You are on page 1of 68

KENDRIYA VIDYALA YA SAN6ATHAN

U BAI

Class XII

Subject:

CHEMISTRY

(For Use ofKV Students Only)

December 2010

oac

(KENDRIYA VIDYALAYA RHE, KHADKI, PUNE.20


FIRST PREBOARD EXAMINATION 2010-11
TIME: 3 HOURS
MAX.MARKS: 70

CLASS- XI SCIENCE
SUBJECT: CHEMISTRY

1)
2)
3)
4)
5)
6)
7)

GENERAL INSTRUCTIONS
All Questions are compulsory.
Marks for each question are indicated against it.
Question numbers 1 to 8 are very short answer questions and carry one mark each.
Question no.9 to
are also short answer questions and carry 2 marks each.
Question no.19 to 27 are also short answer questions and carry 3 marks each.
Question no.28 to 30 are long answer questions and carry 5 marks each.
Use of calculator and other electronic devices are not allowed. Use Log tables, if
necessary.

is

1.What do you know about doping


2.State the value of i for the dissociation of K4!e(CN)6J
3.State the colloidal range
4.What is the function of Na3AIF6in the Hall process
5.Write the IUPAC name ofCHChCHCh

1
1
1
1
1

6.Give the Tollens test for-aldehyde


7.State the proticity ofH3P04and oxidation number ofP in it
8.Give the balance reaction for Haber process
9. 1.26g of protein contain in 200cm3 aq. Solution of protein ,the osmotic
Pressure Of solution at 300K is 2.57bar calculate the molar mQ6'S
of protein
[/2.::
00 g"3 Li} haT }<;,-Irnof~/ J
10. The rate constant of a reaction K= 5.5?<10-14S -1Predict the order and
Calculate Half life of the reaction.
11.(a)Why phenols are more acidic than alcohols
'(b }Why Ethers are used as solvent in number of organic reactions.

1
1
1

12. How will you convert -

2
2
2

a) Aniline to Chlorobenzene
b) Aniline to Azodye (any)
13. State the following term with suitable examples
a) Peptide bond
b) Glycosyldic linkage
.:
14. Distinguish between ideal and non-ideal solution (any four points)

15. Give a balance chemical equation for each of the following


a) Esterification
.
b) Hemi acetal and acetal formation
16. Identify A, B, C & D

R-X -tKc,} A

H'2./Ni
Nq/H ct/~o}

B_C_i?

R-c~

~CI

2
I

17. Distinguish between DNA & RNA

18. What do you know about hydrometallurgy. Give a balance chemical equation for
silver Cynide process.
LCQch; ~)(J of s; 1V e '6
2

0,

'1

--

---~
pa

19. In the FCC lattice the edge length of unit cell is 408.6 pm. Calculate the density of
crystal. (If the atomic mass of crystal is 108 u)
3
20. Give the correct answer of-the following
3
a) Why catalyst can increase the rate of reaction.
b) Why inversion of cane sugar is pseudofirst order reaction.
c) What will be the unit of specific rate constant for the second order reaction.
21. State Hurd)' and Schulze rules for the co-agulation and identify the physical state

of

the dispersed phase and dispersion medium in - a) Milk

b) Blood

22 Give the reason of the following


a) oble gases have very low boiling points
b)Flurine (F2) is stronger oxdising agent than (Cl-)
c)PCIs decomposes to PCi) and Cl, on heating.
23. a)Write the IUPAC name of ionization isomer of [Co(NH3)sS04]Br
b)Explain the shape and magnetism of Ka [Fe(CN)6] by VBT.

24. A organic compound with molecular formula C4H9Br optically active.


3
Explain its probable mechanism and products form when it reacts with NaOH.
25. Write the structure and names of monomers -

a) Nylon-2, Nylorr-o
b) Teflon
c) Dacron
26. Give example of each C OYJ I" n arn e s)
a) Short spectrum and broad spectrum antibiotics.
b) Antiseptic and disinfectant
c) Fat soluble and water soluble vitamins

27. Draw the structure ofXeF6 and BrF3


What happens when yellow phosphorus reacts with aquous NaOH.
OR
27.Complete and balance the following chemical reactions.
i)
ii)
iii)

XeF6 +NaF ~
Cu+ H2S04 (CONC)~
F2+ H20
-?-

.
+
+

+ 2H20
.

pa

ityof
3

28.Standard electrode potentical of two electrodes are gven as EOAl 3+IAI :::-1.66V

and
a)
b)
c)
d)
3

EOFe2+/Fe = -044.V
Construct the electro chemical cell in symbolic form.
Write half cell reactions and overall cell reaction.
Calculate the standard emf of the cell.
Calculate the emf of the cell when both the electrolyte solutions are 0.1 molar
concentrations at 25C.

,.,

OR

-'

a) State the kohlrausch law.


b) Write the product of electrolysis ofaq.NaCI.
c) Give the SI unit of Molar conductivity.
d) Calculate the charge of 1 mole of electrons.

28.

,.,

-'
,.,

H.

29.a)
b)
c)

Calculate the Magnetic moment of divalent ion in aq solution if its


atomic number is 25.
How will you prepare K2Cr207 from chromite ore.
Why transition elements and their compounds are coloured.

.~

OR
3
29. a) What is Lanthanoid contraction? Give the reason and write the consequences' 5
of lanthannoid Contraction.
b) How will you prepare KMn04 from Mn02.
c) Why the highest oxidation state of metal exhibited in its oxide or fluoride only.
3

30. a) Distinguish between


5
a. Acetone and diethyl ketone
b. Propan l-al and propan-2-one.
b) What happens when
i)
Grignard reagent reacts with CO2 in dry ether followed by acidification,
ii)
Esters react with NaOH followed by acidification.
.
iii)
Give the balance chemical reaction for cannizaros reaction.

OR
30.

a) Why addehydes are more reactive than kentones for Nucloephillic addition reaction.
b) An organic compound with a molecular formula C9HlO0 forms 2,4 DMP
derivative, reduces Tollens reagent and undergoes cannizzaro reactions. On vigorous
oxidation, it gives, 1,2 benzene dicarboxyllic acid. Identify the compound and write all the
above- mentioned reactions.
5

~----

KE

DR

A 'IDYALAYA

GANESHKHIND

E 0 RD EXAMINATION Time 3Hrs

55 ~II

PUNE
~IO-

~O\,

UB- CHEMISTRY

MM=70

General Instructions:
1. All questions are compulsory.
2. Questions from 1 to 8 are very short ans ',er

est

s and carry 1 mark each.

3. Questions from 9 to 18 are short ans !.Ierques ions and car

2 marks each.

4. Questions from 19 to 27 are also short answer ques ions and carry 3 marks each .

5. Questions from 28 to 30 are long answer questions and car


6. Use log table if necessary. Use of calculators is not alia

5 marks each.

ed.

l.In calcium fluoride structure what would be the coordination number of


calcium and fluoride ions?
2. Why is an increase in temperature observed on mixing chloroform and
acetone?
3.DeJine enthalpy of adsorption.
4. What is the function of flux?
5. What is meant by inert pair effect?
6.Why is PIll weaker than NH]?
7.Give one chemical test to distinguish between chlorobenzene and ethyl
chloride
8.Name the reagent which converts benzoic acid into benzene directly?
9.A solution contains 23g ethanol and 72g of water. Calculate the mole
fraction of ethanol and water.
10.When fruits and vegetables that have dried are placed in water they
slowly swell and return to original form.WhyjWould
a temperature increase
accelerate the process? Why?
I I. Write the Arrhenius equation.How the value of activation energy is
determined graphically?
12,Write the chemical equation of reaction taking place in the extraction of
zinc from zinc blende.
13. Account for the following
I .Ethers are weak bases
2. Ethers are soluble in water.
14.What happens when
a)EthanoJ vapors are passed over alumna at 600K
b)Exccss ethanol is heated with cone. H2S04 at 413 K

c
r

c
~
c
e-

"

b)Excess ethanol is heated with cone. H2S04 at 413 K


IS.Discuss carbylarnines reaction. What is its use?
16.How would you prepare
I.Aniline from nitrobenzene
2.Methylamine from ethylamine.
J 7.How is glucose
prepared from cane sugar?
IS.Explain mutarotation.Give
its mechanism in case ofD-glucose.
19.5ilver crystallizes in fee lattice. ffedge length of the cell is 4.077 x 10--8
ern and the
density is 10.5 glec calculate the atomic mass of silver.
20.The rate constant of a reaction with respect to A,is 6 min-I .If start with
=0.8
mol/L when would [AJ reach the value of 0.08 mol/L
21 .Explain the following terms.
a) Ferric hydroxide sol get coagulated on addition of sodium chloride
solution.
b) Cottrells smoke precipitator is fitted at the mouth of the chimney used
in factories.
c) Physical adsorption is multilayered while chemisorption is
monolayered.
22.Account for the following.
a.Penta valent bismuth is.a strong oxidizing agent.
b.Ofthe noble gases only xenon is known to form real chemical compounds.
c.Despite its lower electron affinity fluorine is a stronger oxidizing agent
than chlorine
23.What happens when dioxygen is treated with
a)Phosphorus
b)Zinc sulphide c )HCl in presence of CuCh
24.[Fc(CN)(J'-is
weakly paramagnetic while [Fe(CN)6]4-is diamagnetic.
Explain

rA-,

ase

of

->

2S.Although chlorine is an electron withdrawing group yet it is ortho para


directing in clectrophilic substitution reactions. why?
26.Discuss primary, secondary and tertiary structure of proteins.
27.How are polymers classified on the basis of their method of synthesis?
Give two examples of each class.
28.a)Calculate the standard Creeenergy change for the following reactions at
2S C
Au(s) + Ca2+ (aq,lM) ~ Au:1+ (aqj.IM) + Ca(s)
EO Au3+/Au = + 1.5 V EO Ca2+iCa = --2.8V
Predict whether the reaction wi II be spontaneous or not at 25 C .Which of
the above two
half cells will act as all oxidizing agent and which one will be a reducing
agent?

N
I

o
....
o
N

....
I

><

...

'0

~
o
co,

...

<!)

0..

. b)Thc conduct i vi

ty uro.oo

I i\II acetic acid is 4 x 10 :. Skm.Calculate

dissociat

ion

constant
O/~

of acetic acid if JI..{lM of acetic acid is 390.5S

or

a)Explain how ,uSlillg


iron is envisaged
electrochemical
cell.Give
any t\-VO methods of prevention
ofrusting.

as setting

crn '

111101

lip ofa

the

b)Explain the reactions taking place in cathode and anode of dry cell.
29.Describe
the preparation,
properties (any two) and usestan-, 1\ 0) of
po tass i urn
dichromate.
OR
What happens when
I.Potassium pcrrnanganatc
is treated with ozone
2.sodium tb iosulphato is treated with acidified K:zCr:!O,
3.PotassiLlI11 iodide is treated with alkaline KMno.,
with acidified

potassium

dichromate

5./lydrogCIl peroxide is treated with acidified


solution.
30. How woul d you convert
I. Propanal to buianonc
I Y; Nt
2.Pmpanone
to propene
.~ I Y2M

potassium

permanganate

4.//ydrogen
sol uti on.

3.Benzaldehyde
OR

peroxide

is treated

to 3-phenyl

propane-I-ol

2M

Describe the [ol lo wing name reactions


I.Gabriel pthalimide
synthesis
2M
1.Rcilllcr-Teimallll
reaction
112M
3. Wolf kishner reduction
112M

with the help of equations.

........................................................

KENDRIYA VIDYALAYA (O.F.) BHUSAWAL


Pre Board Examination 2010-11
Class -XII Chemistry

t.

Time -3 Hrs.

M.M.70

General Instruction

:-

1. All questions are compulsory.


2. Question No.1 to 8 are very short answer type and carry one mark each.
3. Question No. 09 to 18 carry 2 marks each.
4. Question 19 to 27 are short answer carry 3 marks each.
5. Question No. 28 to 30 are long answer type and carry 5 marks each.
6. Use log table if necessary, use of calculator is not allolf'ed.
Q.1.
Q.2.

What is f center?
.The conversion of molecule x to y follow second order kinetics.If concentration of x is
increased three times how will it affect rate of formation ofy
Why does phenol has higher boiling point than toluene?
Q.3.
Q.4.
How is phenol prepared from cumene ?
Which of the two Fe2+ or Zn2+ is coloured?
Q.5.
Complete the reaction: XeF6 + H20 ---7
Q.6.
What is the role of stabilizer in froth floatation process? Give examples
Q.7.
Why does R3P=O exist but R3N=O does not
Q.8.
Q.9. Crystalline CsBr has a bee structure. Calculate the unit cell edge length if the density
of CsBr crystal is 4.24 cm-3
Define
molar conductance. How does molar conductance of a weak electrolyte vary
Q.I0.
with dilution?
Q.ll. Calculate equilibrium constant of the reaction:
Zn + Cd+2 <-> Zn+z +Cd
Given

EO cell

=0.36 V
OR

reduction potential of Ni+z / Ni if the cell potential of the cell ;


Ni INtZ (O.Ol)M II Cu+z(O.lM) I Cu is .59 V. Given that EO Cu+z / Cu (S) = +.34 V
Calculate the standard

Q.12.

Give IUPAC name of;


(a) CH3-CH-CH2-CH2-CHO

(b)(CH3hC=CH-C-CH=C(CH3h

II

CHO
0
Q.13
Discuss the mechanism of dehydration
when butan-2-ol is heated with cone.
H2S04 AT 443 k. Name the product formed.
Q.14. With the help of suitable example explain (a) Aldol condensation (b) Carbylamine
reaction
:
Q.15. (a) Give the structure of'Xef', and XeOF4
(b)How can you prepare Cb from HCl ? Write reaction
Q.16. (a) Methylamine in water reacts with ferric chloride to precipitate ferric hydroxide.
Explain.
(b) Why aniline is less basic than ethyl amine?
Q.17. What is Zwitter ion and isoelectric point?
Q.18. Show how would you synthesise the following aicohol from suitable alkenes;

Q.19.

Q.20

Q.21.

Q.22.
Q.23
Q.24.

Q.25.

Q.26.

Q.27.

Explain the following; ,


(a) Antihistamine
(b) anionic detergent
(c) Artificial sweetening agents
(a) Copper can be extracted by hydrometallurgy
but not zinc.
(b) What is the role of depressant in froth floatation process?
(c) Why is the reduction of a metal oxide easier if the metal is formed in liquid st
the temperature of reduction ?
Fe/HCl
HN021273K
C6HsOH
C
(a) C6HsN02 ----7
A
)B ---~)
KCN
LiAI~
HN02 /OOC
(b) CH3CH2Br--4
B)
C)
cucn
H20l'lr
NH3 / 6.
(c) C6HsN2CI ------Jt
B)
C )
An element with molar mass 2.7 x 10-2 Kg mo -I forms a cubic unit cell with ed
length 405 pm.If its density is 2.7 x 103 Kg-3 .what is the nature of the cubic unit
Write name of monomer and use of;
(c) Bakelite
(a) Nylon - 66
(b) Terylene
(a) Explain denaturation of protein.
(b) What is glycosidic: linkage?
(c) Why Vitamin C cannot be stored in our body?
(a)How will you prepare colloidal solution of gold.
(b) What happens when a small amount of FeCh is added to the precipitate
Fe(OH)3 ?
(c) What is the difference between multi-molecular and macro-molecular colloids'
How will you account for the following?
(a) Transition metal show variable oxidation state.
(b) The enthalpy of atomization of the transition element are high.
(c) Why are Mn +-2compounds more stable than Fe +2 toward oxidation to their state?
A certain reaction is .50% completed in 20 minutes at 300 K and the same reaction
again 50% completed in 5 minutes at 350 k .Calculate activation energy if it is
first order reaction

[R:= 8.314JK1 ;log 4

.602]

OR
For the decomposition

of azoisopropane

to hexane

and nitrogen

at 543 K .the

following data is obtained.


t (see)

P(mm ofHg)

35.0

360

54.0

720

63.0

Calculate the rate constant.


Q.28.

(a) Osmotic pressure of a 100 cm ' of a solution containing 3.002 g of an unidentified


solute is 2.55 atmosphere at 298 K. What is the molar mass of the solute?
(b) Henry's law constant for CO2 in water is 1.67 x 108 Pa at 298 K .calculate the
Quantity of CO2 in 500 ml of soda water when packed under 2.5 atm CO2 pressure
At 298 K

(a) Two element A and B form compounds having AB2 and AB4 .When dissolve in
20 g of benzene (4H6) ,1 g of AB2lowers the freezing point by 2.3 K whereas 1.0
G of AB4 lowers it by 1.3 K. The molar depression constant for benzene is 5.1 K
Kg mol" . Calculate atomic masses of A and B .
(b) Explain why the molecular mass of acetic acid when dissolve in benzene is more
than normal molecular mass

liquid s
Q.29.

Iwith ed
ibic unit

(1) How will you distinguish between;


(a) CH3CHO and CH3COCH3
(b) CH3CHO and C6HsCHO
(c) CH3COC6HS and C6HsCOC6HS.
(2)How will you convert ;
(a) Acetophenone to 2-phenyl-2-butan-2-ol
(b) propene to acetone

-OR
(1) An organic compound A molecular formula CgHI60; was hydrolysed with dilute
Sulphuric acid to give a carboxylic acid B and an alcohol C .oxidation of C with
chromic acid produced B .C on dehydration gives but-I-ene . Identified A,B and C .
Write reaction involved

Jrecipitate
r colloids

Il

Q.30.
r

(2) Predict the product formed when cyclohexanecarbaldehyde


(a) PhMgBr than H30+
(b) Zinc amalgam and dilute hydrochloric acid
(a) Why dose PCb fumes in moisture.
(b) Write the structures of the following;
(1)~P207
(2) H2S20g (3) H3P04 (4) H2SOS
(c) How is the presence of S02 detected

OR

to their -

(a} How does fluorine differ from rest of family member


(b) Give the structure ofXcF2 and XeF6 .
(c) Complete the following;
XeF6 +NaF
)
P4+NaOH+H20
)

ne reaction

f it is

----:::::
'543 K .th;

I
unidentified

.ate the
~ pressure

react with

KENDRIYA VIDYALAYA, AMBARNATH


FIRST PRE BOARD EXAMINATION . 201

o,

Sub. : Chemistry

M.M.

Std. :. XII

Time

General lnstructlons
1)

All questions are compulsory.

2
2)

Marks for each question are indicated against it, answer them accordingly.

3)

Use log tables, if necessary.

1)

Which point defect in crystal of a solid does not change the density of the solid?

2)

Why is ferric chloride preferred ()ver potassium chloride in case of a cut leading
to bleeding?

3)

Arrange the following compounds in an increasing order of basic strengths in


their aqueous solutions . NH1 C~H5NH2' (C]HJ2 N~J,(C]H5}, N

4)

Write the structure of 1 - Phenylpropan - 2 - 01

5)

Give one chemical test to distinguish between Aniline and benzylamine.

6)

What is meant by the term. pynometallurgy

7)

Write the IUPAC name of the following compound - OHC.C)-l~ .CI-IO- P

8)

Why the use of aspartame limited to cold foods and drinks? .

9)

What type of cell is a lead storage battery? Write the anode and the cathodereactio
and the overall cell reaction occurring in the use of a lead storage battery.

10)

11)

Define the following:


i)

Elementary step in a reaction.

ii)

Order of a chemical reaction

Describe the role of the followingi)

NaCN in the extraction of silver from a silver ore.

ii)

Cryolite in the extraction of aluminium from pure alumina.

M.M.

a)

How will you distinguish between Propan-I-of and Propan-2-01

b)

Illustrate the followings with example

(i +2)

Time
i)

Williamson Synthesis

ii)

Reimer - Tiemann Reaction

Differentiate

a)
solid?

the 1oJJowjngs

wHh example -

i)

Thermoplastics and thermosettings

i i)

Homopolymer and Copolymer

(2+3)

Define the terms osmosis and osmotic pressure. What is the advantage of using osmotic
oressure as cornoarad to othar colliqative properties for the determination of Molar Masses
of solutes in solution?

ading
b)

What concentration of nitrogen should be present in a glass of water at room temperature.


Assume a temperature of 25C,a total pressure of 1 atm and mole fraction of nitrogen in

in

air of 0.78 (KH for Nitrogen

= 8.42 x 10-7

M/mm Hg)

OR

a)

b)

i)

Mole fraction

ii)

Molarity of a solution

Calculate the temperature at which a solution containing 54g of glucose in 250g


of water will freeze. (~ for water

dareactio

a)

b)

(2+3)

Define the following terms -

= 1.86 K Kg rnor+)
(2+3)

Draw the structure of i)

BrF3

ii)

H2S207

Account for the followings i)

Pentahalides are more covalent than trihalides.

ii)

ICI is more reactive than 12,

iii)

Noble gases have very low boiling point.


OR

100-10-11/4

30)

a)

Draw the structure of

b)

Explain the followings -

a)

b)

i)

Solid phosphorus pentahalides behaves as an ionic compounds.

ii)

All the bonds in PCls are not equal in length.

iii)

Sulphur in vapour state exhibits pararnaqnetisrrr-

How will you carry out the following conversions i)

Acetaldehyd to butan - 1, 3-diol

ii)

Acetone to propene

Identify the unknown organic compoundsCI-IC LI

i)
()

ii)

A+B

..c;

dilNaOH)

(i)

0,

) A +B

(;;) Znj H,O

C+H,O

iii)

iv)

OR
An organic compound (A) having molecular formula C9H100 forms on orange -precipitate (8) with 2, 4- DNP reagent. Compound (A) gives a yell0"Y precipitate

when heated in the presence of iodine and NaOH along with a colourless compo
(D). (A) does not reduce Tollen's reagent or Fehling solution nor does it decolorise =water. On drastic oxidation of (A) with chromic acid a carboxylic acid (E) of molec
formula C7H602 is formed. Deduce the structures of the organic compounds (A) t

KENDRIYA VIDYALAYA,CME
PRE BOARD EXAMINATION 2010
CHEMISTRY

; 3 O[C 2010

CLASS-XII
Max. Marks: 70
Time: 3 hours
General Instructions:
a) Question nos. 1 to 8 is very short answer question and carries 1 mark each.
b) Question nos.9 to 18 is short answer question and carries 2 marks each.
c) Question nos. 19 to 27 is also short answer question and carries 3 marks each.
d) Question nos. 28 to 30 is long answer question and carries 5 marks each.
1) Of physisorption
adsorption

and chemisorption

which type of adsorption

has a higher enthalpy

of

and why?

2) Write the IUPAC name of the following

compound:

CH3-0-CH2-CH(CH3)-CH2-CH31

3) What is the total number of atoms per unit cell in a face centered

cubic crystal

structure?

4) Describe

glycosidic

linkage,

giving an example.

5) Draw the structure of the compound


6) Which is the strongest

whose IUP AC name is 4-chloropentan-2-one.

acid in aqueous

solution, HF or HCI?

7) Define the term polymerization.


8) Write the chemical reaction
diazonium

in which iodine ion displaces

diazoniurn

group from a

salt.

9) Depict the galvanic cell in which the following


Zn(s) +2Ag+(aq)

reaction takes place:

-7 Zn2+(aq) +2Ag(s)

Further indicate what are the carriers

of the current inside and outside the cell? State the

reaction at each electrode.


(OR)
Write complete

n orange re
)recipitate (C
iSS

compoun

decolorise Sr:
.) of molecule:
rnds (A) to (E

i) Oxidation

chemical

equation

for:

of Fe2+ by Cr207 2- in acidic medium.


.:

ii) Oxidation

of S203

2-

by Mn04- in neutral aqueous medium.

10) i) Arrange the following


C6H5NH2, (C2H5hNH,

(C2H5hNH,

order of basic strength

in increasing

order of basic strength

(C2H5)3N and CH3NH2.

\v
IOC

in water:

(C2H5)3N and NH3

ii) Arrange the following


C2H5NH2,

in an increasing

in gas phase:

11) Define the term 'osmotic pressure'. Describe how the molecular mass of a substance
can be determined on the basis of osmotic pressure measurement.

12) What chemical principle is involved in choosing a reducing agent for getting the
metal from its oxide ore? Consider the metal oxide. AbO] and Fe20] and justify the
choice of reducing agent in each case.

13) Distinguish between homopolymers and copolymers and give an example of each
class.

14) List the factors which influence the rate of chemical reaction.

...

15) Write one chemical reaction to illustrate the following:


i) Hoffmann's bromamide reaction.
ii) Gabriel phthalamide reaction.
16) Answer the following:
i) Which neutral molecule would be isoelectronic with ClO- ?

ii) Of Bi(V) and Sb(V) which may be stronger oxidizing agent and why?
17) i) Why are haloalkanes more reactive towards nucleophilic substitution reactions than
haloarenes?
ii) Which one of the following two substances undergo SN1 reaction and why?
a) CH3-CH2-CH(CI)-CH2-CH3

b)CH3-CH2-CH2-CH2-CH2-Cl.

18) What is meant by lanthanoid contraction? What effect does it have on the chemistry
of the elements which follow lanthanide?
19) What is a semiconductor? Name the two main types of semiconductors

and explain

their mechanism.
20) Mention the use of the following drugs and the name of class of drugs to which the.
belong: i) Ranitidine

ii) Paracetamol

iii) Tincture of iodine.

21) i) What is the basics of formation of the spectrochemical

series?

ii) Draw the structure of geometrical isomers of the following co-ordination complexe:

a) lCo(NH3)3Ch1

and b) lCoCh(en)21+

:)

22) i) Name the reagent and write the chemical equation for the preparation of the
following compounds by Williamson's
a) Ethoxy benzene

synthesis:

b) 2-methyl-2-methoxypropane

ii) Why do phenols not give the protonation reaction readily?

23) Calculate the temperature

at which a solution

water will freeze. (Kr for H20

= 1.86K Kg/mol)

containing

54g of glucose,

in 250g of

OR

A solution containing

8g of a substance

pure ether boils at 35.60C.

Determine

in 1OOg of diethyl ether boils at 36.86C whereas


the molecular

mass of solute.

(K, for ether = 2.02K Kg/mol)


2

24) Explain what is observed

i) KCl, an electrolyte,

3
when:

is added to hydrated

ferric oxide sol.

ii) An electric current is passed through a colloidal


iii) A beam of light is passed through a colloidal
25) How would you account

i) The transition

for the following

metals generally

form coloured

Cr2+ acts as a reducing

agent.(Atomic

= 24 and Mn = 25).

iii) The actenoids

solution.

situations?

ii)With 3d4 configuration


mass of Cr

solution.

compounds.
agent but Mn3+ acts as an oxidizing
3

exhibit a larger number of oxidation

states than the corresponding

lanthanoids.

26) What happens when D-glucose


i) HI

ii) Bromine

water

is treated with the following

reagents?

iii) HN03

reaction takes 40 minutes

27) A first order decomposition

for 30% decomposition.

Calculate tl/2 value for it.

2
explain
3

28) a) Complete the following

chemical

i) F2 + H20 -7

+ H20 -7

b) Draw the structures

vhich they

i) H2S207

ii) Ca3P2

of the following

reaction

equations:
iii) XeF4

+ H20 -7

species:

ii) N03-

OR
Assign reasons for the following:

-omplexes:

i) Sulphur vapour is paramagnetic.


ii) NH3 has greater affinity

of the

for protons than PH3.

iii) The negative value of electron


i ) SF6 is much less reactive

gain enthalpy

of F is less than that of Cl.

than SF4.

) Of the noble gases only Xe is known to form well established

l,

chemical

compo

29) a) Giving a chemical equation for each, illustrate the following process:
i) Cannizzaro reaction

ii) Acetylation

iii) Decarboxylation

b) State chemical tests to distinguish between the following pairs of compounds:


i) Propanal and propanone

ii) Phenol and benzoic acid.


OR

a) An organic compound A contains 66.77% of carbon, 11.63% of hydrogen and the rest
is oxygen. The molecular mass of the compound is 86. It does not reduce Tollens reagent
but forms an addition product with sodium hydrogen sulphite and gives positive iodoform
test. On vigorous oxidation it gives ethanoic and propanoic acids. Write the possible
structure of the compound A.

30) Conductivity ofO.00241M acetic acid is 7.896 X 10-5 S/cm. Calculate its molar
conductivity if Am 0 for acetic acid is 390.5 S cm2/mol. What is its dissociation constant?
OR
a) Derive the general expression for half life of a first order reaction.
b) The decomposition of ammonia on platinum surface is a zero order reaction. What
would be the rate of production of dinitrogen and dihydrogen if k

2.5 X 10-4 Llmolls? 5

'-I

KENDRIYA VI DYALAYA NO.1DEHU ROAD, PUNE

I the rest
s reagent
iodoform

sible

Pre-board XII

SUB:-CHEMISTRY

M.M=70

TIME:

3 HRS

.................................................................................................................................................
General Instructions:
l)AII questions are compulsory
ii)Questions number lto 8 carry 1 mark each.

iii)Questions number 9 to 18 carry 2 marks each.

olar

iv) Questions number 19 to 27 carry 3 marks each

onstant?

v) Questions number 28 t030 carry 5 marks each


vi)Use Log tables

if necessary .Use of calculators not allowed .

.....................................................................................................................................................................................
What

(lX8=8)

Llmol/s? 5
1.Which of the following

elecfrolytes

is most effective for the coagulation of

Fe(OHh sol and why? Na3P04, Na2S04, NaCl,


2)What are ligands.
3)Out of l-Pentanol,2-Pentanol

and 3-Pentanol which one is optically active?

4)What are the common type of secondary structures

of proteins?

5)Write the name of the monomer of Teflon.


6)What product

is obtained when ethyl benzene is oxidised with alkaline Kmn04.

7)What is Hinsbergs reagent?draw

the structure.

8)What are enzymes?


(2X10=20)
9.ln the compound

AX the radius of A+ ion is 95pm and that of X- ion is 181 pm.

Predict the crystal structure of AX and write the coordination

numbers of each of

the ion.
lO.Silicon is an insulator but silicon doped with phosphorus
semiconductor.

acts as a

Why?

-:\.

O.

11.K3[Fe (CN)6] is dissociated 30% in solution

.CaIculate the vant Hoffs factor.

Or
If the Vant Hoffs factor of CaCI2 is 1.5, calculate the degree of dissociation.
12.Consider the reaction :Cr20/
quantity

of electricity

+14H+ +6e-------) 2Cr3+ +8H20. What is the

in coulombs needed to reduce 1 mol of Cr207 2-.

13.Calculate the spin only magnetic moment


14.[Fe(CN)6l

3--

is weakly paramagnetic

while[ Fe(CN.J]

15. What is meant by copolymerization?


16.How would you convert a)Methyl

of M2+(aq) ion(Z=27)
4-

is diamagnetic.

Why?

Give example of such polymer.

bromide to ethanamine.b)chlorobenzene

phenol.
17Write the products of the following

reaction:

1)CHr--CHr--CH=CH2 +HCI------>
2)C6HsCI +Na --ether-->

Xilve two examples.

18 ..What are antihistarnines

(3X9=27)
19.What is corrosion?

What are the factors which affect corrosion?

20.Explain the following


l)Electrophoresis

terms:

2)Dialysis

21.Name and with the help of chemical equation


refining of l)Nickel

explain the methods used for

2)Zirconium.
or

Giving examples differentiate

between roasting and calaination.

22.Account for the following:


i)NH3 has higher boiling point than PH3
ii)N02 dimerizes
iii) Ozone acts as powerful

oxidizing agent.

.:

,.

'

factor.

ion.
i

the

23.What happens when:


i)potassium
ii)potassium

rrianganate

(give only ionic equation)


is treated with ozone.

iodide is treated with alkaline KMn04iii)Hydrogen

with a acidified potassium permanganate


.tic. Why?

peroxide is treated

solution

24.Write chemical reactions to show the presence of

er.

alan aldehydic group in glucose

rbenzene

b)Presence of a carbonyl group


c)presence of a primary alcoholic group
25)Discuss the reactions of primary
acid(NaN02

secondary and tertiary

amines with nitrous

+HcI)

26)What happens when phenol is treated with :i)methyl chloride

in presence of

anhydrous AICl3ii)excess of bramine iii)benzenediazoniumchioride

in presence of

aOH
3X9=27)

27)What is osmotic pressure and how is it related to the molecular

mass of a non-

volatile substance?
(5X3=15)
28.a)Give a brief description
s used for

of i) Cannizzaros reaction

ii) Aldol condensation

b)What happens when acetone reacts with :i)Hydrazine

ii)NaHS03

Or
:10W would you distinguish (give a chemical test)
.:

a) i)Benzaldehyde
ii)

Ethanal

and acetaldehyde
and methanal

)Identify (A),(B) and (C) in the following


_a c.KOH

reactions :ACETONE

LiAIH4
__->A--PCI5
__>B-

-->C

9.a)Describe the manufacture

of sulphuric acid by Contact process.

b) i) Deduce the molecular shape of BrF3 on the basis of VSEPR theory.


ii)Why chlorine

is a powerful

bleaching agent

13

or
a) With the help of a flow-chart

explain how is ammonia

manufactured

industrially?
b) i) Write the balanced
and concentrated

chemical

equation

for the reaction of chlorine with hot

NaOH .Is this reaction a disproportionation

ii)Draw the structure of XeF4 and also write the hynridisation


3G.o\ \Nt\o\

\S \t\1C IC"ICC.\0' c:a'ra\),s't on acnvaton

reaction.
of Xe.

energy? explain with the help of

graph
b) The rate of reaction quadruples

when the tempearature

313K.Calculate the energy of activation

changes from 293K tc

of the reaction assuming that it does not

change with temperature.


OR
a)Explain the difference

between

the terms Order and molecularity

b)Sucrose decomposes in acid solution

of a reaction

into glucose and fructose according to th

first order rate law,with t1/2=3.00 hours.What

fraction

of sample of sucrose

remains after 8 hours.

.:

1/ { 0

"---_.-

Page- 1
KV No.2, COLABA
PRE-BOARD EXAM-I (2010-11)
CHEMISTRY
e with hot

Time: 3 Hrs.

MM70

Class- XII

1) What is an emulsion?
2)

(1)

(1)

Write the structural formula of 3-oxopentanal ?

the help a

t it does no

3) Name two metals that occur in nature as oxides?

(1)

4) Write the name of an antacid which is often used as a medicine?

(1)

5) What is the number of atoms in a body-centred cubic unit cell of a crystal?


(1)
6) Which one has higher electron gain enthalpy with negative sign, sulphur
or oxygen?
(1)

. of a reactio
::cording to tt
. sucrose

7) Arrange the following compounds in an increasing order of their basic


strength in aqueous solutions: NH3, RNH2, R2NH, R3N

(1)

(8) Give the IUPAC name of the following compound?


H3C~CHk
~j

: ;'C~Br
(9) Differentiate between molality and molarity of a solution. What is the
Effect of rise in temperature on molality and molarity of the solution? (2)
10) Describe the role of the following:
i) NaCN in the extraction of silver.
ii) CO in the purification of nickel.

(2)
.:

11) Corrosion is essentially an electrochemical phenomenon. With the help of


a diagram explain the reactions occurring during the corrosion of iron
kept in open atmosphere.
(2)
OR
Define the term molar conductivity and indicate how molar conducti
or
a substance changes with change in concentration of a week electrol e
and a strong electrolyte in its solution.
Contd- on Page 2

Page -2-

(2)

12) Draw the structure of the following molecules:


i) Br F3
ii) H2S207

13) State reasons for the following observations:


(2)
i) The enthalpies of atomisation of transition elements are quite high.
ii) There is greater horizontal similarity in the properties of the transit)
elements ttuu: oLtne main group elements.
14) Give a chemical equation for each of the following reactions:
i) Williamson's synthesis
ii) Reimer- Tiemann reaction

(2)

15) Explain SNI and SN2 mechanism with suitable exa.p1ples ?


(2)
. 16) Name two water soluble vitamins, state their source' and the diseases
caused due to their deficiency in diet?
(2)
17) What are the following substances?
(2)
i) Invert sugar or Anomers
ii) Polypeptides or Nucelotides
18) Define:
(2)
i) Antipyretic
ii) Analgasics
19) Silver crystallizes in face-centred cubic unit cells. Each side of the unit
cell has a length of 409 pm. What is the radius of silver atom? (Assume
that each face atom is touching the four corner atoms in the unit cell)
20) Calculate the equilibrium constant for the following reaction equilibri
Fe(s) + Cd2+ (aq);::,====~Fe2+ (aq) + Cd (s)
.:

Given:

EOCd?+/Cd

= -0.40 V;

EOFe2+/Fe

=-0.44V

21) Calculate the freezing point depression fon~0_711m aqueous solution of


sodium sulphate, if it is a completely ionized in solution. If this solution
actually freezes at - 0.320C, what is the value of'van't Hoff factor for it at
the freezing point? (Kr for water is 1.86 C molal-l )
(3
Contd. on Page 3

Page -3
22) Describe what is observed when
(3)
i) An electric current is passed through a colloidal solution.
ii) a beam oflight is passed through a colloidal solution.
iii) an electrolyte such as NaCl, is added to hydrated ferric oxide solution.

(2)

(2)
lite high.
ae transiti

23) Explain the following observations:


(3)
i) With the same d- orbital configuration (d+) Cr2+ion is reducing agent
while Mn+3ion is an oxidizing agent.
ii) Cu" ion is not stable in aqueous solution.
rii) Among the 3d series of transition elements, the largest number of
oxidation states are exhibited by manganese.

(2)

24) Three geometrical isomers are possible for [Co(en)(H20h(NH3h]3+ . Draw

molecular structures of these three isomers and indicate which one of them is
chiral.
pR.
l
.
F L )
~q)
fxp}l1i.., ~e
~b~dicSo.J}rn I~ l e\eN b
'
25) Complete the equations for the following reactions:
(3)

(2)

l-Jt

e diseases
(2)
(2)

i)

CH3 CH2 OR + 80Ch -7 A

KCNt

(2)

B
Per oxide
of the unit
L? (Assume
unit cell) C
l

equilibriu:
(

ii) CH3CH=CH2+Br '

~~3
ill) ..~

(3)
e3

+ HI -') D + E

26) How are the following conversions carried out:


i)

ii)
iii)

solution of
solution
tor for it at

~C+D

(3)

Aniline to nitrobenzene
Ethanamine to N-ethylethanamide
Chloroethane to propan-l-amine

OR
__Give one chemical test each to distinguish between the compounds in the
following pairs:
i)

ii)
iii)

Methylamine and dimethyl amine


Aniline and benzylamine
Ethylamine and aniline

Contd. on Page 4

Page- 4
Differentiate between the modes of formation of an addition polymer (S
& a condensation polymer ~Give one example of each of these formationl.zr) Ctiv-l ~t- mP11ofTl('rs~.f (c'i\) Ie,(.["n (h) JeTuPeni CJ-J N~-b,
28) a) How are the following obtained?
(['
(] i) Benzoic acid from ethylbenzene
ii) Benzaldehyde from toluene
27)

b) Complete each of the following reactions by giving the missing reactant,


reagent or product:
i) C6H5COCl ----~~-----------~

Pd-Bo..S4

0
1/

>
ii)

crC"A,-fr<

cr

o
II

iii)

(5)
))

OR
a) How will you bring about the following conversions?
i) Ethanol to 3-hydroxybutanal
ii) Benzaldehyde to benzophenone
b) An organic compound A contains 69.77% carbon, 11.63% hydrogen and
rest oxygen. The molecular mass of the compound is 86. It doesn't react wi:
Tollen's reagent but forms an addition compound with sodium hydrogen
sulphite and gives a positive iodoform test. On vigorous oxidation it gives .
mixture of ethanoic and propanoic acids. Derive the structure of compound
29) a) Complete the following chemical equations:
.:
(i) XeF2 + PF5
~
(ii) Cla (g) + NaOH (aq)
~
( hot & conc.)
b) Explain the following observations:
i) +3 oxidation state becomes more and more stable from As to Bi
the group.
ii)
Sulphur in vapour state shibits paramagnetism.
iii)
Fluorine doesn't exhibit any positive oxidation state. (5)
Contd on Pag

KENDRIY A VIDY ALA YA ONGC, PANVEL


PRE BOARD -1 CLASS XII CHEMISTRY
MM-70
TIME- 3.00 HRS

General Instructions:
1. All questions are compulsory.
2. Q.No. 1 to 8 are very short answer type questions each of one mark.
3. Q.No. 9 to 18 are short answer type questions, each of two marks.
4. Q.No. 19 to 27 are short answer type questions each of three marks.
5. Q.No. 28 to 30 are long answer type questions each of five marks.
6. Use of calculator is not allowed. Use Log Table, if necessary,
Ql What is the coordination number of each atom in HCP type of unit cell?
Q2 How is radius of atom related with the side of unit cell in BCC unit cell?
Q3 The rate law of a reaction 2A (g) -------7 B (g) is, r= k [AJ 2. How does rate
change, if volume of the reaction mixture is halved?
Q4 What do you understand by activation energy of a reaction?
Q5 Draw the structure ofXe02F2 using VSEPR theory.
Q6 Write the structure offollowing organic compound3-Chloro-a-methyl acetophenone
Q7 It is harder to prepare chiorobenzene by acid catalyzed substitution of hydr
group of phenol. Explain.
Q8 Name the linkages present in the monomers of following biomolecules(1) Protein
(2) DNA
Q9 Aluminium crystallizes in a ccp structure. Its metallic radius is 125pm.
(i) What is the length of the side of the unit cell?
(ii) How many unit cells are present in 1.00 cnr' of Al
Q 10 Three iron sheets have been .coated separately with three metals A,B and C
whose std. electrode potentials are given below.
Metal
ABC
-Iron
EO(V)
-0.46
-0.66
-0.22
-0.44
In which case lusting will take place faster when coating is damaged and whv

Q 11 Give reason for the following observations


(1) Why is ester hydrolysis slow in beginning and become faster after
Some time?
(2) Why are powdered substances more effective adsorbent than their
crystalline form?
Q12 Explain following terms:
(i) Peptization
(ii) Heat of adsorption
Q 13 Give reason for the following:
(1) SF 6 is resistant to hydrolysis
(2) Inter halogens are more reactive than tlieir parent halogens.
Q14 Complete following reactions:

(i) ICI) + H20


(ii)P

--------7

+ NaOH + H20

Q15. Which out ofp-nitro

----------7
phenol and phenol has smaller value ofpKa and why?

Q16 Write the reactant for the preparation of2-Ethoxy-2-methyl


propane by
Williamson's Ether synthesis. Explain the reason for your choice of such reactants
.Q 17. Explain following reactions with suitable equation:
(1) Hoffmann's Bromamide reaction
(2) Gabriel Phthalimide

synthesis

OR
Explain following reactions with suitable equation:
(1) Carbylamine reaction
(2) Sandmayer's reaction
Q18. Explain following observations:
(1) Aniline has smaller value of Kb than cyc1ohexanamine.
(2) Primary amines have higher boiling points than tertiary amines of
comparable molar masses?
;:

- why?

Q 19. Calculate the emf of the cell at 298K temperature.


Cd2+ ICd (0.01M) II H+ (0.02M)1H2 (0.5 atm),Pt
(Given EOfor CdfCd2+ = -0.403V, R= 8.314JlK/mol,

F= 96500 C Imol)

Q20. A first order reaction completes 50% in 10 minutes. How long would it t
to complete 990/0 ?
Q21. (a)Explain following with suitable example:
1. Gas phase refining
2. Zone refining
(b) Why is Carbon better reducing agent than CO above 673K temperatu:
Q22. Arrange following according to the property indicated against it.
(a) PH3, NH3, SbH3, AsH3, BiH3 ---Decreasing order of reducing nature
(b) HCIO, HCI03, HCI04, HCI02 ----Increasing order of acidity
r

(c) F2' O2, Ch, Br2 ------- ------------

Increasing order of oxidizing tendenc;

Q23. (a) Write IUP AC name of ionization isomer of [Cr(NH3)4Ch]Br


(b) Using YSEPRT, explain why [NiCI4 is tetrahedral but [Ni (CN)4f
Square planer complex?

f-

Q24. (1) Write four differences between SN1 and SN2 mechanisms.
(2) Complete following equations:
..-'

aq KOH

a) CH3-CH-CH3 -------------7

1
CI
b) CH -

C-Na + CH3-CH2-CI -----------7

Q25. (1) How does D- glucose react with following? (Write chemical equation
(a). Cone. HN03
(b). HCN
(2) What are the products of hydrolysis of nucleotide?
OR
(l) Define: Glycosidic linkage and N- glycosidic linkage
(2) Write two differences between DNA and RNA
Q26. (a) Write the structures of monomers of following polymers:
1. Teflon
2. Natural rubber
(b) Classify following as homo polymer and copolymer:
Buna-S, PAN, Bakelite plastic, Nylon-6

,~

Q27. Explain following with suitable example:


(a) Analgesics

(b) Antiseptics

(c) Artificial sweetening agents

Q28. (1) Define: Colligative properties and mole fraction


(2) Benzene and toluene form ideal solution over entire range of composition.
, The vapour pressure of pure benzene and toluene at 300K are 50.71mm
and 32.06mm ofHg respectively. Calculate the mole fraction of benzene
in vapour phase, if 80g of benzene is mixed with 100g of toluene.
OR
(1) Define: Vapour pressure and Molality
(2) 75.2g of phenol is dissolved in one Kg of a solvent of Kj = 14.
If depression in freezing point is 7K, then find the % of phenol that-
dimerises.
Q29. (a) How is KMn04 prepared from pyrolusite ore?
(b) How does acidified KMn04 react with following:
(1) aq Na2S03
and (2) Oxalic acid
(c) Write the structure of magnate ion
OR
.~
(a) How is K2Cr207 prepared from chromite ore?
(b) How does acidified K2Cr207 react with following:
(1) aq NaN02
and (2) H2S
(c) Write the structure of dichromate ion
Q30. (a) Distinguish between following pairs of organic compounds using
chemical test:
1. Methanoic acid and ethanoic acid
2. Acetophenone and benzophenone
(b) Perform following conversions:
1. Phenol to benzoic acid
2. Propanone to propene
3. Benzoic acid to benzaldehyde
OR
(a) Perform following conversions:
1. Propene to acetone
2. Propene to acetaldehyde

(b) Explain following observations:


1. Aldehydes are more reactive than ketones
2. Chloroacetic acid is stronger acid than acetic acid
(c) Write the mechanism

of following reaction:

HCHO + HCN ----------7

OH
1
H-C-H

1
CN

KENDRIYA VIDYALAYA

,"'RHE' PUNE-G2

THIR3J' PREBOARD - EXAMINATION


SUB: CHEl\lISTRY

Time-3hrs.

l\1M-70

General instructions
1) All questions are compulsory,
2) Question nos, 1 to 8 are very short answer questions and carry 1 mark each.
3) Question nos 9 to 18 are also short answer questions and carry 2 mark each
4)
Question nos 19 to 27 are also short answer questions and carry 3 mark each
5)
Question nos 28 to 30 are long answer questions and carry 5 mark each
6) Use log tables if necessary, use of calculators is not allowed.

Q. 1 Why are detergents

are called soap less soap?

Q.2 Draw the structure of de -oxyribose

sugar.

Q.3 Illustrate the difference between antagonists

and agonists.

Q.4 Why sky is blue?


Q.5 What are F centres? How they are responsible
Q.6 Why is the

for colour?

bond angle in PH3 molecule lesser than NH3 molecule?

Q.7 Write the IUPAC name of the following compound.

CH,-0-CH2j

CH-CH,-CH
I
- 3
CH3

Q.8

Draw the structure of~-D-(+)-Glucopyranose.

(Fischer projection

Q. 9 State the law co- relating the pressure of a gas and its solubility

structure)

in a liquid .State an

application of this law.


Q.! 0 Give reason:

.:

i) ICI is more reactive than 12.


ii) All the P- CI bonds are not equivalent
Q.ll

In PCI)

Write complete chemical equation for:


a) Fe2+ + Cr20/
~

(in acidic medium)

b) MnOq" + C20/

(in acidic medium)

Q. 12 Ce3+ has electronic


Q.13

configuration

Answer the following

[Xe] 4f1. Calculate

its magnetic

moment.

questions:

i) Which element in the first series of transition

clements

does not exhibit variable oxidat

state and why?


ii) There is a greater range of oxidation
Q.14

i) why are haloalkanes

state among the actinides

are more reactive towards nucleophilic

than haloarenes?

CH3 CH2 CH2CHClCH2

Q.16

Describe

substitution

reactions

'"

ii)Which one of the following

Q.15

than among the lanthani

the following

i)

Glycosidic

ii)

Peptide linkage.

Give chemical

compound

undergoes

SN' reaction and why?

CH3 OR CH3 CH2CH2CH2Cl


terms:(with

structure)

linkage

tests to distinguish

between compounds

in each of the following

pairs:

i) Phenol and benzyl alcohol

ii) Butane-z-ol

and 2-methyl

propan-z-ol.

17 Account for the following:


i) Aniline does not undergo Fridel craft alkylation.
ii) Although -NH2

derivatives
Q.18

group is an ortho and para directing

group, nitration

of aniline gives

111

also.

Illustrate the following

with an example

each:

i) Linkage isomerism
ii) Coordination

isomerism.

OR
Give the electronic
Why this complex

Q. 19

configuration

tal field

is coloured?

4Sgm of etheleneglycol

depression

of the Ti in [Ti (H20)6]3+ ion in an c:~.aTI::c..-;~

is mixed with 600g of water. Calculare

and b) the freezing point of the solution.(kf

of H_0 =" ~;:.......,.,-:::

g point

An element x with an atomic mass of 60glmol has density of 6.25g/cm3 -.If the edge

Q.20
length

of its cubic unit cell is 400pm,

identify the type of cubic unit cell. Calculate

the radius of

an atom of this element.


Q.2]

Write thenames

and draw the structure of monomers

classify them as addition or condensation


i) bakelite
s

Q.22

ii) natural rubber

Write the chemical

equations

polymers

and

polymers.
iii) polystyrene

for the following

conversions

i) Ethyl benzene to benzene


ii) Acetaldehyde

of the following

(not more than 2 steps)


,.

to butane -1 ,3-diol

iii) acetone to propane


Q.23

State the principles

on which the following

operations

are based:

i) vapour phase refining


ii) leaching
iii)Distillation

OR
Name the method used for refining of

me

i)

ickel

ii)

Zirconium

iii) The extraction

of Au by leaching with NaCN involves both oxidation

and reduction.

Jutifyby giving eqations.

Q.24

Draw the structure


i) H2S}07

of the following:

ii) BrF3

iii) XeF4
.:

Q.25

How are the following

colloids different from each other in respect of their dispersion

medium and dispersed phase? Give one example of each


i) Aerosol
ii) Hydrosol
iii) Emulsion

Illustrate the following

Q.26

i) Hell-volhard-Zelinsky

Q.28

reaction

ii) Clemmensen

reduction

iii) Cannizzaro's

reaction

Q .27 Complete

..

name reaction

Sui

and balance the following equations:

i)

P4 + NaOH + H20

ii)

C + HN03

iii)

XeF2 + PFs

(i)State Kohlrausch

molar conductivity

Tin

law of independent

migration of ions .Write an expression

of acetic acid at infinite dilution according

ii) Clculate

~Illo

Given that

111

(HCl)

111

(NaCl)

for tl

to this law.

for acetic acid.

111

426 Scm2morl

126 Scmrnol'

(CH3COONa)

91 Scm2morl

OR
Write all the chemical reaction
cell containing
conductivity

-~
involved in the rusting of iron. The resistance

of a conductix

O.OOlM solution at 298K is 1500 ohm. What is the cell constant if the
ofO.OOlM KCL solution at 298K is 0.146xlO-3

Q .29 Define the order and molecularly

cl11-1?

of a reaction. Give an example of each.

A first ord
0.1'

decomposition

reaction takes 40 minutes for 30% of

decomposition.

Calculate

tl/2 value for


0.2;

Q .30

An organic compound

(A) molecular

sulphuric acid to give a carboxylic


acid produced (B ).on dehydration

formula CgHI602 was hydrolysed

acid (B) and an alcohol (C).Oxidation


gives but-l-ene.

Write equations

with dilute

of (C)with chromi

for the reactions involved

OR
a)What is ammonolysis?

Give one example .Describe the preparation

of nitroalkanes

and alk:

nitrils from alkyl halides. Explain why the boiling points of alkyl halides are higher than thos
corresponding

alkanes.

b) Write the IUPAC name ofDDT.

Also draw its structure.


Q.5)
Q.6)

Q.7)

KENDRIYA VI DYALAYA NO.1

A. F. s. PUt~,~F

FIRST PRE - BOARD EXAM


Sub: Chemistry

Class: XII

Time: 3 hrs.

Marks: 70

General Instructions:
All question are compulsory
O. No. 01 - 08 are very short answer questions and carry 1 marks each

O. No. 09 - 18 are short answer question and carry 2 marks each


-Q. No. 19 - 27 are short answer question and carry 3 marks each
O. No. 28 - 30 are long an~wer questions and carry 5 marks each
.Use log table if necessary
Use of calculators is not allowed.
0.1)

Which point defect in crystals decreases the density of the solid?

0.2)

How do metallic and ionic substances differ in conductinq electricity?

0.3)

Why is Bi (V) a stronger oxidant than Sb (V) ?

0.4)

Give the IUPAC name of the following compound:


CH3

I
I

HC-C-CI
3

CH3
0.5)

Write the structure of 2 - phenyl ethanol.

0.6)

Give one test to distinguish between aldehydes and ketones.

Q.7)

What is meant by reducing sugars?

Chemistry - XII - 2
;

0.8)

Give one example of elastomer.. .~)U r,! Po . 5

0.9)

Define the terms, 'molarity and molality'. What is the advantage of using molality n.16)
molarity?

0.1 0)

The resistance of a conductivity cell containing 0.001 M KCI soiution at 298K is 15


What

is cell constant

if the conductivity

of 0.001 M KCI solution

at 298

0.17)

0.146 X 10.38 ern:'.

OR
What type of cell is a lead storage battery? Write the anode and the cathode reacti

0.18'

and the overall cell reaction occuring in the use of a lead storage battery.
0.11)

Given that the standard electrode potentials (Eo) of metals are :+

K / K = -2.93V, Ag / Ag
2+

Mg / Mg = -2.37V, Cr

= 0.80V, Cu

3+ .~

2+

/ Cu

0.12)

0.13)

--

= 0.34V

2+

/ Cr = - 0.74V, Fe / Fe = - 0.44V

Arrange these metals in an increasing order of their reducing power.

0.19

Q.2C

Describe the following :i)

Electrophoresis

ii)

Shape - selective catalysis

0.2

How are the following colloids different from each other in respect of dispersion
medium and dispersed phase? Give one example of each type.
(i) An aerosol

0.14)

0.15)

(ii) A gel.

Complete the following chemical reaction equations :(i)

Cap2 + H20 --~')

(ii)

S + HN03

Draw the structural formulae of the following compounds :(i)

XeF

0.2

Chemistry - XII - 3
.16)

.17)

Give the chemical tests to distinguish between the following pairs of compounds :i)

Ethylamine and dimethylamine

ii)

Aniline and benzylamine

Identify A and Bjn each of the following processes :-.

A CsHsOH
OH_ )
NI
fH2
A
.)

i)
ii}
0.18)

reduction

Draw the molecular structures of the monomers of


(i) Teflon

O. ~9)

(ii) Polyethene.

Niobium (Nb) crystallises in a body centred cubic (bcc) structure. If its density is 8,55g
crrr", calculate the atomic radius of niobium,
(Atomic weight of Nb

Q,20)

= 93u,

NA

= 6,02 X 10

23

Calculate the temperature at ~hich a solution containing 54g of glucose (C6H,206) in


250g of water will freeze (K,for water

Q.21)

rncl')

= 1,86k mol:' kg)

Write the chemical reactions which take place in the following operatloos :i) _ Electrolytic reduction of AI203
ii)

Isolation of zinc from zinc blende

iii)

Mond's process for refining of nickel.


OR

Describe the principle involved in the following metallurgical operations '-

0.22)

i)

Zone refining

ii)

Electrolytic refining

Hi)

Froth - floatation process,

Assign a reason for each of the following statements:


i)

Phosphorus (P4) is more reactive than nitrogen (N2)

ii)

All the bonds in PCls are not equal in length.

in,

Sulphur in vapour state exhibits paramagnetism.

1-1

.-

Chernistry

0.23)

of the following

i)

[ Cr (H20)2

ii)

[ Co

iii)

[ NiCI4

(C20

0.29)

(diamagnetic

b)

J 2between SN1 and SNz mecharusms

of substitutio

Give one example of each.


0.30)

How will you bring about the following conversions?


i)

Ethanol to acetone.

ii)

Benzene to acetophenone

iii)

Benzoic acid to Benzaldehyde

substances

a)

b)
dil

? Give one example of each of them.

i)

Antipyretics.

chr

ii)

Cationic detergents

for

iii)

Sweetening

agents.

Explain the following

. i)

a glycosidic

:-

linkage

ii)

a peptide linkage

iii)

denaturation

a)

Derive the general

b)

The decomposition

of protein

.
Q.28)

OJ

entities:

(NIj)s CI ] 2+

0.26) " What are the following

Q.27)

coordination

behaviour

4)2]

How would you differentiate


reactions?

0.25)

Write the IUPAC name and describe the magnetic


paramagnetic

0.24)

- XII -

expression

for half life of a first order reaction.

of NH3 on platinum surface is a zero order reaction. what

would be the rates of production

of

N,

and Hz if

K = 2.5 X 10-4 mol'l

s'

OR

a)
- "b)

List the factors that determine

the rate of a chemical

The half life for decay of radioactive

14C

reaction.

is 5730 years. An archeological

artefa

containing wood had only 80% of the 14Cactivity as found in a living tree. Calculate'
age of artefact.

Chemistry - XII- 5
0.29)

a)

b)

Compete the fol/owing chemical equations:


i)

Cr 02

ii)

'2

7(dQ)

CU +(aQ) +

+H S
_2

(9)

(aq)

+ H+

(ac)

__

--'~

">

How would you account for the fol/owing :_


i) The oxidising power of oxoanions are in the order V0 + < Cr 0\
2

< MnO-

ii) The thrid ionization enthalpy of managanese (Z = 25) is exceptionally high.


iii) Ci2+ is a stronger reducing agent than Fe2+
.30)

a)

3M

Write one chemical equation for each, to illustrate the following reactions:
i) Rosenmund reduction:
ii) Cannizzaro reaction.

b)

An organic compound A has the molecular formula CeH160 . It gets hydrolysed with
2

dilute sulphuric acid and gives a carboxylic acid B and an alcohol C. Oxidation

ore

with'

chromic acid also produced B. C an dehydration reaction gives but - i - erie. write equations
for the reactions involved.

3M

~(**

"

KENDRIYA

VIDYALAYA SANGATHAN, MUMBAI


PREBOARD EXAMINATION
2010-2011
SET II

CLASS XII
SUBJECT: CHEMISTRY

REGION

TIME: 3HRS
MAX MARKS - 70

General Instructions:1. All questions are compulsory.


2. Marks are indicated against each question.
3. Question numbers 1 to 8 are very short answer questions of 1 mark
each; answer these in one word or about one sentence each.
4. Question numbers 9 to 18 are short answer questions of2 marks each,
answer these in about 30 words each.
5. Question numbers 19 to 27 are short answer questions of 3 marks
each, answer these in about 40 words each.
6. Question numbers 28 to 30 are long answer questions of 5 marks
each, answer these in about 40 words each.
7. Use log table, if necessary. Use of calculator is not permitted.
1. Define the 'forbidden zone' of an insulator.

[1]

2. Why FeCI) preferred KCI for cut leading to bleeding?

[1]

3. An ore sample of galena (PbS) is contaminated with Zinc blended


(ZnS). Name one chemical which can be used to concentrate galena
selectively by froth flotation method.

[1]
4. Write the IUPAC name of Ionization isomer of[Cr (H20)sBr}S04

[1]

5. Why Orthonitro Phenol is steam volatile?

[1]

6. Write IUPAC name ofPh-CH=CH-CHO

[1]

7. Write the name and structure of one of the common initiators used in
free radical addition polymerization
[1]

8. PKb of Aniline is more than that of methylamine. Explain why? [1]


9. Give reasons for the following:
i. At higher altitude people suffer from a disease called anoxia. In this
disease they become weak and can not think properly
[1]
ii, When mercuric iodide is added to an aqueous solution of KI the
freezing point is raised
[1]
10. Answer the following with reasons:
i. Can you store a copper sulphate solution in zinc pot?
ii Rusting of Iron is more in sea shores

[1]
[1]

11. Explain the geometry and magnetic properties of [Ni (CN)]2-based


Valence bond theory.
[2]
12. An optically active compound having molecular formula C7H15Br
reacts with aqueous KOH to give a racemic mixture of products.
Write the mechanism involved for this reaction.
[2]

13. Explain why


a. Transition metals form complexes
b. Actinoid contraction is greater from element to element than
Lanthoid contraction

[1]

14. Out line the principle of following process in metallurgy:


a. Van arkel method
b. Chromatography

[1]
[1]

15. Write difference between the following:


i. Amylose and amylopectin
ii. DNA and RNA

[1+1]

[1]

16. Explain the following


i. Sandmeyer's Reaction
(1+11

11.Friedel-Craft-Reaction

l7. What are essential and non essential amino acids. Give two example
of each type.
[2]
\~. '~'h\\e

\\\e 'S\\\\c\\\\e

a\\.~ \\.am~ ci\ mC)t\lJm~\'S 1J"t"t1J\\C)'N\\\.'jb


"?1J\'jm~\'S

a. Nylon 2 Nylon 6

b. Gl'i9tat

(l +11

_.

19. An element E crystallizes in body centered cubic structure. If the


edge length is 1.469 x 10 -10 m and the density is 19.3 g/crrr', calculate
the atomic mass of the element. Also calculate the radius of atom of
this element.
[3]
20. Explain the following observations:
i. Ferric hydroxide sol gets coagulated on addition of NaCI solution.
ii. Cottrell's smoke precipitatoris fitted at the mquth of chimney in
Factories
iii, Physical absorption is multilayered while chemisorption is
monolayer.
[1 + 1+ 1]
21. a. ICI is more reactive than h
b. Draw the structure of Xe03 and R2S207.
c. What happens when HN03 reacts with Cu metal

[3]

22. A mixed oxide of iron and chromium FeOCr203 is fused with sodium
carbonate in. the presence of air to form a yellow coloured compound
A. On acidification the compound A forms an orange coloured
compound B, which is a strong oxidizing agent. Identify the
compound A and B and write balanced chemical equation for each
step.
[3] .
23. a. Explain how does -OR group attached to a carbon of benzene ring
activate it towards electrophilic substitution?
b. Give tests to distinguish between the following pairs of compounds
i. Phenol and propan-z-ol
ii. Ethanol and acetic acid
[1+2]
24. Account for the followings:
i. Aniline does not undergo Friedel-Craft's reaction
ii. Aromatic primary amines cannot be prepared by Gabriel
Phthalimide Synthesis.
iii. Aniline on nitration form Para isomer
[3]

.:

25. Explain the followings:


a. Nucleoside
b. Diabetic patients are advised to take artificial sweeteners instead of
natural sweeteners.
c. Detergents are non-biodegradable while soaps are biodegradable.
[3]
3

26. A 5% solution (by mass) of cane sugar in water has a freezing point
of 271 K. Calculate the freezing point of 5% glucose in water if the
freezing point of pure water is 273.
[3]
27. A current of 1.50 amps was passed through an electrolytic cell
containing AgN03 solution with inert electrodes. The weight of Ag
deposited was 1.50g. How long did the current flow? Also write the
reaction involved in this.
[3]

LOg~/R

Time

nswer questions. based on the curve:


What is the order of reaction?
Calculate the rate constant if slope is 2 X 10-4
Derive the relationship between rate constant and half life of this
reaction
[1+ 1+ 1]
.i) A reaction is 50% complete in two hours and 75% complete in 4 hrs.
Calculate is the order of the reaction.
[2]

OR
r a certain reaction, A+ 2B
ven below:
Ex eriment
1
2

-+

2C + D, the experimentally obtained data is

0.30
0.60
0.30
0.60

Bo
0.30
0.30
0.60
0.60

Initial rate of reaction


0.096
0.384
0.192
0.768

10

For the reaction


i. Derive the order of reaction with respect to A and B
ii. Write the rate law
4

--,-'

iii. Calculate the value of rate constant


iv. Write the expression in terms of A and C

[2+1+1+1]

29. A) give reasons for the following:


i. Anhydrous Aluminum Chloride act as catalyst in many reactions.
ii. Noble gases form compounds with fluorine and oxygen only.
(B) Arrange the following in the increasing order of properl
indicated:
1) F2,C12, Br2, I2( Bond dissociation enthalpy)
2) HF, HCI, RBr, HI(Acid Strength)
~ 3) NH3,PH3,ASH3,SbH3,BiH3(Base
Strength)
[1+1+1+1+1]
Or
a. In the ring test for identification of nitrate ion, what is the formula of
the compound responsible for the brown ring formed at junction of
two liquid?
b. What happens when Ch water reacts with cold dilute solution of
Sodium hydroxide?
c. When Cone. H2S04 was added into an unknown salt present in a test
tube, a brown gas A was evolved. This gas is intensified when Cu
turnings were added into the test tube. On cooling the gas A changed
to a colourless gas B. Identify gas A and B and give the equation
involve
[1+1+3]
30. A compound X (C2~0)
on oxidation gives Y ((C2~02).
X undergoes
haloform reaction. On treatment with HCN X forms a product Z which
on hydrolysis gives 2-Hydroxypropanoic acid.
(a) Write down structures of X and Y and their IUPAC names.
(b) Name the product when X reacts with dil NaOH
(c) Write down the equation for the reactions involved.
[2+ 1+2]

OR
How the following conversions are carried out
i.
Phenol to anisole
11.
Acetic acid to methylamine
Ill.
Propanoic acid to Acetic Acid
IV.
Phenol to 1,2,3 tri-bromo Benzene
v.
Aniline to benzoic acid.

give equations?

[ 1 each]

KENDRIYA VIDYALAYA SANGATHAN


MUl\1BAI REGION
I PRE-BOARD

(SET - III)
Class: XII
Time: 3 Hours

Subject: Chemistry
Max. Marks: 70

Ceneral Instructions:
1. All questions are compulsory.
2. Question nos. 1 to 8 are very short answer questions and carry 1 mark each.
3. Question nos. 9 to 18 are short answer questions and carry 2 marks each.
4. Question nos. 19 to 27 are also short answer questions and carry 3 marks each.
5. Question nos. 28 to 30 are long answer questions and carry 5 marks each.
6. Use log tables if necessary, use of calculators is not allowed.

1. Why ZnO turns yellow on heating?

2.

What is the

(1)

an't Hoff factor for a compound which undergoes tetramisation in an

organic solv nt?

(1)

(1.)

3. What are shape selective catalysts? Give one example?

4.

Give the method of refining ofNi?

5. Why

6. Dra

o- and CO

(1)

are not isostructural?

(1 )

the structure of
:

(1 )

7. Halo

es rea ts with KCN to give alkyl cyanides while AgCN to give isocyanides.

Gi re reasons?

8.

(1 )

~ ic Chloroacetic acid or Acetic acid? Why?

(1 )


./

9. A 4% solution of Sucrose is isotonic with 3% solution of an unknown organic substance.


Calculate the molar mass of the unknown substance?

(2)

10. Ethanol and Acetone form which type of deviation from Raoults law? Explain with
diagram?

(2)

11. Answer the following questions on the basis of a curve fora-first order reaction A ~ P

log (Ro/R)

Time
(a) What is the relation between slope of this line and rate constant?
(b) Calculate the rate constant of the above reaction if the slope is 2

io'

S-I?

(c) Give the relationship between half life ofa first order reaction and its rate constant?
(2)

12. Name the chief ore of Aluminium? Give the reactions at anode and cathode for Hall(2)

Heroult process?

13. How will you convert?


(a) Ethanol to Butane 1) 3 diol.
(b) 2 - phenyl propane to phenol.
(2)

Write equations?

14. Give the chemical test to distinguish between


(a) Phenol and Benzoic Acid
(b)

~'-CH,oH

(2)

and

15. Explain the following named reactions with suitable equations

(a) Gatterman reaction


(b )'Cannizaro reaction

(2)

16. What happens when D-glucose is treated with following reagents?


(a) HI
(b) Bromine water
Write equations and name the products?

(2)

17. Differentiate between 1 and 2 structure of protein?

(2)

18. Account for the following?


(a) Aniline does not undergo Friedal crafts reaction ..
(b) Aniline is less basic than methyl amine.

(2)

19. KCN has a density of 1.52 g/crrr' and crystallizes in FCC type structure. Calculate the
distance between K+ and CN" ions?

(3)

20. It is observed that rate of a chemical reaction doubles with every 10C rise in
temperature. If a reaction takes place with temperature range 295 K to 305 K. What
would be the value of Activation energy for this reaction?

(3)

21. Explain the terms?


(a) Peptisation
(b) Electrophoresis
.:

(c) Homogenous catalysis

(3)

22. (a) Out of noble gases Xe only known to form compounds with oxygen and fluorine.
Why?
(b) CIF3 exists FCb not. Why?
(c) OF 2 is called as oxygen difluoride not fluorine oxide. Why?

(3)

.,

23. Using valence bond theory of complexes, explain the geometry and magnetic behavior or

[Ni (CN)~f and [Co (NH3)6]3+?

24. Give the mechanism of preparation of Ethoxyethane from Ethanol?

(3

25. (a) Write the structure of monomers used in the preparation of?
1) Teflon
2) Buna- S
(b) What are biodegradable

polymers? Give two examples?

(3)

26. Give one important use of each one of the following?


(a) Chloramphenicol
(b) Omprezole
(c) Aspartame
(d) Ranitidine
(e) Equanil
(f) Furacine

(3)

27. Write balanced chemical equations for the following reaction?


(a) Zn reacts with concentrated HN03.
(b) White phosphorous reacts with concentrated NaOH.
(c) Sulphur reacts with concentrated H2S04.

(3)

28. (a) Conductivity of 0.00241 m Acetic acid is 7.896 x 10-5 s/cm. Calculate the molar
conductivity if 6.0 for CH)OOH is 390.5 scm/mol?

Calculate dissociation constant of

acid?
(b) Describe the electrochemical

(3)
phenomenon of rusting the Iron with equation?

(2)

29. (a) A blackish brown co loured solid (A' when fused with alkali metal hydroxide in
presence of air, produces a dark green coloured compound B, which on electrolytic
oxidation in alkaline medium gives a dark purple coloured compound C. Identify A,
B, C and write the reactions involved?

(3)

-..

(b) What happens when an acidic solution of the green compound B is allowed to stand
for sometime? Give the equation involved? What is this type of reaction called?

(2)

30. An organic compound 'A' has molecular formula CgH1602 was hydrolysed with diluted
H2S04 to give a carboxylic acid B and an alcohol C. Oxidation of C with chromic acid
give B. C on dehydration give but - 1 - yne. Write equations for the reactions involved?
Also write the WP AC names of A, B and C.

.-

(5)

------

_-------~G
.

/"

./
.I

I PRE-BOARD EXAMINATION
SUB: CHEMISTRY
CLASS-XII

MARKS -7
TIME-3H

General Instructions

:-

(i)

All questions are compulsory,

(ii)

Questions no. 1 to 8 are very short answer questi


and carry one mark each.

(iii)

Questions no. 9 to 18 are short answer questions carry two marks each.

(iv) Questions no. 19 to 27 are also short answer


questions and carry three marks each.
(v)

Questions 00. 28 to 30 are long answer questions a


carry five marks each.

(vi)

Use log tables if necessary, use of calculators in not


allowed.

1. What are F Centres?


2. What is the Significance of leaching in the extraction of
Aluminium.

.:

3. Why PH3 is weaker base than NH3


4. Out-of Chlorobenzene

and P-nitro chlorobenzene

will react with Sodium hydroxide easily and why?


5. Write the IUPAC name of the following
1

compound.

, which

HOOC - CH = CH - COOH

6. Give one test to distinguish between Aniline and N-Methyl


Aniline.
7 . Why do Zr and Hf exhibit similar properties.
7. The first conisation energies of 5d transition

elements

are higher than those of 3d and 4d transition elements in


respective groups. Why?
9. What is the molality

of solution which contains 18gms of

glucose C6 H1206 in 250gm of water?


lO.what is an adsorption

Isotherm? Describe Freundlisch's

adsorption Isotherm.
11.What is the difference
solution?

between lyophobic and lyophilic

Give one example of each type.

12. Mention

the various reactions taking place in the blast

furnace.
13. Explain the following
A] CIF3 exists but Fcl3 does not.

.:

B] unlike phosphorous nitrogen shows little tendency for


catenation.
14 . What happens when
2

/'

A] Excess of ethanol is heated with cone. H 2504 at 413k.


B] Phenol is treated with acetyl chloride.
15. Explain the following
A] Aldol condensation
B] Reimer Tiemann reaction
16. How will you distinguish [give one test only]
Write chemical equation :A] Propanol and Propanone

B] Ethanol and Methanol.


17. Write the differences
18. What are nucleotides?

between

DNA and

RNA.

Name two classes of nitrogen

containing bases found in nucleotides ?


19a) What type of stoichiometric

defect

shown by ZnS.

b) A face cent red cubic element (atomic mass 60) has a cell
edge of 400Pm.What

is its density?

20) The vapour pressure of pure benzene at a certain


temperature

in 0.850 bar.0.5g non- electrolyte

volatile solid is added to 39.0g of benzene


gmol -l).The vapour

and

non-

( mol mass 78

pressure of this solution is found to be

0.845 bar.Calculate the molecular mass of the substance.


3

r:

21. Explain the following giving reasons.


A)Transition metals exhibit high enthalpies of atomisation.
B)Among the lanthanoids Ce (III) is easily oxidized to Ce(IV).
c)There is a decrease in atomic size with increasing atomic
numbers of transition

elements across a period.

22.Write the I.U.P.A.C names for the following:


a)[ Ptcl (NH 3) 5] cI 3
b)Explain crystal field splitting in tetrahedral

complexes.

23.How would you convert


a)Benzene to O-nitro chloro benzene
b)2 Bromoprapane to 1 Bromopropane
c) Toluene to Benzyl alcohol.
24. Account for the following:
a) Carboxylic acids have higher boiling points than alcohols of
comparable molecular mass.
b)The order of reactivity of halogen acid with ether is .
HI>HBr>Hcl.
c)The Pka value of chloro acetic acid is lower than Pka value of
acetic acid.
4

.~

,
.i

25. Complete the following


a)C 6H 5 NH2

-;>

CHl CoCI

? H~Oilt -

b) CH3 CoNH2 Br~j KOH


c) C6 Hs N02

Sn 1 He!

-;>

H2S04/HN03

? Na No

21

-;>

HCI

-;>

26. Discuss the Synthesis of Bakelite and give its uses. Why is
Bakelite a thermosetting

Polymer.

OR
Discuss the 'synthesis of Neoprene and Buna S rubber and thei
uses.
27. Account for the following
.-

a) Aspirin drug helps in the prevention of heart attack.


b) Diabetic patients are advised to take artificial sweetener
instead of natural sweetener.
c) Detergents are non-biodegradable

while Soaps are

biodegradable.
28. (a) Write the cell reactions occur in a lead storage battery?
(b) Calculate the equilibrium

constant of the reaction

Cu(s) + 2Ag+(aq) -------> Cu 2+(aq) + 2 Ag (s)

EO cell =O.46V
5

,.

29. a) Write the difference between molecularity

and order of

reactions.
b) If the rate constant of a reaction is 2.0 mol
and 32 mol

-1

-1

LS-1 at 700k

LS -1 at SOak. What is the activation energy.

30.Give reasons for each of the following.


a.Noble gases are mostly chemically react.
b. Nitrogen does not form Pentahahdes.
c. Bismuth is a strong oxidizing agent is penta valent state.
d. Despite its lower electron affinity fluorine is a stronger
oxidizing agent than chlorine.
e. Sulphur in vapour state exhibits paramagnetic

behaviour.

OR
Write the balanced equation and complete the following.
1.Ca 3 P 2 + H 2 0--------------->
2.P 4 + KOH + H 20-------------------->
3. H 2 5 + So 2
4.5 F 4 + H20

-----------------------

------------------------

>
>

5.Cu + Cone. H 250 4----------------------->

Kendriya Vidyalaya VRDE, Ahmednagar


1ST PRE-BOARD Examination

. " s fl
i

~)

1u

November-20i0
Time: 3 hrs
1.
2.
3.

Sub: Chemistry

Class-XII

F.M- 70

Name 2 substances with anisotropic behavior. [1]


What is the amount of solute and solvent in a 20% glucose solution in water bv mass?[l]
Define standard electrode potential. [1]

4.
5.
6.
7.
8.
9.
10.
11.
12.
13.

How is the average rate of a reaction different from the instantaneous rate of the reaction? [1]
What is meant by the process of sorption? [1]
write the formula of the 2 ores of iron. [1]
Why nitrogen cannot show maximum covalency of five? [1]
Why Zn, Cd and Hg should not be transition metals?[l]
Write the primary and secondary valencies of Cobalt in [Co(NH3h(C03)]CI?
[1]
Which isomerism will be given by [Fe(NH3h(N02hl?
[1]
Write the type of attractive force and the nature bf solid formed by a) H20 b)Quartz
[1.-1
Calculate the molarity of 2 gms NaOH in 2L of water. [2]
Write the half cell reactions for the cell
Pt (s)/Hz(g)/H+(aq)//Pt(S)/Br2(aq)/B((aq)
[2]
14. In a reaction 2P -7 30" the concentration ofP decreases from 12 mol/L to 6 mol/L in 30
min.Calculate the rate during this interval.[2]

15. Write the expression for Fretmdlich adsorption isotherm. Also, write the values when l/n =0
and when l/n = 1. [2]
16. What is froth-floatation? Name 1 froth stabilizer. [2]
17. Why the 2nd and 3rd d-series elements have almost same atomic radii? [2]
18. Explain the basicity of group 15 hydrides. [2]
19. What are chelates? Give 1 ego What are ambidentate ligants? Give 1 ego [3]
20. Write the formula of a compound formed by A,B and C atoms, where A occupies the ccp lattice,
B occupies half of the octahedral voids and C occupies one-third of tetrahedral voids.[3]
21. State and explain the Henry's law. Give 2 practical applications of the law, [3]
22. Represent the cell where the following reaction takes placeNi(s) + 2Ag+ (O.oolM)-7
Ni2+(O.OlM) + 2Ag(s).
Also calculate the Ecellvalue. Given EONi2+/Ni
= -0.25V and EOAg+/Ag
= 0.80 V [3]
14
23. The half life for radio-active decay for C is 5730 years. If an archaeological survey of a wood
14
sample gave 80% of C then estimate the age of the wood sample.[3]
24. Explain the terms - a)Co-agulation b)peptization c) Hardy-Schulze rule [3]
z
25. Write all the reactions involved in the extraction of iron from it's ore.[3]
26. Draw the structure

of H3P03 What happens when PCls is heated? Why PCI3 fumein

moisture?[3]

27. Though silver has completely filled d-orbitals yet it is a transition element-why? Why the d-block
elements show high enthalpy of atomization? Both Cr2+and Mn3+ have d" configuration yet Cr2+
is reducing while Mn3+ is oxidizing in nature - explain. Explain why EOvalues for Mn, Ni and Zn
are more negative than expected?[5]
OR

Calculate the magnetic moment of a divalent ion in aqueous solution if it's atomic no. is 24 Why
do transition metals form coloured ions? What are the reasons for the d-block elements to be
good catalysts? The d-b!ock metals often form alloys -- why? [5]
28. Draw the structure of dichromate ion. Write the ionic equation for the reaction of dichromate
with ferrous salts in acidic medium. Write the commercial method of preparation of
perrnanganate.
Give one use of potassium permanganate.[5]
OR
Explain 'Ianthanoid contraction'. Why are f-block elements known as inner-transition elements?
What is the composition of Misch metal? Give 2 uses of lanthanoids. Why actinoid contraction is
even more than that of the lanthanoids? [5]
29. Write the formula for the followinga)tetraa mmi neaq uachlorideocoba It( I!I)eh loride
b)potassiumtetrahydroxozincate
(II)
c)dichlorobis(eethane
-1,2-diamine)cobalt(llI)ion
d) mercurytetrathiocya
natocoba Itate( III)
e)d iam m inesilver( I)d icya noa rgentate] I)
[5]
OR
Give one ego of ionization isomerism. Draw the 2 geometrical isomers of [CrCI2(oxhr3 complex
and also state which one will have optical activity.how can you prove that K4[Fe(CN)6] is a
complex salt while CaC03.MgC03 is not?[5]

30. Explain the crystal field splitting of d-orbitals in an octahedral field. Show with proper diagram
. the removal of degeneracy. What are the 2 options available for d4 ions for electronic
distribution

depending

on f:.o

and'P'values? Explain the synergic metal-

CO bond formation[S]

Q.
KENDRIYA VIDYALAYA,
CRPF, MUDKHED
ST
1 Pre-board Examination: 2010-11
fu
MM: 100
Class -. XII
Subject - Chemistry
Time Allowed:
Q

GENERAL INSTRUCTIONS:
1.
All questions are compulsory.
2.
3.

Marks for each question are indicated against it.


Question numbers 1 to 8 are very short answer questions and carry 1 mark each.

4.

Question numbers 9 to 18 are short answer questions and carry 2 marks.

5.

Question number 19 to 27 are also short answer questions and carry 3 marks each.

6.

Question number 28 to 30 are long-answer

7.

Use Log Tables, if necessary. Use of calculators

questions and carry 5 marks each.

Q
Q

is not allowed.

tr

Q.1 define the term amorphous?


Q.2 Give an example of a solid solution

in which the solute is a gas?


(

Q.3 What are enzymes?


Q.4 what are emulsion?

Q.S Why are halogen coloured?


Q.6 Write down the electronic

configuration

of CI?

Q.7 Give the IUPAC name


ofC6HsCOCI ?
-~
Q.8 write the structure of the m- nitro benzaldehyde.
Q.9 Explain the role of
a) cryolite in the electrolyte

reduction

of alumina?

b) carbon monoxide in the purification


Q.10 Explain the following
a} Ferromagnetism

of nickel?

with suitable example.

b) paramaganetisum

Q.11 What role does the molecular interaction

play in solution of alcoho

water?
Q12. Calculate the equilibrium

constant of the reaction

Cu(s)+2Ag(aq)

Cu2+ +2Ag+

EOcell= 0.46v
Q.13 Calculate the molarity of a solution containing

Sg of NaOH Ml soluti;

Q.14 Draw well label diagram of daniell cell having electrode of zinc and'
dipping in
the solution.
Q.1SWhat is the difference

between physisorption

Q.16 What are lyophilic and lyophobic sol?

and chemisorption.

17 Write down the reaction taking place in the different

zone in the blast

nace during
the extraction.

18 Difference between mineral and ore


_9 How is ammonia manufacture

industrially

20 How is sulphur dioxide an air pollutant .

.21 Why is dioxygena gas but sui pur a solid?


22 What are characterstics

of the transition

element and they called

nsition element?

...

23 Write the structure

of the major organic product in the reaction

+ Nal

CH3CH2CH2Cl

Acetone/heat

) ?

- .24 What happen when


a) n- butyl chloride is treated with KOH
.25 Explain why propanol has higher boiling point than that of the
drocarbon butane?

.26 Write the classification

of polymer based on source with example .

.27 Name reagent used in the following

reaction.

a) Oxidation of primary alcohol to carboxylic acid.


b) Benzyl alcohol to benzoic acid.
or
a) Phenol to 2-4-6 Tri-nitrophenol
b) Carboxylic acid to Primary alcohol
.28 How will you convert

a) C6HsNH2

2NaN02

+ 2HCl

273-278

) ?

.29 Why are vitamin A and vitamin C essential to us give their important
sources?

30. Write the name and structure of the monomers of the following

polymer

a) Buna -S b) Buna-N c) Dacron d) Neprone.


Or
What are the biodegradable

and non-biodegradable

detergent?

Give

one example of each?

_.

:DID.'ih

\1)'iALA.l: A.~O."F.)'JA.RANGAON --- 2\)1\)-11

PRE BOARD EXAMINATION


CLASS: XII
SUBJECT: CHEMISTRY
Time: 3 hrs.
General

MM :70

Instructions:

(i).All questions are compulsory.


(iij.Questions 1 to 8 are very short answer type questions carrying 1 mark
each.Answer in One sentence.
(iii).Questions 9 to 18 are short answer type carrying 2 marks each. Answer in 30
words.
(iv).Questions 19 to 27 are short answer type carrying 3 marks each. Answer in 40
words.
(v).Questions 28, 29 and 30 are long answer type carrying 5 marks each. Answer in
70 words.
(vi).Calculators are not permitted. Use log tables if necessary.

1). The value of Df'G" for formation of Cr-O, is -540 Kl/rnol and that of AhO) is
-827 Kl/mol. Is the reduction of CrZ03 possible with AI?
2). When NaBr is heated with cone, H2S04, Br2 is produced but when NaCI is heated

with cone. H2S04, HCI is produced. Why?


3). Write IUPAC name of C6H5NHCOCH3 .

4). What is oxidoreductase?


5). Write IUPAC name of ionization isomer of: [Cr(NH3)sBr]S04.

6). Write example of water in oil type colloids.


7). What is common in hcp and ccp types of solids?
8). Complete the following:
NaB~
~HzCOCH2COOCH3
9). "The extra~
reduction." Explain.

by leaching with NaCN involves both oxidation and

10(i). How many faraday of charge is required for conversion of C6H5NOz into
C6HSNH2.
(ii).During electrolysis ofNaOH ,Ch and H2 while for molten NaCI only Na metal
and Cl2 gas are obtained. Explain these observations with suitable equation.

11). Explain the following:


(i). Clemension reduction.
(ii). Diazotization
12)(i).Why are transition metal compounds colored?
(ii), Although Sc is the first transition element, its compounds are colorless. Why?

13). Why oxide of sulphur is capable of acting as oxidizing as well as reducing agent.
Why?
14)(i).Draw diagram to illustrate the depression in freezing point when non volatile
solute is dissolved in a volatile solvent.
(ii). Two liquids A and B boil at 135C and 1850C respectively. Which of them
has a higher vapour pressure at 800C?
15)(i).V rite mechanism for the cleavage of unsymmetrical ether having a tertiary
group v ith HI.
(ii).\Vh

ethyl ter-butyl ether cannot be prepared starting with ethanol.

16). HO\: do you distinguish:


(i). Phenol and P-Cresol .

(ii). Propanol and ethanol.

17)(i).
at is electrochemical series?
(ii). \Vh are certain monodentate ligands called ambidentate? Give example.

OR
Discuss nature of bonding and magnetic property of the complex [Fe(CN)6
according to V. .13. Theory. At. Number of Fe = 26.

18). Give reasons:


(i). Am.ines are weaker acids than alcohols.
(ii). Phenols does not undergo acid catalyzed dehydration .

.-

19)(i).
each.
(ii).

at are the classes of neurologically active drugs? Write one example for
'hat is the use of sodium benzoate in food?

20)(i). by calculations based on colligative properties of solutions some times gives


abnormal molecular mass values for solute? What is the nature of the
abnormalities?
(ii). 2 gm. ofC6HsCOOH dissolved in 25 gm. of benzene shows a depression in
freezing point equal to 1.62 K Kg/mol. What is the percentage of association
of acid, if it forms a dimmer in solution?
21)(i).Calculate the emf of the cell in which the following reaction takes place.
Ni(s) + 2 Ag+ (0.002M)
------.~
Given that EO cell = 1.05 V.

Ni2+ (O.l6M) + 2 Ag(s)

(ii).What are the products obtained at anode and cathode when aqueous NaCI is
electro lysed with Pt electrode?
22). Answer the following:
(i).How do you classify carbohydrates on the basis of their hydrolysis?
(ii). What are nucleic acids? Mention their two important functions.
23)(i)Chromium crystallizes in bee structure. Its atomic diameter is 245 pm, find
density. Atomic masses of Cr = 52 U, NA = 6.022x1023 mol" .

I'

(ii).Irrthe face centered cubic arrangement of' A' and 'B' atoms where 'A' atoms
are At the comers of the unit cell and 'B' atoms at the face centres.One of the 'A"
atom is missing from one comer in the unit cell. What is the simplest formula of the
compound?
24).Account for the following:
(i).Chlorobenzene is less reactive towards nucleophilic substitution.
(iij.Ethyl amine has lower boiling point than ethyl alcohol.
(iii).PKa of ethanoic acid is greater than that of chloroethanoic acid.
25)(i)Critical temperature ofNa, CO, CH4 are 126, 134 and 110 K respectively.
Arrange Them in increasing order of adsorption on the surface of activated charcoal?
(ii). What happens when a freshly precipitated Fe(OH)3 is shaken with little dil.
FeCl3 solution? Explain with possible reactions.
26)(i).What are chain growth and step growth polymerization?
(ii).Write preparation of
(a). Novolac.
(b). Teflon

Give examples.

27)(i).Which metal in the first transition series exhibits + 1 oxidation state most
frequently and why?
(ii).Write down the number of 3d electrons in each of the following ions:
V2+ C r,
3+ M n,e,
2+ F +2 C-0,3+ C 0,1,
2+ N'2!- C u.2+
...T2+
1,_,
Indicate how the 5d orbitals are to be occupied for these hydrated
ions[ octahedral]..
.
OR
(a).In a given series the differences in the ionization enthalpies between any two
successive d - block elements is very much less. than that in case of S and P block
elements. Give the explanation.
(b). Transition elements exhibit highest oxidation states in oxides rather than in
fluorides Why?
(c).An yellow translucent solution is obtained on passing H2S gas through an acidified
solution ofKMn04. Identify the solution and write the balanced chemical
equation.
28)(i).Complete the following chemical equations and balance them:
(a).NH3 (excess) + Clz
~
(b).P4+ NaOH + H20
~
(C).xeF4 + SbFs
~
(ii).Describe the contact process for manufacture of sulphuri
conditions required to maximize the yield of sulph
illustrate
Following properties of sulnhuric
(a). strong acidic c
~.(cj.dehy
::::n?~'~

29)(i).A reaction IS 1- oraer In .A' and second oraer In .IJ .


(a). Write the differential rate equation.
(b).How is the rate affected when concentration of 'B' is tripled?
(c).How is rate affected when concentration of both 'A' and 'B' is doubled.
(ii).The kinetics of the reaction: A + 2B = Product; obeys the rate equation,
Rate = K [At [BY, for it, find:
(a).Order of the reaction.
(b).Apparent molecularity of reaction
(cj.Order of reaction when 'B' is in large excess.
OR
(i).The rate of reaction : 2NO + eb
~
2NOel,
is doubled when
concentration of eb is doubled and it becomes eight times when concentration
of both NO and eh are doubled. Deduce the order of reaction.
(ii). The time required for 10% completion of a first order reaction at 298 K is equal
to that required for its 25% completion at 308 K. If the pre - exponential factor
for the reaction is 3.56 x 109 Secl, calculate its rate constant at 318 K and also
the energy of activ'ation.
~
30)(i).How do you convert the following?
(a). Aniline to N- methyl aniline.
(b). Benzaldehyde to a - hydroxyl phenyl ethanoic acid.
(c).2 - Bromopropane to 1 - bromopropane.
(ii). Arrange the following in the increasing order of property indicated.
(a)eHF2eOOH, eHeheoOH,
eH3eOOH :-------' Acidic strength.
(b).eH3NH2' (eH3hNH, (CH3)3N -------- Basic strength in solution.
OR
(i).An unknown aldehyde 'A' C7H60 on reaction with KOH gives 'B' and 'C'. 'A'
Reacts with Zn - Hg and concH'Cl to give 'D' which change to 'A' by er02eh.
'B' on heating with soda lime gives 'E'. Identify' A' to 'E' and write all reactions.
(ii). Write equations for:
(a). cross aldol condensation between propanal and ethanal in presence of dil.
NaOH.
(bj.Preparation of2-methyl propan-Zvol from a Grignard reagent.

,.
I

KENDRIYA VIDYAlAYA

Pre
bOCltd ~o.
-=======-

--I'\me:. 3\-\T5.

fJ) -

Z 0J 0

MllYkS -

SU b.: Chemistry

iz"

Std.:

Q. 1

what are the point defects

Q. 2

what is alcosol

10

1
1
of nitrogen in NO-

Q.3

what is Hybridization

Q.4

Zn & Hg has little tendencv.n,

Q.5

Give IUPAC name of following

form complex compound?

1
1

CH39H
CH 3 - 2H - tH - CH3

Q.6

Arrange the f6/lowing compounds in an increasing order of

basic strengths in their aqueous solution

Q.7

Write the structure formula of

.1
2 - Ethoxv - 3 - Methyl Pentane
Q.8

Nylon - 66 is an example of which type of polymer?

Q.9 Complete the fo/lowing

chemical reaction
2

Q.10

2 X e F2 + 2 H2 0

----------7

2 Ag + PCls

----------7

Explain and define

2.
1) Pig iron
2) Wrought
Q.11

iron

Define following
2
1) Rate of Reaction

ernical Kinetics

are the factors on which the conductivity

Q.:=-

of

ytic soio" depend?


(or) .

t
_~

he standard tree;~nergv

-7

__ aq)

Zn 2+(aq)

+ Cuts)

changefor the reaction

EO

= +1.10v

at 25C Given

__ -'"' - or1
-.....__~

Q.l

- e following

reactions

- --0 --7
-- _-- + 14 H+ -7
Q. 1- --_~~-

2
ollowing

reactions

.- 1

-: - H20

.--

J.

_~ __ ~:~ airs of halogen compounds


Q.15
dergoes faster SN I reaction?

3)

Cl

1)

.>.>:
~~

4)

Cl

sent in DNA which one of these is not


Q.l

=-

1\

Q.17

Name two fat soluble vitamins


their deficiency

Q.

their sources & the diseases caused due to

in diet?

18 Explain difference

bet" polyacrylates

Q. 19 Calculate the value of Avogadro

= 2.165

number from following

dNacl

& polyesters
data

g ern"

2.

Distance bet" Na+& Cl in NaCI = 281 pm NaCI is rock salt type structure

(At Mass
Q.20

Na .;;= 23 CL = 35.5

The rate of particular

reaction

doubles when temp changes

~-~

from 27 C to 34 C calculate the energy activation


reaction
Q.21
Q.22

(R = 8.314 jK,l mol")

Give the application


Electrolytic

of colloids

conductivity

Explain following

of KCI at 298

in 2.48

its molar Conductivity?

3
3

is higher than that of methoxymethane

2} Phenol is more acidic than ethanol


3}

Q.24

r' Solu"

observation

1) Boiling point of ethanol


""

of 0.20 mol

X10,2 ohm" ern" calculat;


Q.23

for such a

a&

P nitro phenol is more acidic than phenol

Give the Suitable example of each

1) Linkage Isomerism

2) Ambident
3) Polydentate

ligands
ligands

OR
Draw the Structures
""

1) Ni (CO)4

of

2) Fe (cc),

3
"3) {Cr (Co)d

0.25

the transition

sa ....
e

of 3

(Sd) series of transition

o -a-

e among

0.26 Describe

element

state among actionoide

among the lanthanide

he following

can act as good

are virtually

the

members of 2nd series

ose of the corresponding

3 There is a greater oxidetion


5

& their compounds

elements

rd

e allic'radii

2.

ould you account for the following

than oxidation

Subs with Suitable example of each type

3
1)

on ionic detergent

2) Food preservatives
~

0.27

3) Disinfectants
Complete

the following

reaction

1) CH3NHz + C6HsCOCL -7
2)

NHz

288K

3)
(CH3(O)zO

Pyr.idine
Q.28 Gi e chemical test to distinguish

& propanone

2) Ethanol & Prop anal

in the following

pairs of

substance
1) Propanal

bet compounds

." '

'"
!

./

3) Propanal & Diethyl ether


4) Propanone

& propanaol
OR

Q.28

Arrange the following

Penta -1-01,
Q.29

compounds

butan -1-01, ethanol,

in order to increasing

boiling point

propan -1-01, methanol

i) How is glycerol obtain as a by product of soap industry

3
ii) Draw the structure
1) BrF3

of following

2) XeF4

iii) Give some uses of sulphuric

acid

OR
A) Write the Lewis structure

--7

B) Why oxygen has less tendency


Q.30

A) Define the following


1)

1) N20S

to catenate

2) N20

3) N02

than sulphur

term

Molarity

2) Osmosis
B) Calculate the mole fraction

of benzene in solution

containing

30% by

mass in CCI4
OR.
A) What is meant by
1) Colligative

properties

2) Van's Hoff factor


B) Explain why the boiling point of a Solution containing
.'

is higher than the boiling point of a pyre solvent

a non-volatile

solute
3