16 Basil oil. . . . . . . . . . . . . . . . . . . . 32 (+)-γ-Decalactone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8 4-Acetoxy-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl isovalerate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl acetate . . . . . . . . 27 Clove bud extract . . . . . . . . 32 trans. . . . Ethyl 2-trans-4-cis-decadienoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 26 β-Caryophyllene . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5-Dimethylpyrazine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .2-cyclopentadione . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 40 6. . . . . . . . . . . . . . . . . . . . . . . . 9 4-Acetoxy-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 13 α-Angelica lactone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 21 Butyl acetate . . . . . . . . . . . . Ethyl 3-hydroxyhexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Hexen-1-al . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cis-4-Heptenal solution . . . . . . cis-3-Hexen-1-ol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3-Ethylpyridine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 105 (S)-(−)-Perillyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 121 Terpinyl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . 101 1-Octen-3-one solution . . . . . . . . . . . . . . . . . . . . . . . . . . . Lauric aldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Lemon oil. . . . . . . . . . . . . . . . . . . . . . 98 δ-Nonalactone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 3-Octanol . . . . . . . . . . . . .7-dihydrocyclopenta[b]pyrazine . . . . . . . . . 100 Octanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 107 Phenylacetaldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 94 (Methylthio)methylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . . . . 102 Octyl butyrate . . . . . . . 99 cis-6-Nonenal . . . . . . . . . . . .5-dimethyl-3(2H)-furanone . . . . . . . . . . 123 2. . . . . . . . . . . . . . 110 3-Phenylpropyl isobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 93 5-Methylquinoxaline . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FnF. . . . . . . . . . . . . . Name W330906 W320218 W274402 W320307 W337307 W378704 W320404 W320501 W337404 W331007 W320803 W341509 W274704 W331201 W276200 W276405 W381101 W530412 W277126 W277304 W376604 W278009 W335606 W344001 W344015 W358002 W346500 W279609 W279617 W279900 W280003 W358118 W358126 W280305 W280518 W351504 W280607 W358304 W358315 W280704 W281506 W281799 W342106 W283207 W530432 W321818 W284300 W358401 W331708 W331715 W266418 W285803 W322105 W287105 W286702 W287407 W401404 W322601 W288608 W289302 W290904 W291102 W292400 W292419 W292516 W293008 W322806 W323004 W299618 W338907 W302600 W303208 W502707 W518107 W518018 W304409 W355801 W304506 W305308 W359009 W332100 W323705 W323713 W377406 2-Methylpyrazine . . US/UN. . . . . . . . . . . . . . . . . . . . . . . 102 3-Octyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl anthranilate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95 3-(Methylthio)propionaldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 109 2-Phenylpropionaldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Isobutylthiazole . . . . . . . . . . . . . . . . . . . . . . . 3-Methyl-1-pentanol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 113 p-Propyl anisole . . . . . . . . . . . predominantly trans . . . . . . . . . . . . . . . . . . . . . . . . . 2-Methyl-4-propyl-1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 119 Spearmint oil . . . . . . . . . . . . . . Name W257615 W446207 W317403 W317454 W258814 W259403 W259411 W205508 W205532 W205710 W206008 W206903 W207500 W350702 W217506 W217514 W217905 W218707 W219304 W219703 W313203 W313408 W222011 W247006 W293903 W355518 W310212 W260000 W319600 W261408 W261513 W262600 W262706 W263508 W264504 W265608 W265624 W346209 W317705 W266906 W350206 W318108 W267104 W318302 W267201 W267708 W268208 W268216 W340707 W359904 W364428 W335908 W269018 W269301 W269328 W269506 W269514 W269808 W269905 W330507 W270008 W270015 W330604 W318809 W336203 W376108 W270806 W319104 W350818 W341002 W271926 W272000 W371009 W357502 W272906 W275409 W343706 W346306 W376205 W319503 W319902 W274003 W357804 W330829 Hexyl propionate . . . . . . . . . . . . . . . . . . 122 5. . . . . . . . . . . . . . . 100 3-Octanone . . . . . . . . . . . . . . . . . . . . 3-Methylpentanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 113 Propionic acid . . . . . . . 106 Phenethyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . pgd xref Food-grade certified products index Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl 2-octynoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Methyl-2-butenal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 112 Piperonal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .trans-2. . . . . . . . . . . . . . . . . . . mixture of cis and trans . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 120 Sucrose acetate isobutyrate solution . . . . . . . . . . . . . . . . 4-Methylpentanoic acid . . . . . 2-Isopropyl-4-methylthiazole . . . . . . . . 102 Oleic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .8-Tetrahydroquinoxaline . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 108 2-Phenylethyl isothiocyanate . . . . . . . . . . . . . . . . . . . . . . . . . . 93 2-Methyltetrahydrofuran-3-one . . . . . . . . . . . . . . . . . . . . . . . . Methyl cyclopentenolone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 94 2-Methyl-3-tetrahydrofuranthiol . . . . . . . . Isobutyl butyrate . . . . . Methyl trans-cinnamate . . . . . . . . . .2-cyclohexanedione . . . . . . . . . . . . . . . . 4-(4-Methoxyphenyl)-2-butanone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl butyrate . . . . . . . . . . . . . . . . . . . . . . 5-Methyl-2-hepten-4-one. . . . . . . . . . . . . . . 123 Theaspirane . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 105 2-Pentylfuran . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4-Hydroxy-2. . . . . . . . . . . . . . . . . . . . . . . . . . 95 3-(Methylthio)-1-propanol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Methoxy-3-methylpyrazine . . . . . . . Maltol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . o-Methoxycinnamaldehyde . . . . . . . . . . 2-Isobutyl-3-methoxypyrazine . . . . . . Isoamyl formate . . . . . . . . . . . . . . . . . . . . . 107 Phenethyl propionate . . . . . . . . . . . . . . . . . . . . . . . . 103 Palmitic acid . . . . . . . . . . trans-2-Methyl-2-butenoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (±)-2-Methylbutyric acid . . . . . . . . . 2-Methylpentanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 121 α-Terpineol . . . . . . . . . . . . . . . . α-Ionone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 118 Sodium citrate dihydrate . . Isobutyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Mercapto-3-butanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 Neryl acetate . . . . . . . . . . . . . . . . . . . . . 96 Neohesperidin dihydrochalcone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5-Methyl-2-phenyl-2-hexenal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Lauric acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5H-5-Methyl-6. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6-Methylcoumarin . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 123 Page 133 . . . . . . . . . . . . . . . . . . . . . . . Methyl anthranilate . . . . . . . . . . . . . . . . . 109 1-Phenyl-1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl jasmonate . . . . . . . . . . . . . . . . . . . . . . . . . 105 2-Pentylfuran . . . . . . . . . . . . . . . . . . . . . . . . . . Linalyl propionate . . . . . . . . . . . . . . . . . . . . . . . . Isobutyraldehyde . . . . . . .com Page 64 65 65 65 66 66 66 67 67 67 67 67 67 67 69 69 69 69 69 69 70 70 70 71 72 72 73 73 73 74 74 75 75 75 76 77 77 77 77 78 78 79 79 79 80 81 82 82 83 83 83 84 84 84 84 84 84 85 85 85 85 85 85 86 86 87 87 87 87 88 88 89 90 90 90 91 91 91 91 91 92 92 93 93 Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .2-propanedione . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . terpeneless . . . . . . . . Methyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .7. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .6-Tetramethylpyrazine . . . . . . . . . . . . . Hydroxyacetone . . . . . . . . . . . . . . . . . . . . . 107 Phenethyl isovalerate . . . . . . . . . . . . . 104 Parsley leaf extract . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Morocco . . . . . . . . . . . . . . . . . . . . α-Ionone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl propyl trisulfide . . . . Methyl 3-(methylthio)propionate . . . . . . 110 Piperine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isobutyl formate . . . . . . . . . . . . . . . . trans-2-Methyl-2-pentenoic acid . . . . 120 L-(+)-Tartaric acid . . . . . . . . . . . . . . . . . . . Isoamyl isobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 114 Pyrazineethanethiol . . . . . 97 trans. . . . . . Isopropyl cinnamate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 3-Nonanone . . . . . Isobutyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (±)-4-Methyloctanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 0809. . . . . . . . . . . . . . . . . . . . . .5-dimethyl-3(2H)-furanone . . 93 Methyl 2-pyrrolyl ketone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Methyl-3-furanthiol . . . . . . . . . . . . . . . . . . . . . . . . . . 4′-Methylacetophenone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 94 Methyl thiobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 γ-Octalactone . . . . . . . . . . Maltyl isobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 3-Octanol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isovaleric acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Linalool . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .#2545. . . . . . . . . . . . . . . . 99 cis-6-Nonen-1-ol . . . . . . . . . . . . . . . . . . . . . . . . 112 Propionic acid . . . . . . . . . . . . . . 113 Propyl disulfide . .3-oxathiane. . . . . Methyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4-Methyl-1-phenyl-2-pentanone . . . . . . . . . . . . . . . . . . . . . . . . 123 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl p-tert-butylphenylacetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl hexanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 116 Rum Ether . 113 Propyl acetate . . . . . . . . . .6-Tetramethylpyrazine . . . . . . . . . . . . . . . . . 122 δ-Tetradecalactone . . . . . . 97 Neroli oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 102 Onion oleoresin . . . . . . . . . . . . . . . . . . . 4-Hydroxy-2. . . . . . p-Mentha-8-thiol-3-one . . . . . . . Menthyl isovalerate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Feel inspired at safcglobal. . . . . . . . . . . . . . 95 3-(Methylthio)propyl isothiocyanate . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl 3-hydroxyhexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 102 3-Octyl acetate . . . . . . . . . . . . . . . . . . 2-Methoxy-4-methylphenol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isobutyl cinnamate . 2-Methylbutyric acid . . . . . . . . . . . . . . . . . . . 105 4-Pentenoic acid . . . . . . 103 4-Oxoisophorone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .6-Nonadienal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 1-Octanol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 104 trans-2-Pentenal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 120 Sucrose acetate isobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl furfuryl disulfide . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl 3-nonenoate . . Methyl cyclopentenolone . . . . Isoeugenyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 106 Phenethyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl 2-methylbutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 101 1-Octen-3-ol . . . . . . . . Jasmin extract . . . . . . . . . . . . . . . . . . . 2-Methylbutyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 93 6-Methylquinoline . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 96 Neroli extract . .3. . . . . . . . . . . . . . . . . . . . . . . . . . . 4-(4-Hydroxyphenyl)-2-butanone . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Methylbutyl 2-methylbutyrate . . Isoamyl alcohol . . . . . . . . . . . . . . . . . . . . Isoamyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 94 4-Methyl-5-thiazoleethanol . . . . . . . . . . . . . . . 121 α-Terpinene . . . . . . . . . . . 105 1-Penten-3-ol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 3-Nonanone . 99 γ-Octalactone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 119 Succinic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isobutyl acetate . . . . . . . . 97 trans-2. . . . . . . . . . . . . . 2-Methylhexanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Levulinic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 96 Myristic acid . . . . . . . . . . 94 3-(Methylthio)butanal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 117 Safranal . . . . . . . . . 101 Octyl acetate . . . . . . . . . . . . . . . . . . . . . . .5. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3-Methyl-1. . . . . . . . . . . . . . . cis-Jasmone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5. . . . . . . 94 4-Methyl-5-thiazoleethanol acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95 Myrcene . .6. . . . . . . . . . . . Maltol . . . . . . . . .cis-6-Nonadien-1-ol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . Place an order with your local SAFC representative (see back for contacts). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Page 123 123 123 124 124 125 125 126 126 126 Cat No. . . . . . . . . . . . . . . . . . . . . . FnF. . . . . . . . . . . 2. . . . . . . . . . . . . . . . US/UN. . . . . . . . . . . . . 2. . . . . . . . . . . . . . . . . . . . . . . Veratraldehyde . . . . . . . . . . . . . . . . . . . . . . . .4. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5-Trimethylthiazole . . . . . .5-Trimethylpyrazine . . . . . . . . . . . . . . . . . . . . . . . . . . . . γ-Undecalactone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4-Vinylphenol solution . . . . . . . . . . . . . . . . . . . . . . . . Triacetin . . . . . . . . . . . . . . . . . . Vanillin isobutyrate . . . . . . . . . . . . . . . 2-Undecanone . . (±)-γ-Valerolactone . . . . . . . . . . . . .2′-(Thiodimethylene)difuran . . . . . . . Tocopherols . . . . . Tributyrin . . . . . . . . . o-Toluenethiol . . . . . . . . . . . . . . Name W347507 W309109 W309303 W310301 W310700 W310727 W375403 W310905 W373923 Trithioacetone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 0809. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Thiophenethiol . . . . . Vanillin . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Page 127 127 128 128 129 129 129 129 130 . . . . . . . . . . . . . . . . . . . . . . . . . . . pgd xref SAFC® Flavors & Fragrances Food-grade certified products index 134 Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3. . . . . . . . . . . . . . . . . . . . . Name W361518 W323802 W306207 W530066 W324000 W200700 W222305 W324418 W332518 W328618 Thiazole . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .#2545. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Vanillin . . . . . . . . . . . Tripropionin . . . . . . . . . . . . . .

. . . . . . . . . . . . . . 29 Citronella oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 22 Butyl butyryllactate . . . . . . . 25 Cassia oil . . . . . . . . . . . . . . . . . . . . . ceylon type . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 16 Bay oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . blue . . . . . . . . . . . . . . . . . . . . . . . . . 4-(4-Hydroxyphenyl)-2-butanone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 Chamomile oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 24 Butyric acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 25 Carob absolute . . . 16 Benzoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Geranium absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 14 Angelica seed oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 26 Chamomile absolute . Name W234300 W530362 W342017 W235900 W236012 W236128 W236217 W236411 W271810 W274623 W240702 W241415 W241512 W242217 W242713 W243019 W314811 W243213 W243434 W243728 W243914 W342815 W242810 W246328 W244015 W244112 W244317 W244910 W245115 W245615 W245712 W246215 W246603 W246611 W523402 W246719 W248207 W248606 W523518 W519901 W248924 W249017 W316315 W250104 W250309 W250406 W250500 W250716 W530376 W530382 W250813 W250910 W251216 W251712 W252108 W252204 W253006 W253200 W253405 W530394 W334812 W328915 W254711 W255726 W255734 W255912 W256110 W256323 W317128 W256528 W256714 W256811 W257215 W317215 W349915 W257615 W317454 W258814 W259200 W259411 W205532 W205710 W206016 W206326 W207519 W350710 Cumin seed oil . . . . . . . . . . . . . 29 Citronellyl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl cinnamate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Geranyl butyrate . . . . . . . . . Java . . . . . . . . . . . . . . . . Hexanal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cis-4-Heptenal solution . . . . . . . Moroccan . . . . . . . . . . . . . . . . . methyl chavicol type . . . . . . . . . . . . . . . . . . . . . . . . . . . . Damascenone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ginger oil . . . . . 16 Basil extract. . . . . . . . . . . . . . . . . . Fir needle oil. . . . . . . . . . . . . . . . . . . . Ethyl octanoate . Eucalyptus oil citriodora . . . . . . . . . . . . . . . . . . . . . . . . . α-Ionone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 16 Beeswax absolute breche . . . . . . . . . . 31 Feel inspired at safcglobal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Hexen-1-al . . . . . . . . Heptanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8 Acetic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl isobutyrate . . . . . . . . . Geranyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 16 Balsam fir absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Betulina . . . . . . . . Eugenol . . . . . . . . . . . . . . . . . . . . . . . . . . . . comoric type . . . . . . . . . . . . . . . 16 Basil oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl isobutyrate . . . . . . . . . . . . . . . . . Siam . . . . . . . . . . . . . . . . Ethyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4-Hydroxy-2. . . . . . . . . . . . . . . . . . . 17 Benzoin resinoid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Helichrysum oil . . . . . . . . . . . . . . . 24 Canaga oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 30 Cornmint oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Geraniol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 26 Cedar leaf oil . . . . . . . . . . . . . . . Ethyl laurate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 25 4-Carvomenthenol . . . 14 Anise star oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 25 Cardamom oil . . . . . . . . . . . . . . . . . . . . . . . Genet absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 15 Balm leaves oil . . . . . . . . . . . . . . . . . . . . . Davana oil . . . . . . . . . . . . . . . Chinese . . . . . . . . . . . . . . . . . . . . . . . . Ethyl decanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9 Allyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 24 Camphor white oil . . . Hexyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (+)-γ-Decalactone . . . . . . . . Ethyl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 11 Almond oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8 4-Acetoxy-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Geranyl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 19 Bergamot oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl pyruvate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Crenulata . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 29 Citronella oil. . . . . . . . . . . . . . . Ginger extract . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Eucalyptus oil . . . . . . . . . . . 14 Angelica root oil . . . . . . . . . 8 Acetaldehyde solution . . . . . . . . . . . . . . 17 Benzyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 24 Caraway oil . cis-3-Hexen-1-ol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl propionate . . linalol type . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexanal . . . . . . . . . . . . . . . . 30 Costus oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Garlic oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 28 (±)-Citronellal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Cypress oil . . . . . . . . . . . 26 Cassia oil . Isoamyl hexanoate. . . . . . . . . . . . . . . . . . . . .5-dimethyl-3(2H)-furanone . . . . . . . . . . . . . . . . . . . . . . . . Heptyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 21 Butyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl valerate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 12 Amyris oil . . . . . . . . . . . . . . . 30 Clove bud oil . . . . . . . . . . . . . . 30 Coriander oil . . . . . . . . . . . . . . . . . . . . . Galbanum oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Fennel oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Chinese . . 21 Butyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .Canadian . . . . . . . . . . . . . . . . . . . . Dimethyl sulfide . . . . . . . . . . Geranium extract . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 20 Buchu leaf oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzoin resin absolute. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl benzoate . . . . . . . . . . . . . . . . . . . . . . Siberian . . . . . . . . . . . . . . . . . 25 Carrot seed oil . . . . . . . . . 26 Celery seed oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl heptanoate . . . Fir needle oil. . . . . . . . . . . . . . . . . . . . . . Geranium oil. . . . . . . . . . . . . . . . . . . 14 Anisyl alcohol . . . . . . . . . . Ethyl hexanoate . 26 Cedrol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 18 Benzyl propionate . . . . . . . . . . . . . . . . . . . . . Hexanoic acid . . . . . . . . . . . . . . . . . . . . Ethyl 2-methylbutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bleached . . . Genet extract . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 30 Coumarin. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 Cinnamon leaf oil . . . . . . . . . . 30 Copaiba balsam oil . . . . . . . . Roman . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl cinnamate . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl 3-hydroxybutyrate . . . . . . . . . . . . . . . . . . . . . . . . Fenugreek absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . Chinese 85/35 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 30 Clove bud extract . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 30 Cornmint oil . . Ethyl formate . . . . . . . . . . . . . . . Florida . . . . . . . . . . . . . . . . . . . . . . . . . 28 Citral . . . . . . . . . . . . . . . 30 Copaiba balsam. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Guaiac wood oil . . . . . . . . . 12 Ambrette seed absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 Chamomile oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 Cinnamaldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Chinese . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Decanal . . . . . . . . . . . . . . . . Immortelle absolute . . . 8 Acetaldehyde . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl palmitate . . . . . . . . . . . . . . . . . . . . . . . . . . . Furfural . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 26 Cedarwood oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .Naturals and essential oils index Cat No. . . . . . . . Name W200220 W200336 W200344 W200603 W332615 W379715 W203211 W204600 W205001 W517100 W208800 W209000 W209619 W209910 W211300 W530333 W212000 W211907 W211901 W212202 W212628 W212717 W213128 W213314 W213306 W213300 W213519 W213713 W213810 W214019 W214115 W215015 W215317 W215325 W215481 W284505 W215600 W521108 W530345 W216900 W217417 W217816 W218626 W219010 W339315 W221910 W222119 W223115 W223204 W223816 W224111 W224300 W224405 W224820 W225800 W521205 W234605 W226718 W522406 W521418 W227102 W530358 W227307 W521302 W227501 W228613 W228826 W229105 W229210 W229202 W230316 W230715 W230804 W230812 W231614 W232200 W232300 W233100 W233218 W521809 W521906 W233404 W521604 W521701 W233609 W526509 Acetal . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzyl isobutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 20 Bois de rose . . . . . . . . 22 Butyl 2-methylbutyrate . . Dimethyl anthranilate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 20 Buchu leaf oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 Cinnamon bark oil . . . . . . . . 27 Chamomile oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Furfuryl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzyl benzoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .com Page Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 17 Benzoin resin absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Grapefruit oil. . . . Hexyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Elemi Resin . . . . . . . . . . . . . . . . . . . . . Ethyl isovalerate . . . . . . . . . . . . . . .5-dimethyl-3(2H)furanone . . . . . . . . . . . . . . . . 16 Basil oil. . . 19 Black pepper oil . . . . . . 20 Bran absolute . . . . . δ-Decalactone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 19 Birch oil . . . . . . . . . . . . . . . . . . . . . . . 2-Furyl methyl ketone . . . . . . . . . . . . . . . . . . . . . . . . . . . 30 Cognac oil . . . . . . . . . . 8 Acetone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl 2-methylbutanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl 2-trans-4-cis-decadienoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Decanoic acid . . . . . . . . . . . . . . . . Ethyl lactate . . . . . . . . . . . . . . . . . . . . . . 30 Cognac oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Eucalyptus oil . . . . . . . . Guaiacol . . . . . . . . . . . . 26 Cassis bourgens absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Texas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 19 Bergamot oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl acetate . . . . . . . . . . . . . . . . . . bitter . . . . . . . . . . . . . . . . . . . . Ethyl acetoacetate . . 20 Butyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . 16 Benzaldehyde . . . . . . . . . . 23 Butyraldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Page 31 32 32 32 32 33 33 33 37 40 41 42 42 43 44 44 44 44 45 45 45 46 47 47 47 47 47 49 49 50 50 51 51 51 51 51 52 52 52 52 53 53 54 54 55 55 55 55 55 55 55 55 55 56 56 56 56 56 57 57 57 58 58 60 60 60 60 61 62 63 63 63 64 64 64 64 65 66 66 66 67 67 67 67 67 67 135 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 Cinnamon oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl butyrate . . . . mixture of isomers . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cis-3-Hexenyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 trans-Cinnamic acid . . . . . . . Ethyl isobutyrate . . . . . . . . . . . . . . 17 Benzyl alcohol . . .

. . . . . . . . . . . . . . . . . . . . . . Peppermint oil . . . .Turkish . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 (±)-2-Methylbutyric acid . . . . . 100 3-Octanol . . . . Phenylacetaldehyde solution . . . . . . . . . . . . . . . . 73 Jasmin extract . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Name W281506 W281611 W281719 W281794 W522600 W281800 W282510 W282529 W282537 W522708 W282812 W282928 W530432 W283606 W283800 W331715 W284807 W284815 W284823 W284831 W211710 W523607 W285714 W285811 W287415 W287814 W201800 W290106 W290500 W292826 W292419 W292516 W293415 W294926 W295817 W297070 W298816 W523801 W299200 W523704 W300306 W300500 W510483 W303208 W303224 W303305 W303704 W502715 W304000 W241202 W390208 W304522 W323713 W306401 W306509 W306606 W530455 W306908 W530462 W308315 W324426 W524409 W308900 W309101 W309311 W344303 W310727 W524301 W311006 W311308 W311901 W311928 W311936 Oleic acid . . . . . . . . . . . . . . . Orange oil . . . . . . . . . . . . . . . . . . . . . . . . . 99 Nutmeg oil . . Tagete oil . . . 84 2-Methylbutyl 2-methylbutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Undecanone . . . . . . . . . . . . . . . . . . . . . . . . 2. . . . . . . . . . 81 Methyl anthranilate . . . . . . . . . . . Phenylacetic acid . . . . . . . . . 77 Mandarin oil . . . . . . . . Rose oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Peppermint oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 96 Myrrh oil . . . . . . . . . . . . . Propionic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 102 3-Octyl acetate . . . . . . East Indian . . . . . . . 85 6-Methyl-5-hepten-2-one . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ylang-ylang oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 82 2-Methyl-1-butanol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Java . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Valencene . . . . . . . . . . . . . . . . . Tobacco absolute . . . . . Trivertal . . . . . . 100 Octyl acetate . . . . . . . . . . . . . . . . . Dutch . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 74 Lavender oil 40/42% fleurs . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Petitgrain oil. . . . . . . . . . . 1-Propanol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 3-Nonanone . . 100 1-Octanol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Spike lavender oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Pimenta leaf oil . . . . . . . . . 96 Musk ketone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Peru balsam oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 2-Nonanone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Thyme oil . . . . 102 Octyl butyrate . . . . . . . . . . . . . . . . . . . . Pimenta berry oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 Octanoic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 83 2-Methylbutyl acetate . . . . . . . . . . . . . . . . . . . Phenethyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 82 Methyl benzoate . . . . . . . . . . . 83 2-Methylbutyl isovalerate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Opoponax oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rose crystals . . . . . . . . . . . . . . . . . . . . . . . . . . . Styrax . . . . . . . . . . . . . . . . . . Propyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rose absolute. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 102 Page Cat No. . . . . . . . . . . . . . . . . . . . . . . . . Wintergreen oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 87 Methyl 2-methylbutyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73 Jasmin absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73 Lactic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 76 Linalyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Name W208515 W208019 W208213 W217514 W217913 W218715 W220213 W222011 W222216 W269212 W310212 W259802 W260000 W260401 W261114 W261416 W261513 W262000 W262218 W523100 W262404 W262501 W262528 W262600 W263109 W263117 W263516 W263613 W517208 W265101 W265624 W265713 W265721 W523208 W317713 W266523 W266825 W267112 W267619 W268216 W268313 W399817 W364428 W350613 W350516 W335916 W269328 W269514 W269816 W270015 W270733 W270814 W271926 W275506 W522902 W276413 W276618 W277002 W530412 W276804 W525308 W277126 W278513 W344015 W279307 W279617 W279714 W279927 W280011 W358126 W280615 W358315 W280712 Isoamyl isovalerate . . . . . . . . . . 84 Methyl cinnamate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 78 2-Methoxy-4-methylphenol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Vanillin . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ylang-ylang oil . . . . . . . . . . . . . . . . . . . . Orange oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75 Lemon oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Orange terpenes . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 77 p-Mentha-8-thiol-3-one . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 69 Isobutyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . γ-Undecalactone . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3. . . . . . . . . . 68 Isobutyl acetate . . . . . . . . . . . . Succinic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Spearmint oil . . . . . . . . . . . . . . . 77 L-Menthol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 74 Lemongrass oil . . . . . . . . . 76 Maltol . . . . . . . . . . . 88 Mimosa absolute Moroccan . . . . . . . . . . . . . . . . . . . . . Thyme oil . . . . . . . . Pyruvic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Pine needle oil . . . . . . . . . . . . . . . . . . . . . . . . Spanish . . . . . . . . . . . . . . . . . . . . Propyl propionate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Page 102 102 103 103 103 103 103 103 103 103 103 103 104 104 104 105 106 106 106 106 106 106 106 106 108 108 111 111 111 113 113 113 114 114 116 116 117 117 117 117 118 118 118 119 119 119 120 120 121 121 121 121 123 124 124 124 124 124 124 125 126 127 127 127 128 128 129 129 130 130 130 130 130 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . L-Turpentine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 85 Methyl cyclopentenolone . . . . . . . . . . . . . . . . . . . . . 77 Marjoram oil. . . . . . . . Onion oil. . 70 Isobutyric acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 96 Nerol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Sandalwood oil . 100 Octanal . . . . . . . . . 75 L-Linalool . . . . . . . Patchouli oil . . . . . . . . . . . . . .SAFC® Flavors & Fragrances Naturals and essential oils index 136 Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Orange flower absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Tolu balsam . . . . . . . . . . . . Triethyl citrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 83 3-Methylbutyl 2-methylbutanoate . . . . . . . . . . Violet leaf absolute . .5. . . 68 Isoamyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . α-Terpineol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 77 Mandarin oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 Nerolin bromelia . . . . . . . terpeneless . . . . . . 73 Isovaleric acid . . . . . . . . . 68 Isoamyl octanoate . . . . . . . . . . . . . . . 74 Lavender absolute . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 74 Lauric acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75 Lemon oil . . . . . . . . . . . . . . . Onion oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ylang-ylang oil . . . . . . . 2-Pentylfuran . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73 Juniper berry oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 96 Neroli extract . Peppermint oil . . . Spearmint oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Parsley leaf extract . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Orange oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Tonka bean absolute . . . Sassafras oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 69 Isobutyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . 75 Lime oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 76 Litsea cubeba oil . . . . . . . . . . . . . 96 Myristic acid . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Parsley oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Rosemary oil . . . . . . . . . . . . . . . . . . . . . . . . . Peppermint oil . . . . . Origanum oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Vetiver acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75 Lime oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Place an order with your local SAFC representative (see back for contacts). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 Neroli oil. . . . . . . Olibanum oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Propyl acetate . . . . 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Morocco . . . Thymol . . 74 Lauric aldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Sage oil . . . . . . . . . . . . . . . . . . Moroccan . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 76 Lovage oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 70 Isovaleraldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 99 γ-Octalactone . . . . . . . . . . . . . . .3. . . . . . . . . . . . . . . . . . . . . . . . . . . .5-Trimethylpyrazine . 69 Isobutyl alcohol . . . . . . . . . . . . . . . . . . .6-Tetramethylpyrazine . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Paraguay . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Tarragon oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Propyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 87 Methyl hexanoate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Mexican . 79 Methyl acetate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Tea tree oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 78 L-Menthyl acetate . . . . . . . . . . . . 75 Lemongrass oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75 Lemon oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 Methyl butyrate . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 70 Isobutyraldehyde . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 Nerolin Yara Yara . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Orris concrete . . . . . . . . .

. . . . . . ≥99%. . . . . . . . 14 Anise star oil. . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . ≥98%. . . . . . . . . . . FG . . . . . . . . . . . . . . ≥99%. . . . . . . 16 Bay oil . . . . . . . ≥98%. . . . . . . . . . . FCC. natural. . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . ≥97%. . . . . . . FCC . 70% isoamyl acetate basis. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . 14 Angelica root oil. . . . . . . . . . . . . . . . . . . . FG . . . 96%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . FG . . . . . . . . . . . . . 21 Butyl acetate. . .23 Butyl 10-undecenoate. . . . . ≥97% . 12 Allyl tiglate. . FCC. . . . . . . . . FG . . . . . . . . . . . . 19 Benzyl isovalerate. . FCC . . . . . . . . . . . . natural . . . . . . . . . . . . . . . . FCC. 11 Allyl octanoate. . . 23 Butyl valerate. . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . 15 Balm leaves oil. . . . . . . . . . . . . . . ≥99%. . . . FG . . . . . . . . 22 Butyl butyrate. . ≥99. ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23 Butyl laurate. . . . natural. . . . . . . . . . . . . . . . . . natural . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . natural . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . rectified . . . . . . . . FCC . . 21 Butylated hydroxyanisole. . . . . . . . natural. . . . . . . . . . . . FCC. . % in H2O . 22 Isobutyl cinnamate. . . . . . . . . . . . . . . . 12 Allyl propionate. . . . . . . . . . . . . 17 Benzyl benzoate. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . ≥98% . . . . ≥98%. . . ≥98%. . . . . . . . ≥97% . . . . . . . . . . . . ≥98% . . . . FCC. natural. ≥97% . . FG . . . . (Non-sensitizing) . . . . . . . . . . . . . . . . .20 Isoborneol. . . FG. . . . . . . . . .13 Isoamyl hexanoate. . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . FCC . . . ≥99% . . ≥98% . . . . . . . . . . . . 21 Isobutyl acetate. . . .10 Agar. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 50 wt. . . . . . FCC . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . 125 Caffeine. . . . . . . natural. FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 99% . . . . . . . ≥99%. . . . . . . . . . . . . . . .22 Butyl (S)-(−)-lactate. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . FCC. . FG . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . ≥98%. . . 16 Basil extract. . . JSFA . . . . . . . . . . FCC . FG . FCC. . . . . 11 Allyl hexanoate. . . . . . . . . . . . . . . . . . . . . . . FCC. natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . Italy origin . . . . . . . ≥98%. . . . . . . . . natural . . . 16 Benzoic acid. . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .8 Acetaldehyde phenethyl propyl acetal. . . . . . . . . . . ≥98%. . . . . . . ≥99% . . . . . . . ≥99%. . . . . . . . . . . . . . . FCC . % in isopropanol . . . . . . natural. . . . . . . . . . . . 16 Peru balsam . . . . . . . . . . . . . . . FCC. . natural. . . . . . . . . . . . . . . . . . . . ≥97% . . ≥98%. . . . 70 Butyric acid. . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 70 Isobutyl salicylate. . . . . FCC . . . . . . . . . . . . . . . 22 Isobutyl formate. . . ≥98% . . . . . . . . . mixture of isoamyl and 2-methylbutyl salicylates. . . . . natural. . . . . . . . . 8 Acetaldehyde. . . . 17 Benzoin resinoid. . . . . . . . . . . . . . . . . . 67 Isoamyl laurate. . . . . . . . . . . . . ≥97%. ≥98. 17 Benzyl alcohol. . . . . . ≥99% . . . 23 Isobutyl propionate. . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . 18 Benzyl formate. . . . . . . . . . . . FCC. . . FG . . . . . . . . . . . . . . . . ≥98%. ≥95%. . . . . . . . . . 15 Anisyl acetate. . . . FCC. . . . . . . 24 Isobutyric acid. 98% . . . . . . . . . . . . . . . . . . . . . FCC . . . . FG . . 22 Butyl butyryllactate. . . FCC . . . . . . . . . . . . . . . . FG . . . . 67 Amyl 2-furoate. . . . . . . . . . . . . ≥98%. . . . . . . . . . . . FCC . FCC. . . 69 Buchu leaf oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 13 Amyl hexanoate. . . . . . . FG . . . . . . . . 69 Isobutyl acetate. . . . . . . . . 69 Isobutyl butyrate. . . . . . .5%. . . .12 Allyl phenylacetate. . . . . . . 20 wt. . . . . . . . FCC . FG . . . . . sweet . . . . . . . . . Betulina. . . Italy origin. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Cat No. . . . . . . . . . . . . FG . . . . . . . ≥98%. natural. . . . ≥98%. . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . .21 Isobutyl alcohol. . . . . FG . . . . . . . . ≥98% . . . . . % ethanol . . . . . . . . . . .69 Isobutyl alcohol. . . 11 Allyl 2-furoate. . . . . . . . . . . . . ≥97% . . 16 Basil oil. . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . ≥90% . . . . . . . . . 23 Butyl levulinate. . . . . . . . . . . . . . . . . . . 14 Anise seed oil. . . . . . . . . . . . . . natural. . . . . . . . . . . . . . 67 Isoamyl alcohol. . . . 50 wt. . . . . . ≥98%. . 17 Benzyl acetate. . FCC. . . . . . . . . . . . . . . . . . . . . . . . 67 α-Amylcinnamyl alcohol. . . . . . . 69 Butyl formate. . . ≥97%. . . . . 13 Isoamyl acetate. . . 67 Isoamyl cinnamate. . . . . . . . . 8 Acetaldehyde solution. . . . ≥98%. . . . . ≥96% . . . . . . . . 14 Anisole. . . . . . . . . . ≥98%. . . . . 17 Benzyl butyrate.5%. . FCC . . . . . . . . . . . . . . . . . . . . . . . . . FG . 8 Acetanisole. . . . . . . . . . . . . . . . . . . . . . . . . . . 13 Isoamyl butyrate. . . . . Siam . . . . . . . ≥98%. . . . . . . . . . ≥98%. . . . . . . . . . . . Crenulata. . . . . ≥95%. . . . . . ≥97%. . . . . . . . . . . . 24 Calcium acetate hydrate. . . . . . . . . . . . 111 Allyl anthranilate. . . . . . . natural. FCC . ≥98%. . 68 Isoamyl isovalerate. . . . . . . . . . . . . ≥97% . . . natural . . . .FEMA index 2002 – 2228 FEMA No. 69 Isobutyl angelate . . . . . . . . . 17 Benzyl benzoate. . . . . . . . . . . . . natural (US). . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural . . . . . . . . . . . . . . . 118 Pimenta berry oil.16 Benzaldehyde propylene glycol acetal. . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . FG . . . . . . . . . . . . ≥97%. . . . . . . . 69 Butyl butyrate. Certified organic (NOP/EU) . . . . . . . . FCC . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture with Amyl hydrocinnamyl alcohol . . . . . . . FCC . . . . . . . . 14 Angelica seed oil. . . 70 Butyl propionate . . . . . 69 Butyl heptanoate. . . . . . . . . .21 Butyl acetate. . . . . . . . . . . FG . . . . . . . . . . . . . 67 α-Amylcinnamaldehyde. . . . . FG . . . . mixture of isomers. . mixture of cis and trans. . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . anhydrous . . . . ≥98%. . . . . . . . . . . . . . . . . . 15 Anisyl alcohol. . . . . . . . . . 24 Butyric acid. . . . . . . . . . . . . . . . . . . . . . . .18 Benzyl isobutyrate. . . . . . . . . . . . . FG. . . . . . . . . . . 19 Bergamot oil. . . . . . . . . . . . . . . . .5%. . . . . .67 Amyl alcohol. . . . . . . . . . . . . . . . . . . .70 Tributyrin. . . . . . FG . . . . . FCC . . . . ≥98%. 18 Benzyl mercaptan. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 12 Allyl sulfide. 16 Feel inspired at safcglobal. . . . . . . . ≥98% . ≥98% . . . .5%. . . . . . . . . . . ≥80% . . . . natural. . . . . . . . . ≥99% . . . . . . . . 69 Butyl isobutyrate. . . . . . FCC. . . . . . . . . . natural. . . ≥99%. FCC . . . . .12 Allyl isovalerate. . . . FCC. . . . . . . . . . . . . . . . . FCC . . . . . . . .23 Butyl isovalerate. . . . .8 Acetal. FG . . . . . . . . . ≥97%. . . . . ≥99%. . ≥98%. 68 Isoamyl propionate. . . . . . natural. . . . . . ≥95% . . . . . . . . . . . . . . . . . . . 11 Allyl hexanoate. . . . . . . . . . . . . . . . . . mixture of isomers.23 α-Isobutylphenethyl alcohol. ≥98% . . . . . . . FCC. . . . . . . . 22 Isobutyl hexanoate. . 20 Isobornyl acetate. . . . . . . 16 Benzaldehyde. FG . . 17 Benzyl alcohol. . . . . . . . . . . . . . . . . . . FG . FCC . FG . . . . . FCC . . . . . . . . . . . . . Ivory Coast origin. . . . . . . . . . . 17 Benzyl isobutyrate. . . . . . . . . . . . . . . . 23 Butyraldehyde. . . . FCC. . . . . . . . . . . . natural. . . . . . . . . . ≥99. . 19 Bois de rose . . . . . . . . FG . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . . . . . . . 19 Bergamot oil. ≥99%. . . . . . . . . .68 N-Amyl octanoate. . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . 8 Adipic acid. . . . . natural . . . . . . . . . . . . 24 Butyraldehyde. FCC . . ≥99% . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . Name 2126 2127 2127 2128 2130 W212628 W212709 W212717 W212806 W213004 2131 2131 2133 2133 2133 2134 2135 2135 2137 2137 2137 2138 2138 2140 2140 2141 2141 2142 2145 2147 2149 2150 2150 2151 2152 2153 2153 2153 2154 2156 2158 2159 2160 2163 2169 2169 2170 2174 2174 2175 2175 2178 2178 2179 2179 2180 2181 2183 2184 2185 2186 2186 2187 2187 2188 2189 2190 2190 2193 2196 2197 2199 2201 2202 2202 2203 2205 2206 2207 2208 2209 2210 2211 2212 2213 2215 2216 2217 2218 2219 2219 2220 2220 2221 2221 2222 2222 2223 2224 2228 W213101 W213128 W213300 W213306 W213314 W213403 W213500 W213519 W213705 W213713 W213748 W213802 W213810 W214000 W214019 W214108 W214115 W214205 W214507 W214701 W214906 W215007 W215015 W215104 W215201 W215309 W215317 W215325 W215481 W215600 W215805 W215902 W216003 W216305 W216900 W530345 W217018 W217409 W217417 W217506 W217514 W217808 W217816 W217905 W217913 W218006 W218103 W218308 W218405 W218502 W218618 W218626 W218707 W218715 W218804 W218901 W219002 W219010 W219304 W219606 W219703 W219908 W220108 W220205 W220213 W220302 W220507 W220604 W220701 W220841 W220906 W221007 W221104 W221201 W221309 W221503 W221600 W221708 W221805 W221902 W221910 W222003 W222011 W222100 W222119 W222208 W222216 W222305 W222402 W222801 Beeswax absolute breche . . . . . . . . . . . FCC . . . . . . FCC . 99% . . . . . . . . FG . . . ≥65% . . . ≥98%. . . . . 17 Benzyl acetate. . . FCC. . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . 16 Benzaldehyde dimethyl acetal. . . . 35 wt. . . . . . . . FCC . . . . . . . . . . . . . . Name 2002 2002 2003 2003 2003 2003 2003 2003 2003 2004 2005 2006 2006 2007 2009 2011 2012 2015 2018 2020 2021 2022 2026 2028 2029 2030 2031 2032 2032 2033 2034 2037 2038 2039 2040 2042 2043 2045 2046 2050 2053 2055 W200204 W200220 W200301 W200328 W200336 W200344 W200360 W200379 W200387 W200409 W200506 W200603 W200611 W200700 W200905 W201103 W201201 W201502 W201800 W202002 W202118 W202207 W202606 W202800 W202908 W203009 W203106 W203203 W203211 W203300 W203408 W203718 W203807 W203904 W204005 W204218 W204307 W204501 W204600 W205001 W205303 W205508 2055 2056 2057 2057 2058 2059 2060 2060 W205532 W205605 W205702 W205710 W205818 W205915 W206008 W206016 2061 2063 2063 2065 W206105 W206318 W206326 W206504 2068 2069 2072 2074 2075 2075 2077 2078 2079 2079 2080 2080 2082 2082 W206806 W206903 W207209 W207403 W207500 W207519 W207705 W207802 W207918 W207926 W208000 W208019 W208205 W208213 2083 2084 W208302 W208418 2085 2085 2086 2088 2090 2094 2096 2096 2097 2098 2099 2099 2101 2102 2113 2116 2117 2119 2119 2120 2122 W208507 W208515 W208604 W208800 W209000 W209417 W209619 W209624 W209708 W209805 W209902 W209910 W210102 W210218 W211300 W211613 W211710 W211901 W211907 W212000 W212202 Acetal. . . . . . . . natural. . . . . FG . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . FCC. . FG . 13 Isoamyl alcohol. . . . 13 Isoamyl formate. . . . . ≥97%. . . . . . ≥99. . 17 Benzophenone. . ≥99% . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . 8 Acetaldehyde. ≥99%. . . . . . . . . 67 Isoamyl butyrate. . . . . . . .5%. ≥99%. . . . . . ≥98%. . ≥98% . . . . . . . . . 11 Allyl-α-ionone. . . . . . ≥98%. 11 Allyl disulfide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97%. . . . . . . . . . . . . . . . . . 12 Ammonium sulfide solution. . . 69 Butyl anthranilate. . . . . . . . . . . . . . . . . . . . . . .12 Ambrette seed absolute . . FG . . . ≥99%. . . . . linalol type. . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .9%. . . . . . 20 2-Butanone. . . . . . . . . . . . . . 68 trans-Anethole. . . . .10 Allyl butyrate. . . . . . . . . . . . . . . . . FCC . . . . 8 Acetaldehyde solution. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . 68 Isoamyl octanoate. . . 68 Isoamyl salicylate. . mixture of isomers. . . . . . . . 70 Isobutyl hexanoate. . . . . . . . . . FG . . . . . . . . . . 15 Anisyl alcohol. . . . . . . FCC. . . . . . FG . . . . . . . . . . . . . . 24 Isobutyraldehyde. 22 Isobutyl isobutyrate. . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . natural . Cat No. . . . . . FG . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . 8 Acetaldehyde solution. . . .com Page FEMA No. . . . . . . . . . . 13 Amyl octanoate. . . . . mixture of isomers. . . 11 Almond oil. . . . 70 Isobutyric acid. . FCC . . . . . . . . . . . . . . . natural. 70 Butyl butyryllactate. . FG . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . ≥98% . . . FCC. . . . ≥99. natural. . . . . . 106 Peru balsam oil . . . . . . . . 22 Isobutyl butyrate. . . . . . . . .68 Isoamyl isovalerate. . . . . . . . . . . . . . . . . . . . FCC. . . . . . FG . . . . . . . . . . . 67 Amyl butyrate. .106 Basil oil. ≥99%. . . . . . . 8 Triacetin. . 18 Bergamot oil. . . . . . . . . . . . . . . ≥98% . . .17 Benzoin resin absolute . . FCC . . . . . ≥98%. . . . . . . . . . . . . 20 Buchu leaf oil. . ≥98% . . . . . . . . . . . . 18 Benzyl propionate. . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . FCC. . . ≥99%. . . . 70 Butyl phenylacetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural . . . ≥95% . . 16 Benzaldehyde. . . . . . . . . FCC . . . . . . FCC . 70 Butyl 4-hydroxybenzoate. . 68 Isoamyl nonanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . .18 Benzyl phenylacetate. . . . 11 Allyl cyclohexanepropionate. natural. . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . comoric type . . . . . . FCC . . . . . . . . . . . . . . 40 wt. . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . ≥93%. . . . . ≥98%. . . . . . . . ≥99%. . ≥97%. . . . . . . 68 Bornyl acetate. . . . ≥98%. . FCC. . . . 17 Benzyl alcohol. . ≥99% . . . . . . . . . . . . . . FCC . . . . 125 Acetophenone. . . . . . . . . . . . . . . . . . . % in ethanol . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .11 Allyl isothiocyanate. . . . . . . . . . . . % in H2O . . . . . . . FCC . . . . natural (US). . . . . . . . 68 Isoamyl pyruvate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 11 Allyl phenoxyacetate. . . . . . . . . . . . 8 Acetic acid. . . . . . . . ≥98%. ≥98%. . . . . . . . . . . . ≥98%. . . . . . . . . . . natural . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . ≥98% . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . ≥95% . . . 8 Acetaldehyde solution. . . . ≥98% . . . mixture of isomers. . . methyl chavicol type. . . . 67 Isoamyl benzoate. . FG . 14 Anise star oil . . . . . . . 21 Butylated hydroxytoluene. . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . mixture of isomers. . . . . . . . . . . 19 Benzyl salicylate. . . . . . . . . . . 67 Isoamyl hexanoate. . 18 Benzyl propionate. . . . . FG . . . . . 21 Butyl alcohol. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . natural. . . . . . . . . . . . 24 Page 137 . 10 Sodium alginate . . . . 69 Isobornyl propionate. . . . . . . . . . . . . . . . ≥98% . . . . . 17 Benzoic acid. . . . 11 Allyl heptanoate. . . . . . . . 11 Allyl 2-ethylbutyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . . . .5%. . . . . . . . . . . . . . . . . . 13 Isoamyl octanoate. . . natural. . . . . 8 Acetaldehyde. . . . . . . . ≥98% . . . . bitter. . . . . . . . . . . . . . . . . . . . . . .15 Anisyl propionate. . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . 15 Anisyl formate. . . . . . . . . . . . . . 17 Benzyl butyrate. . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . ≥99%. . . . . . FCC . . . . . . . . . . ≥99. . . . . . . . . . . . ≥92% . . . . .6%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . .19 Birch oil. . . . . . . . . . . . . . . . . . . natural.13 Amyl formate. . . . . . 80% isoamyl butyrate basis. . . . . . . . . . . . . . . . . . 17 Benzoin resin absolute. . . . . . . . . . . . ≥98%. . . . . . . . FCC . . . . . . . . . . . 8 Acetic acid. . . . . . . . . . . . . . . 70 Butyl sulfide. . . . . FCC . . . . . . . . . . . . . . . . . . ≥97% . . . . . 11 Allyl cinnamate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5%. . . . . . . . . . . . . FCC . . natural . . 18 Benzyl cinnamate. . . . . . . . ≥98%. . . natural. . . . . . . . . . . ≥98. . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . 13 Isoamyl cinnamate. . . . . . . . . . . . . . . . . natural. FCC . . 21 Isobutyl benzoate. . . . . . . . . . . . . . . ≥90%. . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 70 Isobutyraldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 22 Butyl hexanoate. . . . . . . . . . . . . . . . . . . . ≥99%. . . 67 Isoamyl acetate. . 23 Isobutyl phenylacetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . mixture of isomers. . 68 Isoamyl propionate. . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99. . . . . . ≥99. FG . . . FCC. . . .69 Butyl alcohol. . . . . . . . . . . . . ≥98%. . . . FG . . . . . . . . . . . . . . . .

≥98% . . . . natural. . . . . . . . . . . . . 51 Isoeugenyl acetate. . . . . mixture of cis and trans. 36 2′. . . . . . . . . . . . . . . . . FCC. . . . . . . . ≥97%. . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . 48 Ethyl nonanoate. . . . ≥98%. . . . . . . . . . . . . . . . . ≥98%. . 41 D-Isoascorbic acid. . FCC . . . . . . . . . . . . . . . . . . 27 trans-Cinnamaldehyde. . . . . 98% . FCC . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . 50 Ethyl propionate. .3-Dimethoxybenzene. . . 26 Celery seed oil. . . . . . . . . . . 29 Citronellyl isobutyrate. 29 Citric acid. .α-Dimethylphenethyl acetate. . . . . . . . . . ≥98% . . . . . . . . . 70-75%. . . . . . 47 Ethyl vanillin. . . ≥98% . ≥97% . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . ≥85% . . . . . . . . . . . . ≥98%. . . ≥98%. . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 49 Ethyl propionate. . . . . . . . . . . . 50 Ethyl pyruvate. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . FCC. FCC. . . . . . . . . . . . . . . FCC . . . . . . FG . . . . . . . . . FCC . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . 38 3. . . . . . . . . . . . . Cat No. . . . . . . . natural . . . . . . . . . . . 50 Ethyl salicylate. . . . . . . . . . . . . .33 1-Decanol. . 44 Ethyl isobutyrate. . . FCC . . . . . . . . 43 2-Ethylbutyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . 41 δ-Dodecalactone. . . . . . FCC. . . . mixture of cis and trans. . . . . . . 47 Ethyl lactate. . . . . . . . 71 Eugenyl acetate. . . . . . . . FCC. . . . . . . . . . . ≥99%. . ≥98%. . . . . . . . . . . . . . . . . ≥98% . . FCC . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . . . . . . . . . . . . . . . . . . . . . 47 Ethyl 2-methylbutyrate. FCC . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . natural. ≥98%. . . . mixture of cis and trans. . . . . . . . . . ≥98%. . . . . . . FCC. . . . . . . . . . . ≥98%. . . . . . 28 Cinnamyl formate. . . . . . . . . . . . . . . . . . . . . FG . . FCC. . . . . . . 51 Ethyl isovalerate. . . . . . . . . . . . . . . . ≥98%. . . . . . ≥96%. . . . . 47 Ethyl isovalerate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . 25 Carvacrol. .4′-Dimethylacetophenone. . . 27 Cinnamaldehyde. ≥99%. . . . . . . ≥99% . . . . . . natural. . . natural. . . . . . . . . . . .35 Dillweed oil. . . . . . . .49 Ethyl octanoate. . . . . ≥98%. . . . . . . 42 Ethyl acetate. . . 29 (±)-Citronellal. . . . . . . . . . 32 δ-Decalactone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . 36 1.24 Canaga oil . . . . . . FCC .29 Citronellyl propionate.29 Citral dimethyl acetal. . . . ≥98%. . . . . ≥96% . . . . . . . . .30 Cognac oil . . . . . . . . . . . ≥97%. . . . . . natural . . 51 Ethyl valerate. . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . ≥98% . . ≥97% . . . . . . . . . . . . . . . FCC . . . . . . . . ≥98%. . . . 29 Citronellyl acetate. . . . . natural. 37 2. . . FCC . . . . . . natural. . . . . . . . . ≥97%. . . FG . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . 47 Ethyl levulinate. . . . . . . . . . 43 Ethyl 2-aminobenzoate. . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . 47 Ethyl 3-methyl-3-phenylglycidate. . FG . . . ≥93%. . . . . . . . . . . . . . . . . . . . . . . . . Name 2377 2378 2380 2381 2383 2385 2386 2387 2389 2391 2392 2393 2394 2396 2397 2399 2400 2401 2402 2407 2410 2411 2412 2413 2414 2414 2415 2415 2416 2418 2420 2421 2422 2422 2425 2427 2427 2428 2428 2429 2430 2430 2431 2432 2432 2434 2434 2435 2436 2437 2437 2439 2439 2440 2440 2441 2441 2442 2443 2443 2444 2445 2447 2449 2449 2451 2451 2452 2454 2455 2456 2456 2457 2457 2458 2459 2460 2461 2462 2462 2463 2463 2464 2465 2466 2466 2467 2467 2468 2469 2470 2475 2476 2477 2478 2480 W237701 W237809 W238007 W238104 W238309 W238503 W238600 W238708 W238902 W239100 W239208 W239301 W239402 W239607 W239704 W239901 W240001 W240109 W240206 W240702 W241008 W241105 W241202 W241318 W241407 W241415 W241504 W241512 W241601 W241806 W242004 W242101 W242209 W242217 W242500 W242705 W242713 W242802 W242810 W242918 W243000 W243019 W243108 W243205 W243213 W243418 W243434 W243507 W243604 W243701 W243728 W243906 W243914 W244007 W244015 W244104 W244112 W244201 W244309 W244317 W244406 W244503 W244708 W244902 W244910 W245100 W245115 W245208 W245402 W245518 W245607 W245615 W245704 W245712 W245801 W245909 W246018 W246107 W246204 W246215 W246301 W246328 W246409 W246506 W246603 W246611 W246700 W246719 W246808 W246905 W247006 W247502 W247618 W247707 W247804 W248010 Diethyl succinate. . . . . . . . . 30 Clove bud extract. . . . . . . . . . . . . . . . . natural. . 98% . FG . . . . . . . . FG . . ≥98%. . . . . . 32 p-Cymene. . . . . . . . . . . . . . . . . .51 Eucalyptus oil . . . . . . . . . . . . . FCC . . .4-Dimethoxybenzene. . . . . ≥98%. ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31 Cyclohexyl acetate. . . . . natural. . . . 45 Ethyl hexanoate. . . . . . . . . . . . . . FG . . . . . . . . . . . . . . 33 Decanoic acid. . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . FCC. FCC. . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . 44 Ethyl cinnamate. . . . . . Certified organic (NOP/EU) . . . . . FG . . . . . . . . . FG . .32 Davana oil. . . . . . . . . . . . . 27 Cinnamyl acetate. . . . . . . . 25 Cardamom oil. . . . . . . FCC. . . . 31 Cyclohexyl propionate. . 25 Cardamom oil. . . . . ≥92% . . FG . . . . . FCC. . .33 δ-Decalactone. . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . 32 γ-Decalactone . . . . 85/35% . 35 L-Dihydrocarvyl acetate. . . 30 p-Cresol. . . . . . . . . . . . . . .25 Carrot seed oil . . . . . FCC . . . . . . . . . Certified organic (NOP) . . . . . . . 27 Chamomile oil. . . . . . 26 (−)-Carvyl propionate. FCC. . . . . . . . . . . 29 Citronella oil. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . 80-85% . . . 26 Chamomile oil. . . . . . . . ≥98%. . FCC . . . . . . . ≥97% . . . . . . . . . . . FG . . . . . . . . mixture of cis and trans. . . . . . . . ≥97% . . . . FCC . . . 43 Ethyl benzoate. . . . . . . . . . . ≥90%. . . . . mixture of isomers. . . . . . . FG. . . . . . . . . . . . . . . 45 Ethyl hexanoate. . . . . . . . . . . . . . . . FG . . . . . 49 Ethyl 3-phenylglycidate. . . 28 Cinnamyl isobutyrate. ≥96% .6-Dimethyl-5-heptenal. . . . . . ≥96% . ≥92%. . . . . . . . . . FCC. . . . . . . . . . 119 γ-Dodecalactone. . . FCC. FCC. . . . . . . . . . . . . . . . . . . FCC . . . . . . . . 88 Isoeugenyl phenylacetate. . . . . FCC . . . . . . . . . . . . 47 Ethyl 2-methylbutyrate. . . . . . . . . . . . . . . . ≥93%. 28 trans-Cinnamyl propionate. . . . ≥97% . . . . . . . . . . . . . . . Page . . . . . ≥95% . . . . . . . . . . . ≥98%. . . . . . . . 42 Ethyl acrylate. . . . 34 Benzyl ether. . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Name 2229 2230 2231 2232 2238 2241 2241 2243 2244 2245 2247 2248 2248 2249 2249 2250 W222909 W223018 W223115 W223204 W223816 W224111 W224123 W224300 W224405 W224502 W224707 W224820 W224847 W224901 W224928 W225002 2251 2252 2258 2258 2263 2267 2271 2273 2273 2275 2286 2286 2288 2288 2291 2291 2292 2292 2292 2293 2294 2296 2297 2298 2299 2301 2302 2303 2303 2304 2305 2306 2307 2307 2308 2308 2308 2309 2311 2313 2314 2316 2316 2317 2322 2323 2323 2331 2332 2334 2336 2337 2341 2343 2346 2347 2349 2351 2354 2355 2356 2359 2360 2360 2361 2361 2362 2362 2363 2364 2364 2365 2367 2368 2369 2371 2374 2375 2376 W225118 W225207 W225800 W521205 W226318 W226718 W227102 W227307 W227315 W227501 W228605 W228613 W228818 W228826 W229105 W229140 W229202 W229208 W229210 W229318 W229407 W229601 W229709 W229806 W229903 W230103 W230200 W230308 W230316 W230405 W230502 W230618 W230707 W230715 W230804 W230812 W230840 W230901 W231118 W231304 W231401 W231606 W231614 W231703 W232200 W232300 W232314 W233100 W233218 W233404 W233609 W233706 W234109 W234300 W234605 W234702 W234907 W235105 W235407 W235504 W235601 W235900 W236004 W236012 W236101 W236128 W236209 W236217 W236306 W236403 W236411 W236500 W236705 W236802 W236918 W237108 W237418 W237507 W237604 (+)-Camphene. . . . 33 Decanoic acid. . . . . . . . . . natural . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . 34 Decyl butyrate. . . . . . . . . natural . . . Java. . . . . . . . . . . . 32 Cyclohexyl isovalerate. . . . . . . . .36 1. . . . . . . white . . . . . . . . . . 47 Ethyl laurate. ≥99%. . natural. natural. . . 47 2-Ethylbutyric acid. Chinese 85/35 . . . . ≥98%. . .51 Eucalyptus oil . . ≥99%. . . . . . . . . . . . . . . . .α-Dimethylphenethyl butyrate. . . . . . . . . . . . . ≥93% . .5%. . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . .3-Diphenyl-2-propanone. . . . . . . . . . . . . . . . . . . . FCC. . . . . . .27 Cinnamon leaf oil. . . . . . 95%. natural. . . ≥98% . . . 50 Ethyl sorbate. . . FCC . . . . . . . . . . . . . . ≥98% . ≥99. 97% . . . . FG . . . . . . . . . . . . . . . . 39 α. . . Certified organic (NOP/EU) . . . . . . . . . . . FCC . . ceylon type. . Certified organic (NOP/EU) . . . . . . . . . . . . . . . .49 Ethyl 3-phenylpropionate. . . FG . . . . . . . . . FG . . . . . . . . . . . . 39 2-Methyl-1-phenyl-2-propanol. . ≥99. . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . .51 Ethyl valerate. . 24 Caraway oil. . 47 Ethyl laurate. . . . . . FCC . . . . . . . 27 trans-Cinnamic acid. . . . . 49 Ethyl palmitate. 29 Citronellyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . 25 D-Carvone. . . . . . FCC. . . . . . . . . . . . . . . 27 Chamomile oil. . . . . . mixture of isomers. . . mixture of isomers. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 29 (±)-Citronellal. . . . . . . . . . . . . . . . . . . . . . . ≥97%. 44 Ethyl cinnamate. . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . FCC. . ≥96% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33 Decanal. . . . . . . . ≥98%. . . . . . . natural (US) . FCC . . . . . natural (US). . . . . . . . . . . . . . . . . FG . . . 35 Dihydrocoumarin. . ≥98%. . . . . . . . . . . . . . . natural . . . 35 Diethyl sebacate. . . . . . . . . . .26 β-Caryophyllene. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 40 Sodium phosphate dibasic. . . FCC . . . . . . . . . FCC . . . . . . . . . . . FG . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . . . . . FCC . . . . . . .44 Ethyl decanoate. . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . 31 Cuminaldehyde. . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . FCC . . . . . FCC . . . . . . . . . . 26 Cassia oil. . . . . . . . ≥80% . . . . ≥95%. . . . FCC . . . . . . . . . . . . . FCC . . . . . . . . FCC . . . . . . . . . 44 Ethyl butyrate. . . . ≥97% . . . . . . 34 Diethyl malonate. natural. . . . . . . . . . . . . . . 48 Ethyl octanoate. 34 Decyl propionate. . . ≥98%. FCC . . ≥95% . . . . . . . . . . . . . ≥98% . ≥97%. . . . . . . . natural (US). . . . . . . . natural. . . . . . ≥99%. . . natural . . . . . . . . . . . . . . . . . . . . . . ≥98%. FCC . . 28 trans-Cinnamyl isovalerate. . . . 50 Ethyl tiglate. . . . . . . ≥99%. . . . . . . ≥99%. . . . FG . . . . . . . . . . . ≥97%. . . . . . . . 45 Ethyl formate. . . . . . . . 44 Ethyl butyrate. . . . . . . . 49 Ethyl phenylacetate. . . . . . . . 40 1. . . natural. . . . . . . . . . . . . . . . . . . FCC . . . . . . FG . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . 50 Ethyl pyruvate. . . . . . . . . . . . . . ≥99% . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . FCC . . . . . . . . . . . 28 Cinnamyl cinnamate. . . . . . . . . . . . . . . . . . . . . . . . . . . . 29 Citronellol. . . 42 Ethyl acetoacetate. . . ≥96%. . . . ≥98%. . FG . . . . . . . . 45 Ethyl lactate. . . . . . . . . . 46 Ethyl isobutyrate. ≥92%. . . . . . . . . . . . . 18 Diethyl malate. . . . . . . . FG . . . . . FG . . 26 Cyclohexaneacetic acid. FCC . . ≥98%. . . . . . . FCC . . . . . . . . . FCC. . . . FCC . . . . . . . . . 30 Citronellyl valerate. . . . . FCC . 27 Cinnamon oil. . . . . . . . . . . FG . . . . . . . . . ≥95%. . . . . . . . . . 42 Ethyl acetate. . . . . . FCC. . . . . . ≥92% . . . . . 25 (−)-Carvyl acetate. 26 Castor oil. . . . . . . . . . . . . . . . . . . . . . . . . . 92 α. . . ≥95% . . FCC . . . . . . . . . . . . . . . . . . . . . . . 28 Citral diethyl acetal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33 Decanal. . . . . . . . ≥96% . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . 25 L-Carvone. . . . . 42 Ethyl acetoacetate. . . ≥99% . . . . . . . . . . . . . . . . . . . . . . Cat No. . FG . . . . . . . . . 44 Ethyl decanoate. . . . . . . . . . . ≥98%. . . . . . . . . . . . 99% . . . ≥97%. . . . . . . . . . . 42 Ethyl 2-acetyl-3-phenylpropionate. . . . . . . . . . . . . 41 Elemi Resin. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . . 51 Eucalyptol. FCC . . . . . . natural. . . 45 Ethyl 3-(furan-2-yl)propionate. . . . . . . . . . . . . . . . . . . . . . 52 Place an order with your local SAFC representative (see back for contacts). . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . ≥95%. German. . . . . . . 25 Carob absolute. . . FCC. . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . 30 Clove bud oil. . . . . . . . . . . . . . . . . 49 Ethyl palmitate. . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . 71 Methyl eugenol. . . . . . . . .48 Ethyl myristate. . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 45 4-Ethylguaiacol. . 51 Eugenol. . . . mixture of cis and trans. . . . . . . FCC . . . . . FG . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . .33 n-Decyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 50 Ethyl 10-undecenoate. . . . . . . . . . FG . . . . 25 L-Carveol. . 45 Ethyl heptanoate. . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . ≥98%. FG . . . . . . Roman . . . . ≥97% . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . redistilled . . . . . . . . . . . . . . . . . . . 52 Fenchyl alcohol. . . . . 28 Cinnamyl alcohol. . . FG . . . . . . . . . . FCC. . . . . . . . . . . . . 27 trans-Cinnamic acid. . . . . . . . . . . . . . ≥98% . 99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 28 trans-Cinnamyl butyrate. . natural. . . . . . . . 33 Decanal dimethyl acetal. . . . . . . . . 24 Camphor white oil . . . . . . . . . . . . . . ≥95%. . . . 51 Isoeugenol. . . . . . . . . . . . . . . . . . .35 Diethyl L-tartrate. . . 27 Cinnamon bark oil. . . . . ≥99%. . . FCC. . . . ≥95% . . . . . .5%. . . 41 trans-2-Dodecenal. . . . . . . . . . FCC . FCC . . . . . . . . . . . . .25 4-Carvomenthenol. . . . . . ≥98%. . . natural. . . . . . . . . . . . . . . . . . natural. . . . . . . ≥98%. .39 Dimethyl succinate. . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . FCC . . . . . . . . Java. . . ≥98%. . . . .29 Citronellyl formate. . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31 Cassis bourgens absolute . . . . . 29 Citronella oil. . 35 Page FEMA No. . . . . . . . . . . . FCC . . . FCC . . . . . . FCC . . . . . . 30 Cognac oil . . . . . ≥98%. FG . . ≥92% . . . . . . . . . 45 Ethyl heptanoate. . . . . . . . . . . . . . . . . . . . . ≥80% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥92%. . . . . . . . . .28 Citral. 44 Ethyl cyclohexanepropionate. . . . . . ≥97% . . ≥92%. . . . . . . . . . . . . . FCC . . . ≥98%. . 28 Citral. . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . natural. FG . . . . . FG . . . . . . 24 D-Camphor. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥80%. . natural. . . . FCC . . 30 Costus oil. . . . . . FCC. . . . . . . . . ≥98%. 32 (+)-γ-Decalactone. . . . . . . . Certified organic (NOP/EU) . . . . . 28 Cinnamon leaf oil. . . . . . . . . . . . . . . . . 25 4-Carvomenthenol. . . . . . . . . . . . . . . FCC . . . . . . .SAFC® Flavors & Fragrances FEMA index 2229 – 2480 138 FEMA No. . . ≥98%. . . . . FCC . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . 42 Ethyl p-anisate. . . . . . . . . FCC. . . . . 68 4-Allylanisole. . . . . . . . . . . .7-Dimethyl-1-octanol. . . . . ≥95% . . . . . . . . . . FG . 27 Cinnamon bark oil. . . . 26 Cedar leaf oil . . . . . . . . . . . . . . . . FCC . 42 Ethyl benzoate. . FCC. . . . FCC . . ≥98%. . . . . . . ≥98%. . . . . blue . . . . . . . . . . . . 44 Ethyl formate. . . FCC . . 10 Tarragon oil. 31 Cumin seed oil. . 71 Farnesol. . . . . . . 26 Cassia oil . . . . . . . . . . . . .31 Cyclohexyl butyrate. Ceylon origin. FG. . . . . ≥80%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . ≥95%. . . . . . FCC . . . . 121 4-Ethoxybenzaldehyde. . . . . . . . ≥98%. . natural (US). green. . . . . . . . . . . . . . . . FCC . . ≥98%. . . . . 30 Clove bud oil. . . . natural. . . . . . . . . . . . . . . . . . . . natural . . FCC . FCC . . . . . . . . . 51 Eugenol. . . . . . . . . . . . . . . . . . . . . . . 29 Citronella oil. . natural. . . . . . . . . . . FG . . . . . . . . . . . . . FG . . . . 86 Methyl isoeugenol. . . . . . . FCC . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . ≥85%. FG . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . 30 Coriander oil. . . . . . . . . . . . . . ≥99% . . . . . . natural. . . . . . . . . . . . . . . . . . . . .

. . . . . 89 Methyl 4-methylvalerate. natural (US). . . . . . . FCC . . natural . . . . . . . . . . . ≥97%. . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . FG . . . . . 55 Geranyl butyrate. . . . . . . . ≥92%. . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . FG . . . . 88 Methyl 2-methoxybenzoate. . . . . . natural. . . . . . . . FCC . . . . . . . Argentina origin . . . . . . . . . . . . . . . . 75 Lemon oil. . . . . . . . . . . FG . . . . . . . . . . . . . . . . . 76 Linalyl isovalerate. . . . . . . . . ≥97% . . . . . .57 1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53 Fumaric acid. . . . . . 82 Methyl p-tert-butylphenylacetate. . . . . . . . . . . . . . 87 Methyl hexanoate. . . ≥90%. 55 Geranium oil. . . . . . natural. . . . . . . . . . . . . 97% . .1-Dimethoxyheptane. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥96%. . . . 84 Methyl butyrate. . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . ≥99%. . . 55 Geraniol. . . . . . . . . . . . >98% . . . . .60 trans-2-Hexen-1-ol. . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . natural . . . . . 76 Linalyl benzoate.60 Hexanoic acid. . . . . . ≥98% . . . . . . . 62 Hexyl acetate. . . . . . . . . . . 77 Mandarin green oil. . . . . . . . . 1 wt. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . 56 Ginger extract. . .61 cis-3-Hexen-1-ol. 85 6-Methylcoumarin. . . . . . . . . 53 Furfuryl acetate. . . . . . . . . . . . . natural . . 53 Furfuryl mercaptan. . . . . . . . . . ≥99% . . . . 106 DL-Menthol. . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . 80 1-(p-Methoxyphenyl)-2-propanone. . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . 73 Juniper berry oil. . . . . . . . . natural . . ≥97%. . . . . . . FCC. . ≥98%. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . FG . . . . . FCC. . ≥93% . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . natural (US). . . . . . . . . . . . . FG . . . 82 Methyl anthranilate. . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . ≥95%. . . . . . . . 66 Indole. . . .FEMA index 2482 – 2724 FEMA No. . . . . . . purified by distillation. . . 67 Jasmin absolute. . natural . . . . . . . ≥98%. 57 γ-Heptalactone. . . . . . . . . . . . . . . . . . 79 2-Methoxy-4-methylphenol. . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . Florida . . . . . . . . . . . . . . . . . . . . .75 Lemon oil. ≥98% . . . . 74 Lauryl alcohol. 55 Geraniol. . . . . . . . . . . . 61 cis-3-Hexen-1-ol. . . . . . . . . FG . . . . . ≥99%. . FCC . . . 66 β-Ionone. . . . . . . natural . . . 55 Geranyl acetate. . FCC . . . . . . . . . . . . 86 2-Methylheptanoic acid. . . . . . . . . . . . . . . . . . . 76 DL-Malic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . 58 Heptyl butyrate. . . . . . . . . . . . . FCC . . 55 Geranyl phenylacetate. . . . . . . . 65 Hydroxycitronellal dimethyl acetal. . . . . . . . . . . . ≥98%. ≥99% . . . . FCC. . 84 Methyl trans-cinnamate. . . . . . . . . . . . . . . . >99%. . . . . . . . . . . . . . . . . . ≥84%. . . . . . . . . . . . . sweet. . . . . . . . . . . Certified organic (NOP/EU) . . . . . . . . 74 Lemon oil. . . . . . . . . . . . natural. . . . . . . . . . . . . . . . FCC. . . . . . . . natural. FG . . . . . .55 Geranyl butyrate. . . ≥98%. . . . . . 73 Isovaleraldehyde. . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . 78 L-Menthone. . . . . . . . . FCC . . . . . . . . . . Italian. . . . . 74 Lauric aldehyde. 84 2-Methylbutyraldehyde. . . . . . . . . . . . . . . . FG . . . . . .53 Furfural. . . . . . . . . . . 75 L-Linalool. . . . . 82 α-Methylbenzyl alcohol. . . . . . . Cat No. . . . . . . FG . . . . . . . . . . . . . . . . . 75 Lemongrass oil. . FG . . . . natural. . . ≥95% . . . . . . .52 Fenugreek absolute. . . . FG . . . . ≥97% . . . . . . . . . . . ≥99% . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58 Heptyl acetate. . . . . . . . natural. . . . . . . . . . . .74 Lactic acid. . . . . . . . . . natural (US). ≥99% . . . . . . . . 79 4-(4-Methoxyphenyl)-2-butanone. . . . . . . . . . mixture of isomers. ≥95%. . . . . ≥98%. . . . . . . . . . . . . . . . . . FG . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . FG . . . . ≥98% . . . . . . . . . . . . . Certified organic (NOP/EU) . . . . natural. . . . . . . . . . . .3-Hexanedione. . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . 89 Methyl β-naphthyl ketone. . . . . . . . . . . . . 77 Maltol solution. . . . . . . . . .60 2. . . . . . . . . . . . . . . . . . . . . . . cold-pressed. . . . . . ≥98%. . ≥98%. . . . . . . . . natural . . . . . . ≥98%. . . ≥98%. . . . . . . . . FG . . . FCC. FG. . . . . . . ≥98%. FCC . . . . . . . FG . . . . . . . . . . . . 64 Hexyl propionate. . . . . . . . . . ≥98% . . . . . . . ≥93% . . . . . . . . 88 Dimethyl anthranilate. . . . . . . . . . . . Certified organic (NOP/EU) . . . . . FCC . . . . . . . . . . . . ≥99%. . . . . FCC. . . . . . . . . . . . . . . .3-Heptanedione. . . . . . . . . . . . . 37 Methyl 2-methylbutyrate. . . . . . . . . . . . . . . . FG . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . .5%. . . . natural . . . . . 66 Hyssop oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥93%. . . . . 77 (S)-(−)-Perillyl alcohol. . . . . . . . . . 74 Lemongrass oil. . . . . . . . . . . . . . . . . . . . .74 Lavender oil. . . . . . . . . ≥98%. . . . ≥97%. . . . . . . . . . . FG . . . . . . . FCC . . . . . . . . . . 75 Lime oil. . 81 4-Methylanisole. . . . . . . . ≥92%. . . . FG . . . . . ≥99% . . . . . . . . . . . . . . . . . . 84 α-Methylcinnamaldehyde. . . . . . . FCC. . . . . . . . . . . . . . . . . . natural. . 76 Linalyl propionate. . . . FCC . . . . . . . . . . . . . . . . . natural. . . . . FCC . . . . FG . . . . . . . . . . . . . . . . . . . . natural. . . . . .76 Lovage oil . . . . . . . . . . . . . . . . . . . . .56 Guaiacol. . . FCC . . . Argentina . . . . . . . natural (US). FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . rectified. . . . . . . ≥98%. . . . . . . . . . . . . . . Certified organic (NOP/EU) . FG . . . . . . . . . . . . Mexico origin . . . . . natural (US) . . . . . . . . . . 88 Methyl 3-(methylthio)propionate. . . . . . . . 73 Juniper berry oil. . . . . . . FG . . . . . . . . . . . . FCC . . . . . . . ≥96%. . . . . . . . ≥99% . FG . . . . . . . . . . . . . . ≥98. . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . .com Page FEMA No. . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . ≥97%. ≥97%. . FCC . . . . . natural (US) . . . . . . . . . . . . 64 Hydroxycitronellal. . . . . . . . FCC . . . . . 66 4-(4-Hydroxyphenyl)-2-butanone. . . . . . . . . FG . . . . natural. . . . . . . . . . . . . . . . . terpeneless. . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . FG . . 36 2. . . . . . . FG . . . . . . . . . . . . 56 Geranyl isovalerate. .53 Furfural. . . . . . . . . 81 2-Methylanisole. . . . ≥98% . . . . . . . . 55 Geranyl acetate. . ≥97%. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . FG . . . . . . ≥98%. . . . 82 Methyl anthranilate. FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . 55 Genet absolute. . . . . . . . . . . . . . . . ≥98%. . . . . . 64 Hexyl hexanoate. . 75 Levulinic acid. . . . . . . natural. . . . . . . FCC . . . . . . . . . . . . ≥98%. . . . . . . . . ≥99%. . . . . . . natural . . . . . . . . . . . . 58 Heptyl formate. . ≥98% . ≥97% . . . . . . . . . . 73 Methyl butyrate. . . . . . . 74 Lavender absolute. . . . . ≥97%. . . . . FG . 89 Methyl myristate. . . . . . . . . ≥97%. . . natural. . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . Chinese. . . . . . . . . . 85 5-Methylfurfural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 87 Methyl hexanoate. . . . . . . .74 Lavender oil 40/42% fleurs . natural. . . . . . FG . . . . . . . . .58 Heptyl acetate. . . . . . FCC. . . . FCC. . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . ≥98%. ≥98%.14 2-Methoxy-4-methylphenol. . . . . . . . . . . . . . . . 63 Hexyl alcohol. 64 Hexyl hexanoate. FCC. . . . . . . . . . . . . FCC. . . ≥80% . 65 4-(4-Hydroxyphenyl)-2-butanone. . . . . ≥98%. . . . . . . . . . . . . . . . . . . .5% . . ≥95%. . . 55 Genet extract. . . . . . . . . . . . . . . ≥97%. . . . . . 78 p-Anisaldehyde. . . . . . . . . . . . . . natural (US). . . . . 85%. 77 Maltol. . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73 Jasmin extract. . . . . . . . . .60 cis-3-Hexenal solution. . . . . . . 77 Maltol. 82 Methyl benzoate. . . . . . . . . . . . . . . . . natural. . . . . FG . . . . . . 56 Geranyl propionate. . . ≥98%. . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . ≥98%. 56 Guaiac wood oil . . . . . . . . . . . . . . . . . . . . . 56 Ginger oil. . . . ≥97%. 89 Methyl nonanoate. . . . Certified organic (NOP/EU) . . . . . natural. . . . . . . . . . . FCC . . . . . . . . . . . . . . . 81 Methyl acetate. . FG. . . . ≥98%. . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . 63 α-Hexylcinnamaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . % in benzyl alcohol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 63 Hexyl butyrate. . . . . . . . . . . FG . . . . . ≥90% . . . . . . . . . ≥90%. . . . . . . 76 Linalyl acetate. . . . . . . . . .59 1-Hexadecanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .60 trans-2-Hexen-1-al. . . . ≥98%. . . 98%. . . . . . . . . . . . . . ≥97% . 60 Hexanal. . . .52 Formic acid. . . . . FCC . . ≥98%. . . . ≥97. . FCC. . . . . . . . . . . . . . . . FCC .77 Marjoram oil. . . . . 54 Galbanum oil . . . . . . . . . . . . 50% in triacetin. . ≥97% . . . . . . ≥98%. FG . . . . . 57 Heptanal. . . . . . . . . . . . East Indian. . . . . 81 Methyl p-anisate. . . . . . . 77 Mandarin oil. . . ≥98% . . . . . . . . . . . . . . . . . ≥99%. . . 53 Furfuryl acetate. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .86 Methyl heptanoate. . . . . FCC. . . . . . . . . . . . . FG . . FCC. . . . FCC . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . ≥99%. . . . . . . 59 ω-6-Hexadecenlactone. . . . . . . . . FCC . . . . . . . . . . . . . . . . . 74 Lauric acid. . . . . . . . . . . . . Certified organic (NOP/EU) . . . . . . . . . . . . . . . . . . . FCC. . . . . 74 Feel inspired at safcglobal. . . . . . . . . predominantly trans. . . . . . . . . FCC. . . . . . . . FG .5% . ≥99% . . . . . . 76 Linalyl formate. . . . . . . ≥98% . . . . ≥99%. . ≥98% . . . FG . . 56 Grapefruit oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. 88 2-Methylbutyric acid. . . . . . . . . . . . . . . . natural . . 88 Methyl 2-methylbutyrate. 58 4-Heptanone. . . . . . . . . . . . . . . . .64 Hexyl octanoate. . . . . . . . . . . . FCC . ≥98%. . .74 Lauric aldehyde. . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . FG . . . . . . . . . . . . FG . . . . . . . . . . 57 Guaiacyl phenylacetate. . ≥85% . . . . . . . . . . . . . . natural. . natural . . . 82 α-Methylbenzyl butyrate. . . . . . . . . . . . . . . . . . . . ≥97%. . . FCC . 63 Hexyl butyrate. . . . . ≥95%. . . . . . . . . . 87 6-Methyl-5-hepten-2-one. . . ≥98%. . . . . . . . . . . . . ≥97% . . . . . . . . natural. . . . FCC . California origin . . . . . . . . . . . Chinese. . . .66 α-Ionone. . . . . . . . . . . 56 Glycerol. 60 Hexanoic acid. . . . . . . . . . 75 Lemon oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53 Furfuryl alcohol. . . . FCC. . . FG . .84 (±)-2-Methylbutyric acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . ≥80% . . . . . . . . . . . . . . . . . . . . . . . FCC . FCC . . . . 82 Methyl benzoate. . . . . natural. . ≥97. . . . . . . . . . . ≥95%. . . . . FCC . . . . . . . . . . . . . . . . . . . FG . .73 Lactic acid. . . . . . . .66 Immortelle absolute. FCC . FG . . . . . . natural. . . . . . FCC . . .74 Lauric acid. . . . . . . . . . ≥99%. . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54 Garlic oil. . . . . . . . . . . . . . . . . . . . . 64 Hexyl formate. . . . . . . . . . . . FG . . . . 84 Isovaleraldehyde. . . ≥97% . ≥98%. . . FCC. .76 Linalyl butyrate. . . . . 63 Hexyl acetate. . . . . . . ≥99%. . . . . . . . . ≥98% . . . . 75 Lime oil. . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . 85 Methyl cyclopentenolone. . . . . . . . . 87 Methyl laurate. . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . 86 Methyl 2-furoate. . . . FCC . . . . . . . . . . . . FG . . . . . . 81 2-Methoxy-4-vinylphenol. . . . . . . 87 6-Methyl-5-hepten-2-one. . . . . . 78 DL-Menthyl acetate. 57 2-Heptanone. . . . . . . . 60 trans-2-Hexen-1-al. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .64 Hexyl propionate. . . . . . . FCC . 85 Methyl cyclopentenolone. . . ≥90% . . . ≥98%. ≥97%. . . . . . . . . . . . 77 Mandarin oil. 82 α-Methylbenzyl acetate. . . . . . . . . . . . . . . . . FCC . . FCC . . . . . . . . . . . . . Name 2616 2617 2620 2622 2622 2624 2624 2625 2625 2625 2626 2627 2631 2631 2633 2635 2635 2636 2636 2638 2639 2642 2645 2646 2651 2655 2656 2656 2656 2657 2657 2657 2663 2664 2665 2665 2665 2667 2668 2668 2669 2670 2671 2671 2672 2674 2675 2676 2676 2677 2679 2680 2681 2682 2682 2683 2683 2684 2685 2686 2689 2690 2691 2692 2692 2693 2693 2694 2695 2695 2697 2698 2698 2699 2700 2700 2702 2703 2705 2706 2707 2707 2708 2708 2710 2715 2717 2718 2718 2719 2719 2720 2721 2722 2723 2724 W261602 W261718 W262000 W262218 W262235 W262404 W262440 W262501 W262528 W262533 W262600 W262706 W263109 W263117 W263303 W263508 W263516 W263605 W263613 W263818 W263907 W264202 W264504 W264601 W265101 W265501 W265608 W265616 W265624 W265713 W265721 W265734 W266309 W266418 W266507 W266523 W266590 W266701 W266809 W266825 W266906 W267007 W267104 W267112 W267201 W267406 W267511 W267600 W267619 W267708 W267902 W268003 W268100 W268208 W268216 W268305 W268313 W268402 W268518 W268607 W268909 W269018 W269107 W269204 W269212 W269301 W269328 W269409 W269506 W269514 W269700 W269808 W269816 W269905 W270008 W270015 W270202 W270318 W270504 W270601 W270709 W270733 W270806 W270814 W271004 W271500 W271705 W271802 W271810 W271918 W271926 W272000 W272108 W272205 W272302 W272418 Lauryl acetate. . . . . . 63 Hexyl alcohol. . . . . . . . . . . . . natural. . . . . 61 trans-2-Hexenyl acetate. . . . ≥98%. . 75 (R)-(+)-Limonene. . . . . . . . . . . . . FCC . . . . . . . . 60 Hexanal. . . . . . . . . . . . ≥98%. . . . 66 α-Ionone. . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . FCC. . . . . . . . . . . . . . 78 Menthyl isovalerate. . . . . . . . . . . natural. . . . . . . . . . natural. . . . . . . . . . . . . . . . . 55 Geranyl formate. . . . . . . 96% . . FCC. . . .59 γ-Hexalactone. . ≥98%. . . . . FG . . . . FG . . . . . . . . . . . . . . . FCC. . . . . . . . 56 Geranyl propionate. . . . . . . . 81 Methyl acetate. . .75 Linalool. . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . expressed. . . . . . . 82 α-Methylbenzyl propionate. . . . . FCC . . ≥98% . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . natural . . . . . . . . . . . ≥97% . . ≥97%. . ≥98%. . . 37 Dimethyl anthranilate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . FG . . . . . FCC . . . . . . . . . . . . . . . . . 87 Methyl 4-hydroxybenzoate. . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . FCC . . . . . . ≥95%. . . . . . . . 78 L-Menthyl acetate. . . . . . . . . . . . . . . . 76 Linalyl acetate. . . . . . . . . .54 3-(2-Furyl)acrolein. . . . . . . . . . . . . . . . . . . . FG . . . . . . Certified organic (NOP/EU) . . natural . . . Morocco origin . . . FCC . . . . . . . . . . . . . . ≥98% . . . . . . . 58 3-Heptanone. Name 2482 2486 2487 2488 2489 2489 2490 2490 2491 2493 2494 2501 2503 2504 2505 2507 2507 2508 2509 2509 2512 2512 2514 2516 2517 2517 2518 2521 2522 2525 2530 2532 2534 2535 2539 2540 2542 2543 2544 2545 2546 2547 2547 2548 2549 2552 2554 2555 2556 2557 2557 2557 2558 2559 2559 2560 2560 2561 2562 2563 2563 2564 2565 2565 2567 2567 2568 2568 2569 2570 2572 2572 2575 2576 2576 2583 2585 2588 2588 W248207 W248606 W248703 W248800 W248908 W248924 W249009 W249017 W249106 W249300 W249408 W250104 W250309 W250406 W250500 W250708 W250716 W250813 W250902 W250910 W251208 W251216 W251402 W251607 W251704 W251712 W251801 W252108 W252204 W252506 W253006 W253200 W253405 W253502 W253901 W254002 W254201 W254304 W254401 W254509 W254606 W254703 W254711 W254800 W254908 W255203 W255408 W255505 W255602 W255718 W255726 W255734 W255807 W255904 W255912 W256005 W256110 W256102 W256218 W256307 W256323 W256404 W256501 W256528 W256706 W256714 W256803 W256811 W256900 W257001 W257206 W257215 W257508 W257605 W257615 W258318 W258504 W258806 W258814 2591 2592 2593 2594 2594 2595 2598 2600 2604 2604 2611 2611 2614 2614 2615 2615 W259105 W259200 W259306 W259403 W259411 W259500 W259802 W260000 W260401 W260404 W261106 W261114 W261408 W261416 W261505 W261513 Fennel oil. natural. . . . . >98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . 85 Methyl cinnamate. . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . ≥97%. FG .81 4′-Methylacetophenone. . . . . . . . 84 Methyl isobutyrate. . . . . . . . natural. . . . . . ≥98%. . . . . . . . . 58 Heptyl alcohol. . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 78 L-Menthol. ≥95%. . . . . . . . Cat No. . . . . . . . . . . . . Mexico or Tahiti origin . . . .59 Hexanal. . . . . . . . . . . . . . natural . 89 Page 139 . . . . . . . . 78 L-Menthol. . . . . . . . . . . . . . . . . . . . .

. . . . . . . . . . . . . . . . . 110 Methyl phenylacetate. . . . . . . . . . . . . . . .104 ω-Pentadecalactone. 113 Propionaldehyde. . . ≥98% . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . 104 Parsley oil. . . . . . . . . . . . . . . . .96 Myrrh oil . . . . . . . . . . . . . . . . . . 91 2-Phenyl-1-propanol. . . . . . Certified organic (NOP/EU) . . . . . 108 Phenethyl tiglate. . . . . . . . . . . . . . . . . . . . .108 Phenethyl isovalerate. . . . . . . . . . . . . . . . FCC . 110 3-Phenylpropyl isobutyrate. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . Page . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . .117 Rhodinol. . . . . . . . . . . . . . . . . FCC . . . . . . . . . . FCC. . . . . . . . . . . . natural. . . . . 112 Propenyl guaethol. . . . FG . . . . . . . . . . . . ≥98% . . . . . . . . .1-Dimethoxyoctane. . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . 116 Propyl propionate. . . . FCC . . . . . . . 110 2-Phenylpropyl isobutyrate.93 Methyl salicylate. . . . . FCC. . . . . . . . . . . . . . 113 Propionic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . cold-pressed. . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . .116 Pyruvic acid. . . . . . . . . . . . . . . . . . ≥90%. . . FCC . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . Florida origin . . . . . 98 2-Nonanone. . . . . . . . . . . . . ≥99%. . . . . . . . . . ≥98%. . . . . . . . natural. . . . . . . . . . . . . . . . . . . 73 (R)-(+)-Pulegone. . . . FCC . . . mixture of L-citronellol and geraniol. . . . . . . 106 Peppermint oil. . . 103 Orange flower absolute. . ≥98%. .5% . . . . . . . . natural . . 99% . . . . . FG . . . . . . 118 Sandalwood oil. . FCC . . . . . . . . .92 Methyl propionate. . . ≥94% . . FCC. . . . . . . . . . . . . ≥99%. FCC. . ≥98%. . . . . . . . . . . . . . . FCC . . 107 2-Phenoxyethyl isobutyrate. . 97 trans-2. . . . . . . . . . . . . . . . . . . . . . . 116 Pyroligneous acid . ≥98%. . . . . . . . . . . . . . . . . 104 Patchouli oil. . . . . . . . .103 Palmarosa oil. . . . . . ≥98%. ≥92% . . . . . . . . . 102 Octyl formate. . . . . . . . . . . . . . . . . . . . . .103 Orange oil. . ≥80% . . . . . . . . . 98 Nonanal. . . . . . . . . . . . . . . . . . . . . . . . . . . . 116 Pyruvaldehyde solution. . . . . . . . . FCC . . . 114 Propyl butyrate. . FG . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . .116 (−)-Isopulegol. . . . . . . 20 Peppermint oil. ≥97%. . . . . . . Name 2859 2860 2861 2862 2863 2864 2865 2866 2867 2868 2870 2871 2873 2874 2874 2876 2878 2878 2879 2881 2883 2884 2885 2886 2887 2888 2889 2890 2891 2892 2893 2897 2899 2900 2901 2902 2902 2903 2905 2908 2909 2911 2912 2913 2915 2916 2917 2920 2922 2923 2924 2924 2924 2924 2925 2925 2926 2928 2928 2929 2930 2933 2934 2934 2935 2936 2939 2940 2943 2944 2947 2949 2949 2951 2952 2956 2958 2958 2962 2963 2965 2966 2967 2969 2970 2970 2976 2980 2988 2992 2992 2996 3001 3003 3004 3005 W285900 W286001 W286109 W286206 W286303 W286400 W286508 W286605 W286702 W286818 W287008 W287105 W287318 W287407 W287415 W287601 W287806 W287814 W287901 W288101 W288306 W288403 W288500 W288608 W288705 W288802 W288918 W289000 W289108 W289205 W289302 W289701 W289906 W290017 W290106 W290203 W290238 W290300 W290500 W290807 W290904 W291102 W291218 W291307 W291501 W291609 W291706 W292001 W292206 W292303 W292400 W292419 W292443 W292451 W292508 W292516 W292605 W292818 W292826 W292907 W293008 W293318 W293407 W293415 W293504 W293601 W293903 W294004 W294306 W294401 W294705 W294918 W294926 W295101 W295205 W295604 W295809 W295817 W296236 W296309 W296503 W296600 W296708 W296902 W297003 W297070 W297607 W298018 W298816 W299200 W299225 W299618 W300100 W300306 W300403 W300500 Phenethyl anthranilate. . . 113 Propyl acetate. . .100 Octanal. . . . . . . . . . . . . . . . . .SAFC® Flavors & Fragrances FEMA index 2725 – 3005 140 FEMA No. . . . . . . . . . . . . FCC . . . . natural. . . . . . . . . . . . . . . . . . . . . ≥99%. terpeneless. . . . . . . . .3-Nonanediol acetate. . . . . . . . Cat No. . . . . . . . . . . FCC. 65 2-Phenylpropionaldehyde dimethyl acetal. . 108 4-Phenyl-2-butanol. . . . . . . . . . . . . . . . . . . . ≥96% . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . 110 3-Phenylpropyl isovalerate. . . . . . % in ethanol . . . . . FCC . . . . . . . . . ≥98%. . . . . . . . . . . . . . . 73 Propyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . ≥99% . . . . . . . . . . purified by triple-distillation. . . . . . . . . . . . . . . 106 Phenethyl acetate. . . . . . . . . . . . . . . . . . . . FCC . . 96 Myristic acid. . ≥99% . . . . . FCC . . . . . . . . . . . . . . . . . . . Dutch . FG . . . . . . FCC . ≥98%. . . . . . . . 108 Phenylacetaldehyde. . . . . . 97 Neryl isovalerate. . . . . . . . . . . . . . . . . . . . . . . ≥99%. ≥99% . . . . . . 96 Myristic acid. . . . . . ≥92%. . 99% . . . . 111 Pimenta leaf oil . . . . . . . . . . . . . . . FCC. . .96 Nerolin bromelia . . . . . Certified organic (NOP/EU) . . . . . . . . . Indonesia origin . . . . . . . 111 Piperidine. . . . . . . . . . . . . . . California origin . . . . . . . . . . . . . . . 112 Polysorbate 20 . . . . 107 Phenethyl formate. . . . FCC . . . . . . . . . . 118 Place an order with your local SAFC representative (see back for contacts). . . . ≥98%. . . . . . . . . . . . . . . natural. . . . . . .96 Myrcene. . . . . . . . . . 114 Isopropyl formate. . . . . . . . . . . . . . . . . . . . . natural (US). . . . . . natural (US). ≥97% . . . . . . ≥98% . . . . . ≥97% . . . . . . . . . . . . . . . . . 100 2-Octanol. . 101 Octyl acetate. . 97% . . . . . . FCC. . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . ≥98%. . . . . 113 Propionic acid. . . 113 Propyl acetate. . . . . . . . . . . . . 110 3-Phenylpropyl propionate. . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . ≥96% . . . . . . . . . . . . . FG . . . . . . . 107 Phenethyl 2-furoate. . 110 3-Phenylpropyl acetate. . . . . . . . . . . . ≥98% . . . . . . . . . . . . . FG . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 117 Rum Ether. . . . . . .100 1. . . . 100 3-Octanone. . . . . . . . . . 98 2-Nonanone. . . . . . . . . . . . . . . . . . . . .7%. ≥98% .5%. feed grade. . . . . Certified organic (NOP/EU) . . . . FG . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . ≥95% . . . . . . . . . . . . . FG . FG . . . . . . . . . . . . . . . . . . ≥85% . . . . . . . . . . ≥98%. . . . . . . . . . . . . FCC. . . . 116 Quinine monohydrochloride dihydrate. . . 118 Sage oil. . . . . . . . . . . . . 90 4-Methyl-2-pentanone. . . . ≥99%. . . . . . . . . . . . . . . . 106 Phenethyl alcohol. . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . 102 Octyl butyrate. . . . ≥99%. . . . . 88 2-Methylpentanoic acid. . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . .108 Phenylacetaldehyde dimethyl acetal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. .116 Pyruvic acid. . ≥99. . FG . FG . . . . . . 114 Isopropyl phenylacetate. . . . . . . . . . . ≥95%. . . . . . . . 114 Isopropyl cinnamate. FCC . . . ≥99%. . . . . FCC . FCC . . . . . . . . . . . . . . . Morocco. . . . . . . . . . . . natural.cis-6-Nonadien-1-ol. . . . . ≥99. . . . . 100 1-Octanol. . . . . . . . 101 1-Octen-3-ol. ≥98%. . . natural. . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . ≥95% . . . . . . . . . ≥92%. . . . . . . . . . . . . . FCC . . ≥98%. FG . . . . . . . 116 Isopulegyl acetate. . . . ≥96%. . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . FG . . . . . . . . . FG . . . . . . . . . . 107 Phenethyl phenylacetate. . . . FCC . . . ≥92%. . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . FCC. . Moroccan . FCC . . . . . . . . . . . 98 1. . . . . . 113 1-Propanol. . . . . . . . . . .5% . . . . . . . . . . . . . . . . . . . . . . . . . 90% . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . .114 Isopropyl butyrate. . . . ≥90% . . . . . . . . . . . . . . . . . . . .104 2-Pentanone. . 114 Propyl formate. . . . . . . . . . . . . . . . . . . . . . . . 92 4-Methyl-1-phenyl-2-pentanone. . . . . . . . . . . . . . . . . . . . 40 3-(Methylthio)propionaldehyde. . . . . . . . . . . . . . ≥97% . . . . . 105 4-Pentenoic acid. . . . . . . Certified organic (NOP/EU) . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . ≥97%. . . . . . . FCC . . . . . . . . . . . . . 36 Octanoic acid. . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . FG . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . mixed esters. . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . 106 Peppermint oil. . . FCC . . . . . . . . . . . . . . . . . . ≥96% . . . . ≥98% . 102 Oleic acid. . . . . . . . . . . . purified by redistillation. . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . 102 Olibanum oil . . . . . . . . . . 97 Nerolidol. . . . . . FCC . . . . . . . . . . . . . . . . . . . . FCC . . . . ≥98% . . . . . . . . . . . . . . . . 117 Rosemary oil. . . . . . . 98% . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . ≥99. . . . . . . . 107 Phenethyl salicylate. . . . . . . . . . . . . . 85 wt. ≥97% . . . . . . . ≥98% . . . . . . . . . . . . 97 Nerol. . . . . FCC . . . . . . . . . . . . . . . ≥97% . Cat No. . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . 106 Phenethyl benzoate. 97 Neryl isobutyrate. . . . . . . . . . . . . . . . . . . . 97 Neryl butyrate. . . . . . . . . . . . . . . 96 Neroli oil. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . natural. . 95 Methyl isovalerate. . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . 98 γ-Nonanoic lactone. . . . . . . . . . . . . . .99 γ-Octalactone. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . FG . . . . . . . . . . . 110 Phosphoric acid solution. FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 2-Octanone. . . . ≥99% . . . . . . . . . . . . . . . . 103 Origanum oil. . . . . . . . . . . ≥97%. FCC . . . . . . . . . . . . . . . . . . . . . . 103 Onion oil. . . . . . . . . . . . . . . . . . . . 102 Frankincense oil. . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . 99%. . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . 103 Orris concrete . . . . . . . . . . . . . . . FG . . . . . . . . . . . . ≥98%. . . . ≥99% . . 106 Peppermint oil. . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . 72 Propyl isobutyrate. . . . . . . . . 72 Propyl gallate. . . . . . . . . . . . . . . redistilled. . . . . . . . . . . . 108 Phenylacetic acid. . . . . Spanish. . . . . ≥98%. . . . . . . . . . . . 111 Pine needle oil. . . . . . . . . . . . . . . . .113 Isopropyl alcohol. . . . . . . 106 α-Phellandrene . . . . . FCC . ≥97% . ≥97% . . . . . . . 72 Propylene glycol. . . . . . . 112 Polysorbate 80 . . 103 Orange oil. . . . . . . . . . . . . FCC . . ≥99% . . . . . . . . FG . . . . . . 99% . . . . . . . . . . . . . . . . . . . . FCC. . . .104 Palmitic acid. . . . . Certified organic (NOP/EU) . . natural. . . . . . . . . . . . . . . . . . . . . 113 Propionic acid. . % in H2O . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . ≥90%. . . . 113 Isopropyl acetate. . . . . 100 Octanal. . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . 104 Patchouli oil . . . . . . . . . . . ≥96% . . . . . . . . . . . . . . . . sweet. . . . . . . . . . . . ≥98%. . ≥99. . . . . . . . . . ≥99% . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . ≥90% . ≥95% . ≥99%. . . ≥98% . . . .7% . . . . . . . . . . ≥99%. . . . . . . . . . . 93 Dimethyl sulfide. . . . 95 Methyl valerate. . . . . . . . . . . . redistilled. . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . . . . 107 Phenethyl butyrate. FCC . . . natural. . . . 112 Polysorbate 60 . . natural. . . . . . FCC . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . . . . . . . . . . . . . . ≥97% . . . 100 1-Octanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥90%. . . . . . . . mixture of isomers.40 Dimethyl sulfide. 90 Methyl 2-nonynoate. . FG . . . . . . . . . . . . ≥98%. . 112 Piperine. . . . . . . . . . . . 102 Octyl octanoate. . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . FG . . . . ≥96. . . . . . . . . . . . . 100 Octanoic acid. FG . . . . . . ≥98%. . . . 114 Propyl hexanoate. . . FG . . . . . . .102 Octyl isobutyrate. . . . . . . 111 (−)-α-Pinene. . . .110 2-Phenylpropionaldehyde. 117 Rose absolute. . ≥97% . . . . . . .110 2-Phenylpropyl butyrate. . . . . . . . . . 110 3-Phenylpropionic acid. . . . . . . . . . . 108 Phenylacetic acid. . . . . . . . . . . . . .106 Page FEMA No. . . . . . . . . . . . . . . . 109 3-Phenyl-1-propanol. .109 Benzylideneacetone. . . . . FG . . . . . 92 2-Methyl-3-(p-isopropylphenyl)propionaldehyde. . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . ≥99% . . . . . . . . . 102 Octyl butyrate.107 Phenethyl propionate. . . . natural. . . . . . FG . . . . . . FCC . 90 Methyl octanoate. . . . cold-pressed. natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . 91 Mimosa absolute Moroccan . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 88 6-Methylquinoline. . . . . . . . . . . . .5%. . . . . . . . . . 102 Octyl acetate. . . . . . . . . . . . . . . . . FCC. . . . 73 Pyridine. . . . . . . .108 Phenylacetaldehyde solution. . . . . . . . . . . . . . . . .110 Hydrocinnamaldehyde. . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . 114 Propyl 4-hydroxybenzoate. . . . . . . . . . . . . . . . . .114 3-Propylidenephthalide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 111 (−)-β-Pinene. . . . . . . Mexican . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 103 Orange oil. . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . ≥98%. . . . . . . . . . . . . . FCC . . . . . . . . 112 Piperonyl acetate. 18 1-Phenyl-3-methyl-3-pentanol. . FG . . . . . . . . . .103 Orange oil. . . . . . . 98. . . . . . . . . . . . . . . . ≥80% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . ≥97% . . . . . . . . . . . ≥98% . . . . . . . . . . 102 Octyl propionate. . . . . . . . . . . . Certified organic (NOP/EU) . . . . . FCC . 112 Potassium acetate. . . . . . . . . . . . 98% . . . 102 Octyl isovalerate. . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 Nonanoic acid. . . . 117 Sage oil. . . . . ≥99% . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . ≥98%. . FCC. 106 Phenethyl alcohol. . . FCC. . ≥98% . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥90%. . . . . . . . . . . . . . . . 112 Piperonyl isobutyrate. . . . . . . . . . . . . 117 Rosemary oil. . . . . . . . FCC . . . . . . . . . . Brazil origin . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .107 Phenethyl cinnamate. . ≥99% . . . . 111 (1R)-(+)-α-Pinene. 71 p-Propyl anisole. . . . . . . natural. . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . ≥97% . . . . . . . . . . 99 Nutmeg oil. . . . . . . . . . . . ≥99%. 114 Propyl hexanoate. . . . .71 1-Propanol. 113 Propionic acid. . . . . . . . . . . . . . . . . . . .99 Nonyl alcohol. . . . . . . . . . . . . . % in H2O . . . . . . 118 Salicylaldehyde. . . . . . . ≥98%. . 105 Black pepper oil . . . . . . . . 112 Piperonal. . . . . . . . . . . . . FCC. . ≥99%. . . . . . . FCC . . . . . . . . . . . . . . . 106 Phenethyl acetate. . . . . . . . . 100 γ-Octalactone. . . . . . . . . . . . . . . . 53 Onion oil. . 107 Phenethyl isobutyrate. . . . . . . ≥98%. . . . . . . . . FG . . . 10 wt. . . . . . . . 40 Dimethyl sulfide. . . . . . . . . . 90 Methyl 2-octynoate. . .106 Peppermint oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 113 4-Isopropylbenzyl alcohol. . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . 71 Propyl butyrate. 40 wt. . . . natural. . . . . Name 2725 2726 2728 2729 2731 2732 2733 2740 2742 2743 W272507 W272604 W272809 W272906 W273104 W273201 W273309 W274003 W274208 W274305 2744 2745 2746 2746 2746 2747 2752 2753 2754 2755 2762 2764 2764 2766 2768 2770 2771 2772 2773 2774 2775 2778 2780 2781 2782 2783 2784 2785 2785 2788 2789 2793 2796 2796 2797 2797 2798 2799 2799 2800 2800 2801 2802 2803 2805 2806 2806 2807 2807 2808 2809 2811 2813 2814 2815 2816 2816 2817 2817 2818 2824 2825 2825 2825 2828 2829 2831 2832 2836 2838 2838 2840 2842 2843 2845 2848 2848 2848 2848 2848 2856 2857 2857 2858 2858 W274402 W274518 W274615 W274623 W274658 W274704 W275204 W275301 W275409 W275506 W276200 W276405 W276413 W276618 W276804 W277002 W277126 W277207 W277304 W277401 W277509 W277800 W278009 W278106 W278203 W278300 W278408 W278505 W278513 W278807 W278904 W279307 W279609 W279617 W279706 W279714 W279801 W279900 W279927 W280003 W280011 W280100 W280208 W280305 W280518 W280607 W280615 W280704 W280712 W280801 W280909 W281107 W281301 W281409 W281506 W281611 W281623 W281719 W281794 W281800 W282401 W282510 W282529 W282537 W282812 W282928 W283109 W283207 W283606 W283800 W283823 W284009 W284203 W284300 W284505 W284807 W284815 W284823 W284831 W284843 W285609 W285706 W285714 W285803 W285811 Methyl trans-2-nonenoate. . natural. . . . . . . . . . 109 1-Phenyl-1-propanol. . . . . . . FCC. . . . . ≥98%. . . . . . . . . . . . . . FG . . 97 Neryl acetate. . . . . FCC . . . . . . . . . . . . . 98 Nonyl acetate. . . . . . . .

. . . . . . . . . . . . . 58 δ-Hexalactone. . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . 37 3. . . . . . . . . . . 124 Thyme oil. . . . . ≥98%. . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥93% . . . . . . . . . . . . 10 wt. . . . . . . . . . 73 5-Methyl-2-phenyl-2-hexenal. . . . . . . . . . . . . . . . . . . . . 73 Isovaleric acid. . . . . . . . . . . . . . . . . . . . . . . . ≥95% . . FG . ≥99%. . . . . . 124 Tributyl 2-acetylcitrate. . . . . . . . . . . . ≥99% . 92 Methyl propyl disulfide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . .130 Ylang-ylang oil. . . . .4-Decadienal. . ≥99%. . . . FG . . . . . . . .α-Dimethylstyrene. . . . . . . . . . . . . . . 98%. FG . . .125 L-Turpentine . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . . . . . FG . . . . . . . . ≥97%. . FCC. . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . 122 2-Thiophenethiol. . . . . . . . . . 65 4-Hydroxy-2. . . . . . . . . . . . . . . . 128 2-Undecanone. 122 Tetrahydrofurfuryl alcohol. . . . . 49 2-Ethyl-1-hexanol. . . 77 2-Mercaptopropionic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥96% . mixture of isomers. . . . . . . . . . . . . . . . . FCC. . 48 4-Ethylphenol. . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural (US). . . . . . . . . 33 4. . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . .5-Trimethylpyrazine. . . . . . . . . . . . ≥99% . . . . . . . . . . . . 123 o-Toluenethiol. . . . . . . . . . . . . FCC. . . . . FCC . . . . . . . . . . . . . ≥98%. . . . . . . .com Page FEMA No. . . . . . . . ≥98% . . . . . . . . . . . . . . FG . . . . . FG . . . . . . . . . 73 (±)-γ-Valerolactone. . . . . . ≥98%. . . . . . . . . . . . . . . . 122 Tetrahydrolinalool. . . . . . . . . . . . . . . ≥98% . . ≥98% . . . 127 2-Undecanol. . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . 121 DL-Tartaric acid. . . . . . . . .6-Tetramethylpyrazine. . ≥90% . . . . . . . . . . . ≥95%. . . 22 Cyclopentanethiol. . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . 40 Page 141 . . . 19 2-sec-Butylcyclohexanone. . . . . . . . . . . . . ≥98% . . .α. . . . . . . . . . . ≥96. . . . . . . . . . FG . FG . . . . . . . . . . . 108 2-Phenyl-2-butenal. . . FG . ≥98% . ≥98%. . . . . .54 Feel inspired at safcglobal. . . . . . . . . . . FCC .122 Terpinyl propionate. . . . . . . . . . ≥94% . . . . . . . . . . . . . . 129 Violet leaf absolute . . . natural. . 62 Hexyl isobutyrate. . . . .4-Dimethoxystyrene. . . natural. . FG . . . . . . . . . . . .5-dimethyl-3(2H)-furanone. . . . . FG . . ≥99%. . . . . . . . . . FCC. . . . ≥98% . . .trans-2. ≥98%. . . . . . . . . . . 119 Sodium citrate dihydrate. . . . . . . . . . . . . 91 cis-Jasmone. . . . . . . . . . . . . . . . . . 130 Wintergreen oil. . . ≥95% . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .105 Isopentylamine. . . . . . . . . . . . . . . . . . . . . . 121 Tannic acid .2′-(Thiodimethylene)difuran. . . . ≥80%. . . . . . . . 15 Benzothiazole. . Name 3161 3162 3163 3163 3164 3165 3167 3168 3169 3170 3171 3171 3172 3172 3174 3174 W316105 W316202 W316315 W316318 W316407 W316504 W316709 W316814 W316903 W317004 W317101 W317128 W317209 W317215 W317403 W317411 3174 3177 3177 W317454 W317705 W317713 3180 3181 3183 3184 3186 3188 3191 3193 3194 3195 3196 3199 3200 W318000 W318108 W318302 W318418 W318604 W318809 W319104 W319309 W319406 W319503 W319600 W319902 W320005 3201 3202 3203 3204 3205 3208 3209 3212 3213 3215 3218 3219 3221 3222 3223 3224 3225 3226 3228 3229 3230 3231 3233 3235 3236 W320102 W320218 W320307 W320404 W320501 W320803 W320900 W321206 W321303 W321508 W321818 W321907 W322105 W322202 W322318 W322407 W322504 W322601 W322806 W322903 W323004 W323101 W323306 W323500 W323608 3237 3237 3238 3240 3241 3242 3244 3244 3245 3246 3247 3248 3249 3250 3251 3252 3254 3255 3256 3259 3261 W323705 W323713 W323802 W324000 W324108 W324205 W324418 W324426 W324507 W324604 W324701 W324801 W324906 W325007 W325104 W325201 W325406 W325501 W325600 W325900 W326100 3262 3263 3264 3266 3267 3268 3269 3271 3272 3273 3274 3275 3277 W326208 W326305 W326402 W326607 W326704 W326801 W326909 W327107 W327204 W327301 W327409 W327506 W327700 Furfuryl isopropyl sulfide. . . . . China origin . . . . . . . . . . .5. . . . . . . . . . . . . . . . . . . . . . . . . FG . . . ≥97% . . . . . . . . . . . . . . . . . . . . 53 Furfuryl methyl sulfide. . . . 35 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. .2-cyclopentadione. . . . . . . . . . . . . . . . . . . . . % in propylene glycol .124 Tolu balsam . . . . . . . . ≥98%. . . mixture of diastereomers. . natural. ≥98%.6-Dimethoxyphenol. . . . ≥98% . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . ≥98% . . . . . . 61 trans-3-Hexenoic acid. . . . . . . . . ≥90% . . . . . . . . . . . . . ≥94% . . . . . . . . . . . . . . 32 cis-4-Decenal. mixture of cis and trans. . . .2′-(Dithiodimethylene)difuran. . . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . . . .FEMA index 3019 – 3277 FEMA No. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .107 Phenol. . . . . . . 129 2-Acetylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . 101 trans-2-Pentenal. . . 87 1-Methylnaphthalene. . . . ≥90% . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. mixture of isomers. . . . . . . . ≥97%. . . . . . . . . . . . . . 122 (+/-)-Tetrahydrofurfuryl propionate. . . . . . . . 57 trans-2-Heptenal. . . . . . white. . 60 trans-2-Hexenoic acid. . . FG . . . 65 p-Mentha-8-thiol-3-one. natural . . . 46 3-Ethyl-2-hydroxy-2-cyclopenten-1-one solution. . . . FG . . 37 3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 118 Sodium benzoate. . . FG . . . . . . . . . . . . . . . . . . . . . .61 cis-3-Hexenyl acetate. . . ≥98% . . . . . . . . . . . . 122 Tetrahydrofurfuryl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. 59 3. . . . . . . . . 9 4-Phenyltoluene. . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . ≥96% . 130 Ylang-ylang oil. . . . . . . . . . . . . . . . . . . . 70 2-Isobutyl-3-methylpyrazine. . . . . . . . 95 Styrene. . . . . . . . . . . . . . . . . 125 p. . . . . . . 98% . .6-Xylenol. . . . . . . . ≥88% . . . . . . . . . . . . . . . . 119 Stearic acid. . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . 121 Terpinyl isobutyrate. . . . . . . . . . . natural. . . . FG . . . . . . .6-Tetramethylpyrazine. . . . . . . . . . . . . . . . 39 4. . 116 2-(Methylthio)pyrazine. . . . . . . . 122 Terpinyl formate. 124 m-Tolualdehyde . . . . . . . . . . 130 Ylang-ylang oil. . . . . . . . . . . . . . . . . . ≥97% . . 129 Vanillin. . . . . . . . .126 2. . . FCC. . . . . . . . . . . . . . . FG . . . . . . mixture of cis and trans. . . . . . . . . . . ≥95%. . . . . .124 Thymol. . . . . . . . . . 124 p-Tolyl acetate. . . . . . . . . . . . . . . FG . . . natural. . . . . . . . ≥90% . . . . .129 Veratraldehyde. . ≥96%. . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . 46 2-Ethyl-5(6)-methylpyrazine. ≥85% . . . . . . . . FG . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . 9 Biphenyl. . . . . . . . . . . . . . . . . . . . . . 65 4-Hydroxy-2. 119 Spike lavender oil . . . . . . . . . . . . . >99%. . ≥99% . . .95 trans. . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . 107 Phenethyl octanoate. . . . mixture of isomers.5-Dimethylthiazole. . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . 50 wt. . . . . . . 128 Undecyl alcohol. . 53 Furfuryl thioacetate. . . . . . . . . . .4-Dimethyl-5-acetylthiazole . ≥97% . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . .5-dimethyl-3(2H)-furanone solution. . . . . extra . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . Cat No. .5-Trimethylpyrazine. . . . . . . . . . . . . ≥97% . . . ≥99% . ≥95%. . . . . . . . . 119 Spearmint oil . . . . . . . . . . . . . . . . . . . . . FG . . . white. . terpeneless . . . . . . . ≥98%. . . . . . ≥97% . . . ≥99%. . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 119 Spearmint oil.3. . . . . . . 71 Phenethyl hexanoate. . . . FCC . . 125 2. . . . . . natural. Name 3019 3024 3025 3026 3028 3029 3032 3032 3032 3032 3033 3035 3037 3038 3040 3042 3044 3044 3045 3045 3046 3047 3049 3050 3052 3053 3055 3056 3057 3058 3060 3062 3064 3065 3065 3066 3068 3068 3068 3069 3073 3077 3080 3082 3083 3083 3089 3091 3091 3092 3093 3093 3095 3097 3098 3101 3102 3102 3103 3107 3107 3108 3109 3110 3113 3119 3119 3119 3119 3124 3126 3129 3130 3132 3133 3134 3135 3136 3137 3138 3142 3144 3146 3148 3148 3149 W301912 W302406 W302503 W302600 W302805 W302902 W303208 W303216 W303224 W303237 W303305 W303518 W303704 W303801 W304000 W304204 W304401 W304409 W304506 W304522 W304603 W304700 W304905 W305006 W305200 W305308 W305502 W305618 W305707 W305805 W306002 W306207 W306401 W306509 W306540 W306606 W306800 W306801 W306802 W306908 W307300 W307718 W308005 W308218 W308307 W308315 W308900 W309101 W309109 W309206 W309303 W309311 W309508 W309702 W309818 W310107 W310204 W310212 W310301 W310700 W310727 W310808 W310905 W311006 W311308 W311901 W311928 W311936 W311942 W312401 W312606 W312908 W313009 W313203 W313300 W313408 W313505 W313602 W313718 W313801 W314218 W314404 W314609 W314803 W314811 W314900 3151 3152 W315109 W315214 3153 3154 3155 3156 3158 3160 W315303 W315400 W315508 W315605 W315818 W316008 Skatole. . . . . . . .9 β-Alanine. . . . . . . 40 2. . . . . . .6. . . . . ≥85%. . . 126 Undecanoic acid. III . . . .7-Tetrahydro-3. . . . . . FCC. . 109 Propyl disulfide. . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . 119 Spearmint oil. . . FCC . . . . . . . . . . . . . . . . . . 9 2-Acetylpyridine. . . . . . . . . . . 130 Ylang-ylang oil. . . . . . . . . . . . . . . . . . . . . . . . 128 Vanillin. . 39 2. . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . 25 wt. . . . . . . . . . . . . . . . . . 114 Isopropyl tiglate. . . ≥90% . . . . . . . . . . ≥99%. . . 94 (Methylthio)methylpyrazine. . . ≥99%. . . ≥96%. . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . ≥97% . . . . . . ≥98% . . . . . . . . . . Cat No. . . . . . FG . . . FG . . . natural . . . . . . . .2-propanedione. . . 15 L-(+)-Arabinose. . . . . . . . . . . . FCC . . . . . . 124 p-Tolyl phenylacetate. . . . . . . 130 2. . . FCC. . . . . . ≥97%. . FG . . . . . . . . ≥99% . 64 4-Hydroxy-2. . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . mixture of cis and trans. . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . 39 2. . . . ≥98%. . . . . . . . . . .54 2-Furyl methyl ketone. . . . . . . . . . . . . . . . . . . . . . . 121 α-Terpineol. . . . ≥96% . .124 Thyme oil. . . . . . . . . . .α-Trimethylbenzyl alcohol. . . . . FG . . . ≥94% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 127 2-Undecanone. . . . . . . . . . . . . . . . . . 128 Valeraldehyde. ≥98% . . . . 128 2-Vinylanisole. . . . . . . . . . . . . . ≥98% . . . . . . . . . FG . . . . mixture of cis and trans. . . FCC . FG .4-Nonadienal. . . . ≥98%. . . . . . . . . . . ≥85%. . FG . . . 19 Butylamine. . 109 1-Phenyl-1. . . . . . ≥99%. . . . . . . . . . . . . . . . . 109 Phenyl disulfide. . FCC . . . . II . . . . . . . . 121 Terpinyl butyrate. 119 Spearmint oil. . . . . . . . . . . . 92 4-Methyl-2-phenyl-2-pentenal. . . . . . . . ≥97%. . . . . . . . . . . FCC . . . . . . . . . FG . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . 79 2-Methoxy-3-methylpyrazine.5% . . . . . . ≥97% . . .3.77 p-Mentha-8-thiol-3-one. . . . . . . . . . . . . . . . . . . . . . . . . .79 o-Methoxycinnamaldehyde. . . . . . . ≥92%. ≥98% . . . . . . . . . .2-cyclopentadione. . . . . . .130 2-Acetyl-3-ethylpyrazine. . . . . . . . . FG . . 97%. . . ≥80% . . . . . . . . . . . . . . . . . . . . . . . 36 2. % in propylene glycol . . . . . . . ≥98% . . . . . . . . . . . 97% . . . . . . . . . . . . . ≥98%. . . . . . . . . FG . ≥94%. . . . . . . . . . . . . . 37 3. . . . . . . . . . . . . . .127 Undecylenic acid. . . natural. . . . . . . . . . . . . . . . .54 trans. . . . . . . . . . . . . . . . . . . . . 129 Vanillin acetate. . . . . . . . . . . . . 119 D-Sorbitol. 121 Terpinyl acetate. . . . . . . . . . FCC . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . 111 2-Methyl-3-furanthiol. . . . . . . . .7-Dimethyl-6-octenoic acid. . . . . . . . .39 p. . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . ≥99%. . . . . . . .95 5-Methyl-2-thiophenecarboxaldehyde. . . . . . . . . . . . . . . . . . . . 32 L-Cysteine. . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . FCC . . . . FG . . . . .123 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . 86 2-Methylhexanoic acid. . . . . . . . 94 4-Methyl-5-thiazoleethanol acetate. . . .5. . . . . . . . . . . . . . . ≥97% . . . ≥99%. . . . . . . red . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 124 p-Tolualdehyde. . . . . . . . . 37 3. . . . . . . . FG . . . . . . . . . . . ≥97% . . . ≥98% . .3-Diethylpyrazine. . . .6-Dimethylpyrazine. . . . ≥98% . . . . . . . . . . . . . ≥98%. . . . . . . . .5-dimethyl-3(2H)-furanone. . . . . 122 Tetrahydrofurfuryl acetate. 125 trans-2-Tridecenal. . 120 4. . 118 Sodium Acetate Anhydrous. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 40 Disodium succinate. ≥98%. . . . . . . . . . . . . . . . . . . . . . . ≥88% . . . . . . . . . . . . . . . . . . . . . 123 Thyme oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 121 L-(+)-Tartaric acid. . . 44 Ethyl 2-trans-4-cis-decadienoate. . . . . . . . . 62 cis-3-Hexenyl acetate. . . . . FCC. . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97% . . .3-Dimethylpyrazine. . . . . . . . . . . . . . . .7%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . 127 γ-Undecalactone. . . . . FG . . . . . . . . . . . . natural (US). . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . natural . . 123 2. . .6-dimethylbenzofuran. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . .70 2-Isobutylthiazole. . mixture of isomers. . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . ≥99% . . . . . . FG . . . . . . . . . . . . . . . . . . .3. . Certified organic (NOP/EU) . . . . . . 93 5-Methylquinoxaline. . . ≥99%. . . . . . . . . 119 Sorbitan monostearate. . . . . . . . . . . . . .trans-2. . . . . 120 Tagete oil. . . . . . . . . . . . . 49 2-Furanmethanethiol formate. . . . . . . . . . . . . . . . . . . . . . . FG . . . .127 γ-Undecalactone. . . . . . ≥98%. ≥98% . . . . . . . . . . . . . FCC.4-Dimethyl-1. . . . . . .trans-2. . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . 98%. . . . . . . . . . . . . . . . . . . 40 Dimethyl trisulfide. . . . . . .120 Sucrose octaacetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . . . .5-Dimethyl-1. . . . . . . .119 Styrax . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 128 Valeric acid. . . . . . . FCC. . . . . . . . . . 54 2-Furyl methyl ketone. FG . . . . . . . . . . . . .70 trans. . . . . . . . . . . . . . . . . . 92 Methyl 2-pyrrolyl ketone. . natural. . . . . . . . . . 122 2. . . FG . . . . ≥95% . FCC . . . . . . . . . . . . . . . . . . .5. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . . . FG . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . 99 trans-2-Octenal. . . . . . . . . . . . . . . . . . . . . . . . . . . 91 trans-2-Methyl-2-pentenoic acid. . . .10 (+)-Arabinogalactan . 46 5-Ethyl-3-hydroxy-4-methyl-2(5H)-furanone. . . . . . . . ≥90% . . . . . . . . . . . . . . . .124 o-Tolualdehyde . . . . . . . . . . ≥85% . . . . ≥99%. . . . . . . . . . . . 41 Ethyl 2-trans-4-cis-decadienoate. . . . . . . . .3. . . . . . . ≥98% . . . extra. 48 2-Ethyl-3-methylpyrazine. . . . . . . . . . ≥98% . . 89 2-Methyl-2-pentenal. . . . . . . . . . ≥95%. . . . . . . . . . technical grade . 124 Trimethylamine solution. . . . . . . . . . . natural (US). FG . . . . . . . .5-Dihydro-3(2H)-thiophenone. . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . 37 2. . 98% . . . 121 Terpinolene. 44 2-Ethyl-3(5 or 6)-dimethylpyrazine. . . . . . . . . . . FCC. ≥99% . . ≥98% . . . . .128 10-Undecenal. . . 64 Hexyl isobutyrate. . . 125 Triethyl citrate. . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . 121 α-Terpineol. . .4-Heptandienal. FCC. . . . . . . 73 Pyrazineethanethiol. . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . .4-Hexanedione. . . . . . ≥99%. . . . .79 2-Acetyl-1-methylpyrrole. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . ≥85%. . . . . . . . . . . . . . . . . ≥97%. . . . . ≥99. . . . . . . 130 Vanillylacetone. . . . . . . . . . . . . . . . . . . FG . . . . . % in H2O . . . . . . . . . 21 2-Isobutyl-3-methoxypyrazine. . . . . . . . . FCC. . . . . . . . . ≥97% . . mixture of isomers. . . . . . . . . . . . . . 97 trans-2-Nonenal. . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . FG . . . . . FG . . . . . FG . . 32 2. . . . . . 127 Undecanal. . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . ≥96%. . FG . . . . . 125 Triethyl citrate. . FG . . . . . FG . . . ≥90%. . . FG . . . . . . . . . . ≥96%. . . . . . . . . . . . 17 Bis(2-Methyl-3-furyl) disulfide. . . . . . . . . . . . . . . . . . .5-Dimethylpyrazine. . . . . . . . 128 Isovaleric acid. . . . . . 122 Tetrahydro-4-methyl-2-(2-methyl-1-propenyl)-2H-pyran. . . . 93 4-Methyl-5-thiazoleethanol. . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . FG . . . . . . . . . . . FCC. . . .

. . . . 12 Butan-3-one-2-yl butanoate. . ≥90%. . . . . . . . . . . . . . . . . . . . predominantly trans. . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . 46 Ethyl 3-(methylthio)propionate. . . . . 123 Thiamine hydrochloride. . . . 78 DL-Methionine. . . . . . 21 o-Cresol. . .5%. . . . . . . . . . FG . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . 123 2-Thienyl disulfide. .60 cis-3-Hexenyl 2-methylbutanoate.6. Name 3279 3280 3281 3282 3283 3284 3285 3286 3287 3288 3289 3289 W327905 W514403 W328103 W328200 W328308 W328405 W328502 W328618 W328707 W328804 W328901 W328915 3290 3291 3293 3294 3295 3297 3298 3298 3301 3302 3303 3304 3305 3306 3307 3308 3309 3310 3311 3312 3313 3314 3315 3316 3317 3317 3318 3321 3322 3323 3324 3325 3326 3326 3327 3328 3329 3332 3333 W329002 W329118 W329304 W329401 W329509 W329703 W329800 W329810 W330108 W330205 W330302 W330418 W330507 W330604 W330701 W330829 W330906 W331007 W331104 W331201 W331309 W331401 W331503 W331600 W331708 W331715 W331902 W332100 W332208 W332305 W332402 W332518 W332607 W332615 W332704 W332801 W332909 W333204 W333301 3336 3340 3342 3343 3345 3346 3347 3348 3348 3351 3352 3353 3354 3356 3358 3359 3359 3360 3362 3364 3365 3368 3372 3373 3374 3375 3376 3377 3379 3380 3382 3383 3386 3388 3389 3390 3391 3393 3393 3394 3395 3397 3398 W333603 W334006 W334200 W334308 W334502 W334618 W334707 W334804 W334812 W335118 W335207 W335304 W335401 W335606 W335800 W335908 W335916 W336009 W336203 W336408 W336501 W336807 W337218 W337307 W337404 W337501 W337609 W337706 W337900 W338001 W338206 W338303 W338605 W338818 W338907 W339008 W339105 W339315 W339318 W339407 W339504 W339709 W339806 Ethyl 2-mercaptopropionate. . . . . . . 54 L-Glutamic acid. . . 128 DL-Valine. .3-Diethyl-5-methylpyrazine. . .86 Methyl trans-3-hexenoate. . . . . . . 105 2-Pentylfuran. . FG . . . . . . FG . . FG . . . . . . . . . . . . . ≥95% . . . . . . . . . . 75 3-Mercapto-2-butanone. . . . . . . . . . . . . . . . . . . . . . . . . . . . .14 δ-Undecalactone. . . . 127 2. . 99% . .114 2-Propylphenol. . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . 85 5H-5-Methyl-6. . . . . . . . . . . . ≥97% . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . 62 2-Isopropyl-5-methyl-2-hexenal. . . . FG . . . . . . . . ≥96% . . . . . . . . . . . . . . . . 101 Propyl mercaptan. . . . . . . 71 L-Leucine. . FG . 98 3-Nonanone. . . . 8 Acetone. . . . . . . . ≥95%. . . . ≥97% . . . . . . . ≥97% . . . . .59 4-Hexen-1-ol. . . . . . . FCC. . . . . . . . .12 2. . . . . . . . ≥98% . . . . .trans-2. . . . . . . . . . . . . . . . . . . FG . . . . . . . . FG . . . FG . . . .1-1. . . 50%. FCC . . . . . . . . . . . . .6. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . FCC . . . . . . . FG . . . . . . . 98% . . . . 98 2-Pentanol. . . . . . . . . .60 4-Hydroxybutanoic acid lactone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 88 2-Methylpentanal. . . . FG . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . FG . . . . . . ≥98% . . . . 72 trans-2-Methyl-2-butenal. . . . . 98%. . 69 2-Methoxy-3-(1-methylpropyl)pyrazine. 91 3-(Methylthio)-1-hexanol. . . . . . .5%. . . . . ≥99%. . . . . . . . . . . . . FG . . . . . . . . . . 95 trans-3-Octen-2-one.61 cis-3-Hexenyl formate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .117 (−)-Ambroxide. 94 4-Methylthio-4-methyl-2-pentanone. . . . . . . . . .6-Trimethyl-1-cyclohexene-1-acetaldehyde. . . . . . . . . . . . ≥94% . FG . . . . % in triacetin . . ≥98. . . . . . . . . . . . ≥97% . . . . . . . . . . . . . FG . .trans-2. mixture of α. . . . . . 94 3-(Methylthio)butanal. FCC . FG . . . . . . . . . . 50 2-Ethylfenchol. 83 2-Methylbutyl isovalerate. . . . . . . . . . . FCC . . . . . . . . . . . . . . . ≥90% . . . . . . . . . . . . . . . . . . . . . . ≥99% . 128 3-Acetylpyridine. . . . . . . . . . . . . . . .9-Nonanedithiol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . . . . . . ≥96%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . 95 trans-2. . ≥95%. ≥98%. . . . . . . . . . . . . . . . . . . 88 3-Methylpentanoic acid. . . . . ≥98%. . . . . . FCC . . . . . .5(6)-dimethylpyrazine. . . . . . . . . . . . . 46 trans. . . . . . . . . . . . . . ≥97%. . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . .4. . . ≥98%. . . . . . . FCC . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . FCC . . . . . . . . . . . 79 3-Methylbutyl 2-methylbutanoate. . . . . ≥97% . . . . . . . . . ≥97%. . . . . . . . . . . 99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 21 3-Butylidenephthalide. .46 5-Ethyl-2-methylpyridine. FCC . . . . . . . . . . 40 Ethylene brassylate. . . . . . . .5-Trimethyl-1-hexanol. . . . . . . . . . . . ≥85% . . . . . . . . . . . . . . . . . . . 9 2-Acetylthiazole. . . . . . . . . . . . . . . .10-Dimethyl-5. . . . . . . . . . FG . . . ≥98%. . . . . . . . . . . . . . . . . . . . FCC . . . . Page . . . . . . . ≥99%. . . . . ≥98%. . . . . . . . . . . . . . 43 Ethyl maltol. . . . . . ≥98% . . . . . . natural (US). ≥97%. . . . . . . . . . . . . . . . . . mixture of isomers. . .95 2-Naphthalenethiol. . . . . 94 1. . . . . . . . . . . . . . 35 2-Ethoxythiazole. . . . . . . . . . . . . . ≥93%. . . . . . . . FG . . . . . . . 91 cis-6-Nonen-1-ol. . . . . . . . . . . . . . . . .87 4-Methyl-3-penten-2-one. . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . 20 1-Butanethiol. . . . ≥99% . . . . . . 50 Ethyl thioacetate. . . . ≥98% . . . . ≥97%. . . . . . . 95% . . . . 105 L-Proline. . . . 99% . . . . . . . . . . . . . . . . . . . . . 37 Ethyl 3-hydroxybutyrate. . . . . . 63 δ-Nonalactone. . . . . . . ≥98% . . . . . . . . . . . . . 86 Methyl propyl trisulfide. . ≥90% . . . . . . . . . ≥98% . . . . . . . . . . . . . . 10 wt. . . . . . ≥97% . . . . . . 54 1-Furfurylpyrrole. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31 3-Decen-2-one. . . . . . . . . . . . . . . . 79 2-Methoxypyrazine. . . . . . . . . . . . . . . . . . . . . . . FCC. . . ≥99%. . . . . . . 96 2-Nonanol. . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . .5-Trimethylhexanal. . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . 48 3-Heptanol. . . . . . . . ≥98% . . . . . . . . . . . .SAFC® Flavors & Fragrances FEMA index 3279 – 3553 142 FEMA No. . . 95 Myrtenol. . 52 3-Acetyl-2. . . . . . . . . . . . . . . 34 2. . . . . . . . . FG . . . . . . 65 α-Angelica lactone. . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . .5%. . . ≥94% . . . . . . . .6-Dimethyl-4-heptanone. . . . . . . . . . . . . . FG . . . . . . .5-dimethylthiophene. . . . . . . .8-Octanedithiol. . . . . . . .5-Dimethyl-2. . . . . . . . . . . . . . . . FCC . . 126 2. . . . .50 (1R)-(−)-Myrtenal. . . . . . . . . . . 8 2-Acetyl-3. FCC . . . . . . . . . . . . . . . . . . . . . . . FCC. . FG . . . . . . . . . . . . . . . . . . . . . . ≥98% . mixture of isomers. . . . . . . . . . . . . . . . . 10 wt. ≥98% . ≥98%. . . . . . . . . 50 Furfuryl 3-methylbutanoate. . . . . . . ≥97% . . . 84 3-Methylbutyl 2-methylbutanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥96% . . . . . . . . . . . . 100 1-Octen-3-one solution. . . . . . . . . . . . . 87 2-Methyl-4-pentenoic acid. . . . . . . . . . . .81 2-Methyl-1-butanethiol. . . . . . . . . . . . . . . 67 Methyl 3-hydroxyhexanoate. 79 3-Methyl-2-cyclopenten-1-one. . . . . . . . . ≥97% . FG . . . . . . . ≥97%. . . 94 4-Methylthio-2-butanone. . . . . . . . . . . . . 56 Tripropionin. . . . . . . . . . . . . . . . . . . . . . . .10-Mercaptopinane. ≥97% . . . . . 83 Methyl dihydrojasmonate. . . . FCC . . . . . . . . . . . . . . . . natural (US). . . . . . . . . . 48 Ethyl 2-methyl-4-pentenoate. FCC. . . . . . . . . . . . . . . .38 2. . . FG . . . . . . ≥98% . . 10 S-Allyl thiopropionate. . . . . . . . . . . Cat No. . . .3-. . . . . . FG .3 wt. . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥90% . FG . . .99 Valencene. ≥99% . . . . . . 99 Propiophenone. . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . .5-Trimethylthiazole. . . . . . . . . . . . . . . . . . . FG . . . .42 Ethyl trans-3-hexenoate. . . . . . . . . . . . . . . . . ≥97%. . FG. . . . . . . .cis-6-Nonadienal. . . .6-Dimethylpyridine. . . . . . . . . . . . 94 3-(Methylthio)propyl isothiocyanate. . . . . Cat No. . . . 86 Methyl jasmonate. . . . . . 85 Methyl furfuryl disulfide. . . . . . 85 3-(5-Methyl-2-furyl)butanal. . . . . 97% . . . ≥97%. . . . . . . . . . ≥97%. . . . FCC . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . mixture of isomers. . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . 60 4-Hexen-3-one. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5.9 1. . . . . . . . . . . . ≥97% . . . . . . . . . 54 Glyceryl tribenzoate. . .47 2-Isopropylphenol. . . . 57 cis-4-Heptenal. . ≥97% . 96 3-Nonanone. .37 N-Ethyl-2-isopropyl-5-methylcyclohexanecarboxamide. . ≥99% . . . 91 3-(Methylthio)-1-propanol. . . . . . . . . . . . . .6-Hexanedithiol. ≥98% . . . natural. ≥99%. . . ≥98%. . 78 2-. . . . . . . FCC . . . FCC . . . . . 34 Dimethyl disulfide. . . . . . . . 116 2-Tridecanone. . . . . . . ≥98% . . . . . . .39 6. . . . . . . . . . . . . . natural. ≥95%. ≥98%. . . . 47 2-Ethylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . ≥98%. . . . . ≥70% . 95% . . . . . . . . . . . . . . ≥98%. . . . . . . . . 78 3-Mercapto-2-butanone solution. . 54 Heptanoic acid.and β-. . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans isomers. . . .4-Hexadienal. . .3-Butanedithiol. . . . . . . . . ≥98% . . . . . . FG . FG . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58 3-Hexanone. . . . . . . . . . . . 105 Damascenone. . . . . ≥98% . 48 Ethyl stearate. . . . . ≥98%. . . . . . . . . . . . . . . . ≥96% . . . . . . . . . . . . . ≥97% . . 104 2-Pentylfuran. . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . 57 Heptanoic acid. . . . . . . ≥99% . . . . . .1-Dimethoxyethane. . . . . . . . . . . . . ≥98. . . . . . . . . . . . . . . . .5-dimethylfuran. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 63 Hexyl 2-methylbutanoate. . . . . . . . . . FCC . . . . . natural. . . . . .99 Linoleic acid. . . ≥94% . . . . . . . . . . 98%. . 126 Glycine. 83 3-Methyl-1. . . . . . . . . .22 2. . . . . . . . . 57 3-Hexanol. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95 4-Methyl-5-vinylthiazole. . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95% . 48 2-Ethylbenzenethiol. . . . . . . . . . . . . ≥95% . . . . . . . . 116 3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 45 Ethyl 3-hydroxyhexanoate. . . . . . . . . FG . . . . . . . . . . . ≥98% . . >97% . . . . . . . ≥99%. . . ≥97%. . 129 Dicyclohexyl disulfide. . FG . . . 46 Ethyl 3-hydroxybutyrate. . . . . . . . . . natural (US). . . . . . FCC. ≥98% . . . . . FG . . . . . % (190 proof ethanol). . . . . . FG . . . . . . . . . . . . . . . . ≥97%. . . . . . . FG . 84 2-Methylbutyl isovalerate. . . . . . . . . . . . . . . ≥99% . . . . . . . . . . ≥88%. . . mixture of cis and trans. . . . . . . . . . . . . . . . . . . . . . . . . . ≥96% . . . . . . . . . ≥99% . . . . . . . . .64 Hexyl 3-methylbutanoate. . . . . . . . . . . . . . . . . . . .5%. . . . . . . . . ≥99%. . . FG . . . . . . . . . . 98% . .4-Dimethylbenzaldehyde. . . . . . . . ≥98%. . . . natural . FG . 47 2-Ethyl-3-methoxypyrazine. . . . . . . ≥98. . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . % in triethyl citrate. . . . . . natural. . . . . . . . ≥98% . . . . . . ≥90% . . . . . . . . . . . . . ≥98. . . . . . . . . . . . . . . . . natural (US). . . . . . . . . . . . FCC. . . . .4-Undecadienal. . . . . . . . . . . . . . . . . . FG . . . . . . . 97% . . . FCC . . . . . . . . . . . . . Name 3402 3403 3406 3407 3408 3410 3413 3415 3416 3417 3420 W340200 W340308 W340618 W340707 W340804 W341002 W341304 W341509 W341606 W341703 W342017 3421 3422 3423 3424 3426 3427 3428 3428 3429 3430 3432 3433 3435 3436 3437 3438 3439 3440 3440 3443 3444 3448 3450 3455 W342106 W342203 W342300 W342408 W342602 W342718 W342807 W342815 W342904 W343005 W343218 W343307 W343502 W343609 W343706 W343803 W343900 W344001 W344015 W344303 W344400 W344818 W345001 W345501 3461 3462 3463 3465 3469 3470 3471 3474 3475 3477 3478 3480 3486 3487 3488 3489 3490 3491 3492 3495 3497 3498 3499 3499 3500 3502 3503 3505 3505 W346101 W346209 W346306 W346500 W346918 W347000 W347108 W347418 W347507 W347701 W347809 W348007 W348600 W348708 W348805 W348902 W349003 W349100 W349208 W349518 W349704 W349801 W349909 W349915 W350001 W350206 W350303 W350508 W350516 3506 3506 3507 3507 W350605 W350613 W350702 W350710 3508 3511 3512 3513 3514 3515 3521 3522 3523 3524 3527 3530 3531 3532 3536 3537 3540 3542 3543 3545 3546 3547 3548 3553 W350818 W351105 W351202 W351318 W351407 W351504 W352101 W352209 W352316 W352403 W352705 W353000 W353108 W353205 W353604 W353701 W354007 W354201 W354309 W354503 W354600 W354708 W354805 W355305 cis-3-Hexenyl butyrate. . . . . . . . . . . . . . . . . . . . . . . 50 wt. . . . . . . . . . . . . . . . 45 Ethyl undecanoate. . . . . . . . . . . FG . . . . 23 3-Ethylpyridine. . . . . . . . . . . .51 2-Pentylpyridine. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . FG . . . . . . . . . . . 64 2-Mercapto-3-butanol. . . .5%. 127 trans-2-Undecenal. . . . . . . . . ≥97%. . . . . . . . . . . . 70% isoamyl isobutyrate basis . . . . 113 Quinoline. . . . . . . . . . . . . . . . . .96 Furfuryl pentanoate. ≥98% . . . .4-dithiane. . . . . . . . . . ≥96%. . ≥95% . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . ≥98% . . . . . ≥97% . . . . . . . . . 58 2′-Hydroxyacetophenone. . . . . . . . . . . . . . . . . .2-cyclohexanedione. . 85 1-Methyl-3-methoxy-4-isopropylbenzene. . . . . . . . . . . . . . . . . . . . . . . . . . . 76 Ethyl vinyl ketone. . . . . . . 71 Place an order with your local SAFC representative (see back for contacts). . . . . . . ≥98. . . . . . . . . . ≥98%. ≥96% . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . ≥98% . . . ≥97%. . .87 5-Methyl-5-hexen-2-one. ≥80% . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 43 Furfuryl propionate. . . . . . . . . . . . ≥96%. . . . . . . . . . . . . 105 Pyrrole. . . . . . . . . . . . . . . . . . . . . . 70% 3-methylbutyl 2methylbutanoate basis . . . . . . . . . . 56 2-Heptanol. . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . 56 Page FEMA No. . . . . . . . . . 31 Ethyl trans-2-butenoate. . . . . . . . . .8-Tetrahydroquinoxaline. . . . . . 84 2-Methylbutyl 2-methylbutyrate. . . . . . . . . . . . . FG . . . . . . . ≥95% . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . ≥97% . . . . . 97 trans-2-Nonen-1-ol. . . 64 Hexyl 2-methylbutanoate. . . . . . . . . . . . . . . . . 123 3. . . . . . . . . . . . . . . . natural (US) . . . . . 93 2-Methyltetrahydrofuran-3-one. . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . ≥98%. . . 118 Fenchyl acetate. . . . ≥98% . ≥98% . . . . 9 m-Cresol. . . . . . .54 Furfuryl thiopropionate. . . . . . . . . .98 1. .115 Pyrrolidine. . . 126 Trithioacetone. . . . . . . . . .7-dihydrocyclopenta[b]pyrazine. . . 126 Acetone. . . . 93 Methyl thiobutyrate. . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . ≥75% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . ≥96%. . natural. . . . . . . . . . . . FG . . . . . . . . ≥95%. . . . . . . . . . . . 31 Cyclohexanecarboxylic acid. . . . . . . . . . . . 127 DL-Isoleucine. . . . . . . . . . . . . . . . . . . . . . . .92 2-(1-Methylpropyl)thiazole. . .5. . . ≥98. . . . . . . . . . . . ≥99%. >96%. . . . . . . . . . . . . ≥98% . FCC . . . . . . . . . . . . . . 83 Isoamyl isobutyrate. . . . . . . . . . . . . . . . . ≥97% . . . . . . . . 125 Safranal. ≥65% . . . . . . . . . . . ≥95%. . . . . . natural. . . . . . . . . . . . . . . . . . . . .98 2-Methoxy-3(5 or 6)-isopropylpyrazine. . . . . . . . . . . . . . . . .5-dihydroxy-1. . . . . . . . . .62 Hexyl trans-2-butenoate. . . . . ≥99%. . . . . . . . . . . . . . . . . natural. . . . . . . . . ≥98%. . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 93 2-Methylpyrazine. . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . 63 cis-3-Hexenyl 3-methylbutanoate. . . . . . . . . ≥98% . . . . . . . FCC . % in 1-octen-3-ol. . . . . . . . . . ≥98% . . . . 62 cis-3-Hexenyl hexanoate. . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . 36 2. . . . 61 Isobutyl trans-2-butenoate. . . . . . ≥92% . . . . . . . . . . . . . . . FG . . . ≥98% . . . . 94 Methyl 2-thiofuroate. . . . . . . .126 3-Acetyl-2. . . . . 72 Maltyl isobutyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9 Butyl 2-methylbutyrate. . . ≥99% . . . . . . . . . . . . . . . ≥96%. . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 3-Methyl-2-cyclohexenone. . . . . . . . . . . . . ≥95% . . .7. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . 112 5. . . . . FG . . . . . ≥99% . . . . . . . . . . 23 Butyl 2-methylbutyrate. . . . . . . . . . . . . . . . . .38 2. . . 65 Isophorone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95% . 32 4-Oxoisophorone. . . . 80 2-Methylbutyl 2-methylbutyrate. . . . . . . . 101 3-Penten-2-one. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . 47 Ethyl 2-methylpentanoate. . . ≥95% . . . . . . . . . .5%. . ≥98%. . . . . . . . 91 2-Methyltetrahydrothiophen-3-one. 77 4-Methylpentanoic acid. 51 1. . . . . . . . . . . . . . . . . . . 58 cis-4-Heptenal solution. . . . . . . . . . . . . . . . . . . . . . . . . . 82 3-Methyl-2-butanethiol. . 103 trans. . . ≥97% . . . . . . . FCC . . . . ≥97% . . . . . . . . . . . . . . . . . 1. . 67 Isoamyl isobutyrate. . . . . . . . . . . . . . . . .9-undecadien-2-one. . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

. . . . 108 1. . . . . . . . . . . . . . . . . . 83 3-Methyl-2-butenal. . . . . . .12 Cyclohexanone. . . . . . . . . . . . . . . . . . . . 31 Ethyl trans-2-decenoate. . . . . ≥96% . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . ≥97% . . . . . . .5%. . . . . . ≥97% . . . . . . . . . . .32 4-tert-Butylphenol. . . . . . . . . . . . . . . ≥99% . . . . . . 36 4-Ethyloctanoic acid. .5-Dihydroxy-1. 105 Phenylethyl mercaptan. . . . . . 23 trans. . . . . . . . . . 99 3-Octanol. . . . 89 4-Methylnonanoic acid. . . . . . . . . . . . . . . . . . .77 (−)-Myrtenyl acetate. . . . . . . . . . ≥99% . ≥90%. 101 ε-Decalactone. . ≥98% . . . . . . . . 129 4-Ethylbenzaldehyde. . . ≥97% . . . 101 2-Phenylphenol. 90 2-Methyl-1-propanethiol. . . . . . . . . . . ≥96% . . . 33 2. . . . . . . . 101 Feel inspired at safcglobal. . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . FG . . . . . . .4-Cineole. . . . . . . . mixture of isomers . . .5-dimethyl-3(2H)furanone. . . . . . . . . . 35 Phenethyl 2-methylbutyrate. . . . . . . 65 Salicylic acid. . . . . . . . . . . . . . .42 6-Amyl-α-pyrone. . . 89 Methyl nicotinate. . . . . . . 61 trans-2-Hexenyl butyrate. ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3 wt. . . . . . . . . . . . . . . . . . . ≥99% . . . . . 104 DL-Phenylalanine. . . . . . .127 Vanillyl alcohol. . 52 Litsea cubeba oil. . . . ≥97% . . . . . . . . . . . . . . . . . . . . . 117 δ-Tetradecalactone. . . . . . . ≥96% . . . . . . . FG . . . . . . . .2-Dimethoxybenzene. . . . . .129 4-Acetoxy-2. . . . . . . . . . . . . . . . . . . . >98% . . ≥97%. . . . . . . . . . . . . . . . . . . . . . 121 2′-Aminoacetophenone. . 113 Resorcinol. . . . . . . . . . . 82 Diethyl sulfide. . . . . . ≥98% . . . . . . . . . .4-dithiane. . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 27 9-Decenoic acid. . . . . . . . . . . . . 37 1. ≥99% . . . 102 3-Octyl acetate. . . . . . . . . . . . . . . . . . . . . . ≥92% . . . . . . . . . . . . . . .3-Propanedithiol. . . . . . . . . . . . . . . . . . . . 79 Methyl cyclohexanecarboxylate. . . . . . . . . . . . . . . . .5-dihydrofuran-2-one solution. .4-Hexadien-1-ol. FG . . . . . . . . . . ≥99%. . . . . FG . . . . . .130 3. 99% . . . . . . . 100 3-Octanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 93 Bis(methylthio)methane.4-Dimethylanisole. . . ≥98% . . . . . . . . . . 25 1-Decen-3-ol. ≥80% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .8% . . . . . . . . . . . . . . . . . . . 12 3-Decanone. FCC. . . . .5-dimethyl-3(2H)furanone. . . . . . ≥97% . . . . . . . . . ≥98% . . . . . . . . .5-dihydrofuran-2-one. . . . . . . . . . . . . 71 Isopropyl 2-methylbutyrate. . . . . . . . . ≥90% . . . . 121 2-Acetyl-2-thiazoline. . . . . . . . .3(E). . . . . . . . . FG .115 Butyl salicylate. . 35 trans-p-Methoxycinnamaldehyde. . . . . . . . . . . . . . . . . . . . .4-Dithiane. . . . . . . . ≥99% . . . . . FCC . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .105 L-Phenylalanine. . . 98% . . . . . . . . . . . . . FG . . . FG . . . . . . . FG . . . . . . .4-Dihydroxybenzoic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 121 D-Dihydrocarvone. . . . . .23 4-(p-Acetoxyphenyl)-2-butanone. . . . . . . . . . . . . . . . . . .49 2-Methylbutyl acetate. . . . 123 2-Methyl-3-tetrahydrofuranthiol. . 89 Methyl 3-nonenoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .trans-2. . . . . . . . . . . . . . . . . .35 Menthalactone. . . . . . . . . . . . . . . . . . . . . FG . 72 DL-3-Methyl-2-butanol. . . . . . . . . . . . . . . FG . . ≥97% . 97% . . . . . . . . . . . . . . . . 98%. . . . . . . . . ≥99%. . . 109 2-Propanethiol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . ≥92%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36 1. . . . . . . . . . . . . . . . . . . . . . . . . . .56 2-Methoxyphenyl acetate. . . . . . . . . . . . ≥93%. . . . . . . ≥97% . 90 (±)-4-Methyloctanoic acid. ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . FG . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . 19 trans-2-Octen-1-ol. . . . . . . . . . . 108 L-Tyrosine. . . . . . . . . . . . . . . . . .6-Nonadienal. . . . . . . 62 cis-3-Hexenyl isobutyrate. ≥97%. . . . . . . . . . . . . . . . . 123 Benzenethiol. . . . . . . . . .3-oxathiane. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . .trans. . . . . . . . . . . ≥98% . . . . . . . . . . . . . . 97% . . . . . . . . ≥85%. . .5-Dimethyl-3-hydroxy-2. . . . 66 β-Cyclocitral. . 85 4-Methylcyclohexanone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥70% . % in propylene glycol. . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . ≥98. . . . . . >98% . . . . . . . . . . . ≥97% .99 cis-5-Octen-1-ol. 63 4-Ethoxyphenol. . . . . . . . . . . . . . . . . . . . . . . . . . ≥94% . . . . . . . 92 Methyl sulfoxide. . . . . . . . . . . . . . . . . . 40 2-Ethylfuran. FG . . . . . . . . . . ≥98% . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . .62 cis-3-Hexenyl lactate. . . . . . . . . . . . . . . . . . . 66 trans-Isoeugenyl benzyl ether. Name 3723 3724 3726 3736 3737 3739 3740 3748 3751 3754 3756 3761 3762 3763 3764 3765 3766 3774 3787 W372307 W372404 W372609 W373605 W373702 W373923 W374008 W374806 W375101 W375403 W375608 W376108 W376205 W376302 W376418 W376507 W376604 W377406 W378704 3789 3793 3794 3795 W378917 W379301 W379401 W379506 3796 3797 3797 W379603 W379700 W379715 3798 3799 3800 3803 3811 3813 3817 3818 3818 3819 3821 3824 3826 3827 3828 3831 3835 3839 3846 3846 3847 3854 3858 3869 3870 3871 3874 3875 3878 3887 3892 3893 3894 3897 3900 3901 3902 3902 3906 3909 3910 3918 3922 3924 3924 3926 3929 3931 3933 3944 3945 3946 3947 3948 3949 3952 3957 3959 3960 3963 3964 3965 3966 3973 3982 3984 3985 W379808 W379905 W380008 W380318 W381101 W381306 W381718 W381810 W381829 W381918 W382108 W382418 W382604 W382701 W382809 W383104 W383503 W383902 W384606 W517208 W384704 W385409 W385808 W382501 W387001 W387101 W387401 W387509 W387800 W388718 W389201 W389323 W389404 W389706 W390003 W390101 W390208 W390215 W390607 W390909 W391018 W391808 W392200 W392103 W392405 W392618 W392901 W393118 W393304 W394440 W394505 W394602 W394718 W394807 W394904 W395218 W395701 W395900 W396001 W396303 W396400 W396508 W396605 W397301 W398209 W398403 W398500 2-Oxobutyric acid. . . 90 4-Methylthiazole. . . . . . ≥97% . . . . natural (US). . . . . . . . . FCC . . . . . . . . . . 100 1-Octen-3-yl acetate. . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . FG . . . . . . . . . . . . ≥98% . . . mixture of 1. . . . .5%. . . . . . . . . . natural. . . . . . . 121 Tea tree oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . predominantly trans. . . . . . . . . . . . . . . . . . ≥97% . . . FG . . . . . . ≥96% . ≥98. . . ≥96% . FG . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . 76 3-Mercapto-3-methylbutan-1-ol. . . . . .5-dihydrofuran-2-one solution. . . 83 4-Propylphenol. . . . . . . . ≥99% . . . mixture of isomers. 96 Taurine. . . . . . . . . . . . . 9 4-Acetoxy-2. . . . . . . . . . 10 wt. . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . ≥96. . . . . 10 L-Alanine. . . . . . . . . . . . . . . . . . . . . . . FG . ≥98% . 97% . . . . . . . . . ≥98% . . . . . . . . . . . . . . 15 p-Anisic acid. 11 L-Aspartic acid. . ≥99% . . . . . . . FG . . . . . . . ≥95% . . . . 37 Diphenyl ether. . . . . . . . . . . . . . . . . . . . 99% . 62 Hexyl benzoate. . . . . . . . . 43 5-Methyl-2-hepten-4-one. . 89 trans-2. . . . . . . . . . . . . . . . . . . . . . . . . . 95 D-(−)-Ribose. . . . . . 31 Cyclopentanone. . . . . . . . 59 cis-2-Hexen-1-ol. . . . . . . . . .38 4. . . . . . . . . ≥98% . . . . . . . . . . . . 106 α-Terpinene. . . . . . . . . . . . . . . . . . . . . 63 4. . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 63 cis-3-Hexenyl propionate. . . . . ≥90%. ≥90% . . . . . . . . . . 38 2-Ethyl-4-hydroxy-5-methyl-3(2H)-furanone. . . . . . . . . . ≥98% . 38 4. . . 15 3-Carene . . . . . . . . . . . . . . ≥98%. ≥97%. . . . . . . . . . . . . . . . . . . . . FG . . . . . ≥98% . . . . . . . . . . 101 Phenylpyruvic acid. . . . . . . . . . . . . . . . . . . . . 63 m-Anisic acid. 99 2. . . . . . . . . . . . ≥97%. . . . . . . . . . . . mixture of isomers. . 83 3-Methyl-2-buten-1-ol. . . . 83 2-Methylbutyl acetate. . . . . ≥97% . . . . . . . . .3(E). . . . . . . . . . . . . . . . . . . . . .5% . . . . . . . . . . 13 2-Hydroxy-4-methylbenzaldehyde. . . 118 1. . . . . . . . . . . . . . . . . . 15 2-Methylcyclohexanone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 99% . . . . 76 L-Lysine. . . . . ≥98% . . . . . . . FG . 97% . . . . . . . . . . . ≥98%. . . . . 87 3-Methyl-1-pentanol. . . . . . . . . . . . . . . .111 Vanillin isobutyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . ≥90% . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . % in propylene glycol . . . . . . . . . . . . . . . . . . . ≥97% . . 49 L-Glutamine . . . . . . . . . . . . . . . . . . 99. . . . 90 2-Methyl-4-propyl-1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98% . . . ≥99% . . . . . . FG . . . . ≥97%. . . . . 44 Ethyl-trans-2-octenoate. . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . .FEMA index 3555 – 3985 FEMA No. . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . 61 2-Acetyl-5-methylfuran. . . . . . . . . ≥98% . 38 4-Hydroxy-5-methyl-3-furanone. . . 36 Isopropyl disulfide. . . . . . . . . . . . . . . . 80 cis-3-Hexenyl benzoate. . . . . .5(Z) and 1. . . . . . . Name 3555 3556 3557 3558 3559 3565 3567 3568 3569 3573 3574 3575 3578 W355518 W355690 W355704 W355801 W355909 W356506 W356700 W356808 W356905 W357308 W357405 W357502 W357804 3580 3581 3581 3582 3583 3583 3584 3585 3588 3589 3590 3595 3596 3598 3599 3600 3608 3609 3612 3613 3615 3616 3617 3618 3620 3621 3623 W358002 W358118 W358126 W358207 W358304 W358315 W358401 W358509 W358800 W358908 W359009 W359505 W359602 W359807 W359904 W360007 W360805 W360902 W361208 W361305 W361518 W361607 W361704 W361801 W362001 W362107 W362301 3626 3632 3633 3634 3634 W362603 W363200 W363308 W363405 W363413 3634 W363421 3635 3639 3641 3643 3644 3644 3646 3647 3649 3650 3652 3655 3656 3658 3660 3664 3665 W363501 W363928 W364118 W364304 W364401 W364428 W364607 W364703 W364908 W365009 W365203 W365505 W365601 W365807 W366005 W366404 W366501 3666 3667 3673 3674 3676 3680 3683 3684 3687 3688 3689 3690 3691 3695 3696 3697 3698 3699 3703 3704 3707 3709 3710 3712 3716 3720 3721 3722 W366609 W366706 W367303 W367400 W367605 W368008 W368318 W368401 W368709 W368806 W368903 W369004 W369101 W369501 W369608 W369705 W369802 W369918 W370304 W370401 W370703 W370908 W371009 W371203 W371602 W372005 W372102 W372218 2-Isopropyl-4-methylthiazole. ≥97% . . . 78 3-Methyl-1-butanethiol.122 2. . . . . . . . . . . . FCC . . . . . . FCC . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . 9 4-Allyl-2.3. . . . . . . . . . . . . . . . . . . . . . .4-Octadienal. . 62 cis-3-Hexenyl cis-3-hexenoate. . . . .72 (S)-(−)-Perillaldehyde. . . . . . ≥95%. . . . . . . 126 2-Acetyl-3-methylpyrazine. . . . . . FG . .5-Undecatriene. .130 Anisyl phenylacetate. . . . . 38 2. . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . .94 cis-2-Nonen-1-ol. . . . . . . . . FCC. . . . . . FG . . . . . . . . . . . . . . . . ≥98% . . . . 113 Sodium diacetate . . . . . .5(E) isomers. FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . .2-Dimethyl-5-(1-methylpropen-1-yl)tetrahydrofuran. 90% . . . . . . . .86 Methyl 2-methylpentanoate. . . . . . FG . . . . . . . . . . . . . . . . ≥97% . . . . 78 2-(3-Phenylpropyl)pyridine. . . . . % in propylene glycol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5-Dimethyl-2-ethyl-3-thiazoline. . . . . . . . . . FG . . . . . 119 Mercaptopyruvic acid sodium salt. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 85 3-Methylcyclohexanone. . . . . . . .128 Vanillyl butyl ether. . . . . . . .103 2-Pentadecanone. . . . . . . . . . . . . . . . 97% . . . ≥99% . 62 4-Hydroxybenzaldehyde. . . . . 111 2-Pentyl butyrate. ≥89%. . . 45 Ethyl 3-(furfurylthio)propionate. . . . . 86 cis-3-Hexenyl crotonate . . . . 118 Page 143 . . . . . . . . . . . . . . . .3. . . . . . . . . . . . . 109 Phenyl salicylate. . . . . . . . .45 1-Ethylhexyl tiglate. . Cat No. . . . ≥98% . . . . ≥98% . . . . . . . . . . . . . FG . . . . . . . . . 98% . . 93 cis-6-Nonenal. . . . . . . . . . . . . . . . . ≥97% . . . . .com Page FEMA No. . . . . . . . . . . . . . . . . . . . . . . . . . . . 109 4. . . predominantly trans. . . . . . . . 72 2. . . . . . 85 2-Methyl-3(5 or 6)-ethoxypyrazine. . . . . . . . ≥98% . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . ≥98% . . . FCC . . . . . . . 62 cis-3-Hexenyl tiglate. . . . . . . .102 1-Penten-3-ol. . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . ≥99% . . . . . . . . . . .49 Whiskey lactone. . . . . . .5-Dimethyl-3-hydroxy-2. . . . . . 9 DL-1-Amino-2-propanol. . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . 46 2-Ethyl-4-methylthiazole. . ≥85%.59 2. . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . ≥98% . 18 5-Phenyl-1-pentanol. . . . . . . . . . . . . . 129 4-Vinylphenol solution. . . . . . . . . . . . . . . 41 Ethyl (methylthio)acetate. . . ≥97% . . . . . . . . . .5-Dimethyl-4-methoxy-3(2H)-furanone. . . . . . . . . . . . . ≥99%. . . . . . . . FCC. . . . . . . .6-Trimethylphenol. . . . . . . . . . . .121 γ-Terpinene. . . . . . . . . . . . . . . . 90 4-Methyl-2-oxopentanoic acid sodium salt. . . . . . .6-dimethoxyphenol. . . . ≥98% . . mixture of cis and trans. . . . 38 2. . . . . . . . . . . . . . . . . .48 Farnesene. . . . . . ≥94%. . . FG . 15 1. . . . . . . . . . . . . . . . . . . .35 3-Methyl-2-oxopentanoic acid sodium salt. . . Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . 10 L-Arginine. . . ≥98. . . . 16 Benzyl disulfide. .5-Dimethyl-3-hydroxy-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 85% . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . 111 2. . . . . . . . . . . . . . . . . . . . . . .107 cis-3-Hexenyl phenylacetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97% . . . . . FG . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . 9 2. . . . .cis-6-Nonadienyl acetate. . . . . . ≥97% . . . . . . mixture of cis and trans. . . . 33 2-Methyl-3-furanthiol acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . ≥92% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . . . . . . . . . . 101 3-Octyl acetate. . . . . . . . . . . . . .130 Neohesperidin dihydrochalcone. .trans-2. . . . . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . 38 4. . . . . . . . . . . . . 10 DL-Alanine. . . . ≥96% . . . . . . .4-Hexadienoic acid. . . . . . . . . . . . . . . . . . . . . .98 2-Octenoic acid. ≥98%. . . . . 90 Methyl 2-methyl-3-furyl disulfide . . . 10 wt. . . . . ≥98% . . . . . . . . . . . . . . . . . . . .6-Dimethylbenzenethiol. . ≥97%. . . . . . . . . 33 Thiazole. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . ≥97% . . . . . 117 (3aR)-(+)-Sclareolide. . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . natural (US). . . . . . . . . . . ≥99% . ≥97% . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . >97% . . . . . . . . . . . . . . .130 2-Methoxy-4-propylphenol. .5%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . 46 Dihydro-β-ionone. . . . . . . . . . natural. . . . . . . FG . . ≥97% . . 96 trans. . . mixture of isomers. . . . . . ≥85%. . . . 48 Ethyl 3-oxohexanoate. . . . . . 79 Tea tree oil . . . . . . . . 83 4-(Methylthio)butanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .4-Xylenol. 85 2-Methyl-3-methylthiofuran. . . FG . . . ≥98%. 76 Litsea cubeba oil . . . . . . . . . . . . . . . . . . . . .5-Dimethyl-2-isobutyl-3-thiazoline. . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . 91 Dihydrojasmone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥92% . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . ≥96%. . . . . . . ≥98% . . . . . . . . FG . . . . . . . . . . mixture of cis and trans. . . . . ≥98% . . . . . . . . . . ≥96%. . . 83 4-Methyl-2. . . . . ≥99% . . . 97 Theaspirane. . . . . ≥90% . . . . . . ≥98% . . 15 L-Menthyl lactate. . . . . . 81 trans-2-Methyl-2-butenoic acid. . . ≥99% . . . . . . . . . . . . . . . . . . . . 94 1-Hexen-3-ol. . . . 34 2. . . . . . . . . . . . . . . . . . .5-Xylenol. . . . . . . . . . . . . . . . . . . ≥96% . . . . . . . 90 Methyl trans-2-octenoate. . . . . . . ≥90%. . . . . . . . . . . . . ≥98% . . . . FCC . . . . . . . . 94 3-(Methylthio)hexyl acetate. . . . . . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . . . . . . . . . . . ≥97% . . . . . . . . . . . ≥98% . ≥95% . . . . 9 1-Octen-3-yl butyrate. .6-dimethoxyphenol. . . 72 Isopropyl myristate. . . . . . . . . . . . . . . . . . . .

2-diol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . 104 Tridecanal. . 95 Ethanethiol. . . ≥99% . . . . . . . .83 2-Methyl-3-heptanone. . . . . . . . . . 65 Place an order with your local SAFC representative (see back for contacts). . . 98% . ≥98. . . . . . . . Name 3986 3987 3988 3998 3998 4000 4003 4004 4014 4015 4019 4022 4028 4049 4065 4077 4077 4080 4093 4121 4129 4132 4152 4159 4163 4179 4190 4193 4195 4202 4210 4215 4219 4219 4219 4235 4236 4237 4239 W398608 W398705 W398802 W399809 W399817 W400009 W400300 W400408 W401404 W401501 W400201 W402206 W402826 W404926 W406503 W407701 W506400 W408001 W409301 W412101 W412901 W413201 W415201 W415901 W416301 W417901 W419001 W419301 W419501 W420201 W421001 W421501 W421906 W521604 W521701 W423501 W423601 W423701 W423901 4-Hydroxybenzoic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97% . . . . . . . . . . . . . ≥99% . . . . . . . . . ≥95%. . 126 2-Methylbenzoxazole. . . . . . . . . . . . . . 98% . . . .5% . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . .5% . . . . . . . 69 Page FEMA No. . . . . . ≥96% . . . . . % in H2O . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . 81 2. . . . . . . 113 Isobutylamine. 64 Isopropyl isothiocyanate. . . 81 2′-Methoxyacetophenone. . . . . 61 2. . . . . . . . . . . . . . . . 13 2-Methylpiperidine. . . . . . ≥99. Cat No. . . . . . . . . . . . . . . . 87 Methyl (methylthio)acetate. . . . . . . . 125 Tridecanoic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 72 Methyl isothiocyanate. . . . . ≥97% . 79 2-Methylfuran. . . 95% . . . . . . . . . 116 Methyl methacrylate. . . .SAFC® Flavors & Fragrances FEMA index 3986 – 4462 144 FEMA No. . . . . . . . . . 129 2-Methyl-1-butanol. . . . . . . . . . . . . . . 101 Ethyl dimethyl dioxolane acetate. . . . . . . . . . . . . . . . . . . . . . . 65 4-Hydroxybenzyl alcohol. . . . . . 99% . . . . . . . . . 21 Amylamine. . . . . . 14 o-Anisaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 83 2-Methyl-1-butanol. . . . . . . . . . . 99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .70 1-Octene. . . . . . . . 105 Hesperetin. . . . . . . . . . . . . . . . . . Page . .82 (1S. . . . . . 58 trans. . . . . . . . . . . . . . . . . . .trans-2. . .5-Trimethyloxazole. . ≥97% . . . . . . . . . . . . . . . . . . . 98% . . . . . . . . . . . . . . . . ≥99% . . . . . 98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97% . . . 30 Cornmint oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98% . . . . . . . . .6-Trimethylphenol. . . . . . . . . . .126 1-Pentanethiol.86 L-Ornithine hydrochloride. . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 88 6-Undecanone . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . .5% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98% . . . . . . . . . . 89 2-(Methylthio)ethanol. . . FG . 61 Methyl 4-pentenoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 59 2′-Methylacetophenone.2S. natural. . . . . . . . . . . . . . . . . . . . . . . . 18 Hydroxyacetone. . . . . . 91 trans-3-Hexen-1-ol. . . . . . . . . . . . . . . . . . . . . . . 109 Pyrazine. . . . ≥97% . . . . . . . . . . 99% . . . . . . . . . . . . . . . . . . . 99% . . 95% . . . . . . . . . ≥99% . . . . . . . . . . . . . 31 Syringaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98% . 94 2-Phenylethyl isothiocyanate. . . . . . . 71 2-Methoxythiophenol. 33 2-Isobutyl-4-methyl-1. . . . . . . . . . . . . . . . .125 cis-4-Decen-1-ol. . . . . . . . . . . . . . . . 103 trans-2-Pentenoic acid. . . . . . . . ≥95% . . . . . . . . 99% . . . 47 Hexyl isothiocyanate. . . . . .3-dioxolane. . . . 97% . . . . . . 85% . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . 97% . . . . . . . . . . . . . . . . . . . . . 125 Triethylamine. . . . . . . . . . . . . . . . . . . . . . . . . . . . .34 Geranic acid. . . . . . . . . . . . . . . . . . . . . . . 96% . . 39 Piperazine. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 34 5-Hexen-1-ol. . . . . . . . 112 Thioacetic acid. . . . . . 42 1-Heptanethiol. . . . .0% . . . . .65 Vanillic acid. . . . . . . .4-Hexadienyl acetate. . . . . . . . . . . . . . . . . . . . . 127 Cornmint oil . . . . . . 30 ε-Caprolactam. . . . . . . . . . .5% . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . 97% . . . . . . . . . . ≥95% . . . . . . . . . 120 2-Propylpyridine. . . . . . . . . . . . 111 Prenyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99. . . ≥99% . . . . . . . . . . . ≥98. . . . . . 99% . . . . . . . . . . . . . . . 34 cis-2-Penten-1-ol. . . . . . 123 Tyramine. . . . . . . . . . . ≥95% . . 97% . . . . . 59 Isopropenyl acetate. . . . . . . . .4R)-(+)-Limonene-1. . . . . . . . . . . 95% . . . . . 75 cis-3-Nonen-1-ol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 42 Propylamine. . . . . . . . . Cat No. . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . 55 1-Hepten-3-ol. . . 128 β-Cyclodextrin . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 126 (R)-(+)-N. . 97% . . . . . . . . . . . . ≥98. . . . . . 96% . . 98% . . . . . . . . . . . . . . . . 125 Tripropylamine. . . . . . . . . . . . . 44 trans-2-Decen-1-ol. . . . . . . . . . . . . . . . . 97% . . . . .104 Pentadecanoic acid. . . . . . . . . . . . . . . . . . . . . 14 (−)-Bornyl acetate. . . . 98% . . . .N-Dimethyl-1-phenylethylamine. 25 Ethylamine solution. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 70 wt. .4. . ≥97% . .99 Ethyl isothiocyanate. . 88 Benzyl isothiocyanate. . . . . . . . . . . ≥98% . . . . . . . . 112 Methyl 10-undecenoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 20 Diethyl disulfide. . . . . . . . . . . . . . ≥96% . . . . . . . . .105 Phthalide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 99% . . . . . 97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . 99% . . . . . . . . . . . . . . . . . . . . . 99% . . . . . . .5% . . . . . . . . . . . . . . . ≥98. . . . . . . . . . . . . . . . . Name 4240 4242 4244 4245 4246 4247 4248 4250 4253 4258 4259 4271 4286 W424001 W424201 W424401 W424501 W424601 W424701 W424801 W425001 W425301 W425800 W425900 W427100 W428600 4293 4294 4304 4305 4313 4316 4329 4333 4334 4335 4336 4349 4351 4353 4356 4394 4398 4409 4412 4420 4422 4425 4426 4428 4462 W429300 W429400 W430400 W430500 W431300 W431600 W432900 W433300 W433400 W433500 W433600 W434900 W435100 W435300 W435600 W439400 W439800 W440900 W441200 W442000 W442200 W442500 W442600 W442800 W446207 (±)-sec-Butylamine. . . . . . . . . . . . . . . 30 Cornmint oil . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . 92 Trimethylamine N-oxide. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . 116 o-Anisaldehyde . . . . . . . . . . . . . . . . . 98% . . . . . . . ≥97% . .4. . . . . . . . . . . . . . . . . . . . Certified organic (NOP/EU) . . . . . . chinese type . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . redistilled . . . . . . . . ≥97% . . . . . . . . . . . . 57 2-Decanone. . . . . . . .

. . . . . . . . . . 2-(1-Methylpropyl)thiazole. . mixture of isomers. . . . . . . .. . . . . . . . . . . . .. . . . . . . . . . .. . . .. . . . . . . . . . . ≥98% . . ≥99%.. .4-Hexanedione. . . ≥95% . FG . . 97%. . . . . . ≥97% . . . . . . 3-Phenyl-1-propanol. . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . .. . . . . . .. .. . . . . . . . . . . . . . . Isopropyl disulfide. . . . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . FCC. . ≥98%.. .. . . . Methyl furfuryl disulfide. . (Methylthio)methylpyrazine. . . Vanillin. . . . . ≥95%. . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . Phenethyl acetate. ≥99%. . . . . . . 43 . . . ≥95%. . . . . . . . ... . . . . . Furfuryl thiopropionate. . . . . ... . . 17 . . . . . . . . .. . ≥98%. .. . . . . . . . . . . . . . . . .. . . . . . 2-Mercapto-3-butanol. . Ethyl benzoate. . . . . .. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . .. Skatole. . . . . . . . . . . FCC. . . . . . . . . . . . .. . o-Toluenethiol. . .. .. . . . . . . . .. . . . . .. . . . . . . . . . . . . .. . . . . . . . . . . . . 95 . . .. ≥97% . . . . p-Propyl anisole. . . . . . . . . . ≥99%.. FG . . . . . . . FCC . . . . . . . . . . ≥97%. . . . . . . . . .. . . . ≥98%. . . . .. . . . . . . . . . . . Ethyl phenylacetate. . . . . . . . 94 101 112 112 116 118 128 129 trans-Anethole. . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . .. . . . .. . . . . . . . . . . . . . . . . . . . . . .. 1. . . . Piperonal. FG . . . . ≥99%. . . . . 4-Hydroxybutanoic acid lactone. . . . .. . . . . .. . . . . .. .. . .. . . . . . . . .. . .. . . . . . . FG. . . ≥99% . .. . . FG. . . . . . . . . . Ethyl benzoate. . . . . . natural. . . . . . . . . FG . . .. . . ≥97%. . FG . .. . FCC . . . .. . . FCC. .. FCC. . 94 . . . . . FG . .4-Dimethyl-1. .. .... . . . . . . . . . . . FCC . . . .. . 63 . . .. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .. . Phytol. . . . . Isovaleric acid. .. . . . . . . . . . . . . . 95 . . . ≥97. . . 45 . . . . . . . . . . 18 . . S-Allyl thiopropionate. . . . . . . . . . 59 . . . . .. . . . .. . . . . . . . . . ≥97%. . . . . . . .. . . . . . Name Page Allyl disulfide.. ≥98% . . . . . . . . . . . . . ≥97%. 21 ... . . . . . . . . . FG . . . . 85 103 108 109 110 110 111 112 120 127 129 butterscotch W315818 2-Furanmethanethiol formate. . . . . . . . . . . . . . . . . . . 43 . . . 81 . 81 . natural. . ≥98% . . . . FCC . 6-Methylcoumarin. . . . ≥99%. . . . .. . . . . . .. . . .. . . . ≥99% . . . . . .. . . ... . . . . . ≥98% . . . . . . . .. . . 2-Ethyl-4-hydroxy-5-methyl-3(2H)-furanone. . . . ≥98%. ≥98% . . . . . . . Furfuryl mercaptan. . .. . . . . . . . . . mixture of cis and trans. . . . . . . . . . . . . . . . . .. . . . . . . . . . .. . . . . .. . . . . garlic) Cat No. . FCC. . . ≥98% . . . . . . . . 52 . . . 15 . . . . . . FCC . . . .. . . . . .5-Dimethyl-3-hydroxy-2. . . . . . . . . . . . 32 . . . . . .. . . . mixture of isomers. . . . . . . . . natural. . . . . . . Farnesol. . . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . . 12 . . . Cinnamyl cinnamate. . . . . . . 52 . . . 2-Methoxythiophenol.. FG. FG . .. . ≥97% . . . . . . . .5%.. . . . . .. . . . . . . . . . . . . . . . . . . . Bis(methylthio)methane. . .. . . . 85 . . 46 . . . . . Vanillin acetate. . . . . . . . . . . FCC. . . . . . . . . . . ≥97%. . . .. . . ≥97%. trans-Cinnamyl isovalerate. . .. . . . . . . .. . .. . . . . . . . . . . . .. ... ≥98%. . . . . 2-Furyl methyl ketone. . . . . . . . . . . . . . 95 113 114 114 123 124 Ethyl 3-(furfurylthio)propionate. . . . . FCC . . . . . . . . . . . . . . . .. . . . . .. . . . . . . . ≥97%. . . . . . . ≥80% . . . . . . . . . . . . . . . . . . . . . . . . 94 . . . . . mixture of isomers. . . . . . . . . . . . . . . . . . . . . . .. ≥98% . . . . . . . . ≥98% . γ-Nonanoic lactone. . . ≥98%. . . FCC. . . . . . . . 28 . . . . . .. . . . . . . FCC . .. . . . . . ≥97% . . . . . 81 . FCC . . . FG . . . . 49 . . . . . . . . . . . . . . .5-Dimethyl-2. . . . . . . . . ... . ≥99%. . . Dimethyl trisulfide. ≥97% . . .. . . . . . . . . . . . . .. . . . .. FCC . . . . . . . . . . .5-dihydroxy-1. . . . . .. . . . . . Pyruvic acid. . . . .. . . . .2′-(Thiodimethylene)difuran.. ≥97% Ethyl acetate. . . .. . . . . . . FCC . . 9 11 15 38 . . . . . . 37 . . . . . . . . . . ≥96%. . . . . . ≥98%. . . . . . . . . . . . . . . . . . ≥95%. . . . . . . 98 112 113 124 128 129 balsamic anise W208604 W267007 W374008 W288101 W326801 W241407 W242004 W242209 W242217 W245208 W247804 W248207 W359807 W267902 W269905 W247502 W276200 W278106 W291102 W293008 W307300 W310301 W373702 Name Page balsam alliaceous (onion. . . . . . . . . . . 38 .. . . . . . ... Dicyclohexyl disulfide. Benzenethiol. . .. . . . 23 . . . . . . 2-Acetyl-3. . . . . . . . . . . . . .. . . . . . . . . . . . .... . . . . . . . .. . . . .. .. . .. . . . . . . . . .. . . .. . . . . . 50 .. . . . . . . . . . . . . . . 65 . .. . . 40 wt. . . . . . FCC . Benzylideneacetone. . . . . . . . . . . 28 . . . . . . . . . . . . . . . . . . . . . . 3-(Methylthio)propyl isothiocyanate.. . . . . . FG .. . . . . Ethyl pyruvate. ≥99%. . . . . . . . . . . . . . . FG. . . . . . . . . . . . .. . . . . . . . . . . . . . . . . . 95% .. . . . . . . . . . FG . . . . . ≥99% .. . . . . . . . . . ≥99%. Ethyl tiglate. .. . . . . . . . . . . 3-Methyl-2-cyclohexenone. . . 67 . . . . . FCC .. . . . . . .. . . .. 3-(Methylthio)-1-propanol. . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . FCC . . .. . . ≥98%. . . . .. . . . . . . mixture of isomers. . . Allyl 2-furoate. .. Methyl propyl disulfide. Vanillin. . . . . . . . . . . . . . . . . . . . ≥97% . . 1-Octen-3-yl butyrate.. . . ≥97%.. . . . .. . . . . . . . . .. . . . . . . . . . .. . . . . . . . . . . .. .. . ≥98% . . . . . . . . . . . . . . . . . . . % in propylene glycol. . . . .. . .. . . . . . . . . . .Organoleptic properties index alliaceous (onion. . . . . 14 . . . % in H2O. 66 . .. . . . . . FCC . . . . . . . . . . . garlic) W202800 W204218 W332909 W361607 W387800 W347809 W221503 W326208 W344818 W326607 W345001 W327506 W383104 W327905 W383503 W328200 W316105 W249300 W334707 W382701 W350206 W329800 W336203 W357308 W320102 W337218 W387509 W378704 W360007 W331007 W331104 W341509 W274704 W331201 W389706 W322806 W352101 W323802 W324000 Cat No. 53 caramel W200506 W332704 W203009 W209902 W363405 W363421 W366404 W242918 W315303 W362301 W348708 W314900 W245402 W339407 W245712 W246018 W249300 W316318 W253901 W316814 W329118 W317411 W501808 W346209 W267406 W415901 W336009 W270008 W270202 W336203 W378704 W320803 W372307 W285706 W292206 W296902 W297003 W297070 W306207 W222305 W310700 W310727 W310905 Acetanisole. .. .. . . . . . .. . . . . . . . . . . . . . . . . . . . .. .. . . . . .. . Furfuryl isopropyl sulfide. . .. 2-Thiophenethiol. . ≥97% . . . . . . . . FCC. . . . . . .. . 86 . Siam . . . . . . . . .. . . . . 4. . . . . . . . . . . . ≥97%. . . . . . . . . . . . 49 . . ≥98%. . . . . . . . Farnesol. . . . . . . . . . Ethyl 3-phenylglycidate. . .. . ≥96%. . . . . . . .. . . . . . ≥95% . . . .. . 49 . . .. . . .. . . . . . . . . . . . . ≥97%.com W202207 W407701 W213101 W213306 W288101 W229407 W229601 W229806 W229903 W229709 W230200 W230103 W241601 W242217 W246905 W247804 W509876 W369101 W259500 W293903 W359904 W269808 W522600 W286818 W288403 W288500 W289302 W502200 W291102 W303704 W308900 W310808 Allyl cinnamate.. cis-3-Hexenyl salicylate. 19 . 2.. . . . 95 103 106 113 116 116 116 123 125 129 129 129 145 . . . . . ≥99%.. .. . . . . . . . . . . . . . . . . . . 5-Methylfurfural. Allyl sulfide. Isopropyl cinnamate. . . . . .5-dihydrofuran-2-one solution. . ≥98%. . . 52 . . . . . . . . . . 2-Ethylbutyric acid. . . . . . . . . . . . . . . . . . . .. . . . .. . FCC. . . . . . . . . . . . . .. . . . . . . Feel inspired at safcglobal. . . . . . . . . . . .. . . . . .. . natural. .. . . . . . . . 37 . . . . .. . . . . . . .. . . . . . . . . ≥99%. . . . . . . .. .. . . . . .. . . . . . . . Propyl disulfide. . . 54 . . . . . ≥99%. . . . . .. . . ≥97%. . . . . 2-Methyl-3-tetrahydrofuranthiol. . . . . . . .. . .. . . . . 77 .. . . . . . . . . . . . . . . .. . . . . . . . . . . . . . ... . . . . . . . . . . 96 . . . . . . . . . . . . . . . . .. . . .. . ≥97%. FG . . . . . . . . . . . . . . . . . . FG . . . . . . . . ... . . . . . . . . . . . . . . . . . . . . .5-Dimethyl-3-hydroxy-2. . . . . . . ≥99%. . . Pyruvaldehyde solution. . 98%. .. . . . . . . . . . Cinnamyl alcohol. . . . . . . 60 . FG . . . . . . . ≥96% . . . . . . . 3-Mercapto-2-butanone. . . . . . . . . . . . . . . . . . . . . Vanillyl alcohol. . . . . . FG. . . . . . . . 36 . ≥95% . . . . . . . . . . . .. . . . . . . .. . . . . . . .4-Dithiane. . . . . . . . . . . . . ≥95% Cinnamyl formate. . .. Piperine. . . . . Veratraldehyde. . . . . . . . . . . . . . . . . . 42 . . . . . . ≥80% . . . .. . 42 . . . . . . . . FCC. . . . .. . ≥94% .. . . . % in propylene glycol 5-(Hydroxymethyl)furfural. . . . . . . . . . . . .. ≥98% . . . . . . . o-Anisaldehyde . . .5-dihydrofuran-2-one. . natural. . . . . . Valeric acid. . . .. . . . . . . . . . .. . . . . . .. . . . ≥98%.. . . . . . . . . .. ≥95% . . . . . . . . . . . . Anisyl alcohol.. . . . . . . . . . . . . . . .. . . . . .. . . . . . . . . . . . .. 28 . . . . . . . . . . . . . . 1-Butanethiol. . . . . . . . . . . . . . . animal W367400 W255505 W259306 W310204 W331007 W361208 W290807 W290904 W352316 W301912 W310107 W312401 . ≥97%. .. . . .. p-Anisaldehyde. . . . . . ... FG. . . 54 . .. . .. .. . . . . . .. . 4-Hydroxy-2. . . . . . ... .. . . . . FCC . . . . . . 16 . . mixture of isomers. . . . . . . . . . . . . ≥97% . . .. . . . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . . . . . . . . . ..5-dimethyl-3(2H)-furanone solution. . . . . . . . . . . . . . . Benzoin resin absolute. p-Tolyl acetate. . . . . . . . . . . . . . . Ethyl maltol. 28 .. . . . ≥97% . . . . . . . .. . . FG .. . . . . . . .. . . . . . . . . . . .. . . . . . 85 . . FCC.. . . . . . . . . . . . . . . . FCC. . . . . ≥99%. . ≥98%. . . . . . .. Benzoic acid. . . . . . .. . . . . . . ≥98% . . . . . . . . . . 46 . . . . . . . . . . . . FCC. . . . . . 72 . . Propyl mercaptan. . . . . . . . . .. . . β-Ionone. . ≥99%. . . . . . . . . . . . .. . . . . . . . . . . . . . . Eugenyl acetate.. . .. . . . . .. . . . . . . . . . . 40 . . . . . .. . . FG . 65 . ≥99% . . . . .. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 81 . . . . . 11 . . ≥97%. . . . .. . . . Ethyl p-anisate. 28 . . . . . . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . ≥98% . . mixture of isomers. . . . . . . . ≥97% . . . . . . . ≥98% . . . . .. . . Ethyl (methylthio)acetate. . . . . . .. ≥98%. . . ... . . . .5-Dihydro-3(2H)-thiophenone. . . . . . . . FG . . . 44 .4-dithiane. . . Styrax. . .. . .. . . . . . . . .. .. . . . . . . . . . . . .. . . . . . . . . . . . . . . . . 2. . 50 . . . . . . . . . . 3-Phenylpropyl isobutyrate. . . . . . . . . . . . .. . . . . . . . . ≥98%. . . . . . . . . .. . . . . . .. . . . . . . 86 . . . . . . . .. . . . . . . predominantly trans. . . .. . . . . .. . 48 . .. . . FCC . . . . . . . . . . . .. . . . ≥98% . . . mixture of cis and trans. . . . . . . . . . . . . . 43 . . . . . . . . . .. . . 4. . . . . . . . . . . . Cinnamyl isobutyrate. . . . . . . 1-(p-Methoxyphenyl)-2-propanone.. . . . . . . . . . . . . . . FG. . . . . . . . . . ≥92%. . . . .. . . . . . . . . . . . 93 . . . . . . . FG . . . Methyl p-anisate.. . . FG . . . . . . .. . . . . . . . . . . trans-Cinnamyl propionate. . Piperidine. . . . . . . . . . . ... . . . .. . ... . . 2-Propanethiol.. ≥97%. . 57 . . . . . . . . . . . . . . .. . . . FG . ≥98% . . . . . . Vanillylacetone. . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . FG . . . . .. Ethyl 2-mercaptopropionate. . . . . . . . . ≥99. . . . . . . Opoponax oil . .. .. . . . .... 8 . . . . . . FG . . . .. . . . .. . . . . . . ≥99%. . 83 . . . . . . . . . . . .. . . . . . . . Butyl sulfide. . . FCC . . . . . . . . 50 . . . . FCC. . . .. .. . ≥98%. .. . . . . . FCC. . . . .. . .. . . . . . . . Tributyrin. . . . . . .. . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .. . . . . . ≥98%. . 14 . FCC. . . . . . . . . . . . . ω-6-Hexadecenlactone. . . . . . . . . Methyl cyclopentenolone. . . . .. . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . .. . . . . . . . . . . . . FCC . . . . . Hexyl benzoate. . . . . . . . ≥99% . FG. . 97%. Phenethyl salicylate. . . . . . . . . . . . . . . FCC.. . ≥96% .. . . . . . . . . . .. . . . . . ≥90%. . . . . 41 . . . . . . . . . . . . . . . . 86 . . . . . .. . . . . . . . . .. . . . . . . . . . . . . . ≥97%. . . . . . . mixture of isomers. . . . . . . . . . 2-Methoxy-4-propylphenol. . . . . Methyl thiobutyrate. . . FCC. . . . . . . . . . . . . . .. . 3. . . . . .. FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .. 2-Oxobutyric acid. . . . . . . . . . . . . . . . .. . . . . . . 47 . .. . .. . 17 . . . . . . . 10 wt. . . FCC .. ... . . . . . . . . . . . . .. . . . . . . . . . . . . . . . .. ... . . . . 94 . . . . . . . . . . . . . . ≥98% . . . . . .. FG . .. . . . ≥98% . . . . . . . ≥98%. .. .. . . . . . 3 wt. . . FG .. .. ≥97%. . .. . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . . .. FCC. Pyruvic acid. . .. . .. . . . 54 . . 78 . ≥99%. . . . . . . . . . . . . . .. . mixture of cis and 4-(Methylthio)butanol. . . . FG . Ethyl 2-acetyl-3-phenylpropionate. . . . . . . . . . .. . 89 . . . . ≥98%. . . . . . . . 1-Phenyl-1-propanol. . 18 . 66 . . Pyrrolidine. . . . . . . . . . . .. . . . . . . .5-Dimethyl-4-methoxy-3(2H)-furanone. . . . . . . . . . . . . . .. . . ≥97%. . . . . .. . . . . . . . .. . . . . . . . . . . . . . . . . .. . . . . . .. 11 . . . . . .. . Methyl 2-methyl-3-furyl disulfide ... .. . . . . . . .. . . ≥99%. . . . . . . . 38 . .. 34 . . . . . . . . . . . ≥95%. . . ≥98%. . . . . . . . . . . . . .. . . . . . . . . . . . . . .. .. . . . . . . . . .. . . . . . . . . . . . .. . . . .. FG . . . . . . . FCC. . . . . . . . FG . ... . . . 14 .. . . 50 . . . . . .. . . . . .. . . . . . . . . . . . . . . . . 85 . . .. .. . . . . . . . 28 . ≥98% . . . . . .. . 4. . . . . . .. . . . . . . . ≥99%. . . . . . . . . . . 2. . ≥97%. . . . . . .. . 72 . 43 . . . . mixture of isomers. . . . . . . . . . .. . . 12 . . . . . . . . . . . . . .. . . . .. . . . . .. . . . . Fennel oil. .. . . . . . . . . . Methyl furfuryl disulfide. . . FG ... . . . . . . . . . FG . . . .. 47 . . . . . . . . . . . . . . . . .. . . . . . 3-Ethylpyridine. .. . . .. . . . . . . . ≥92% . . FG . .. . . . . . . 93 . . . . . . trans-Cinnamyl butyrate. . . . . .. . . . . . . . . . . . . . . . . . .. .. FG . . . . . . .. . ... . . . . . . . .. .. . . . . . . Cyclopentanethiol. . . .. .. . . . . . . . . . . . . .. . . .. . . . ≥97%. .. . . .. . . . . Anisyl phenylacetate. . . . (±)-γ-Valerolactone. . . . . .. . . . . . . . . . . . . ≥90% . . Maltyl isobutyrate. . .. . . . Methyl trans-cinnamate. . . . . . .. . . . . 54 . . . . . . . . . .. . 53 . Furfuryl mercaptan. . . FG . . . . . . .. . ≥98%. . . . . . .. . . ≥99%. Propenyl guaethol. . .. . . . . . . . . . . . . . . . Methyl thiobutyrate. . . . . . . . . . .. .. . . . . . . 63 . . . . . . . . ... . . .. . . . . . . . . . . . . . 94 .. . . 5-Ethyl-3-hydroxy-4-methyl-2(5H)-furanone. . . . . 3. . . . 2-Ethyl-3(5 or 6)-dimethylpyrazine. . . . . . . . . .. . . . 28 . . L-Turpentine . . . . . . . ≥95% . Methyl eugenol. . . . . . . . . . . . . . . . . FG . . . . . . . ≥97% . . . . Methyl sulfoxide. . .. . . . . . . . . . . . . . . . . . ≥98%. . . . . Ethyl thioacetate. .. . .. . ≥97% . . . . . . ≥90% . . . .... . . . 92 . . . . . . . . . . . .. . ≥98%. . . . . . ≥80% . . . . . .. . . . . . . .. . . . Indole. . . . . . . . . .. . . . . . ≥97%. . .. .2-cyclopentadione. . . . . . . . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . . . . .. . . . . . . . . . . .. . . . . . . . trans-2-Methyl-2-butenoic acid. . . . . . . . . . . . . Piperonal. . . . . . . . FCC . . . .. . . . 51 .. .. . . ≥97%. .. . 94 . . . . . . . . FCC. . . .. . . . . . . . . . . . . . . . 73 . . . . . . . . . . γ-Heptalactone. . 2-Methyl-3-tetrahydrofuranthiol. . . . . . . .. . . . . . . . . . . . 3-(Methylthio)propionaldehyde. . . . . . . .. . . . . . . . . .. . . FG ... . .. . .5(6)-dimethylpyrazine. . . . . . . . . . . FG . . . . . . . .. . .. . . ≥98%. . . . . . . . . . Myrcene. . . Ethyl benzoate. . . .. .. FCC . . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . .5%. . . . . . . . . . . . . . . . .. . 86 . .. . . FG . . . .. ≥99%. . trans. . . . . . . .. .. . . . Benzylideneacetone. 78 .. . .. . . . . . . . . . . . . FG . . . . .. . . . Methyl 2-thiofuroate. . ≥97% . . . ≥98% . . . . . . . .. . . . . . . .

. . . . . . . . . . . Benzaldehyde. . . . . Butyl 2-methylbutyrate. . Allyl phenylacetate. . . . . . . . . FCC . . . . FG . . . . . . . . . . . . . . . . 96% . . FCC . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. . FCC. . . . . . . . . . . . . . . . . . . Vanillic acid. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . FCC. . . . . Ethyl cinnamate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl cinnamate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . % in propylene glycol. . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . FCC . . . . . . . FG . . . . . . . . . ≥96%. . . . . . . . . . . . . . . . . . . . . . . 84 . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . ≥98%. . . . . . . 93 . . Butyraldehyde. . . . . . . . . . . . . . Lauryl alcohol. . . . . . . . . ≥92%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . natural. . . . . . . . . . . . . . . Benzyl benzoate. . . . FG . . . . . . . . . . 4-Allylanisole. . FCC. . . . . . . . . . . . . . . . . . . . . . 27 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl isobutyrate. . . . . . 124 . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . .5%. . . . FCC . . ≥98%. . . . . . . . 29 . . . . . . . . . . ≥97. . . . . . . . . ≥99%.3. . . . . . . . . . . . . . . . . . . . natural. . . 27 . . . . . . . . . . . . Benzyl acetate. . . . . . . . . . . . 67 . . . . . . . 44 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . 35 . . . . . . . . . . . . . Allyl cyclohexanepropionate. Phenylacetaldehyde solution. . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . FCC . . FCC . . ≥99%. . . . . . . . ≥99% . . . . . . . . . . . Butyl phenylacetate. . . . . . . . . . . . . . . . 88 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-Cinnamic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . Cinnamon oil. . . . . . . . . . . . . . ≥98% . . . . . . . . . 80% isoamyl butyrate basis. . . . . . 4. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . FG . FG . . . . . ≥98%. . . . . . . ≥97% . . . . . . . 65 . . . . . . . . . . . . . Allyl phenoxyacetate. . . Isoamyl cinnamate. . 23 . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . (1R)-(−)-Myrtenal.4-Heptandienal. 23 . . . . . . . . . . Methyl eugenol. . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . ≥98% . . . . . 73 . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . Phenylacetaldehyde. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . FG. . . . . . . . . . . .5. . . ≥99% . . . . . . . . . 46 . . . . . . . . .. . . . . . . . . . Name Page chocolate W312606 W332801 W267007 W209902 W214205 W237108 W339318 W221902 W224847 W237701 W362001 W315214 W245208 W249300 W288705 W259306 W206318 W206326 W218502 W220205 W221007 W265608 W329800 W267104 W330205 W267902 W268208 W268216 W269107 W269506 W269514 W247502 W343609 W357308 W376205 W319902 W320005 W337218 W330906 W331309 W277304 W284203 W285900 W287407 W287415 W287814 W322407 W318604 W292303 W404926 W323705 W323713 W324418 W332518 W398802 W310700 W310727 W375403 146 p-Anisaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . Benzylideneacetone. FCC . . . . . . ≥90%. . . ≥99%. . . . ≥98%. . . . . . . . . . . . Eugenol. . . . . . ≥98%. ≥92%. 77 . . . . . . . . . . . . . . . . FCC . . . . . . . 82 . . . . . . ≥88% . . . . . . . . . . 79 . . . ≥97%. . . . . . Tetrahydrofurfuryl acetate. . . . . . . . . Syringaldehyde. . 51 . . . Benzyl cinnamate. . . Octyl isovalerate. . . . . . . . . . . trans-Cinnamaldehyde. . . . . . Isobutyl phenylacetate. . . . . . ≥92%. . FCC. . . . . . . . . FG. . . . . . . . . . . . . . . Beeswax absolute breche . . . . . . . . . . . . . . . . . . . . natural . . . . . . ≥98%. . . . . . . . . . . Basil oil. . . . . . . . . . . . . . . . . . . . . . . . . . . trans-Cinnamic acid. . . Neryl acetate. . . . . FCC. . . . . . . Cardamom oil. . FCC . . . . . . . . . . . . Hydrocinnamaldehyde. . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . FCC. ≥98%. . . . ≥98%. . 28 . . . . . . . . . . . . . . red . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . 3-Methyl-1-pentanol. . . . . . . . . . . . . . . . . . . . . . 89 . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . ≥99% . . . . ≥97% . . . S-Allyl thiopropionate. . . . .5. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . Orris concrete . . . . ≥98%. . . . . . . . . . 2-Methylbutyraldehyde. . . . . . . ≥98% . . . . . . 2. . . . . . . . . . α-Methylcinnamaldehyde. . 67 . FCC . . . . . . . . . . . . . . . . ≥98%. 9 10 10 11 11 12 12 12 13 13 13 13 13 14 14 14 15 15 15 15 16 16 16 17 17 17 17 18 . . . . . . . . . . . ≥98%. . . . . . . ≥99% . . . . . . . . . . . . . . . . Octanal. . . . . . . . . . . Cinnamyl cinnamate. . . . . . . . Allyl phenylacetate. . . . . . . . . . . . . . 2-Phenyl-2-butenal. . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . FCC. . . . . . . . 9 .SAFC® Flavors & Fragrances Organoleptic properties index balsamic: chocolate Cat No. . . . . . . . . . . . . . . . . natural. . . . . . . . . . . 97% . . . FCC . . . . . . . . . . . . . ≥98%. . . . . ≥97% . . . . . . . . . . . . . Methyl p-anisate. . Maltol. . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . 2-Methoxy-4-methylphenol. . . . . . . 84 . Anisyl alcohol. . . . . . . . . Anisyl alcohol. . . . . . ≥97% . . ≥99%. . . . . . . . FCC . . . . . . . . . . . . . . . . . FG . .. . . . .5-Trimethylpyrazine. . . Isopropyl phenylacetate. . . . . . . . . . . . . . . . . . . . . 27 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 16 . . . . . . . . . . . . . . . . . . . . . . . . . . . Benzyl benzoate. . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . 55 . . . . 56 . . FCC. . . . . . . Amyl alcohol. ≥99%. . . . ≥90% . . . . . . . . . . . . . . . . ≥98%. . . Anisyl alcohol. . . . . . . . . Phenethyl acetate. . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . Isoeugenyl phenylacetate. . . . . . . . . ≥98%. . . . . . . . . . 2-Acetylthiazole. . . . . 2. . FG . . . . . . . . . . ≥98%. . . FCC. . . . . ≥99%. . 92 . . . ≥98%. . . . . . . . . Acetal. . . . . . . . . trans-p-Methoxycinnamaldehyde. . . . . . . ≥97. . . . . . . . . . . . . . . . . . . . . . . . . 98%. . . . . . . . . . . . . . . . . . . . . . . . . . 50 wt. ≥98%. . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . . . . 86 106 116 cinnamon W267007 W288101 W224111 W228613 W228605 W228818 W229202 W229806 W243000 W243019 W246700 W246719 W316407 W254401 W288705 W247707 W355690 W356700 W269700 W247502 W211613 W296309 Cat No. . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . 2. Acetophenone. . . . . . . . . . . . . . . . . . . . . . . ≥99% . 8 . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . .trans-2. . . . . . . Phenylacetaldehyde. . . . . . . . . . . . . 4-Carvomenthenol. . . . ≥92%. . . . . Phenylacetic acid. . . . . . 2-Methoxypyrazine. . . . . . . . . 69 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥85% . . . . . . . . . . . Indole. . . . . . . . . . . . . 122 . . . . . . 58 . . . . . mixture of isomers. . . . . . . . . 92 . . . . . . . . . 74 . . . . . . . . . . . . . FCC. . ≥96%. . FCC . ≥99%. FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 . . . . . . . . . 27 . . . . . . . . . . . . Phenethyl anthranilate. . . . . . . . . . . . . . . . . . . . . . . Methyl phenylacetate. . . FCC. . . . . . . 98% . ≥99%. . . . . . . . . . . . . . . . ≥99% . . FG . . . . . . . . . . . . . . . ≥98%. . . . 2-Pentanone. . . . 95 . . . . 78 . . . . . . . . . . . 49 . . . . . . . . ≥97%. . . . . Benzyl ether. . . . . . . . . . . . . . . . . . . . FG . . % in ethanol. Ethyl phenylacetate. . . . . . . . . 51 . . . . . . . . . . . . . . FG . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . Methyl 10-undecenoate. . . ≥99%. . . . . . . . . . . . . . . . FCC. . . . . 25 . . natural. . . . FCC . . . . . . . 14 . . . FCC . . . . . . 82 . . . . . . . . . . . Diethyl succinate. . . . . . . . . . . . . . . . . . . . . . . .3. . . ≥98%. . . . . FG . . . . . . . . . . . . . . . natural (US). Octanal. 70% isoamyl isobutyrate basis . . . . . . . . . . 27 . FCC . . . . . . . . . . . . . . . . . . . . . . . . . 49 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . ≥98%. 91 . . . . . . . ≥99%. . . Phenethyl benzoate. . . . . . ≥98%. . . . . . Methyl 2-methyl-3-furyl disulfide . . . . 8 . . . . . . natural. . . . . . . . . . . . . ≥97%. ≥98%. . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . 3-Ethyl-2-hydroxy-2-cyclopenten-1-one solution. . . . . FCC. . 66 . . . . . . . . 28 . . . . . 30 . . . . . FCC. . . . Isobutyl hexanoate. . . . Phenylacetic acid. Genet absolute. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl anthranilate. . . . . 6-Amyl-α-pyrone. . . . . . . Tetrahydro-4-methyl-2-(2-methyl-1-propenyl)-2H-pyran. . . . . . . . ≥97% . . . . . . . . FCC. . . . . . . . ≥98% . . . 97 105 106 108 108 108 109 111 113 120 123 123 126 126 129 129 129 129 . . . . . Benzyl ether. . . FG . . . . . . . . natural. . . . . . . . . . . . . . . . . p-Anisaldehyde. Allyl heptanoate. . . . . . . . . . . ≥97% . . . . . . . . . ≥99%. . . . 54 . . . Vanillin. . . . . . . natural. . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . 15 . . . . ≥99%. . . . . . . Vanillin. . . . . . . FCC . . . . . . . . . . . . . . . . ≥98%. . . . . . W200204 W200220 W203807 W203904 W209910 W212628 W214906 W220906 W228818 W228826 W229806 W230200 W231401 W231703 W245208 W250406 W251607 W288705 W259306 W206016 W350702 W350710 W221007 W247707 W295604 W261718 W272205 W273309 W425301 W339504 W277304 W279706 W279714 W281409 W282928 W285706 W285714 W285803 W285811 W285900 W286001 W287318 W287407 W287415 W287806 W287814 W293407 W305502 W323608 W306401 W306509 Acetal. . . . . . . . . . . . . . . . . . . Eugenol. . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . o-Anisaldehyde. . . . . . . . . . . . . . . . . . . . . . . . 72 . . . . . . 18 . . . . . . . . . . . . . . . . FCC. . . . . . . . Propyl butyrate. . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . β-Alanine. . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . ≥99%. . Propionaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. ≥99% . . . . . . . . . . . . Cinnamyl cinnamate. . FCC. . . . . . trans-Anethole. . . . . . . . . . . . . mixture of cis and trans. . 2-(1-Methylpropyl)thiazole. Phenylacetic acid. . . . . . . . . . . . . . ≥99%. 92 . . . ≥98% . . 25 . . . . . . . . . . Thyme oil. 70 . . . . . . . . ≥97%. . . 65 . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl anthranilate. . . . . . . . . . . . . natural. . . . natural. . . . . . . . . . . . . . . . 44 . . ≥99%. . . . . Neryl acetate. 70 . . . . . . FCC . FG . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . Ethyl cinnamate. . . . . . . ≥97% . . Benzaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . 67 . . . . . . . . . . . . . . ≥98%. . . . FCC. . . ≥90%. 89 . . . . . . . Hydrocinnamaldehyde. . . . . FG . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . Thyme oil. . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . Methyl anthranilate. Isobutyl phenylacetate. . . . . . . . . . FCC. . . . . . . . . 66 . . . . . . . comoric type . . Benzyl acetate. . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . FG . . . FCC . 2-Methylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . natural. . . . . ≥90%. . FG . ≥97% . Phenylacetaldehyde solution. . . . 18 . . Anisyl formate. . . . . 15 . . . . mixture of isomers. Allyl phenoxyacetate. . . . . . . . . . . Acetanisole. . . . ≥99%. . . . . . . ≥93%. . . . . . . . . . FCC. . . Name Page honey 2-Acetylpyrazine. . . Cinnamaldehyde. . . . . . . . . . . . . . FG. . . . . Indole. . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . 84 . . . . . . . . . . . . . . natural.5-Trimethylthiazole. . . . . . . . . . . . . . . . . . . . . . . 28 . . . . . . . . . . . . . . . 97 100 100 102 103 106 106 106 106 106 107 108 108 108 108 108 114 122 . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . trans-Cinnamic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .4. . . . . . . . . . . . . . . . Hydrocinnamaldehyde. . . ≥98%. . . . . . . . . . . . . Phenethyl alcohol. . . . . . . . . . . . . . . . . . white. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5-Dimethyl-2-ethyl-3-thiazoline. . . . . . . . . . . . . . . . . . . . . . 38 . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . FCC. . . . . . ≥95% . . . . . . . . . . mixture of cis and trans. . . . . . . . . . . . . . . . ≥98%. . Phenethyl acetate. . . . . . . . Methyl eugenol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . ≥98%. . . ceylon type. . . . . . . . . . . . . . . . . 14 . . . . . . . . . . . . . . FCC . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . 10 wt. . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . Methyl myristate. . . . . . . . . . . . 2-Methylbutyric acid. . . ≥90%. . . . . . . 65 . . . N-Amyl octanoate. . . . . . . . . . . . . . . . . FCC . Peru balsam . 18 . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 93 . . . natural . . . Amyl octanoate. . ≥95% . . . . . . . . . . . . . . Phenethyl alcohol. 71 . . . FCC. . . . 5-Methyl-2-phenyl-2-hexenal. . . . . 12 . 28 . . . . . . . . . . . . Benzyl phenylacetate. . . . . . . . . . 2-Heptanone. . . natural. . . . . Citronellyl valerate. . Furfuryl mercaptan. . . . . . . . . . . . . . . . . . . ≥97% Isopropyl myristate. . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . FG . . . . . . . . . . . . . . . . ≥99%. FG . . . . . . . . . . . % in ethanol. . . . . . . . . . . . . . FG . . . . 8 . . . . . . . . . . FG . . . . . . . . . . . . . . . 71 . . Isoeugenyl phenylacetate. . . . . . . . . . . FCC. . . . ≥95% . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . 3-Mercapto-2-butanone. . . Isoamyl butyrate. . FCC. . . . . . . . . . . . . . . . . FG. . . (±)-2-Methylbutyric acid. . . . . . . . . . ≥98% . . . . . . 24 . . . . . 81 . . . . . . . natural. ≥98%. . . . . . . . 3-Acetylpyridine. . . . . 81 . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . FG . . natural. p-Anisaldehyde. . . . . . . . FCC . . . . . . . . . . . . . . . . 18 . . . . . . . . FCC . . . . . . . . . FCC . . . . . . . 67 . . .. . . . ≥98%. . . . . . . . . ≥98%. . . . . . . . . . . . . . . . 95 . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . ≥99%. . . . . . . . ≥98%. . . . . . . . . . . . . . . . . 2-Phenoxyethyl isobutyrate. . . . . 8 . . . FG . . . . . 10 . . . natural. . ≥98%. . . . FG . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . ≥85% . . . . . . . . . . . . . . . . . . . . . 67 . mixture of isomers. . . . . . . . . ≥80% . . Citronellyl formate. . . . . . . . . . . . . . . . . . . . natural. . . . . . . . .6-Tetramethylpyrazine. . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . (R)-(+)-Pulegone. . . . . . . . . . . . . . . . .3. 96 . . . . trans-Cinnamyl isovalerate. FG. . . . . . . . 79 . . . . . . . . . . . . . . . . . . . . . . . . . FG . 57 . .5%. . . . . . . . 12 . . . . . . . . Isoamyl isobutyrate. . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 124 sweet W200506 W200905 W342408 W325201 W241105 W202606 W203106 W203807 W203904 W332909 W205605 W206105 W207918 W207926 W369608 W208604 W506400 W267007 W209805 W209902 W209910 W210102 W211907 W212709 W212717 W213500 W213519 W213802 W213810 W237108 Place an order with your local SAFC representative (see back for contacts). . . . . . . . . . . . . . . . natural. . . . . . . . . . . FCC. ≥98% . . . . . . . . . . . . . . Anisyl acetate. . 10 wt. . . . . . . . natural. . . . . . . . . . 70 . FG . . . . . . . . . . . . . . . . . . . . . . FCC . ≥98%. . . . . . . . . . . . . . . . . . . . ≥90%. . . . . . . .5%. . . . FCC. 86 . . . . . . . . . . Anisyl alcohol. . . . . . . . . . . . . . . mixture of cis and trans. . . . . . . . . . trans. . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . Geranyl phenylacetate. . . . . . ≥88% . . . . . . . . . . . . . . . . . . . . . . . . . 4-Methyl-5-vinylthiazole. . . . . . . . . . . . . . . . . 1-Methyl-3-methoxy-4-isopropylbenzene. FG . . . . . . . ≥97. Isobutyl benzoate. . . . . Ethyl phenylacetate. ≥97%. . . FCC . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . ≥98%. . FG . . . . . . . . . . . . . . . . . . . . . . ≥95%. . ≥99%. . . . . . 4-Methyl-2-phenyl-2-pentenal. . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . .6-Tetramethylpyrazine. . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . FCC . . . Vanillin isobutyrate. . . . . . . . . . . . . . . . . α-Amylcinnamaldehyde. . . . . . . . ≥90%. . . . . . . . . . FG . FCC. . . . 4-Phenyltoluene. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . .

FCC. ≥95%. . . . . . . . . . . . FCC. . . . . . .5-Dimethyl-1. . . . Benzyl phenylacetate. . 4-(4-Methoxyphenyl)-2-butanone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . .4-Hexadienyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . 2-Methoxy-4-methylphenol. . . . . . . . . . . . . . . . . . . . . . . . . . . L-Menthone. . . . . . . . . . . . FCC . FG . . . . . . . . . . . . . . . . . Isobutyl formate. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . ≥98% . . . . . Isopropyl 2-methylbutyrate. . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . FCC. . 84 84 86 86 86 88 88 89 89 92 92 93 94 96 96 96 97 97 97 97 97 98 99 147 . . . . . ≥98%. . FG . . . . ≥93%. . . . . . . FCC. . trans-Cinnamic acid. . . . FCC. . . . . natural. . FCC. . . . . . . . . ≥99%. . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . Ethyl phenylacetate. . . . . . . . Methyl acetate. . . . FCC . . . . . . . . . . . . . . . . . mixture of isoamyl and 2-methylbutyl salicylates. . . . . . . . . ≥98%. . FG . . . . . . . . . . 2′. . . . . Benzyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . δ-Decalactone. . . . . . . . . . . . . . Eugenyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . natural. Dihydrocoumarin. . . 4-tert-Butylcyclohexyl acetate. . . . . . . . . . FCC . ≥97% . ≥97% . . . . ≥98%. . . . . . . . . . . . . ≥98% . Neryl isovalerate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98%. . . . . . . . . . . . . . . . . . . . . . ≥98%. . natural. . . . . . . .com . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥92%. . . . FG. . . . . . . . . . . . . . . . . . . . . . natural . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . Isopropyl butyrate. . . . . . . . . . . Methyl dihydrojasmonate. natural. . . . . . . . . . . . . . FCC . . Cinnamyl isobutyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . ≥98%. . . . . . . . ≥97%. . . FCC . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . FCC. . . natural. . ≥92% . . . . . . . . . . . . . . . ≥98%. ≥97% . . . Isoamyl hexanoate. . mixture of isomers. . . . . . . . . . . . FCC . . . . FCC . . . . . . . . . . . . . . . . . . . Isobutyl hexanoate. . ≥99% . . . . . . . Ethyl acetoacetate. . . . . . . . . . . . . . . . . . . . . . predominantly trans. . . . . . . . . . . . . . . ≥98%. . . . . . FCC . . . . . . . . . . . . . ≥98%. . . . ≥99%. . . . . FCC . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . Lauric aldehyde. . . . . . Ethyl 3-methyl-3-phenylglycidate. . . . Hydrocinnamaldehyde. . . . . . . ≥98% . . . . . . . . . . . . . ≥98%. . . . . .and β-. . . . . . Ivory Coast origin. . . . . . . . ≥98%. . . . . . . . . . trans-Cinnamaldehyde. . . . . . . . . . . . . FCC. . . . . . . . . . ≥97%. . . FCC . δ-Decalactone. . ≥80% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . 4-Methyl-1-phenyl-2-pentanone. . . ≥98%. . . . . . . . . W316903 W392901 W349704 W363308 W256501 W256706 W256803 W256811 W256900 W257605 W288705 W354805 W258318 W317403 W258806 W258814 W259500 W205818 W207500 W207519 W208507 W208515 W208000 W208418 trans-2-Hexenoic acid. . . . . . . . ≥95%. . . . . . Myrcene. . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . Methyl phenylacetate. FG . . . . . . . . 2′-Hydroxyacetophenone. . . . . . ≥97%. . . . . Furfural. . . . . . . . . . . . . . . ≥90%. . . . . . . FG . . . . . . . . . . . . ≥97%. . . . . . . . . . . ≥99%. . . . . . . . . . . . ≥95% . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . FG . . . Isobutyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . Isobutyl angelate . . . . ≥93% . . . . . . . FG . . . . . . . . . . FCC . . . . . . . . . . . . . . . . ≥99% . 4-Ethoxybenzaldehyde. . . . . . . . . . . . ≥90%. . . . . . . . . . . . . . . . . FCC. . . . ≥98%. . . . . . . .3-Hexanedione. . . . . . . . . . ≥99%. . . . . . ≥98%. . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . ≥98% . . . . . . . . . . . . . Name W214507 W288101 W214906 W215007 W215015 W215104 W215317 W215902 W333204 W217409 W218103 W507318 W220507 W224111 W225118 W228605 W228818 W229105 W229407 W229806 W229709 W230707 W233404 W234907 W235504 W235407 W236101 W236128 W236209 W236217 W238104 W510424 W238708 W342718 W326909 W239100 W241318 W241504 W242101 W375608 W242500 W242713 W506109 W243000 W243019 W243108 W354309 W243418 W367303 W315109 W342807 W342815 W244201 W244406 W383503 W245208 W245607 W245615 W245712 W245801 W246409 W246506 W246905 W507709 W339008 W248207 W248606 W248908 W248924 W250708 W250716 W250902 W250910 W251208 W251216 W251402 W251704 W251712 W328707 W253901 W254509 W254908 W413201 W255602 W255807 W256005 Benzyl formate. . . . . .Organoleptic properties index balsamic: sweet Cat No. . . Neryl butyrate. . . . . . . . . . . . . . . . . . . . 4-Methylthio-2-butanone. . . . . . . . . . . . . . . . . . . . . Fenchyl acetate. . . 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . Cyclohexyl isovalerate. . . . . . . . . . . . . Lovage oil. . . . . . 2-Methylbutyl isovalerate. . . . . . . . . . . . . . . Bergamot oil. . . . Geraniol. . . . . . . . . . . 3-Methylbutyl 2-methylbutanoate. . . . . . . . . . . . . . . . . . . . . . Butan-3-one-2-yl butanoate. . . . . . . . . . . . . . . . . . . (−)-Carvyl propionate. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . ≥98%. . . . . . . . . . . . . ≥95%. . . . . . . . . . . . Neryl acetate. . . . . . . . . . . . ≥98%. . . . . . . Methyl 4-methylvalerate. . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . ≥99% . . . . . . . . . . . Methyl jasmonate. . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . ≥98%. . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥80% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl β-naphthyl ketone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . Cyclohexyl acetate. . . . . . . . . . . . Hexyl butyrate. Isoamyl isovalerate. . Ethyl propionate. . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . γ-Hexalactone. . .5%. . . . . . . . . . . . . . . . . . . . 18 18 18 18 19 19 19 20 21 21 21 22 23 25 26 27 27 27 28 28 28 29 30 31 32 32 33 33 33 33 35 36 37 37 37 39 42 42 42 43 44 44 44 44 44 44 45 45 45 46 46 46 47 48 48 49 50 50 50 50 51 51 51 52 52 52 52 53 53 55 55 55 55 55 55 55 56 56 56 57 58 58 59 59 60 60 W217506 W217514 W218006 W219304 W219703 W220205 W246808 W369802 W247707 W355305 W292605 W293504 W369918 W322903 W261505 W261513 W263303 W263508 W263605 W263613 W264601 W264504 W265101 W376418 W266701 W266825 W266906 W318108 W267104 W267112 W267201 W267600 W267902 W268100 W268208 W268216 W350605 W350516 W269700 W340804 W247502 W270202 W341002 W271918 W272108 W272302 W273309 W274003 W274518 W337501 W276200 W376507 W381101 W525308 W277304 W277401 W277509 W277800 W335606 W337900 Page . ≥96%. . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl isovalerate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . Geranyl propionate. . . . . . . . . . . . . . . . . . . . . Eucalyptol. . . . . . . . . . . FG . . ≥98%. . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . Methyl anthranilate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . FCC. . ≥98%. . . . . . . . . . . . FCC. . . . . . . . Glycine. . . . . . . ≥95% . Menthalactone. . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . ≥98%. . . . . . . . FCC . . . . . . . . FCC . . . . . . . . Name . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl acetate. . . . . . . . . . . . . . . . . . . . 2-Ethylfuran. . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . Linalyl acetate. . . . . . . 97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4-(4-Hydroxyphenyl)-2-butanone. . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . Furfural. . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . ≥95% . . . . . . . . . . Butyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural . . . . . . . 2-Ethylbutyl acetate. . . . . . . ≥98%. . . . . . . . . . . . . Ethyl salicylate. . . . . Ethyl 2-aminobenzoate. . . FCC .4-Dimethylbenzaldehyde. . . . Hexyl alcohol. . . . . . . . . Cinnamyl cinnamate. . . . . FCC. . . . . . . . FCC . . . Cinnamon bark oil. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥96% . . . 2-Methoxy-4-methylphenol. . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . FCC . . FG. . . . . . . . . . . . . . . . . Hexyl propionate. . . . FCC. ≥95%. . . . . . . . . . . . . . . . . . . . FCC. FCC . . . . . . . . . . . . . . . . FCC. FG . . . . . . Benzyl propionate. ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . 5-Methylfurfural. . natural. . . ≥98%. . . . . . . . . . . . . . ≥98% . . . . . . . . . . . Neryl isobutyrate. . . . FG β-Ionone. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . 4-Hydroxy-2. Isoamyl benzoate. . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . FG . . . ≥97% . . . FCC . . . . . . . . . . . natural.4′-Dimethoxyacetophenone. . . . . . . . . . . . . . . . . Feel inspired at safcglobal. . . . . . . . Linalool. . . . . . . . . . . . . . . . . . Geranyl butyrate. . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . FCC. . . FCC . . . . . 3-Heptanone. FCC. . ≥92%. . FCC. . natural. . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . ≥85%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . Butyl anthranilate. . . . . . 3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . .2-cyclopentadione. Hexyl butyrate. . . . . ≥90% . FCC. . . . ≥98%. . . . . FG . . Isopropyl acetate. . . . . . . . natural. . . . . . . . . . . . . . . . . . (Non-sensitizing) . FCC. . . . . . ≥98%. . . . . . . Neohesperidin dihydrochalcone. . . . . Butyl (S)-(−)-lactate. . . . . . . . . . . . . . . . . . . . . . Geraniol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cis-3-Hexenyl isobutyrate. . . . . . . . . . . . . . . . . . . . . . . . trans. . . . . . .5-dimethyl-3(2H)-furanone. . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . Cardamom oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . Linalyl isovalerate. . . . . . . . . . . . . ≥98%. . . . . . . . . cis-3-Hexenyl phenylacetate. . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . FCC . . ≥96%. . . . . natural. . . Linalyl acetate. . . . . . ≥99%. . . . . . . . . . . . . L-Menthyl acetate. . . . . . . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . Methyl salicylate. . . . FCC . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . . trans-2-Nonen-1-ol. FG . . . . . . . . . . . . . . . . . . . . . . . 4-(4-Hydroxyphenyl)-2-butanone. . . . . ≥98% . . . . . ≥98% . . . . . . . . ≥95% . . . . . . ≥98%. 97% . . . . . . . . ≥98%. . . . . Isobutyl cinnamate. . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isobutyl acetate. Fennel oil. . . . . . . . . . . . . . . ≥98% . . . . . . . . . ≥98%. . . . . . . ≥99%. . . Cyclohexyl propionate. . . . . . . . . . . . . . ≥92%. . . α-Methylcinnamaldehyde. . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 61 62 63 63 63 63 63 63 64 64 65 65 65 65 66 66 67 67 67 67 68 68 68 . . . . . natural. . FG . . Isoamyl octanoate. . . . . . ≥95%. . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . ≥96% . . . . . . . . . . . mixture of α. . . . γ-Heptalactone. . . . . FCC . . . . . . . . . . . Ethyl 3-hydroxybutyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl eugenol. . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl cinnamate. . . ≥99% . . . . . . . . . . . . . . . . . . . ≥95% . . . . . . . . natural. . . . . . . natural. . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . 3. . . . . ≥97% . . . . . . . Ethyl cinnamate. . . . . . ≥98%. . . . . . . . . 70% 3-methylbutyl 2-methylbutanoate basis . . 4-Methylanisole. . . . . . . . . . . . . . . . . . . . . . . . . . (±)-Citronellal. . . . . . . >98% . . . . . . . . . . . . . . . . . . . . Ethylene brassylate. . . . . . δ-Nonalactone. . . . . . ≥97%. . . . (R)-(+)-Limonene. . . . . . . Ethyl cyclohexanepropionate. . . . . . . . . . . . . . . . . trans-Isoeugenyl benzyl ether. . . . . . ≥98%. . . . . Coriander oil. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . FCC . . . . . . . . Menthyl isovalerate. . . . . . . ≥97%. . . . . . . ≥98%. . . . . . Ethyl (methylthio)acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Benzyl salicylate. . . . . . . . . Heptyl butyrate. . . . . . . . . . . . . . . . Decanal. . . . . . . . . . . . . . . . . . . . . . . Decanal. . . . . . . . ≥96%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. FCC. Ethyl formate. . . . . . . . . . . . Geranyl propionate. . . natural (US). . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . natural . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl salicylate. FG . . . . . . . . FCC. . . . . . . . . . . .4′-Dimethylacetophenone. . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Bornyl acetate. . Ethyl chrysanthemate. . . FCC. . . . . . . . . . . . . . . . . . ≥98%. . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . ≥97%. . . . . . FCC. . . . . . . . FG . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . Isophorone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . ≥92%. . ≥96%. . . . . . . . . . . . . . . Methyl anthranilate. . . . . . . . . FCC . . . . . . . . . . . . . . . . . ≥98%. . . . . Methyl 2-methylbutyrate. . . . . . . . . . . . . FG . . . . . . ≥98% . . . . . . α-Hexylcinnamaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 96%. . . . . . . . . . . . . Ethyl levulinate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . ≥99% . . . . . . FCC . . . . . . . . Benzylideneacetone. . . . . . . . . . . . . . . . . . . . Isoeugenyl phenylacetate. . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Hexen-1-al. . . . . ≥97%. . . . . . . . . . . . . . . . natural. . . . . . . . . . FG . . . ≥99%. . . . ≥99%. . . . . . . Isopropyl tiglate. . . . . . . Geranyl butyrate. . . FG . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Page Cat No. . Isoeugenol. . . . . . . . . . . . . . . . . . . Geranyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . ≥98%. Ethyl pyruvate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4-Ethylbenzaldehyde. . . . . . . . . Isoamyl hexanoate. Geranyl formate. . . . . . . . . . 2. . . . . . . . . . . . . . . . . . . (−)-Myrtenyl acetate. . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . FCC . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . cis-3-Hexenyl 2-methylbutanoate. . . . ≥98%. . . . . . . . . Nerolin Yara Yara. . . . . . . . . . FG . . . . . . ≥98%. . natural (US). . . . . . . . ≥99% . ≥98. . . Ethyl propionate. . . . . . . . . . . . FG . . FG . . . . . . natural. . . . . . . . . . . . . . . . . ≥98%. 2-Ethyl-1-hexanol. . . . . . L-Fenchone. . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl butyrate. . . . . . . . . . . . mixture of cis and trans. . . . ≥98% . . . . . . . . Hydroxycitronellal. . . ≥90% . . Lauric aldehyde. .7-Dimethyl-1-octanol. . . ≥98%. . FG . . . . . . . mixture of cis and trans. . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . .trans-2. . . . o-Methoxycinnamaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3′. . 68 69 69 69 69 69 70 71 71 71 71 71 72 72 73 74 74 75 75 76 76 76 76 76 77 78 78 78 79 79 79 80 81 81 82 82 82 83 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Cinnamyl alcohol. . . . Ethyl vanillin. . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . ≥98% . . . . FCC . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Fenugreek absolute. FCC . . . ≥98%. . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . ≥98% . . . . . . . . natural . . Methyl p-anisate. . . . . . . . . . . . . . ≥96%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . Linalyl propionate. . . . . FCC. . . . . . . . FCC. . . . . Ethyl 3-hydroxybutyrate. . . . Geranyl acetate. . . . . . . .

. . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95%. . . . . . . . . . . . . . . . . Java . . FCC. . . . . .3-Diphenyl-2-propanone. . Myrtenol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . ≥99%. . Beeswax absolute breche . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . FCC . . . Ethyl benzoate. . . . . . . . . . . . . . . . . . . . . . 40 . . . . . . . . . . γ-Undecalactone. . . . . . . . . . . . . . . . . . . . Acetovanillone. . Thyme oil. ≥99%. . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . mixture with Amyl hydrocinnamyl alcohol Anisole. . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . ≥97%. . . . . . . . . . . . natural. . . . . 30 . . 2-Pentyl butyrate. . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl butyrate. . FCC . . . . Anisyl alcohol. . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . FG . . . . . . . Terpinolene. . . . . . . ≥97% . . . . . Indole. . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . Peru balsam . . . . . ≥98% . . . . . . . . . . . . . . 4-Allylanisole. . . . . . . . . . . . . . . . . 1-Propanol. . . . . . . . . . . . . ≥98%. . . . . . . . . . . .5-Xylenol. . . . . . . . . . ≥96% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . vanilla W200506 W508454 W241105 W205605 W267007 W209805 W209902 W209910 W210218 W212628 W288101 W217808 W326100 W504904 W222909 W223018 W365807 W228605 W238007 W238104 W379905 W353701 W242209 W242217 W349100 W246409 W246506 W507709 W254800 W259306 W215805 W216305 W321907 W267104 W267112 W267406 W267902 148 . . ≥90% . . . . . . . . . . . . . . ≥98. . . . . . . . . . . . . . . . . . . . . . . . . . . . Acetanisole. % in ethanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . Rhodinol. . . . . FCC. . . . . . . ≥98%. . . . . FCC . . Isobornyl propionate. . . . ≥98%. . . . . . . . . . . . . . . . . 70 chemical alcohol W241105 W206504 W209708 W315605 W335118 W392405 W374806 W284203 W292818 W292826 4-Allylanisole. . . . . . natural. . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . Isopentylamine. . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Name W341606 W281107 W282928 W342106 W284203 W389323 W211613 W285706 W285714 W285900 W286109 W286303 W286605 W286702 W287415 W287806 W372609 W288403 W288500 W288918 W289000 W289108 W289302 W290807 W291102 W292818 W292826 W292206 W294306 W295205 W338605 W298018 W355801 W305200 W306606 W308005 W308307 W308315 W309109 W309508 W309702 W324701 W310700 W310727 W312401 W524301 W359505 trans-3-Octen-2-one. . . . . . . . . . . . . . . . Theaspirane. . . . . . . . . . . . . mixture of isomers. . . . . . . . . ≥97% . . . . . 36 2. . . . . . . . . . . . Methyl p-anisate. . . . . . . . . . L-Dihydrocarvyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . Thyme oil. . . . . . . . . . . ≥99% . . . . . . . . . Anisyl acetate. . . . . . . . FG . . . FCC . . . . natural. . . . . . . . . . . FG . . . . . . . . . . . . . . FCC . . . . . . . . ≥97. . . . . ≥99%. . . . . . . . . . . . . . . . . . . ≥99%. . 1-Propanol. . . . . . . . . . .9%. . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . Thymol. . . . . . . ≥90%. . . . . 2-Methoxy-4-methylphenol. . . . . . . . . >98% . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . purified by redistillation. . . ≥97%. . . . . . . 3-Methylcyclohexanone. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥85%. . . . . . . . ≥98%. . . . . . . FG . . ≥98%. . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . mixture of L-citronellol and geraniol. . . . . . . . . . . . . . . 50 . . . . . . . . . . . . . . . . . FCC. . . . . (+)-Camphene. . . . . . . . . . . . . . . . . . . . . . . . . . (1S)-(−)-Verbenone. Eucalyptol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG Valeraldehyde. 94 camphoraceous W521604 W521701 W355305 W504505 W266523 W266590 W266507 W266701 W266825 W266809 W374806 W268100 W394718 W284807 W284815 W284823 W284831 W299200 W303208 W303216 W303224 W355801 W306401 W306509 Cornmint oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . L-Menthyl lactate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3-dioxolane. . . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl phenylacetate. . . . . . . 2. . . . . . 2-sec-Butylcyclohexanone. . . Cinnamyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . .2-Dimethoxybenzene. . . . . . . . . . . . . 13 . . . . . . . . . . . . 3-Phenylpropyl acetate. . . . . . . . 3-Phenylpropyl isobutyrate. . . . . . Methyl eugenol. . . ≥98%. . . . . . . . . . . Vanillin. . . . . . ≥90% . . . . . . . .6-Dimethyl-4-heptanone. . . . . . . . . . Phenethyl acetate. . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . Phenylacetic acid. . . . . . . . . FG . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . (1R)-(−)-Myrtenal. FCC. . . . . . . . . . 2-Ethylfenchol. . . . . . Ethyl benzoate. . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4-Methylanisole. . . . . . . . . . . trans-Cinnamaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . ≥97% . . . . . . . . . . . Isoborneol. . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . ≥97% . . . . . . . . . . . . FCC. . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Propenyl guaethol. . . . . . FCC . . . FCC. . . . .4-Cineole. . . L-Menthyl lactate. . . . . . 78 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl vanillin. . . . . . . . . . . . . . . . 101 102 103 103 105 105 106 106 106 106 107 107 107 107 108 108 108 109 110 110 110 110 110 112 112 113 113 113 114 114 116 117 121 122 124 125 125 125 127 128 128 128 129 129 129 129 130 W268100 W269905 W247502 W272302 W336807 W276200 W339504 W343900 W282928 W211613 W287814 W291102 W292206 W296309 W303305 W377406 W309818 W310727 W506907 W311308 W229318 W245704 W269905 4-Methylanisole. . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . 78 105 113 113 1. . . . . . Piperonal. . Wintergreen oil. . . . . . . . . . . . . . . . ≥90% . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . ≥98% . . . . . . . . (S)-(−)-Limonene. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . α-Amylcinnamyl alcohol. . . . . . . . . DL-Phenylalanine. . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . FCC . . . . . . . . 4-Ethylphenol. . . . 4-Oxoisophorone. . . . . . . . . . . . . 13 2. ≥98% . . . . . . . . 78 . . . . . . ≥99%. . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . Cat No. . . . . . . . . . . . . . . . . . . . . . . FCC . . . FCC. . . . . . . . . . ≥98%. . . Vanillin. . . . . . . . . . . . . . . . . . . . . ≥89%. . . . FCC. . . . . . . . . . . . . . . L-Menthol. . . . . DL-Menthyl acetate. . . . . . . . . . . FG . . . . 92 . . . . . . ≥96%. . . . . . . . . . . . . . . . . . ≥99%. . . Name . . . . . . . . . . . 4-Methyl-3-penten-2-one. . . . . . . . . . . Ethyl pyruvate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99. . . . . . . . . . . . L-Fenchone. . Spearmint oil. . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . ≥99%. 78 . . . Anisyl alcohol. . . . Phenethyl anthranilate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Heptyl alcohol. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . Propyl formate. . 10-Undecenal. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . ≥92%. . . . natural. . . .SAFC® Flavors & Fragrances Organoleptic properties index balsamic: sweet Page Cat No. . . . . . . . ≥97% . . . . . . . . . . . . Vanillin. α-Terpinene. . . . . . . . . . . . . Pyrrole. . . . . . . . . . . . . . . . . . Phenethyl propionate. . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . ≥97% . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8 10 13 14 15 15 15 15 16 18 21 22 24 24 24 27 27 35 35 36 38 43 43 45 51 51 52 58 66 68 69 71 79 79 81 81 Page . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . ≥99%. . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . ≥90% . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . 86 . . . . . . . . . . . . Vanillylacetone. . . . 71 . . . . . . ≥97% . . . . . . . . . . . .6-Dimethylbenzenethiol. . . . . . . . FCC Peppermint oil. . . . FCC. . . . . . . . . ≥99%. . . . . Vetiver acetate. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . Orris concrete . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . ≥99% . . L-Menthyl acetate. . 3-Propylidenephthalide. . . . . . FCC. . . . 8 . . . . . . . . FCC . . . . . . . . . . . . . . . . FCC . 3-Phenyl-1-propanol. . . . . . . . . . . . . . . . . 60 . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . 78 . . . . . white. . . . . . . . . . ≥99%. . . . 82 . . ≥99% . redistilled . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . Dihydrocoumarin. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Phenylpropyl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . ≥98%. . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . 96 . . . . . Butyrophenone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . 37 Place an order with your local SAFC representative (see back for contacts). . . . FCC . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . 1-(p-Methoxyphenyl)-2-propanone. . . . . . . . . Peppermint oil. . . ≥97% . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Spearmint oil. . . . . 1. . 75 . . . . . . . . . . . 2-Pentanone. . 15 . . . . . . . . . . . ≥98%. . . . . Tributyl 2-acetylcitrate. . . . . . . . . 96 103 106 108 112 113 116 119 123 128 129 129 130 . . . . 78 . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . 82 . ≥99%. . . . . . . . . . . . . . . . . FCC . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . Butyl alcohol. . . . . . . . . . Piperonal. . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . chinese type. . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . FCC. . . natural. . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . 3-Hexanol. . . . . . . . . . . China origin. . . . . . . . . ≥97% . . . ≥98% . . . . . . . . . . FCC . . . . . . . . . . . . . . . 28 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 20 wt. . . . . . . . . . . . . . . . Isophorone. . . . . . . . 30 . . . . . . . . . . . . . . . . . . . 99% . . . . . . . . . . . . . . 2. . Phenylacetic acid. . . . . . . . . . . . ≥99% . ≥97% . . . .5-Dihydroxy-1. . . . . . . . . FCC . . . . . . . . . . mixture of isomers. . . . . . . . . . . FCC . . . . . . . . . . . . . FCC . . 89 . . . . . . . . . . . . ≥99%. . . . . . . . L-Menthol. . . . . . red . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Cornmint oil . . ≥98%. . . . . . . . . . . . . . . . . . . . Orris concrete . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG Styrene. . . . . . . . . . . . . . 90 120 121 plastic W239704 W357502 W323306 W304603 . . Propenyl guaethol. . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . 2-Methoxy-4-methylphenol. . . . . . . . . . . . . . . . . . . . . ≥85% . . . . . . . FG . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . mixture of diastereomers. . . . . . . . . . . . . . . . . Phenethyl acetate. . . FG (±)-4-Methyloctanoic acid. . . . FCC. . . . . . . . . FCC . . . . . . mixture of cis and trans. . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . D-Camphor. . . . Triethyl citrate. . . . . . . . . . .5%. . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . 10 . . . . . . . . . . . . . Rosemary oil. . . . . . . . . . . . FG . . . . . . . . 97% . . ≥97%. . . . . . Triethyl citrate. . ≥98%. . . . . . . . . . . . . . . . . . . . . Terpinyl formate. . 78 . . natural. . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . L-Menthone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . ≥98%. . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . Undecylenic acid. . . . . . . . . . . . . . . Benzylideneacetone. . . Octyl octanoate. FCC. . . . . . . . . . . . ≥96% . . . . . . . . . . . . . . . Piperidine. . . . . . . . . . FG . . purified by triple-distillation. . . . . . . . . . . . . . . . . . . . . . . 2-Pentanone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 96 . . . . . . . . . . . . . . . . . . . . . . . . 85 106 106 106 106 117 119 119 119 121 124 124 cheesy creamy W428600 2-Isobutyl-4-methyl-1. . . . . . . ≥99%. . . ≥95% . . . . . . . . . . . . . Spearmint oil. . sulfurous W205303 W382604 W366609 Ammonium sulfide solution. . ≥98% . . . . . . . . . . . . . . . . .4-dithiane. . . . 97% . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . 85 other W351202 2-Methyltetrahydrothiophen-3-one. . . . . . . . . . . . ≥99% . . . . . . . . . . . ≥95% . cis-2-Hexen-1-ol. . . . . . . FCC . . 10 wt. . . . . . . . . . . . ≥98%. . . . FCC . . . . . . . . . . . . Undecyl alcohol. . ≥97%. . . . . . . . . . . . . . . . . . . . . . . (R)-(+)-Pulegone. . . FCC. . 6-Methylcoumarin. . . . terpeneless . . . . . . . . . . . . . . Peru balsam . . . . . . . ≥89%. . . . . . . . DL-Menthol. . . . . . . . . . . . . . FCC . . . . . . . % in H2O. 85 . ≥98%. . . . Peppermint oil. . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Propanol. . . . . . 1-Phenyl-1-propanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl cinnamate. . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenylacetaldehyde solution. . . Methyl β-naphthyl ketone. . . . . . . ≥99%. . . . . . . . . . . . Myrcene. . . . . . . . . . . . . . . . ≥98%. . . . . . 1-Propanol. . . . . α-Terpinene. . . . . . . . FG . . . . . . . . . .5%. . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . 6-Methylcoumarin. . . . . . . . . . . . . . . . . . . . natural. . . . . FCC. . . . . . . . . . . . . . . . . . ≥96% . . . . Anisyl propionate. . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . ≥93% . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . Amyl alcohol. . . . . . . . . 61 . . . p-Anisaldehyde. . . . . . . . . . . . . . . . natural. . . . . . . . . . Peppermint oil. . . . . . . ≥98% . . . . . . FG. . . . . . . . . . . . . . . . . . . . Spike lavender oil . 1. . . FCC. . . . . . . . 49 . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . 78 . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . FCC . . ≥98% . . . . . . . . . . . . . . 3-Phenylpropionic acid. . . . . . . . . . . . . . . . . . . . . . . . terpeneless. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

. . . . . ≥97%. . 97% . . . 67 . . . . . . . . . . . . . . . . . . . FCC. . . . Methyl anthranilate. . . . . . . . . . 4-Carvomenthenol. . . . . FCC . . . . . . . . . . Chinese 85/35. . . . . . . . . . . 96 . . . 96 . . . . . Octyl formate. . . . . . . . . . . . . . . . . . ≥85%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 72 . . mixture of cis and trans. . . . . . . . . Citral. . . FCC . . . . . . ≥98%. . . . . . . Italian. . trans-2-Octen-1-ol. . . . . . . . trans-2-Heptenal. . . . . . . . . . .9-Nonanedithiol. . . . 2-Methyl-3-methylthiofuran. . . . . . . . . . . . . . FG. . . . . . 79 . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . ≥92% . . . . . . . . . . . . . white. . . . . . . . . . . . . . FG . . . . . . . 32 . . Terpinyl acetate. . . . . Neryl isobutyrate. FCC . . . . . . . . . . . . . . . . FG. . . natural. . . . . . . . . . . . . . . . . . . . . 1. FCC . . . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . . . . FCC. 1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥90% . . . . . . . .3-. . . . . Octanal. . Methyl 3-(methylthio)propionate. . . . . . . . . 90 . . FG. . . FCC . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 77 . . . . . . . . predominantly trans. . . . . . . . 22 . . . . . . . . . . . . Thyme oil. . . . . . . . . . . . . . Neryl butyrate. . . . . . . . Octyl butyrate. . 2-Methyl-3-tetrahydrofuranthiol. . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . 55 . . . . ≥90% . . . . . 2-. 82 . . . . . FG . . . . . . . . . . . . . . . . . . . natural (US). . . . . . . . . rectified. . ≥97%. FG . . . . . . . . . Propyl mercaptan. . . . ≥97% . . . . . . . . 25 . . . γ-Terpinene. . . natural. . . FG . trans-2-Decenal. Furfuryl mercaptan. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Farnesene. . 33 . . . 77 . . . . . . . . . . . . . . . . . . . . 58 . . . . . . . . . . . . FCC . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 76 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. FCC. . 77 . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . Decyl butyrate. . . . ≥85%. . . . . 55 . . . . . . . . . . . . .trans-2. . . . . . . . . . Linalool. . . . ≥97%. . . . . . FG . . . . . . . . FG. . . . . . . . . . . natural. . . . . . . FCC . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . Diethyl maleate. 97% . . . . . natural . . . Methyl 10-undecenoate. . .Organoleptic properties index chemical: sulfurous Cat No. redistilled. Ginger oil. . . . . . . . 34 . . . . . . . . . . . . . . . . . 52 . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . ≥97% . FCC. . . . . . . . . (R)-(+)-Limonene.10-Mercaptopinane. . . . . . . . . . . 75 . . . . . . cis-4-Decenal. . . . . Mexico origin Methyl anthranilate. . . . FCC . . . . . . . . . . . . . . Linalool. . . . . . . . . . . . . . . . . . . . . . . trans-2-Pentenal. . . . . . . . . . . . . . . . FCC. . . FG trans. . . . . . . . . . . . . . . . Lauryl acetate. . . Dimethyl sulfide. . . . . . . . . . . . . . . . . . . . . . . . Eucalyptol. . . FCC. . . . FG . . . . . . . . . . . . . . . . . ≥98% . . . . . . . trans. FG . . Nonanal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl octanoate. . predominantly trans. . . 79 . mixture of isomers . . . . . . . ≥99%. FCC . . . . . . . . . . . . FCC . . . . FCC. . FCC . FCC α-Terpinene. . . . . . . . 58 . 1. . . . . . . . . . . . . . . . . ≥98%. . 3-Decanone. 99% . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . ≥97%. ≥92%. . . . . . . . . . . . . . . . . . . . . 96 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . FCC . . . . . . . . . . . . . . . . . . Phenylacetaldehyde. . . . . . . . . . . . . . . ≥98% . . .2-Dimethyl-5-(1-methylpropen-1-yl)tetrahydrofuran. . . . . . . . 94 . . . . . . . . . FCC. . . . . . . . . ≥92%. . . . . . 82 . . . . . . . . . . . . Italian. . . . . . . . . . . . . . . FCC. . . . Mandarin oil. . . . . . . . . . . . . . . . .com . . . . . . . . . . . . 33 . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . natural . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥93%. . . . . . . . . . . 32 . . . . . . . . . FCC. . . . . . . . . . . . . . ≥95% . . . . . . 38 . Octyl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . Methyl 2-thiofuroate. . . . . . . . . . . . . . . . . . 56 . . . . . FCC . . . . . . . . . . . . . . . . . . . . . >98% . . . . . 75 . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 45 . . . . . . . . . ≥97% . . . . 29 . . . . . . . Linalyl formate. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . ≥96% . . . . . . . . . . . . . . . . . 75 . . . . . . . . . . . . FG. . Nonyl alcohol. . ≥95% . . . . trans-2-Undecenal. FCC . . . . . . . . . . . . . . . . . . . FCC . . . . . . ≥98%. . . . . . . . . . ≥98% . ≥99%. natural (US). . . . . . . . . . . . . . . . . . . . . . . . . . . . . Mandarin oil. . 98 100 109 113 114 116 127 citrus 3-Carene . . . . . . . . . 82 . . . . . . . . . . . Dimethyl anthranilate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 89 . purified by distillation. . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . FCC. . . . . . . . . . 25 . 78 . . . . . . FG . 1. . natural. . . . . . . . . . . . . . . . . . . . . . . . 25 . . . . . . 82 . . . Citral diethyl acetal. . FCC . . . . . . . . . . . . . . . . ≥97%. . . . 97% . Isopropyl disulfide. . . . . . Octyl formate. . . . . . . . . 2-Propanethiol. . FG . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . 29 . . . 62 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. ≥96% . . . . . . . . . . . . . . ≥93% . . . . . . . Pyrazineethanethiol. . . FG. . . . . . . . . . . . . . W392901 W259500 W263303 W263508 W265713 W265721 W266825 W266809 W272302 W381101 W277304 W277401 W277509 W278203 W280011 W280712 W280909 W321818 W287407 W287415 W309206 W342300 W211300 cis-3-Hexenyl isobutyrate. 95% . . . . . . . . . . . . . . . . . FG . 78 . . . . . . . . . . . natural (US). . . . . . . . . FCC. . . . . . . 98% . . . . . . . . . . . ≥98% . ≥95%. . . . . . . . . . . . Methyl anthranilate. . . . . . . . . . . . . . 98 116 128 lime W224820 W224847 W349100 W383902 W263109 W268208 W268216 W339504 W277304 W278203 W296309 W309702 melon W358118 3-Octanol. . Linalool. . . . . . . . . . . . . . . . . ≥95%. . . . FCC. . . . . . . (±)-Citronellal. . . . . . . FG . . . . Mandarin oil. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥92%. . . . . . . . . . . . . . . . . . . . . . . . . . o-tert-Butylcyclohexyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . Nonanal. . . . . ≥98% . . . . . . . . . . . FG . . . . . . . . . . . . . . ≥89%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Java. . . . . . . . . . . . . . . FCC. . . . . . . . . FCC. . . . . % (190 proof ethanol). . . . . mixture of isomers. . Undecyl alcohol. 97 . . . . . . . . . . . ≥97% . ≥97% . . . . 89 . . . . . . Methyl 2-methyl-3-furyl disulfide . . . . . . . . trans-2-Hexen-1-ol. . . . FG . Undecanal. . . . . . . . . . 75 . 75 . . . . . Argentina . 2-Methyl-3-tetrahydrofuranthiol solution. . . . . . . . . . ≥95%. . . . Nonanal. . . Cardamom oil. . . . . . . FG . . . . . . . . . . . . . . . . . Decanal. . . . . . . . . . ≥90%. ≥98%. . . . . . . . . 48 . . . . . . . . . . . . . . . . FG . . . . . . . . . . Genet absolute. . . . . . mixture of isomers. . . . . . . . .1-1. . . . . . . . . . ≥95% . . . . ≥97%. . . . . . . . . . . 56 . . . . . . . . . . . 95% . . . . . . . . . Decanoic acid. . . . . . . . . . . . . 28 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . ≥95% . . . 40 . . . . . . . . . 2. . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . 29 . . . . . . . ≥98%. . . . . . . . . . . Neohesperidin dihydrochalcone. . Isophorone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Thyme oil. . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . FCC . . . . . . . . . . . . . mixture of L-citronellol and geraniol. . Ethyl 3-hydroxyhexanoate. . . FCC . . . 89 . . . . . . . . . FG . . 46 . . . mixture of isomers. . . . . . . . . . 97%. . . . . . . . . . . . . . . . FCC . . . . . trans-3-Octen-2-one. . . . . . . . . . . . . . . . . . . Argentina . . (1R)-(−)-Myrtenal. . . . . . . . . . . . . . . . . . . . . ≥96%. . . . . . . . . . . . . . . . . . . . Rhodinol. . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . FCC. . .6-Dimethyl-5-heptenal. . Lemon oil. . ≥98%. . . . . . . . . . . . . . . . . . . . Lemon oil. . . . . . . . . . . . . . . . . . . . 99 100 100 100 101 102 102 106 106 121 121 122 124 124 other lemon W382108 W224820 W224847 W230316 W230308 W230502 W230707 W230715 W230804 W230812 W231118 W238902 W412101 W252204 W316504 W262501 W262528 W263303 W263508 W268208 W268216 W277304 W278203 W341606 W287407 W298018 W355801 W309702 Page . . . . . . . . . . β-Ionone. . . . . . . . . . . . . . . . . FCC . . . . . . . . . . natural. . 58 . 74 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural (US). ≥98%. . . . . . ≥95%.0 wt. . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . (R)-(+)-Limonene. . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . FCC . . . . . 2. . . . . . . . . . . . Citral dimethyl acetal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . Phenethyl acetate. . . . Balm leaves oil. . . . .3-. . . . . . natural. . . . . 34 . . . . FCC . . . . . . . . . . . . . . . . . . 97% . Nonanal. . ≥98%. FCC. . . . 1-Octanol. . . . . ≥85% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 38 . . . . . . . . . . . . . . . . . ≥93% . . . . . . . . Dimethyl sulfide. . . . . . . . 33 . . ≥97%. . . . . . 2-Mercapto-3-butanol. . . . . . . natural . Neryl acetate. . . . . . . . . . ≥97%. . . . . . . . . . . 34 . . . . . . . . . . . . . . . . . . . . . 75 . . . . . . ≥97%. . . . . . . Trithioacetone. . 82 . . . . . . . . . . . . . . . . . . Damascenone. . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . Lime oil. . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . FCC . . . . 40 . . . . . ≥95% . FCC. . . . . . . . . . . . . . 59 . . . mixture of isomers. . . . . . . . . . . . . . . . . 98 . . . ≥93% . . . . . . . . Dimethyl anthranilate. . Page Cat No. . % in ethanol. . . . . . . California origin . . . . FCC . . . . . . . . 29 . . . . . . . . . . . ≥98%. . . . 17 . . . . . . . 2-Methyl-2-thiazoline. . . . . . . . Isoamyl propionate. . . . . . . . . . . . . . . . . ≥98% . . . . Citronellyl acetate. . . . . FCC . . . . . . cis-3-Hexenal solution. . . . . . . . . . . ≥92%. . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . ≥98%. . . natural. . . . . . . . . . . ≥92%. . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . 99 . . . . . . . . FCC . . ≥97%. . . . . . 10 wt. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . FG . . . 32 . . . . . . . . . . . . . . . . . . . . . . . 4-Carvomenthenol. . . . . 33 . . . . . . . . Phenylacetaldehyde solution. . . ≥90%. . . . . . . mixture of cis and trans. . . . . . . Neryl acetate. . . . . . . . . . . . . FG. . . . 50% in triacetin. . 2-Nonanone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . L-Menthyl acetate. . . . . . . . . . Nerol. . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Name . . . . . . . . . . . . . . . . .10-Mercaptopinane. . . . . . . . . . . . . . .4-Decadienal. . .5-Dimethyl-2-ethyl-3-thiazoline. . . . . . . . . . . . . . . 1-Octanol. . . . . . . . FG . . . . . 29 . natural. . . . . . Methyl β-naphthyl ketone. . . . FG . . . . . . . . . . . . 29 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54 . . . . . . . . . . . . Methyl anthranilate. . . . . . . . . . . . . . . . . (R)-(+)-Limonene. . . . . . . mixture of isomers. . 97 . . . 75 . 97 . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥93% . . . . . . . . . . . . . . . . . . . Methyl anthranilate. . . . . ≥98% . . . . . . . . . . . ≥97% . . . . . 71 . . . natural. . Heptyl alcohol. . . . . . . . . . . . .3 wt. . . . . . . Neryl acetate. . . . . . 2-Ethylfenchol. 78 . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . 2-. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 25 . . . . . . . . . . . . . . . . . . . . . 44 . . . . . . . . . . . . . . . . . . . . 94 . 94 . . . . . . . . DL-Menthyl acetate. . . . . . . . . . . . . 89 . . . . . . 46 . . . . . . . . natural . ≥96%. . . (±)-Citronellal. . . . . FG . . . . 96% . . . . . . . . . . . . . . . . . . Phenylacetaldehyde. . . . Mandarin oil. . . . ≥98%. . 4-Carvomenthenol. . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . cold-pressed. . . . . . . . . . . . . natural. . . . . . . . . . . . ≥99%. . . . .trans-2. . . . . . natural. . . . . 85% . . . . . . . . . . . ≥99%. . . . . . . 3-Decen-2-one. . . . . . . . . . . . . . . . . . . . . . Phenyl disulfide. . . . . . . . . . . . . . 68 . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . ≥85%. . . . . . FG . . . . . . . . 29 . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . ≥99%. Neryl acetate. . . . . . FG . ≥97%. . FCC. FG . . . . . . . . . . . . . . 25 . ≥92%. Name W362001 W274615 W274623 W249300 W382701 W350206 W350303 W357308 W394904 W272000 W378704 W550701 W518123 W331104 W351318 W351407 W322504 W389706 W352101 W323004 W347507 4. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Feel inspired at safcglobal. . . . . . . . . . . ≥99%. trans-2-Decenal. . . . . . . . . . . . . . . . . . . . . . . . . . red . . . . . . . . . . . ≥98%. . . . Undecyl alcohol. . . . . . . . . . . . . . . . 98 100 102 102 105 108 108 127 128 . . . 98 . . . . . . . . 16 33 33 33 33 34 37 37 41 52 60 61 W213705 W524018 W224111 W230405 W230715 W231118 W235601 W342017 W313505 W236209 W236217 W236306 W236403 W236608 W353205 W236802 W505005 W366501 W242500 W354503 W242802 W334308 W246506 W250406 W252204 W254703 W254800 W342904 W208205 W355305 W261602 W263303 W263508 W264202 W265713 W265721 W350303 W268208 W268216 W272809 W425301 W277002 W277207 W277304 W278203 W278513 W358002 W278904 W279706 W279714 W280003 W388718 W280704 W280909 W285706 W285714 W355909 W304700 W305200 W306401 W306509 149 . . n-Decyl acetate. . . . . . . . Geranic acid. . . Argentina origin . . . . . . . . . . . . . . . Ethyl isobutyrate. . . . . . . . . . . . . . . FCC . . . . . 2-Ethylbutyl acetate. . . . . . . . . . . (R)-(+)-Pulegone. . . . . . . . . . mixture of isomers. . . . . . . . . Citronella oil. . . Phenethyl acetate. . . . . . . . . . . . . . FCC. . . . . . . Ginger oil. . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . p-Cymene. . . FCC . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . 51 . . . . . . . . . . FCC. . FCC . . . . . 97 . . 3-Decanone. FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (±)-Citronellal. . . . . 95 .8-Octanedithiol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Nerolidol. . . . . Beeswax absolute breche . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . FCC . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . ≥97% . . . . . . . cis-6-Nonenal. . . . . . . FCC . . . . . . . . . Citral. Farnesol. . . . 97 . ≥95% . . FCC . . . . . . . . . . . . . . . . . . . . . . . ≥80% . . . . . . . . . . . . . . . Citronella oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl 3-(methylthio)propionate. . 16 Benzyl alcohol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 82 . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . 38 . . . . . . . ≥98% . % in propylene glycol . ≥96% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Citronellyl acetate. . . . . . . . . . . . . . . . . . Methyl anthranilate. . . ≥92%. . 29 . . . Decanal. . . . . . . . . . . . Terpinyl formate. . . . . . ≥92% . . . . . . . . 25 . . . . . . . . . . . 98 101 108 117 121 128 4-Carvomenthenol. . FG. . . . . . . . . . . . . . Decanal dimethyl acetal. . . . . . . 97 . 100 orange W212628 W503800 W396605 W236608 W326402 W236705 W271802 W271810 W240206 W247804 W256102 W256218 . . 77 . . . . . . . . . . natural. . trans-2-Dodecenal. . . . . Octanal. 75 . . . . . . . . . . . . 97 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75 . . Heptyl acetate. . . . . 94 . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥92% . . . . . . . . . . ≥98%. . . . . . . . . 85/35%. . . . . . . . . . . . . . . . . . . ≥99%. ≥97%.4-Hexadienal. . . 28 . . . FG. . . FCC . . . . . . . . FCC. . . . ≥95%. . . . . . . . . . . . . . . . . . . . ≥90%. . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . 29 . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . ≥95%. . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . .

. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Octen-3-ol. ≥97%. . . . . . . . . . . . Furfuryl thiopropionate. ≥98%. . . . 3-Heptanol. natural . . . . . . . . . . . . . . . . . . 2. . . . . . . . . 64 . . . . . ≥99%. . . . α-Methylbenzyl propionate. . . . . . . . trans-2-Octen-1-ol. . . . . . . . . . . . . . FG . . . . . . . . . . . .5-dihydrofuran-2-one solution. . . 85 . . . . . . . . . ≥98% . . . . . . . . . . . 82 . . . 2. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Octen-3-yl butyrate. ≥97% . . . . . . . . . . . . . . . . . . . . . 60 . . . . . . . 57 . 82 . . . . . . . . . . . ≥98%. . . Furfuryl mercaptan. . . . . . ≥92%. . 3-Ethylpyridine. . . . . . . . . . . . . . . . . 2. . .4-Hexanedione. . . . . . . . . . . . . . . . . . . . . . . . Name . . . ≥97%. . . . . . . . natural. . . . . . . . . . .3. . . . 35 . . . 99% . . . . . . . . . . . . . ≥98%. . . . . . . FG. . . . . . . . ≥98% . . . . . . . . . . . . 2-sec-Butylcyclohexanone. 88 . . . mixture of cis and trans. . . . . . . . . . . . . . . . . . . . . ≥85%. . . ≥96%. . . . . . . . . . . . . . . . (±)-4-Methyloctanoic acid. . . . . . . FCC . . . . . . . ≥98%. . ≥95%. . . . . . . . . . . . . . . . ≥97%. FG . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . FG . . 88 . . FCC . . ≥90%. . . . . 98% . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . ≥99% . . . . . 98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 86 . 3-(Methylthio)-1-hexanol. . ≥97%. . . . . . . . . . . ≥98% . . 13 2. . . . . . . . FG. . . Furfuryl pentanoate. . . . . . . . . . . . . . . . . . . . . . . . . . 90 . . . . . . . . . . . . 10-Undecenal. natural. . ≥99%. . . ≥98%. . . Hydrocinnamaldehyde. . . . . . . 70 . . . . . . 2-Furyl methyl ketone. . ≥98% . 2-Isopropyl-4-methylthiazole. . . . . . . . . . . . . . ≥98%. . . . . natural. . . . . ≥98%.5-Dimethyl-2-ethyl-3-thiazoline. . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . 1-Methyl-3-methoxy-4-isopropylbenzene. . . . . . . . . . . . . 2. . . . . . . . . ≥99%. FG. . . . . 94 . . . . . . . . . . . . . . natural (US). . . . . . 2-Methylbenzoxazole. . . . . . . . . . . . . . . . . . . . . . . . . . 2-Methoxythiophenol. . . . . . . . . . . . . γ-Undecalactone. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥90% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . 98% . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . FCC . . . . . 95 100 101 101 102 103 105 107 108 113 113 117 122 123 123 127 Amyl acetate. . trans-2-Hexenoic acid. . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . % in propylene glycol 3-Mercapto-2-butanone. 89 . . . . . . . ≥98%. FCC . . . . . . . . . . . . . . ≥98% . . 82 . . . . . . . . . . . o-Cresol. . . . . . . . . . . natural (US). . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . 74 . . . . . Methyl furfuryl disulfide. . . ≥98%. . . . . . . . . . . Ethyl (methylthio)acetate. . . . . . . . ≥90% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . FG . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . 13 . . . . . . . . . . . . . . . . . . FG . FG . 93 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3-Dimethylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 40 . . . . . . . . . . . . . . . . . . . . . . . . . .5-Dimethyl-4-methoxy-3(2H)-furanone. . 34 . . . . . . . . 94 . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . Lauryl alcohol. . . . . . . . . . . . . . . . 58 . . . . . . . 2-Methylbutyraldehyde. . . . (Methylthio)methylpyrazine. . . . . . . . .5. . . . . . . . . 79 . . . . . . ≥99%. 2. . . . . . . 76 . . . . . . . . . . . 97% . . . . Cat No. . . . . . . Phenylacetic acid. . 2-Ethyl-3-methylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . cis-3-Hexenyl tiglate. . . . . 60 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . .5-Dimethyl-4-methoxy-3(2H)-furanone. . . ≥94% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Methyl-3-methoxy-4-isopropylbenzene. FG . . . 39 . . . . . . . . 61 . . . . . . . . . . . . . . . . . . . . . . . . . 1-Methyl-3-methoxy-4-isopropylbenzene. . . . . . . . 86 . . . . . . .5-Dimethyl-1. . . . . . . . . . . . . . . . . . . . . . . . . . 34 . . . . . . . . . . . . . . . . . . . . . . . . 48 . . . . . . . . . 2-Furyl methyl ketone. . . . . FG . . . . ≥99% . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . Methyl 10-undecenoate. . . . . . . . . Methyl anthranilate. . 84 . . . . .6-Tetramethylpyrazine. . . . . . . . . . . . 97% . . . . . . . . . . . . . . . . . 125 127 128 128 128 129 Acetaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . 63 . . . . . . . . Amyl formate. . . . . . . . . . . 45 . . FG . . . FCC . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . Methyl thiobutyrate. . . 4. . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . FCC. . . . . . 45 . . . . . . . 54 . . . . . . . . . . . . . . . . . . . . 4. . . . . . . 79 . . . . . . . 3-Octanol. . ≥97%. . . . . 5-(Hydroxymethyl)furfural. . . . . . . . . . . . . . . . . 54 . . . . natural. . 2-Ethylbutyl acetate. . . . . . . . . . . . . . . . . . Angelica root oil. . . . ≥98% . . . . . . . . . . . . . . . . . . . . 2-Heptanol. . . . . ≥98% . 86 . 95 . . . . . . . . . ≥98%. . . . . . . . . . . . . ≥97% . . FG . . . . . . . 91 . . . ≥98%. . . . . . .3-Diethylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . 98% . . . . 82 . . . . Pyruvic acid. 3-Ethylpyridine. . . . . . .6-Tetramethylpyrazine. . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . 3-Octanone. . . . . . . . . . . . 2-Undecanone. . . . . . . . . . . . . . Veratraldehyde. . . . ≥99% . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . ≥95% . . . . . . . ≥80% . . . . . . . . . . . . . . . . . . . Ethyl 3-(furfurylthio)propionate.5-dihydrofuran-2-one. . . . . . . . . . . . . . . . . . . . . . . 48 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46 . . . . . . . . . . . . . . . . . ≥99%. ≥99% . . . . . . . . . . . . . . . . . . . 5H-5-Methyl-6. . . . . . . . . . . . . . . . . . Thymol. . . . . . . . . . . . . . . . . . . . . . . ≥99%. 36 . . ≥97%. . . . . . . . ≥98%. . . . . . . . . . . . 53 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8 . . . 3. . . . . . . . . . ≥99%. . 2-(1-Methylpropyl)thiazole. . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . ≥99%. . . . . . . . . . . . . . Ethylene brassylate. . . . . . . . . . . . . . . . 2-Ethyl-3(5 or 6)-dimethylpyrazine. . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . FCC. . 99% . . . .3. . . . .5. . . . . . . . 90 . . . Ethyl thioacetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98%. Acetaldehyde. ≥98% . . . . . . . . 86 . . . . 4. . . . . . . . . . . . . . . . . . . . . 3. . predominantly trans. . . . . . . . . . . . . . Diethyl succinate. . . . . . . . natural. . . . . . . . . . . . . . . FCC. . Indole. . . 49 . ≥98%. . . . . 85 . . . . . . . . ≥98%. . 2-Methyl-3-tetrahydrofuranthiol. . . . . . . . .6-Dimethylpyrazine. . . . . . . . . . . . . . . ≥98%. . . 44 . . . 5-Methylquinoxaline. . . . . . . . FG . FG . . . . . . . . . . . . . natural. . . . . . . 2. Methyl anthranilate. . . . . . . . . 1-Furfurylpyrrole. . >98% . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . 50 wt. . . . . . . . FG . . . . . . . . . . . . . ≥98%. . . . . . 54 . . ≥90%. . . 82 . . . . . . . . . . .4-Dimethylthiazole. . . . . . . . . . 2-Pentanone. . . . 81 . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . ≥98%. . . . . . . . . . . mixture of isomers.5. . . . FG . . . . ≥97%. . . . . . . . 38 . . . . . . . . . . . . . . . . . . . 12 22 31 31 34 35 38 41 44 45 50 50 51 54 Page . Propionaldehyde. . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 38 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . 3-Hexanone. . . . . FCC . FG . . . Cyclohexyl acetate. . . . . . . . . . . . . . FCC . . . . . . . 65 . . . . FG . . . . . . . . . . . 3-Octanone. . . . . . . . . . . Heptyl alcohol. 2-Ethyl-3(5 or 6)-dimethylpyrazine. 89 . . . . . . . . . . FG . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . 83 . . . . . . . . 2. . . . . . . . 95 . . .6-Tetramethylpyrazine. . . . . . . . . . . . ≥98%. . . . . . . . . . . . . 97% . .SAFC® Flavors & Fragrances Organoleptic properties index citrus: other Page Cat No. . . . . . . . . . . . . . . . .7-dihydrocyclopenta[b]pyrazine. . . . mixture of L-citronellol and geraniol. . . . . . . . Methyl eugenol. . . . . . . . 19 . . . . . . . . . FCC. . . 2-Ethylbutyl acetate. . . 8 12 37 38 earthy mushroom W369608 W366404 W351504 6-Amyl-α-pyrone. 2-Ethylfuran. . . . 66 . . . . . . . 2-Methylpentanal. . . 2-Methyl-3(5 or 6)-ethoxypyrazine. . . . . . . . . . . . 1. . . . ≥97%. . . . . . . . . . . . . . . . FG . . . . . . .5. . . . . . . . . 80 . . . . . . . . . . . .3. . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . 82 . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . FG. 49 . . . . . . . . 2-Methyl-3-furanthiol. . . . . ≥90%. . . . . . . . 1-Methylnaphthalene. . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . natural (US). . . . . . . 50 . . . 38 1-Octen-3-one solution. . . mixture of isomers. . . ≥97% . . . . . . . . . . . . . . . . . Methyl 2-methyl-3-furyl disulfide . . . . . . . . . Isobutyl phenylacetate. . . . . . . 3-Decen-2-one. . . . . . . . . . . . . . . FCC. ≥98%. . . . . . . . ≥97%. . . . . . . . . . . . . . . . Dicyclohexyl disulfide. Octyl butyrate. . ≥98% . . FG . . . . . 2′-Methoxyacetophenone. . . . . FG . . . . . . FG . . . ≥98% . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . 1-Decen-3-ol. . . . . . .5-Dimethyl-2-ethyl-3-thiazoline. . . . . . . 4-Hydroxy-2. . . . . . . . . . . . . . . . . . . . .5-dimethyl-3(2H)-furanone solution. ≥95%. . . 2-Methoxy-4-methylphenol. . . . . . FG . . . 4-Oxoisophorone. . . . . . . . . . . . . >98% . . . . . mixture of isomers. . 2-Methoxy-3(5 or 6)-isopropylpyrazine. . . . . . . . . . ≥98%. . . . . . . 58 . . . . . . . . . . . . . . . . FG. . . Methyl cyclopentenolone. . . . . . . . . . . . . . 66 . . . . ≥95%. . FG . . . . . FG . . . . . . . . . 38 . . . . . . . FG . . . . . . . . . . . . ≥99%. . . . . . . 2-Thiophenethiol. . . . . . . . . . . . . . . 2. . . . . . 97% . . . . . . . . . . . . . . . . . . . . . Methyl eugenol. . . . . . . . . . . . . ≥97%. . . . . . ω-6-Hexadecenlactone. . . . . . . . . . . . . . . . . . . . . FG . . . . . . Name W308218 W347507 W309303 W309311 W309508 W310905 trans-2-Tridecenal. . . . . . . . . . . . . FG . FCC. 2. . ≥95%. . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . FG . . . . . FG . . . . . . . 10 wt. . . . . . . . . . . . . . . . . . . . .6. . . . . . . . 80 . . . . . . . . . . Furfuryl methyl sulfide. ≥98% . . . . 2-Methoxy-4-methylphenol. Bis(methylthio)methane. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3-Octanol. . . . . . . . 54 . . . 2-Octanol. . . . FCC . . 50 wt. . . . . . . . . . . . . . . . .2-cyclopentadione. . . . . . . . . . . . . . . . . 1-Octen-3-one solution. . . . .5-Trimethylthiazole. . . . . . Indole. FCC. . . . . ≥98%. . . . . . . . . . . . . . . . . . . 35 . . . 98% . Diethyl succinate. . . . . . . . . . . ≥98%. . . . . . . . 54 . . . . 4. 89 . . . . . . 54 . . . FG . . . . . . . . . . . . . . . . . . . . . . 65 . . . . . . . . . . .3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . mixture of diastereomers. FCC . . . . . . . . . . . . .6-dimethylbenzofuran. . mixture of isomers. . . . . . . . . . . . . . . . . . . Ethyl 10-undecenoate. . . . . . . . . . . . 99% . . . . . . . . . . 78 . . . . . . . . . . 2-Methylanisole. . . . . . . . . . . . % in propylene glycol. . . . . . . Pyruvic acid. . 18 . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hydrocinnamaldehyde. . . . . . . . . ≥98% . . . . . . . . . . . ≥97% . . . . . . . . . . . . ≥98%. . . . . . . . . . 14 . . . . . . γ-Dodecalactone. FG . . . . . coffee W200301 W200336 W332909 W326909 W362001 W363413 W366404 W327107 W327301 W354007 W503401 W367303 W367400 W315214 W383503 W314900 W339407 W328200 W315818 W316105 W249300 W316008 W334707 W316318 W316315 W354708 W316814 W317411 W329800 W267104 W267112 W415901 W268208 W268216 W269107 W270008 W318809 W336203 W343609 W357308 W394904 W320307 W378704 W320803 W297003 W297070 W323705 W323713 W323802 W306207 W306606 W332518 . . . . Hexyl propionate. . . . 3-(Methylthio)-1-propanol. . .3-Dimethoxybenzene. . . ≥98%. . . . . 95 116 116 123 123 123 123 124 126 W316318 W254800 W255505 W316903 W257605 W288705 W501808 W259306 W220841 W221007 W368709 W268208 W268216 W439800 W268909 W247502 W343609 W357502 W337218 W518123 W331007 W320803 W358118 W280305 W361208 W280704 W342106 W284203 W286508 W287814 W292818 W292303 W298018 W323500 W323705 W323713 W309109 2-Furyl methyl ketone. . . . . . . . . . . . . . . . . . 39 . 50 wt. . . . . . . . . . . 66 . . . . . Benzyl disulfide. . . . . . . . . . ≥95% . Rhodinol. . . . . . . . . . . . . . . . . . . . . . . . . . % in propylene glycol . 70 . . . . . . ≥97% . Lovage oil. . . . . . . . . . . ≥97%. . . . . . . . . . . . . . 88 . . ≥98%. 2-Ethylpyrazine. . . . ≥97%. . . ≥95% . . . . . . . . FCC . . . . . . . . . . . . . . . . . . 101 musty W205001 W326100 W348007 W234907 W344818 W237701 W362001 W240001 W242500 W354309 W328103 W339407 W246107 W339709 150 Ambrette seed absolute. . . . . .5-Dimethyl-3-hydroxy-2. . . . . . 81 . . . . . . . . . 2-Furanmethanethiol formate. . . 65 . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . ≥99% . . . . . . .7-Tetrahydro-3. . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . FCC . . . . . . . . . .6-Tetramethylpyrazine. . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . FCC. . . . . . . ≥98%. . . . . . . ≥99%. . . . . . . . . . . . . . . FG . 50 . . . . . . . . . . . . . . . . α-Methylbenzyl butyrate. . . . . . . . . . . . . . % in 1-octen-3-ol. . . . . . . . . . . . . . . . . . . . . 2. . . . . . 53 . FCC . 82 . . . . . . . . 96% . . . . 2-Methyl-3-buten-2-ol. . . . . . . . . FCC. . . . . . . . . . . . . . . ≥98%. . . . α-Isobutylphenethyl alcohol. . .5-Dimethyl-3-hydroxy-2. . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . . . . 95 100 100 100 101 101 101 101 other W504009 W206806 W208800 W361704 W387800 W382418 W353205 W313602 W237701 W238503 W363405 W242500 W349100 W315508 W314900 W339407 W328405 W328804 W329002 W393118 W288705 W259306 W355518 W261718 W265101 W416301 W335800 W268003 W268607 W268909 W503908 W330604 W247502 W343609 W319309 W356905 W341304 W343803 W341509 W425301 W280100 W358118 W358126 W280305 W280518 W388718 W351504 Place an order with your local SAFC representative (see back for contacts). . . . . . . . . . . 4. . . . . . FG . . . . . . . . . . . . . . . . . . . . FG . . 3-Ethylpyridine. . . . FG . . . . 2. . . . . . . .4. . . . . . . . . . . . . . 2-Undecanone. 10 wt. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . ≥97%. α-Methylbenzyl propionate. . . ≥90% . 82 . . . . ≥99%. . . . . . . . . . 3-Ethyl-2-hydroxy-2-cyclopenten-1-one solution. . . . ≥98%. . . . . . 72 . . . . ≥99%. . . . . . . . . . . . FG . . . . . 13 . . . . 94 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Propanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . ≥98%.5. . . . . . . . 2-Methyl-2-thiazoline. . . . . . . . . 50 . . . . . . . Methyl anthranilate. . . . . . . . ≥98%. . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl 2-furoate. . . . . S-Allyl thiopropionate. . . . . . . . . . . . . . . . . . . . . . Furfuryl isopropyl sulfide. . ≥97%. . . . ≥98% . . . . . . 98%. . FG. ≥95%. . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . FG. . . . . . . . . 93 . . . . . . . . . . . . . . . 59 . . .2′-(Thiodimethylene)difuran. . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . Trithioacetone. . . . . . . . . . . . . 2-Methoxyphenyl acetate. . . . . . . (Methylthio)methylpyrazine. . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . 3-Octanol. . . 54 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Ethylfenchol. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . ≥98%. . . . . . . . . . . . ≥98%. . . . . . . . . . . mixture of isomers. . . . . . FCC. . . . 39 . . . . . . . ≥97% . . . . Methyl anthranilate.6-Dimethylpyridine. . 45 . . . . % in 1-octen-3-ol. . . . . . . ≥97%. . . ≥80% . . . . . . . . . . . . . . . . . . . . . 79 . . . . . . . ≥98%. . . . . . . . . . . FG . 2-Methyl-3-methylthiofuran. . . . . . . . . . . . . . . . . .

. FCC . . . . . ≥99%. . . . . . 62 . . . . . . . . ≥98%. . . . . . . . . . . . . . ≥98%. . . . ≥96% . Butyl isovalerate. . . . . . . ≥98%. . . . . . . . . . . Ethyl acetate. . Anisole. . . . . . . . . . . . . . . . 2-Methyl-3-methylthiofuran. . . . . . . . . . mixture of isomers. . . . . . 15 . . . . . . . FG . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . FCC . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33 . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . Tetrahydro-4-methyl-2-(2-methyl-1-propenyl)-2H-pyran. . . . . . . . . . . . . FG. . . . . . . 2-Methyltetrahydrofuran-3-one. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Decen-3-ol. . . . . . . . . . . . 2. . . . . . . . . . FG. ≥98%. . ≥98% . . . . . . . ≥90% . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . ≥99% . . 3-Heptanone. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . Butyl propionate . . . . . . . . . . . . . ≥99. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3-Heptanol. . . . . . . . . ≥99%. . . . . . . . . . . . . Butyraldehyde. . . . . . . . . . . . . . Isobutyl acetate. . . . . . . FG . . . . . . . . . . Isobutyl isobutyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. 47 . . . . 58 . . . . . . . . . . . . Benzyl benzoate. . . . . . . . . . . . ≥98%. Isopropyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Octen-3-yl butyrate. . . . . . ≥98%. . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . ≥99%. . . 2-Nonanone. . Ethyl (methylthio)acetate. δ-Nonalactone. ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5. . . . . . . . FG . . . . . 2-Pentanone. . . . . FG . . . . 2-Thienyl disulfide. . . . ≥96%. . . . . . . ≥99%. . 22 . . m-Cresol. . . . . . . . natural (US). . . . . . . . ≥99% . . . . . . . . . . . . . . . . . 2-Methyltetrahydrothiophen-3-one. . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . ≥95% . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . W332305 W323802 W306606 W352403 W347507 W309109 W310107 W311901 Page Cat No. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . >98% . . . . . . . . . . Propyl formate. . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Penten-3-ol. . 58 . . . FCC . . . . Ethyl propionate. 98 . FCC. . . . . . . . ≥95%. . . ≥99% . . . . . . . . . . . . . ≥95%. . . . . . . Acetaldehyde solution. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 94 . . . FCC. . . . Methyl hexanoate. FCC . . . . . . . . . . . . . . . . FG . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . 22 . . 98 101 101 101 105 105 109 127 127 Anisole. . . . . . . . . . . . . Isovaleric acid. . . . . . . ≥97% .5-Dihydro-3(2H)-thiophenone.5%. ≥99%. . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33 . . . . . ≥98%. . . . . . FCC . . . . . ≥99% . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . natural. . . . . . . ≥98% . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . ≥95%. . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . ≥98% . . . . . . . .5%. . . 2. . . . . . . . . . . ≥97%. . . . . . . . . . . . . . 2-Methoxy-4-methylphenol. . . . . . . . . . . . . . . . . . . . . . trans-2-Hexenyl butyrate. . . 66 . . . . . . . . . . . . . . . . . . . . FG . . ≥98%. . . . . . . . . . . FG . . ≥97%. . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . FCC . . . . 4. . . . . . . . . . . . . ≥97% . ≥97%. . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . Methyl butyrate. . . . . . . . . . . FG . . . . . Ethyl butyrate. . . . 99%. . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 101 101 102 109 109 110 113 114 122 W273104 W277800 W284203 W292303 W293415 W294306 W338605 4-Methyl-2-pentanone. . . . . . . . . . .trans-2. 36 . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . Indole. . 18 . . . . . . FG . . . . Butyric anhydride. . . . FCC. . . 1-Phenyl-1. . . . . . . ≥98% . 2-Methoxy-4-methylphenol. . . ≥98% . . . . . . . . ≥92% . . ≥98%. . . . . . . . . . ≥97% . . 2. . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . δ-Dodecalactone. . . . ≥98%. . . Ethyl trans-2-butenoate. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . FG . . . . . . . 4-Pentenoic acid. . . . 2-Methylpentanal. . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. FG . . . . . . . ≥99% . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isopropyl phenylacetate. . . . . . . . . ≥97%. . . . . . . FG . . . . . . . . . . . . . Isopropyl 2-methylbutyrate. FCC. . . ≥99%. . . . . . . . . . . . . . . . . . . . Octyl isobutyrate. . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . Amyl formate. . . . . . . . . . . . . . . . . ≥98%. . . . . . . FCC . . fatty butter W200506 W203718 W209708 W214000 W288101 W219002 W219010 W221600 W527211 W236101 W236128 W326607 W240109 W244007 W244015 W328103 W254304 W354708 W328901 W255807 W340200 W501808 W259306 W222208 W292907 W318809 W270601 W376108 W387509 W337307 W351202 W335606 W278513 W280305 W341606 W361208 W284300 W358401 W322601 W342203 W329401 cheese W209708 W213802 W214000 W387800 W333204 W219002 W219010 W222100 W222119 W382418 W240109 W314900 W254304 W334812 W254606 W255904 W255912 W317004 W392618 W257605 W259306 W355690 W310204 W265101 W267104 W267112 W269506 W269514 W270601 W394904 15 17 17 19 21 22 22 24 24 34 41 49 57 57 58 60 60 61 62 64 66 72 73 76 79 79 84 84 87 89 151 . . . . . . . . . . . . . . . . . . . . . . . . . . Isopropyl alcohol. . . ≥98%. . . . . . . . . . . . Amyl acetate. . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . 71 . . . . . . . . . . 1-Octen-3-yl butyrate. . . . . . . Propyl disulfide. . . . . . . . . . . . . . δ-Decalactone. . . . . . . . . . 4-Heptanone. . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . ≥98%. . . . . . . . . . . Propionaldehyde. . . FG . . . . FG . 47 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . FCC. . . . . natural. . ≥97%. . . . . . . . .2-propanedione. . . . . . . . . . . . . . . . . . . . . . . . . . . 60 . . . . . . . . 2-Ethylbutyl acetate. . . . . . δ-Decalactone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-3-Octen-2-one. III . . . . . . . . . 5-Methyl-2-hepten-4-one. . . . . . . . γ-Undecalactone. . 93 . FG . . . . . . .com . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Allyl 2-ethylbutyrate. FCC . . . ≥98%. . . . . . . . . . . . ≥97%. . Thymol. . . . . . . . . FCC. . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG. . . Allyl octanoate. . . . . . . 8 . . . . . . 3. . . FG. . . . . . . . . . . FCC . . . . . . . . . . . . ≥99% . . . . . . . . . . . . . . FG . . . . . . . . Allyl propionate. . . . FG . 2-Phenylpropionaldehyde dimethyl acetal. δ-Dodecalactone. . . . . . . . . . . Diacetin . . . . . . . . . . . . . . . Acetone. . . . . . . . . . . . . . natural. . . . . . . . . . . . . 8 . . . . ≥99%. . . . . . . . . δ-Undecalactone. . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (±)-2-Methylbutyric acid. . . . . . . . . . . . . . . . . . . . . Ethyl acetate. FCC . . . . . . . Anisole. . . . . . . . FG . FCC . . . . . Acetaldehyde. . ≥97% . . . . . Decyl propionate. . . . . . . . Heptanoic acid. . . . . . . . . . ≥97%. . Pyrrole. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexanoic acid. ≥97%. . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . 2-Methylheptanoic acid. . . ≥98%. FCC . . . . . . . . . . . . . . . . . . . . . . FG .7%. . . . . . FG . . . . . . . . . . . . . cis-3-Hexenyl isobutyrate. . . . . . . . . . . . . . . . . . . . . . FG . . . . . >97% . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . trans. . . . . . . 11 . . Isobutyric acid. . . . . . . . . . . . . 2-Butanone. . . . 8 . . . . . . 2-Furanmethanethiol formate. . 98%. . . .. . . . . . . . . . . . . . . . . . . . . . . . . 2-Methylheptanoic acid. . . . . 23 . . . . . . . . . . . . . . . FCC . . . 87 . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . FG . . . . . . . . . . ≥99. . . . ≥98%. . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . Butyl butyryllactate. . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . FG . ≥99% . . . . . . . . . Methyl acetate. . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . 98%. . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . 3-Hexanol. . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isobutyl formate. . . . . Ethyl acetoacetate. . . . . .Organoleptic properties index earthy: other Cat No. . . . . 96%. . ≥97. . . . . . . . . . . . . . ≥98%. . . . .3-Hexanedione. FCC . . . . . . . . . . . . . natural (US). . . . . . . FCC. . . . . . . . . 87 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Phenyl-2-butenal. . . . . . . . . . FG . . . . . . . . . . . Isopropyl myristate. . . . . . . . . . . Ylang-ylang oil. . . FCC . . Benzyl butyrate. . . . FG. . . . . . . . . . . . . . . . . . . . . . . . FG . . . . Phenyl disulfide. . . . . . . . . . . . . . . . . . . trans-3-Hexenoic acid. . . . . . . . . . . . . . . . . . . Ethyl lactate. FCC. . . . . . natural. . . . . . ≥98%. . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . Butan-3-one-2-yl butanoate. . . . . . . . . . . . . . . . . Butyl butyryllactate. . . . . . . . . . . . ≥98% . . . . . Butyl butyryllactate. . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . 8 . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . Ethyl formate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .5. . . . . . . . . Ethyl butyrate. . . . . . . . . . . . . 41 . . . . . . . . mixture of cis and trans. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Acetone. . . . . . . . . . . . FG . . . . . . . . . . . . . FCC. . . . . ≥99%. . . . . . . . . . . . . FG . ≥99% . . . . . . . . . FCC. . . . . . . . . . . . . . natural. . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . Butyl 10-undecenoate. . FCC . . . . . . . . . . . . . ≥98% . . . . . . . . 50 wt. . . . . . . . . .3-Heptanedione. . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . .3-Heptanedione. . . . . . . . FG. . . . . . . . . . . Methyl sulfoxide. . . . . . . . FG . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . Acetaldehyde phenethyl propyl acetal. . . . natural. . . . . . . . . . . . . . Ethyl 3-phenylpropionate. Butyl valerate. Methyl 3-hydroxyhexanoate. . . . . 57 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl formate. . . 2-Ethylfuran. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥85%. . . . . . natural. . . . . . . . . . . . . . . . ≥96% . . . . . . . % in ethanol . . . . . . . . . . . . . . . . . FCC . 1-Propanol. . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . Ethyl levulinate. 2-Methylbutyric acid. . . . . . . . . . . . . . . ≥97%. . . 1-Hexen-3-ol. . . . . . . . . . Butyric acid. FG. . ≥98%. . . . . . . . . . Butyric acid. . . . Isobutyl butyrate. . . . ≥97%. ≥97% . . . . . . . . . . . . . . . . . . . 4-Hexen-3-one. . . . . . . . . . . . . . . FG . natural. . . . natural. . predominantly trans. . . ≥99%. . . . . . . . . . . . . . . . . . . . . . ≥93%. . ≥98% . . . . . . 3-Octanone. . . . Name W341606 W361208 W280801 W322407 W322504 W288802 W292818 W322806 W323500 W323608 trans-3-Octen-2-one. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 66 . . . FG . . . . . . . . . . . . . . . . . . . . . . Hexanoic acid. . . . 8 11 12 13 13 15 21 23 23 23 24 24 31 34 34 38 42 42 42 42 43 44 44 44 44 45 45 47 48 49 50 50 50 53 58 60 60 61 61 62 64 69 69 69 70 71 72 73 81 84 87 87 87 91 Page . . . . . . . . . . . . . . . . . . . . 94 . . .2′-(Thiodimethylene)difuran. . . . . . . . . . . . . . Hexyl propionate. . . . . . . . ≥95%. . . . . . . . . . . . Ethyl lactate. . . natural. . . FCC. . 2. . . . . . . . . . 70 other W200301 W200336 W200328 W200409 W332607 W332615 W202908 W204005 W504009 W206806 W209708 W217018 W221805 W221104 W221708 W221902 W221910 W353000 W236918 W500615 W353701 W241407 W241415 W241512 W241504 W348600 W242500 W242705 W242713 W506109 W243418 W367303 W244201 W383503 W245518 W245607 W245615 W245909 W315818 W254509 W335118 W329002 W360805 W335207 W392901 W257001 W217506 W218707 W219703 W218901 W292605 W369918 W295604 W267600 W269301 W270806 W270814 W350818 W341304 Acetaldehyde. . . . . . . . . . . . . . . . 70 . . . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . . . . . . . . . . . . . . Butyraldehyde. . . . . Bis(methylthio)methane. . . . . . . . . . . . . . . 5-(Hydroxymethyl)furfural. 24 . . 97% . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl chrysanthemate. . . . . . Propyl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . ≥98% . Benzyl butyrate. . . Valeric acid. 50 . . . . . . . . . . . ≥98%. . . . . . .6-Dimethyl-4-heptanone. . . . . 2. . ≥98%. . . . . ≥97% . . Ethyl sorbate. . . . . . . . .3-dioxolane. . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . 2-Ethylpyrazine. . . . . . . . . . . . Ethyl propionate. 122 123 123 124 126 127 127 128 130 ethereal musty W428600 2-Isobutyl-4-methyl-1. . . ≥99%. . . . . . . . Methyl hexanoate. . . . . . . . . . . 2-Methyl-3-furanthiol. . . . . . . . . . . . . . . . . . . . . . . Trithioacetone. . . . . ≥97%. . . . . . . ≥97%. . . . . . . . . . 91 . . . FG. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . FCC Neryl isovalerate. . . . . . . Indole. . . FCC . . . mixture of isomers. . . ≥97%. . . . . . . . . . . . . . cis-4-Heptenal. . . . . Lovage oil. Ethyl acetoacetate. . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . ≥99% . FCC. . . . . . . . . . . . . . . . . 97 105 113 114 114 116 Acetanisole. . . . . . . . . . . . . . . . Feel inspired at safcglobal. . . . . . . . . . . . . . . . . . . . . . . 86 . . . . . . . . . 8 . . . . . . . natural. . ≥98% . . . . . . . . . . . . . . . . . . .6-dimethylbenzofuran. . . . . . . . . . natural. . . . . . . Benzylideneacetone. . . . .6. . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . .7-Tetrahydro-3. . FCC . . . . . . . . . . . . . . . . . . . . 3-Hexanone. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . 98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. 2-Ethyl-3(5 or 6)-dimethylpyrazine. . . . . . . . . . . . . . . . . 8 . . . . . ≥95% . . . . . . 17 . . . . . . . . . . . . . . . . . . . 4. . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . cis-3-Hexenyl butyrate. . . . . . . . . . . . . . . . . FCC . Butyl butyryllactate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . ≥92%. . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . Name . . . . . . . .5-Trimethylhexanal. . . ≥97%. . . . . .4-Undecadienal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . FG. . . . . . . . . . . . .

. . . . . . . . . . . . natural. . . . Anisyl acetate. . . . . . Argentina . . . . . . . . . . . . . . . . . . . . . . . . Methyl decanoate. . . . . . . . . 3-(Methylthio)propionaldehyde. . . . . . . . . . . . . . . . Methyl 2-thiofuroate. . . . . ≥99% . . . . . . . . . . . 84 . . . . . . 75 . . . . . . . . . Propyl butyrate. . . . . . . . FG. . . . . . . . . . . . ≥97%. . . . . . . . . . . . 3-(Methylthio)propionaldehyde. . . . ≥98% . . . . . . . . Menthalactone. . . . ≥97% . . . . . . 87 . . . . . . . . natural. . . . FCC. . . . . . . . . . . . . . 87 . . . . . . . . . . . . . . . . . . Methyl 10-undecenoate. 91 116 120 123 Allyl hexanoate. . 2-Pentanone. . . . . . . . . . natural. . . . . . 3. . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Argentina origin . . . . . . . . . . Hexanoic acid. . . . . . . Vanillic acid. . . . . . . . 58 . . . ≥98% . . . . . . . . . . . . . . . . . . FCC . . . . ≥98%. . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . 91 . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Ethyl-1-hexanol. . . . . .3-Hexanedione. . . . . . . . . . . . . . . . . . ≥98%. . ≥98%. . . . . . . . . . . . . . . . . . ≥93%. . . . . . .5. . . .3-Hexanedione. . . . . . . . . Heptyl acetate. . . . . . . . . . . . . . FG . . . . . . . . . . . . . . Neryl acetate. FG . . . . 9 11 13 14 23 29 31 Page sour W230200 W242918 W248800 W334804 W255904 W255912 W269204 W262501 W262528 W265721 W269506 W269514 W275409 W296600 W502715 W332208 other W203203 W203718 W207209 W353108 W234907 W313505 W236128 W236403 W236500 W503800 W396605 W236608 W353205 W236802 W238600 W314218 Place an order with your local SAFC representative (see back for contacts). . FCC. . . . . ≥97. . . . . . . . . . . . . ≥98%. . . . . . . . Isoamyl alcohol. . . . . . . . Cyclohexanecarboxylic acid. . . . .5-Trimethyl-1-hexanol. . . . . . ≥99%. . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . 98 . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . 98 . . . . . . . Allyl 2-ethylbutyrate. . . . . . . . . . ≥99% . . . 97%. . . . . . 1-(p-Methoxyphenyl)-2-propanone. . . . . . . . . . . . . . . . . . . FG. . . . . . . . . 91 . . . . . . . ≥97% . . . . ≥98%. . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . Methyl laurate. . . . natural. . . . . . . . . . . 60 . . . . . . 93 . . . . . . . . . . . . . . >96%. . . . . . . . δ-Decalactone. . . . . . . . . 6-Methylcoumarin. . . . . . . . 1-Octen-3-ol. . . . . 95 . . . . . . . . . . . . . 3-Nonanone. . . .7-Dimethyl-6-octenoic acid. . . . . . . . . ≥97%. 75 . . . . . . . ≥97%. . . . . . . . Benzylideneacetone. . 1. . . . . . . . . Orris concrete . . . Ethyl nonanoate. Ethyl 2-trans-4-cis-decadienoate. . . . . . . . . . . . . . trans-p-Methoxycinnamaldehyde. . . . . . . . . Veratraldehyde. . . . . . . . . . . . . ≥97%. Butyl laurate. FG . . . . . ≥97%. . . . 3-(Methylthio)propionaldehyde. . . . . ≥92%. . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . 2-Methyl-3-buten-2-ol. . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . Methyl thiobutyrate. . . . . FG . . . . . FG . . .4-Decadienal. . . . ≥99% . . . . . . . . . . . . . 48 . . . . . 73 . . . . . . FG . . . . . . . . . . . . . . . . . . 14 . . . . . . . . . . . . . . . Mandarin oil. . . . . . . . . . . ≥98%. . . . . . . . . . . . . . Myristic acid. . 60 . . . . . . . . . . . . . . . 2-Ethylbutyl acetate. . . . . . . . . . . Phenylacetic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3-Octanol. . . . . . . . . . . . . . . . . . . . FCC . . . . . . . 98 . . 77 . . . . . ≥99% . . . . . . . 98 . . . . . ≥98% . . . . . . . . . . . . Pyruvic acid. . FG . . . . . L-Menthyl acetate. . . . . 3-Decanone. . . . Cuminaldehyde. . . . . . . . . FG . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . 9 . . . . . . 3. . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . ≥97% . . . . . . . . . . . . . ≥98% . . . . . . . . . ≥98%. . . . . . . . . . . ≥99%. . . . ≥97% . . . . . . . . 3. . . . . . 67 oily W325007 W325104 W202908 W207209 W329304 W220604 W230405 W234109 152 2-Acetyl-3-ethylpyrazine. . . . . . . . . . . . . . . . . . . . . . . . . 25 wt. . . . . . . . 44 . . . . . . . . . . . . . . . . . 2-Methylpentanoic acid. . . . . . . . . . . . . .5%. . . . . . . . . . . . . . . . . . . . . . . . . DL-Menthyl acetate. . . . . 86 . . . . . . . . . . . . . . . . . . 87 . . . FG . . . . . Butyl butyryllactate. . . . . 98 100 100 100 102 103 104 106 116 117 117 125 126 127 trans-Cinnamyl isovalerate. 95 . . . . . . . 96% . . . . . . . ≥97%. . . . . . . . . 98 100 100 101 101 105 105 108 113 114 122 123 123 p-Anisaldehyde. . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . 24 . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . mixture of isomers. . 41 . . . . . . . . . . . . . . . Methyl eugenol. . . . 77 . . . . . . . . . . . . . . . . . . . . . . . . . . . 6-Methyl-5-hepten-2-one. . . 4-tert-Butylcyclohexyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Trimethylamine solution. . . . . . . . . . . . .2′-(Thiodimethylene)difuran. . . . . . . FCC. . . . . FG. . FG . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . 67 . . . . . . . γ-Octalactone. . . . . . . . . . . . . . ≥90% . . . . . . . . . . . . . 54 . . ≥99%. . . . ≥99% . . . . . . . . . . . . . . . Rhodinol. . . . . . . . . . . . . Furfuryl mercaptan. . .Turkish . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .cis-6-Nonadienyl acetate. . FCC. . . . ≥98%. . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . 15 . . . FG . . . . . mixture of isomers. . . . . . 83 . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 91 . ≥99%. . . 98%. . . . . . . . . 84 . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . ≥99% . . . ≥98%. . . . . . . . . . FCC. . . . . . . . . . . . . . ≥97%. . . FCC . . . . . . . . . . 97%. . . . . . . . . . . . . . Hexyl propionate. . . . . . . . . . . trans-2. natural. 2-Nonanone. . . ≥98%. . . . . . FG . . . . . . . . . . . . . . . . . . . . . . ≥92%. 44 . . . . . . . . . . FG Nonanoic acid. . FCC . . . . . . . . . . . . . . . . . . Farnesol. . . . . . . FCC. . . . . . . . . Methyl p-tert-butylphenylacetate. . . . . . . . . δ-Decalactone. . . . Vanillylacetone. . ≥97%. . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . 1-Octen-3-ol. . . . . . . 91 . . . . . . . . . Ethyl decanoate. FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . 44 . 28 . FCC. . . . . . . . . . . natural. . ≥98%. . . . . . . ≥98%. . . δ-Dodecalactone. . . . . . . . . . FG . . . . . Pyridine. . . . FG . . . . . . . .3-Heptanedione. . . FG . ≥98%. . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 99% . . 2-Ethylbutyric acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . Butyl (S)-(−)-lactate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Decanol. . . . . . . . . . . . . . . . . natural. . . . . . . Fumaric acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 60 . . . . . . . . . . . . . . . . . . . Lemon oil. . . . . . . . . . . . . . . . . . . ≥99%. 36 . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexanoic acid. ≥99% . . . . ≥98% . . . . Propionaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Nonanone. . . . . . . . . . . . . . . . . . . . . . . . Methyl cyclohexanecarboxylate. . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 . . . . . . . . . . . . . ≥97% . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . Heptanal. . . . . . . Hexyl propionate. . . . . . . . . . . . . . . . . FCC. . . . . . . ≥97% Decyl butyrate. Isopropyl butyrate. . . . 46 . . . . . . . . . . Dihydrocoumarin. . . . . . . . . . . . . . . . . . . . Isovaleraldehyde.SAFC® Flavors & Fragrances Organoleptic properties index fatty: cheese Page Cat No. . . . . . . . . . . . . . . . . . . . 3-Methylpentanoic acid. . . 98 . . . . . . . . . 44 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 . . . ≥98%. . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . FCC. . . . . . . Heptyl alcohol. . . . . 90 . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . 22 . . Butyl butyryllactate. . . . . . . 86 . . . ≥98% . . . . . ≥98% . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . δ-Tetradecalactone. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . 3-Octanone. . . . ≥98% . . . . . . . . . . . . . . . . . . Methyl p-anisate. . . Name W357502 W275409 W346306 W351105 W331007 W274704 W278408 W278505 W278513 W344001 W279927 W358126 W280305 W280518 W284203 W284300 W287814 W292303 W294918 W305707 W332100 W323802 (±)-4-Methyloctanoic acid. . . . . . . . . . . . 94 . Citral diethyl acetal. . . . . . . . . . . . . . . 57 . . rectified. ≥97% . . . . . . . . . . . . . . ≥98%. FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . Isopropyl 2-methylbutyrate. . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . FG . . . . ≥98% . ≥98% . . . . . ≥93%. . . FCC. Succinic acid. . . . . . . . . . . . . FCC . . . . . . 78 . . . . natural. . . . . . . . . 57 . . . . . ≥97%. . . . 81 . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .6. . . . . . . . . . . . . . . . . . . ≥98%. . . . . (±)-2-Methylbutyric acid. . . . . . 2-Acetylpyridine. . . . . . natural. . . . . . FG . . . . . . . . FCC . . . . . . . . . . . . . . . . Methyl stearate. . . FCC . . . . . . . . . . . . . . . . . 52 . . . 78 . FG . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . FCC . 2-Oxobutyric acid. . . . . . . . . . . . ≥92%. . . . . 72 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . FCC. . . . . . . . . . . . . . . . 95 . . . . . . . . ≥92% . . . . . . . . . . Tributyrin. . . . . . . . ≥98%. . . . . . . . . . . 4-Pentenoic acid. . . . . . . . . 68 . . . . . . . . . . . . . . . ≥98%. . . . . . . ≥97%. . . . . . . . . ≥99%. . . . . 85 . .2-Dimethoxybenzene. . . . . . . . . . ≥97%. ≥95% . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . predominantly trans. . . . . . . . . . . . Propenyl guaethol. . . . . ≥93% . . . . . . . . . ≥98%. Methyl eugenol. 2. . . . . . FG . . . . . 2-Methylpentanoic acid. . . . . 96 . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . ≥95%. . δ-Dodecalactone. . . . ≥97% . . . FCC. . . . . . . . . . FCC . . Octyl isobutyrate. . . . . . 97 . . . . . . . . . . . . . . . . FG . . . California origin . . . . . . . . . . . . . . . . . Amyl 2-furoate. . ≥80%. . . . . . . . . . . FG. . . . . . Octanoic acid. Propyl hexanoate. . . . . . . . 2-Nonanone. . . . . FCC . . . . . . . . . FG . . . . . . . . . Name . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . 6-Methyl-5-hepten-2-one. . . . . . . . . . . . . . . ≥80% . . . . . . . . 64 . 97% . . . . . . . . . . . . . . . . . . . . . . . 2-Methylheptanoic acid. . . Undecanoic acid. . . 98 . . . . . . Tetrahydrofurfuryl butyrate. . . . . ≥94% . . . . . . . . . . . . ≥98%. . . . . . . . 23 . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . .7. . . FCC. . . . . . . . . . . . . . . . FG . ≥98%. . . . . . . 41 . . FG . . 33 . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . Allyl octanoate. . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . FCC. . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . ≥99%. . . . . . . ≥96% . . . . . . Vanillin isobutyrate. . . . FG . . . . . . . . . . . . . . . . . . . 3-Decen-2-one. . 85 . . . . . . . . . . . . . . . . . . . . 2-Heptanol. . . . . . . . . . . FCC. . . . . . . Decanoic acid. . . . . . 60 . . . . . 33 . FG . . . . . . . . . . . . 85 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥96% . . . . ≥98% . . . Ethyl decanoate. . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . ≥97% . . . ≥98%. . . trans-2-Decenal. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . creamy W267007 W209805 W288101 W219002 W219010 W507318 W220507 W221902 W236101 W236128 W238104 W379905 W240109 W314803 W255807 W316814 W257605 W207705 W293504 W376418 W356700 W267406 W267902 W269018 W269514 W269905 W356808 W247502 W270601 W271500 W343706 W331104 W274704 W279609 W280518 W280801 W372307 W291102 W292206 W293407 W297003 W297070 W359009 W222305 W398802 W375403 W312401 W310905 hop oil W206016 Isoamyl butyrate. . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 79 . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . FG. . . . . . % in H2O . . . . .4-Hexanedione. . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Octanol. . . ≥97% . . . . . . . . . . . . . . . . . . . mixture of L-citronellol and geraniol. . . . . . . . . . natural. . . . . . . . . . . . . . . 57 . . . . . . . . . . . . . . FG . . . ≥98%. . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . Isoamyl laurate. . . . . . . . . . . . . . trans. . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . 11 11 13 31 31 32 33 33 33 33 33 33 34 34 36 39 . . . . . . . . . . . . . 35 . . . . . . . . . 80% isoamyl butyrate basis. 3-Decanone. . . . . . . . . . . . . . . . . . . . . Cat No. . . . . . . . . . . ≥98%. . . . 22 . . . . . . . . . . . . . . . . . . . 5. . . . . . . (S)-(−)-Perillaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . Octyl octanoate. . . . . . . . . . . . . . . . . 2-Pentanol. . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . 58 . . . . 2. . . . . . . . . . . . . Butyraldehyde. . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . 57 . . . . . . . . Heptanoic acid. . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . 2-Methyl-4-pentenoic acid. . . . . . Lemon oil. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 87 . Amyl 2-furoate. . . 72 . . . . . . . natural (US). . . . . . . . . . . . ≥98%. . . . cold-pressed. . . . . . . . . . . . . . . . . . . ≥97% . . natural. Propyl propionate. . . . . . . . . Thiamine hydrochloride. . . . . . . . . ≥98%. . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . Pyruvic acid. ≥98%. . . . . . . . . . . . FCC . . . . . . 81 . . Piperonal. . . . . . . . . . . . . . . . . . Methyl 3-hydroxyhexanoate. . . ≥99% . . . . . . . . . . . . ≥98% . 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53 . . . . . . . . . . ≥97% . . . . . . . . . . . 95 100 101 102 103 112 113 114 116 116 122 125 129 129 129 129 W236608 W240109 W242500 W243205 W243213 W315109 W244708 W247804 W249300 W254002 W254304 W328804 W254703 W254800 W255807 W257605 W205702 W205710 W369918 W266825 W266809 W359807 W503908 W505501 W247502 W270709 W270733 W350818 W504807 W274704 W425301 W276405 W277304 W395218 W278203 W278505 W278513 W279900 W280100 W358118 W281107 W282928 W331600 W355704 W295809 W298018 W523704 W324108 W332402 W324507 trans-2-Decenal. 60 . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . ≥97%. . . (±)-2-Methylbutyric acid. . . . . . . . . . . . . . . . . . FG . . ≥97% . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . FCC . . ≥98% . . . FG . . . . . . . . . . . ≥98%. . . . . . . . . . . . . FG . . . FG . . . .4-Dimethoxybenzene. . . . . . . . . . FCC . . . . . 94 . . . . . . . . . . . . . . . . . . . . . . . . 2-Nonanone. . . . . . . . . . . . . .8-Tetrahydroquinoxaline. . . Rose oil. . . . . . . . . . . . . . . . . . . . . 18 . . . . . . . . . . ≥98%. .trans-2. . . . . ≥85%. . FCC . . . . 2-Methylbutyric acid. . . ≥95%. ≥99%. . . . . . . FCC. . . . . . . . . . . . . 67 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1. ≥97%. . . FCC . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . 22 . . . . . . FCC . . . . ≥98%. . . . . . FG . . . . . α-Angelica lactone. . . . . . . . . . . . . Octanoic acid. . . . . . . δ-Decalactone. . 2. . . . 4-Methylpentanoic acid. . . . . . . . . . . . . . . . . . . . Isoamyl alcohol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. natural. . . . natural. . . . . . . . . . . . . . . . . 64 . . 33 . . . . . . . . . ≥98% . ≥97%. . . . . . . . . . FG. . . . FG . FCC . . . . FG . . . . . . . . . . 81 . . . . . Cyclohexyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . ≥98%. . FG. . . . ≥98%. ≥96% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . 44 . . . . . . . . Nonanal. . . . . . 3-Octanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . FG. . . . . . . ≥97%. . . . . . . . . . . . . . 2-Methoxy-4-propylphenol. . . . . . . . 88 . . . . .

. . . . . . . . . . . . . . . . . . . . natural. natural. . . . . . . . . . . . . . . . . . . ≥99% . . . . .. . .. . . . . . ≥92%. . . . . . . . . . . . . . . . . . . . . . 73 . . . . . . . . . . 2-Nonanone. . . . . . . . . . . . . . . . . . . . . . . . . . . Jasmin absolute. . 73 . . . . . . . . . . . . . . .. . trans-2-Hexenoic acid. . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . Hexanoic acid. Hexanal. . ≥97. . FG . . . . . . . . . . . . . FCC . . . . . . . . . . . . . ≥99%. . Geranyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97% . . . . . . . . . . . . . . . . 2′-Hydroxyacetophenone. 97%. . FCC. . . . . . . . . . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .. . . . . .. ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .. . .trans-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . FCC . . ≥98%. . . . . FG . . . . . . . .. . . . ≥96% . . . . . .. . FCC. . . . . . . . .. . . . . . . . . . . . . . . . . . .. . . . . . .. . . . . . . . . . . . . . . . . . . Methyl jasmonate. Heptanal. Phenethyl phenylacetate. . . . . . .. . . . . . . . . . . predominantly trans. . .. . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl p-tert-butylphenylacetate. 15 . . . . . .. . . 37 37 42 89 97 Cat No. . . . . . . . . . . . . . FCC . . . % in H2O . . . . . . 79 . . . . . . . . . . . . . . . . . . . p-Tolyl phenylacetate. . . . 1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58 . . . . . . . . . . . . . . FCC . ≥99% . . . . .. . .. . . . FG . . . . . ≥96%. . . . . . trans. . mixture of isomers. . . . 98 . . FG . . . Pyridine. . . . . . . . . . . . . . FCC. . . mixture of isomers . . . . 2-Pentyl butyrate. 3-Decen-2-one. . . . . . . . . natural Heptyl formate. . . . .. 54 . Methyl furfuryl disulfide. . . . . . Lauryl alcohol. FCC. . . . . ≥97% . . . . ≥98%. . . . . . Name W240001 W240206 W314811 W364118 W364304 W246107 W254002 W316407 W254509 W316504 W328915 W255203 W255718 W255726 W255734 W349518 W255904 W255912 W316903 W256218 W393118 W257605 W259306 W261114 W261408 W261416 W261718 W350605 W357308 W272205 W321206 W278203 W278106 W331503 W278505 W321303 W337900 W372102 W279706 W279714 W280003 W372218 W281506 W389323 W266418 W305006 W323713 W222305 W309206 W309508 γ-Dodecalactone. . . . . Ethyl 10-undecenoate. . . . . . . . . . . . 1.. . . . . . . . . . ≥80% . . . . . . FG . . . . . . 17 . . . . . .. . . . . . . . . . FG . . Furfuryl mercaptan. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . Lactic acid. . . . . . . . . ≥98%. . . . . . cis-3-Hexenyl tiglate. . . . . . . . . . . . . . . cis-4-Heptenal. . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . .. . . . . . . . . . natural. . .. . . . . . . . 2-Pentanone. . . . . . .. . . . . . . . . Methyl anthranilate. FG.. . α-Amylcinnamyl alcohol. . . . . FG .. . . . . . . . . . . . . . . . . . ≥90%. . . . . . . . . . Dimethyl anthranilate. . . .. . . . . ≥99%. . 66 . . . . . FCC . . . . . . o-Anisaldehyde . . . . . . % in triethyl citrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . predominantly trans. . . . . . . . . . . . .. . . . . . . .. . . . . 17 . FG . . . . . . FCC . . . . . FCC . . . 42 . . . . . . .. 18 .. . 41 . 3-Phenyl-1-propanol. . ≥97% . . . cis-4-Heptenal solution. . ≥90%. . . Tributyrin. ≥95%. . . . . . . . . . . . . 41 . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . 2-Methoxy-4-methylphenol. . . . . . . . . 25 wt. . . . . . . . . . . . . . . .. . . . . . . . . 18 .. . . . . . >98% . ≥98%. . . . . . ≥97% . 13 . . . . . . 1-Octanol.. . . . . . . . . . . . . . 98 101 101 105 116 120 125 125 Dimethyl anthranilate. 31 . . . . . . . . . . . . . . . . . . . . (US) . . . . . . . . . . FCC . . . . . . . .. . . ≥98%. . . . .. . . .. FCC.. .. . . . . . . . . . . . . . . . . . 98 . . . . . . . . . . mixture with Amyl hydrocinnamyl alcohol Benzyl acetate. . . . . . . . . 98 . . . . . . . . . . . . . . . . . ≥95%. . Ethyl 2-acetyl-3-phenylpropionate. FCC. . . . . . . . . .. . . . . ≥95%. . ≥98%. . . . . . . . . . ≥95%. . . . . . . . .. . . .. . 79 . . . . . . . . . . . . .. . . . . . . . . fishy W313009 W383104 W249300 W328901 W259306 W359807 W336203 W274704 W321206 W278203 W278505 W278513 W280518 W361208 W284203 W296600 W303704 W550132 W324108 floral blossom W271802 W271810 W242101 W272302 W277304 . . . . . . .. . . . . . . . trans-2-Nonenal. . . .. .. . . . . . 49 . . . . . . . . . . . . . . Methyl anthranilate. . ≥98% . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . . . ≥97%. . . . 2-Nonanone. . . . . . . . . . . . ≥90% . ≥95%. . . . . . . . . . . . .. . . . . . . . . . . . . . . .. . . Benzyl propionate. . . Octanal. . . . . Citronellol. . . . . . . FCC. 55 . . . . . . . Skatole. . . . . . . . Methyl dihydrojasmonate. FCC. . 97% . . . . . . 88 107 108 108 108 110 110 124 hyacinth W209902 W229407 W288705 W268518 W269018 W271705 W286605 W286818 W287407 W287601 W273201 W288500 W307718 iris W285900 W309303 Phenethyl anthranilate. . . . . . . . . . . . . . . . . . .. . . . . . . . . . 59 . . ≥85% . . . . . . . . . . . . . . . . .. . 57 . . . . . . . . . 74 . . Terpinyl isobutyrate. . . . . . . . . . . . . . .. . . . . . . . .. . . . . . . Ethyl-trans-2-octenoate. . . .. . . . . . .. . . . . . . . . . . . . . . 13 . . . . 2-Methoxy-4-methylphenol. . . 82 . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . ≥98%. . . . . ≥97%. .. . . . . natural. . FG . . . .. . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . 44 . . . . . . natural. . . . 2-Methylbutyl isovalerate. . . . . . . . . . . . . . . . . .. .. . . . . . . . . . . . . . . ≥98%. . mixture of cis and trans. . . . . . . . . ≥97%. . . . . Hydrocinnamaldehyde. . . ≥98%. ≥98% . . . . . . .. ≥95% . . . . .4-Heptandienal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Octyl acetate. . . . . . FG . . . Feel inspired at safcglobal.. . . . . . . . 1-Octen-3-ol. . . ≥99%. . . . . . . Diphenyl ether. . . . . . . . . . . . . Methyl phenylacetate. . . . . ≥98%. . . . . . ≥99%. .. . . . . . .. . . . . . . . . . . . . . . . . . . . . . . . 28 . . .. FG . . . . . ≥95% . . . . . . ≥99%. . . . . . . . . .. . . . . . . . . . . . . . . . . . . . .. . . . . . 99 . . . . . . . . . . . . . . . . . . . . . . . . . 60 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . FCC . 44 . . 58 . . . . . . .. . . . . . . . . . . . . . . natural. . . . . . . . 88 . . . . . . . . . 60 . . . .. . . . . . . . . natural. . . . FCC. . . . . . .. . . . . . . . . Phenethyl salicylate. . . . . . .. . . . . . . . . . . . . . . . Lavender oil 40/42% fleurs . . . . . . . . . . . . ≥98% . . . . . . . . . FG . . . . 40 . . . FCC . . . . . ≥98% . . . . . . . . . . . . FCC. . . . . . . . . . . . . 60 . . . . . . FCC. . . . . . . . . . . . . Phenylacetaldehyde. . . . p-Anisaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. 2-Methoxy-4-methylphenol. . . 89 . . . 98 . . . . . . . . . . . . . . . . . . . . . Hexyl propionate. . . 79 108 109 Linalyl benzoate. ... . . . . . . . . . . ≥98%. . . . .trans-2. . . . . . . . . 65 . . . . . . . . . . FCC . . . . . . FCC. . . . ≥95%. ≥96%. . . . . . . . . . . . . ≥85% . . . . . . . . . . . . . . . . . . .. .. . . . . . . . Oleic acid. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (S)-(−)-Perillyl alcohol. . . . . . . . . .. . . . . . . . . . . . . . . . . . 3-Heptanone. . . .. . . . . . . . . . . . 79 . . . . . . . . . . . . . . . . . mixture of cis and trans. . . . . . . . . . . . . . . . . . . . . ≥98%. . . . 2-Methoxy-4-propylphenol. . 19 . . .. . . . . . FCC .. FCC . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . 76 . .trans-2. . .. . . . . . . . . . . . . 3-(Methylthio)propionaldehyde. .. . . . . . . trans-2-Hexen-1-ol. . . . . . . . . . . . . . . 2. . . . Tetrahydro-4-methyl-2-(2-methyl-1-propenyl)-2H-pyran. . . . .. . FG . . . . . . . . . . 98 . . α-Methylbenzyl propionate. . . . . . . . . . . . natural. . . ≥98%. . FCC. . . FG. . . . . . . .. . . . .. . FCC . . . . . . . FG . . . . ≥98% . . . . . . . . . . .. . . . . ≥99% . . . . . . 29 . ≥90%. . . . . .. . . . Hexanoic acid.5%. . . . . . . . . 60 . . . . . . . . . . . cis-5-Octen-1-ol. . . . . . FCC 2-Phenyl-1-propanol. .. γ-Nonanoic lactone. . FG . . . . . . . 66 . . .. . . . . . . . . . . . . . . . . . ≥85% . . Methyl β-naphthyl ketone.6-Hexanedithiol. . . . . . . . . . FCC. . .. . . trans. 61 . . . ≥97%. . . . . . . . . . . . . . ≥98%. 153 . . . . . . mixture of isomers. . . FG . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . Styrax. . natural. . . .com . 86 . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . Methyl p-tert-butylphenylacetate. . . . 1. . . . . . FCC. . . . Ethyl 2-aminobenzoate. . . . . . . . . . . . . . . . 52 . . . . . .. . Benzyl isobutyrate. . . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . . . . . . . 60 . FG . . . . . . . . . . Methyl 2-methyl-3-furyl disulfide . . . FG . . . . . . . . 76 82 82 99 geranium W312908 W230901 W366706 W323608 Biphenyl. . . . . . . . . . . . . . . . . . 10-Undecenal. 66 . . . .. . . ≥90% . . . . . . . . natural. . . . . . . . . . . . . mixed esters. . . . . . . . FG. . . . . . . . . . . . . . . . FG. . . . . . FCC . . . . . . . . . 97 . . . . . . . . 1-Octen-3-yl acetate. . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . . .. . . . ≥98% . Trimethylamine solution. . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . ≥98% . .4-Nonadienal. natural (US). ≥97%. . . . . . 57 . . . . . . . . . FG. . . . . . . . Linalyl benzoate. . . ≥97% . . 2. . . . . . . . . . . ≥93%. FCC.. . . . . . . FG. . . . . . . . . . . . ≥99%. . FCC. . . . . ≥96%. . . . . 89 . . . . . . . . ≥85% . 2-Nonanol. . . . . . . . . . . . Ethyl trans-2-decenoate. . 99 . . . . .. . Name Page carnation W229806 W247006 W267104 W267112 W286818 W361801 Cinnamyl cinnamate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .. . . . . . . . . trans-2-Dodecenal. . . . . ≥95% . α-Methylbenzyl acetate. . . FG . . . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . . 34 . . . . . . . . 86 . . . . . . . . . . . Lauric acid. . . . . . . . .. natural. . . . . . . . . . . . . . . . . . . . . . . . . . . 4′-Methylacetophenone. . . . . . . . ≥85%. . . . . . . Prenyl acetate. . 71 . . 63 . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . 81 . . Page . . . . 83 . . . . . . . . . . . .trans. . . FCC . . . . . . . . . . . . . . . . . FG . . . . . . . ≥92%. . 74 . .. natural. . . . α-Hexylcinnamaldehyde. . . . . . ≥88% . . . . . . . . . . . . 8 14 14 65 81 Anisyl alcohol. . . . . . . . . . . . . Cyclohexaneacetic acid. . . . . . . . . . . . . . . . FCC . . . . . . . . . ≥95% Isoeugenyl acetate. . . . .. . . . . . ≥98% . . . . 28 . . . . Indole. . . . . ≥98% . ≥97% . . . ≥97% . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . Nonanal. . . . . . .. . . . . . . . . . . . . 99 100 100 100 101 102 105 106 122 123 125 127 128 Butylamine. . . .5. . . . . ≥96%. . . .. . . . .. . ≥98%. . . . . . . . . . . natural. . . . FG . . . . . . 82 . . . . . . . . . . . 74 . . . . . . . . . . . . . . . . . . . . . . . . . . . Hexanal. . . . . . . . .. . . trans. . . . . . . . . . . . ≥98%. . . . . trans-2-Heptenal. 92 . . 1-Octen-3-yl butyrate. . . . . . . . . . . . . . . . . . . . . . Cinnamyl alcohol. . . 74 . . . . . . Hexanal. . . . . . gardenia W263818 W268402 W268909 W278807 . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . .6-Tetramethylpyrazine. . ≥98%. . . . . . . . . . . ≥99%. . . . . . . . . . . . FCC . . .. ≥98%. 61 . . . . . ≥85%. . FCC . . . . . . . 95 . . . . . . . ≥98%. . . . . . . . 98 102 118 Farnesene. . Octanal. . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . FG . . . .3. . . ≥99% . . . α-Methylbenzyl alcohol. . Benzyl butyrate. . . 84 . ≥97%.. . Neryl acetate. . . 122 hawthorne W200905 W407701 W267007 W354805 W267708 Acetophenone. . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . . . . . . . . . . . FG .. . . . . . . . . ≥99%. . . . 41 . . . . . . . . . . . . . . . . . . Phenethyl salicylate. . . . FCC. . . . . . . . . . . . . . . . 64 . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . 28 . FCC . . . . . . . . . Indole. . . . . . trans-2-Nonen-1-ol.. . . . . . . . . . . . . . . .. . . . . . . .Organoleptic properties index fatty: other Cat No. Undecanal. . . . . . . . . . . . . . . . . . . . . . . . . . . . .. . . . . . . . . . . . . FCC . . . . .. . . . . . . . 2-Methoxy-4-methylphenol. . . . . . . . . . . . . . . . . . FCC. . . . . . . ... . 51 . . . . . . . . . . . . . . . . 96%. . .. . . . . .. . . . . FCC . . . . . . . . . . . . . . . . . . . .. . FG. . . . . . . . . . . . . . . . . . . . . . Methyl 2-methoxybenzoate. . . . . . . . . . . . . . . . . . . . . . . 98 . .. . . . . . . . .. Nonanal. . . . . . . . . . . 84 . . . . . . . . . . . . . . . . . . . . . . . FG . . . ≥93% . ≥98%. . . . . . . . . . . . . . . . . . . .3-Nonanediol acetate. . . . . FG. . . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 60 . . . . . . . 5-Phenyl-1-pentanol. . . . . . . . . . . . . . . . . . >98% . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . FG . . . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . . 25 wt. . . . . . . .. . . . . . . . .. . . . . . . . . . . . . . Methyl myristate. . . . . .. . . . . . .. % in propylene glycol. . . . . . 97 . . . . . .. . .. . . . . . . . . . . FCC. . . . .. . . . . . FCC. . . . .. ≥98%. . . . . . .. . . ≥97%. . . . . . . . . . mixture of cis and trans. . .. . . . .. . . . . . . . . . .. . . . . . . . . . . . . . . . . . .. . . . . . . . . 106 2-Undecanone. . . . . . . . Lauric acid. . . . . . . .. . . . . 58 . ≥98%. . . . . . . . . FCC. . Trimethylamine solution. . . . 82 . . . . . . . . . . . cis-Jasmone. . . . . . . . . . . . . . . . mixture of isomers. . . . . . . .. . . ≥98%. .. . . . . . . . . . .. . . . . . . . . . . . . . . . . .. ≥97%. . . . FCC . .. Benzyl propionate. . . . . . . . . . . . . . . ≥98%. . . ≥92%. . . . . . . . . . . . . . . . . . . . . . . . . Indole. . . 2-Nonanone. . . . . . . . . . . . . . . FCC . . . FCC. ≥98%. . . . . . . . . . . .. . . . . . . . . . . . . . . . . . . . . . .4-Octadienal. . . . . . .. . . . . . . . . . . . . . . ≥97%. Phenylacetaldehyde dimethyl acetal. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . 128 jasmine W206105 W206504 W213500 W214000 W214108 W215007 W215015 W229806 W234702 W353205 W241601 W256900 W259306 W259802 W319600 W263818 W267104 W267112 W268208 W268216 W269018 W340804 W341002 W273309 W278300 W280607 W301912 α-Amylcinnamaldehyde. ≥98%. . . . . . 19 . Cinnamyl cinnamate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . Ethyl 2-trans-4-cis-decadienoate. . . 74 101 112 lavender W383902 W250910 W262218 W358207 W420201 . . . . . . Morocco origin . . . . . . . . . . . . . . . . .. . . . . . . .. . . . . .4-Nonadienal. . . . . . . . ≥97%. .. . . . . . . . . . . . . . . . . . 10 wt. . . . . 21 . . . . . . . . . . . . . . ≥97% . . . . . . . FCC. . . . . . . . . .. . . . . . . . . FCC . . . . . . . . . ≥98%. . . . . 64 . . FG . . . . . . . . . . . . . . . . . . . . . . . 58 . . . FCC . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . .. . .4-Dithiane. .. . . . . . . . . . . . . . . . . .. . . . . . . . . . . . . . . . . Nonyl acetate.

. . . 29 . . FCC trans-2. . . . . . . Benzyl benzoate. . . . . . . . . . . . . 8 . . . . 8 . . . . . ≥97%. . . . . . . . . . . . . . . . Citronellyl propionate. . . . . . . . . . . . FCC. . . . . . . . . . . . . Citronellol. . . . . . . . . . . . . . . . . . . . . 55 . . . . . . . . . . . . . . . . . . 128 Page violet W233609 W259403 W259500 W272507 W272604 W272906 W337706 W278009 W337900 W282928 W291102 W311006 Costus oil. . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . 55 . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . α-Terpineol. . . . . . . . . . . . . ≥98%. . . . . . . . . . . . n-Decyl acetate. FG . . . . . . . . . . Acetophenone. . . . natural . . . . . . . . . . . . . . . ≥98%. FCC. . . . . . . . . . . . . . Nonyl alcohol. . . . . . . . . . . . . . . . . . . Phenethyl isobutyrate. . . . . . . . . . . . . . . . ≥95%. . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . Phenethyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥92%. . . ≥98%. . ≥98%. . cis-3-Hexenal solution. . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . .3 wt. . . . . . . . . . . . . . Benzyl acetate. . . . . . . . . . . . . . . natural. . mixture of cis and trans. . . . . . . . . . . . . . . . . . . . . . . . Ethyl salicylate. . . . . .4′-Dimethoxyacetophenone. . . . . . . . Geranyl isovalerate.4-Hexadienal. . ≥98%. ≥98% . . . . . . . . . . . . . . . . . . . . . . . . Neryl acetate. . . . . . . . . . . . . . . . . . . 95 . . . . natural. . . . . . . . . . . . . . . ≥99%. . . . . . . . . 69 . . . . . . . . . . . . Hexyl propionate. .7-Dimethyl-1-octanol. . . . . FG . . . . 2′. . . . . . . . . . 97 . . . . . . . . . β-Ionone. . . . . . . . . . FG . . . . . . 98 . . . ≥90%. . . . . . . . . . . Furfuryl propionate. . . . . . . . Nonanal. FCC . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl nonanoate. . . . . . . . . . . . . . . . . . . . . . . Decanal. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl anthranilate. . . . . . Ethyl octanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . predominantly trans. . . . . . . . . . . . . Citronellyl propionate. . Benzylideneacetone. . . . . . . ≥95%. ≥97%. . .cis-6-Nonadienal. . . . . . . . . . . . . . . . . . . . ≥98%. . 23 . . . . . . . . . . . . . . . . . . . . . . . other W200204 W200220 W200905 W203300 W205001 W347108 W506400 W209902 W209910 W210102 W210218 W212806 W213500 W213519 W213802 W213810 W214019 W214205 W214507 W288101 W214115 W214906 W215104 W215600 W223204 W224111 W530358 W228818 W228826 W229318 W229601 W229806 W236209 W236217 W236306 W503800 W396605 W236608 W237701 W376302 W510424 W238708 W239208 W242209 W242217 W501301 W244104 W244112 W244902 W244910 W245801 W247804 W334618 W250406 W530382 W250902 W255408 W342904 W256102 W256501 W257605 W258504 W259306 W259500 W207802 W208418 W216305 Place an order with your local SAFC representative (see back for contacts). . . . . . . . Guaiac wood oil . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 30 . . . . . . . . Rhodinol. . . . . ≥98% . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 29 . . . . . ≥96% . trans. . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Citronellyl valerate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl isovalerate. . . . . . . . . . . Anisyl formate. . . . . . . . . . . . . . FG . . . . Methyl p-tert-butylphenylacetate. . . . . . . Geranyl acetate. . . . . . . . . . . . . . . . . . . . . . . β-Ionone. . . . . . . . . . . . . . . . . . . Ethyl benzoate. . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl acetate. natural. . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . .4′-Dimethylacetophenone. Violet leaf absolute . . . . . 34 . . . . . . ≥99%. . . . . . . . .10-Dimethyl-5. . FG . . . . Geranyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . ≥95% . ≥98% . . . . . . trans-2-Nonen-1-ol. Hydroxycitronellal dimethyl acetal. . . FCC . . . . . . . FCC. . . . . . . . . . FCC . . . . . . FCC . . . . 55 . . . . . . . Acetal. . . . . . . . FCC. . . . . . . . . . . . . . . . . Geranic acid. . . . .SAFC® Flavors & Fragrances Organoleptic properties index floral: lilac Cat No. . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl trans-2-nonenoate. . ≥95% . . . . . . . . . . . . . . . . . FCC . Geranyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥96%. . FCC. 33 . . . . . . FG . . . . . . . Genet absolute. . . . . . . . . . . . . . . . . . . . 56 . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . Orris concrete . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥94%. . . . . . . . . . . . . . FCC . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . Chamomile absolute. . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl hexanoate. . . . . . . . . . . . . . . . 84 . . . . . Neryl isobutyrate. . . . . . . . . . . . . Decanal dimethyl acetal. . . . . . . . FCC . . . . . . . . . . . . . . . . ≥98% . . . . . . Citronellyl isobutyrate. . . . . . . . . . . . . . . . . . . . . (−)-Ambroxide. . . . . FCC. . . . . . . . . . . . . . natural. . ≥98% . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . 3-Octyl acetate. . . . . . . Ethyl phenylacetate. . . . . . . . . . . FCC . . . . . . . . FG 1-Decanol. . . . . . . . FCC. . FCC. . . . . . . . . . . . . Damascenone. . . . 29 . . . . . . . . . . . . predominantly trans. . . . . Dihydrojasmone. . . . . . . . . . . . . . . . . . . . . . . . . Benzaldehyde dimethyl acetal. . . . . . ≥99% . FCC . . . . . . 97 121 121 lily W206105 W256900 W258318 α-Amylcinnamaldehyde. . . . . . . . . . . . . . . . 60 . ≥98%. . . . . . . . . . . . . Name W309311 W309508 2-Undecanone. FCC. . . . . . . . . . . 68 . . . . . . . . . . . . . . . 99%. . . . Cinnamyl cinnamate. . . . . . . . . . . 3′. . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . Ambrette seed absolute. . . Benzyl formate. 97 . . . . . . . . . . . . . . . . . . . . . . . Hexyl acetate. . . . . . . . . . 67 . FCC. . . . . . Anisyl alcohol. . . . Anisyl alcohol. . . 85% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl laurate. . . 99% . Benzyl salicylate. . . . . . . . ≥95% . . . . . . . . . . . FG. . . . . . . . . . Allyl-α-ionone. . . . . . 30 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . predominantly trans. 3. . . . . . . . . . . . . . . . Cardamom oil. . . . . . . . . . . . . . Rose absolute. . ≥95% . . 55 . . . . 55 . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . ≥98% . . . . . . . . . . . Ethyl laurate. . . . 99 102 102 102 106 106 106 106 106 107 107 107 107 107 107 107 108 108 108 108 110 117 117 117 127 Cat No. . . 13 α-Hexylcinnamaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥92%. . . . . . . . . . . . . . . . . . . . 22 rose W220906 W229806 W230200 W230707 W230901 W231118 W231401 W231304 W231606 W231614 W500607 W231703 W342017 W236500 W236705 W239100 W354201 W315109 W245208 W250406 W412101 W250708 W250716 W250902 W250910 W251208 W251402 W251801 W251607 W251704 W251712 W253405 W259500 W218502 W247006 W295604 W261602 W269018 W425301 W277207 W277304 W277509 W278203 W278904 W358304 W280909 W281409 W285706 W285714 W285803 W285811 W285900 W286001 W286400 W322105 W286206 W287105 W286605 W286702 W286818 W287008 W287318 W287814 W288918 W298018 W298816 W523704 W309206 154 Butyl phenylacetate. . . . . . . . . . FG . . . . FCC. FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . 3-Phenylpropionic acid. . . . . ≥96% . . . . . . . . . . . . . . . . ≥99% . . . . . . FCC. . . . FCC. . . . . FCC . . . 29 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . Nerolidol. . . . Geranyl formate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . Isobornyl propionate. . . . . . . . . . . . ≥99%. . . . . . . . . . . α. . ≥96% . . . . . . Ethyl octanoate. . . . . . . . . Methyl 2-octynoate. . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . Benzyl phenylacetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural (US). . . . . . . . . . . . . . . . ≥98%. . . ≥97%. . . α-Ionone. . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . (±)-Citronellal. . . Isoeugenyl acetate. . . . . . . . . . FCC . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . FG . ≥99%. . . . . . . FG . . . . . . . . . . . . . ≥95% . . . . . . . . . . . . . 1. . . Octyl isovalerate. . . FCC . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . 97 . . . . . .Turkish . . . . . . . . . . . . . . . . . . . . . . . . Citronellyl acetate. ≥98%. . FG . . 55 . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . 55 . Isobutyl benzoate. . . . . . . . . . . . . ≥99%. . . . . . . . . . .cis-6-Nonadien-1-ol. . . natural . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-Cinnamyl butyrate. . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Moroccan . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . ≥98%. . . . . 3-Decanone. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Citronellyl formate. . . . . . . . . . . . . . . . . . . . . . . . mixture of isoamyl and 2-methylbutyl salicylates. . . FCC . . Citronellyl tiglate. . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . natural. . . . . . . . . . . . . . . Benzyl butyrate. . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . 1-Hexadecanol. . . . . . . trans-2-Decenal. . . . . ≥97% . . . . Phenethyl acetate. Benzyl acetate. . . . . . . ≥99%. . . . . . FCC . . 66 . ≥95%. . . . . . . . . . FG . . ≥99% . . . . . . . . . . . . . . . . . Lauryl acetate. . . . . . Phenethyl phenylacetate. . . . FCC. . . . . . . . . . . . . . . FG . ≥96%. . . . . . . . Geranyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . FCC. . . . . . . ≥98%. . . . . FG. . . . . . . natural. FG . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . ≥90%. . . . . . . . . . . . . . . . . . . . . . . FCC . Geranyl phenylacetate. . . . . . FCC . . FG . . . . . . . . . . .trans-2. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥92% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . 99 103 112 130 Acetal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . FCC . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . 90 . . . . . . . . . . . ≥99%. . . . Rose oil. . . FCC. . . . . . . FCC . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . FG. . . . . . . . . Canaga oil . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural . . . . . . . . . . . . FG . . . . . . Geranyl propionate. . . . . . . Phenethyl alcohol. . . . . . . . natural .α-Dimethylphenethyl acetate. . . . . . . . . . . . . . . . . . . . . . . Ethyl 2-furoate. . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . 73 . . . . . . . β-Ionone. . Diethyl succinate. . . . . Phenethyl salicylate. . . . . . . . . . . . . trans-Cinnamic acid. .1-1. . . . . . . . . . . . . . . . . . . Geranyl butyrate. . . . . . . . . . . Phenethyl tiglate. . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . FCC. . . . 50% in triacetin. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . 90 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65 marigold W219908 Butyl heptanoate. . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . Octyl formate. . . . . . . . . . . . ≥85% . . . . . . . . . . . . . . . . Geranium extract. . . FCC. . . . . . . . . . . . . . . . . 30 . . natural (US) . . . . . . . . . . . . . . . . . . . . . . . Name Page lilac W209805 W256102 W277509 W304506 W304522 Anisyl acetate. . . . . . . . . . . 57 . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . Piperonal. . Ethyl benzoate. . . . . % (190 proof ethanol). ≥96% . . . . . . . . . . . ≥90%. . . . . . . . Cinnamyl acetate. . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . 6. . 15 . Bois de rose . . . . . . . ≥98%. . Methyl 2-nonynoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Anisyl propionate. ≥98%. . . . Benzyl isobutyrate. FCC . . . . . . . ≥99%. . . . . trans-Cinnamyl isovalerate. . . . . ≥98%. ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . 29 . FCC. . . . . . . . . . . . . . natural. . . . . . . 98 . . ≥96%. . . ≥65% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 . . mixture of isomers. . . . . . . . . ≥97%. . . Benzyl benzoate. . . . . . . . natural. ≥95%. . . . . . . . . . . . . α-Terpineol. . . natural. . . . . . . . . natural (US). . . . . . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . trans-2. . . . . . . . . . Isopropyl phenylacetate. . . ≥98% . . . ≥97%. . . . 56 . 55 . . . Phenethyl formate. . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . 56 . . . . . . . . . . . . . . . . ≥98%. . . . . . . Farnesol. . . . . . . . . . . . . . . . mixture of cis and trans. trans-Cinnamic acid. . . . . . . . . . . . . . . . . . . . . 29 . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥80%. . . . FG . . . . . . . . . . . ≥99%. . natural. . . . . . . . . . . . . . . 28 . FCC . . . . . . . . . Genet absolute. . . FG . Geraniol. . . . . . . . . . . .9-undecadien-2-one. . . . . . . 46 . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Phenoxyethyl isobutyrate. . . . . . . . . . . . . . . . . . . . ≥99%. ≥95%. . . . . . . . . . . . . . . . . . . . . . . 67 . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . Undecanal. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 71 . . . . . . . ≥97%. . . . . Decanal. FCC. . . . . . . FG . . . . . FCC. . . . . . . . . cis-3-Hexenal solution. FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . 74 . . . . . . . . . . . . . . . . . . . . . . . 40 . . . . . . . FCC . . . . . . . . . . . . . . . . . . 3-Decanone. FCC . . . . . . . . . 30 . . . . . . . . . . . . . . . . Methyl 10-undecenoate. 49 . . . . . ≥80% . 69 . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . ≥97% . . . . . . . natural . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Benzyl cinnamate. . . . . . . . . . . . . . . . . 90 . . . . . . . . . FCC. . 50% in triacetin. . . . . . . . . . . . . . . . . . natural. ≥99%. . . . . . . . . . . . . natural . . . . . . . . . . . . . . . . . . . 8 11 12 12 14 15 15 15 15 16 17 17 17 17 17 18 18 18 18 18 19 20 24 25 27 27 27 28 28 28 33 33 33 33 33 33 35 35 36 37 39 43 43 45 47 47 49 49 50 52 54 55 55 55 59 59 60 63 64 65 66 67 68 . . . . . . . . ≥98%. . . . . . . . . . . . FG . . ≥99%. . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . ≥95%. . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . ≥92%. . . . . . ≥95% . o-Anisaldehyde. . . . . . . . . . . FCC. . . . . . . . FG . . . . . . . . 28 . . . . . . . . . . natural. . . . . . . ≥99%. . . . ≥96%. ≥99% . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . ≥97%. . . . . . ≥96%. . . Phenylacetic acid. . . . . . . . . . . . . . . . . . . . Phenethyl alcohol. natural. . . . . . . . . . . . . . . . . . . . . . . . . 32 . . . . . . . . Phenethyl benzoate. . Indole. . . . . . . . . . . . . Neryl isobutyrate. ≥90% . . . 96% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . natural. 2-Ethyl-1-hexanol. . . . . . . . . . . . . . ≥98%. . . . 128 10-Undecenal. . . . . mixture of isomers. natural. . . . . . . . . 56 . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of L-citronellol and geraniol. . . . . . . . . . ≥97% . . . . . 64 Hydroxycitronellal. . . . . . . FCC . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . Isoamyl salicylate. . . . . . . . . . Geraniol. . . . . . . . . . . Cinnamyl cinnamate. . . . . .

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . 76 . extra . . Ethyl levulinate. Beeswax absolute breche . . . . . . FCC . . . . . . . . . 76 . . . . . . natural . . . . . . ≥98%. . . . . . . . . mixture of cis and trans. Phenylacetaldehyde. . . . . . . . . . ≥95% . . . . . . ≥98% . . . . . . . . . . . . . natural. . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Geranyl butyrate. ≥99%. . . . . . . . . . . . . . 79 . . . . . . . . . . . . . . . Linalyl isovalerate. 88 . Ethyl 2-trans-4-cis-decadienoate. . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . ≥80% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . FCC. . mixture of cis and trans. . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . Phytol. . . . . ≥98%. mixture of cis and trans. . . . . . . . Spike lavender oil . . . ≥97% . . . . . . . . . . . . . . . . . . FG. . . . ≥90%. . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . ≥98%. . . . . . . . . . . . . . ≥98%. . . . . Ethyl hexanoate. . . . . . . mixture of isomers. . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl hexanoate. . . . 2-Methyl-3-(p-isopropylphenyl)propionaldehyde. . . . . Cyclohexyl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Terpinyl formate. . ≥98%. . . . . . . . . . . . . . . . . . . . . . 97 . . . . ≥98%. . . . . . . . . . . . . . ≥98%. . . . . . . . Piperidine. . . . . . . . . FG . . . . . . . . . . . . . . . FG . . . . . . . . . Butyl isobutyrate. . . . . . . . . . . . . . . FCC . . . 84 . . . . . . .4-methylenedioxyphenyl)-propanal . . . . . . 4-Isopropylbenzyl alcohol. . . . . . . cis-3-Hexenal solution. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . Isoamyl propionate. . . . . . 98 102 105 105 106 108 108 112 113 113 114 121 130 155 . . . . . . . . . ≥97% . . . . . . . . . . . . . . Feel inspired at safcglobal. . . . . . . . . . . . . . . . ≥97%. . . . . . . . ≥98% . . . . . . . natural. . . . . . . Geranyl butyrate. . . . . FCC . . . .4-Hexadien-1-ol. . . ≥95% . . . . . . . . . .trans-2. . Heptyl formate. . . . . . . . . . FG . . . . . Jasmin extract. . . . . . . . Butyraldehyde. Neryl acetate. 69 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 96 . . . . . . . . . . 97 . . . . ≥97%. . . . . . . . . . 89 . . . Propionaldehyde. . Hexyl 3-methylbutanoate. . . . . . . . . . . . . . . . . . . . . . Neroli extract. . . . . . . . . . . . . . . . . . . . FCC. . . . . . . 2-Methylbutyl 2-methylbutyrate. . . . . . . . . . . . . . . . FG . . . . . ≥98%. . . . . ≥98%. . . . . . . . . . . . . % (190 proof ethanol). . . . FCC . . . . FCC. . . FCC . . . . . . . . . . . . 3-Methylbutyl 2-methylbutanoate. . . . . 97 . . . . . . . . . . . . . 3-Octyl acetate. . . α-Isobutylphenethyl alcohol. . . . (±)-2-Methylbutyric acid. . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . 2-Methylanisole. . . . . . . . . . . . . . . . . . . . ≥96% . . . . ≥97%. . . . . . . . . Phenylacetic acid. . . . 2-Octanone. . . . . . natural. Benzyl isovalerate. . . . . ≥99% . . . Ethyl isovalerate. . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . Methyl butyrate. . . . . . . . . ≥97% . . . . . 89 . . . . . . . . . . FG. ≥99% . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . cis-3-Hexenyl 2-methylbutanoate. . . . . FCC . 74 . . . . . . . . . . . . . . . . . . Methyl anthranilate. . . . . . . . . . . . . . . . . . . . . . . . . . 3-Propylidenephthalide. ≥98%. . . . . . . . . . 75 . . . . 70 . ≥98%. . . . . . . . . . . . . . . trans-p-Methoxycinnamaldehyde. . . . ≥99%. . . . . . . . . . . . . . . . . . 97 . . 84 . . Phenethyl alcohol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . ≥98%. . . . . . . . 98 . . . . FCC . . natural. 82 . 2-Nonanone. . . . . . . . . . . . . . . . FG . FCC . . . . . Isoamyl hexanoate. . . . . . natural. . . . . . . . . . . . . Ylang-ylang oil. . . . . . . . . . 2-Pentanone. . . . . . FCC. . . Diethyl succinate. . . . . . . . . . . . FCC. . 2-Isobutyl-4-methyl-1. . . . 80 . . . . natural. . . . . . . . . . . ≥97%. . . 97 . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 . . . . . . . . . . . . . ≥90%. . . 84 . . . 50% in triacetin. . . . . . . . . . . . . Isobutyl acetate. . . . . ≥98%. . . . ≥99%. . . . . . . . . . . Name Page Cat No. Acetone. . . ≥98%. . . . . . . . . . . . . . ≥98%. . . . . . . . . . 3-Phenyl-1-propanol. . 82 . . . . . . . . . . . . . . . . . . . . 97 . ≥98% . . . . . . FG . . . . . . . . . . . . L-Linalool. . . . . . Isoamyl propionate. . . . . . FCC . . . . 8 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Piperonal. . . . . . . Phenethyl acetate. . . . . . . . Lauric aldehyde. . . . . . . . . . . . . . . . . . . . . . Phenylacetaldehyde solution. cis-3-Hexenyl 3-methylbutanoate. . . . . . . . . . . . . . ≥98%. . . . Isoamyl isovalerate. . . . . . . ≥85%. . . . . . . . . . . . . . . Isobutyl hexanoate. . . . . . . . . . . . . ≥98. . . . . . . . . . . . . . . . . . FCC . . . . . ≥97%. . . . Allyl isovalerate. 2-Methylbutyl isovalerate. . . ≥97% . . . Phenethyl 2-methylbutyrate. . . . . . Hexyl acetate. . . . . . . . . . . . . . . . . Phenethyl formate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥95%. . . . Genet absolute. . . . . . . natural (US). Neryl isobutyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . Phenethyl butyrate. . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . ≥98%. . 1-Phenyl-1-propanol. . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . ≥96% . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . natural. . . . . . . . . . . . trans-2-Hexen-1-al. . . . . . . . Vanillin acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural . . . . . . . . . Methyl β-naphthyl ketone. . 2. . 2-Methoxy-4-propylphenol. . . . . . . . . mixture of isomers . . FCC. . Nerolidol. . Methyl propionate. . . . . . natural. . 71 . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . FG . . . . ≥95%. . . . . . . . . . . . . . . . . Benzyl propionate. . . . FCC. . . . . . . . Nonanal. . . mixture of isomers. . . . . . . . . . . . . . ≥99%. . . . . . . . III . . . . . . . . . . . . 70 . . . . . . . . . . . . . . . . 2-Phenylpropionaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Hexenyl butyrate. . . . . ≥90% . FCC. . . . . . . . . Geraniol. . . . . . . . FCC. . . Geranyl isovalerate. . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . Ylang-ylang oil. . . . . . . . . . . . ≥97%. . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . ≥99%. . Phenethyl octanoate. cis-3-Hexenyl isobutyrate. . . natural. . . . . . . . . . . . . . . . . . . FG . . . . FG . ≥97% . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . 2-Methylbutyl 2-methylbutyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC Isoamyl hexanoate. . . . . . . . . . . . . . . . . . . . Phenylacetaldehyde solution. . . . . FG. natural. trans-2-Pentenal. natural. . . Name W218502 W220841 W221201 W369802 W293318 W260000 W261505 W261513 W512850 W263508 W263516 W263605 W263613 W318108 W356700 W267201 W359807 W268003 W268208 W268216 W335916 W269409 W274305 W523909 W272302 W275506 W530412 W525308 W277304 W277401 W277509 W321206 W278505 W280011 W280208 W358315 W285714 W285811 W286109 W286400 W363200 W322202 W286605 W287415 W287806 W287814 W322407 W288306 W288403 W288500 W288608 W289000 W289205 W289701 W502200 W290807 W291102 W295205 W406503 W303305 W305200 W306401 W306509 W310808 W311901 W311936 Isobutyl benzoate. . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . % in ethanol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Butyl isovalerate. . . . . . . . 2-Methylbutyric acid. . . . . . . . 2-Phenyl-2-butenal. . . . . . . ≥98% . . trans-2-Hexen-1-al. . . . . . . . . . . . . . . . . . . . . . cis-3-Hexenyl hexanoate. . . ≥99%. . . ≥98% . . . . . . . . . . . . ≥98% . . . 2-Methylbutyl isovalerate. . . . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . FG . . . . .4-Nonadienal. . . . . . . . FCC . . . . natural. . . . . . . . . . . . . . Isobutyl propionate. Ethyl 2-trans-4-cis-decadienoate. . mixture of isomers. . . . . . . . . . . . . . ≥98% . . . . . . . . . . FCC . . . . . . . . . . . . . . . 3-Phenylpropyl acetate. . . ≥95%. . . . . . . . . FCC . . . . . . . . . . . . . . . . . . Propyl butyrate. . . . . . . . . . . . . Allyl propionate. ≥99% . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. ≥98%. . . . . . . .Organoleptic properties index floral: other Cat No. . 79 . . . . . . . . . . . . . . . . . . . . . 84 . . . . . . . natural. . . . . 1-Phenyl-3-methyl-3-pentanol. . . . . . trans-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Nerolin Yara Yara. . . . . . ≥98%. 84 . . . . . . . . FCC . . . . . ≥98%. . . . . . . . mixture of isomers. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . FCC . . . . . ≥99%. . . . . . . . . . . . . . . . . Methyl butyrate. . . . . . . . . . . ≥96%. . . ≥99%. . . . . . . .com . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . FG . . FCC. . . . . . . . . . ≥98%. . trans-2-Hexen-1-ol. . . . . . . . . . . . . . . . . . . . . ≥99%. . . FCC. . FCC. . . . . . . . . FCC. . . . . . . . . . . . . . . . ≥98%. . Thyme oil. . FG. . . . . . . . . . . . . . . . . . . . . . . . FCC 2-Methyl-3-(3. . . . . . . . . ≥97%. ≥95%. . . . . . . . . . . . . . . . . . . . . Ylang-ylang oil. . . . . . . . . ≥97%. . . . . . trans. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Farnesene. 73 . . . . . . . . . . FG . . . . . Mimosa absolute Moroccan . . . .trans-2. . . . . . . . . . . . . . . . ≥97%. . . 10 wt. natural. . . . . . . . . . . . . . . . . . . . . . . FG . . . ≥98%. . . . . . . . . . FG . . FCC. . . . . . . . . . . . . . FCC. . . . . . . . . . . FCC. . . Methyl isovalerate. . . . . Isoamyl isovalerate. . . . . . . . . . ≥99%. . . . . . . Thyme oil. . . . . . . . . . . . . . . . FG. . . . . . . ≥80% . . . ≥99% . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . ≥99% . . . . . . . . natural. . . . . . . . .9-undecadien-2-one. . ≥98%. . ≥98%. . . . . . . . . . . . . natural. . 80% isoamyl butyrate basis. . . . . . . . . . . ≥98%. . . Phenethyl acetate. . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . ≥98%. . . ≥97%. . . . . . FCC . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . ≥98%. . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥90% . . . . . . . . . . ≥97% . . . . . . . . ≥98%. ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . o-Methoxycinnamaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . Ethyl 2-methylbutyrate. . .1-1. . . . . . . . . FCC . . . 98 100 100 102 106 106 107 107 107 107 107 108 108 108 109 109 109 110 110 110 110 110 111 112 112 114 116 119 122 124 124 129 130 130 W342017 W237701 W354201 W314803 W314811 W243906 W243914 W246301 W246328 W244201 W244309 W245208 W246204 W383902 W250406 W250708 W251208 W251216 W251801 W254304 W254606 W316504 W254800 W255203 W392200 W256005 W256110 W256102 W392405 W256218 W256404 W392618 W340308 W392901 W349704 W349801 W256501 W350001 W257605 W206016 W207500 W207519 W208507 W208515 W208000 W208205 W208213 W217506 W217514 W220205 W220213 W428600 W247707 W264601 W267511 W268402 W350605 W350613 W350516 Acetone. . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Methoxy-4-vinylphenol. ≥98%. ≥80%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenylacetic acid. . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . ≥98% . . . . . . . ≥98% . . . . . . . ≥95%. . . . . 88 . . . . . . . . . . . . . . . . . ≥98%. . FCC. . . natural . . . . . . . . . . . . . Damascenone. . . . . . . . . . . . Lavender oil synthetic . . Isobutyl acetate. .3-Heptanedione. . . . . . . . . . ≥95% . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . 32 35 40 44 44 45 45 47 47 47 47 49 51 52 55 55 55 55 56 57 58 58 58 59 59 60 60 60 61 61 62 62 62 62 63 63 63 64 64 67 67 67 68 68 68 68 68 69 69 70 70 70 71 76 81 82 83 83 . . . . . . . . . . . . . . Benzyl acetate. Ethyl valerate. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . Neryl acetate. . . . . . . . . . . . . . FCC. . . . . . . . . . . . . 84 . . . ≥97% . . . . . . . . natural . . ≥97%. . . . . . . . . . .cis-6-Nonadienyl acetate. . . ≥99%. . . . . . . . . . . . fruity apple W332607 W332615 W204501 W204005 W212628 W213500 W215201 W215007 W218618 W219908 W218804 W221805 W221708 W221902 W235105 . . . . . . FG . . FG . . . . . . . . . . . . . FCC. . Neryl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. FG Butyl valerate. . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1-Propanol. . . . . . . Isoeugenyl phenylacetate. . . . . . ≥97% . . . . . . . . . . . . . . . 81 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 10 wt. Methyl anthranilate. . . . . . . . . . FG. . 70% 3-methylbutyl 2-methylbutanoate basis . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . % in ethanol. . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . III . . . . white. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . FCC. . . . . . . . . . . . . . . . ≥98%. . . . . FG . . . . . . . . . . . . . .10-Dimethyl-5. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . FCC. . FCC. . . . . . . . . . . . . . . . . . . . FCC. ≥98% . . . . . . . . . FG . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . Linalool. . . . . . . . . . . . 1-Octanol. . . . ≥98%. . . . . . . . . cis-2-Hexen-1-ol. . . . . . . 2-Phenylpropyl isobutyrate. 8 11 12 16 17 18 18 22 22 22 23 23 24 31 W335908 W335916 W269301 W269328 W269506 W269514 W275301 W271918 W274208 W277207 W277304 W395218 W278203 W358304 W284203 W321818 W285706 W287407 W287415 W420201 W292818 W292303 W293407 W304905 W311901 Page . . . . . . . . . . . . Isobutyl hexanoate. . . . . . 2-Propylpyridine. . . . . . . Terpinyl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . Butyl butyrate. FCC. . . . . . Heptyl alcohol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . . . . . FCC . . . . . 81 . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . Ethyl phenylacetate. . . . . . . 4-Heptanone. . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . 74 . . FG . . . . . . . . . . ≥96%. . . . . . . . . . ≥98%. . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . Butyl heptanoate. . . . 3-Octyl acetate. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . natural. . . . .3 wt. . . . . . FCC. . . . . . . . . . . . . . . . . . . . ≥96% . . . . . . . . . . . Lauric aldehyde. . . . . . . . . . natural. . FCC . . . . . . . . . . . . . .3-dioxolane. . . . . . . . . . 4-(4-Methoxyphenyl)-2-butanone. . . . . . . . . . . . . . . FG . . . α-Methylbenzyl acetate. . . . . ≥98%. . . . . . . . . . Linalyl acetate. . 97 . . . Hexyl propionate. . Phenethyl phenylacetate. . . . . . . . . . FCC. . . . . . Methyl isobutyrate. . . . . . . . FG . . . . . . . . . 1. . . . . . . Linalyl acetate. . . . . . FCC. . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . . . 88 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . 71 . Prenyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl 2-methylbutyrate. . . . . . . . . 74 . . . . . . . . . . . . ≥90%. . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . Isoamyl butyrate. . . . . . . . . . . . . . >98% . . . red . . . . . . . . . . . . . . . . FG. . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . 92 . . . . ≥95%. . . . . . . . . . . . trans-2-Heptenal. . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . trans-2-Hexenyl acetate. . . . . . . natural. . . . . 2-Methylbutyl 2-methylbutyrate. . . . . . . . . . . trans-Isoeugenyl benzyl ether. . . . .5% . . . . Isoamyl octanoate. . . . . . . . trans. . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . natural. . 88 . . FCC . . . . . ≥98%. . . . . . . . . . 76 . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . 98% . . . . . . . . . FCC . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . 6. . . . . . . . . . . . . . . . . . . . . ≥85% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3-Phenylpropyl propionate. . . . . . . . . . . . . . . . natural (US). . . . . . . . . . . . . mixture of isomers. . . Ethyl isovalerate. . . . .

. . . 21 . . . . . . . . . . . . . . . . . . . . . . . . . . . . 45 . . Ethyl heptanoate. . . . . . . . . . . . . . . . . . Benzyl cinnamate. . . . 86 . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . Allyl propionate. . cis-3-Hexenyl acetate. ≥98%. . . . . ≥98%. . . . . . . . . . . . . ≥97% . FG . . ≥98%. . . . . . . . ≥97%. . . . . . . 17 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥89%. . . . . 38 cherry W204501 W205915 W267007 W209805 W212709 W212717 W213500 W213705 W213802 W214205 Allyl isovalerate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Propionaldehyde. . . . . . . . . . 96 . ≥98%. . . ≥96% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Methylbutyric acid. . . . . . . . . . . . . . . . . . FCC Isophorone. . . . Cyclohexyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 80% isoamyl butyrate basis. . . . 71 . natural. . . . . . . . . . . . FG . . . . . 18 . . . . . . . . . . . . . . Benzyl cinnamate. . . . . . . . . . . . . . . . FG . . . . (1R)-(−)-Myrtenal. . . . . . . . . . . . . . . . banana W203106 W203718 W504009 W205915 W215007 W217409 W218618 W218804 W221104 W235407 W505005 W242209 W242500 W242705 W242713 W243906 W243914 W348902 W244910 W249009 W249017 W354708 W254401 W254606 W360805 W256218 W256404 W317101 W393118 W205508 W205532 W206008 W206016 W208515 W208205 W217506 W217514 W222003 W292605 W263907 156 11 11 13 13 18 21 22 22 23 32 34 43 44 44 44 45 45 48 49 53 53 58 58 58 61 61 62 62 63 67 67 67 67 68 68 69 69 70 71 76 Cat No. . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl 3-oxohexanoate. . . . . . . . . . . . . . Benzyl acetate. . . . 2. . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . ≥98%. . Ethyl octanoate. . . . . . . . . . . . . . . . ≥98% . . . . ≥97%. . . . . . . . . ≥97% . . . . . . . . . cis-3-Hexenyl tiglate. . . . . Ethyl butyrate. . . . . . . . . . . . . . FCC. . . . . . . . . Isoamyl propionate. . . . . . . . . . . ≥97%. . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . ≥97% . . . FCC. . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . δ-Nonalactone. . . . . Propyl formate. . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . FCC . ≥98%. . . . . . . . . . . . . Genet absolute. . . . . . . . . . Myrtenol. . . . . . . . . . Benzyl alcohol. . . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . 29 . . Amyl butyrate. ≥98%. . . . . . . . . . . . . . . . . . . . ≥99% . . . . . 17 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . ≥99% . . . . .SAFC® Flavors & Fragrances Organoleptic properties index fruity: apricot Cat No. . . . . . . . . . . Ethyl hexanoate. . . . . FCC . . . . . . . . . . . . . . . . 2-Methoxy-4-propylphenol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2-Phenylpropyl butyrate. . . . . . ≥99%. . . 70% isoamyl acetate basis. . . . . . . . . . . . . ≥96% . . . . . . . . . . . . . . . FG . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . 11 13 14 15 16 16 17 17 17 18 . . . . . . . . . . . . . . . . Hexyl butyrate. . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl butyrate. ≥98%. . ≥97%. FCC. . . . . 67 . 2-Ethylbutyl acetate. . . . . . . trans-2-Hexenyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Piperonal. . FCC . . . . . . . . . . . . Italian. 84 . . . FCC. . FCC. . . . . . . . FCC . . . Methyl 10-undecenoate. . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . FCC. . . 28 . . . . . . . . . . . ≥90%. . . . . . . . . . . . . . . . . . . . 49 . . . α-Methylbenzyl acetate. . . ≥98%. . . . Dicyclohexyl disulfide. . . . . natural. . . . . . . . . . . . . . . . . . . Mandarin oil. . . . . . . 95 101 105 107 113 4-(p-Acetoxyphenyl)-2-butanone. FCC . . . . . . . . ≥94%. . . . . . . . . . . ≥98%. . . . . L-Menthyl acetate. . . . . . . . . . . . . FCC . . . . . 78 . . . . . . . . . . . . . . . . . Name Page apricot W202118 W203106 W204005 W212628 W213403 W213500 W214000 W214205 W214507 W231401 W236128 W237701 W242500 W383503 W244902 W245208 W247804 W250708 W251216 W254703 W254800 W256803 W257605 W206008 W350702 W350710 W208507 W208515 W207802 W208205 W359807 W268402 W269506 W269514 W247502 W277304 W335606 W282928 W285706 W286605 W287407 W289108 Allyl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . FCC Isoamyl isovalerate. . . . . . . . . . . . . . . . . . . . Ethyl benzoate. . . . 3-Heptanol. . . FCC . . . . . . . . . . . . . . . . . . 67 . . . . . ≥98% . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . 16 . 58 . . . . Benzaldehyde. . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . Butyl isobutyrate. . . . . . . . . . . . . . trans-3-Octen-2-one. . . FCC. . . FCC . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥96%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . Ethyl (methylthio)acetate. . . . . . . . . 45 . . . . . . . ≥98% . . . Butyl acetate. . . . . . FG. . . . . . . . natural . mixture of isomers. . . . . . 1-Hexen-3-ol. . . . . . . . . . . . . . . . . . . . . . . . . . . 19 . . . . . . . . . . . . . ≥99%. FG. . . . . . . . . . . . . . . . . . . . . ≥98%. . . ≥97%. . . . ≥98%. . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . FG . . . . . . . . . 35 . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . ≥97% . Isoamyl butyrate. . . . . . ≥98%. . . . . . . . . . . . . . . . . . 3-Octanone. . . . . . . . ≥96%. . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . 11 . . natural. . . . . ≥97% . . . . . . . . . . . . . 12 . . . . . natural. . . . . . . . . . ≥95%. . . . . . . . . . . . . . . FG. . . . . . . . ≥99%. ≥99%. . . ≥98%. . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . natural . . . . 57 . . . . . . . . . . FCC. . . . . FCC. . . . . . . . . . . . . . . . mixture of isomers. . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . 67 . . . . . . . . . . . . . . . . . . . . . . . . . . . . Phenethyl hexanoate. . . . . . . ≥99%. . . . . . . . . ≥98% . . . . . . . . . . . . . 68 . . . . FCC . ≥85%. . . . . . . . . . . . FCC. FG . . . . . . . . . . . . . Butyl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . 9 . FCC . . . . . . . . . . . ≥90%. FG . . ≥98% . . . . . . . FCC. . Juniper berry oil. . . . 10 wt. . . . ≥98%. . ≥98%. . . . . . . . . . . FG . . . . . . . . Butyl propionate . . . . . . 11 . Diethyl maleate. . p-Mentha-8-thiol-3-one. . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Styrax. . . . . . mixture of cis and trans. . . . . . .5%. FG . . . . . . . . . . . . . . . . . FCC. . . . . . . FCC . FCC. . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . FG . Methyl propionate. . . . . . . . . . . . . . . . . ≥97%. . . . 67 . . . . ≥98%. . . . . FCC . . . 52 . . . . . . . . . . . . . . natural. . . . . . . ≥98%. Benzyl alcohol. . . . . ≥95%. . . . . FCC. . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . 2-Heptanone. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . Heptyl alcohol. . . Isoamyl propionate. . . . . FCC. 81 . . . . . 68 . . . . . Allyl heptanoate. . . . . . . . . . FCC. . . . . . . . . . . . 55 . β-Ionone. FCC. . . . 89 . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Geranyl butyrate. . . . . . . . . FCC . . . . . . . . . . . . ≥98%. . . . ≥98%. ≥97% . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . 2-Ethylbutyl acetate. . L-Menthone. . . . . . . . . FG . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . α-Terpinene. . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . Butyl butyrate. . . . . . . . . . . . . . . . . . FCC. natural. . Benzophenone. . . . . . . . . . . . . Benzyl butyrate. . . . . . . . . . . . . . . . . . . . . . . . . 86 . . . . . . . FCC . . . . . . . . . . . . . . . . . . Farnesol. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl isobutyrate. . . . . . . . . . . . FCC . . . . FCC. . . . . mixture of isomers. . . . . . . ≥95% . 17 . . . . . Page . . . . . . . . . . . . . . ≥98%. . 2-Methylbutyl acetate. . . . . . . . . . Isoamyl nonanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Isoamyl acetate. . . . . . . DL-Menthyl acetate. . . . . . . . . . . . . . . . . . . . . . . Allyl octanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54 . . . . . Phenylacetaldehyde. . . . . . . . . Geranyl isovalerate. . . . . . . . . . . Ethyl benzoate. . . . . . . . . . . . . . . . . . . . . . Citronellyl formate. . . . . . . . . . . . . . . . . . ≥97%. . FG . . . . FCC . . . . . . . . . . . . Benzaldehyde. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . ≥98%. . . FG. . . . 77 . . . . . . . . FG . . . . . . . . . . 2-Pentanone. . . . . . . . . . . . . . 4-Heptanone. . . . . . . . . . . . . . . . . . . . . . . . . 97 . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . ≥98%. . . . . ≥99%. . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Place an order with your local SAFC representative (see back for contacts). natural. . Isoamyl isobutyrate. . . . Name W364401 W364428 W247502 W274208 W425301 W280305 W284203 W322105 W292303 2-Methylbutyl acetate. . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . FCC. . . . . . . . . . . . . . . 28 cantaloupe W238902 2. Diethyl succinate. . . . . . . . . . . . . . . . p-Anisaldehyde. . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . Isoamyl butyrate. . . . . 77 . . . . . . . . . . . Ethyl octanoate. FCC . . . . 56 . . . . . . . . . . . . . Anisyl acetate. . . . . . . . . . . . . . ≥98%. . . . . Theaspirane. . . . . . . . . . . . . . . . . . . Methyl 2-furoate. . FG . . . . ≥98%. . . . . FCC. . . . . . . . . . FCC. . . . . . . . Methyl eugenol. . . . . . 78 . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . Furfuryl acetate. . . 11 . . . . . . . . . . 34 . . . . . . . . . . . . . . . . . . . 26 . . . . . . 91 . . . . . . . . . . . . . . . . 55 . . . . ≥97%. . . FCC . . . . . . . . . ≥98%. . . . ≥98% . . . . . . . . FCC. FCC. . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . ≥98%. . . . . . . . . . . FG . . . . . . . . . . . . . . . . Orris concrete . . . . . . . . . . . . . . . . Ethyl phenylacetate. . FCC. . . . . ≥99%. . . . FCC . . . . . . . . . 58 . . . . . Benzyl acetate. . . natural. . . . . . . . . . . . . . 18 . . . FG . Benzyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 84 . . . . . . . . . . . . . FCC. . . Piperonyl isobutyrate. . . . . . . 83 . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . FCC. δ-Decalactone. . 22 . . . . natural. . FG . . . . . FCC. . . . . . . . ≥95% . . . . . . . . . . Heptyl acetate. . ≥98%. . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . 17 . . . . . . ≥98% . . 80% isoamyl butyrate basis. Orris concrete . . . . . . . . . . . . . . . 96% . . . . . 49 . . ≥98%. . . . . . . . . . . . . . . . . . . . ≥98% . . . . . 2-Ethylfenchol. . . . . . . . . . . . . . . . 96 . Methyl heptanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . ≥97. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . predominantly trans. . . . . . . . . . . . . . . α-Ionone. . . . . . . . . . . . . . . Isoamyl isovalerate. FG. . ≥98%. . . . . trans-2-Hexen-1-ol. . . . . . . . . FG. . . . ≥95% . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . Geraniol. . . . . 63 . . . . . . . . . . . . . . . . . FG . Furfuryl acetate. . . . . . . . . . . . . . . . . . . . . . . 83 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . 98%. . . . . . . . . natural. . . . ≥98%. . FCC. . . . 99% . Methyl β-naphthyl ketone. . . . . ≥99%. . . . . . . . . . . FG . . Ethyl hexanoate. . . . . . . . . . . . Benzyl benzoate. . . . . . . . . FG . . . . . . . . . . Isoamyl butyrate. . ≥94%. . . 44 . Isopropyl acetate. . 12 . . . . . . FCC . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . FG . . . . . . . . . . 33 . . . FCC . . . . . . . . . . . . . . . . . 82 . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . mixture of isomers. . . . . . . . . . . . . . . Amyl butyrate. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . Hexyl propionate. . . . . . . Benzyl propionate. 85 . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . 78 . . . . . . . . . . . . . . FG. . . . . . FG . . Allyl heptanoate. . FCC. . . . . . . . FCC . . . . . . . . . . . . . FCC . . . . FCC. . . . . . . . . . . . . . . . . FCC . . . . . . . . . 55 . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . FG . 43 . . . 66 . . . . . . . . . . . . FG. . ≥99%. . FCC . . . . . . . Benzyl butyrate. . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . Butan-3-one-2-yl butanoate. . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . % in ethanol. . ≥94% . . . Trithioacetone. . . . . . . ≥99% . . FCC . FG . . . . ≥98%. . . . . ≥97%. . . . . . . . . . Neryl isobutyrate. . . . . mixture of cis and trans. . 72 . . . . . . . . . . Benzyl propionate. . . . . . . . . Isobutyl acetate. . . . ≥97%. . natural. . . . . ≥98%. . . . . . . ≥98%. . . . . . . . . . FCC. 44 . . . 98 103 106 107 108 110 Allyl heptanoate. . natural. Benzyl formate. . . . . Isobutyraldehyde. . . . . . . . . 48 . . . 2-Ethylbutyric acid. . . . . . . . . . . . . . . . . . 68 . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . 84 . . . . . . . . .. . FCC. . . . . . . . . . . . Cinnamyl cinnamate. . . . . 3-Octanone. . . . (±)-2-Methylbutyric acid. . . ω-Pentadecalactone. . . . . . . . . . . . . . . . . ≥95% . . . . . . . . . . . . . . Ethyl 2-methyl-4-pentenoate. . . . . . . . . . . . . . . . ≥97%. . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . 92 . . . . FG. Methyl cyclohexanecarboxylate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . 3-Methylpentanoic acid. . . . . 55 . 98%. . . . . . . natural. . . . . . . . . . . . . . . . . . . FG . . . . . . . . . ≥97. . . . . . . Phenylacetaldehyde. FG. . . . . . . Isoamyl butyrate. . . . . . . . . . . . . 86 . . . . . . ≥97%. . . . . . . . . . . . . . . . 64 . . . . . . . . . . . . 67 . . . . . . . . . . . p-Anisaldehyde. . . . 70% isoamyl isobutyrate basis . . . . FG . . . . . . . .5%. . . . . . . . . ≥95%. . 49 . . . . . . . . . . . . . . . . . . . . . Phenylacetaldehyde solution. . . . (±)-2-Methylbutyric acid. . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . Neryl acetate. . . . . . . . . . . Beeswax absolute breche . . . . . . . . . . . . . . . FG . . . . . . . . FG . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . Phenethyl acetate. . . . . . . . . . . . . Geraniol. . . . . . 97 101 101 103 104 108 108 112 112 114 120 121 123 127 berry W365203 W203106 W204307 W267007 W213705 W214000 W215007 W215015 W333204 W218618 W234605 W229806 W344818 W242209 W242918 W349100 W243701 W368318 W328308 W250406 W250708 W251801 W254304 W259403 W259500 W206016 W355305 W340618 W260401 W265713 W317705 W266701 W266825 W266809 W269514 W356808 W270318 W270504 W272302 W343706 W339504 W343900 W277509 W280305 W341606 W282928 W284009 W287407 W287415 W291102 W291307 W294306 W303704 W355801 W377406 W347507 blueberry W230200 trans-Cinnamyl isovalerate. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . ≥90%. . . . . . . ≥98% . . . . . . . . . . . 73 . 86 . . . . . . . . . . . . . . 2-Isopropyl-5-methyl-2-hexenal. . . . . . . . . . . . . . . . . . . natural. . . . . . 17 . . . . . . . . ≥99% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FG . . . FG Methyl eugenol. . . ≥97% . . . FG . . . . . . . . ≥99%. . . . . ≥99%. . . . . . FCC. . . . . ≥93% . . . . . . Isoamyl isovalerate. . . . . FG . . . . . . Amyl acetate. . . . . . . . . 14 . . . . . . . . . . . ≥98%. . . . . . ≥98% . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . .6-Dimethyl-5-heptenal. . . . . . . . . . . Cassis bourgens absolute . . . . . . FG . FG. . . . . . . . . . . . FCC . . . . . ≥98% . . . . . . . . . . . . Phenethyl phenylacetate. . . . . . . . . Furfuryl 3-methylbutanoate. . . . . Isobutyl acetate. . ≥95%. . . . . . Allyl tiglate. . . . . . . . . 68 . . Isoamyl acetate. . . . . . . . . . . . . . . . . . . . . . . . . Linalyl butyrate. . . . . . . . ≥96% . . . . . . . ≥99%. . . . . . . . . . . . . ≥98%. . .3-Heptanedione. . . . . . . 18 . . . . . . .

. . . . . . . . . . . . . . . . . . . . 82 . Octyl octanoate. . . . . . . FCC . . . . . . . Heptyl alcohol. FG. Isoamyl salicylate. . . . . . . . . . . . . . . . . . . . . . . . . 50% in triacetin. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 72 . . . . . . . . . . . . . . . . . 2. . . . . . . . . . Methyl anthranilate. . Butyl butyryllactate. . . . . . . ≥90% . . . . . . . . . . . . . . 13 . . . . . . natural. . . . . . . . . . . . . . . . . Butyrophenone. . . . 88 . Isoamyl octanoate. . . . . . . . . . . Veratraldehyde. . . . . . . . . . . 77 . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . .3-. . . . natural. . . . . ≥93%. . FCC. . . . . . . . . . . . . . 98 108 108 Allyl tiglate. . . . . . . . . . . mixture of isoamyl and 2-methylbutyl salicylates. . ≥99%. . . . . . . . 1. . . . . . . . . . . . . Nonanal. . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . 95% .6-Dimethyl-5-heptenal. . . . . . . . . ≥95%. . Methyl 3-nonenoate. . . . . 85 . . . . . natural (US). . . . . . . . . . . . Ethyl decanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . 77 112 jam W204307 W288101 W215007 W259500 W346209 W291307 . . . ≥98%. . . . . . . . . (±)-2-Methylbutyric acid. . . . . . . Nonanal. . . ≥85%. . . . . FG . . . . FCC . . . . . . . . . . . . . . Methyl anthranilate. . . . . . . . . . . . . . . ≥98%. . . . . . . . ≥98%. . . . . . 4-(4-Methoxyphenyl)-2-butanone. . . . . . . . . . FCC . . . . . . . . . . . . . . . ≥99%. . . . . . 80 . . FCC. . . . 18 . . . . . . . . . . . . . . . . . Neryl acetate. . . . . . . . . . . . . . . FG. . . . . . . Phenethyl acetate. . . . . . . . . . Phenylacetaldehyde. . . . . 95 106 108 108 112 112 113 124 129 129 W218901 W265713 W265721 W317713 W268208 W268216 W269506 W269514 W272302 W276200 W276804 W277304 W278203 W282928 W285706 W285714 W286109 W287407 W287415 W292303 W404926 W309702 W398802 Isobutyl isobutyrate. . . . 2-Pentylpyridine. . 12 . . . ≥99%. . . . . . . . . . . . . Phenethyl acetate. . . . . . . . . FCC. . Neryl acetate. . . . . . . . . . . . . . . ≥96%. . . . 84 . . . . . . . . . . . . . . . . . . . . . FCC . . (S)-(−)-Perillaldehyde. . . . . . . . . FCC. . . Dihydrocoumarin. . . . . . . . . . . . . . β-Ionone. . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . ≥99% . . . ≥98%. . Ethyl 3-hydroxybutyrate. . . . . .4-Dimethylbenzaldehyde. . . . . . . . FCC . FG. . . 98 100 102 122 127 130 coconut W369608 W219002 W236101 W236128 W238104 W238503 W240109 W349208 W253901 W254800 W208000 W261718 W269905 W247502 W318809 W271500 W272302 W272418 W278203 W278106 W278505 W278513 W279609 W281107 W305308 W329401 W380318 . . . Mandarin oil. . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . .5-dimethyl-3(2H)-furanone solution. ≥92%. . 56 . . . . . .trans-2. . . 3-Methyl-2-cyclohexenone. . . . . . . . . . . . . 5-Methyl-2-thiophenecarboxaldehyde. . . . . . . . . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 . . . . FG. . . . . . . . . . . . . FCC . . . . ≥99%. . . . . 2-. . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . >97% . . . FCC. . . . . . . . . . 96 . . . natural. . . . 81 . . . . . . . . . . FCC . ≥98%. . . . . cis-3-Hexenal solution. . . . . . . . ≥97% . . . . . . . trans-2-Nonen-1-ol. . . . . . . . . . . . 2-Nonanone. . . . . . . . . . . . . . . . δ-Dodecalactone. . . . . . Dimethyl anthranilate. . . . . . . . . . . . . . . . . . . Ethyl phenylacetate. . . . . . . . FG . . . .10-Mercaptopinane. . . . % in ethanol. . . . . . . . . . . . . . . . . . δ-Undecalactone. FCC. . . . . . . . . . . . . . . . 2-Nonanone. . . . . . . . . . FG . . . Ethyl 2-mercaptopropionate. . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . Furfuryl butyrate. . . . . . . . . . . . . . . . . Isoamyl butyrate. . . . . . . . . . . . . . . Methyl eugenol. . . . . . . . . . . . . . . Propionaldehyde. . 2-Methyl-3-furanthiol. . . . . . . . . . natural. . . . . . . . . . . . . . . . 65 66 67 68 Page . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99% . . ≥85% . . . . . . . . . . FCC . 6-Amyl-α-pyrone. . . . cranberry W237701 W242217 W250406 Diethyl succinate. . . . . FCC . . Methyl anthranilate. . . . . . . . . . . . . . . . . . . . . 85 . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . 74 . . . ≥98%. . . . FG . . . natural. ≥98%. . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 103 106 106 107 108 108 113 120 128 129 grapefruit W213705 W224820 W224847 W238902 W245208 W247804 W350303 W268208 W268216 W277304 W278203 W287407 W287415 Benzyl alcohol. . . . . . . . . . 38 . 89 . . . . . . . . . . . . . . . . . . . . . . . . . . . . Methyl β-naphthyl ketone. . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . FG . . . . . . . . . FCC . . . . . . . . 98 . . . Hydrocinnamaldehyde. . . . . . . . . . . . natural. . . . . . . δ-Decalactone. . . . . . FCC. . . . . . . . . . . . . 2-Nonanol. 97 . . . . FCC . . . . . . . . . Ethyl benzoate. . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 10 wt. . . . . . . . . . . Methyl p-anisate. . . . . . . Nonanal. . . . . . . . . . . . . . . . . . . . . . . . . . . 82 . . . . . . . . Isoamyl laurate. . . . . . ≥97% . . . . ≥98%. . . . . . . . . . . . . ≥94% . . . . . . . . . . . FCC. . . . . . . natural. . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . γ-Octalactone. . . . . . . . . . . . . . 2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural (US). . . . . FG . . . ≥99%. . FG . . . . . . . . . . ≥95%. . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . % in ethanol. . FCC. . . . . . . . . . . . . . . . FG. . FG . . . . . . . . . . . . . . . . . . . . ≥98%. . . . ≥99%. . . . . .Organoleptic properties index fruity: cherry Cat No. . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . ≥90%. . . . . . . . . . . . FCC. . . . . . FG. natural . . . . . . . ≥98%. ≥95% . . . . . . . . . FCC. . . . 17 . . . . . . . . . . . FCC L-Menthyl acetate. . . . . ≥97%. 4-Carvomenthenol. . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . Ethyl decanoate. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3-(Methylthio)-1-hexanol. . . . . . . . . . . . . . . . . . . . . Benzyl propionate. . . . . FCC. . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . ≥99%. FCC. . . . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . . FG . . . . Phenethyl butyrate. . mango W208507 W208515 W266825 Isoamyl isovalerate. . 97% . . . . . . . . . . . . . Undecyl alcohol. . . . 18 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . β-Ionone. Methyl β-naphthyl ketone. . . . . . . . . . . . FG . . . Ethyl phenylacetate. . . . . . . . . . . 67 . . . . . . . . . . . . . . . . . . . γ-Heptalactone. . . . . . . FCC. ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . % in ethanol. ≥98%. . . . . . . . . . . . . . . . ≥98%. . . . . . . ≥99%. . . . . . 62 . . FG . . . . . FCC . . . 55 grape W230200 W237701 W271802 W271810 W366404 W242101 W242209 W242217 W243205 W243213 W342807 W342815 W354503 W327905 W501700 W329002 W256102 W256404 W317209 W317411 W259306 W259500 W207705 W208418 trans-Cinnamyl isovalerate. . Octyl acetate. . . . . . . . . . FCC. . . . . ≥95%. . ≥97% . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Diethyl succinate. . . Ethyl 2-aminobenzoate. . . . . . % in propylene glycol . . ≥97%. . . . . . . 45 . . . . . . . . . . . . 51 . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . 70 . ≥98% . Phenylacetaldehyde solution. . . . . . . . . . . . . 2. . . . . . . . . . . . ≥97%. . . . . . . . . . . . FG . . . . . FCC. ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . 63 . . . . . . . . p-Mentha-8-thiol-3-one. . ≥97%.3-Dimethoxybenzene. . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . FCC. FCC . . . . . . . . . . . . 4-Carvomenthenol. . . . . natural. . . . . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . . . . . . . . . . . Geranyl isovalerate. . . . . . . . . . . cis-3-Hexenyl cis-3-hexenoate. . . . . . . . . . . . . . . 2-Methylbutyric acid. Methyl jasmonate. . . . FCC. . . 67 . . . . . . . . . . . . . . cis-6-Nonen-1-ol. . . . . . ≥80% . 97 . . . . . . . FG . FCC . . . . . . . . Farnesol. . . Vanillin isobutyrate. . . ≥99% . . . . . . . . 95 . . . . . . ≥95%. . . . . . . . . . . . . . 6-Methylcoumarin. . . ≥90%. . . . . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . 98 . . . . . . . . . . . . . . . . . . . . . . . Myrcene. . . . . . . ≥90%. . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . Whiskey lactone. . . . . . . . . . . . . . . . . . . . FG. . . . . . . . . . . . . . . . . . . . . ≥99%. . . . . . . . . . . . 99 . . . . . . . . . . . . . . . . . . . . . ≥92% . . . . . . . . . . . natural. . . . . . . . . . . . . . FCC . . . . predominantly trans. . . . . . . . . . . . . . . . . . . . . . ≥90%. . . . Ethyl 3-hydroxyhexanoate. FCC. . . . . . . . . . 25 . . . Ethyl undecanoate. trans-2. . . . . Argentina . . . . . . . . . . . . . . . . . . . . . .com . . . . . . . . . . . . . . . . . . 65 . 2. . . . Menthalactone. . . . ≥99%. . . . . . 52 . . . 64 . . . . . . . . . . . . . . . . . . . . . . 79 . . . . . . . 84 . . . FCC. . . . . . . . . . . . Phenylacetaldehyde. . 78 . . . . . . . . . 98 . . . . . . . ≥92% . . ≥97% . DL-Menthyl acetate. . . . . . . . 37 . . . . . . . . . ≥98%. . . . . . 68 157 . . . . . . . . . . . . . . Methyl laurate. . . . . . . . . . . . . . . . . . FG . . . . Hexyl acetate. . . . Phenylacetaldehyde solution. . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . ≥99%. . 10 wt. . . . . . . . . . FCC. . . . . . Name Page Cat No. . . . . . . . . . . . . ≥99%. . . . . . . . . . . . FG . . . . . ≥99%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . Benzylideneacetone. . . . . . 43 Genet absolute. . . 97 . . . . . Piperonyl acetate. . . . FCC. . . . . . . . . . . . . . . . . . Methyl anthranilate. . . . . . . . . Hexyl propionate. . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. natural. . . . . . . . . . 80% isoamyl butyrate basis. . . . . . . . . . . . Dimethyl anthranilate. . . . 82 . . . . . . . . . . . . . . . . . . FCC . . . . ≥98%. . . ≥99%. . . . . . . . . . . . . . Name W288101 W504904 W230707 W342718 W242209 W242217 W245208 W256501 W288705 W259403 W355690 W376418 W267201 W336009 W320900 W355704 W287407 W287415 W291102 W291218 W346918 W306800 W375403 W310905 Benzylideneacetone. . . . . . . . . . . . . . . . . . FG . . FG. . . . . . FG . . . . ≥98%. . . . FCC. ≥95%. . . Maltyl isobutyrate. . . . . . . . 49 . . . 77 . . . . . . . . . . . 99 . . 35 Ethyl benzoate. . . . . . . . . FCC. . . 88 . . . . . . . . . . . . FCC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . . . ≥98%. . . . . ≥94% . . . . . . . natural. . δ-Decalactone. . . . . . . . . . .5-Dimethyl-4-methoxy-3(2H)-furanone. . . . . . . . FCC . Ethyl phenylacetate. . Isopropyl myristate. FG . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . 36 . . . . . . . . . . . . . . . . . 66 . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . 68 . . . . . . . . . Ethyl heptanoate. . . . . . . . . . ≥98% . . . FCC. . . 82 . . FG. . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . Terpinyl propionate. . 33 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥97%. . . . . . . . . . . . . ≥98%. . 3-Hexanone. . . . . . . . . . . . . . . FG . . . . . . . . . FG . . . . 38 . . . . . . . . . . . . 25 . . . . . . . . . . . . . . . . . . . . . . . . . Phenylacetaldehyde. . . . . . . 41 . . . . . . . . . ≥99%. . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . Nonanal. . . . . . . Ethyl benzoate. . . . . . . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . ≥96%. . . . . . . . . . . . . ≥98% . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC. . . . . Mandarin oil. . . . . . . natural . . . . 89 . . FG . . . FCC . . . . . . . . . . . . . . ≥98%. . FCC . . . . . . predominantly trans. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 18 . . . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . Nerolin bromelia . . . . . . . FG . . . . . . . . . ≥98%. ≥97% . . . . 43 . . . . . Phenethyl acetate. . . FG . . . . . . FCC . . . . . . . . . . Feel inspired at safcglobal. . . . . . . . . . . . . . . ≥97% . . . . . . . . . . . . . . . . . 35 . . . . . . Phenylacetaldehyde solution. . . . . . . . . . Propiophenone. . . . . . . . . . . . . . . . . . . trans. . . ≥95%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . FCC . . . . . . . . . . . . . . . . . . . . . . . 98 . . . . ≥97%. . . . . . ≥99%. . . . Ethyl 3-hydroxybutyrate. . . . . . . . . . . . ≥95%. . . . . . . . . . . 49 . . . . . . . . . 33 . . . . . . . . ≥97%. . 35 . . . FCC . . . . . . . . . . . . . . . . FCC . . . 57 . ≥98%. . . . . . . . . ≥98%. . . . . . . . . . . . Hexyl isobutyrate. . . . 80% isoamyl butyrate basis. . cis-2-Nonen-1-ol. 10 wt. . . ≥98%. . . . . . . . . 98 . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Piperonal. . . . . FCC . . . . . . . . . . . . 22 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mixture of isomers. . . . ≥95%. . . Phenethyl acetate. . . . . . ≥97%. . . . . . ≥96%. . FG. . . 10 wt. . . . . . . . . . . . . . . . . . . . . . . . . . Ethyl benzoate. . . . . . ≥98%. . . . . . . . . . . 99 102 105 106 106 108 papaya W206016 Isoamyl butyrate. . . . . . trans-2-Hexenyl acetate. . 89 . . . . . . . . . . . 77 . . . FCC . . . . . . 77 . ≥97%. . . . . . . 49 . . . . 29 . . . . . . . . . . . . . . . . . . . Lauryl alcohol. 90 . ≥90%. . . . . ≥99% . . . . . . . Ethyl benzoate. . . . . natural. . . . . . . . . . . . . . . . . . 58 . . . . . . . . . . . . . . . . . . . . . ≥98%. . . ≥99%. . 4-Hydroxy-2. . . . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . γ-Nonanoic lactone. . . . . . . . . . . ≥90%. . . . FCC . . ≥99% . . . 86 . . . . . . . . . . . . . . . . . . . . . . . 24 . . . ≥99%. . . . . . . . . . . . . . . . . . Indole. . . . . ≥92%. . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . FG . . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 68 Isoamyl isovalerate. . . . . . . 68 L-Menthyl acetate. . . . . . . . . . . . . . . ≥98%. . . . . FG . . . FCC. . . . . . . natural. . . . . . . . . . . . . . . . . . ≥97%. Phenylacetaldehyde. . . . . . ≥90%. . mixture of isomers. . . . . . . . . . . .cis-6-Nonadien-1-ol. . . . . . . . . ≥98%. . . . . FCC. . . . . . . . . . . . . . . FG . . . . . . . . . . . . . . cis-6-Nonenal. . . . Vanillic acid. . 43 . . . . . . . . . . . . . . . . . . . . . . . . . . natural. . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Italian. . FCC. . mixture of cis and trans. . . . . FG . . . . . . . FCC . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . . . . . . . . . . . . . . . 99 . . . . ≥96%. . . . . . . . . . . natural. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . . . . . . . Methyl nonanoate. . . . . . . . . . 67 . . ≥95% . . . . Orris concrete . . . . . . . ≥98%. 98 . . . . . . . . (±)-Citronellal. . . . . ≥97% . . . . . . ≥98%. FCC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . ≥98% . . natural. . . FCC . 78 . ≥95%. . . . . . . . . 28 35 37 37 38 42 43 43 44 44 46 46 46 47 53 60 60 62 64 . . . . . . . . . . . . Syringaldehyde. . . . . . . . . . . . . . . . . . . . . . . . . . ≥98%. . . . . . . FCC . 78 melon W237604 W238902 W243701 W245208 W251801 W368903 W257605 W20