Guia Mangá

Bioquímica

Masaharu Takemura, Kikuyaro e Office Sawa

novatec

The Manga Guide to Biochemistry is a translation of the Japanese original, Manga de wakaru seikagaku, published by Ohmsha, Ltd. of Tokyo, Japan, © 2009 by Masaharu Takemura and Office Sawa. The English edition is co-published by No Starch Press, Inc. and Ohmsha, Ltd. Portuguese-language rights arranged with Ohmsha, Ltd. and No Starch Press, Inc. for Guia Mangá Bioquímica ISBN 978-85-7522-287-4, published by Novatec Editora Ltda. Edição original em japonês Manga de wakaru seikagaku, publicado pela Ohmsha, Ltd. de Tóquio, Japão, © 2009 por Masaharu Takemura e Office Sawa. Edição em inglês The Manga Guide to Biochemistry, copublicação da No Starch Press, Inc. e Ohmsha, Ltd. Direitos para a edição em português acordados com a Ohmsha, Ltd. e No Starch Press, Inc. para Guia Mangá Bioquímica ISBN 978-85-7522-287-4, publicado pela Novatec Editora Ltda. Copyright © 2012 da Novatec Editora Ltda. Todos os direitos reservados e protegidos pela Lei 9.610, de 19/02/1998. É proibida a reprodução desta obra, mesmo parcial, por qualquer processo, sem prévia autorização, por escrito, do autor e da editora. Editor: Rubens Prates Ilustração: Kikuyaro Tradução: Rafael Zanolli Revisão gramatical: Patrizia Zagni Editoração eletrônica: Carolina Kuwabata ISBN: 978-85-7522-287-4 Histórico de impressões: Fevereiro/2012 Primeira edição

NOVATEC EDITORA LTDA. Rua Luís Antônio dos Santos 110 02460-000 – São Paulo, SP – Brasil Tel.: +55 11 2959-6529 Fax: +55 11 2950-8869 E-mail: novatec@novatec.com.br Site: www.novatec.com.br Twitter: twitter.com/novateceditora Facebook: facebook.com/novatec LinkedIn: linkedin.com/in/novatec

Dados

Internacionais de Catalogação na Publicação (Câmara Brasileira do Livro, SP, Brasil)
Takemura, Masaharu Guia mangá bioquímica Kikuyaro e Office Sawa ; Zanolli]. -- São Paulo : Franscisco, CA : Tokyo : Press, 2012.

(CIP)

/ Masaharu Takemura, [tradução Rafael Novatec Editora ; San Ohmsha : No Starch

Título original: The maga guide to biochemistry ISBN 978-85-7522-287-4 (Novatec Editora) 1. Ciências de vida 2. Bioquímica - Estudo e ensino 3. História em quadrinhos I. Kikuyaro. II. Office Sawa. III. Título.

12-01142 Índices para catálogo sistemático:

CDD-572

1. Bioquímica ensino em históra em quadrinhos 572 PRL20120202

Sumário
Prefácio . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . xi Prólogo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 1

1 O que acontece dentro de seu corpo? . . . . . . . . . . . . . . . . . . . . . 13 1. Estrutura celular . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Quais são os componentes de uma célula? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. O que acontece dentro de uma célula? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Síntese de proteínas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Metabolismo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Produção de energia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Fotossíntese . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Uma célula é o local de muitas reações químicas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Bioquímica da síntese de proteínas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Bioquímica do metabolismo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Bioquímica da produção de energia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Bioquímica da fotossíntese . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. Conhecimentos fundamentais de bioquímica . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Carbono . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ligações químicas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Biopolímeros . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Enzimas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Oxidação-redução . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Respiração . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Metabolismo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 14 16 18 19 20 22 24 26 27 29 30 32 36 36 36 36 37 37 37 38

2 Fotossíntese e respiração . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 1. Ecossistemas e ciclos . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ecossistemas e o ciclo biogeoquímico . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . O que é o ciclo biogeoquímico? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Ciclo do carbono . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 2. Sobre a fotossíntese . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A importância das plantas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Estrutura do cloroplasto . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Fotossíntese - A reação de fotofosforilação . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Fotossíntese - Fixação do dióxido de carbono . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3. Respiração . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . O que é um carboidrato? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Sacarídeos e o sufixo “-ose” . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Por que monossacarídeos assumem estrutura cíclica? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 40 40 43 45 48 48 49 50 57 60 60 63 63

Por que temos de respirar? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Respiração é a reação que quebra a glicose para criar energia . . . . . . . . . . . . . . . . . . . . . . Estágio 1: decomposição da glicose pela glicólise . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Estágio 2: ciclo do ácido cítrico (ciclo de Krebs ou ciclo TCA) . . . . . . . . . . . . . . . . . . . . . . . . Estágio 3: produção em massa de energia pela cadeia de transporte de elétrons . . . . . . . . Conclusão . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. ATP - A moeda da energia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5. Tipos de monossacarídeos . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Aldoses e cetoses . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Piranose e furanose . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Tipos D e L . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6. O que é CoA? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

64 66 68 71 74 79 82 83 83 83 84 85

3 Bioquímica de nosso dia a dia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 87 1. Lipídeos e colesterol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 88 O que são lipídeos? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 88 Ácidos graxos . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95 Colesterol é um tipo de esteroide . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 97 Função do colesterol . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 98 Lipoproteínas: além do bem e do mal . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 100 O que é arteriosclerose? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 103 Mistério 1: o colesterol realmente faz mal? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 105 2. Bioquímica da obesidade - Por que armazenamos gordura? . . . . . . . . . . . . . . . . . . . . . . . . . 106 Energia ingerida e energia gasta . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 106 Animais guardam gordura . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 108 Sacarídeos em excesso se tornam gordura! . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 111 Quando a gordura é utilizada como fonte de energia . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 118 Mistério 2: por que engordamos se comemos demais? . . . . . . . . . . . . . . . . . . . . . . . . . . . 123 3. O que é tipo sanguíneo? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 124 Tipo sanguíneo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 124 Como determinamos o tipo sanguíneo? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 125 Mistério 3: o que é tipo sanguíneo? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 129 4. Por que as frutas ficam mais doces à medida que amadurecem? . . . . . . . . . . . . . . . . . . . . . 130 Que tipos de açúcar existem nas frutas? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 130 Monossacarídeos, oligossacarídeos e polissacarídeos . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 131 Como as frutas se tornam doces . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 133 Mistério 4: por que as frutas se tornam doces? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 135 5. Por que os bolinhos de arroz mochi são tão elásticos? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 136 Diferenças entre o arroz normal e o arroz mochi . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 136 A diferença entre amilose e amilopectina . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 138 O que significam os números em α(1→4) e α(1→6)? . . . . . . . . . . . . . . . . . . . . . . . . . . 140 Mistério 5: por que os bolinhos de arroz mochi são tão elásticos? . . . . . . . . . . . . . . . . . . . 145

viii sumário

. . . . . . . . . . . . . 3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Enzimas e proteínas . . . . . Estrutura primária de uma proteína . . . . . . . . . . . . . . . Estrutura terciária de uma proteína . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Enzimas e inibidores . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . O que é uma enzima? . . . . . . . . . . . . . . . A glicosiltransferase determina o tipo sanguíneo . . . . . . . . . . . . . . . . . . . . . . . . .4 Enzimas são as chaves para as reações químicas . . . Estrutura quaternária de uma proteína e subunidades . . . . . . . . . . . . . . . . . . Proteínas são formadas por aminoácidos . . . . . . . Ácido nucleico e nucleotídeos . . . . . . . . . . . . . . . . . . . . . . . . . Enzimas derrubam esse “muro” . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Taxa máxima de reação . . . . . Uso de gráficos para compreender as enzimas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Função de uma enzima . . . . . . . . . . . . . . . . . . . . . . . . 149 1. . . . . . . . . . . . . . . . . . . . . . . O que é energia de ativação? . . . . . . . . . . . . . . . . 2. . . . . . . . . . . . . . . . . . . . . O RNA tem várias funções . . . . . . . . . . . . Equação de Michaelis-Menten e constante de Michaelis . . . . . . . . . . Hidrolases . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Transferases . . . . . . . . . . Por que utilizamos números recíprocos? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Por que as enzimas são importantes para as reações químicas? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . mRNA . . . . . . . . . . . . . . . . . . . . . . . . rRNA e tRNA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 199 1. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. . . . . . . . . . . . . . . . . . . . . 2. . . . . . . Substratos e enzimas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Enzimas alostéricas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Enzima rigorosa? Enzima descontraída? . . Ácido nucleico e genes . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Funções das proteínas . . . . . . . . . . . . Estrutura secundária de uma proteína . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . A descoberta da nucleína . . . . . . . . . . . Ribozimas . . . . . . . . . . . . . . . . . . Replicação do DNA e a enzima DNA polimerase . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . O básico sobre ácidos nucleicos . . . . . . . . O que é um ácido nucleico? . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 150 151 153 154 158 159 160 161 162 162 164 166 168 169 172 174 175 176 177 178 180 182 186 193 196 5 Biologia molecular e a bioquímica dos ácidos nucleicos . . . . . . . . . . . . . . . . . . . . . 202 202 204 205 209 212 214 218 218 220 222 223 226 sumário ix . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Complementaridade das bases e estrutura do DNA . . Vamos calcular Vmáx e Km! . . . . . . . . . . . . Estrutura do RNA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . O DNA é a linguagem dos genes . . . . . . . . . . Classificação das enzimas . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

. . . . . . . . Bioquímica e biologia molecular . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Medição da reação de enzimas . . . . . . Eletroforese e um western blot . . . . . . . . . . . O trabalho sujo de um bioquímico . . . . . . . . . . . . . . . . . . . . 228 228 229 229 230 231 232 232 233 234 235 236 Epílogo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Cromatografia em coluna . . . . . . . . . . . . A origem da célula . . . . . . . . . Blotting de lectina . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . O início da bioquímica e da biologia molecular . . . . . . . . . . . . . . . . . . . . . . . . . . . Centrifugação . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Retornando à bioquímica . . . . . . . . . . . . . . . . . . . . . . 239 Índice remissivo . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4. . . 249 x sumário . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . Realização de experimentos bioquímicos . . . . . Desenvolvimento de técnicas de DNA recombinante . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

Cheguei! Que bom que você voltou. Ei! Espere um pouco! Já volto! Aaaarg! Não consegui emagrecer nada! Objetivo: Perder 2.5 quilos! Abaixo os quilos! .

Olá? Hã?! Resolvi fazer uma visita apenas para lhe oferecer uma fruta de meu jardim. Tenho que admitir... . Nemoto... mas — Aaaai!! Nemoto? De onde você apareceu?! Bem..Preciso chegar a um peso saudável! Hum..

Kumi... Não há por que se sentir desse jeito..Este melão está uma delícia! Mas eu estou de regime e não deveria comer frutas.. isso é ridículo. nem que seja por mais um só dia! mas Kumi. até parece! Meu corpo inteiro provavelmente é feito de pizza e bolo! (Pratos favoritos de Kumi) Já chega! Ficarei de jejum até atingir meu objetivo! Eu me recuso a permanecer acima do peso. linda. continuaria sendo. hum... Talvez minha ideia não tenha sido tão boa. Mesmo que você comesse tudo de que gosta... .

você NÃO está acima do peso. e. ... e.. estou fazendo uma pesquisa sobre esse assunto em minha universidade.. você já é muito atraente. Bio.Você entendeu tudo errado! Bem... acho que não conseguiria entender.. aliás... hum. Bio-quê? Bioquímica! Parece algo muito complicado... vermelho Quero dizer. Então vamos começar com algo que você já conhece.. parece que você não entende como funciona o corpo humano! * Ahã * Introdução à Bioquímica. Em primeiro lugar.

mas as revistas não mentem. b Car oi d rato Então. gordura e carboidratos.Calorias. Claro que sim! Afinal. não sei por quê. certo? Por que você acha que engordará se comer muitos carboidratos? Bem. mas as pessoas costumam dizer que você ficará gordo se comer muitos carboidratos. dê uma olhada. certo? É sério. né? Hum. certo? Dizer que carboidratos têm muitas calorias é um pouco diferente... Prólogo 5 . ão r ve Diet a rel s: um ató ri e sp ecia o l. estou de regime. veja só! isso você conhece... Gordura Óbvio! dIsso eu já sabia! s eme r b So a Engordar significa aumentar o teor de gordura em seu corpo.. ar em Como fic a o ar p a m r o f . Pois então.. a gordura é um exemplo de nutriente de alta caloria.

ela é fantástica! * Sobre a autora 6 Prólogo . Eu juro. Em outras palavras. o! Errad Além disso. às vezes os professores são assustadores. ela é a autora deste livro. Veja. é a química de nossos corpos! Aahhhh Parece interessante.. Na verdade..Se você estudar bioquímica entenderá por que isso ocorre! A bioquímica é o estudo dos processos químicos que ocorrem dentro dos corpos de organismos vivos. Professora adjunta Choko Kurosaka.. mas eu não sou boa em química. a minha professora é muito simpática. * Confie em mim..

r Ca bo os at r id ina Vita m s Gordura ais miner A gordura e os carboidratos de que falamos também são substâncias químicas.. Proteínas Fiquei tão preocupada pensando em meu peso como um número.. Então. Tão bonita!!! Química não é tão difícil quanto você imagina. reações químicas estão ocorrendo em seu corpo.. certo? O quê? Não acredito! Isso mesmo! Nossos corpos (e de outras criaturas vivas) são formados por muitos tipos de substâncias químicas.. né? Todos são substâncias químicas! . Água Que não pensei em meu corpo do ponto de vista químico.Essa professora é. Por exemplo. quando você janta e digere a sua comida. reações químicas devem ocorrer o tempo todo em nossos corpos. Kumi.

.. pode me ajudar a realizar um experimento no laboratório.. poderei conhecer aquela professora! No dia seguinte — Está bem! Conte comigo! Logo. dando uma atenção especial a esse "ponto de vista químico. logo terei o corpo de uma supermodelo! * * Universidade Krebs ." Estou fazendo uma pesquisa sobre os processos químicos de nossos corpos para minha universidade.. falando nisso.. Se você quiser. . Hum. Se eu participar do experimento.Exatamente! Para resumir: A bioquímica é o estudo do que ocorre dentro de nossos corpos (e dos corpos de outros organismos vivos)....

. Ela é ainda mais deslumbrante em pessoa!!! Hum. Bem-vinda ao meu laboratório... Queria muito lhe perguntar. ? Prólogo 9 . Kumi.* Olá! * Laboratórios Kurosaka Prazer em conhecê-la..

fiquei completamente impressionada. .. mas a bioquímica certamente pode aumentar o que sabemos sobre a forma como nossos corpos interagem com os alimentos.. a bioquímica e nossa aparência física não estão relacionadas diretamente.Se eu estudar bioquímica. Encantada ♥ Minha nossa! Bem. ficarei tão linda quanto você? Quando vi sua foto.

..Podemos estudar a forma como nossos corpos processam quimicamente aquilo que comemos e como transformam esses alimentos em nutrientes utilizados por nosso corpo para se reabastecer. e a promover nossa saúde como um todo. Você será saudável e bela! Esse conhecimento também pode nos ajudar a curar doenças. Poderei me tornar tão bela quanto a professora! E serei capaz de descobrir os segredos de uma boa saúde!! Conte comigo! Esse é o espírito! Está bem.... .. primeiro você tem de beber esta xícara de água... Que legaaaaaal! Se eu estudar bioquímica. Se realmente compreender como seu corpo funciona.

finalmente.. desenvolvido pelos laboratórios Kurosaka.Ela contém um robô tão pequenino que não podemos vê-lo a olho nu. Apelido do robô mascote: Robogato. Aí vamos nós! glub glub glub Que legal! Agora.. Nós o utilizaremos para estudar o interior de seu corpo. Que o estudo da bioquímica se inicie! .

3 Bioquímica de nosso dia a dia .

. Por que engordamos se comemos demais? 3. O que é o tipo sanguíneo? 4. o que é isso? Sinto muito. Lipídeos e colesterol O que são lipídeos? Estou pronta para estudar! Bocejo Dormi como uma pedra. tentem descobrir as respostas para essas questões enquanto se divertem em casa.. podem me passar as informações que descobrirem. Ei! Uma mensagem da professora Kurosaka! Flip Que legal! Espere. Por que você e o Nemoto não tentam descobrir as respostas para as questões a seguir? Depois. mas surgiu um imprevisto e não poderei comparecer ao nosso encontro de estudos hoje. Por que os bolinhos de arroz mochi são tão elásticos? Esses são mistérios que só podem ser solucionados pela bioquímica! Como não é necessário que vocês venham à faculdade hoje. está bem? 88 CAPÍTULO 3 . Por que as frutas ficam mais doces à medida que amadurecem? 5.1. O colesterol realmente faz mal? 2. 1.

Muito bem! Vamos escrever um relatório tão completo. que a professora vai ficar de boca aberta! Ela não perde por esperar! Mas esses mistérios parecem interessantes! O l á ! Duas horas depois — Então nossa aula hoje será sobre. Estou um pouco preocupado. Terei que fazer as coisas do meu jeito! . que pena.. Está bem! Vamos resolver esses mistérios! Murmura Murmura Muito bem! O que será que aconteceu de tão repentino à professora? Espero que eu saiba ensinar isso direito. mas não há volta.....Ah..

Para seu bem. Sei que meu pai está sempre falando de seus níveis de colesterol. Isso aí! O colesterol é um tipo de óleo.. e não precisamos dela. também temos de aprender dois outros assuntos: lipídeos e proteínas. certo? Acho que isso o torna definitivamente algo ruim. ou gordura. O colesterol realmente faz mal? Vamos descobrir.. Gordura não faz bem à saúde. Ainda que tenhamos aprendido sobre sacarídeos nas aulas da professora Kurosaka. Esses são nossos três principais nutrientes. Meu objetivo é ter zero por cento de gordura corporal! pai Colesterol Ruim! = Objetivo: Perder 2.Para começar: 1. O que são lipídeos? Eles são diferentes da gordura? . Muito bem. Kumi. é melhor estudarmos os lipídeos primeiro. vamos falar de lipídeos! Ahã o quê? Estou preocupada apenas com a gordura.5 quilos! Abaixo os quilos! Não é bem assim.

. Solventes orgânicos são. Bioquímica de nosso dia a dia  91 . pai . o significado de ambos é exatamente o mesmo.. como lipídeos neutros.. e dizemos “gordura”. lipídeo = gordura. queremos dizer gordura neutra/lipídeos neutros. • Lipídeo neutro • Fosfolipídeo • Glicolipídeo • Esteroide Ainda assim. vamos utilizar apenas a palavra “lipídeo” daqui em diante. Em outras palavras. Tecla Tecla Lipídeos Gordura neutra Funciona assim: Há vários tipos de lipídeos.Bem. Como isso pode nos confundir. Solventes orgânicos? Um exemplo é a acetona.. mas. muitas vezes utilizada como removedor de esmalte. Como lipídeo é um termo genérico utilizado para se referir a várias biomoléculas. Lipídeo é um termo geralmente utilizado na bioquímica.. normalmente quando estamos falando de uma dieta. * Há exceções no entanto: alguns glicolipídeos se dissolvem na água. líquidos que consistem em compostos orgânicos com átomos de carbono em suas estruturas. glicolipídeos e esteroides. mas se dissolvem em solventes orgânicos*. Para nosso propósito. mais especificamente. Lipídeos Uma propriedade importante dos lipídeos é o fato de que não se dissolvem facilmente em água. enquanto gordura é uma palavra utilizada em nutrição.. O álcool é outro exemplo.. é difícil defini-lo. fosfolipídeos..

um lipídeo neutro é a substância que geralmente chamamos de “gordura”. Tremendo Também temos o monoacilglicerol. temos os lipídeos neutros! Lipídeos neutros são formados a partir de duas substâncias: glicerol e ácidos graxos. Ahá! Meu inimigo é o triacilglicerol! Nunca esquecerei o nome desse vilão abominável! e o diacilglicerol. no qual dois ácidos graxos são combinados a um glicerol. formado por uma molécula de glicerol e três ácidos graxos combinados desta forma: Glicerol Ácido graxo Triacilglicerol Lipídeo neutro O triacilglicerol pode surgir muitas vezes em discussões sobre lipídeos. Dentre os lipídeos neutros de nosso corpo. GrrrrrrrRRr Gordura Primeiro. o mais comum é o triacilglicerol... que tem apenas um ácido graxo combinado a um glicerol. 92 CAPÍTULO 3 .. um a de cada vez..Agora vamos discutir esses tipos distintos de lipídeos. dur Gor tra u ne • eo Lipíd tro n eu Como mencionei antes. Seguindo em frente.

. Esfingofosfolipídeos têm extremidades de esfingosina.A seguir. Um fosfolipídeo baseado em glicerol é chamado glicerofosfolipídeo. não exatamente. uma membrana de camada dupla pode ser criada com a parte hidrofóbica virada para dentro e a parte hidrofílica virada para fora. Ela é formada principalmente por fosfolipídeos! Fosfolipídeos têm uma propriedade chamada anfipaticidade. temos os fosfolipídeos! o ipíde fol s o • F fosfolipídeos têm uma estrutura na qual um dos três ácidos graxos de um lipídeo neutro é substituído por um composto químico contendo ácido fosfórico.... enquanto a parte do composto químico que contém o ácido fosfórico é hidrofílica. Hidrofílico significa algo que se mistura facilmente com água. dessa forma. Falando nisso. Um desses elementos não é como os outros.. Kumi. Você não se lembra de quando falamos da membrana celular? Hããã. já conversamos sobre fosfolipídeos antes. A expressão anfipático significa que os fosfolipídeos têm substâncias de ambos os tipos. As duas partes correspondentes aos ácidos graxos são hidrofóbicas... você se lembra? Hmm. Fosfolipídeo Ácido fosfórico Ácido graxo Hidrofílico Hidrofóbico Hidrofílico Fosfolipídeo Extremidade polar variável* Hidrofóbico * Um fosfolipídeo pode ter um grupo polar variável em uma de suas extremidades. Hidrofóbico significa uma substância para a qual essa mistura não ocorre facilmente.

Há vários tipos de glicolipídeos.E agora. Eles são as estrelas do espetáculo na verdade. Dê uma olhada! Estrelas?! Tá bom! Queria mesmo é nocauteá-los. assim como ocorre nos lipídeos neutros. muito importantes. como esfingoglicolipídeos e gliceroglicolipídeos. ácidos graxos fazem parte de muitos lipídeos diferentes... não? • Lipídeo neutro • Fosfolipídeo • Glicolipídeo • Esteroide Esses contêm ácidos graxos.. na prática. Galactocerebrosida (tipo de esfingoglicolipídeo) Esfingosina e • Glicolipíd o Galactose Sacarídeo Ácido graxo Fosfolipídeos e glicolipídeos também incluem ácidos graxos. 94 CAPÍTULO 3 . os ácidos graxos que você odeia tanto são. glicolipídeos! Glicolipídeos são lipídeos que contêm um sacarídeo como componente. Isso mesmo! A maioria dos lipídeos contém ácidos graxos. Kumi. Lipídeos Gordura neutra Hum..

os ácidos graxos que existem em nosso corpo têm de 12 a 20 átomos de carbono. Primeiro. mas não são essenciais para uma boa saúde. o ácido esteárico e o ácido araquidônico não podem ser sintetizados. Nossa. Por outro lado. Por exemplo. temos uma estrutura que chamamos de grupo carboxila (-COOH). entendi! É como óleo e água: difícil de misturar! Alguns ácidos graxos são formados em nossos corpos. ácido linolêico e ácido α-linolênico são essenciais.Ácidos graxos Ácidos graxos são uma fonte de energia e também podem se tornar fosfolipídeos. Dois ácidos graxos. os seres humanos não poderiam sobreviver. Ah. presentes nos sacarídeos (consulte a página 61 para mais informações sobre sacarídeos). Como apenas átomos de hidrogênio (H) estão ligados a cada um dos átomos de carbono. o ácido graxo não se mistura facilmente com a água. mas que não podem ser sintetizados por seres humanos. matéria-prima para criação de membranas celulares. Todos esses ácidos graxos contêm mais de 16 Cs! Bioquímica de nosso dia a dia  95 . o que significa que são necessários e bons para nossa saúde. Ainda que possamos construí-los conectando desde alguns átomos de carbono (C) até dezendas deles. Sem ácidos graxos. sério? Que incrível! E eu pensava que eles fossem nossos inimigos. Faltam-lhe grupos hidroxila (OH). H C H3C H H C H H H H H H H H C H C C C C C C C H H H H H H H H Ácido graxo C H C C H H H O OH (CH3(CH2) 12COOH) Grupo carboxila Na extremidade final dessa longa cadeia (chamada de cadeia de hidrocarbonetos). carboidratos em excesso são convertidos em ácido palmítico. vamos analisar a estrutura dos ácidos graxos.

Entretanto. nós a representamos assim. Parece que estou tendo um pesadelo com meu boletim! Ácido palmítico Ácido esteárico Ácido linoleico Ácido α-linolênico CH3(CH2) 14COOH CH3(CH2) 16COOH CH3(CH2)4(CH=CHCH2)2(CH2)6COOH CH3CH2(CH=CHCH2)3(CH2)6COOH Quando há uma ligação dupla dentro da molécula. e geralmente um átomo separado se liga a cada braço. Isso é chamado de ligação dupla. dois braços são utilizados para ligar um carbono a outro átomo.. 96 CAPÍTULO 3 . como você pode ver na figura a seguir: H C H H C H H C H H C H Um átomo de carbono tem quatro “braços”. se temos muitas ligações duplas. Ácido araquidônico CH3(CH2)4(CH=CHCH2)4(CH2)2COOH Certos ácidos graxos apresentam ligações duplas entre os átomos de carbono no meio da molécula. por isso são muitas vezes incluídos como componente de membranas celulares (ou seja. Isso significa que o ponto de fusão dos ácidos graxos difere significativamente. Carbonos com ligações duplas são chamados insaturados. Ácidos graxos insaturados não solidificam tão facilmente. Então. Ligações duplas têm certas peculiaridades que impedem que os ácidos graxos insaturados formem um sólido estável. em alguns casos. dependendo do número de átomos de carbono presentes e do número de ligações duplas entre esses átomos. continuando mais líquidos em temperaturas baixas do que os ácidos graxos saturados.. e ácidos graxos que têm carbonos insaturados são chamados ácidos graxos insaturados. os ácidos graxos são mais difíceis de solidificar? Isso mesmo. fosfolipídeos) para as quais flexibilidade é importante.Nossa! Quantos Cs.

Sua vida amorosa neste mês será muito turbulenta! Ha ha ha. sua natureza por demais séria acabará o atrapalhando e você não conseguirá aquilo que deseja. certo? A previsão para seu mês é. até que é divertido prever o futuro de alguém com base em seu tipo sanguíneo. Vejamos. Por isso. não deixe que uma vidente decida seu futuro! Isso é tudo! Mesmo assim. Ainda assim. né?! Bioquímica de nosso dia a dia  129 . você é Tipo A. Você terá uma oportunidade inesperada de se aproximar de quem gosta... O sistema de grupo sanguíneo ABO classifica as pessoas de acordo com as diferenças entre certas cadeias de açúcar encontradas na superfície dos glóbulos vermelhos. Até hoje. ainda bem que não há evidências científicas que comprovem essas teorias. AB e O) são baseados no sistema de grupo sanguíneo ABO.? 3 Mistério O que é tipo sanguíneo? Os quatro tipos sanguíneos (A. Ta-dá! * * Adivinhação por tipo sanguíneo... B. não temos evidências que confirmem a teoria de que diferenças nessas cadeias são capazes de afetar a personalidade de uma pessoa.

.4. o açúcar “da uva” é encontrado em muitas frutas diferentes.. a frutose (açúcar das frutas) e a glicose (açúcar da uva*).. elas estão maduras. isso vale para muitos tipos diferentes de frutas. Exatamente. E o melão que você me trouxe antes estava maduro e delicioso! Sim. podem ter um gosto ácido demais. mas por quê? O motivo é que temos três tipos de açúcar em grande quantidade nas frutas: a sacarose (açúcar de mesa). Na verdade. melões e melancias. mas o que significa “maduro”. 130 CAPÍTULO 3 . e não só nas uvas. são bem doces. todos ficam mais gostosos à medida que amadurecem.. doces e deliciosas. Quando laranjas ainda estão verdes. Por que as frutas ficam mais doces à medida que amadurecem? Que tipos de açúcar existem nas frutas? Chegou a hora de nosso quarto mistério: por que as frutas ficam mais doces à medida que amadurecem? Falando em frutas. bioquimicamente falando? Sabemos que uma fruta madura é mais doce. estamos falando de frutas. uvas. Laranjas. acabamos de comprar algumas peras frescas. mas quando maduras. Que estranho! Achei que elas tivessem apenas o açúcar das frutas. Afinal. Hum. * Apesar do nome.

formada por ao menos três átomos de carbono conectados.Monossacarídeos. Ainda que a sacarose seja um oligossacarídeo. nós a chamamos de dissacarídeo. Se dois ou mais monossacarídeos se ligarem. a glicose e a frutose têm estruturas diferentes. como é formada pela conexão de dois monossacarídeos. Veja como são esses sacarídeos: CH2OH C C H OH HO C H CH2OH H C H H C OH Glicose Frutose O H C OH O OH C H C H C HO CH2OH C O H H C OH H C OH C OH H CH2OH O C H H C OH OH C H OH C CH2OH O C CH2OH Sacarose Ah. (veja a página 63 para mais detalhes). Bem. formarão um oligossacarídeo. oligossacarídeos e polissacarídeos Antes dissemos que a sacarose. agora vamos aprender mais sobre esses diferentes sacarídeos! A unidade básica de um sacarídeo é chamada de monossacarídeo. A glicose e a frutose são monossacarídeos formados por seis átomos de carbono. então a sacarose é formada pela ligação de uma glicose com uma frutose! Bioquímica de nosso dia a dia  131 . Isso mesmo! Temos vários tipos de sacarídeos e eu adoro comer todos eles.

132 CAPÍTULO 3 . Cogumelos também utilizam quitina como material estrutural.Exatamente! Também temos sacarídeos feitos de muitos monossacarídeos. As plantas armazenam a glicose dessa forma depois que esta é criada pela fotossíntese. Então. Ele é chamado glicogênio e é produzido principalmente pelo fígado ou por músculos. É verdade. que formam moléculas extremamente longas ou estruturas ramificadas complexas. mas agora entendi a sua utilidade! Glicose Glicogênio Outros tipos de polissacarídeos incluem a celulose e a quitina. A celulose é o principal componente da parede celular vegetal das plantas. O amido é formado por muitos monossacarídeos de glicose conectados. Você consegue se lembrar de algum polissacarídeo que talvez conheça? Bem. chamados polissacarídeos. Glicose Amido Nossos corpos (e de outros animais) também contêm um “material de armazenamento” como o amido. certo? Isso mesmo. como camarões e caranguejos.. falamos sobre batatas e arroz antes.. conectando moléculas de glicose em excesso e armazenando-as para uso futuro. e esses alimentos eram repletos de sacarídeos. o amido deve ser um polissacarídeo. eu me lembro de você mencionar o glicogênio antes. enquanto a quitina é componente fundamental da casca dos crustáceos.

Por que isso ocorre? Hum. polissacarídeos. Ltd. frutas cítricas. como a glicose. são quebrados em monossacarídeos. enquanto diminiu a atividade da invertase. uma enzima que sintetiza a sacarose nas frutas. ficam mais doces e deliciosas à medida que amadurecem. quando eu estava comprando morangos e laranjas no supermercado. Frutas. Science of Fruit. Editor. Mas à medida que esses frutos amadurecem. Você está correta. havia uma placa que dizia: “Conteúdo de açúcar: 11% a 12%”. frutose e sacarose. a quantidade relativa de sacarose aumenta continuamente.Como as frutas se tornam doces Agora. responsável pela quebra da sacarose. Antes. certo? Bioquimicamente falando. como laranjas e melões. Acredito que se a fruta fica mais doce à medida que amadurece. isso deve significar que seu conteúdo de açúcar aumentou em proporção. contêm praticamente a mesma quantidade de glicose. Sacarídeos (mg/g de peso fresco) 100 Sacarose Sacarídeos (mg/g de peso fresco) 50 Frutose Sacarose Glicose Frutose Glicose Mês Set Out Nov Dez Jan Fev Laranja Mês Jun Jul Ago Set Pera-japonesa Fonte: Saburo Ito.. vamos voltar às nossas questões. todos os três tipos de açúcares aumentam em quantidade. como o amido. Bioquímica de nosso dia a dia  133 . Então. Asakura Publishing Co. vamos falar de sacarídeos! Dê uma olhada nos gráficos a seguir. Em uma pera-japonesa.. e aumenta a atividade da sacarose-fosfato sintase.. (1991) Quando as frutas amadurecem. como laranjas. deve ter ocorrido uma alteração nos sacarídeos. Antes de estarem maduras.

seguida pela sacarose e. à medida que aumenta a quantidade de sacarose ou frutose. Das três. depois que seu conteúdo de sacarose tiver aumentado e quando estiverem mais doces e deliciosas. considerando a doçura da glicose 1 Uau! Então. o que faz que a fruta fique bem doce quando chega o momento de sua colheita. a diferença nas quantidades desses açúcares é mais marcante: à medida que a fruta amadurece. podemos ver que há um aumento na quantidade de frutose ou sacarose. glicose. frutose e sacarose são todas doces. Frutose 2 Sacarose 1. frutas cítricas devem ser coletadas no inverno.. conforme os polissacarídeos são quebrados. quanto de sacarose aumenta repentinamente. 134 CAPÍTULO 3 . depois. a frutose é a mais doce. pela glicose. combinando j Invertase (baixa atividade) k Sacarosesacarose Glicose Frutose 6-fosfato frutose UDP-glicose fosfato sintase Então. a doçura dos melões depende principalmente de seu conteúdo de sacarose. Por exemplo. quer dizer que uma fruta fica mais doce à medida que mais sacarose é produzida? Bem.Ah.4 Glicose 1 Graus de doçura. então é a sacarose-fosfato sintase que forma a sacarose glicose e frutose . a fruta fica mais doce e amadurece. e eles estarão mais saborosos quando os níveis desse açúcar estiverem mais altos. Assim como as frutas cítricas. Por outro lado. no caso das peras-japonesas. Analisando os gráficos da página 133. a quantidade tanto de frutose..

. a pepsina.. O fato de que o tipo do substrato é determinado pela enzima é chamado de especificidade de substrato.. 162 Capítulo 4 . vamos falar de enzimas — as chaves para as reações químicas! Vamos lá! A primeira informação importante que devemos saber é que uma enzima só pode funcionar se combinada a determinado material “parceiro”. enzima digestiva responsável pela quebra de proteínas em nosso estômago.. e nunca DNA. quebrará apenas amido. Gordura . Função de uma enzima Substratos e enzimas Finalmente. quebrará apenas proteínas.. presente na saliva. enzima substrato Complexo enzimasubstrato Produto da reação A reação não ocorre enzima Outra substância O complexo não pode ser formado A “substância parceira” com a qual uma enzima trabalha é chamada de substrato... Proteína A enzima digestiva. α-amilase.. Amido .2. Enzima O “parceiro” da enzima Por exemplo. e nunca gordura.

Para algumas enzimas.. o material produzido quando o amido é quebrado pela Dependendo do número de moléculas de glicose que ele contém. O processo é mais ou menos assim: tesoura! Enzima a α-amilase corta o amido em pedacinhos? ima E nz Enzima to! Pron Cort a Cort a Enzima α-amilase Ela corta o amido como uma tesoura! Amido Enzima α-amilase Complexo enzimasubstrato Enzima Enzima Enzima Produtos da reação: Maltose. .. e o produto da reação (ou seja. O substrato é o amido.. dextrina-limite e assim por diante. “maltotriose”.No caso da α-amilase de nossa saliva.. sendo menos rigorosas quanto aos materiais com os quais podem interagir. cara! Vamos analisar esses dois tipos de enzimas. Outras têm especificidades de substrato mais abrangentes. maltotriose. Enzima descontraída Enzima rigorosa É do meu jeito e pronto! Tanto faz. os substratos têm de ser muito específicos. α-amilase) é um tipo de sacarídeo. esse sacarídeo é conhecido como “maltose”. “dextrina-limite” e muitos outros nomes diferentes.

. Há enzimas que também podem atuar em substâncias semelhantes ou intimamente relacionadas aos seus substratos.Enzima rigorosa? Enzima descontraída? Algumas enzimas são “rigorosas”. o que significa que atuam apenas quando combinadas a substratos muito específicos. as enzimas capazes de quebrá-las tiveram que se tornar mais flexíveis. 164 Capítulo 4 . Exatamente! Enzimas do catabolismo de proteínas (enzimas que quebram proteínas) muitas vezes apresentam certa flexibilidade quanto ao substrato com que podem interagir. Lembre-se de que há muitas proteínas diferentes. teríamos uma enzima exclusiva para cada tipo de proteína! Isso certamente daria um trabalho enorme! Apenas glicina Apenas alanina e histidina Rigorosa ! Rigorosa! Como as proteínas são muito complexas. Muitos exemplos dessas enzimas podem ser vistos no sistema digestório — como as enzimas envolvidas no catabolismo das proteínas.. Rigorosas e descontraídas? Parece a diferença entre minha mãe e meu pai. Outras são mais “descontraídas” e atuam sobre uma quantidade maior de substratos. Se as enzimas fossem específicas demais.

B. a lisina e a prolina. Essa enzima é muito flexível quanto ao tipo de substrato com que pode interagir. C e Y. certo? Então. ainda temos 17 tipos com os quais é capaz de trabalhar. uma das enzimas do catabolismo de proteínas secretada pelo pâncreas.Por exemplo. Ela parece bem flexível! Isso mesmo. por exemplo. incluindo A. a tripsina pode cortar apenas o lado C-terminal da arginina e da lisina. ainda que a carboxipeptidase A não possa lidar com a arginina. desprende aminoácidos sequencialmente a partir da extremidade de uma proteína. Por exemplo. a carboxipeptidase. como a arginina. pode desprender praticamente qualquer aminoácido da extremidade C-terminal de uma proteína. ProlinA ArgininA LIsinA N-terminal lado C-terminal da arginina lado C-terminal DA LISINA Posso desprender tudo que não seja arginina. lisina ou prolina. A carboxipeptidase pode ser de vários tipos. Entretanto. a lisina e a prolina. mas não funciona corretamente em aminoácidos volumosos ou com grupos R aromáticos. ArgininA LIsinA lado C-terminal DA ArgininA lado C-terminal DA lIsinA Rigorosa! Tripsina Enzimas são as chaves para as reações químicas  165 . A carboxipeptidase A. temos também algumas enzimas de catabolismo de proteínas que são bem “rigorosas”. C-terminal Bem descontraí da lado C-terminal da prolina Carboxipeptidase A Há 20 tipos de aminoácidos que formam proteínas.

. com isso concluímos nossas aulas! Bam Vocês dois fizeram um ótimo trabalho! Graças a você.ão jeç pro e d a la *S * Muito bem. professora.... Chegou a hora! Agora que terminamos nossa última lição. Ensine-me os segredos definitivos dos regimes! Epílogo 239 ... falando nisso. professora! Hum.

. Energia ingerida Energia gasta Alimente-se moderadamente e faça exercícios com frequência! Mesmo que existam incontáveis dietas sempre na moda. tudo se resume a isso! . perderá peso. em seu relatório. Este gráfico é a chave! Energia armazenada como gordura Se você gastar mais calorias do que ingere..Tolinha — esses "segredos" estiveram com você o tempo todo! Como assim? Veja. Toq ue Está tudo aqui.

. Pobre Kumi B uááááá . será que. Camba leando Cambaleando Bem. Já deve ter percebido que fazer regime passando fome não faz nenhum sentido... Minha nossa.. acho que aprendi muitas lições importantes. Quem estou querendo enganar? Eu gosto demais de comida para cuidar daquilo que como! Com certeza vou engordar! Acalme-se. Hum. sacarídeos e lipídeos são importantes para seu corpo... certo? . Kumi? Certo?! Você aprendeu que proteínas.. é claro! Certo.Aaaaaai E não se esqueça de se alimentar com uma dieta balanceada. Kumi! MAS..

. Falta muito para que você se pareça com um peixe-boi.Perdida! Vou comer bolo e pizza até ficar enorme! Acabarei me tornando um enorme peixe-boi comedor de salgadinhos! Kumi.. ou talvez um ursinho que está se preparando para hibernar. Soluço Soluço Soluço 242 Epílogo ... Balança Ei! he he he .. por isso não se preocupe! O quê? Ei. bem gordinho para aguentar o inverno.... deixe de exagerar. se você pensar um pouco. verá que os animais gordinhos são sempre mais bonitinhos. Você está mais para um leão marinho. Balança Gorducha! a ha Ha h a h Quer saber. professora.

para mim a Kumi não está nem um pouco gorda. é? Se você tem algo a dizer. é melhor que diga de uma vez! snif Está bem! Em primeiro lugar.5 q u 2 s! uilo sq o ixo Aba E mesmo que estivesse. r rde : pe tivo ilos! e j Ob .Deixe a Kumi em paz! Será que você não percebe que ela é sensível demais para aguentar esse tipo de tratamento? Ah. ela ainda seria linda! Epílogo 243 .

.. Na verdade... Gostoso Ela é linda quando está se esforçando em seus estudos.. Ela é uma das garotas mais lindas que já conheci! Poderia até dizer que.. A Kumi é uma gata! 244 Epílogo .. E mais linda ainda quando está vestindo seu maiô! Hum...Ela é linda quando está comendo demais..

. Nemoto? .. e aquele comentário sobre o "leão marinho".. e o "ursinho gordinho"...... .Dãããã! E você acha que eu não sei tudo isso? Hã? Ne- A Kumi é uma gracinha! Mas.

Kumi! ♪ Sim. Vermelho 246 Epílogo . Uma armadilha.. Já estava na hora de o Nemoto falar o que sente por você. Chega de dietas da moda para mim. Hehe.. você estudou de verdade e aprendeu algumas lições bem importantes sobre o seu corpo. E você também descobriu outra informação importante...Foi só um pouco de psicologia reversa! Pisca Funcionou direitinho. não é mesmo? Com certeza. posso dizer que essa lição foi um enorme sucesso! Kumi.

.. Epílogo 247 . agora que terminamos nossas lições. mas... tenho certeza de que um rapaz inteligente como você é capaz de dar um jeito nisso.Então. Hum.. Ah.. é claro... Nemoto.. que tal fazermos uma boquinha? Mas. eu ainda estou totalmente quebrado! Legal! Por conta do Nemoto. Vou me arrumar! ..

Obrigada Por tudo! ! E agora. Vamos atacar a comida! 248 Epílogo ....

Sign up to vote on this title
UsefulNot useful