You are on page 1of 96

Functional Ingredients & Formulated Products for Cosmetics & Pharmaceuticals

Functional
FunctionalIngredients
Ingredients&&
Formulated
FormulatedProducts
Productsfor
for
Cosmetics
Cosmetics&&Pharmaceuticals
Pharmaceuticals

NOF CORPORATION

CONTENTS
CONTENTS

Functional ingredients

1.LIPIDURE
1-1. LIPIDUREHM, PMB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
1-2. LIPIDUREA, C . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
1-3. LIPIDURES, NR, NA. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
2.CERACUTE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
3.VINOVEIL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
4.ALFEEL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
5.EXTRACTS (PLANT EXTRACTS). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
6.HIGH-PURITY SOYBEAN PHOSPHOLIPIDS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

Base materials

7.FATTY ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
8.TRIGLYCERIDE
8-1.HARDENED OIL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
8-2.TRIGLYCERIDE SATURATED FATTY ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
9.GLYCERIN. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
10.HIGHER ALCOHOL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
11.METALLIC SOAP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
12.FATTY ACID ESTER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
13.SURFACTANTS
13-1.ANIONIC SURFACTANTS . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
13-2.CATIONIC SURFACTANTS . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
13-3.AMPHOTERIC SURFACTANTS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
13-4.NONIONIC SURFACTANTS
(1) SORBITAN FATTY ACID ESTERS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
(2) GLYCERINE FATTY ACID ESTERS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
(3) ALKYROL AMIDES . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
13-5.AMINES . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14.POLYOXYALKYLENE GLYCOL DERIVATIVES
14-1.POLYOXYALKYLENE GLYCOL(Double-Chain Form) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14-2.POLYOXYALKYLENE GLYCOL(Multiple-Chain Form). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14-3.POLYOXYALKYLENE ALKYLETHER(Double-Chain Form) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14-4.POLYOXYALKYLENE ALKYLETHER(Multiple-Chain Form). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14-5.POLYOXYALKYLENE ESTER(Double-Chain Form). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14-6.POLYOXYALKYLENE ESTER(Multiple-Chain Form)
(1) GLYCERIN DERIVATIVES. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
(2) TRI-METHYL PROPANE DERIVATIVES . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
(3) SORBITAN DERIVATIVES. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
(4) CASTOR OIL & HYDROGENATED CASTOR OIL DERIVATIVES. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
(5) SORBITAN DERIVATIVES. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
(6) METHYLGLUCOSIDE DERIVATIVES. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14-7. POLYOXYETHYLENE DERIVATIVE (NITROGEN CONTAINING FORM). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14-8. POLYOXYETHYLENE DERIVATIVE (AMINE OXIDE FORM). . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
14-9. POLYOXYALKYLENE DERIVATIVES. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
15.HYDROGENATED POLYISOBUTENE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
16.VEGITABLE OIL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
17.PURIFIED OLEIC ACID AND ITS DERIVATIVES . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

4
5
6
7
9
10
11
28

30
32
32
33
34
35
36
37
38
40
41
41
42
42
43
47
52
56
58
62
64
65
67
71
74
75
76
77
78
79
80

Premix products

18.PHOSPHOLIPID PREMIX SOLUTIONS


18-1.HIGH-CONCENTRATION EMPTY-LIPOSOME SOLUTION. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
18-2.HIGH-CONCENTRATION CERAMIDE 3 CONTAINED LIPOSOME SOLUTION. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
18-3.PRIMESOME-MB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
18-4.LIPID MIXTURE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
18-5.HYDROGENATED SOYBEAN CYCLIC PHOSPHOLIPID CP7 CONTAINED LIPID MIXTURE EXTRASOME CP7-M. . . .
19. COMPOSITE OF DETERGENTS
19-1. MILD DETERGENT MIXTURE OF AMINO ACID SOAP AND POLYSORBATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
19-2. COMPOSITE OF FOOD DETERGENTS FOR BACTERIAL ERADICATION. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
20. DEFOAMING AGENTS . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

82
83
83
84
84
85
85
86

INDEX

INCI CODE INDEX. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 87


TRADE NAME INDEX. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 91

[Inquiry Address]. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
1

94

Functional ingredients

Base materials

Base materials

Premix products

Premix products

Premix products

Premix products

Index

Index

Index

Index

Functional ingredients

5. EXTRACTS
(PLANT EXTRACTS)

Base materials

4. ALFEEL

Base materials

3. VINOVEIL

Functional ingredients

Functional ingredients

Functional
ingredients

1. LIPIDURE

2. CERACUTE

6. HIGH-PURITY SOYBEAN
PHOSHOLIPIDS

1. LIPIDURE
1-1. LIPIDURE-HM, PMB

Main Application & Features : For mainly Skincare, Moisturizing, Barrier effect, Stress reduction, Improvement of rough skin
LIPIDURE is the polymer which consists of 2-methacryloyloxyethyl phosphoryl
CH3 choline(MPC) whose structure is similar
to that of phospholipid which is one of the elements of cell membrane.

( CH2C )m

LIPIDURE is the polymer designed imitating cell membrane.


C=O
O
LIPIDURE retain plenty of moisture for skin and hair fiber.
O(CH2)2OPO(CH2)2N+(CH3)3
LIPIDURE is very safe and can improve rough skin thanks to its biocompatibility.

O-

CH3

CH3

CH3

( CH2C )m

( CH2C )m

( CH2C )n

C=O

C=O

C=O

OC4H9

O-

OLIPIDURE-HM

( CH2C )m

C=O

O(CH2)2OPO(CH2)2N+(CH3)3

O(CH2)2OPO(CH2)2N+(CH3)3

CH3

CH3

CH3

( CH2C )l

( CH2C )n
O

C=O

C=O

Product Name

O(CH2)2OPO(CH2)2N+(CH3)3

CH3n=7)
LIPIDURE-PMB(m=4, n=1), LIPIDURE-B(m=3,

OC4H9

CH3

( CH2C )m ( CH2C )n
O

O(CH2)2OPO(CH2)2N+(CH3)3

INCI Code

C=O

C=O

OC4H9

O-Na+

O-

O-

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


LIPIDURE-HM

CH3

( CH2C )l

LIPIDURE-PMB

C=O

CH
CH3ACRYLATE, WATER,
CH33BUTYLENE GLYCOL,
POLYPHOSPHORYLCHOLINE GLYCOL
METHYLPARABEN ( CH2C )
(( CH
CH22C
C ))
m

m
n

O
POLYQUATERNIUM-51,
WATER C=O

C=O
C=O

O(CH2)2OPO(CH2)2N+(CH3)3

OC4H9

CH3
( CH2C )n

C=O

2)2OPO(CH2)2N+(CH3)3
O(CH
O-Na+

O-

OCH2CHCH2N+(CH3)
CIOH

LIPIDURE-PMB(Ph10)

POLYQUATERNIUM-51,
WATER, PHENOXYETHANOL
-

LIPIDURE-PMB(BG)CH3

POLYQUATERNIUM-51, WATER, BUTYLENE


GLYCOL CH3
CH3

CH3

( CH2C )n

( CH2C )m

( CH2C )n

C=O

C=O

( CH2C )m
For COSMETICC=O
USE ONLY
O

+(CH
23
)2)3OPO(CH2)2N+(CH3)3
O(CH
2)2N+(CH3)3GLYCOL
OCH
2CHCHWATER,
2N
O(CH2)2OPO(CH
LIPIDURE-HM(Ph10)
POLYPHOSPHORYLCHOLINE
ACRYLATE,
PHENOXYETHANOL
O-

LIPIDURE-HM-500

CH3

LIPIDURE-PMB(Ph10)-1M
( CH2C )
m

LIPIDURE-B

C=O

OH

CI-

O-

POLYPHOSPHORYLCHOLINE GLYCOL ACRYLATE, WATER, BUTYLENE GLYCOL,


METHYLPARABEN

CH3

POLYQUATERNIUM-51,( WATER,
PHENOXYEHANOL
CH2C
)
n

C=O

POLYQUATERNIUM-51, WATER, PHENOXYETHANOL

O(CH2)2OPO(CH2)2N+(CH3)3

O(CH2)17CH3

O-

C=O
O(CH2)17CH3

1-2.

1. LIPIDURE

Functional ingredients

Functional ingredients

Base materials

Base materials

Premix products

Premix products

Index

Index

Functional ingredients

CH3

Functional ingredients

( CH2C )m
CH3
C=O
O
( CH2C )m
O(CH2)2OPO(CH2)2N+(CH3)3
C=O
OLIPIDURE-A,
C O
O(CH2)2OPO(CH2)2N+(CH3)3
CH3
O-

( CH2C )
( CH2C )
CH3
CH3
C=O
O
C=O
LIPIDURE-A & LIPIDURE-C
products.
LIPIDURE-A has anionic groups in its structure,
( CH2has
Cbeen
)m developed for hair+care
( CH
2C )n
2OPO(CH
)2Nfrom
(CH
3)3
OC
9
O(CH
that give plenty of moisture to hair
fiber2)and
prevent 2hair
spreading
by4H
reducing
the static electricity.
C=O
O
C=O
LIPIDURE-C has cationic groups in its structure,
that form hydrogel on hair fiber uniformly and result in giving smooth
Ocombing.
O(CH2)2OPO(CH2)2N+(CH3)3 OC4H9
CH3
CH3
CH3
On
Main Application & Features : Formhair care, Moisturizing, Anti static electricity,
Smooth combing

Base materials

Base materials

( CH2C )l
( CH2C )m ( CH2C )n
CH3
CH3
CH3
C=O
O
C=O
C=O
( CH2C )l
( CH2C )
( CH2C-)n +
4H9
O Na
O(CH2)2OPO(CH2)2N+(CH3)3 OCm
C=O
OC=O
C=O
O
+
O-Na
O(CH2)2OPO(CH2)2N+(CH3)3 OC4H9
LIPIDURE-A
CH3
CH3
O( CH2C )m
( CH2C )n
CH3
CH3
C=O
O
C=O
( CH2C )m
( CH2C )n
2CHCH2N+(CH3)3
O(CH2)2OPO(CH2)2N+(CH3)3 OCH
C=O
OC=O
CIO
OH
O(CH2)2OPO(CH2)2N+(CH3)3 OCH2CHCH2N+(CH3)3
CICH3
CH3 OH
O-

POLYQUATERNIUM-65, WATER, PHENOXYETHANOL

Index

LIPIDURE-A

O-

LIPIDURE-C

Premix products

For COSMETIC USE ONLY

Premix products

( CH2C )m
( CH2C )n
CH3
CH3
C=O
O
C=O
( CH2C )m
( CH2C )n
O(CH
2)17CH3
O(CH2)2OPO(CH2)2N+(CH3)3 INCI
Product Name
Code
C=O
OC=O
O
O(CH2)2OPO(CH2)2N+(CH3)3 O(CH2)17CH3

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


LIPIDURE-C

POLYQUATERNIUM-64, WATER, PHENOXYETHANOL

Index

C=O

C=O

O(CH2)2OPO(CH2)2N+(CH3)3

OC4H9

O3
1-3. LIPIDURE-S, CH
NR,
NA

CH3

( CH2C )l
C=O

CH3

( CH2C )m ( CH2C )n
O

C=O

C=O

O(CH2)2OPO(CH2)2N+(CH3)3

OC4H9

O-Na+

C=O

C=O

Main Application & Features : Emollience, Barrier effect

LIPIDURE-S consists of MPC and Stearyl methacrylate, moieties and is water-insoluble due to its hydrophobicity. It is
O- and foundation.
formulated in make-up products such as lipstick
LIPIDURE-S also has a self -assembly property, that forms, micro polymer micelles in water. When micro polymer
CH3 lamellar layer is formed on the surface
CH3 of skin and hair fiber.
micelles suspension is used and dried,
This structure generates (an
excellent
and
hair)fiber. LIPIDURE-S aqueous suspension can
CH
2C ) barrier on the surface of skin
( CH
2C
m
n
also be formulated for skin care and hair care products.

LIPIDURE-NR is a multivalent alcohol


solution
which contains
5%3)LIPIDURE-S,
and LIPIDURE-NA
2)2OPO(CH
2)2N+(CH
3
OCH2CHCH
2N+(CH3)3 is a micro polymer
O(CH
micelle suspension which contains 1% LIPIDURE-S
CI-

O-

OH

CH3

CH3

( CH2C )m

( CH2C )n

C=O

C=O

O(CH2)2OPO(CH2)2N+(CH3)3

O(CH2)17CH3

OLIPIDURE-S

Product Name

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


LIPIDURE-S

POLYQUATERNIUM-61

LIPIDURE-NR

POLYQUATERNIUM-61, GLYCERIN, BUTYLENE GLYCOL

LIPIDURE-NA

POLYQUATERNIUM-61, GLYCERIN, BUTYLENE GLYCOL,


PCA ETHYL COCOYL ARGINATE, WATER

2. CERACUTE
2-1. CERACUTE-F, L, V
Functional ingredients

Functional ingredients

Functional ingredients

Base materials

Base materials

Base materials

Premix products

Premix products

Index

Index

Functional ingredients

Main Application & Features : Anti-aging(Improvement of skin elasticity, anti-wrinkle and volumizing of hair)

CERACUTE is an original cosmetic ingredient which is designed imitating natural ceramide structure, and has an
excellent affinity to skin and the other properties that natural ceramide does not have due to the polymerization.
Once CERACUTE is used on the surface of skin and hair fiber, elastic polymer network is formed there, and hydrogen
bonding of intra - or inter molecule of CERACUTE improves skin elasticity, lifts up wrinkles without strained feeling, and
volumizes hair.

CH3

( CH2C )m

( CH2C )n

C=O

Base materials

CH3

C=O

OCH2CH2NHCOCH2CHCH2
OHOH

Product Name

O(CH2)17CH3

CERACUTE-F

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

CERACUTE-V

GLYCERYLAMIDOETHYL METHACRYLATE/STEARYL METHACRYLATE COPOLYMER,


GLYCERIN, BUTYLENE GLYCOL, PCA ETHYL COCOYL ARGINATE, WATER

Index

GLYCERYLAMIDOETHYL METHACRYLATE/STEARYL METHACRYLATE COPOLYMER,


GLYCERIN, BUTYLENE GLYCOL

Premix products

CERACUTE-L

Index

GLYCERYLAMIDOETHYL METHACRYLATE/STEARYL METHACRYLATE COPOLYMER

Premix products

CERACUTE-F

2-2. CERACUTE-G

Main Application & Features: Anti-Ageing (Improving gloss of hair)


CERACUTE-G is a hair care polymer which composition is shown as below. It recovers shininess lost by aging or
damaging to natural beauty hair shine. To compare with silicone or hydrocarbon oils, CERACUTE-G does not give
stickiness or heavy texture, but smooth and light texture.

CH3
( CH2C )l
C=O

CH3

CH3

( CH2C )m

( CH2C )n

C=O

C=O

OCH2CH2NHCOCH2CHCH2

O CH

OHOH CH3 C

CH3
C

CH2

CH3

CH2
CH

OCH2CH2N+(CH3)3
CI-

CH2
CERACUTE-G

Product Name

INCI Code

For COSMETIC USE ONLY


Ceracute-G

POLYQUATERNIUM-92, BUTYLENE GLYCOL, CITRIC ACID,WATER

3. VINOVEIL
3-1.VINOVEIL-BS

VINOVEIL-BS is a dialkyl type Gemini compound having phosphorylcholine (PC) mimetic structure as hydrophilic group.
PC group is a polar head of phospholipids which is one of the elements of cell membrane. High biocompatibility and
Hydrophilicity are noteworthy features of this functional group.
Gemini compound has been known by its unique structure; multiple hydrophilic & hydrophobic groups in a molecule,
having high surface activity and self-associating property. The benefits of VINOVEIL-BS are shown below.

Functional ingredients

Functional ingredients

Functional ingredients

Functional ingredients

Main Application & Features: Lamellar similar membrane for Skin care, Hair

High safety due to its similar structure of phosphorylcholine group.


Easily forming small multi-lamellar vesicles in water by itself. The vesicles form lamellar body like film on skin and hair.
Efficacy of lamella body includes improvement of smoothness, moisturizing, and barrier properties, above all for hair
care. VINOVEIL penetrates inside of hair and gives consistency.

Base materials

Premix products

Premix products

Base materials

Base materials

Base materials

N
VINOVEIL-BS

For COSMETIC USE ONLY


VINOVEIL-BS-100P

BEHENDIMONIUM ETHYL STEARYL PHOSPHATE

VINOVEIL-BS-1D

BEHENDIMONIUM ETHYL STEARYL PHOSPHATE, BEHENTRIMONIUM


CHLORIDE, GLYCERIN, ALCOHOL, WATER

Premix products

INCI Code

Premix products

Product Name

Prototype

Index

Index

Index

Index

4. ALFEEL
4-1.ALFEEL -SD

Main Application & Features : Improving lubricity of hair in wetting


ALFEEL-SD is a hair care polymer; compositon shown as below. Nano-gel particles can be formed by self-association
of this polymer in water and it can improve lubricity of hair in wetting. Furthermore, this polymer has high adsorption to
hair due to positive charge, but it does not accumulate.

R = Long alkyl chain group


2
R = Cationic gruop

Product Name

INCI Code

For COSMETIC USE ONLY


ALFEEL-SD

POLYQUATERNIUM-107, , PHENOXYETHANOL, CITRIC ACID, SODIUM CITRATE, WATER

10

5. EXTRACTS (PLANT EXTRACTS)


5-1. APRICOT JUICE PH
Functional ingredients
Base materials

Base materials

Base materials

Functional ingredients

Base materials

Functional ingredients

Functional ingredients

Main Application & Features : Enhance hyaluronan production, Antioxidative activity (SOD mimicking activity),
Exfoliating activity
APRICOT JUICE PH boosts the skin's ability to retain moisture by enhancement of the production of hyaluronic acid.

Ingredient

Compound
Ratio (%)

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Premix products
Index

11

Index

PHENOXYETHANOL

84.4

Premix products

Phenoxyethanol

Index

GLYCERIN

Premix products

Concentrated Glycerin

Index

PRUNUS ARMENIACA(APRICOT) JUICE

Premix products

Apricot Juice

14.9
0.7

5-2. KUMIS KUCHING EXTRACT BG

Main Application & Features : Endotherin-1 inhibition (Skin-whitening), Antioxidative activity


KUMIS KUCHING EXTRACT BG is utilized as an agent for the treatment of skin pigmentation such as spots and
freckles induced by UV.

This product is the material jointly developed with National Institute of Advanced Industrial Science and Technology.
Patent licensing : Patent No. JP4992008

Ingredient

INCI Code

Compound
Ratio (%)

For COSMETIC USE ONLY

BUTYLENE GLYCOL

59.6

WATER

39.5

ORTHOSIPHON STAMINEUS EXTRACT

0.9

12

5. EXTRACTS (PLANT EXTRACTS)

5-3. CHINPI EXTRACT K65B


Functional ingredients
Base materials

Base materials

Base materials

Functional ingredients

Base materials

Functional ingredients

Functional ingredients

Main Application & Features : Suppression of tyrosinase biosynthesis (Skin-whitening), Protection against UV,
Blood circulation promotion
Citrus tachibana peel extract is utilized as an agent for the treatment of skin pigmentation such as spots and freckles
induced by UV.

Ingredient

Compound
Ratio (%)

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Premix products

Index

Index

64.0

Premix products

13

Index

CITRUS AURANTIUM TACHIBANA PEEL EXTRACT

Premix products

WATER

Index

Citrus Unshiu Peel Extract

Premix products

BUTYLENE GLYCOL

34.4
1.6

5-4. AKEBIA EXTRACT BG

Main Application & Features : Stimulation of urea synthesis (moisturizing action)


AKEBIA EXTRACT BG boosts the skin's ability to retain moisture by enhancement of the production of natural
moisturizing factor, Urea on keratinocytes.

Ingredient

INCI Code

Compound
Ratio (%)

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


AKEBIA TRIFOLIATA STEM EXTRACT

0.9

WATER

69.1

BUTYLENE GLYCOL

30.0

Akebia Extract

1,3-Butylene Glycol

14

5. EXTRACTS (PLANT EXTRACTS)

5-5. SHEKWASHA EXTRACT BG


Functional ingredients
Base materials

Base materials

Base materials

Functional ingredients

Base materials

Functional ingredients

Functional ingredients

Main Application & Features : Suppression of tyrosinase biosynthesis (Skin-whitening), Inhibition of collagenase
biosynthesis (Protection of dermal matrix), Inhibition of prostaglandin synthesis (Anti-inflammatory)

Citrus depressa peel extract is utilized as an agent for the treatment of skin pigmentation such as spots and freckles
induced by UV.

Patent licensing from the research institute of Ministry of Agriculture, Forestry and Fisheries of Japan
Patent No. JP3010210
Ingredient

Compound
Ratio (%)

INCI Code

WATER
CITRUS DEPRESSA PEEL EXTRACT

59.2
39.4

Premix products

Citrus Unshiu Peel Extract

Premix products

BUTYLENE GLYCOL

Premix products

Premix products

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

1.4

Index

Index

Index

Index

15

5-6. PASSION FRUIT EXTRACT BG

Main Application & Features : Endotherin-1 inhibition (Skin-whitening), Antioxidative activity


Passion fruit extract is a new natural anti-ageing ingredient extracted from pericarp of Passiflora edulis in Okinawa.
Various polyphenols such as luteolin glycoside are contained as an active components. It has the antioxidative effect and
controls the Endotherin-1 production.

This product is the material jointly developed with National Institute of Advanced Industrial Science and Technology.
Patent licensing : Patent No. JP4992008
Ingredient

INCI Code

Compound
Ratio (%)

For COSMETIC USE ONLY

BUTYLENE GLYCOL

59.3

WATER

39.5

PASSIFLORA EDULIS PEEL EXTRACT

1.2

16

5. EXTRACTS (PLANT EXTRACTS)

5-7. CAMELLIA FLOWER EXTRACT BG


Functional ingredients
Base materials

Base materials

Base materials

Functional ingredients

Base materials

Functional ingredients

Functional ingredients

Main Application & Features : Antioxidative activity, Anti-androgenic mimicking effect

Camellia flower extract is a new natural anti-ageing ingredient extracted from the flower of Camellia japonica in Goto
islands, Nagasaki. Camellioside A and B are contained as active components. Therefore, it has antioxidative effect and
inhibits 5-reductase activity.

Ingredient

Compound
Ratio (%)

INCI Code

For COSMETIC USE ONLY

Premix products

Index

Index

49.5

Premix products

17

Index

CAMELLIA JAPONICA FLOWER EXTRACT

Premix products

WATER

Index

Premix products

BUTYLENE GLYCOL

49.5
1.0

5-8. CAMELLIA SEED EXTRACT BG

Main Application & Features : Estrogen-like effect, Antioxidative activity


CAMELLIA SEED EXTRACT BG is a new natural anti-ageing ingredient extracted from the seed of Camellia japonica in
Goto islands, Nagasaki. The extract has estrogen-like effect and antioxidative activity.

Ingredient

INCI Code

Compound
Ratio (%)

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


1,3-Butylene Glycol

BUTYLENE GLYCOL

50.0

WATER

49.2

CAMELLIA JAPONICA SEED EXTRACT

0.8

Camellia Extract

18

5. EXTRACTS (PLANT EXTRACTS)

5-9. BAKUMONDOU EXTRACT BG


Functional ingredients
Base materials

Base materials

Base materials

Functional ingredients

Base materials

Functional ingredients

Functional ingredients

Main Application & Features : Stimulation of urea synthesis (moisturizing action)

BAKUMUNDOU EXTRACT BG boosts the skin's ability to retain moisture by enhancement of the production of natural
moisturizing factor, Urea on keratinocytes. Because of its colorless and transparent property, it is possible to use it for
many kinds of cosmetics.

Ingredient

Compound
Ratio (%)

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Premix products

Index

Index

69.0

Premix products

19

Index

OPHIOPOGON JAPONICUS ROOT EXTRACT

Premix products

BUTYLENE GLYCOL

Index

Ophiopogon Tuber Extract

Premix products

WATER

29.6
1.4

5-10. EUCALYPTUS EXTRACT ET

Main Application & Features : Antimicrobial activity, Skin-whitening, Anti-androgenic mimicking effect,
Antiinflammatory, Cellular stimulant, Antioxidative activity
EUCALYPTUS EXTRACT ET is made from young leaves of eucalyptus in Japan. An antibacterial activity, whitening
action, anti-male hormone like action, anti-inflammation action, and cell activating action can be expected.

Ingredient

INCI Code

Compound
Ratio (%)

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

EUCALYPTUS EXTRACT ET

ALCOHOL

49.2

WATER

49.2

EUCALYPTUS GLOBULUS LEAF EXTRACT

1.6

20

5. EXTRACTS (PLANT EXTRACTS)

5-11. CAMELLIA LEAF EXTRACT BG


Functional ingredients
Base materials

Base materials

Base materials

Functional ingredients

Base materials

Functional ingredients

Functional ingredients

Main Application & Features : Anti-oxidative effect, Anti-elastase activity, Collagen promoting effect, Estrogenlike effect
CAMELLIA LEAF EXTRACT BG is a new natural anti-ageing ingredient extracted from the leaves of Camellia japonica
grown in Goto islands, Nagasaki. Catechins, camelliatannins and camellianosides are contained as active components.
The extract has anti-oxidative effect, anti-elastase activity, collagen promoting effect and estrogen-like activity.

Ingredient

CAMELLIA JAPONICA LEAF EXTRACT

49.5
49.5

Premix products

WATER

Premix products

BUTYLENE GLYCOL

Premix products

Premix products

For COSMETIC USE ONLY

Compound
Ratio (%)

INCI Code

1.0

Index

Index

Index

Index

21

5-12. TURMERIC EXTRACT BG

Main Application & Features : Anti-oxidative effect, Anti-elastase activity, Estrogen-like effect
TURMERIC EXTRACT BG is obtained by extracting with 1,3-butylene glycol solution from the root of Curcuma longa
grown in Okinamwa. Curcumin is contained as active component. The extract has anti-oxidative effect, anti-elastase
activity and estrogen-like activity.

Ingredient

INCI Code

Compound
Ratio (%)

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Turmeric Extract

BUTYLENE GLYCOL

79.8

WATER

19.9

CURCUMA LONGA (TURMERIC) ROOT EXTRACT

0.3

22

5. EXTRACTS (PLANT EXTRACTS)

Functional ingredients
Base materials

Base materials

Base materials

Functional ingredients

Base materials

Main Application & Features : Hyaluronan production enhancing effect, Cytoskeleton enhancing effect,
Collagen-gel contracting effect, Transglutaminase expression enhancing effect, Ceramide production
enhancing effect, Aquaporin 3 expression enhancing effect

Functional ingredients

Functional ingredients

5-13. CyPA - ET (Liquid type)



CyPA - PW (Powder type)

CyPA has been identified as a novel lysophospholipid with quite unique structure and is obtained from the culture
medium of slime mold (Physarum polycephalum) by Prof. Murofushi in 1985. It has also been found that CyPA is located
in human serum and tear. Recently, it has been shown that CyPA has various biological functions. We have introduced
the technology of enzymatic process to produce CyPA from Prof. Murofushi, and have applied it to cosmetics.

O
CH2O

O
O

O CH

O CH2

Product Name

Compound
Ratio (%)

INCI Code

For COSMETIC USE ONLY

WATER

20

40
40

CYCLIC LYSOPHOSPHATIDIC ACID

50

CYCLODEXTRIN

50

Premix products

ALCOHOL

Premix products

CyPA - ET

Premix products

Premix products

CYCLIC LYSOPHOSPHATIDIC ACID

CyPA - PW

Index

Index

Index

Index

23

5-14. ECKLEXT BG

Main Application & Features : Anti-oxidative effect, MMP-2 inhibitory effect


ECKLEXT BG is obtained by extracting with 1,3-butylene glycol solution from whole algae of Phaeophyta (Ecklonia
kurome) harvested in a marine area of Amakusa, Kumamoto. It contains an abundance of seaweed polyphenols
(phlorotannins). The extract has anti-oxidative effect and MMP-2 inhibitory effect.

Ingredient

INCI Code

Compound
Ratio (%)

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Seaweed Extract (1)

ECKLONIA KUROME EXTRACT

1.0

BUTYLENE GLYCOL

79.2

WATER

19.8

24

5. EXTRACTS (PLANT EXTRACTS)

5-15. VERBENA OFFICINALIS EXTRACT BG


Functional ingredients
Base materials

Base materials

Base materials

Functional ingredients

Base materials

Functional ingredients

Functional ingredients

Main Application & Features : Anti-allergic effect, Anti-inflammatory effect, Anti-oxidative effect

VERBENA OFFICINALIS EXTRACT BG is obtained by extracting with 1,3-butylene glycol solution from whole plant of
Vervena officinalis grown in Okinamwa. The extract has an anti-allergic, an anti-inflammatory and anti-oxidative effect.

Ingredient

VERBENA OFFICINALIS EXTRACT

79.5
19.9

Premix products

WATER

Premix products

BUTYLENE GLYCOL

Premix products

Premix products

For COSMETIC USE ONLY

Compound
Ratio (%)

INCI Code

0.6

Index

Index

Index

Index

25

5-16. YOUKOU SAKURA FLOWER EXTRACT BG

Main Application & Features : Anti-oxidative effect, Estrogen-like effect


YOUKOU SAKURA FLOWER EXTRACT BG is obtained by extracting with 1,3-butylene glycol solution from flower of
Cerasus youkou grown in Ehime. Cerasus youkou is cherry contributed as a symbol of peace not only in Japan but
everywhere in the world. It has many pink flowers, and is resistant to disease and severe climate. The extract protects
your skin and promotes youthful skin. The extract has anti-oxidative effect and estrogen-like activity.

Ingredient

INCI Code

Compound
Ratio (%)

For COSMETIC USE ONLY

BUTYLENE GLYCOL

79.4

WATER

19.8

CERASUS YOUKOU FLOWER EXTRACT

0.8

26

5. EXTRACTS (PLANT EXTRACTS)

5-17. YOUKOU SAKURA LEAF EXTRACT BG


Functional ingredients
Base materials
Premix products

Premix products

Premix products

Base materials

Premix products

Base materials

Functional ingredients

Base materials

Functional ingredients

Functional ingredients

Main Application & Features : Anti-oxidative effect, Skin-whitening like effect, Estrogen-like effect

YOUKOU SAKURA LEAF EXTRACT BG is obtained by extracting with 1,3-butylene glycol solution from flower of
Cerasus youkou grown in Ehime. Cerasus youkou is cherry contributed as a symbol of peace not only in Japan but
everywhere in the world. It has many pink flowers, and is resistant to disease and severe climate. The extract protects
your skin and promotes youthful skin. The extract has anti-oxidative effect, skin-whitening effect and estrogen-like
activity.

Ingredient

INCI Code

For COSMETIC USE ONLY


BUTYLENE GLYCOL

Compound
Ratio (%)

79.4

WATER

19.8

CERASUS YOUKOU LEAF EXTRACT

0.8

Index

Index

Index

Index

27

6. HIGH-PURITY SOYBEAN PHOSPHOLIPIDS

Main Application & Features : Emulsifiers, Moisturizing agents


These products are high-purity soybean phospholipids and Cholesterol() suitable for making various high-quality
cosmetics, especially for liposomal cosmetics.
They give excellent effects such as enhancing moisturizing function of skin, promoting recovery of barrier function of
skin, delivering and slowly releasing active agents to skin.
Marlne Cholesterol(fish delivered)

Ingredient

Product Name

INCI Code

PC purity

Appearance

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Hydrogenated soybean phospholipid

COATSOME NC-21

HYDROGENATED
LECITHIN

90% or more

White Powder

Hydrogenated soybean phospholipid

COATSOME NC-61

HYDROGENATED
LECITHIN

60% or more

Pale yellow Powder

Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Cholesterol

CHOLESTEROL M

CHOLESTEROL

28

White Powder

Functional ingredients

Functional ingredients

Base materials

Base materials

Premix products

Premix products

Index

Index

Functional ingredients

Base
materials
7. FATTY ACID

8. TRIGLYCERIDE
Base materials

9. GLYCERIN

10. HIGHER ALCOHOL


11. METALLIC SOAP
12. FATTY ACID ESTER
13. SURFACTANTS

Premix products

14. POLYOXYALKYLENE
GLYCOL DERIVATIVES
15. HYDROGENATED
POLYISOBUTENE
16. VEGITABLE OIL
17. PURIFIED OLEIC ACID
AND ITS DERIVATIVES

Index

29

7. FATTY ACID

Main Application & Features : Pharmaceutical Additives, Food Additives, Oily Base
Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE PHARAMACOPOEIA (JP)


Stearic Acid

JP STEARIC ACID
NAA-180P-1

Powder

Approved by JAPANESE PHARAMACEUTICAL EXCIPIENTS (JPE)


Refined Oleic Acid

JPE EXTRA OS-85

Liquid

Behenic Acid

JPE BEHENIC ACID


(NAA-222S)

Beads

Approved by JAPAN'S SPECIFICATIONS AND STANDARDS FOR FOOD ADDITIVES (JSSAF)


Stearic Acid

NAA-180

30

Beads

7. FATTY ACID

Lauric Acid
Myristic Acid
Palmitic Acid

NAA-102

CAPRIC ACID

NAA-122
NAA-142
NAA-160

MYRISTIC ACID

Beads

PALMITIC ACID

Beads

NAA-172
NAA-173K
NAA-174
NAA-175
Stearic Acid

NAA-176

Solid
Liquid

STEARIC ACID

Base materials

NAA-171

Appearance

Beads

LAURIC ACID

NAA-312

Base materials

Capric Acid

Functional ingredients

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Base materials

INCI Code

Functional ingredients

Product Name

Functional ingredients

Ingredient

Beads

NAA-180
NAA-1865
NAA-1850
STEARIC ACID CHERRY
Behenic Acid

NAA-222S

Beads or Powder
BEHENIC ACID

Beads

NAA-34

EXTRA OLEIN-80
EXTRA OLEIN-80R
EXTRA OS-85
Linoleic Acid

EXTRA LINOLEIC 90
LINOLEIC ACID 90

Liquid

LINOLEIC ACID

Liquid

Hydroxystearic Acid

HYDROXYSTEARIC ACID

HYDROXYSTEARIC ACID

Flake

Coconut Acid

COCONUT ACID
NAA - 415

COCONUT ACID

Liquid

Index

31

Index

OLEIC ACID

Premix products

EXTRA OLEIN

Index

Oleic Acid

Premix products

NAA-400

Premix products

NAA-35

8. TRIGLYCERIDE
8-1. HARDENED OIL

Main Application & Features : Fatliquors, Oily Base


Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Hydrogenated Oil

CASTER WAX A

HYDROGENATED CASTOR OIL

Flake

8-2. TRIGLYCERIDE SATURATED FATTY ACID


Main Application & Features : Pharmaceutical Additives, Fatliquors, Oily Base
Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS (JPE)


JPE PANACET 800
Medium Chain Fatty Acid Triglyceride

JPE PANACET 810

Liquid

Solid

JPE PANACET 810S


PHARMASOL A-105
PHARMASOL B-105
Hard Fat

PHARMASOL B-112
PHARMASOL B-115
PHARMASOL N-145

Approved by JAPAN'S SPECIFICATIONS AND STANDARDS FOR FOOD ADDITIVES (JSSFA)


PANACET 800
Medium Chain Fatty Acid Triglyceride

PANACET 810

PANACET 810S

Liquid

PANACET 875
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
Glyceryl Tri-2-ethylhexanoate

PANACET 800B

TRIETHYLHEXANOIN

Glyceryl Tricaprylate

PANACET 800

TRICAPRYLIN

PANACET 810
Caprylic / Capric Acid Triglyceride

Liquid

CAPRYLIC/CAPRIC
TRIGLYCERIDE

PANACET 810S
PANACET 875

Production by order

32

9. GLYCERIN

JP GLYCERIN 85

Liquid

JP CONCENTRATED GLYCERIN

Base materials

JP CONCENTRATED GLYCERIN-S

Approved by JAPAN'S SPECIFICATIONS AND STANDARDS FOR FOOD ADDITIVES (JSSFA)


Glycerin

Index

Appearance

JP GLYCERIN PG-S
JP GLYCERIN 85-S

Concentrated Glycerin

Premix products

Glycerin

Base materials

JP GLYCERIN PG

Functional ingredients

Approved by JAPANESE PHARAMACOPOEIA (JP)

Index

INCI Code

Premix products

Product Name

Base materials

Ingredient

Functional ingredients

Functional ingredients

Main Application & Features : Medicines, Pharmaceutical Additives, Food Additives, Moisturizers

FOOD ADDITIVE GRADE GLYCERIN

FOOD ADDITIVE GRADE GLYCERIN-S

Liquid

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Glycerin
CONCENTRATED Glycerin

GLYCERIN 85
GLYCERIN 85-S

GLYCERIN

RG CO

Liquid

RG CO P

Premix products
Index

33

10. HIGHER ALCOHOL

Main Application & Features : Oily Base


Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Lauryl Alcohol

NAA-42

LAURYL ALCOHOL

Solid

Myristyl Alcohol

NAA-43

MYRISTYL ALCOHOL

Beads

Cetanol

NAA-44

CETYL ALCOHOL

Beads

STEARYL ALCOHOL

Beads

CETEARYL ALCOHOL

Beads

OLEYL ALCOHOL

Liquid

BEHENYL ALCOHOL

Beads

Stearyl Alcohol
Cetostearyl Alcohol
Oleyl Alcohol
Behenyl Alcohol

NAA-45
NAA-46
NAA-48
NAA-49
NAA-51
NOFABLE AO-85S
NAA-422

34

11. METALLIC SOAP


Functional ingredients

Functional ingredients

Base materials

Base materials

Premix products

Premix products

Functional ingredients

Main Application & Features : Pharmaceutical Additives, Food Additives, Cosmertics (Powder), Thickening Agents, Glidants, Liquidity Improvers
Ingredient

Product Name

INCI Code

Approved by JAPANESE PHARMACOPOEIA (JP)


Calcium Stearate
Magnesium Stearate

JP CALCIUM STEARATE
JP MAGNESIUM STEARATE

Appearance

Powder

JP MAGNESIUM STEARATE-S

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS (JPE)


Aluminum Stearate

ALUMINUM STEARATE 600


SHOKUBUTSU

Base materials

ALUMINUM STEARATE 600

Powder

Approved by JAPAN'S SPECIFICATIONS AND STANDARDS FOR FOOD ADDITIVES (JSSFA)


Calcium Stearate
Magnesium Stearate

AULABRITE CA-65
AULABRITE CA-65F

Powder

AULABRITE MA-76

Approved by JAPANESE STANDARDS OF QUASI-DRUG (JSQI)


Zinc Laurate

POWDERBASE L

ZINC LAURATE

Zinc Myristate

POWDERBASE M

ZINC MYRISTATE

ZINC STEARATE-S

ZINC STEARATE

ZINC STEARATE SHOKUBUTSU


Calcium Stearate

CALCIUM STEARATE
CALCIUM STEARATE SHOKUBUTSU

CALCIUM STEARATE

ALUMINUM STEARATE 600


Aluminum Stearate

Magnesium Stearate

ALUMINUM STEARATE 600


SHOKUBUTSU
MAGNESIUM STEARATE
MAGNESIUM STEARATE-S

Premix products

ZINC STEARATE
Zinc Stearate

Powder

ALUMINUM DISTEARATE

MAGNESIUM STEARATE
Production by order

Index

Index

Index

35

12. FATTY ACID ESTER

Main Application & Features : Pharmaceutical Additives, Food Additives, Cosmertics (Powder), Thickening Agents, Glidants, Liquidity Improvers
Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS (JPE)


Isopropyl Myristate

JPE IPM-R

Liquid

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Cetyl Myristate

CETYL MYRISTATE

CETYL MYRISTATE

Octyldodecyl Myristate

OCTYLDODECYL MYRISTATE

OCTYLDODECYL MYRISTATE

Isopropyl Myristate

IPM-R

ISOPROPYL MYRISTATE

Isopropyl Palmitate

IPP-R

ISOPROPYL PALMITATE

Butyl Stearate

BUTYL STEARATE

BUTYL STEARATE

Stearyl Stearate

UNISTER M-9676

STEARYL STEARATE

Ethyl Oleate

NOFABLE EO-85S

ETHYL OLEATE

Decyl Oleate

NOFABLE DO-85S

DECYL OLEATE

Diisopropyl Sebacate

UNISTER D-3BS

DIISOPROPYL SEBACATE

Diethylhexyl Sebacate

UNISTER DOS

DIETHYLHEXYL SEBACETE

Neopentyl Glycol Diethylhexanoate

UNISTER H-208BRS

NEOPENTYL GLYCOL
DIETHYLHEXANOATE

Pentaerythrity tetraoctanonate

UNISTER H-408BRS

PENTAERYTHRITYL
TETRAOCTANONATE

Ethylene Glycol Distearate

UNISTER E-275

GLYCOL DISTEARATE

UNISTER E-286

Ethylhexyl Palmitate

UNISTER MB-816

ETHYLHEXYL PALMITATE

Ethylhexyl Stearate

UNISTER MB-876

ETHYLHEXYL STEARATE

36

Liquid

Solid

Liquid

Flake
Liquid

13. SURFACTANTS
13-1. ANIONIC SURFACTANTS

SEKKEN SOJI-K, WATER

NONSOUL MK-1

POTASSIUM MYRISTATE

NONSOUL PK-1

POTASSIUM PALMITATE

NONSOUL OK-1

POTASSIUM OLEATE

NONSOUL LN-1

SODIUM LAURATE

NONSOUL SN-1
Soap Base

NONSOUL SN-1Powder

SODIUM STEARATE

NONSOUL SN-1W1

Liquid
Flake

SODIUM OLEATE

NONSOUL TN-1

SODIUM TALLOWATE

Sodium Oleate

NONSOUL ON-8

SODIUM OLEATE

Laurylsulfuric Acid Triethanol Amine

PERSOFT SF-T

TEA-LAURYL SULFATE, WATER

Liquid

Flake

Solid

PERSOFT EL
PERSOFT EF

SODIUM LAURETH SULFATE, WATER

PERSOFT EFK

Premix products

Polyoxyethylene Lauryl Ether Sulfuric Acid


Triethanol Amine

PERSOFT EFT

TEA-LAURETH SULFATE, WATER

Polyoxyethylene Coconut Fatty Acid


Monoethanolamide Sulfuric Acid Sodium Salt

SUNAMID C-3

SODIUM PEG-4 COCAMIDE


SULFATE, WATER

Sodium N-Dodecanoyl Sarcosinate

FIRET L

SODIUM LAUROYL SARCOSINATE, WATER

Polyoxyethylen lauroyl
Sulfosuccinate sodium salt

SUCCINEED 1-LMN-30

DISODIUM LAURETH
SULFOSUCCINATE, WATER

DIAPON K
Sodium N-Cocoyl Methyltaurate

Appearance

Flake

NONSOUL ON-1N

Polyoxyethylene Lauryl Ether Sulfuric Acid


Sodium Salt

Index

NONSOUL LK-30

Premix products

SEKKEN SOJI-K

Base materials

NONSOUL LK-5

Base materials

POTASSIUM LAURATE

Functional ingredients

Potassium Soap Base

NONSOUL LK-2

Index

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Premix products

INCI Code

Base materials

Product Name

Functional ingredients

Ingredient

Functional ingredients

Main Application & Features : Detergents, Frothers, Dispersants

Liquid

Paste
Paste

DIAPON K-SF

SODIUM METHYL COCOYL


TAURATE, WATER

DIAPON LM

Liquid

DIAPON K-SF POWDER

Powder

DIAPON K-MG

MAGNESIUM METHYL COCOYL


TAURATE, WATER

Liquid

Sodium N-Cocoyl Ethyl Ester Sulfonate

DIAPON CI

SODIUM COCOYL ISETHIONATE

Solid

Maleic Anhydride/Diisobutylene Copolymer


Sodium Salt Solution

POLYSTER OMR

SODIUM MA/DIISOBUTYLENE
COPOLYMER

N-Dodecanoyl-N-methyl--alanine sodium
salt

SOFTILT AS-L

SODIUM LAUROYL
METHYLAMINOPROPIONATE, WATER

N-Dodecanoyl-N-methyl--alanine Triethanol
Amine

SOFTILT AT-L

TEA-LAUROYL
METHYLAMINOPROPIONATE , WATER

Index

Magnesium N-Cocoyl Methyltaurate

Liquid

Production by order

37

Ingredient

Product Name

INCI Code

Appearance

For COSMETIC USE ONLY

NONSOUL LN-T

SODIUM TAURINE LAURATE, WATER

NONSOUL LK-T

POTASSIUM TAURINE LAURATE, WATER

DIAPON HF-SF

SODIUM METHYL CAPROYL TAURATE, WATER

DIAPON K-TS

SODIUM TAURINE COCOYL METHYL TAURATE, WATER

SOFTILT AY-L

TEA-TAURINE LAUROYL METHYL BETA - ALANINATE

Paste

Liquid

13-2. CATIONIC SURFACTANTS


Main Application & Features : Medicines, Anti-Static Agents, Disinfectants, Emulsifiers, Hair Conditioners

Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE PHARMACOPOEIA (JP)


Benzalkonium Chloride

JP Benzalkonium
CATION M2-100

Powder
(Crystalline)

Concentrated Benzalkonium Chloride


Solution 50

JP Concentrated Benzalkonium
Chloride Solution 50
CATION F2-50E

CATION PB-40

Liquid

For PHARMACEUTICAL USE ONLY


Alkyltrimethylammonium Chloride

38

Liquid

13. SURFACTANTS

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Appearance

CATION M2-100R

BENZALKONIUM CHLORIDE

Benzalkonium Chloride solution

CATION F2-50R

BENZALKONIUM CHLORIDE

CATION PB-300

CETYLTRIMETHYL CHLORIDE,
WATER

CATION AB-600

STEARTRIMONIUM CHLORIDE,
WATER

CATION AB-700E

STEARTRIMONIUM CHLORIDE,
ETHANOL

CATION AB-800S

STEARTRIMONIUM CHLORIDE,
ISOPROPANOL

CATION AB-250AQ

STEARTRIMONIUM CHLORIDE,
WATER

CATION VB-M FLAKE

BEHENTRIMONIUM CHLORIDE,
ISOPROPANOL

CATION VB-F

BEHENTRIMONIUM CHLORIDE,
DENATURED ALCOHOL

CATION VB-800E

BEHENTRIMONIUM CHLORIDE,
ETHANOL

CATION 2ABT

DISTEARYLDIMONIUM CHLORIDE,
WATER

Semi- Solid

CATION BB

LAURTRIMONIUM CHLORIDE, WATER

Liquid

CATION EQ-01D

BIS-SOYOYL/RAPESEEDOYL ETHYL
HYDROXYETHYLMONIUM METHOSULFATE, DPG

Paste or Solid

Cetyltrimethyl Ammonium Chloride

Alkyltrimethyl Ammonium Chloride Solution

Solid (Flake)

Index

Index

Index

39

Liquid

Premix products

For COSMETIC USE ONLY

Solid

Premix products

Premix products

Distearlyl Dimethyl Ammonium Chloride

Paste or Solid

Base materials

Stearyl Ammonium Chloride

Liquid

Base materials

Base materials

Benzalkonium Chloride

Functional ingredients

INCI Code

Functional ingredients

Product Name

Functional ingredients

Ingredient

13-3. AMPHOTERIC SURFACTANTS

Main Application & Features : Medicines, Disinfectants, Detergents, Frothers, Anti-Static Agents, Hydrophilic Thickening Agents
Ingredient

Product Name

INCI Code

Appearance

For PHARMACEUTICAL USE ONLY


Lauryl Diaminoethyl Glycine Sodium
Solution

ANON LG

Liquid

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


2-Alkyl-N-Carboxymethyl-N-Hydroxyethyl
Immidazolium Betaine
Lauryldimethylaminoacetic Acid Betaine
Palm Oil Alkyl Betaine Solution
Lauric Amide Propyl Betaine Solution
Palm Oil Fatty Acid Amide Propyl
Betaine Solution
Palm Kern Fatty Acid Amide Propyl
Betaine Solution

SODIUM COCOAMPHO ACETATE,


WATER

ANON GLM-R-LV
ANON BL

LAURYL BETAINE, WATER

ANON BL-SF
ANON BF

COCOBETAINE, WATER

ANON BDL-S

LAURAMIDOPROPYLBETAINE,
WATER

ANON BDL-SF
ANON BDF-R

Liquid

COCAMIDOPROPYL BETAINE,
WATER

ANON BDF-SF
ANON BDC-S

PALM KERNEL AMIDOPROPYL


BETAIN, WATER

ANON BDC-SF
ANON BDB-S

Laurylamino Bisacetic Acid Sodium


Salt Solution

ANON LA

DISODIUM LAURIMINODIACETATE,
WATER

Liquid
(Cloudy under 20C)

Lauryldiaminoethyl Glycine Sodium Salt

ANON LG-R

SODIUM LAURYL
DIETHYLENEDIAMINOGLYCINATE,
WATER, ETHANOL

Liquid

ANON LA POWDER

DISODIUM
LAURIMINODIACETATE, WATER

Powder

For COSMETIC USE ONLY

Production by order

40

13. SURFACTANTS

13-4. NONIONIC SURFACTANTS

Appearance

Liquid

NONION LP-20R
Sorbitan Fatty Acid Ester

Premix products

NONION CP-08R

Base materials

APPROVED by JAPAN'S SPECIFICATIONS AND STANDARDS FOR FOOD ADDITIVES

Functional ingredients

INCI Code

Premix products

Product Name

Base materials

Ingredient

Functional ingredients

Main Application & Features : Food Additives, Emulsifiers

Functional ingredients

1SORBITAN FATTY ACID ESTERS

NONION PP-40R

NONION SP-60R

Pellet

NONION SP-60RP

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS


Sorbitan mono-laurate

NONION LP-20R

SORBITAN LAURATE

Sorbitan mono-palmitate

NONION PP-40R

SORBITAN PALMITATE

Sorbitan mono-stearate
Sorbitan mono-oleate

NONION SP-60R

SORBITAN STEARATE

NONION SP-60RP
NOFABLE SO-85IS

Base materials

NONION OP-80R

Liquid

Liquid
Pellet

SORBITAN OLEATE

NOFABLE SO-901
NONION OP-83RAT

Sorbitan sesqui-oleate

NOFABLE SO-852S

SORBITAN SESQUIOLEATE

Liquid

NOFABLE SO-902
NONION OP-85R

SORBITAN TRIOLEATE

NOFABLE SO-853S

2GLYCERINE FATTY ACID ESTERS

Premix products

Sorbitan tri-oleate

Production by order

Main Application & Features : Food Additives, Emulsifiers

Ingredient

Product Name

INCI Code

Appearance

Approved by JAPAN'S SPECIFICATIONS AND STANDARDS FOR FOOD ADDITIVES (JSSAF)


Glycerin Fatty Acid Ester

MONOGLY MB

MONOGLY MB

GLYCERYL STEARATE

Lipophilic Glyceryl Monooleate

NOFABLE GO-851S

GLYCERYL OLEATE

Polyglycerin laurate

UNIGLY GL-106

POLYGLYCERYL-6 LAURATE

41

Beads
Liquid

Index

Lipophilic Glyceryl Monostearate

Index

Index

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Beads

3ALKYROL AMIDES
Main Application & Features : Hydrophilic Thickening Agents, Foaming Agents

Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Lauryl Diethanol Amide
Palm Oil Fatty Acid Diethanol Amide
Palm Oil Fatty Acid Diethanol Amide (2)
Oleic Acid Diethanol Amide
Lauric Acid Monoisopropanol Amide

STAFOAM DL

LAURAMIDE DEA

Solid

STAFOAM DF-4

COCAMIDE DEA

STAFOAM DFC

COCAMIDE DEA, GLYCERIN

Liquid
(Solid in Winter)

STAFOAM F

COCAMIDE DEA (1:2)

Liquid

OLEAMIDE DEA

Liquid

STAFOAM LIPA

LAURAMIDE MIPA

Waxy

STAFOAM MF PELLET

COCAMIDE MEA

Pellet

STAFOAM DO
STAFOAM DOS

For COSMETIC USE ONLY

13-5. AMINES
Main Application : Anti-Static Agents, Hair Conditioners

Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Stearyl Dimethyl Amine

TERTIARY AMINE AB

42

DIMETHYL STEARAMINE

Solid

14. POLYOXYALKYLENE GLYCOL DERIVATIVES


14-1. POLYOXYALKYLENE GLYCOL (Doble-Chain Form)

Premix products

INCI Code

Base materials

Average Molecular
Weight

Product Name

Functional ingredients

HO(C3H6O)nH
Ingredient

Premix products

HO(C2H4O)nH

Base materials

Main Application & Features : Pharmaceutical Additives, Water-Soluble Polymers, Solvents, Lubricants,
Glycocalyx Agents, Moisturizers, Skin Conditioning Agents

Functional ingredients

Functional ingredients

POLYETHYLENE GLYCOLS

HO(C4H8O)aC3H6O(C4H8O)bH
Approved by JAPANESE PHARMACOPOEIA (JP)
Macrogol 400

MACROGOL 400R

MACROGOL 400H

MACROGOL 4000

Macrogol 4000

MACROGOL 4000R

MACROGOL 4000PS

MACROGOL 6000

Macrogol 6000

MACROGOL 6000R

Macrogol 20000

MACROGOL 6000P

MACROGOL 20000

Macrogol 1500
Macrogol Ointment

MACROGOL 1500
MACROGOL 1500R

MACROGOL OINTMENT

380420

2,6003,800

7,3009,300

Mixture(300,1540)
Mixture(400,4000)

190210

MACROGOL 200R

MACROGOL 300

MACROGOL 300R

Macrogol 600

MACROGOL 600

570630

Macrogol 1000

MACROGOL 1000

9501,050

Macrogol 1540

MACROGOL 1540

Macrogol 300

285315

Premix products

MACROGOL 200

15,00025,000

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS(JPE)


Macrogol 200

Base materials

MACROGOL 400

HO(C2H4O)a(C3H6O)b(C2H4O)cH

1,3001,600

1: Production by order 2: Adapting for Multi-compendial JP(JPE), EP, NF(USP) , 3: High quality Polyethylene glycol , 4: Powder

Index

Index

Index

43

Ingredient

Product Name

Average Molecular
Weight

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Polyethylene Glycol 200

PEG# 200

200

PEG-4

Polyethylene Glycol 300

PEG# 300

300

PEG-6

Polyethylene Glycol 400

PEG# 400

400

PEG-8

Polyethylene Glycol 600

PEG# 600

600

PEG-12

Polyethylene Glycol 1000

PEG#1000

1000

PEG-20

Polyethylene Glycol 1500

PEG# 1500

Mixture (300,1540)

Polyethylene Glycol 1540

PEG# 1540

1540

PEG-32

Polyethylene Glycol 2000

PEG# 2000

2000

PEG-40

Polyethylene Glycol 4000

PEG# 4000
PEG# 4000P

3100

PEG-75

Polyethylene Glycol 6000

PEG# 6000
PEG# 6000P

8800

PEG-150

Polyethylene Glycol 11000

PEG# 11000
PEG# 11000P

11000

PEG-240

Polyethylene Glycol 20000

PEG# 20000

20000

PEG-400

PEG-6, PEG-32

Powder

POLYPROPYLENE GLYCOLS
Main Application & Features : Solvents, Oils, Hairdressings
HO(C2H4O)nH

HO(C3H6O)nH
HO(C4H8O)aC3H6O(C4H8O)bH
Ingredient

Product Name

Propylene Oxide Addittion Male Number = n

Average Molecular
Weight

INCI Code

2000

HO(C2H4O)a(C3H6O)b(C2H4O)cH

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS(JPE)


Polypropylene Glycol 2000

POLYPROPYLENE GLYCOL 2000

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Polypropylene Glycol

UNIOL D-700

700

PPG-12

UNIOL D-1000

1000

PPG-17

UNIOL D-1200

1200

PPG-20

UNIOL D-2000

2000

PPG-34

44

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

Butylene Oxide Addition Mole Number = a + b

HO(C2H4O)a(C3H6O)b(C2H4O)cH
Ingredient

Product Name

Average Molecular
Weight

INCI Code

Functional ingredients

HO(C4H8O)aC3H6O(C4H8O)bH

Functional ingredients

Main Application & Features : Solvents, Oils


HO(C3H6O)nH

Functional ingredients

HO(C2H4O)nH
POLYBUTYLENE GLYCOLS

For COSMETIC USE ONLY

Base materials
Premix products
Index

HO(C2H4O)nH

Index

700

Premix products

UNIOL PB-700

POLY(1,2-BUTANEDIOL)6PROPYLENEGLYCOL

Base materials

500

Base materials

UNIOL PB-500

POLYBUTYLENEGLYCOL
/PPG-9/1COPOLYMER

HO(C3H6O)nH
POLYOXYETHYLENE POLYOXYPROPYLENE GLYCOLS
Main Application & Features : Stabilizers, Emulsifiers, Thickening Agents, Gelatinizers, Moisturizers
HO(C4H8O)aC3H6O(C4H8O)bH

Premix products

HO(C2H4O)a(C3H6O)b(C2H4O)cH

Ethylene Oxide Addition Mole Number = a + c


Propylene Oxide Addition Mole Number = b

Ingredient

Product Name

EO
( WT % )

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS (JPE)


Polyoxyethylene (3)
Polyoxypropylene (17) Glycol

PLONON #101P

10

Polyoxyethylene(20)
Polyoxypropylene (20) Glycol

PLONON #124P

40

Polyoxyethylene (54)
Polyoxypropylene (39) Glycol

PLONON #235P

50

Polyoxyethylene (160)
Polyoxypropylene (30) Glycol

PLONON #188P

80

Polyoxyethylene (120)
Polyoxypropylene (40) Glycol

PLONON #237P

70

Polyoxyethylene (196)
Polyoxypropylene (67) Glycol

PLONON #407P

70

INCI Code

Index

Production by order

45

Ingredient

Product Name

EO
( WT % )

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Polyoxyethylenepolyoxypropylene
Glycol (23E.O.)(17P.O.)

PLONON #105

50

Polyoxyethylenepolyoxypropylene
Glycol (5E.O.)(35P.O.)

PLONON #201

10

Polyoxyethylenepolyoxypropylene
Glycol (12E.O.)(35P.O.)

PLONON #202

20

Polyoxyethylenepolyoxypropylene
Glycol (30E.O.)(35P.O.)

PLONON #204

40

Polyoxyethylenepolyoxypropylene
Glycol (150E.O.)(35P.O.)

PLONON #208

80

Polyoxyethylenepolyoxypropylene
Glycol (50E.O.)(40P.O.)

PLONON #235

50

Polyoxyethylenepolyoxypropylene
Glycol (200E.O.)(40P.O.)

PLONON #238

80

Polyoxyethylenepolyoxypropylene
Glycol (200E.O.)(70P.O.)

UNILUBE 70DP-950B

70

Polyoxyethylenepolyoxypropylene
Glycol (20E.O.)(9P.O.)

PLONON #056

60

Polyoxyethylenepolyoxypropylene
Glycol (19E.O.)(21P.O.)

PLONON #124

40

Polyoxyethylenepolyoxypropylene
Glycol (22E.O.)(25P.O.)

PLONON #154

40

Polyoxyethylenepolyoxypropylene
Glycol (16E.O.)(30P.O.)

PLONON #183

30

POLOXAMER 182

Polyoxyethylenepolyoxypropylene
Glycol (26E.O.)(30P.O.)

PLONON #184R

40

POLOXAMER 184

Polyoxyethylenepolyoxypropylene
Glycol (38E.O.)(30P.O.)

PLONON #185

50

POLOXAMER 185

Polyoxyethylenepolyoxypropylene
Glycol (150E.O.)(30P.O.)

PLONON #188

80

POLOXAMER 188

Polyoxyethylenepolyoxypropylene
Glycol (48E.O.)(35P.O.)

PLONON #205

50

POLOXAMER 215

Polyoxyethylenepolyoxypropylene
Glycol (40E.O.)(54P.O.)

PLONON #333

30

POLOXAMER 333

Polyoxyethylenepolyoxypropylene
Glycol (20E.O.)(60P.O.)

PLONON #352

20

Polyoxyethylenepolyoxypropylene
Glycol (190E.O.)(60P.O.)

PLONON #357

70

Polyoxyethylenepolyoxypropylene
Glycol (240E.O.)(60P.O.)

UNILUBE 75DE-2620R

75

POLOXAMER 105

PEG/PPG-200/70
COPOLYMER

POLOXAMER 124

PEG/PPG-240/60
COPOLYMER
Production by order

46

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

14-2. POLYOXYALKYLENE GLYCOL (Multiple Chain Form)

Premix products

Base materials

CH2O(C2H4O)aH Product Name


Ingredient

Functional ingredients

HO(CH2CHO)nH

Premix products

CH2OH

Base materials

Main Application & Features : Moisturizers, Skin Conditioners

Functional ingredients

Functional ingredients

POLYGLYCERIN

n = GLYCERINE UNIT #

INCI Code

CH2O(C2H4O)bH
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
CH2O(C2H4O)cH
2
Diglycerin
UNIGLY G-2

DIGLYCERIN

CHO(C3H6O)bH
3H62O)
cH
CH2O(CCH
OH

POLYOXYGLYCERIN

Main Application
& Features2:CHO)
Moisturizer,
nHSkin Conditioner, Viscosity Adjustment Agent
HO(CH

Premix products

CH2O(C2H4O)a(C3H6O)xH
CH2O(C2H4O)aH
CHO(C2H4O)b(C3H6O)yH
CH2O(C2H4O)bH
CH2O(C2H4O)c(C3H6O)zH
CH2O(C2H4O)cH

Base materials

CH2O(C3H6O)aH

n = Ethyleneoxide Addition Mole Number = a + b + c

H4O)aName
(C3H6O)xH n
CH2O(C2Product
Ingredient
CH2O(C3H6O)aH

CH3CH2CCH2O(C2H4O)b(C3H6O)yH
3H6O)bH
CHO(C
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
CH2O(C2H4O)c(C3H6O)zH
26
Polyoxyethylene Glycerin
O(C3H6O)cUNIOX
H G-1200
CH2(26E.O.)

INCI Code

GLYCERETH-26

Production by order

CH2O(C3H6O)aH
CH2O(C2H4O)a(C3H6O)xH
CHO(C3H6O)bH
CHO(C2H4O)b(C3H6O)yH
CH2
CH2O(C2H4O)c(C3H6O)zH
O
Index

CH2O(C3H6O)x(C2H4O)bH
CH2O(C3H6O)aH
47
2CCH2O(C3H6O)y(C2H4O)cH
HO(C2H4O)a(C3H6O)wCH
CHO(C3H6O)bH

Index

CH2O(C2H4O)a(C3H6O)xH
CHO(C3H6O)cH
CH3CH2CCH2O(C2H4O)b(C3H6O)yH
CH2O(C3H6O)dH
CH2O(C2H4O)c(C3H6O)zH

Index

CH2

CH2OH
HO(CH2CHO)nH
CH2O(C2H4O)aH
CH2O(C2H4O)bH
4O)cH ETHER
CH2O(C2H
POLYOXYPROPYLENE
GLYCERIN

Main Application & Features : Moisturizers, Skin Lubricants, Fatliquors, Oils

CH2O(C3H6O)aH
CHO(C3H6O)bH
CH2O(C3H6O)cH
n = Propyleneoxide Addition Mole Number = a + b + c

Ingredient
Name
CH2O(C2H4O)a(C3HProduct
6O)xH

INCI Code

OH
H42O)
b(C3H6O)yH
CHO(C2CH
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
nH
HO(CH
2H4O)c(C3H6O)zH
CH2O(C2CHO)
UNIOL SGP-65

PPG-8 GLYCERYL ETHER

UNIOL TG-700

10

PPG-10 GLYCERYL ETHER

UNIOL TG-1000

16

PPG-16 GLYCERYL ETHER

50

PPG-50 GLYCERYL

70

PPG-70 GLYCERYL ETHER

CH2O(C2H4O)aH

Polyoxypropylene Glyceryl Ether

24
O(C
2H4O)a(C3H6O)xH
CH
2H
O)bUNIOL
HTG-3000
CH2O(C

UNIOL TG-4000R

CH2CCH
O(C
2H42
O)
cH 2H4O)b(C3H6O)yH
CH23O(C

Production by order

CH2O(C2H4O)c(C3H6O)zH
CH2O(C3H6O)aH
H66O)
O)baH
H
CH2O(C33H
CHO(C
3
CHO(C
2O(CPOLYOXYPROPYLENE
3H6
6O)b
cH
CH
POLYOXYETHYLENE
GLYCERYL ETHERS

Main Application & Features : Water-Soluble Polymers, Moisturizers, Skin Lubricants


CH2

O 2O(C2H4O)a(C3H6O)xH
CH
CH2
2H4O)b(C3H6O)yH
CHO(C

[ ] : Random Addition
m = Ethyleneoxide Addition Mole Number = a + b + c
n = Propyleneoxide Addition Mole Number = x + y + z

CHO(C
2O(C3
2H
H64O)
O)ccH
(C3H6O)zH
CH
CH2O(C3H6O)dH
Ingredient

Product Name

CH2O(C2H4O)a(C3H6O)xH

INCI Code

3H6O)x(C2H4O)bH
6O)2
yO(C
H
CH3CH2CCH2O(C2H4O)b(C3HCH
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

H4O)
a(C3H26H
O)
wCH
2CCH
2O(C3H6O)y(C2H4O)cH
HO(C2CH
2O(C
4O)
c(C3H
6O)zH
Polyoxyethylenepolyoxypropylene
UNILUBE 50TG-32
24
24
PPG-24-GLYCERETH-24
Glyceryl Ether (24E.O.)(24P.O.)
CH2O(C3H6O)z(C2H4O)dH
CH2O(C3H6O)aH
H66O)
O)baH
H
CH2O(C33H
CHO(C
3H6O)bH
CHO(C
2
CH

CHO(C3H6O)cH
O
3H6O)dH
CHO(C
2
CH

CHO(C33H66O)ceH

48

CHO(C3H6O)bH
CHO(C3H6O)cH
CHO(C3H6O)dH

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

CHO(C3H6O)eH

POLYOXYBUTYLENE POLYOXYETHYLENE POLYOXYPROPYLENE GLYCERYL ETHERS


Main Application & Features : Water-Soluble Moisturizing Oils, Skin Lubricants, Solvents

CH2O(C2H4O)a(C3H6O)h(C4H8O)xH
CHO(C2H4O)b(C3H6O) i(C4H8O)yH
OH
O)c2(C
3H6O) j(C4H8O)zH
CH2O(C2H4CH

INCI Code

CH2O(C3H6O)aH
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
CHO(C3H6O)bH
Polyoxybutylenepolyoxyethylene
WILBRIDE S-753
polyoxypropylene Glyceryl Ether
WILBRIDE S-753D
CH2O(C3H6O)cH
Ether(8E.O.)(5P.O.)(3B.O.)

Base materials

Product Name

Base materials

Ingredient

Base materials

HO(CH2CHO)nH
<Characteristics>
1. High moisturizing effect.
2. Even if it highly combines, there is good touch.(Not sticky feeling)
[ ] : Random Addition
CH2O(C2H4O)aH
3. It dissolves
in polar oil such as
and estersH
as well as water.
H(OA)OCH
2 triglycerides
CH2O(AO)
Ethyleneoxide Addition Mole Number = a + b + c = 8
4. Because of its low congeal point, it keeps high stability even at low temperature. Propyleneoxide Addition Mole Number = h + i + j = 5
CH2O(C2HC4O)bH
5. High safety and stability.
Butyleneoxide Addition Mole Number = x + y + z = 3
H(OA)OCH
2O(AO)H
cH
CH2O(C2H24O)CH

Functional ingredients

Functional ingredients

Functional ingredients

CH2O(C3H6O) f H

PEG/PPG/POLYBUTYLENE GLYCOL-8/5/3 GLYCERIN


The addition of tocopherol

CH2O(C2H4O)a(C3H6O)xH

CH2O(C2H4O)a(C3H6O)xH
CH3CH2CCH2O(C2H4O)b(C3H6O)yH

[ ] : Random Addition
m = Ethyleneoxide Addition Mole Number = a + b + c
n = Propyleneoxide Addition Mole Number = x + y + z

CH2O(C2H4O)c(C3H6O)zH
Ingredient

CH2O(C3H6O)aH

Product Name

25

25

PPG-25-PEG-25
TRIMETHYLOL PROPANE

UNILUBE 10TT-4500

10

68

PPG-68-PEG-10
TRIMETHYLOL PROPANE
Production by order

CHO(C3H6O)cH
CH2O(C3H6O)dH
49

Index

CH2

UNILUBE 43TT-2500

Index

Polyoxyethylenepolyoxypropylene
O
Trimethylolpropane

INCI Code

Index

CHO(C3H6O)bH
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
CH2

Premix products

Main Application & Features : Moisturizers, Skin Lubricants

Premix products

4O)c(C3H6O)zH
CH2O(C2HPOLYOXYPROPYLENE
POLYOXYETHYLENE
TRIMETHYLOL PROPANES

Premix products

CHO(C2H4O)b(C3H6O)yH

2O(C2H4O)c(C3H6O)zH
2H4O)bH
CH2O(CCH

CH2O(C2H4O)cH
CH2O(C2H4O)a(C3H6O)xH
3CH2CCH2O(C2H4O)b(C3H6O)yH
3H6O)aH
CH2O(CCH
CH2O(C2H4O)c(C3H6O)zH
CHO(C
POLYOXYPROPYLENE
3H6O)bH DIGLYCERYL ETHERS

Main Application & Features : Moisturizers, Skin Lubricants, Fatliquors, Oils


CH2O(C3H6O)cH

CH2O(C3H6O)aH
3H6O)bH
CH2O(CCHO(C
2H4O)a(C3H6O)xH
2
2H4O)b(C3H6O)yH
CHO(CCH
2H4O)c(C3H6O)zH
CH2O(CO
CH2

CHO(C
3H6O)cH
2O(C2H4O)a(C3H6O)xH
CH
CH22O(C
O(C32HH64O)
O)dbH
(C3H6O)yH
CH3CH2CCH
CH2O(C2H4O)c(C3H6O)zH
Ingredient

n = Propyleneoxide Addition Mole Number = a + b + c + d

Product Name CH2O(C


n 3H6O)x(C2INCI
Code
H4O)
bH

2H4O)a(C3H6O)wCH2CCH2O(C3H6O)y(C2H4O)cH
3H6O)aH
CH2O(CHO(C
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
CH2O(C3H6O)z(C2H4O)dH
UNILUBE DGP-700
CHO(C3H6O)bH
9
PPG-9 DIGLYCERYL ETHER
UNILUBE DGP-700F
Polyoxypropylene
Diglyceryl Ether
CH2

CH2O(C3H6O)aUNILUBE
H DGP-950

CH2

CHO(C3H6O)bH

14

PPG-14 DIGLYCERYL ETHER


Production by order

3H6O)cH
CHO(CCHO(C
3H6O)cH
3H6O)dH
3H6O)dH
CH2O(CCHO(C

POLYOXYETHYLENE POLYOXYPROPYLENE PENTAERYTHRITOL ETHERS


Main Application
& Features 3
:H
Moisturizers,
6O)eH Skin Lubricants, Fatliquors, Oils
CHO(C

CH2O(C3H6O) f H CH2O(C3H6O)x(C2H4O)bH
HO(C2H4O)a(C3H6O)wCH2CCH2O(C3H6O)y(C2H4O)cH
CH2O(C3H6O)z(C2H4O)dH
CH2O(C2H4O)a(C3H6O)h(C4H8O)xH
2H4O)b(C3H6O) i(C4H8O)yH
CH2O(CCHO(C
3H6O)aH

O(C
6O) j(C
4H8O)zH
CH
Ingredient
Product
Name
m
3H62O)
bH2H4O)c(C3H
CHO(C

m = Ethyleneoxide Addition Mole Number = a + b + c + d


n = Propyleneoxide Addition Mole Number = w + x + y + z

CHO(C3H6O)cH
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
CHO(C3H6O)dH
Polyoxyethylenepolyoxypropylene
H(OA)OCHUNILUBE
2 CH
2O(AO)H
5TP-300KB
5
65
Pentaerythritol
Ether
(5E.O.)(65P.O.)
CHO(C3H6O)eH
C
(OA)OCH2 CH2O(AO)H
3H6O) f H
CH2O(CH
50

INCI Code

PPG-65-PEG-5
PENTAERYTHRITYL ETHER

O
CH2

CH2O(C3H6O)dH

CHO(C3H6O)cH

14. POLYOXYALKYLENE GLYCOL DERIVATIVES


CH2O(C3H6O)x(C2H4O)bH

Main Application & Features : Skin Protective Agents, Oil for Hairdressings, Form Improvement Agents

HO(C2H4O)a(C3H6O)wCH2CCH2O(C3H6O)y(C2H4O)cH
CH2O(C3H6O)aH
CH2O(C3H6O)z(C2H4O)dH
CHO(C3H6O)bH

Product Name

INCI Code

2H4O)a(C
H6O)h(C4INGREDIENTS
H8O)xH (JSQI)
CH2O(C
Approved by JAPANESE
STANDARDS
OF3QUASI-DRUG

25
(C3HHS-1600D
6O) i(C4H8O)yH
CHO(C2H4O)bUNIOL
Polyoxypropylene Sorbitol
UNIOL HS-2000D
33
CH2O(C2H4O)c(C3H6O) j(C4H8O)zH
CH2O(C2H4O)a(C3H6O)h(C4H8O)xH

PPG-25 SORBITOL
PPG-33 SORBITOL

Production by order

Premix products

Index

Index

H(OA)OCH2 CH2O(AO)H
C
H(OA)OCH2 CH2O(AO)H

Premix products

Premix products

CHO(C2H4O)b(C3H6O) i(C4H8O)yH
POLYOXYBUTYLENE POLYOXYETHYLENE PENTAERYTHRITOL ETHER
2H
4O)c(C3Agents
H62O)CH
j,(C
4H8O)zH
CH2O(C
Main Application
Oil
Thickening
Emulsifiers
H: (OA)OCH
2O(AO)
H
[ Concept ] Oil Rheology Controlling Agent
H(OA)OCH2 CH2O(AO)H

Base materials

Ingredient

CH2O(C3H6O) f H

Base materials

CHO(C3H6O)eH

n = Propyleneoxide Addition Mole Number


=a+b+c+d+e+f

AO : Ethylene Oxide and Butylene Oxide block copolymer


Contained Tocopherol 200ppm

Product Name

Base materials

CHO(C3H6O)cH
CH2O(C3H6O)aH
CHO(C3H6O)dH
CHO(C3H6O)bH
CHO(C3H6O)eH
CHO(C3H6O)cH
CH2O(C3H6O) f H
CHO(C3H6O)dH

Functional ingredients

CH2O(C3H6O)z(C2H4O)dH
CH2O(C3H6O)x(C2H4O)bH

Functional ingredients

POLYOXYPROPYLENE SORBITOLS

Functional ingredients

CH2O(C3H6O)dH
HO(C2H4O)a(C3H6O)wCH2CCH2O(C3H6O)y(C2H4O)cH

INCI Code

For COSMETIC USE ONLY


WILBRIDE RC-9050

Approved

Index

<Characteristics>
1. RC-9050 makes it easy to get transparent oil gel.
2. With polar oils like ester oils, it is easy to get paraffin oil gel & silicone oil gel.
3. The oil gel has thixotropic property.
4. With nonionic surfactants, it is possible to control texture.
5. It is easy to spread the oil gel, keeping the original texture of oil components.

Production by order

51

14-3. POLYOXYALKYLENE ALKYLETHER (Double-Chain Form)


POLYOXYETHYLENE MONOALKYLETHERS
Main Application & Features : Pharmaceutical Additives, Nonionic Surfactants (Emulsifiers, Solubilizers,
Detergents, etc.) , Foam quality improvement agents

RO(C2H4O)nH
CH3
Ingredients

CH3
CH3

R = Alkyl Group
n= Ethyleneoxide Addition Mole Number

Product Name

HLB

INCI Code

13.6

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS (JPE)


RO(C3H6O)nH
Polyoxyethylene Oleylether
NONION E-210E

10

12.4

Cetomacrogol 1000

23

16.1

CH3
CH3
Approved by JAPANESE PHARMACOPOEIA (JP)
LAUROMACROGOL
L-209
2H4O)n
H
O(CNONION

Lauromacrogol

CETOMACROGOL 1000
RO(C2H4O)m(C3H6O)nH

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Polyoxyethylene Laurylether

Polyoxyethylene Cetylether

Polyoxyethylene Oleylether

Polyoxyethylene Stearylether

NONION K-204

9.7

LAURETH-4

NONION K-2071

12.5

LAURETH-7

NONION K-209

13.6

LAURETH-9

NONION K-211

11

14.4

LAURETH-11

NONION K-220

20

16.5

LAURETH-20

NONION K-230

30

17.5

LAURETH-30

NONION K-21001

100

19.2

LAURETH-100

NONION K-2100W2

100

19.2

LAURETH-100,WATER

NONION P-2021

5.3

CETETH-2

NONION P-2071

11.2

CETETH-7

NONION P-208

11.9

CETETH-8

NONION P-210

10

12.9

CETETH-10

NONION P-213

13

14.1

CETETH-13

NONION P-2201

20

15.7

CETETH-20

NONION P-2231

23

16.1

CETETH-23

NONION P-2301

30

16.9

CETETH-30

NONION P-2401

40

17.6

CETETH-40

NONION E-202S

4.9

OLETH-2

NONION E-205S

9.0

OLETH-5

NONION E-215

15

14.2

OLETH-15

NONION E-220S1

20

15.1

OLETH-20

NONION E-230

30

16.6

OLETH-30

NONION E-2351

35

17.0

OLETH-35

NONION S-202

4.9

STEARETH-2

NONION S-207

10.7

STEARETH-7

NONION S-215

15

14.2

STEARETH-15

NONION S-220

20

15.3

STEARETH-20

1: Production by order 2: The addition of Tocopherol

52

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

12.3

C12-14 PARETH-7

NONION NC-212

12

14.6

C12-14 PARETH-12

NONION T-203

8.3

TRIDECETH-3

NONION T-206

11.4

TRIDECETH-6

NONION T-208.5

8.5

13.0

TRIDECETH-8

NONION T-212

12

14.5

TRIDECETH-12

NONION T-220

20

16.3

TRIDECETH-20

NONION M-203

7.6

MYRETH-3

NONION M-204

9.0

MYRETH-4

NONION IS-202

4.9

ISOSTEARETH-2

NONION IS-205

9.0

ISOSTEARETH-5

NONION IS-210

10

12.4

ISOSTEARETH-10

NONION IS-215

15

14.2

ISOSTEARETH-15

NONION IS-220

20

15.3

ISOSTEARETH-20

NONION IS-225

25

16.1

ISOSTEARETH-25

NONION B-205

8.1

BEHENETH-5

NONION B-210

10

11.5

BEHENETH-10

NONION B-220

20

14.6

BEHENETH-20

NONION B-230

30

16.0

BEHENETH-30

NONION B-250

50

17.4

BEHENETH-50

NONION OD-220

20

14.9

OCTYLDODECETH-20

Index

53

Index

Polyoxyethylene Octyldodecylether

Premix products

Polyoxyethylene Behenylether

NONION NC-207

Premix products

Polyoxyethylene Isostearylether

C12-14 PARETH-3

Base materials

Polyoxyethylene Myristylether

8.1

Base materials

Polyoxyethylene Tridecylether

Functional ingredients

Polyoxyethylene Alkyl12-14 Ether

NONION NC-203

Index

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

INCI Code

Premix products

HLB

Base materials

Functional ingredients

Product Name

Functional ingredients

Ingredients

Production by order

POLYOXYETHYLENE CHOLESTERYLETHERS
RO(C
2H4: O)
nH Surfantants(Emulsifiers, Solubilizers etc.)
Main Application
& Features
Nonionic

CH3
CH3

CH3
CH3

CH3
O(C2H4O)nH

Ingredients
RO(C3H6O)nH

Product Name

n = Ethyleneoxide Addition Mole Number

HLB

RO(C2STANDARDS
H4O)m(C3OF
H6QUASI-DRUG
O)nH
Approved by JAPANESE
INGREDIENTS (JSQI)
RO(C2H4O)nH

10
10.7
UNIOX CS-800
Polyoxyethylene Cholesterylether
UNIOX CS-1500
25
14.8
CH3
CH3
CH3
CH3

INCI Code

CHOLETH-10
CHOLETH-24
Production by order

CH3

POLYOXYPROPYLENE ALKYLETHERS

O(C2H4O)nH
Main Application & Features : Oil for Hairdressings, Foam Improvement Agents, Skin Lubricants
RO(C3H6O)nH

R = Alkyl Group
n = Propyleneoxide Addition Mole Number

RO(C2H4O)m(C3H6Product
O)nHName

Ingredients

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Polyoxypropylene Butylether (1)

Polyoxypropylene Butylether (2)

UNILUBE MB-2

PPG-4 BUTYL ETHER

UNILUBE MB-7

12

PPG-12 BUTYL ETHER

UNILUBE MB-11

17

PPG-17 BUTYL ETHER

UNILUBE MB-14

20

PPG-20 BUTYL ETHER

UNILUBE MB-19

24

PPG-24 BUTYL ETHER

UNILUBE MB-38

33

PPG-33 BUTYL ETHER

UNILUBE MB-370

40

PPG-40 BUTYL ETHER

UNILUBE MB-700

52

PPG-52 BUTYL ETHER

Polyoxypropylene Myristylether (3P.O.)

UNISAFE MM-15K

PPG-3 MYRISTYL ETHER

Polyoxypropylene Cetylether (10P.O.)

UNILUBE MP-60K

10

PPG-10 CETYL ETHER

UNILUBE MS-65K

11

PPG-11 STEARYL ETHER

UNILUBE MS-70K

15

PPG-15 STEARYL ETHER

UNILUBE MLA-202P

PPG-2 LANOLIN ALCOHOL ETHER

UNILUBE MLA-205P

PPG-5 LANOLIN ALCOHOL ETHER

UNILUBE MLA-210P

10

PPG-10 LANOLIN ALCOHOL ETHER

UNILUBE MLA-220P

20

PPG-20 LANOLIN ALCOHOL ETHER

Polyoxypropylene Stearylether

Polyoxypropylene Lanolin Alcohol Ether

Production by order

54

RO(C2H4O)nH
CH3
CH3

CH3
CH3

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

CH3

Functional ingredients

Functional ingredients

Base materials

Base materials

Premix products

Premix products

POLYOXYETHYLENE POLYOXYPROPYLENE ALKYLETHERS

Functional ingredients

O(C2H4O)nH

Main Application
& Features
Emulsifiers,
RO(C
3H6: O)
nH Solubilizers, Moisturizers, Hair Oils, Water-Soluble High Polymers

RO(C2H4O)m(C3H6O)nH

Ingredients

m = Ethyleneoxide Addition Mole Number


n = Propyleneoxide Addition Mole Number
[ ] : Block or Random addition.

Product Name

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


UNILUBE 50MB-11

PPG-10-BUTETH-9

10

UNILUBE 50MB-26

17

17

PPG-17-BUTETH-17

UNILUBE 50MB-72

30

30

PPG-30-BUTETH-30

UNILUBE 50MB-168

37

38

PPG-38-BUTETH-37

NONION A-10R1

PPG-5 LAURETH -6

NONION A-13PR1

PPG-5-LAURETH-5

NONION A-25B1

25

25

PPG-25-LAURETH-25

Polyoxyethylenepolyoxypropylene
Cetylether (5E.O.)(4P.O.)

UNISAFE 5P-41

PPG-4-CETETH-5

Polyoxyethylenepolyoxypropylene
Cetylether (5E.O.)(8P.O.)

UNISAFE 5P-81

PPG-8-CETETH-5

Polyoxyethylenepolyoxypropylene
Cetylether (10E.O.)(4P.O.)

UNISAFE 10P-41

10

PPG-4-CETETH-10

Polyoxyethylenepolyoxypropylene
Cetylether (10E.O.)(8P.O.)

UNISAFE 10P-8

10

PPG-8-CETETH-10

Polyoxyethylenepolyoxypropylene
Cetylether (20E.O.)(4P.O.)

UNISAFE 20P-41

20

PPG-4-CETETH-20

Polyoxyethylenepolyoxypropylene
Cetylether (20E.O.)(8P.O.)

UNISAFE 20P-8

20

PPG-8-CETETH-20

UNILUBE 10MS-250KB

34

PPG-34-STEARETH-3

UNISAFE 34S-23

34

23

PPG-23-STEARETH-34

UNILUBE MT-0612B

12

PPG-6-DECYLTETRADECETH-12

UNILUBE MT-0620B1

20

PPG-6-DECYLTETRADECETH-20

UNILUBE MT-0630B1

30

PPG-6-DECYLTETRADECETH-30

UNILUBE 50MT-2200B

24

13

PPG-13-DECYLTETRADECETH-24

UNILUBE 20MT-2000B

10

20

PPG-20-DECYLTETRADECETH-10

Polyoxyethylenepolyoxy propylene
Laurylether

Polyoxyethylenepolyoxypropylene
Decyltetradecyl Ether

PPG-10-BUTETH-9

Premix products

Polyoxyethylenepolyoxypropylene
Srtearylether

UNILUBE 50MB-11D12

Base materials

Polyoxyethylenepolyoxypropylene
butylether

Index

55

Index

Index

1: Production by order 2: The addition of Tocopherol

14-4. POLYOXYALKYLENE ALKYLETHER (Multiple Chain Form)


POLYOXYETHYLENE METHYLGLUCOSIDES
Main Application & Features : Moisturizers, Skin Lubricants

CH2O(C2H4O)dH
O
O(C2H4O)bH
OCH3
O(C2H4O)cH O(C2H4O)aH

n = Ethyleneoxide Addition Mole Number = a + b + c + d

CH2O(C3H6O)dH Product Name


Ingredients
O
O(C3H6O)bH

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


OCH3

MG-10E
10
O(C3H6O)cH O(CMACBIOBRIDE
3H6O)aH
Polyoxyethylene Methylglucoside
MACBIOBRIDE MG-20E
20

INCI Code

METHYL GLUCETH-10
METHYL GLUCETH-20

CH2O(AO)BOH
CH
O(C2H4O)dH
O
O
O(AO)BOH
2H4O)bH
O(C
OCH33
OCH
POLYOXYPROPYLENE METHYLGLUCOSIDES
O(AO)BOH
O(C
2H4O)cH O(C
O(AO)BOH
2H4O)
aHLubricants, Fatliquors
Main Application & Features : Moisturizers,
Skin
CH2O(C3H6O)dH
O
O(C3H6O)bH
OCH3
O(C3H6O)cH O(C3H6O)aH
Ingredients

n = Propyleneoxide Addition Mole Number = a + b + c + d

Product Name

CH2O(AO)BOH
O
Approved by JAPANESE STANDARDS
OF QUASI-DRUG INGREDIENTS (JSQI)
O(AO)BOH MACBIOBRIDE MG-10P
10
Polyoxypropylene Methylglucoside
OCH
3
MACBIOBRIDE
MG-20P
20
O(AO)BOH O(AO)BOH

56

INCI Code

PPG-10 METHYL GLUCOSE


PPG-20 METHYL GLUCOSE

O(C2H4O)bH

OCH3
O(C2H4O)cH O(C2H4O)aH
14. POLYOXYALKYLENE GLYCOL DERIVATIVES

CH2O(AO)BOH
O
O(AO)BOH
OCH3
O(AO)BOH O(AO)BOH

AO : Ethylene Oxide and Plopylene Oxide Random copolymer


BO : Butylene Oxide
Contained Tocopherol 100 ppm

Product Name

INCI Code

Base materials

Base materials

Premix products

Premix products

Premix products

Index

Index

Index

Approved

Base materials

For COSMETIC USE ONLY


WILBRIDE MG-2070

Functional ingredients

[ Concept ] Silky Emollient Sugar

Functional ingredients

Functional ingredients

CH2O(C3H6O)dH
O
O(C3H6O)bH
POLYOXYBUTYLENE POLYOXYETHYLENE
POLYOXYPLOPYLENE METHYLGLUCOSIDES
OCH3
Main Application
Lubricants
O(C3H:6Moisturizers
O)cH O(C,3Skin
H6O)
aH

<Characteristics>
1. Provides smooth feeling derived from sugar base.
2. Provides silky and emollient feeling to skin in spite of hydrophillic ingredient.
3. High and long-lasting moisturizing effect.
4. Enhances penetration of whitening agents.
5. No bitter taste and odorless.
6. It is easy to handle because of transparent liquid.

57

14-5. POLYOXYALKYLENE ESTER (Double-Chain Form)


POLYOXYETHYLENE MONOESTERS
Main Application & Features : Pharmaceutical Additives, Nonionic Surfactants (Emulsifiers, Solubilizer,
Dispersnat, etc.)

O
RCO(C2H4O)nH
O
Ingredients

RCOO = Fatty Acid Residue


n = Ethyleneoxide Moke Number

Product Name

HLB

INCI Code

40

17.0

RCO(C3H6O)nH
Approved by JAPANESE PHARMACOPOEIA (JP)
Polyoxyl Stearate 40

JP Polyoxyl Stearate 40

Approved by JAPANESE
STANDARDS
OF QUASI-DRUG INGREDIENTS (JSQI)
RCO(C
4H8O)nH
NONION L-1

6.1

PEG-2 LAURATE

O
NONION L-4

4.5

9.9

PEG-4 LAURATE

13.3

PEG-8 LAURATE

NONION O-2
RCO(C2H4O)nCR

4.5

8.3

PEG-4 OLEATE

NONION O-4

11.7

PEG-8 OLEATE

NONION O-6

14

13.7

PEG-12 OLEATE

4.7

PEG-2 STEARATE

11.6

PEG-9 STEARATE

35

16.9

PEG-32 STEARATE

NONION S-40

70

18.3

PEG-75 STEARATE

NONION MM-4

12.7

PEG-8 MYRISTATE

NONION MM-9

20

16.3

PEG-20 MYRISTATE

NONION IS-2

4.5

8.2

PEG-4 ISOSTEARATE

NONION IS-4

11.6

PEG-8 ISOSTEARATE

NONION IS-6

14

13.7

PEG-12 ISOSTEARATE

Monolauric Acid Polyethylene Glycol

Monooleic Acid Polyethylene Glycol

NONION L-2

O S-1
NONION

NONION S-4
RO(CGlycol
2H4O)nCR'
Monostearic Acid Polyethylene
NONION S-15.4

Myristic Acid Polyethylene Glycol

Monoisostearic Acid Polyethylene Glycol

Production by order

58

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

O
RCO(C3H6O)nH
Ingredients
O

RCOO = Fatty Acid Residue


n = Propyleneoxide Addition Mole Number

Product Name

INCI Code

Functional ingredients

Main Application & Features : Viscosity Adjustment Agents, Oils for Cosmetics

Functional ingredients

POLYPROPYLENE
GLYCOL
2H4O)nMONOESTERS
H
RCO(C

Functional ingredients

RCO(C4H8O)nH
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
Polypropylene Glycol Monolaurate

36

PPG-36 OLEATE

5.5

PPG-6 CASTORATE

Polypropylene Glycol
Monooleate (36P.O.)
UNILUBE O-2100
2H4O)nCR
RCO(C
Polypropyleneglycol Caster Oil fatty Acid (5.5P.O.)

UNILUBE CF-320

O
RCO(C2H4O)nH
RO(C2H4O)nCR'

Index

PPG-26 OLEATE

Premix products

26

Base materials

O-1500

Index

PROPYLENE GLYCOL LAURATE

Premix products

O
UNILUBE

Base materials

UNISAFE PGML

Base materials

O
Polypropylene Glycol Monooleate
(26P.O.)

Production by order

O
POLYBUTYLENE
GLYCOL
MONOESTERS
3H6O)nH
RCO(C

Main Application & Features : Viscosity Adjustment Agents, Oils for Cosmetics

O
Ingredients

Premix products

RCO(C4H8O)nH

RCOO = Fatty Acid Residue


n = Butyleneoxide Addition Mole Number

O Product Name

RCO(C2H4O)nCR
For COSMETIC USE ONLY

INCI Code

COMUPOAL BL

BUTYLENE GLYCOL LAURATE

COMUPOAL BS

BUTYLENE GLYCOL STEARATE

RO(C2H4O)nCR'

Index

59

O
RCO(C3H6O)nH
O
POLYOXYETHYLENE
GLYCOL
DIESTERS
RCO(C4H
8O)nH

Main Application & Features : Emulsifiers, Solubilizers, Thickening Agents, Gelatinizers

RCO(C2H4O)nCR
Ingredients

RCOO = Fatty Acid Residue


n = Ethyleneoxide Addition Mole Number

Product Name

HLB

INCI Code

RO(C2H4O)nCR'
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
Polyethylene Glycol Dilaurate
Polyethylene Glycol Dipalmitate
Polyethylene Glycol Dioleate
Polyethylene Glycol Distearate(1)
Polyethylene Glycol Distearate(2)
Polyethylene Glycol Diisostearate

NONION DL-4HN

9.7

PEG-8 DILAURATE

NONION DL-40HN

70

17.7

PEG-75 DILAURATE

NONION DP-1.5HN

3.6

PEG-3 DIPALMITATE

NONION DO-4HN

8.0

PEG-8 DIOLEATE

NONION DO-40HN

70

16.9

PEG-75 DIOLEATE

NONION DS-4HN

8.0

PEG-8 DISTEARATE

NONION DS-40HN

70

16.9

PEG-75 DISTEARATE

NONION DS-110HN

250

19.0

PEG-250 DISTEARATE

NONION DIS-400

8.0

PEG-8 DIISOSTEARATE

NONION DIS-600

14

10.3

PEG-12 DIISOSTEARATE
Production by order

60

O
RCO(C4H8O)nH

Functional ingredients
Base materials
Premix products
Index

R = Alkyl Group
R'COO = Fatty Acid Residue
n = Ethyleneoxide Addition Mole Number

RO(C2H4O)nCR'
Ingredients

Index

Premix products

Main Application & Features : Emulsifiers, Dispersants

Base materials

POLYOXYETHYLENE
ALKYL
ETHER ESTERS
4O)nCR
RCO(C2H

Functional ingredients

Functional ingredients

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

Product Name

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Polyoxyethylene Cetylester Stearate


Polyoxyethylene Stearylether Stearate

UNISAFE UMM-103

MYRETH-3 MYRISTATE

UNIOX USP-104

CETETH-4 STEARATE

UNIOX USP-109

CETETH-9 STEARATE

UNIOX USS-104

STEARETH-4 STEARATE

UNIOX USS-109

STEARETH-9 STEARATE

Base materials

Polyoxyethylene Myristyl
Ester Myristate (3E.O.)

Production by order

POLYOXYTETRAMETHYLENE ALKYL DIESTERS

C15H31COO(CH2CH2CH2CH2O) 9 COC15H31

Premix products

Main Application & Features : Emulsifiers, Dispersants


Concept : Heat Conditioning butter

RCOO = Fatty Acid Residue


n = Tetramethyleneoxide Addition Mole Number

<Characteristics>
1. Paste oil that has the melting point at about 35C, and melts at body temperature.
2. Makes your formulation richer texture.
3. Because of excellent affinity for skin and not sticky texture, it is used for make-up cosmetics and foundations,
besides skincare cosmetics.
4. Gives smoothness to hair and keeps moisture in it, it is suitable for haircare products such as hair wax, hair
conditioner, and hair milk.
Ingredients

Product Name

INCI Code

POLY(1,4-BUTANEDIOL)-9
DIPALMITATE

For COSMETIC USE ONLY


Dipalmityl Polyteramethylene Glycol

WILBRIDE CP-9

Index

Production by order

61

14-6. POLYOXYALKYLENE ESTER (Multiple Chain Form)


1GLYCERIN DERIVATIVES
POLYOXYETHYLENE GLYCERYL FATTY ACIDS
Main Application & Features : Emulsifiers, Fatliquors, Thickening Agents

O
CH2OCR
CHO(C2H4O)aH
CH2O(C2H4O)bH

RCOO = Fatty Acid Residue


n = Ethyleneoxide Addition Mole Number = a + b

O
Ingredients
Product Name
CH2O(C2H4O)aCR

HLB

INCI Code

CHO(C2H4O)bH

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

O(C
2H4O)c
H MC-206
CH2Acid
Polyoxyethylene Caprylic
Glyceride
UNIGLY

14.0

15.0

PEG-8 CAPRYLIC/CAPRIC GLYCERIDES

12

15.0

PEG-12 GLYCERYL LAURATE

20

16.5

PEG-20 GLYCERYL LAURATE

30

17.5

PEG-30 GLYCERYL LAURATE

20

15.4

PEG-20 GLYCERYL OLEATE

30

16.6

PEG-30 GLYCERYL OLEATE

UNIGLY MT-280

82

18.5

PEG-82 GLYCERYL TALLOWATE

UNIGLY MT-280-70

82

18.5

130

19.1

UNIGLY2MK-207
CH2O(C
H4O)aCR
Polyoxyethylene Glyceryl Monococoate
UNIGLY MK-207G
O

13.0

PEG-7 GLYCERYL COCOATE

13.0

PEG-7 GLYCERYL COCOATE

UNIGLY MK-230
CH3CH2CCH2O(C
2H4O)bCR

30

17.4

PEG-30 GLYCERYL COCOATE

78

18.9

PEG-78 GLYCERYL COCOATE

POLYOXYETHYLENE
(CAPRYLATE/CAPRATE) GLYCERIDES

UNIGRY
O MC-208

CH2O(C2H4O)aUNIGLY
CR
ML-212
O
Polyoxyethylene Glyceryl Laurate
UNIGLY ML-220
ML-230
CHO(C2H4O)UNIGLY
bCR
OMO-220
UNIGLY

Polyoxyethylene Glyceryl Oleate

MO-230
CH2O(C2H4O)cUNIGLY
CR

Polyoxyethylene Glyceryl Tallow Acid

Polyoxyethylene Glyceryl Tallowate Solution

Polyoxyethylene Glyceryl Monococoate

UNIGLY MT-2130W O

UNIGLY MK-278

Production by order

CH2O(C2H4O)cH
H2C
H(C2H4O)aOHC

CHCH2(OC2H4)dOCR

CH

CHO(C2H4O)bH

O(C2H4O)cH

H2C

RCO(C2H4O)aOHC

CH

O
CHCH2(OC2H4)d OCR
O
CHO(C2H4O)cCR

O(C2H4O)bH
62

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

CH2O(C2H4O)bH

O
CH2O(C2H4O)aCR
CHO(C2H4O)bH

Functional ingredients

Main Application & Features : Nonionic Surfactants (Emulsifiers, Solubilizers, etc.)

Functional ingredients

H4O)aH ISOSTEARATES
CHO(C2GLYCERYL
POLYOXYRTHYLENE

Functional ingredients

CH2OCR

CH2O(C2H4O)cH
RCOO = Isostearic Acid Residue
n = Ethyleneoxide Additional Mole Number = a + b + c

O
CH2O(C2H4O)aCRProduct Name
Ingredients

HLB

INCI Code

UNIOX GM-8IS

CH2O(C2H
CR
O4O)cUNIOX
GM-10IS

12.0

PEG-8 GLYCERYL ISOSTEARATE

10

12.9

PEG-10 GLYCERYL ISOSTEARATE

UNIOX GM-15IS

15

14.4

PEG-15 GLYCERYL ISOSTEARATE

20

15.4

PEG-20 GLYCERYL ISOSTEARATE

30

16.8

PEG-30 GLYCERYL ISOSTEARATE

60

18.1

PEG-60 GLYCERYL ISOSTEARATE

CH2OCR

Polyoxyethylene Glyceryl Isostearate

UNIOX GM-20IS O
CHO(C2H4O)aH
UNIOX GM-30IS
CH2O(C2H4O)aCR
GM-60IS(D)
O)bH
CH2O(C2H4UNIOX
O

Base materials

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

Base materials

CHO(C2H4O)bCR
O

Base materials

Production by order

CH3CH2CCH2O(C2HO
4O)bCR

CHCH2(OC2H4)dOCR
O
H(C2H4O)aOHC
CHO(C2H4O)bH
CH2O(C2H4O)CH
aCR
O 2H4O)cH
O(C
H2C

Premix products

Main Application & CH


Features
: Nonionic
Surfactants
2O(C
2H4O)
cO
H (Emulsifiers, Solubilizers, etc.)

Premix products

POLYOXYETHYLENE GLYCERYL TRI-ISOSTEARATES

Premix products

CH2O(C2H4O)aCR
CH2O(C2H4O)cH
CHO(C2H4O)bH

CHO(C2H4O)bCR
O
O
O
CH2O(C2H4H
O)2C
cCR CHCH2(OC2H4)d OCR
RCOO = Isostearic Acid Residue
O
On = Ethyleneoxide Additional
Mole Number = a + b + c

RCO(C2H4O)aOHC

HLB

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

CH3CH2CCH2O(C2H4O)bCR
UNIOX GT-10IS

Polyoxyethylene Glyceryl Tri-Isostearate

UNIOX GT-20IS

CH2O(C
2H4O)cH
UNIOX GT-30IS
H2C

H(C2H4O)aOHC

10

7.2

PEG-10 GLYCERYL TRIISOSTEARATE

20

10.4

PEG-20 GLYCERYL TRIISOSTEARATE

30

12.3

PEG-30 GLYCERYL TRIISOSTEARATE

O
CHCH
63 2(OC2H4)dOCR
CHO(C2H4O)bH

Production by order

Index

Index

CH Name
Product
CH2O(C2H4O)aCR
O(C2H4O)bH
O

Index

Ingredients

CHO(C
O 2H4O)cCR

CHO(C2H4O)bH
CH2O(C2H4O)cH
O
CH2O(C2H4O)aCR
O
CHO(C
2H4O)
bCR
2TRIMETHYLOL
PROPANE
DERIVATIVES

O PROPANE DISTEARATES
POLYOXYETHYLENE TRIMETHYLOL
Main Application
& Features
Surfactants, etc.
CH
2O(C:2Nonionic
H4O)cCR

O
CH2O(C2H4O)aCR
O
CH3CH2CCH2O(C2H4O)bCR
CH2O(C2H4O)cH
RCOO = Isostearic Acid Residue

Ingredients

H2C

H(C2H4O)aOHC

On = Ethyleneoxide Additional Mole Number = a + b + c

CHCH2(OC2H4)dOCR

Product Name

CH

CHO(C2H4O)bH

HLB

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Polyoxyethylene Trimethylol Propane
Distearate

O(C2H4O)cH

UNIOX TD-4S

H2C

RCO(C2H4O)aOHC

CH

6.5

PEG-4 TRIMETHYLOLPROPANE
DISTEARATE

CHCH2(OC2H4)d OCR
O
CHO(C2H4O)cCR

O(C2H4O)bH

64

Production by order

CH2O(C2H4O)cCR
O
14. POLYOXYALKYLENE GLYCOL DERIVATIVES
CH2O(C2H4O)aCR
O

POLYOXYETHYLENE SORBITAN MONO-FATTY ACID ESTERS


CH2O(C2H4O)cH
Main Application & Features : Nonionic Surfantants (Emulsifiers, Solubilizers, Dispersants, etc.), Pharmaceutical Additives

H2C
H(C2H4O)aOHC

O
CH

O
CHCH2(OC2H4)dOCR
CHO(C2H4O)bH

O(C2H4O)cH
Ingredients

RCOO = Fatty Acid Residue


n = Ethyleneoxide Addition Mole Number = a + b + c + d

POLYSORBATE 80(RS)

20

15.7

20

16.7

20

15.7

POLYSORBATE 80(SS)

Index

POLYSORBATE
O(C280(GS)
H4O)bH

Premix products

Polysorbate 80

Base materials

CH 80
POLYSORBATE

Index

CHO(C2H4O)cCR

Premix products

Approved by JAPANESE
RCO(CPHARMACOPOEIA
2H4O)aOHC (JP)

INCI Code

Base materials

O
O
Name
n
HLB
CHCH
H2C Product
2(OC2H4)d OCR
O

Base materials

Functional ingredients

Functional ingredients

Functional ingredients

CH3CH2CCH2O(C2H4O)bCR

3SORBITAN DERIVATIVES

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS (JPE)


Polysorbate 20
Polysorbate 60

POLYSORBATE 20
POLYSORBATE 20(GS)
POLYSORBATE 60

Premix products

POLYSORBATE 60(GS)

Approved by JAPAN'S SPECIFICATIONS AND STANDARDS FOR FOOD ADDITIVES (JSSFA)


Polysorbate 20

WILSURF TF-20

20

16.7

Polysorbate 60

WILSURF TF-60

20

15.7

Polysorbate 80

WILSURF TF-80

20

15.7

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Polyoxyethylene Sorbitan Monolaurate (20 E.O.)

NONION LT-221
NONION LT-20

20

16.7

POLYSORBATE 20

Polyoxyethylene Sorbitan Monopalmitato (20 E.O.)

NONION PT-221

20

16.0

POLYSORBATE 40

Polyoxyethylene Sorbitan Monoleate (6 E.O.)

NONION OT-206

11.8

PEG-6 SORBITAN OLEATE

20

15.7

POLYSORBATE 80

11.8

PEG-6 SORBITAN STEARAT

20

15.7

POLYSORBATE 60

NONION LT-210

10

14.9

PEG-10 SORBITAN LAURATE

NONION LT-280

80

19.0

PEG-80 SORBITAN LAURATE

NONION IST-221

20

15.7

PEG-20 SORBITAN ISOSTEARATE

NONION OT-221
Polyoxyethylene Sorbitan Monoleate (20 E.O.)

NONION OT-221R

Polyoxyethylene Sorbitan Monostearate (6E.O.)


Polyoxyethylene Sorbitan Monostearate (20E.O.)
Polyoxyethylene Sorbitan Monolauarate
Polyoxyethylene Sorbitan Isostearate (20E.O.)

NONION ST-206
NONION ST-221
NONION ST-60

Index

NONION OT-80

Production by order

65

CH2O(C2H4O)cH
H2C
H(C2H4O)aOHC

CHCH2(OC2H4)dOCR

CH

CHO(C2H4O)bH

POLYOXYETHYLENE SORBITAN FATTY ACID ESTERS


4O)cH
O(C2H(Emulsifiers,
Main Application & Features : Nonionic Surfantants
Solubilizers, etc.)

H2C

RCO(C2H4O)aOHC

CH

O
CHCH2(OC2H4)d OCR
O
CHO(C2H4O)cCR

O(C2H4O)bH

Ingredients

Product Name

RCOO = Fatty Acid Residue


n = Ethyleneoxide Addition Mole Number
=a+b+c+d

HLB

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Polyoxyethylene Sorbitan Trioleate (20E.O.)

NONION OT-521

20

10.8

POLYSORBATE 85

Polyoxyethylene Sorbitan Tristearate (20E.O.)

NONION ST-521

20

10.7

POLYSORBATE 65

Polyoxyethylene Sorbitan Tristearate (160E.O.)

NONION ST-5160

160

17.9

TRISTEARIC ACID PEG-160 SORBITAN


Production by order

66

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

Main Application & Features :Nonionic Surfantants (Emulsifiers, Solubilizers, etc.), Pharmaceutical Additives

O
CH2O(C2H4O)aC(CH2)10CH(CH2)5CH3
O

O(C2H4O)xH

CHO(C2H4O)bC(CH2)10CH(CH2)5CH3
O

Functional ingredients

POLYOXYETHYLENE HYDROGENATED CASTOR OILS

Functional ingredients

Functional ingredients

4CASTOR OIL & HYDROGENATED CASTOR OIL DERIVATIVES

O(C2H4O)yH

CH2O(C2H4O) cC(CH2)10CH(CH2)5CH3
O(C2H4O)zH
Ingredients
Product Name
n
HLB
2)10CH(CH2)5CH3
CH2O(C2H4O)aC(CH

INCI Code

O(C2H4O)xH
O
Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS (JPE)
CHO(C2H4O)bC(CH
2)10CH(CH2)5CH3
20
10.1
Polyoxyethylene Hydrogenated Castor Oil 20
UNIOX HC-20
O(C
2H4O)yH
O
Polyoxyethylene Hydrogenated Castor Oil 40
UNIOX HC-40
40
13.3

Polyoxyethylene Hydrogenated
Castor2Oil
UNIOX HC-60
15.0
CH2O(C
H460O) cC(CH
2)10CH(CH2)60
5CH3

Polyoxyethylene Hydrogenated Castor Oil 100

100O 16.6

UNIOX HC-100

Base materials

Base materials

Base materials

n = Ethyleneoxide Addition Mole Number


=a+b+c+x+y+z

O(C2H4O)zCR
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)

UNIOX HC-60

O(C2H4O)yH

Index

O(C2H4O)60xH 15.0
O
UNIOX HC-60S
CHO(C2H4O)bC(CH
2)10CH(CH2)5CH3
UNIOX HC-100
160
16.6

Polyoxyethylene Hydrogenated Castor Oil

Premix products

UNIOX HC-40
40CH313.3
CH2O(C2H4O)aC(CH
2)10CH(CH2)5

PEG-20 HYDROGENATED CASTOR OIL

Index

10.1

Premix products

20

Premix products

O HC-20
UNIOX

PEG-40 HYDROGENATED CASTOR OIL


PEG-60 HYDROGENATED CASTOR OIL
PEG-100 HYDROGENATED CASTOR OIL

CH2O(C2H4O) cC(CH2)10CH(CH2)5CH3
O

Production by order

O(C2H4O)zCCH2CH2COOH
O

CH2O(C2H4O)aC(CH2)7CH=CHCH2CH(CH2)5CH3
O(C2H4O)xH

O(C2H4O)yH

CHO(C2H4O)bC(CH2)7CH=CHCH2CH(CH2)5CH3
CH2O(C2H4O) cC(CH2)7CH=CHCH2CH(CH2)5CH3
O(C2H4O)zH

67

Index

O
CH2O(C2H4O)aC(CH2)10CH(CH2)5CH3
O

O(C2H4O)xH

CHO(C2H4O)bC(CH2)10CH(CH2)5CH3
O

O(C2H4O)yH

CH2O(CHYDROGENATED
2H4O) cC(CH2CASTOR
)10CH(CH
2)MONOESTERS
5CH3
POLYOXYETHYLENE
OIL
Main Application & Features : Nonionic Surfantants (Emulsifiers,
Solubilizers,
etc.)
zH
O(C2H4O)

O
CH2O(C2H4O)aC(CH2)10CH(CH2)5CH3
O

O(C2H4O)xH

CHO(C2H4O)bC(CH2)10CH(CH2)5CH3
O

O(C2H4O)yH

CH2O(C2H4O) cC(CH2)10CH(CH2)5CH3
O
O(C2H4O)zCR

RCOO = Fatty Acid Residue


n = Ethyleneoxide Addition Mole Number
=a+b+c+x+y+z

O
CH2O(C2H4O)aC(CH2)10CH(CH2)5CH3
Ingredients
Product Name
n
HLB
O(C2H4O)xH
O
CHO(C2H4O)bC(CH2)10CH(CH2)5CH3
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
O(C2H4O)yH
O
CH2O(C
H4O) cC(CH2)10CH(CH2)5CH3
Polyoxyethylene Hydrogenated
Castor2Oil
O
Monolaurate
UNIOX HC-20ML

UNIOX HC-40ML

20

9.0

40

12.4

20

8.6

INCI Code

LAURYL PEG-20 HYDROGENATED


CASTOR OIL
LAURYL PEG-40 HYDROGENATED

OIL
COOH
O(C2H4O)zCCH2CH2CASTOR

UNIOX
OHC-20MIS

PEG-20 HYDROGENATED CASTOR OIL


ISOSTEARATE

CH2O(C
H4O)aC(CH2)7CH=CHCH2CH(CH2)PEG-40
5CH3HYDROGENATED CASTOR OIL
Polyoxyethylene Hydrogenated
Castor2Oil
UNIOX HC-40MIS
40
12.0
ISOSTEARATE
Monoisostearate
O(C2H4O)xH
O
HC-60MIS
13.8 2)5CH3
CHO(C2H4O)bUNIOX
C(CH
2)7CH=CHCH258
CH(CH
ISOSTEARATE

PEG-58 HYDROGENATED CASTOR OIL

O(C2H4O)yH

CH2O(C2H4O) cC(CH2)7CH=CHCH2CH(CH2)5CH3
O(C2H4O)zH

68

Production by order

CH2O(C2H4O)aC(CH2)10CH(CH2)5CH3
O

O(C2H4O)xH

14. POLYOXYALKYLENE
GLYCOL DERIVATIVES
CHO(C2H4O)bC(CH2)10CH(CH
2)5CH3

O(C2H4O)yH

O(C2H4O)xH

CHO(C2H4O)bC(CH2)10CH(CH2)5CH3
O

Base materials

Functional ingredients

CH2O(C2H4O)aC(CH2)10CH(CH2)5CH3

Base materials

Functional ingredients

Main Application & Features : Emulsifiers, SulubilizersO(C2H4O)zCR

Functional ingredients

CH2O(C2H4O) cC(CH2)10CH(CH2)5CH3
O
POLYOXYETHYLENE HARDENED CASTOR OIL SUCCINATES

O(C2H4O)yH

CH2O(C2H4O) cC(CH2)10CH(CH2)5CH3
O
O

n = Ethyleneoxide Addition Mole Number = a + b + c + x + y + z

CH2O(C2H4O)aC(CH2)7CH=CHCH2CH(CH2)5CH3
Ingredients

Base materials

O(C2H4O)zCCH2CH2COOH

Product Name

n
O(C
2H4O)xH

INCI Code

CHO(C2H4O)bC(CH2)7CH=CHCH2CH(CH2)5CH3
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
O(C2H4O)yH
O
PEG-50 HYDROGENATED
Polyoxyethylene Hydrogenated Castor
UNIOX HC-50MSU =
50
CH2O(C2H4O) cC(CH2)7CH CHCH2CH(CH
2)CASTOR
5CH3OIL SUCCINATE
Oil Succinate (50 E.O.)
O(C2H4O)zH
Premix products

Premix products

Premix products

Index

Index

Index

69

Production by order

O
CH2O(C2H4O)aC(CH2)10CH(CH2)5CH3
O

O(C2H4O)xH

CHO(C2H4O)bC(CH2)10CH(CH2)5CH3
O

O(C2H4O)yH

CH2O(C2H4O) cC(CH2)10CH(CH2)5CH3
POLYOXYETHYLENE CASTOR OILS
O
Main Application & Features : Nonionic Surfantants (Emulsifiers, etc.),
O(C2H4O)zCCH2CH2COOH

CH2O(C2H4O)aC(CH2)7CH=CHCH2CH(CH2)5CH3
O

O(C2H4O)xH

O(C2H4O)yH

CHO(C2H4O)bC(CH2)7CH=CHCH2CH(CH2)5CH3
CH2O(C2H4O) cC(CH2)7CH=CHCH2CH(CH2)5CH3
O(C2H4O)zH
n = Ethyleneoxide Addition Mole Number = a + b + c + x + y + z

Ingredients

Product Name

HLB

INCI Code

35

12.8

Approved by JAPANESE PHARMACEUTICAL EXCIPIENTS(JPE)


Polyoxyethylene Castor Oil

UNIOX C-35

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Polyoxyethylene Castor Oil

UNIOX C-35

35

12.8

PEG-35 CASTOR OIL


Production by order

70

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

CH2O(C2H4O)aCOR
CHO(C2H4O)bCOR
CHO(C2H4O) cCOR

Functional ingredients

Main Application & Features : Nonionic Surfantants (Emulsifiers, Solubilizers, etc.)

Functional ingredients

TETRAOLEYL POLYOXYETHYLENE SORBITOLS

Functional ingredients

5SORBITAN DERIVATIVES

CHO(C2H4O) dCOR
CHO(C2H4O)eH

HLB

CHO(C2H4O)bCOR
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
CHO(C2H4O) cCOR
6
5.0
UNIOX ST-6E
dCOR
CHO(C2H4O)UNIOX
ST-30E
30
11.2
ST-30EC
eH
CHO(C2H4O)UNIOX

Tetraoleyl Polyoxyethylene Sorbitol

UNIOX ST-40E

fH
CH2O(C2H4O)UNIOX
ST-60E

INCI Code

Base materials

Base materials

CH2O(C2H4O)aCOR
Ingredients
Product Name

Base materials

RCOO = Oleic Acid Residue


N = Ethyleneoxide Addition Mole Number
=a+b+c+d+e+f

CH2O(C2H4O) fH

SORBETH-6 TETRAOLEATE
SORBETH-30 TETRAOLEATE

30

11.2

SORBETH-30 TETRAOLEATE

40

12.5

SORBETH-40 TETRAOLEATE

60

14.2

SORBETH-60 TETRAOLEATE
Production by order

Premix products

Index

Index

CHO(C2H4O) dCOR

Premix products

CHO(C2H4O) cCOR

Index

CHO(C2H4O)bCOR

Premix products

CH2O(C2H4O)aCOR

CHO(C2H4O)eCOR
CH2O(C2H4O) fH
CH2O(C2H4O)dCOR
O
O(C2H4O)bH
OCH3
RCOO(C2H4O)c
CH2O(C2H4O)aCOR
H
N

HO

OH

N
HO

NH
NH2

L
71

CH2O(C2H4O)aCOR
CHO(C2H4O)bCOR
CHO(C2H4O) cCOR
CHO(C2H4O) dCOR
CHO(C2H4O)eH
TETRAISOSTEARYL POLYOXYETHYLENE SORBITOLS
CH2O(C2H4O) fH

Main Application & Features : Nonionic Surfantants (Emulsifiers, Solubilizers, etc.)

CH2O(C2H4O)aCOR
CHO(C2H4O)bCOR
CHO(C2H4O) cCOR
CHO(C2H4O) dCOR
CHO(C2H4O)eH

RCOO = Isostearic Acid Residue


n = Ethyleneoxide Addition Mole Number
=a + b + c + d + e + f

CH2O(C2H4O) fH
<Characteristics>
1. High ability to CH
emulsify
and solubilize.
2O(C
2H4O)aCOR
2. High safety.
3. Because of itsCHO(C
low congeal point,
keeps
high stability at low temperature.
2H4O)
bCOR
4. Low odor and color (using extra pure(85%) oleic acid derived from vegetables)
CHO(C2H4O) cCOR
Product Name
CHO(C2H4O) dCOR

Ingredients

HLB

30

11.1

INCI Code

CHO(C2H4O)eCOR

For COSMETIC USE ONLY

fH
CH
ST-30IS
2O(C2H4O)
UNIOX

CH2O(C2H4O)dCOR
O
O(C2H4O)bH
OCH3
RCOO(C2H4O)c
CH2O(C2H4O)aCOR
H
N

HO

OH

N
HO

NH
NH2

72

SORBETH-30 TETRAISOSTEARATE

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

RCOO = Isostearic Acid Residue


n = Ethyleneoxide Additional Mole Number
=a+b+c

HLB

INCI Code

CH2O(C2H4O)aCOR
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
CHO(C2H4O)bCOR
3
4.7
Isostearyl Polyoxyethylene Sorbitol (3 E.O.)
UNIOX ST-3IS
CHO(C2H4O) cCOR

SORBETH-3 ISOSTEARATE

Base materials

Base materials

Product Name

Base materials

Ingredients

Functional ingredients

CH2O(C2H4O)aCOR
CH2O(C2H4O)aCOR
CHO(C2H4O)bCOR
CHO(C2H4O)bCOR
CHO(C2H4O) cCOR
CHO(C2H4O) cCOR
CHOH
CHO(C2H4O) dCOR
CHOH
CHO(C2H4O)eH
CH2OH
CH2O(C2H4O) fH

Functional ingredients

Main Application & Features : Nonionic Surfantants (Emulsifiers, Solubilizers, etc.)

Functional ingredients

ISOSTEARIC ACID POLYOXYETHYLENE SORBITOLS

Production by order

CHO(C2H4O) dCOR
CHO(C2H4O)eH
PENTAOLEYL POLYOXYETHYLENE SORBITOLS
CH2O(C2H4O) fH

Main Application & Features : Nonionic Surfantants (Emulsifiers, Solubilizers, etc.)

CHO(C2H4O) cCOR
CHO(C2H4O) dCOR
CHO(C2H4O)eCOR

RCOO = Oleic Acid Residue


n = Ethyleneoxide Addition Mole Number
=a+b+c+d+e+f

CH2O(C2H4O) fH

N
HO

NH2

L
73

Production by order

Index

OH

NH

SORBETH-40 PENTAOLEATE

Index

H
N

INCI Code

Index

Product Name
n
HLB
CH2O(C
2H4O)dCOR
O
O(C
H4O)bH INGREDIENTS (JSQI)
Approved by JAPANESE STANDARDS
OF2QUASI-DRUG
Pentaoleyl Polyoxyethylene Sorbitol
UNIOX SP-40E OCH3
40
11.4
RCOO(C2H4O)c
CH2O(C2H4O)aCOR
Ingredients

HO

Premix products

CHO(C2H4O)bCOR

Premix products

Premix products

CH2O(C2H4O)aCOR

CH2O(C2H4O)aCOR
CHO(C2H4O)bCOR
CHO(C2H4O) cCOR
CHO(C2H4O) dCOR
6METHYLGLUCOSIDE
DERIVATIVES
4O)eCOR
CHO(C2H
TRIISOSTEARIC ACID POLYOXYETHYLENE METHYLGLUCOSIDES
CH2O(C2H4O) fH
Main Application & Features :Viscosity Adjustment Agents

CH2O(C2H4O)dCOR
O
O(C2H4O)bH
OCH3
RCOO(C2H4O)c
CH2O(C2H4O)aCOR
HO

H
N

<Characteristics>
1. Highly efficient viscosity builder.
OH
2. Synergistic effect with other
N viscosity builder.
3. Keeps formulation's foam.
HO
O
4. Excellent moisturizer.
5. Non-irritating to eyes and skin.
6. High stability.
Product Name

NH
NH2

HLB

120

17.3

RCOO = Isostearic Acid Residue


n = Ethyleneoxide Addition Mole Number
=a + b + c + d

INCI Code

For COSMETIC USE ONLY


MACBIOBRIDE MG-120TIS
MACBIOBRIDE MG-T

PEG-120 METHYLGLUCOSE TRIISOSTEARATE


Aqueous solution,Production by order

74

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

(C2H4O)aH
(C2H4O)bH

(C2H4O)aH

Ingredient

RCN

Base materials

RN

Functional ingredients

Main Application & Features :Hair Rinses/Hair Conditioner Base, etc.

Base materials

POLYOXYETHYLENE ALKYL AMINES

Functional ingredients

Functional ingredients

14-7. POLYOXYETHYLENE DERIVATIVE(NITROGEN



CONTAINING FORM)

R = Alkyl Group
n = Ethyleneoxide Addition Mole Number = a + b

Product Name
n
RCNH(C2H4O)aH

INCI Code

(C2H4O)bH
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
2

Base materials

NYMEEN F-202
Hb(OC2H4)a(OCNYMEEN
3H6)
F-203
NCH2CH2N
Polyoxyethylene Cocoalkyl
Amine
2H4)a(OCNYMEEN
3H6) F-205
Hb(OC
NYMEEN F-210

PEG-2 COCAMINE

(C3H6O)3a(C2H4PEG-3
O)bCOCAMINE
H
O)bCOCAMINE
H
(C3H6O)5a(C2H4PEG-5
10

PEG-10 COCAMINE

NYMEEN F-215

15

PEG-15 COCAMINE

Polyoxyethylene Oleylamine

NYMEEN O-205

PEG-5 OLEAMINE

Polyoxyethylene Stearylamine

NYMEEN S-202

PEG-2 STEARAMINE
Production by order

(C2H4O)bH

Hb(OC2H4)a(OC3H6)
Ingredient

Hb(OC2H4)a(OC3H6)

O
or

RCNH(C2H4O)aH

Premix products

RCN

(C2H4O)aH

Premix products

Premix products

(C2H4O)aH
POLYOXYETHYLENE
ALKYL AMIDES
RN
2
H
4
O)bH Agents, Foam Stabilizers, Cleansing Power Improvement Agents, Emulsifiers
(C
Main Application & Features : Thickening

RCO = Fatty Acid Residue


n = Ethyleneoxide Addition Mole Number

NCH2CH
2N
Product
Name

(C3H6O)a(C2H4O)bH
n

(C3H6O)a(C2H4O)bH

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


PEG-3 COCAMIDE

NYMID MF-210

11

PEG-11 COCAMIDE

Polyoxyethylene Coconut Fatty Acid Amide

NYMID F-205

PEG-5 COCAMIDE

Polyoxyethylene Coconut Fatty Acid


Diethanolamide

NYMID DF-203

PEG-3 COCAMIDE DEA

NYMID ML-203

PEG-3 LAURAMIDE

NYMID ML-211

11

PEG-11 LAURAMIDE

Polyoxyethylene Lauryl Monoetholamide

Production by order

75

Index

Index

NYMID MF-203

Index

Polyoxyethylene Coconut Fatty Acid


Monoethanolamide

14-8. POLYOXYETHYLENE DERIVATIVE(AMINE OXIDE FORM)


ALKYL DIMETHYL AMINE OXIDES
Main Application & Features :Foam Stabilizers, Cleansing Power Improvement Agents, Hair Rinses/Conditioner Base

CH3
RNO
CH3
R = Alkyl Group

Ingredient

CH2CH2OHProduct Name

INCI Code

C12H25NO
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
2OH A-LM
CH2CH
UNISAFE

Lauryl Dimethyl Amineoxide Solution

Myristyl Dimethyl Amineoxide Solution


Stearyl Dimethyl Amineoxide

LAURAMINE OXIDE

UNISAFE A-LMR

LAURAMINE OXIDE

UNISAFE A-MM

MYRISTAMINE OXIDE

A-SM
3
CHUNISAFE

Oleyl Dimethyl Amineoxide

STEARAMINE OXIDE

UNISAFE A-OM

OLEAMINE OXIDE

R(OC2H4)nNO
CH3

Production by order

CH3

RNO
DIHYDROXYETHYL
CH3 LAURYL AMINEOXIDES
Main Application & Features : Foam Stabilizers, Cleansing Power Improvement Agents, Hair Rinses/Conditioner Base

CH2CH2OH
C12H25NO
CH2CH2OH
Ingredient

CH3

Product Name

INCI Code

R(OC2H4)nNO
Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)
3
Dihydroxyethyl Lauryl Amineoxide SolutionCH
UNISAFE
A-LE

DIHYDROXYETHYL LAURAMINE OXIDE

76

CHO(C2H4O)eCOR
CH2O(C2H4O) fH

14. POLYOXYALKYLENE GLYCOL DERIVATIVES

14-9. POLYOXYALKYLENEDERIVATIVES
CH2O(C2H4O)dCOR

OH

N
HO

NH
NH2

L: Lactic acid

Pale yellow liquid


Concentration: 50wt%aq.
pH: ca. 7.0

Base materials

Base materials

Base materials

Premix products

Premix products

Premix products

Index

Index

Index

Product Name

INCI Code

For COSMETIC USE ONLY


WILBRIDE R-PL

Functional ingredients

H
N

HO

Functional ingredients

3
OCH
Main Application : Repair of Damage Hair , Improvement
of Gloss
RCOO(C
2
H
4
O)
c
[ Concept ] Glossy Amino Moisture
CH2O(C2H4O)aCOR

Functional ingredients

O
AMINO ACID DERIVATIVES O(C2H4O)bH

PPG-2 ARGININE, LACTIC ACID, WATER

<Characteristics>
1. Acting on internal hair, and providing natural gloss with damage hair.
2. Alcohol solution makes it easy to dissolve in formulation.
3. Improving the cohesion of damage hairs.
4. Providing smooth feeling with the surface of hair.

77

15. HYDROGENATED POLYISOBUTENE

Main Application & Features : Base Oil, Emollient agents, Lipophilic Thickners, Glossy Agents

CH3

CH3

CH3

CH3CCH2CCH2CHCH3
CH3

Ingredient

CH3

Product Name

Kinematic Viscosity
37.8C

98.9C

INCI Code

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Light Isoparaffin

PARLEAM 3

1.4

Light Liquid Isoparaffin

PARLEAM 4

3.1

PARLEAM EX

10.6

2.5

PARLEAM 6

20.1

3.6

PARLEAM 18

300

PARLEAM 24

800

PARLEAM 46

4700

Liquid Isoparaffin

Heavy Liquid Isoparaffin

78

HYDROGENATED POLYISOBUTENE

16. VEGITABLE OIL


MACADAMIA NUT OIL
Functional ingredients

Functional ingredients

Base materials

Base materials

Base materials

Premix products

Premix products

Premix products

Index

Index

Index

Functional ingredients

Main Application & Features :

Macadamia Nut Oil contains a much higher amount of palmitoleic acid than any other vegetable oils. It has light texture,
great affinity for human skin and fatty acid composition similar to that of human skin sebum. Macadamia Nut Oil, which
is nearly colorless and odorless, exhibits much better oxidative stability than other liquid vegetable oils.

Ingredient
Macademia nut oil Vitamin E

Product Name
Macademia nut oil

INCI Code
MACADEMIA TERNIFOLIA SEED OIL

Specifications:
Acid value

1.0 max.

Color (APHA method)

80.0 max.

Specific gravity (at 25 deg C)

0.907 - 0.914

Refractive index (at 25 deg C)

1.465 - 1.468

Saponification value

190.0 - 200.0

Palmitoleic acid

18.0 % min.

Iodine value

70.0 - 80.0

Unsaponifiable matter

1.5 % max.

Heavy metals (as Pb)

20 ppm max

Arsenic

2 ppm max

79

17. PURIFIED OLEIC ACID AND ITS DERIVATIVES

Main Application & Features : Emulsifier, Emollient


Our oleic acid's purity is higher than 99% and impurities such as poly-unsaturated fatty acids (linoleic acid etc.) are
removed by our unique techniques, so that it gives excellent oxidation stability and high affinity to skin. That is the
reason why it can be used in various cosmetics and quasi-drugs as emollient and texture modifiers.

Ingredient

Product Name

INCI Code

Appearance

Approved by JAPANESE STANDARDS OF QUASI-DRUG INGREDIENTS (JSQI)


Oleic acid

CLEARBRIGHT 81S

OLEIC ACID

Pale yellow Liquid


(Solid at low temperatures)

Ethyl oleate

CLEARBRIGHT E-81S

ETHYL OLEATE

Pale yellow Liquid

80

Functional ingredients

Base materials

Premix products

Premix products

Index

Index

81

Base materials

19. COMPOSITE OF
DETERGENTS

Functional ingredients

Premix
products

18. PHOSPHOLIPID
PREMIX SOLUTIONS

20. DEFOAMING AGENTS

18. PHOSPHOLIPID PREMIX SOLUTIONS


18-1. High-concentration empty-liposome solution

EXTRASOME AQUA
Main Application & Features :
This product is a highly concentrated empty-liposome solution that can be mixed with extracts, texture modifiers and
viscosity improvers etc. to easily prepare essences, lotions and skin refreshers.
Being a single lamellar liposome, EXTRASOME AQUA efficiently penetrates and remains in stratum corneum, giving
moisture, smoothness and resilience to skin.
Lipid (phospholipid, cholesterol etc.) concentration: 5%
Typical particle size: 100-300nm
Main Ingredients

Appearance

Hydrogenated soybean phospholipid, cholesterol, alcohol,


viscosity improver, water, antiseptic

White emulsion

EXTRASOME AQUA(BG)

Main Application & Features:


This product is a highly concentrated empty liposomes solution containing no alcohol or thickener. Its easy to prepare
essences, lotions and skin refreshers.
EXTRASOME AQUA(BG) efficiently penetrates and remains in stratum corneum, giving moisture, smoothness and
resilience to skin.
Lipid (phospholipid, cholesterol etc.) concentration: 5%
Typical particle size:100-300nm
Main Ingredients

Appearance

Hydrogenated soybean phospholipid, cholesterol, butylene glycol,


water, antiseptic

White emulsion

EXTRASOME NANO

Main Application & Features :


This product is a highly concentrated empty liposome solution with particle size smaller than 100nm, which is suitable
size to efficiently penetrate and remains in stratum corneum. Being a single lamellar liposome, EXTRASOME NANO
efficiently penetrates and remains in stratum corneum, giving moisture, smoothness and resilience to skin. It is mixed
with extracts, texture modifiers and viscosity improver etc. to easily prepare essences, lotions and skin refreshers.
Lipid (phospholipid, cholesterol etc.) concentration: 5%
Typical particle size: 100nm

Main Ingredients

Appearance

Hydrogenated soybean phospholipid, cholesterol, alcohol,


viscosity improver, water, antiseptic

White emulsion

82

18. PHOSPHOLIPID PREMIX SOLUTIONS

Functional ingredients

Base materials

Base materials

Premix products

Premix products

Index

Index

Main Application & Features :

Functional ingredients

18-2. High-concentration Ceramide 3 contained liposome


solution EXTRASOME C3-L

This product is a highly concentrated empty-liposome solution containing Ceramide 3 well stabilized in the liposome
membrane, despite the fact that Ceramide 3 is a difficult substance to be dispersed in aqueous solution.
Being a single lamellar liposome: EXTRASOME C3-L efficiently penetrates and remains in stratum corneum, giving
moisture, smoothness and resilience to skin. Also, it rapidly provides its Ceramide 3 with skin to give delicate and thin
layer touch.
By simply mixing with extracts, texture modifiers and viscosity improver etc., EXTRASOME C3-L easily prepares
Ceramide 3 contained aqueous cosmetics and quasi-drugs.
Lipid (phospholipid, cholesterol etc.) concentration: 5%
Ceramide 3 concentration : 0.1%
Typical particle size : 100-300nm
Main Ingredients

Appearance

Hydrogenated soybean phospholipid, cholesterol, Ceramide 3,


viscosity improver, water, antiseptic

White emulsion

18-3. PRIMESOME - MB

Main Application & Features:


Advanced empty liposome solution.
This product is a LIPIDURE-PMB conjugated liposome.

This product has synergy effect of moisturizing by LIPIDURE-PMB and liposome.


LIPIDURE-PMB gives moisture mainly on the surface of the skin and liposome gives it to the inner skin, therefore,
comparing with general liposome, it has good texture and improves moisturizing effect.
Favorable stability of liposome due to LIPIDURE conjugation has improved the stability of water based formulation,
Lipid (phospholipid, cholesterol etc.) concentration: 5%
Typical particle size:100-300nm

Main Ingredients

Appearance

Hydrogenated soybean phospholipid, cholesterol, polyquaternium-51,


butylene glycol, water, antiseptic

White emulsion

83

18-4. Lipid Mixture

Main Application & Features:


Lipid Mixture is containing hydrogenated soybean phospholipid and cholesterol uniformly.
When it is added to water, it is easily dispersed in water by using homogenizer to get loations or creams.
Product Name

Main Ingredients

Appearance

EXTRASOME HC

Hydrogenated soybean phospholipid (PC purity:90%),


cholesterol

White powder

EXTRASOME MC

Hydrogenated soybean phospholipid (PC purity:60%),


cholesterol

Pale yellow powder

18-5. Hydrogenated soybean cyclic phospholipid CP7


contained lipid mixture EXTRASOME CP7-M
Main Application & Features :
This product is a lipid mixture containing a novel antiaging ingredient, cyclic Phosphatidic acid(cPA), which is normally
present in human body, and acts on skin surface and gives antiaging effect of improving reconstruction of cytoskeleton
(actin fibers) and enhancing production of hyaluronic acid.
Our high-purity cPA, hydrogenated soybean cyclic phospholipid CP7 (INCI code: Hydrogenated Sodium Cyclic
Lysophosphatidic Acid) does not contain any animal-based materials and is colorless and odorless. By adding CP7 in
cosmetic formulation, anti-aging effect is easily obtained.

O
O
Na+ O
O
P
O
O

Hydrogenated soybean
cyclic phospholipid CP7

Ingredients

Appearance

Hydrogenated soybean phospholipid, cholesterol,


hydrogenated soybean cyclic phospholipid CP7

White powder

84

19. COMPOSITE OF DETERGENTS


19-1. Mild Detergent Mixture of Amino Acid Soap and Polysorbate

<feature of a product>
Polysorbate (WILSURF TF series) is mild food additive surfactant, and recently it is one of the useful detergents for
vegetables and baby bottles. But the poor foaming property of polysorbate has been desired to be improved.
WILSURF PX-50 is the mild detergent mixture of amino acid soap and polysorbate. It achieves very high foaming
property and good feeling after washing off.

Ingredients
Polysorbate, Amino Acid Soap etc

Appearance

pH
(25, Undiluted solution)

Viscosity
mPas, 25

Light Yellow or Yellow Liquid

7.59.5

Ca. 400

Functional ingredients

Functional ingredients

WILSURF PX-50

Production by order

WILSURF EX

Base materials

Base materials

19-2. Composite of Food Detergents for Bacterial Eradication

<feature of a product>
Antimicrobial Activity, Food Additives, High Detergency, High Foaming, Easy to Use
Ingredients

5.07.0

Ca. 250

85

Index

Light Yellow or Yellow Liquid

Premix products

Viscosity
mPas, 25

Index

pH
(25, Undiluted solution)

Premix products

Polysorbate etc

Appearance

20. DEFOAMING AGENTS

Main Application & Features: Defoaminng , Food Additive

Ingredients

Product Name

Appearance

Approved by JAPANS SPECIFICATIONS AND STANDARDS FOR FOOD ADDITIVES(JSSAF)


Sorbitan Fatty Acid Ester etc

DISFOAM FD-2
DISFOAM FC-1
DISFOAM FC-2

Pale yellow liquid


Production by order

86

INDEX
INCI CODE INDEX

B
BEHENETH-5 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
BEHENETH-10 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
BEHENETH-20 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
BEHENETH-30 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
BEHENIC ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
BEHENDIMONIUM ETHYL STEARYL PHOSPHATE. . . . . . . . . . . 9
BEHENTRIMONIUM CHLORIDE. . . . . . . . . . . . . . . . . . . . . . . . 39
BEHENYL ALCOHOL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 34
BENZALKONIUM CHLORIDE. . . . . . . . . . . . . . . . . . . . . . . . . . 39
BIS-SOYOYL/RAPESEEDOYL ETHYL HYDROXYETHYLMONIUM METHOSULFATE. . . 39
BUTYLENE GLYCOL LAURATE. . . . . . . . . . . . . . . . . . . . . . . . 59
BUTYLENE GLYCOL STEARATE. . . . . . . . . . . . . . . . . . . . . . . 59
BUTYL STEARAT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36

D
DECYL OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
DIETHYLHEXYL SEBACATE . . . . . . . . . . . . . . . . . . . . . . . . . .
DIGLYCERIN. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
DIISOPROPYL SEBACATE . . . . . . . . . . . . . . . . . . . . . . . . . . .
DIHYDROXYETHYL LAURAMINE OXIDE. . . . . . . . . . . . . . . . . .
DIMETHYL STEARAMINE. . . . . . . . . . . . . . . . . . . . . . . . . . . .
DISODIUM LAURETH SULFOSUCCINATE . . . . . . . . . . . . . . . .
DISODIUM LAURILIMINODIACETATE . . . . . . . . . . . . . . . . . . .
DISTEARYLDIMONIUM CHLORIDE. . . . . . . . . . . . . . . . . . . . .

36
36
47
36
76
42
37
40
39

E
ECKLONIA KUROME EXTRACT. . . . . . . . . . . . . . . . . . . . . . . . 24
ETHYLHEXYL PALMITATE . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
ETHYLHEXYL STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
ETHYL OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36,80
EUCALYPTUS GLOBULUS LEAF EXTRACT. . . . . . . . . . . . . . . 20
G
GLYCERETH-26. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 47
GLYCERIN. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33
GLYCERYL OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
GLYCERYL STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
GLYCERYLAMIDOETHYL METHACRYLATE/
STEARYL METHACRYLATE COPOLYMER. . . . . . . . . . . . . . . . . 7
GLYCOL DISTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36

32
28
78
31

I
ISOPROPYL MYRISTATE . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ISOPROPYL PALMITATE . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ISOSTEARETH-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ISOSTEARETH-5. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ISOSTEARETH-10. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ISOSTEARETH-15. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ISOSTEARETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ISOSTEARETH-25. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

36
36
53
53
53
53
53
53

L
LAURAMIDE DEA. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURAMIDE MIPA. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURAMIDOPROPYLBETAINE . . . . . . . . . . . . . . . . . . . . . . . .
LAURAMINE OXIDE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURETH-4. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

42
42
40
76
52

Index

87

H
HYDROGENATED CASTOR OIL. . . . . . . . . . . . . . . . . . . . . . . .
HYDROGENATED LECITHIN. . . . . . . . . . . . . . . . . . . . . . . . . .
HYDROGENATED POLYISOBUTENE . . . . . . . . . . . . . . . . . . . .
HYDROXYSTEARIC ACID . . . . . . . . . . . . . . . . . . . . . . . . . . . .

Premix products

C
C12-14 PARETH-3 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
C12-14 PARETH-7 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
C12-14 PARETH-12 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
CALCIUM STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
CAMELLIA JAPONICA FLOWER EXTRACT. . . . . . . . . . . . . . . . 17
CAMELLIA JAPONICA LEAF EXTRACT . . . . . . . . . . . . . . . . . . 21
CAMELLIA JAPONICA SEED EXTRACT. . . . . . . . . . . . . . . . . . 18
CAPRIC ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
CAPRYLIC/CAPRIC TRIGLYCERIDE. . . . . . . . . . . . . . . . . . . . . 32
CERASUS YOUKOU FLOWER EXTRACT. . . . . . . . . . . . . . . . . . 26
CERASUS YOUKOU LEAF EXTRACT . . . . . . . . . . . . . . . . . . . . 27
CETEARYL ALCOHOL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 34
CETETH-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-7. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-8. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-10. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-13. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-23. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-30. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-40. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETETH-4 STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 61
CETETH-9 STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 61
CETYL ALCOHOL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 34
CETYL MYRISTATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
CETYLTRIMETHYL CHLORIDE . . . . . . . . . . . . . . . . . . . . . . . . 39
CHOLESTEROL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 28
CHOLESTERYL HEXYL DICARBAMATE PULLULAN . . . . . . . . . . 8
CHOLETH-10 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54
CHOLETH-24 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54
CITRUS AURANTIUM TACHIBANA PEEL EXTRACT. . . . . . . . . . 13
CITRUS DEPRESSA PEEL EXTRACT. . . . . . . . . . . . . . . . . . . . 15
COCAMIDE DEA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 42
COCAMIDE DEA (1:2) . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 42
COCAMIDE MEA. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 42
COCAMIDEPROPYL BETAINE. . . . . . . . . . . . . . . . . . . . . . . . . 40
COCOBETAINE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 40

Base materials

COCONUT ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
CURCUMA LONGA (TURMERIC) ROOT EXTRACT. . . . . . . . . . . 22
CYCLIC LYSOPHOSPHATIDIC ACID. . . . . . . . . . . . . . . . . . . . . 23

Functional ingredients

A
AKEBIA TRIFOLIATA STEM EXTRACT. . . . . . . . . . . . . . . . . . . 14
ALUMINUM DI STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . 35

INDEX
INCI CODE INDEX

LAURETH-7. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURETH-9. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURETH-11. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURETH-30. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURETH-100. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURIC ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURTRIMONIUM CHLORIDE. . . . . . . . . . . . . . . . . . . . . . . . .
LAURYL ALCOHOL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURYL BETAINE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
LAURYY PEG-20 HYDROGENATED CASTOT OIL. . . . . . . . . . .
LAURYY PEG-40 HYDROGENATED CASTOT OIL. . . . . . . . . . .
LINOLEIC ACID . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

52
52
52
52
52
52
31
39
34
40
68
68
31

M
MACADEMIA TERNIFOLIA SEED OIL. . . . . . . . . . . . . . . . . . . .
MAGNESIUM METHYL COCOYL TAURATE . . . . . . . . . . . . . . .
MAGNESIUM STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . .
METHYL GLUCETH-10. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
METHYL GLUCETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
MYRETH-3 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
MYRETH-4 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
MYRETH-3 MYRISTATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
MYRISTAMINE OXIDE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
MYRISTIC ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
MYRISTYL ALCOHOL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

79
37
35
56
56
53
53
61
76
31
34

PEG-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-32. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-40. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-75. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-150. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-240. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-400. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-8 CAPRYLIC/CAPRIC GLYCERIDES. . . . . . . . . . . . . . . . .
PEG-35 CASTOR OIL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-3 COCAMIDE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-5 COCAMIDE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-11 COCAMIDE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-3 COCAMIDE DEA. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-2 COCAMINE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-3 COCAMINE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-5 COCAMINE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-10 COCAMINE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-15 COCAMINE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-8 DIISOSTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-12 DIISOSTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-8 DILAURATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-75 DILAURATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-8 DIOLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-75 DIOLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-3 DIPALMITATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-8 DISTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-75 DISTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-250 DISTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-7 GLYCERYL COCOATE . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-30 GLYCERYL COCOATE . . . . . . . . . . . . . . . . . . . . . . . .
PEG-78 GLYCERYL COCOATE . . . . . . . . . . . . . . . . . . . . . . . .
PEG-8 GLYCERYL ISOSTEARATE. . . . . . . . . . . . . . . . . . . . . .
PEG-10 GLYCERYL ISOSTEARATE. . . . . . . . . . . . . . . . . . . . .
PEG-15 GLYCERYL ISOSTEARATE. . . . . . . . . . . . . . . . . . . . .
PEG-20 GLYCERYL ISOSTEARATE. . . . . . . . . . . . . . . . . . . . .
PEG-30 GLYCERYL ISOSTEARATE. . . . . . . . . . . . . . . . . . . . .
PEG-60 GLYCERYL ISOSTEARATE. . . . . . . . . . . . . . . . . . . . .
PEG-12 GLYCERYL LAURATE. . . . . . . . . . . . . . . . . . . . . . . . .
PEG-20 GLYCERYL LAURATE. . . . . . . . . . . . . . . . . . . . . . . . .
PEG-30 GLYCERYL LAURATE. . . . . . . . . . . . . . . . . . . . . . . . .
PEG-20 GLYCERYL OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-30 GLYCERYL OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-82 GLYCERYL TALLOWATE. . . . . . . . . . . . . . . . . . . . . .
PEG-10 GLYCERYL TRIISOSTEARATE. . . . . . . . . . . . . . . . . .
PEG-20 GLYCERYL TRIISOSTEARATE. . . . . . . . . . . . . . . . . .
PEG-30 GLYCERYL TRIISOSTEARATE. . . . . . . . . . . . . . . . . .
PEG-20 HYDROGENATED CASTOR OIL . . . . . . . . . . . . . . . . .
PEG-40 HYDROGENATED CASTOR OIL . . . . . . . . . . . . . . . . .
PEG-60 HYDROGENATED CASTOR OIL . . . . . . . . . . . . . . . . .
PEG-100 HYDROGENATED CASTOR OIL . . . . . . . . . . . . . . . .
PEG-50 HYDROGENATED CASTOR OIL SUCCINATE. . . . . . . .
PEG-4 ISOSTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-8 ISOSTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-12 ISOSTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-20 HYDROGENATED CASTOR OIL ISOSTEARATE . . . . . .
PEG-40 HYDROGENATED CASTOR OIL ISOSTEARATE . . . . . .
PEG-58 HYDROGENATED CASTOR OIL ISOSTEARATE . . . . . .
PEG-3 LAURAMIDE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-11 LAURAMIDE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

N
NEOPENTYL GLYCOL DIETHYLHEXANOATE. . . . . . . . . . . . . . 36
O
OCTYLDODECETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
OCTYDODECYL MYRISTATE. . . . . . . . . . . . . . . . . . . . . . . . . . 36
OLEAMIDE DEA. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 42
OLEAMINE OXIDE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 76
OLEIC ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31,80
OLETH-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
OLETH-5. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
OLETH-15. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
OLETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
OLETH-30. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
OLETH-35. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
OLEYL ALCOHOL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 34
OPHIOPOGON JAPONICUS ROOT EXTRACT. . . . . . . . . . . . . . 19
ORTHOSIPHON STAMINEUS EXTRACT. . . . . . . . . . . . . . . . . . 12
P
PALMITIC ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PALM KERNEL AMIDOPROPYL BETAIN . . . . . . . . . . . . . . . . .
PASSIFLORA EDULIS PEEL EXTRACT. . . . . . . . . . . . . . . . . . .
PEG-4. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-6. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-6, PEG-32. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-8. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG-12. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

31
40
16
44
44
44
44
44
88

44
44
44
44
44
44
44
62
70
75
75
75
75
75
75
75
75
75
60
60
60
60
60
60
60
60
60
60
62
62
62
63
63
63
63
63
63
62
62
62
62
62
62
63
63
63
67
67
67
67
69
58
58
58
68
68
68
75
75

INCI CODE INDEX

Base materials
Premix products
Index

89

55
55
55
55
54
54
54
54
54
54
54
54
59
55
55
55
55
55
55
54
55
55
55
55
55
50
50
48
48
48
48
48
48
54
54
54
54
55
55
55
56
56
54
59
59
50
49
49
51
51
55
55
54
54
59
11

Functional ingredients

PPG-10-BUTETH-9. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-17-BUTETH-17. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-30-BUTETH-30. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-38-BUTETH-37. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-4 BUTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-12 BUTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-17 BUTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-20 BUTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-24 BUTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-33 BUTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-40 BUTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-52 BUTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-6 CASTORATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-4-CETETH-5. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-4-CETETH-10. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-4-CETETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-8-CETETH-5. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-8-CETETH-10. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-8-CETETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-10 CETYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-6-DECYLTETRADECETH-12. . . . . . . . . . . . . . . . . . . . . .
PPG-6-DECYLTETRADECETH-20. . . . . . . . . . . . . . . . . . . . . .
PPG-6-DECYLTETRADECETH-30. . . . . . . . . . . . . . . . . . . . . .
PPG-13-DECYLTETRADECETH-24. . . . . . . . . . . . . . . . . . . . .
PPG-20-DECYLTETRADECETH-10. . . . . . . . . . . . . . . . . . . . .
PPG-9 DIGLYCERYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-14 DIGLYCERYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . .
PPG-24-GLYCERETH-24. . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-8 GLYCERYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-10 GLYCERYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-16 GLYCERYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-50 GLYCERYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-70 GLYCERYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-2 LANOLIN ALCOHOL ETHER. . . . . . . . . . . . . . . . . . . . .
PPG-5 LANOLIN ALCOHOL ETHER. . . . . . . . . . . . . . . . . . . . .
PPG-10 LANOLIN ALCOHOL ETHER. . . . . . . . . . . . . . . . . . . .
PPG-20 LANOLIN ALCOHOL ETHER. . . . . . . . . . . . . . . . . . . .
PPG-5 LAURETH -5. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-5-LAURETH-6. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-25-LAURETH-25. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-10 METHYL GLUCOSE. . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-20 METHYL GLUCOSE. . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-3 MYRISTYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-26 OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-36 OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-65-PEG-5 PENTAERYTHRITYL ETHER . . . . . . . . . . . . . .
PPG-25-PEG-25 TRIMETHYLOL PROPANE. . . . . . . . . . . . . . .
PPG-68-PEG-10 TRIMETHYLOLPROPANE . . . . . . . . . . . . . . .
PPG-25 SORBITOL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-33 SORBITOL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-34-STEARETH-3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-23-STEARETH-34. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-11 STEARYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . .
PPG-15 STEARYL ETHER. . . . . . . . . . . . . . . . . . . . . . . . . . . .
PROPYLENE GLYCOL LAURATE. . . . . . . . . . . . . . . . . . . . . . .
PRUNUS ARMENIACA(APRICOT) JUICE. . . . . . . . . . . . . . . . . .

PEG-2 LAURATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-4 LAURATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-8 LAURATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-120 METHYLGLUCOSE TRIISOSTEARATE. . . . . . . . . . . . 74
PEG-8 MYRISTATE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-20 MYRISTATE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-5 OLEAMINE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75
PEG-4 OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-8 OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-12 OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG/PPG-200/70 COPOLYMER. . . . . . . . . . . . . . . . . . . . . . . 46
PEG/PPG-240/60 COPOLYMER. . . . . . . . . . . . . . . . . . . . . . . 46
PEG/PPG/POYLNUTYLENE GLYCOL-8/5/3 GLYCERIN. . . . . . . 49
PEG-20 SORBITAN ISOSTEARATE. . . . . . . . . . . . . . . . . . . . . 65
PEG-10 SORBITAN LAURATE. . . . . . . . . . . . . . . . . . . . . . . . . 65
PEG-80 SORBITAN LAURATE. . . . . . . . . . . . . . . . . . . . . . . . . 65
PEG-6 SORBITAN OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . 65
PEG-6 SORBITAN STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . 65
PEG-2 STEARAMINE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75
PEG-2 STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-9 STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-32 STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-75 STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
PEG-4 TRIMETHYLOLPROPANE DISTEARATE. . . . . . . . . . . . . 64
PENTAERYTHRITYL TETRAOCTANOATE. . . . . . . . . . . . . . . . . 36
POLOXAMER 105. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46
POLOXAMER 124. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46
POLOXAMER 182. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46
POLOXAMER 184. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46
POLOXAMER 185. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46
POLOXAMER 188. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46
POLOXAMER 215. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46
POLOXAMER 333. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 46
POLY(1,2-BUTANEDIOL)-6PROPYLENEGLYCOL. . . . . . . . . . . 45
POLY(1,4-BUTANEDIOL)-9 DIPALMITATE. . . . . . . . . . . . . . . . 61
POLYPHOSPHORYLCHOLINE GLYCOL ACRYLATE. . . . . . . . . . . 4
POLYBUTYLENEGLYCOL/PPG-9/1COPOLYMER . . . . . . . . . . . 45
POLYGLYCERYL-6 LAURATE. . . . . . . . . . . . . . . . . . . . . . . . . 41
POLYSORBATE 20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65
POLYSORBATE 40. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65
POLYSORBATE 60. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65
POLYSORBATE 65. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 66
POLYSORBATE 80. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65
POLYSORBATE 85. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 66
POLYQUATERNIUM-51 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4
POLYQUATERNIUM-61 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6
POLYQUATERNIUM-64 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5
POLYQUATERNIUM-65 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5
POLYQUATERNIUM-92 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8
POLYQUATERNIUM-107 . . . . . . . . . . . . . . . . . . . . . . . . . . . . 10
POTASSIUM LAURAT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37
POTASSIUM MYRISTATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . 37
POTASSIUM OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37
POTASSIUM PALMITATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . 37
PPG-12. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 44
PPG-17. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 44
PPG-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 44
PPG-34. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 44
PPG-2 ARGININE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 77

INDEX
INCI CODE INDEX

S
SEKKEN SOJI-K. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SODIUM COCOAMPHO ACETATE. . . . . . . . . . . . . . . . . . . . . .
SODIUM COCOYL ISETHIONATE. . . . . . . . . . . . . . . . . . . . . . .
SODIUM LAUROYL SARCOSINATE. . . . . . . . . . . . . . . . . . . . .
SODIUM LAURATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SODIUM LAURETH SULFATE. . . . . . . . . . . . . . . . . . . . . . . . .
SODIUM LAUROYL METHYLAMINOPROPIONATE . . . . . . . . . .
SODIUM LAURYL DIETHYLENEDIAMINOGLYCIN. . . . . . . . . . .
SODIUM MA/DIISOBUTYLENE COPOLYMER. . . . . . . . . . . . . .
SODIUM METHYL CAPROYL TAURATE. . . . . . . . . . . . . . . . . .
SODIUM METHYL COCOYL TAURATE. . . . . . . . . . . . . . . . . . .
SODIUM OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SODIUM PEG-4 COCAMIDE SULFATE. . . . . . . . . . . . . . . . . . .
SODIUM STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SODIUM TALLOWATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SORBETH-3 ISOSTEARATE. . . . . . . . . . . . . . . . . . . . . . . . . .
SORBETH-40 PENTAOLEATE. . . . . . . . . . . . . . . . . . . . . . . . .
SORBETH-30 TETRAISOSTEARATE. . . . . . . . . . . . . . . . . . . .
SORBETH-6 TETRAOLEATE. . . . . . . . . . . . . . . . . . . . . . . . . .
SORBETH-30 TETRAOLEATE. . . . . . . . . . . . . . . . . . . . . . . . .
SORBETH-40 TETRAOLEATE. . . . . . . . . . . . . . . . . . . . . . . . .
SORBETH-60 TETRAOLEATE. . . . . . . . . . . . . . . . . . . . . . . . .
SORBITAN LAURATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SORBITAN OLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SORBITAN PALMITATE . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SORBITAN SESQUIOLEATE . . . . . . . . . . . . . . . . . . . . . . . . . .
SORBITAN STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SORBITAN TRIOLEATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARAMINE OXIDE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARIC ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARETH-2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARETH-7. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARETH-15. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARETH-4 STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARETH-9 STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARTRIMONIUM CHLORIDE. . . . . . . . . . . . . . . . . . . . . . . .
STEARYL ALCOHOL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARYL STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

37
40
37
37
37
37
37
40
37
38
37
37
37
37
37
73
73
72
71
71
71
71
41
41
41
41
41
41
76
31
52
52
52
52
61
61
39
34
36

T
TEA-LAURETH SULFATE. . . . . . . . . . . . . . . . . . . . . . . . . . . .
TEA-LAUROYL METHYLAMINOPROPIONATE. . . . . . . . . . . . .
TEA-LAURYL SULFATE . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
TRICAPRYLIN . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
TRIDECETH-3. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
TRIDECETH-6. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
TRIDECETH-8. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
TRIDECETH-12. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
TRIDECETH-20. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
TRIETHYLHEXANOIN. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
TRISTEARIC ACID PEG-160 SORBITAN . . . . . . . . . . . . . . . . .

37
37
37
32
53
53
53
53
53
32
66

Z
ZINC LAURATE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
ZINC MYRISTATE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
ZINC STEARATE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35

V
VERBENA OFFICINALIS EXTRACT. . . . . . . . . . . . . . . . . . . . . . 25

90

TRADE NAME INDEX

E
ECKLEXT BG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 24
EUCALYPTUS EXTRACT ET . . . . . . . . . . . . . . . . . . . . . . . . . . 20
EXTRA LINOLEIC 90. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
EXTRA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 30
EXTRA OLEIN . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
EXTRA OS- 85. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
EXTRASOME. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 82,83

14
10
35
35
40
40
40
40
40
40
40
40
40
11
35

F
FIRET L. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37
FOOD ADDITIVE GLYCERIN . . . . . . . . . . . . . . . . . . . . . . . . . . 33

H
HYDROXYSTEARIC ACID . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
I
IPM-R. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
IPP-R . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
J
JP Benzalkonium . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
JP Concentrated Benzalkonium Chloride Solution 50 . . . . . .
JP CALCIUM STEARATE . . . . . . . . . . . . . . . . . . . . . . . . . . . .
JP CONCENTRATED GLYCERIN. . . . . . . . . . . . . . . . . . . . . . .
JP GLYCERIN . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
JP MAGNESIUM STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . .
JP STEARIC ACID . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
JPE EXTRA OS-85. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
JPE BEHENIC ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
JPE IPM-R . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
JPE PANACET. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

38
38
35
33
33
35
30
30
30
36
32

Premix products

C
CALCIUM STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
CALCIUM STEARATE SHOKUBUTSU. . . . . . . . . . . . . . . . . . . . 35
CAMELLIA FLOWER EXTRACT BG . . . . . . . . . . . . . . . . . . . . . 17
CAMELLIA LEAF EXTRACT BG. . . . . . . . . . . . . . . . . . . . . . . . 21
CAMELLIA SEED EXTRACT BG . . . . . . . . . . . . . . . . . . . . . . . 18
CASTER WAX A. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 32
CATION. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 38
CATION 2ABT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39
CATION AB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39
CATION BB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39
CATION EQ-01D. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39
CATION F2 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39
CATION M2. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39
CATION PB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39
CATION VB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39
CERACUTE-F,L,V. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 7
CERACUTE-G . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 8
CETOMACROGOL 1000. . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
CETYL MYRISTATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
CLEARBRIGHT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 80
CHINPI EXTRACT K65B . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 13
COATSOME. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 28
COCONUT ACID. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
COMUPOAL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 59
CyPA-ET. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23
CyPA-PW . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23

Base materials

G
GLYCERIN. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33

B
BAKUMONDOU EXTRACT BG . . . . . . . . . . . . . . . . . . . . . . . . 19
BUTYL STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36

K
KUMIS KUCHING EXTRACT BG . . . . . . . . . . . . . . . . . . . . . . . 12
L
LAUROMACROGOL NONION L-209 . . . . . . . . . . . . . . . . . . . . 52
LINOLEIC ACID 90. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 31
LIPIDURE-HM, PMB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 4
LIPIDURE-A, C. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 5
LIPIDURE-S, NR, NA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 6

37
38
39
86

M
MACADAMIA NUT OIL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 79
MACBIOBRIDE MG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 56,74
MACROGOL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 43
MAGNESIUM STEARATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
91

Index

D
DIAPON CI. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
DIAPON K, LM. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
DIAPON HF. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
DISFOAM . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

Functional ingredients

A
AKEBIA EXTRACT BG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ALFEEL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ALUMINUM STEARATE 600. . . . . . . . . . . . . . . . . . . . . . . . . .
ALUMINUM STEARATE 600 SHOKUBUTSU. . . . . . . . . . . . . . .
ANON BDB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ANON BDC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ANON BDL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ANON BDF . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ANON BF . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ANON BL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ANON GLM. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ANON LA. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
ANON LG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
APRICOT JUICE PH . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
AULABRITE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

INDEX
TRADE NAME INDEX

PERSOFT . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37
PHARMASOL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 32
PLONON . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 45,46
POLYPROPYLENE GLYCOL 2000 . . . . . . . . . . . . . . . . . . . . . . 44
POLYSTER . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37
POLYSORBATE. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65
POWDERBASE L. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
POWDERBASE M. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
PRIMESOME MB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 83

MAGNESIUM STEARATE-S . . . . . . . . . . . . . . . . . . . . . . . . . . 35
MONOGLY . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41

N
NAA . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 30,31,34
NOFABLE AO. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 34
NOFABLE DO . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
NOFABLE EO. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
NOFABLE GO . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
NOFABLE SO. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
NONION A. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 55
NONION B. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
NONION CP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
NONION DIS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 60
NONION DL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 60
NONION DO . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 60
NONION DP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 60
NONION DS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 60
NONION E. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
NONION IS . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53,58
NONION IST . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65
NONION K. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
NONION L. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
NONION LP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
NONION LT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65
NONION NC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
NONION M . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
NONION MM. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
NONION O. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 58
NONION OD . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
NONION OP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
NONION OT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65,66
NONION P. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52
NONION PP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
NONION PT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65
NONION S. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 52,58
NONION SP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 41
NONION ST. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65,66
NONION T. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 53
NONSOUL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 37
NYMEEN F . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75
NYMEEN O. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75
NYMEEN S . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75
NYMID DF. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75
NYMID F. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75
NYMID MF . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75
NYMID ML . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 75

R
RG CO . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 33
S
SHEKWASHA EXTRACT BG . . . . . . . . . . . . . . . . . . . . . . . . . .
SOFTILT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STAFOAM DF . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STAFOAM DL . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STAFOAM DO. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STAFOAM F . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STAFOAM LIPA. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STAFOAM MF. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
STEARIC ACID SAKURA. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
SUNAMID . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

T
TERTIARY AMINE AB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 42
TURMERIC EXTRACT BG. . . . . . . . . . . . . . . . . . . . . . . . . . . . 22
U
UNIGLY G-2 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNIGLY GL-106. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNIGLY MC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNIGLY MK. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNIGLY ML. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNIGLY MO. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNIGLY MT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 5TP-300KB . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 10MS-250KB. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 20MT-2000B. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 43TT, 10TT . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 50MB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 50MT-2200B. . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 50TG-32 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 70DP-950B . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE 75DE-2620R . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE DGP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE CF . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE MB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE MLA. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE MP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE MS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE MT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNILUBE O. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
UNIOL D. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

O
OCTYLDODECYL MYRISTATE. . . . . . . . . . . . . . . . . . . . . . . . . 36
P
PANACET . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PASSION FRUIT EXTRACT BG . . . . . . . . . . . . . . . . . . . . . . . .
PARLEAM . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
PEG . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

15
37
42
42
42
42
42
42
31
37

32
16
78
44
92

47
41
62
62
62
62
62
50
55
55
49
55
55
48
46
46
50
59
54
53
53
53
55
59
44

TRADE NAME INDEX

Functional ingredients
Base materials

UNIOL HS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 51
UNIOL PB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 45
UNIOL SGP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 48
UNIOL TG. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 48
UNIOX C-35 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 70
UNIOX CS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54
UNIOX G-1200 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 47
UNIOX GM. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 63
UNIOX GT. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 63
UNIOX HC. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 67,68,69
UNIOX SP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 73
UNIOX ST. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 71,72,73
UNIOX TD-4S . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 64
UNIOX USP. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 61
UNIOX USS. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 61
UNISAFE 34S-23. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 55
UNISAFE 5P, 10P, 20P . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 55
UNISAFE A . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 76
UNISAFE MM . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 54
UNISAFE PGML. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 59
UNISAFE UMM-103. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 61
UNISTER D. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
UNISTER E . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
UNISTER H. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
UNISTER M. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
UNISTER MB. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 36
V
VERBENA OFFICINALIS EXTRACT BG. . . . . . . . . . . . . . . . . . . 25
VINOVEIL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 9

Premix products

W
WILBRIDE CP-9. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
WILBRIDE R-PL. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
WILBRIDE RC . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
WILBRIDE S-753. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
WILBRIDE S-753D. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
WILSURF EX. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
WILSURF PX-50 . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
WILSURF TF. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

61
77
51
49
49
85
85
65

Y
YOUKOU SAKURA FLOWER EXTRACT BG. . . . . . . . . . . . . . . . 26
YOUKOU SAKURA LEAF EXTRACT BG. . . . . . . . . . . . . . . . . . . 27

Index

Z
ZINC STEARATE . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
ZINC STEARATE S. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 35
ZINC STEARATE SHOKUBUTSU. . . . . . . . . . . . . . . . . . . . . . . 35

93

ADDRESS
INQUIRY ADDRESS

NOF CORPORATION

http://www.nof.co.jp

Oleo & Speciality Chemicals Division

E-mail: yukagizyutu@nof.co.jp

Head Office

Yebisu Garden Place Tower, 20-3, Ebisu 4-chome, Shibuya-ku, Tokyo 150-6019, Japan
TEL.+81-3-5424-6700 (Internal directory inquiries) FAX.+81-3-5424-6810

Osaka Office

Shin-Fujita Bldg., 4-27, Dojima 2-chome, Kita-ku, Osaka 530-0003, Japan


TEL.+81-6-6454-6554 (Internal directory inquiries) FAX.+81-6-6454-6570

Nagoya Office

Nagoya Mitsui Main Bldg., 24-30, Meiekiminami 1-chome, Nakamura-ku, Nagoya, Aichi Pref. 450-0003, Japan
TEL.+81-52-551-6161 FAX.+81-52-551-2310

Fukuoka Office

Tenjin Saiwai Bldg., 2-20, Tenjin 4-chome, Chuo-ku, Fukuoka, Fukuoka Pref. 810-0001, Japan
TEL.+81-92-741-3111 FAX.+81-92-781-7070

Registered trademarks:
The products names are trademarks or registered trademarks of NOF CORPORATION in Japan and/or other countries.
All other trademarks and registered trademarks are the property of their respective owners. However, and TM are not described.

94

Disclaimers:
The contents of this catalog were made based on documents, information and data which
are available at present. However, NOF CORPORATION does not acknowledge and
undertake any guarantees for any data, evaluation results, chemical hazards etc.
Also, the contents are intended to normal use of the products.
In case of special handling, you should take appropriate measures to ensure the safety.

Issued May 2015.1500(A)