ÔN TẬP HỮU CƠ

( ĐỀ SỐ 1)
Câu 1. Đề hiđrat hóa 2-metylbutan-2-ol thu được sản phẩm chính là anken nào sau đây?
A. 2-metyl but-2-en
B. 2-metyl but-1-en
C. 3-metyl but-1-en
D. Pent-1-en
Câu 2. Este X tạo từ glixerol và axit cacboxylic đơn chức. Thủy phân hoàn toàn X trong 200 ml dung
dịch NaOH 2M, cô cạn dung dịch sau phản ứng thu được 9,2 gam glixerin và 32,2 gam chất rắn khan.
Vậy X là :
A. glixeryl tri acrylat
B. glixeryl tri fomiat C. glixeryl tri axetat
D. glixeryl tri propionat
------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------ Câu 3. Thực hiện phản ứng este hoá giữa axit ađipic (HOOC-(CH2)4-COOH ) với rượu đơn chức X
thu được este Y1 và Y2 trong đó Y1 có công thức phân tử là C8H14O4. Hãy lựa chọn công thức đúng của X.
A. C2H5OH
B. CH3OH
C. CH3OH hoặc C2H5OH D. C3H5OH
Câu 4. Gluxit là hợp chất tạp chức trong phân tử có nhiều nhóm -OH và có nhóm :
A. cacbonyl
B. anđehit
C. amin
D. cacboxyl
+ NaOH
+ HCl du
→ X2. Vậy X2 là:
Câu 5. Cho các dãy chuyển hóa. Glyxin  → X1  
A. H2N-CH2-COONa
B. H2N-CH2-COOH
C. ClH3N-CH2-COOH D. ClH3NCH2COONa
Câu 6. Có thể sử dụng cặp hoá chất nào sau đây có thể sử dụng để phân biệt 4 dung dịch: CH3COOH,
CH3OH, C3H5(OH)3 và CH3CH=O.
A. CuO và quỳ tím
B. dung dịch NaHCO3, dd AgNO3 / dung dịch NH3
C. quỳ tím và Cu(OH)2
D. quỳ tím và dd AgNO3 / dung dịch NH3
Câu 7. Trong số các polime sau: [- NH-(CH2)6- NH-CO - (CH2)4- CO-]n (1); [-NH-(CH2)5 -CO -]n (2)
; [-NH-(CH2)6- CO-]n (3) ; [C6H7O2(OOCCH3)3]n (4) ; (-CH2-CH2-)n (5) ; (-CH2-CH=CH-CH2-)n (6) .
Polime được dùng để sản xuất tơ là:
A. (5); (6)
B. (4); (5); (6)
C. (1); (2); (3); (4)
D. (3); (4); (5); (6)
Câu 8. Hỗn hợp X gồm 2 rượu no đơn chức X1 và X2 có tỷ lệ số mol tương ứng là 1 : 4 ( trong đó MX1 <
MX2). Cho 12,2 gam hỗn hợp X vào bình đựng Na dư thấy khối lượng bình tăng thêm 11,95 gam. Vậy X1,
X2 tương ứng là:
A. CH3OH và CH2=CH-CH2OH
B. C2H5OH và CH3CH2CH2OH
C. CH3OH và CH3CH2OH
D. CH3OH và CH3CH2CH2OH
------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------ Câu 9. Thực hiện phản ứng este hoá rượu đơn chức X với axit Y thu được este Z có công thức phân
tử là C4H6O2. Y có phản ứng tráng gương và phản ứng làm mất màu nước brom. Hãy lựa chọn công thức
đúng của este Z.
A. HCOO-CH=CH-CH3
B. CH2=CH-COOCH3
C. HCOO-C(CH3)=CH2
D. HCOO-CH2-CH=CH2
Câu 10. Chất hữu cơ X có CTPT là C3H7O2N. X tác dụng với NaOH thu được muối X1 có CTPT là
C2H4O2NNA. Vậy công thức của X là :
A. H2N-CH2-COOCH3
B. H2N-CH2-COOCH2CH3
C. CH3-CH(NH2)-COOH
D. CH3-CH2COONH4
Câu 11. Đun nóng chất hữu cơ X trong dung dịch NaOH, thu được Ancol etylic, NaCl, H2O và muối
natri của α- alanin. Vậy công thức cấu tạo của X là:
A. H2N-C(CH3)2-COOC2H5
B. ClH3N-CH(CH3)-COOC2H5
C. H2N-CH(CH3)-COOC2H5
D. ClH3N-CH2-COOC2H5
Câu 12. Hãy cho biết với thuốc thử dd AgNO3 / NH3 có thể phân biệt được các chất trong dãy chất nào
sau đây ?
A. mantozơ và glucozơ B. mantozơ và saccarozơ C. glucozơ và fructozơ D. mantozơ và
fructozơ

4. 4. Câu 17. 4.1 gam. phenylamin.90g B. 1. X tác dụng với Na và với dd AgNO3 / dung dịch NH3. HCOONH2(CH3)2 B. 1. Cô cạn Y được 34. B. 4. Câu 20 Đốt cháy hoàn toàn m gam hỗn hợp gồm C2H4. C3H6. HCOONH3-CH2CH3 Câu 14. Sắp xếp theo thứ tự tăng dần nhiệt độ sôi của các chất sau: CH3OH(1). 3. 16. A. D. 9. 1. 15. Thuỷ phân một hợp chất gluxit Y theo phương trình hoá học: Y + H2O  → 2X. etylamin. . 2. CH3CH2COONH4 D. 3.05% khối lượng nitơ. A.37 gam chất rắn khan. 5. Để phản ứng hết với các chất trong X cần dùng 200 gam dung dịch NaOH 8.1 mol amino axit X cần 200g dung dịch NaOH 4%. B. saccazozơ. CH3COONH3-CH3 C. (4) (CH3)2NH. H2NCH2COOH B.1 gam. xenlulozơ. D. metylamin.H2NCH(COOH)2 C. 5. C. H2NCH2CH(COOH)2 -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. B.65g D. H2NCH2CH2COOH D.Câu 21 Khối lượng axit CH3COOH cần lấy để tác dụng vừa đủ với 10. mantozơ. Một chất béo có công thức: CH2(OCOC17H33)-CH(OCOC15H31)-CH2(OCOC17H29). 3. D. (3) C6H5NH2. C. 6. C. Cô cạn dung dịch thu được 16. 3. Cho m gam hỗn hợp 2 amino axit (trong phân tử chỉ chứa 1 nhóm amino và 1 nhóm cacboxyl) tác dụng với 110 ml dung dịch HCl 2M được dung dịch X. D. Công thức phân tử của X là A. 1. 3. A. 1. 6. 18. 1. 0. 4. 5. tinh bột.65 gam C3H7OH (phản ứng có H2SO4 xúc tác. CH3-CH2-COOH C. 4. 2. 6. Số mol H2 cần để hiđro hoá hoàn toàn 1 mol chất béo là A. Hãy lựa chọn công thức cấu tạo đúng của X. (5) C2H5NH2. 4. C. X tác dụng với NaOH đun nóng thu được muối Y có phân tử khối lớn hơn phân tử khối của X. Hãy lựa chọn công thức đúng của X.t o Câu 19. Câu 18. 5. 1. C2H5OH(2). D.Câu 13. 5. 5. 3. 17. C. HO-CH2-CH2-CH=O B. axit. 2. 2. C. 2. (6) p-O2N-C6H4NH2. 2. HCHO(5).12. 6.1 gam. X và Y đều có phản ứng tráng gương trong điều kiện thường.68 lít khí CO2 (đktc). Cho hơi của X tác dụng với CuO.25g B. 1.Câu 22 Trung hoà 0. Chất hữu cơ X có công thức phân tử là C3H9O2N.Câu 23. Chất X có công thức phân tử là C3H6O2.4% được dung dịch Y.65g -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. CH3COOC2H5(4). 5. 3. Sắp xếp theo thứ tự tăng dần tính bazơ của các chất sau: (1) NH3. 2.1 gam. Amin đơn chức X chứa 15. 3. đun nóng. Tên X là A. 1. HCOO-CH2CH3 Câu 15. B. 10.15g C.Câu 16. B. giả thiết hiệu suất phản ứng 100% ) là A. 5. Giá trị của m bằng A. 5. 10. CH3COOH(3). (2) CH3NH2.95g -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------.3gam muối khan. -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. 3. B. 1. 2. 1.t0. Y là A. C4H8 thu được 1. 4. 4. A. Giá trị của m là A. D.05g D.12g C. CH3-CH(OH)-CH=O D. 1.t0 thu được chất hữu cơ Y đa chức. pentylamin.

B. CH2(OH)CH2(OH). clobenzen và phenol. C. CH2=CHCl.47 gam α -aminoaxit Y tác dụng với NaOH dư tạo ra 1. Câu 26. H2NCH2CH2COOCH3 -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. fructozơ. clobenzen và anilin. D. 639. Khi E phản ứng với dung dịch NaOH đun nóng. C. tơ lapxan.835 gam muối clorua. NaOH và Ag2O trong dung dịch NH3 sinh ra Ag. 609. Câu 29. Công thức cấu tạo của X là A. HCl loãng . HOOC-CHO D. D. Muối của axit không no. saccarozơ.Câu 33Trong các chất sau: CH3-CH=CH2. Mặt khác. Chất X và Y là A. C. C. C. H2NCH2COOH. 619.9 gam hợp chất hữu cơ E thu được 13. NH2-CH2-COOH. CH3(CH2)4CH(NH2)COOH. B.12 lít N2 (đktc). D. D. tơ capron . tơ nilon . Axit no. CH3COOCH2NH2.83 kg. Cho 1. H2NCH2COOCH3. sản phẩm thu được có metanol.83 kg. mantozơ thì những chất không có khả năng tham gia phản ứng tráng gương là: A. -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. nhóm chất nào thuộc loại tơ tổng hợp ? A.83 kg. HOCH2CH2CHO -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. D. 629.Câu 32.47 gam Y tác dụng với HCl dư tạo ra 1. Người ta sản xuất xenlulozơ trinitrat từ xenlulozơ và axit nitric ( sự hao hụt trong sản xuất là 12 %). 1. Saccarozơ và mantozơ. Khi thuỷ phân dầu thực vật xảy ra phản ứng một chiều. B. B.625. Tơ vissco . Từ sơ đồ phản ứng : C6H6 → X → Y → 2. C2H5COOHC. Tơ nilon . Chất hữu cơ X có tỉ khối hơi so với metan bằng 4. 6. Glucozơ và mantozơ. Muối của axit no D. Câu 28 Các nhóm chất sau đây. CH3CH(NH2)COOCH3 D. HOOCCH2CH2CH(NH2)COOH. còn số mol CO2 bằng 2 lần số mol nước. nitrobenzen và anilin. Glucozơ.-----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. HCOOC2H5 B. tơ axetat . D. bông . B. X tác dụng đươc với Na.Câu 25.2 gam CO2. Glucozơ và saccarozơ. Tỉ khối hơi của E so với hiđro bằng 44. C. Axit không no . Công thức cấu tạo của E là A. Công thức cấu tạo của Y là A.5. HCl bão hoà. len . Câu 27 Xúc tác dùng trong phản ứng este hoá của amino axit là : A.Câu 30. CH3CH(NH2)COOH. tơ capron. Khối lượng xenlulozơ cần dùng để sản xuất ra 1 tấn xenlulozơ trinitrat là A. Khi đốt cháy X thu được số mol H2O bằng số mol X đã cháy.83 kg. C.4. Tơ vissco . những chất tham gia được phản ứng trùng ngưng gồm .3 gam H2O và 1. nitrobenzen và phenol.6 tribrom anilin. Saccarozơ và fructozơ.91 gam muối natri. ngoài glyxerin ta thu được chủ yếu : A. H2SO4 đặc. C. B. Đốt cháy hoàn toàn 8. H2SO4 loãng.Câu 24. B. Câu 31. Tơ tằm . B.

CH2=C(CH3)CH2OH. C. C. 2. B.64. CH5N.18 gam một hợp hợp chất amin đơn chức Y bằng một lượng không khí vừa đủ. B.A. Để tác dụng hết với dung dịch X cần 840 ml dung dịch NaOH 1M.76. Công thức của este đó là A. B. C. D. 4. 1. CH2=CHCl và CH3-CH=CH2. dư HCl. D. B. C3H9N. Biết hiệu suất phản ứng bằng 60%. -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. 4. CH3-CH=CH2 và NH2-CH2-COOH. C4H8O2 D. 2. CH3COOH. 7. 4.Anilin phản ứng với nước brom tạo thành p-bromanilin. CH2=C(CH3)CH2CH2OH.54. 8. 5. D. Dẫn toàn bộ khí sau phản ứng vào bình đựng dung dịch Ca(OH)2 dư thu được 6 gam kết tủa và 9. aminoaxit và HCl cùng hết. HO-CH2-CH2-OH và NH2-CH2-COOH. C4H6O4. Các thể tích đo ở cùng điều kịên. Axit đó là: A.Câu 39: Cho một axit cacboxylic đơn chức tác dụng với etylenglicol thu được một este duy nhất.54. C4H11N.4 gam muối. Vậy khi tạo thành dung dịch X thì A.632 lít khí (ở đktc) duy nhất thoát ra khỏi bình. CH3CH(CH3)CH2CH2OH. 2. -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. 9. 6. 1. X có công thức là: A. 3. D. C. 4. C. HO-CH2-CH2-OH và CH3-CH=CH2.2 mol este này tác dụng vừa đủ với dung dịch NaOH thu được 16. Những câu đúng là: A. Ngưng tụ sản phẩm cháy thấy thể tích giảm 30 ml. HCOOH. B.Câu 40: Đốt cháy hoàn toàn 1. ---------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------- . không xác định được. -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. 1. B. CH3CH(CH3)CH2OH. B.Câu 36: Cho các câu sau: 1. C. Giá trị của m là: A. Câu 34: Cho sơ đồ: + CuO + O2 + CH3OH trùng hợp X → Y → D →E → thuỷ tinh plecxiglat. 4.Vinyl axetat không điều chế được trực tiếp từ axit và rượu tương ứng.2 gam glixerin và 9 gam CH3COOH có xúc tác thu được m gam sản phẩm hữu cơ E chứa một loại nhóm chức. A. Tìm công thức phân tử của Y.Tơ nilon. tơ capron.Chất béo thuộc loại chất este. tơ enang đều điều chế bằng phản ứng trùng ngưng. D. dư aminoaxit.Câu 38: Đun 9. C2H7N. Cho 0. 3.Nitro benzen phản ứng với HNO3 đặc (xúc tác H2SO4 đặc) tạo thành m-đinitrobenzen. -----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------. C. D. C8H6O4. B. C4H6O2. 5. 3. Câu 35: Đốt cháy hoàn toàn 10 ml một este cần 45 ml O2 thu được V CO2 : V H 2O = 4 : 3. D. Câu 37: Cho hỗn hợp hai aminoaxit đều chứa 1 nhóm amino và 1 nhóm cacboxyl vào 440 ml dung dịch HCl 1M được dung dịch X. C2H3COOH. C2H5COOH. C.

--------------------------------------------------------------------------------------------------------------------------------- .

Sign up to vote on this title
UsefulNot useful