You are on page 1of 35

www.twitter.com/daykemquynhon www.facebook.com/daykem.

quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

PHẦN I. Më ®Çu
I . Lý do chọn đề tài.

N
Ơ
Trong qu¸ tr×nh gi¶ng d¹y ë tr−êng phæ th«ng nhiÖm vô ph¸t triÓn t− duy cho häc

H
N
sinh lµ nhiÖm vô rÊt quan träng, ®ßi hái tiÕn hµnh ®ång bé ë c¸c m«n, trong ®ã Hãa häc

Y
lµ m«n khoa häc thùc nghiÖm ®Ò cËp ®Õn nhiÒu vÊn ®Ò cña khoa häc, sÏ gãp phÇn rÌn

U
luyÖn t− duy cho häc sinh ë mäi gãc ®é ®Æc biÖt lµ qua phÇn bµi tËp hãa häc. Bµi tËp hãa

.Q
häc kh«ng nh÷ng cã t¸c dông rÌn luyÖn kü n¨ng vËn dông, ®µo s©u vµ më réng kiÕn thøc

TP
®> häc mét c¸ch sinh ®éng, phong phó mµ cßn th«ng qua ®ã ®Ó «n tËp, rÌn luyÖn mét sè
kü n¨ng cÇn thiÕt vÒ hãa häc, rÌn luyÖn tÝnh tÝch cùc, tù lùc, trÝ th«ng minh s¸ng t¹o cho

ẠO
häc sinh, gióp häc sinh høng thó trong häc tËp. Qua bµi tËp hãa häc gi¸o viªn kiÓm tra,

Đ
®¸nh gi¸ viÖc n¾m v÷ng kiÕn thøc vµ kü n¨ng hãa häc cña häc sinh.

G
§Ó gi¸o viªn båi d−ìng häc sinh kh¸, giái ë c¸c tr−êng Phæ th«ng THCS dù thi häc

N
Ư
sinh giái cÊp HuyÖn, cÊp TØnh vµ dù thi vµo c¸c tr−êng THPT Chuyªn ®−îc tèt th× nhu

H
cÇu cÊp thiÕt lµ cÇn cã mét hÖ th«ng c©u hái vµ bµi tËp Hãa häc cho tÊt c¶ c¸c chuyªn ®Ò

ẦN
nh− :CÊu t¹o nguyªn tö, Nguyªn tè hãa häc, §¹i c−¬ng hãa h÷u c¬, C¸c hîp chÊt cã
nhãm chøc....
TR
So víi nhiÒu m«n häc kh¸c nh− m«n To¸n häc hay m«n VËt lý, m«n Hãa häc t−¬ng
B
®èi ®¬n gi¶n. Tuy nhiªn møc ®é kiÕn thøc trong c¸c ®Ò thi Häc sinh giái m«n Hãa häc
00

cÊp HuyÖn, cÊp TØnh, ®Ò thi tuyÓn sinh vµo c¸c tr−êng THPT Chuyªn… l¹i cao h¬n nhiÒu
10

so víi kiÕn thøc mµ häc sinh ®−îc häc theo s¸ch Gi¸o khoa cña Bé Gi¸o Dôc vµ §µo T¹o
3

ban hµnh, dÉn ®Õn viÖc båi d−ìng HSG m«n Hãa häc ë cÊp THCS kh«ng hÒ dÔ dµng ®èi
2+

víi c¸c gi¸o viªn. Mét trong nh÷ng khã kh¨n nhiÒu gi¸o viªn gÆp ph¶i ®ã lµ nguån bµi tËp
ẤP

hãa häc theo tõng chuyªn ®Ò dïng ®Ó luyÖn cho häc sinh.
V× vËy , trong chuyªn ®Ò nµy t«i ®> s−u tÇm, tËp hîp ph©n d¹ng l¹i mét sè c©u hái
C

vµ bµi tËp vÒ este ë møc ®é vËn dông cao, nh»m gãp mét phÇn nµo ®ã cho nguån bµi tËp
A
Ó

rÌn HSG cÊp THCS cña gi¸o viªn THCS thªm phÇn phong phó.
H

II. Mục đích nghiên cứu
Í-

* Cung cấp cho học kiến thức cơ bản, kiến thức nâng cao trọng tâm về este.
-L

* Rèn luyện cho học sinh khả năng tự nghiên cứu và sáng tạo trên cơ sở kiến thức
ÁN

đã được học.
TO

* Phân loại, sắp xếp và đánh giá các bài tập trọng tâm về este có trong các đề thi
học sinh giỏi các cấp, đề thi tuyển sinh vào lớp chuyên Hóa ở các trường THPT Chuyên.
G
N

III. Đối tượng và phạm vi nghiên cứu

*Cơ sở lý thuyết về este.
Ư
ID

* Hệ thống các bài tập nâng cao dành cho học sinh giỏi tỉnh.
BỒ

IV. Nhiệm vụ nghiên cứu.
* Nghiên cứu và ứng dụng lý thuyết về este.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

* Soạn và giải các bài tập thi học sinh giỏi tỉnh, đề thi đại học,đề thi tuyển sinh vào
các lớp chuyên.
* Thực nghiệm đánh giá việc giảng dạy về este trong việc giải các bài tập về este.

N
Ơ
H
V.Phương pháp nghiên cứu

N
Y
1.Nghiên cứu lý thuyết : Nghiên cứu sách giáo khoa, các tài liệu thuộc hóa học hữu

U
cơ, các đề thi học sinh giỏi tỉnh, các đề thi học tuyển sinh đại học, các đề thi học sinh giỏi

.Q
các cấp với cơ sở lý thuyết về este làm chủ đạo.

TP
2. Tổng kết kinh nghiệm giải quyết các bài tập hóa học.

ẠO
3. Trao đổi, học hỏi kiến thức và kinh nghiệm từ đồng nghiệp.

Đ
4. Trò chuyện và khơi gợi niềm đam mê học môn hóa của các em học sinh trong

G
quá trình học tập.

N
Ư
H
VI. Giả thuyết khoa học.

ẦN
Nếu học sinh nắm vững lý thuyết este và giải tốt các bài tập về este thì các học sinh
TR
sẽ có một nền tảng kiến thức vững chắc để khám phá và trau dồi những kiến thức mới,
tạo điều kiện thuận lợi cho quá trình học tập và rèn luyện để có thể chinh phục những
B
00

đỉnh cao về tri thức.
10
3
2+
ẤP
C
A
Ó
H
Í-
-L
ÁN
TO
G
N

Ư
ID
BỒ

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

PHẦN II. NỘI DUNG

N
Chương I: LÝ THUYẾT TRỌNG TÂM VỀ ESTE

Ơ
H
I.Khái niệm và danh pháp

N
1.Khái niệm:

Y
H2SO4 ®Æc,to

U
C2H5OH + CH3COOH CH3COOC2H5 + H2O

.Q
etyl axetat

TP
H 2SO 4 ñaëc , t0
Tổng quát: RCOOH + R'OH RCOOR' + H 2O

ẠO
Đ
Khi thay thế nhóm OH ở nhóm cacboxyl của axit cacboxylic bằng nhóm OR’ thì được

G
este.

N
 CT chung của este no đơn chức:

Ư
Este được tạo bởi axit cacboxylic no, đơn chức mạch hở và ancol no, đơn chức, mạch hở

H
(este no, đơn chức, mạch hở): CmH2m+1COOCm’H2m’+1 hay CnH2nO2 (m ≥ 0; m’ ≥ 1; n ≥

ẦN
2 ).
TR
Công thức chung của Este đa chức được tạo bởi axit cacboxylic đa chức
R(COOH)nvà ancol đơn chức R’OH: R(COOR’)n
B
00

Công Thức chung của Este đa chức được tạo bởi axit cacboxylic đơn chức
10

RCOOH và ancol đa chức R’(OH)m : (RCOO)mR’
 Công Thức chung của Este đa chức được tạo bởi axit cacboxylic đa R(COOH)n
3
2+

chức và ancol đa chức R’(OH)m : R(COO)n.mR’(n, m có thể bằng nhau)
 Tóm lại, có thể đặt CTTQ của este : CxHyOz (x, z ≥ 2; y là số chẵn, y ≤ 2x)
ẤP
C

2.Danh pháp: Tên este = Tên gốc hiđrocacbon của ancol + tên gốc axit (đuôi “at”).
A
Ó
H

Thí dụ:
Í-

CH3COOCH2CH2CH3propyl axetat HCOOCH3 metyl fomat
-L

CH3-COO-C2H5 etylaxetat H-COO-CH3
ÁN

metylfomat
CH2=C(CH3)-COO-CH3 metylmetacrylat CH3-COO-CH=CH2 vinylaxetat
TO

C6H5COO-CH3 metylbenzoat
G
N

II. Tính chất hóa học

1.Phản ứng ở nhóm chức
Ư

a. Thuỷ phân trong môi trường axit
ID

H+
BỒ

CH3COOC2H5 + H2O CH3COOH + C2H5OH
to

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

* Đặc điểm của phản ứng: Thuận nghịch và xảy ra chậm, vì axit và rượu có thể phản ứng
tạo lại este.
b.Thuỷ phân trong môi trường bazơ (Phản ứng xà phòng hoá)

N
to

Ơ
CH3COOC2H5 + NaOH CH3COONa + C2H5OH

H
N
* Đặc điểm của phản ứng: Phản ứng chỉ xảy ra 1 chiều, vì không còn axit để phản ứng

Y
tạo lại este.

U
.Q
* Lưu ý: Một số este có phản ứng thuỷ phân đặc biệt hơn:

TP
− Từ este chứa gốc rượu không no tạo ra andehit, xeton.

ẠO
0
Vd: CH3COOCH=CH2 + NaOH → t C
CH3COONa+ CH3CHO

Đ
0
CH3COOC(CH3)=CH2 + NaOH → t C
CH3COONa+ CH3-CO-CH3

G
− Từ este chứa gốc phenol tạo ra 2 muối.

N
0
Vd: CH3COOC6H5 + 2NaOH → t C
CH3COONa + C6H5ONa + H2O

Ư
2.Phản ứng của gốc hiđrocacbon của este

H
ẦN
a.Phản ứngcộng (với H2, X2, HX),
VD: CH3[CH2]7 CH=CH-[CH2]7 COOCH3 + H2 Ni → CH3[CH2]16COOCH3
o
/t

b. Phản ứng trùng hợp: TR
B
o
VD: nCH2=C(CH3)-COOCH3 t,P ,XT
→ ( -CH2-C(CH3) - COOCH3 ) n
00

3.Este của axit fomic có phản ứng tráng gương, phản ứng khử Cu(OH)2.
10

o
VD: H-COO-R + 2AgNO3 + 2NH3 + H2O NH  3/t
→ HO-COO-R +2Ag↓ + 2NH4NO3
3
2+

0
H-COO-R + 2Cu(OH)2 + NaOH → t C
Cu2O↓ + NaO-CO-OR + 3H2O
III. Điều chế
ẤP

1. Phương pháp chung: Bằng phản ứng este hoá giữa axit cacboxylic và ancol.
C

H2SO4 ñaëc, t0
A

RCOOH + R'OH RCOOR' + H2O
Ó

2.Phương pháp riêng:
H
Í-

Điều chế este của anol không bền bằng phản ứng giữa axit cacboxylic và ancol tương
-L

ứng.
t0, xt
ÁN

CH3COOH + CH CH CH3COOCH=CH2
3.Este của axit và phenol
TO

0
C6H5-OH + (CH3CO)2O →
t C
CH3COOC6H5 + CH3COOH
G
N

Anhiđrit axetic Phenylaxetat

Ư
ID
BỒ

Chương II. BÀI TẬP CÓ HƯỚNG DẪN GIẢI

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

I.BÀI TẬP LÝ THUYẾT
1. Bài tập vận dụng mức độ thấp
Câu 1.Viết CTCT các đồng phân este có cùng CTPT C4H6O2; C4H6O4.

N
Bài giải:

Ơ
H
- C4H6O2 có dạng CnH2n-2O2 => este đơn chức không no có 1 nối đôi trong phân

N
tử

Y
CTCT các đồng phân: CH2=CH-COOCH3 (1) CH3COOCH=CH2 (2)

U
.Q
HCOOCH=CH-CH3 (3)
HCOOCH2-CH=CH2 (4) HCOOCH(CH3)=CH2 (5)

TP
- C4H6O4 có dạng CnH2n-4O2 => este 2 chức no

ẠO
CTCT các đồng phân: CH3COO-COOCH3 (1) HCOOCH2-CH2OOCH (2)

Đ
G
Câu 2.Viết các phương trình phản ứng hoàn thành các phản ứng sau:

N
0 0
1. CH3COOC2H5+ NaOH → t C
2. (CH3COO)2C2H4 + NaOH → t C

Ư
H
0 0
3. CH3OOC-COOCH3+ NaOH → t C
4. R(COO)m.nR’+ NaOH → t C

ẦN
0 0
5. CH3COOCH=CH-CH3 + NaOH → t C
6. HCOOC(CH3)=CH2+ NaOH → t C

TR
O

0 0
8. C6H5OOC-CH3 + NaOH →
t C
9. C
O + NaOH →
t C
B
00

Bài giải:
10

1. CH3COOC2H5+ NaOH →
0
t C
CH3COOH + C2H5OH
3

2. (CH3COO)2C2H4 + 2NaOH → 2 CH3COONa + C2H4(OH)2
0
t C
2+

3. CH3OOC-COOCH3 + 2NaOH →
0
t C
2CH3OH + (COONa)2
ẤP

4. R(COO)m.nR’+ m.nNaOH → m R(COONa)n + nR’(OH)m
0
t C
C

5. CH3COOCH=CH-CH3 + NaOH →
0
t C
CH3COONa + CH3-CH2-CHO
A

6. HCOOC(CH3)=CH2 + NaOH → HCOONa + CH3CO-CH3
0
Ó

t C
H

8. C6H5OOC-CH3 + 2NaOH →
0
t C
C6H5ONa + CH3COONa + H2O
Í-

O
-L

9.
0
C
O + NaOH →
t C
HO-CH2-CH2-CH2-CH2-CH2-COONa + H2O
ÁN

2. Bài tập vận dụng mức độ cao
TO

Câu 1:Hai este A, B là dẫn xuất của benzene có cùng CTPT là C9H8O2. A, B đều cộng
G
N

hợp với H2theo tỉ lệ mol 1:1. A tác dụng với xút cho 1 muối và 1 anđehit, B tác dụng

với xút dư cho 2 muối và nước. Các muối có phân tử khối lớn hơn phân tử khối của
Ư

natri axetat. Xác định CTCT của A, B và viết các phương trình phản ứng.
ID

Bài giải:
BỒ

- A, B đều tác dụng với H2 theo tỉ lệ mol 1 : 1 => A, B có một liên kết đôi C=C
mạch ngoài.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

- A tác dụng với xút cho 1 muối và 1 anđehit, muối có phân tử khối lớn hơn phân
tử khối của natri axetat => A có CTCT là: C6H5COOCH=CH2.
0
C6H5COOCH=CH2+ NaOH → t C
C6H5COONa + CH3CHO

N
Ơ
H
- B tác dụng với xút dư cho 2 muối và nước, muối có phân tử khối lớn hơn phân tử

N
khối của natri axetat nên B phải là este của phenol với axit không no, B có CTCT là:

Y
CH2=CH-COOC6H5.

U
.Q
TP
0
CH2=CH-COOC6H5 + 2NaOH → t C
CH2=CH-COONa + C6H5Ona +
H2O

ẠO
Câu 2.Hoàn thành các phản ứng theo sơ đồ sau (dưới dạng công thức cấu tạo).

Đ
1. C3H4O2 + NaOH → (A) + (B)

G
2. (A) + H2SO4 (loãng) → (C) + (D)

N
Ư
3. € + AgNO3 + NH3 + H2O →€ + Ag ↓ + NH4NO3

H
4. (B) + AgNO3 + NH3 + H2O → (F) + Ag ↓ + NH4NO3

ẦN
Bài giải:
-B, C tham gia phản ứng tráng bạc nên B,C phải có nhóm –CHO trong phân tử.
TR
-(A) + H2SO4 (loãng) → (C) => C phải là axit fomic, A phải là muối của axit
B
fomic (HCOONa) và B là anđehit axetic (CH3-CHO); € là (NH4)2CO3; (F) là
00

CH3COONH4
10

=> CTCT của C3H4O2 là HCOOCH=CH2.
3
2+

Phương trình phản ứng:
ẤP

1. HCOOCH=CH2 + NaOH →HCOONa + CH3CHO
C

2. 2HCOONa + H2SO4 (loãng) →2HCOOH + Na2SO4
A

3.HCOOH + 2AgNO3 + 2NH3 + H2O → (NH4)2CO3+ 2Ag ↓ + 2NH4NO3
Ó
H

4. CH3CHO + 2AgNO3 + 3NH3 + H2O → CH3COONH4 + 2Ag ↓ + 2NH4NO3
Í-

Câu 3.
-L

a)Từ xenlulozơ và các chất vô cơ cần thiết viết phương trình phản ứng điều chế
ÁN

(ghi rõ điều kiện nếu có)Etyl axetat
b)Từ khí thiên nhiên và các chất vô cơ cần thiết viết phương trình phản ứng
TO

điều chế poli vinyl axetat.
Bài giải
G
N

a) Điều chế Etyl axetat

0
(C6H10O5)n + nH2O → t C
nC6H12O6
Ư
ID

0
C6H12O6 → 2C2H5OH + 2CO2
t C

C2H5OH + O2  → CH3COOH + H2O
BỒ

mengiam

→ CH3COO C2H5
0
CH3COOH + C2H5OH  H SO ,t C
2 4
+ H2O
b) Điều chế vinyl axetat

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

0
2CH4 
1500 C , lamlanhnhanh
→ C2H2 + 3H2
2+
C2H2 + H2O  Hg
→ CH3CHO
0
2CH3CHO + O2 → 2CH3COOH

N
t C

Ơ
CH3COOCH=CH2
0
CH3COOH + CH≡CH → t C

H
N
Y
U
II. BÀI TẬP TỰ LUẬN

.Q
Dạng 01:Bài toán về phản ứng thuỷ phân este

TP
1.Thuỷ phân một este đơn chức
1.a. Phương pháp giải

ẠO
- Trong môi trường axit: Phản ứng xảy ra thuận nghịch

Đ
H+, to
RCOOR’ + HOH RCOOH + R’OH

G
- Trong môi trường kiềm (phản ứng xà phòng hoá): Phản ứng một chiều, cần đun nóng

N
Ư
0
RCOOR’ + NaOH → t
RCOOH + R’OH

H
 Một số nhận xét :

ẦN
+ Nếu nNaOH phản ứng = nEste⇒Este đơn chức.
TR
+ Nếu RCOOR’ (este đơn chức), trong đó R’ là C6H5- hoặc vòng benzen có nhóm
thế
B
00

⇒nNaOH phản ứng = 2neste và sản phẩm cho 2 muối, trong đó có phenolat:
10

VD: RCOOC6H5 + 2NaOH → RCOONa + C6H5ONa + H2O
+ Nếu phản ứng thuỷ phân este cho 1 anđehit (hoặc xeton), ta coi như ancol (đồng
3
2+

phân với andehit) có nhóm –OH gắn trực tiếp vào liên kết C=C vẫn tồn tai để giải và từ
đó ⇒ CTCT của este.
ẤP

+ Nếu sau khi thủy phân thu được muối (hoặc khi cô cạn thu được chất rắn khan) mà
C

mmuối = meste + mNaOH thì este phải có cấu tạo mạch vòng (lacton):
A
Ó

O
H

C=O + NaOH HO-CH2CH2CH2COONa
Í-

1.b.Một số bài tập minh họa
-L

Bài 1:Thực hiện phản ứng xà phòng hoá chất hữu cơ X đơn chức với dung dịch
ÁN

NaOH thu được một muối Y và ancol Z. Đốt cháy hoàn toàn 2,07 gam Z cần 3,024 lít
TO

O2 (đktc) thu được lượng CO2 nhiều hơn khối lượng nước là 1,53 gam. Nung Y với vôi
tôi xút thu được khí T có tỉ khối so với không khí bằng 1,03. Xác định CTCT của X ?
G

Bài giải :
N

Theo đề bài: X đơn chức, tác dụng với NaOH sinh ra muối và ancol ⇒ X là este đơn
Ư

chức: RCOOR’.
ID

Áp dụng BTKL: mX + mO = mCO + m H O
BỒ

2 2 2

⇒ 44. nCO + 18. n H O = 2,07 + (3,024/22,4).32 = 6,39 gam
2 2

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Và 44. nCO - 18. n H O = 1,53 gam ⇒ nCO = 0,09 mol ; n H O = 0,135 mol
2 2 2 2

n H 2O > nCO2 → Z là ancol no, đơn chức, mạch hở có công thức: CnH2n+1OH (n

N
≥ 1)

Ơ
n H 2O n + 1 0,135

H
Từ phản ứng đốt cháy Z ⇒ = = ⇒ n = 2.

N
nCO2 n 0,09

Y
Y có dạng: CxHyCOONa → T: CxHy+1⇒ MT = 12x + y + 1 = 1,03.29

U
.Q
x = 2
→ ⇒CTCT của X :C2H5COOC2H5

TP
y = 6
Bài 2:Đun 20,4 gam một chất hữu cơ A đơn chức với 300 ml dung dịch NaOH

ẠO
1 M thu được muối B và hợp chất hữu cơ C. Cho C phản ứng với Na dư thu được 2,24

Đ
lit H2 (đktc). Nung B với NaOH rắn thu được khí D có tỉ khối đối với O2 bằng 0,5. Khi

G
oxi hóa C bằng CuO được chất hữu cơ E không phản ứng với AgNO3/NH3. Xác định

N
Ư
CTCT của A?

H
Bài giải:

ẦN
Chất C tác dụng với Na sinh ra khí H2⇒ C là ancol. Oxi hóa C ra E không phản
ứng với AgNO3
TR
⇒ C không là ancol bậc 1. Các đáp án cho A là este đơn chức. Vậy B là muối của
B
Na.
00

Nung B với NaOH rắn tạo ra D có MD = 32.0,5 = 16. Vậy D là CH4⇒ Gốc R
10

trong D là CH3-.
3

Đặt công thức của A là RCOOR’
2+

CH3COOR’ + NaOH → CH3COONa + R’OH
ẤP

R’OH + Na → R’ONa + H2
C

Ta có: nH = 0,1 mol ⇒ nAncol = 2.0,1 = 0,2 mol
A

2
Ó

nNaOH = 0,3 mol > nAncol⇒ NaOH dư, este phản ứng hết.
H

⇒nEste = nAncol = 0,2 mol ⇒ Meste = 20,4/0,2 = 102
Í-

⇒ R’ = 102 – 59 = 43 ⇒ gốc R’ là C3H7- và ancol bậc 2
-L

⇒CTCT của A: CH3COOCH(CH3)CH3
ÁN

Bài 3:Cho 20 gam este X có tỉ khối hơi so với O2 bằng 3,125, tác dụng với 0,3
TO

mol NaOH. Cô cạn dung dịch sau phản ứng thu được 23,2 gam bã rắn. Xác định
G

CTCT của X
N

Bài giải:

Ư

Đặt công thức este X là RCOOCxHy
ID

Meste = 3,125.32 = 100 ⇒ neste = 20/100 = 0,2 mol ⇒ nNaOH pư = neste = 0,2 mol
BỒ

⇒nNaOH dư = 0,3 – 0,2 = 0,1 mol → mNaOH = 0,1.40 = 4 g

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

⇒mmuối= 23,2 – 4 = 19,2 g ⇒ Mmuối = 19,2/0,2 = 96 ⇒ R = 96 – 67 = 29 ⇒ R là
C2H5-
Lại có: RCOOCxHy + NaOH → RCOONa + CxHy+1O C H O

N
x y +1

Ơ
Áp dụng BTKL: meste + mNaOH (ban đầu) = mbã rắn + m C H ⇒ mC H = 20 + 40.0,3 –

H
x y +1O x y +1O

N
23,2 = 8,8 g

Y
n C H O = nX = 0,2 mol ⇒ M C H O = 8,8/0,2 = 44

U
x y +1 x y +1

.Q
⇒ 12x + y = 27 ⇒ x = 2 ⇒ gốc Hidrocacbon R’: –CH=CH2

TP
y = 3
⇒CTCT của X: C2H5COOCH=CH2

ẠO
Đ
Bài 4:Đun nóng 0,1 mol este no, đơn chức mạch hở X với 30 ml dung dịch 20%

G
(D = 1,2 g/ml) của một hiđroxit kim loại kiềm A. Sau khi kết thúc phản ứng xà phòng

N
hoá, cô cạn dung dịch thì thu được chất rắn Y và 4,6 gam ancol Z, biết rằng Z bị oxi

Ư
H
hoá bởi CuO thành sản phẩm có khả năng phản ứng tráng bạc. Đốt cháy chất rắn Y

ẦN
thì thu được 9,54 gam muối cacbonat, 8,26 gam hỗn hợp CO2 và hơi nước. Xác định
CTCT của X
Giải : TR
B
X là este no, đơn chức, mạch hở : CnH2n+1COOCmH2m+1 ( 0 ≤ n; 1 ≤ m)
00

Ta có: nX = nAOH (pư) = nZ = 0,1 mol ⇒ MZ = 14m + 18 = 4,6 = 46 ⇒ m = 2
10

0,1
Mặt khác:
3
2+

nA = 30.1,2.20 = 2. 9,54 ⇒ MA = 23 → A là Na ⇒ nNaOH (ban đầu) =
100.( M A + 17) 2 M A + 60
ẤP

7,2
= 0,18 mol
C

40
A

C n H 2 n +1 COONa : 0,1 mol Na 2 CO 3
Ó

Y O 2 ,t 0
+ → 
CO 2
H

NaOH d −: 0,18 − 0,1 = 0,08 mol H O
Í-

 2
-L

Vậy: mY + m O (p /−) = m Na CO + m CO + m H O
2 2 3 2 2

(3n + 1)
ÁN

Hay 0,1(14n+68) + 0,08.40 + .0,1.32 = 9,54 + 8,26 ⇒ n = 1
2
TO

⇒CTCT củaX : CH3COOCH3
Bài 7:Thủy phân hoàn toàn 0,1 mol este X trong NaOH dư, thu được 19,8 g hỗn hợp
G
N

gồm 2 muối. Biết X không phản ứng với Brom. Xác định CTPT và CTCT của X.

Lời giải:
Ư
ID

0,1 mol este đơn chức X + 0,3 mol NaOH thu được hỗn hợp 2 muối => X là este 2
BỒ

chức dạng R1-OOC-R-COOR2 hoặc X là este của phenol.
Trường hợp 1: X là este 2 chức R1-OOC-R-COOR2

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Tương tự VD3: tính được R1 + R2 = 64, X k phản ứng với Brom nên R1 và R2 đều
no, k chọn được cặp giá trị thỏa mãn.

N
Trường hợp 2: X là este của phenol => X có dạng: RCOOC6H5

Ơ
RCOOC6H5 + 2NaOH -à RCOONa + C6H5ONa + H2O

H
N
=>M(muối) = 0,1.(R + 67) + 0,1.116 = 19,8

Y
U
=> R = 15: CH3

.Q
TP
=>X là: CH3COOC6H5

ẠO
 CTCT X:CH2=C(COOCH3)-COOCH3

Đ
2. Thuỷ phân este đa chức

G
N
2.a. Phương pháp giải

Ư
H
+Nếu nNaOH phản ứng = α.neste (α> 1 và R’ không phải C6H5- hoặc vòng benzen có

ẦN
nhóm thế) ⇒Este đa chức.
Và: TR
+ R(COOR’)n + nNaOH →R(COONa)n + nR’OH , nancol = n.nmuối
B
00

+ (RCOO)nR’ + nNaOH →nRCOONa + R’(OH)n , nmuối = n.nancol
10

+ R(COO)nR’ + nNaOH →R(COONa)n + R’(OH)n, nancol = nmuối
Sau đógiải tương tự bài toán thủy phân este đơn chức.
3
2+

2.b.Bài tập minh họa
ẤP

Bài 1:Este mạch thẳng A có CTPT C7H12O4 chỉ chứa 1 loại nhóm chức. Để thủy
C

phân 16g A cần vừa đủ 200g dung dịch NaOH 4%, thu được 1 ancol B và 17,8g hỗn
A

hợp 2 muối. Xác định CTCT của A.
Ó
H

Bài giải:
Í-
-L

nNaOH = 0,2 mol
ÁN

nA= 0,1 mol
TO

=> A là este 2 chức
G

- Lại có: A + NaOH => hỗn hợp 2 muối => A có dạng: R1-COO-R-OOCR2
N

R1-COO-R-OOC-R2 + 2NaOH R1COONa + R2COONa + R(OH)2
Ư

0,1 0,1 0,1 0,1
ID
BỒ

M muối = 0,1. ( R1 + R2 + 134) = 17,8 g
=> R1 + R2 = 44

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

R1 = 1: HCOONa thì R2= 43: C3H7COONa
R2=15: CH3COONa thì R2 = 29: C2H5COONa

N
Mặt khác: BTKL =>mR(OH)2 = (16+ 8 -17,8).0,1 = 6,2

Ơ
H
=>R(OH)2 = 62

N
Y
=> R= 28 =>C2H4(OH)2

U
.Q
X k phân nhánh nên có thể có 2 CTCT phù hợp là:

TP
HCOO-CH2-CH2-OOC-CH2-CH2-CH3

ẠO
CH3COOCH2-CH2-OOCCH2CH3

Đ
Bài 2:Chất hữu cơ X có CTPT trùng với CTĐGN. Trong đó thành phần % theo

G
N
khối lượng của C và H lần lượt là 45,45% và 6,06% còn lại là oxi. Khi cho X tác dụng

Ư
với NaOH tạo ra ba sản phẩm hữu cơ. Mặt khác khi cho 9,9 gam X tác dụng với H2O

H
trong môi trường axit H2SO4 thu được 3 sản phẩm hữu cơ trong đó 2 sản phẩm cùng

ẦN
một loại nhóm chức có tổng khối lượng là 5,406 gam và đạt hiệu suất 68%. Xác định
CTPT và viết CTCT của X? TR
Bài giải
B
00

CTTQ của X: CxHyOz
10

Có mC : mH : mO = 45,45 : 6,06 : 48,49 => 12x : y : 16z = 45,45 : 6,06 :
3
2+

48,49
ẤP

 x : y : z = 5 : 8 : 4 . => CTPT X : C5H8O4 số mol X = 9,9/132 =
C

0,075 mol
A

 X + NaOH - 3 sản phẩm hữu cơ.
Ó

 X là este no, hai chức
H

 X + 2HOH - 2 sản phẩm hữu cơ đồng đẳng đơn chức + chất hữu
Í-

cơ 2 chức (X1).
-L
ÁN

Áp dụng BTKL : 9,9.0,68 + 2. 0,075.0,68 = 5,406 + 0,075.0,68. MX1
TO

 M X1= 62 => CTCT của X1 là HO-CH2-CH2-OH
 CTCT của X chỉ có thể là : HCOOCH2-CH2OOC-CH3
G
N

Bài 3: Chất hữu cơ E được tạo bởi 3 loại nguyên tố chỉ chứa 1 loại nhóm chức,

trong đó Hiđro chiếm 6,85%; oxi chiếm 43,84% khối lượng của E, khối lượng mol của
Ư
ID

E nhỏ hơn 250 gam. Lấy 4,38 gam E cho tác dụng với dung dịch NaOH vừa đủ, sản
phẩm gồm ancol và 4,92 gam muối. Tìm CTPT và CTCT của E.
BỒ

(Trích đề thi chuyên Hóa ĐH KHTN Hà Nội năm học 2011-2012)

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Bài giải:
CTTQ của E: CxHyOz
Có mC : mH : mO = 49,31 : 6,85 : 43,84 => 12x : y : 16z = 49,31 : 6,85 :

N
43,84

Ơ
H
 x : y : z = 3 : 5 : 2 . => CTĐG N của X : C3H5O2

N
 CTTN: (C3H5O2)n với ME< 250; n chẵn => n < 3,4 => n = 2

Y
 CTPT của E: C6H10O4

U
E + NaOH -> muối + rượu => E là este 2 chức.

.Q
 n(E) = 0,03mol => n (NaOH) = 0,06mol

TP
ẠO
Có: E + 2NaOH -> muối + rượu

Đ
Áp dụng BTKl : 4,38 + 0,06.40 = 4,92 + m(rượu)

G
N
 MR = (4,38 + 0,06.40 – 4,92)/0,03 = 62 => rượu là HO-CH2CH2-OH

Ư
H
 MR = (4,38 + 0,06.40 – 4,92)/0,06 = 31 loại

ẦN
Có: KLPT TB muối = 4,92 : 0,06 = 82 R COOH = 82 => R = 15
TR
Vậy CTCT của E có thể là: CH3-COOCH2CH2OOC-CH3
B
00

H-COOCH2CH2OOC-C2H5
10

Bài 4:
3
2+

ChấtXcócôngthứcphântửC6H8O4.Cho1molXphảnứnghếtvớidungdịchNaOH,thu
ẤP

đượcchấtYvà2molchấtZ.ĐunZvớidungdịchH2SO4đặc,thuđượcđimetylete.ChấtYphảnứn
g
C

vớidungdịchH2SO4loãng(dư),thuđượcchấtT.ChoTphảnứngvớiHBr,thuđượchaisảnphẩ
A
Ó

mlà đồng phân cấu tạo của nhau. Viết CTCT của .
H
Í-

Bài giải:
-L

Có: X + NaOH -> 2 mol Z + Y
ÁN
TO

0
Z 
H SO , dn ,140 C
2 4
→ CH3OCH3+ H2O
G

 Z là CH3OH ; 1mol X -> 2 mol Z => X là este 2 chức (tạo bởi axit 2 chức và
N

CH3OH)

Ư

 CTCT của X có thể là : CH3OOC- CH=CH-COOCH3 (1)
ID

CH2=C(COOCH3)-COOCH3 (2)
(1) Tác dụng HBr chỉ có 1 sản cộng duy nhất => loại
BỒ

(2) Tác dụng HBr chỉ có 2 sản cộng => thỏa mãn.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Bài 5:Cho 0,01 mol một este X của axit hữu cơ phản ứng vừa đủ với 100 ml dung
dịch NaOH 0,2 M, sản phẩm tạo thành chỉ gồm một ancol Y và một muối Z với số mol
bằng nhau. Mặt khác, khi xà phòng hoá hoàn toàn 1,29 gam este đó bằng một lượng

N
Ơ
vừa đủ là 60 ml dung dịch KOH 0,25 M, sau khi phản ứng kết thúc đem cô cạn dung

H
dịch được 1,665 gam muối khan. Xác định công thức của X.

N
Giải:

Y
Ta có: nZ = nY⇒ X chỉ chứa chức este

U
.Q
= 0,1.0,2 = 2 ⇒ CT của X có dạng: R(COO)2R’
n NaOH
Sỗ nhóm chức este là:

TP
nX 0,01
Từ phản ứng thủy phân: naxit = nmuối = 1 nKOH = 1 .0,06.0,25 = 0,0075 mol

ẠO
2 2
⇒ M muối = MR + 83.2 = 1,665 = 222 ⇒MR = 56 → R là: -C4H8-

Đ
0,0075

G
Meste = 1,29 = 172
R + 2.44 + R’ = 172 ⇒ R’ = 28 (-C2H4-)

N
Ư
0,0075

H
Vậy X là: C4H8(COO)2C2H4

ẦN
Bài 6:Đun nóng 7,2 gam este X với dung dịch NaOH dư. Phản ứng kết thúc thu
được glixerol và 7,9 gam hỗn hợp muối. Cho toàn bộ hỗn hợp muối đó tác dụng với
TR
H2SO4 loãng thu được 3 axit hữu cơ no, đơn chức, mạch hở Y, Z, T. Trong đó Z, T là
B
đồng phân của nhau, Z là đồng đẳng kế tiếp của Y. Xác định công thức cấu tạo của X
00

Giải :
10

Vì Y, Z là đồng đẳng kế tiếp và Z, T là đồng phân của nhau
3

⇒ có thể đặt công thức chung của este X: C3H5(OCO C n H 2 n +1 )3
2+

(1) C3H5(OCO C n H 2 n +1 )3 + 3NaOH → 3 C n H 2 n +1 COONa + C3H5(OH)3
ẤP

7,2 7,9
Theo (1), ta có : nmuối = 3neste

C

.3 =
41 + 3( 45 + 14 n) 14 n + 68
A

Y : C 2 H 5 COOH
Ó

⇒ n = 2,67 ⇒ CTCT các chất: 
H

Z : CH 3 CH 2 CH 2 COOH
T : CH(CH ) COOH
Í-

 3 2
-L

CH2 OCOC2H5 CH2 OCOCH2CH2CH3
ÁN

CH OCOCH2CH2CH3 CH OCOC2H5
TO

CH2 OCOCH(CH3)2
→CTCT : CH2 OCOCH(CH3)2 hoặc
G
N

Ư

3. Thủy phân hỗn hợp este
ID

3.1. Phương pháp giải
BỒ

+ Bài toán về hỗn hợp các este thì nên sử dụng phương pháp trung bình.
+ Các bước còn lại giải tương tự este đơn chức

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

3.2. Một số bài tập minh họa
Bài 1:Một hỗn hợp A gồm 2 este đơn chức X, Y (MX < My). Đun nóng 12,5 gam
hỗn hợp A với một lượng dung dịch NaOH vừa đủ thu được 7,6 gam hỗn hợp ancol no

N
Ơ
B, đơn chức có khối lượng phân tử hơn kém nhau 14 đvC và hỗn hợp hai muối Z. Đốt

H
cháy 7,6 gam B thu được 7,84 lít khí CO2 (đktc) và 9 gam H2O. Tính phần trăm khối

N
lượng của X, Y trong hỗn hợp A .

Y
Bài giải :

U
.Q
Từ đề bài ⇒A chứa 2 este của 2 ancol đồng đẳng kế tiếp

TP
Đặt công thức chung của ancol là C n H 2 n +1OH
n CO = 7,84/22,4 = 0,35 mol; nH O = 9/18 = 0,5 mol ⇒ nB = n H O - n CO = 0,5 – 0,35 = 0,15

ẠO
2 2 2 2

mol

Đ
nCO2

G
C 2 H 5 OH : 0,1 mol
⇒n = = 2,33. Vậy B 

N
nB C 3 H 7 OH : 0,05 mol

Ư
Đặt công thức chung của hai este là RCOOR′ ⇒ neste = nNaOH = nmuối = nY = 0,15 mol

H
ẦN
10,9
⇒mZ = 12,5 + 0,15.40 – 7,6 = 10,9 g ⇒ M muèi = M R + 67 = =72,67 ⇒ M R = 5,67
0,15
Như vậy trong hai muối có một muối là HCOONa TR
B
Hai este X, Y có thể là:
00

hoặc (II) 
HCOOC2 H 5 HCOOC 3 H 7
(I)
10


C x H y COOC3 H 7 C x H y COOC 2 H 5
3

x =1
- trường hợp (I) ⇒ 
2+

y = 3
ẤP

- trường hợp (II) ⇒ 12x + y = 8 ( loại)
C

Vậy A X : HCOOC 2 H 5 : 59,2%
A

Y : CH 3 COOC 3 H 7 : 40,8%
Ó
H
Í-
-L

2.Dạng 2: Bài toán phản ứng đốt cháy este.
ÁN

2.1. Phản ứng đốt cháy 1este:
TO

2.1.a.Phương pháp giải:
G

1. Este no, đơn chức, mạch hở:
N

- CTTQ: CnH2nO2, n ≥ 2
Ư

3n − 2
ID

t 0C
- Phản ứng cháy: CnH2nO2 + ( )O2 → nCO2 + nH2O
2
BỒ

+nCO2 = nH2O

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

3
+nO2 = nCO2 - neste
2
2. Este không no, đơn chức, mạch hở có 1 liên kết C=C:

N
Ơ
- CTTQ: CnH2n-2O2, n ≥ 4

H
N
3n − 3

Y
0
- Phản ứng cháy: CnH2n-2O2 + ( )O2 →
t C
nCO2 + (n-1)H2O

U
2

.Q
+ nCO2 > nH2O

TP
+ neste = nCO2 – nH2O

ẠO
3. Este không no, đơn chức, có k liên kết C=C trong phân tử:

Đ
G
- CTTQ: CnH2n-2kO2 , n ≥ 4

N
Ư
3n − 2 − 0,5k 0
- Phản ứng cháy: CnH2n-kO2 + ( )O2 nCO2 + (n-0,5k)H2O

H
→
t C

2

ẦN
+ nCO2 > nH2O
TR
+ neste = 2(nCO2 – nH2O)/k
B
00

4. Este không no, có từ 2 liên kết C=C trở lên trong phân tử
10

2n + 1 − k − m t 0C
- Phản ứng cháy: CnH2n+2-2kOm + O2 → nCO2 + (n+1-k)H2O
3
2+

2
+nCO2 > nH2O
ẤP
C

+neste = (nCO2 – nH2O)/(k-1)
A

5. Este bất kì:
Ó
H

- CTTQ: CxHyOz. x, y, z nguyên dương, x>=2, z>=2
Í-
-L

- Phản ứng cháy: CxHyOz + O2 ----> xCO2 + y/2H2O
ÁN

- Áp dụng các định luật bảo toàn khối lượng, định luật bảo toàn nguyên tố… để
TO

giải bài toán.
2.1.b. Một số bài tập minh họa
G
N

Bài 1: Đốt cháy m (g) este mạch hở X tạo thành 0,4 mol CO2 và 5,4g H2O. 1 mol X làm

Ư

mất màu dung dịch chứa 160g Br2. 1 mol X thủy phân vừa đủ với 1 mol kiềm tạo ra
ID

một sản phẩm thủy phân có thể tham gia phản ứng tráng bạc. Xác định CTPT, CTCT
BỒ

X.
Bài giải:

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

1 mol X làm mất màu 1 mol Br2 => trong X có chứa 1 nối đôi
1 mol X thủy phân vừa đủ với 1 mol NaOH => X đơn chức

N
=> Đặt CTPT của este X là: CnH2n-2O2

Ơ
H
Có: nC:nH = n : (2n-2) = 0,4 : 0,6 => n = 4

N
Y
=>CTPT của X: C4H6O2

U
.Q
X thủy phân cho sản phẩm tham gia phản ứng tráng bạc

TP
TH1: X là este của axit fomic:=> X có CTCT: HCOOCH=CH-CH3 hoặc

ẠO
HCOOC(CH3)=CH2

Đ
TH2: X thủy phân ra andehit: => X có CTCT: CH3COOCH=CH2

G
N
=> Có 3 CTCT của X phù hợp đề bài: HCOOCH=CH-

Ư
CH3; HCOOC(CH3)=CH2; CH3COOCH=CH2

H
ẦN
Bài 2: Đốt cháy 6g este Y ta thu được 4,48 l CO2 (đktc) và 3,6g H2O. Tìm CTCT
của Y.
TR
Lời giải:
B
00

nCO2 = 0,2 mol
10

nH2O = 0,2 mol
3
2+

=> nCO2 = nH2O =>este Y no, đơn chức, mạch hở
ẤP

Đặt CTTQ của Y là CnH2nO2
C

Có: CnH2nO2 + O2 -----------> nCO2 + nH2O
A
Ó

14n+32 n mol
H
Í-

6 0,2 mol
-L

=> (14n +32).0,2 = 6n
ÁN

=> n = 2
TO

=> CTPT của Y: C2H4O2
G
N

=> CTCT của Y: HCOOCH3

Ư

Bài 3 :Đốt cháy hoàn toàn một este đơn chức, mạch hở X (phân tử có số liên kết
ID

π nhỏ hơn 3), thu được thể tích khí CO2 bằng 6/7 thể tích khí O2 đã phản ứng (các thể
BỒ

tích khí đo ở cùng điều kiện). Cho m gam X tác dụng hoàn toàn với 200 ml dung dịch
KOH 0,7M thu được dung dịch Y. Cô cạn Y thu được 12,88 gam chất rắn khan. Tìm
giá trị của m

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

(Trích đề thi TS ĐH khối A năm 2010)

Bài giải:

N
Ơ
y z t 0C y
Phản ứng đốt cháy: CxHyO2 + − ) O2 → xCO2 + H2O

H
(x +
2 2 2

N
Y
x = 3

U
Theo đề bài : V(CO2)/V(O2) =6/7 => 3y = 2x + 12. =>  thỏa mãn.

.Q
y = 6

TP
 CTPT X là: C3H6O2

ẠO
12,88
 MR = = 92 => 56 < M R < M RCOOK

Đ
0, 2.0, 7

G
=> M RCOOK = 96 tức là: RCOOK = 98 => R = 15 => R ≡ CH3

N
Ư
(12,88 − 0, 2.0, 7.56)
Áp dụng tăng giảm khối lượng => số mol CH3COOK = =

H
(98 − 56)

ẦN
0,12mol
=> Số mol X = 0,12 mol TR
 m = 0,12. 74 = 8,88 gam
B
Bài 4:Đốt cháy 0,8 gam một este X đơn chức được 1,76 gam CO2 và 0,576 gam
00

H2O. Cho 5 gam X tác dụng với lượng NaOH vừa đủ, cô cạn dung dịch sau phản ứng
10

được 7 gam muối khan Y. Cho Y tác dụng với dung dịch axit loãng thu được Z không
3
2+

phân nhánh. Xác định công thức cấu tạo của X .
Bài giải :
ẤP

Công thức X: CxHyO2( 2≤ x; y ≤ 2x )
C

1,76.12 0,576.2
Theo đề bài: mc = = 0,48 gam; mH = = 0,064 gam ⇒ mO =
A

(X)
44 18
Ó

0,256 gam
H

⇒ x:y:2 = 0,04:0,064:0,016 = 5:8:2
Í-
-L

⇒ Công thức của X: C5H8O2
Vì X là este đơn chức (X không thể là este đơn chức của phenol) ⇒ nX = nY
ÁN

= nz = nNaOH = 0,05 mol
TO

Ta có : mX + mNaOH (pư) = 5 + 0,05.40 = 7 gam = mmuối Y
G

O
N

⇒ E là este mạch vòng:
C

 O
Ư
ID
BỒ

2.2. Bài toán đốt cháy hỗn hợp các este:

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

2.2.a. Phương pháp giải
1. Bài toán đốt cháy 2 este đồng phân:

N
- các este đồng phân => có cùng CTPT, cùng KLPT.

Ơ
H
2. Bài toán đốt cháy 2 este tạo thành từ cùng 1 axit, 2 ancol đồng đẳng hoặc cùng

N
1 ancol, 2 axit đồng đẳng:

Y
U
- Các este này sẽ có cùng dạng CTTQ => Đặt CTPT trung bình để viết phương

.Q
trình phản ứng, đưa về bài toán 1 este.

TP
- số liên kết pi trong phân tử: k =( 2nC – nH +2)/2

ẠO
3. Bài toán đốt cháy hỗn hợp nhiều este có cùng CTTQ:

Đ
G
- Đặt CTPT trung bình

N
Ư
- Áp dụng các định luật bảo toàn để giải bài toán.

H
ẦN
2.2.b. Bài tập minh họa
Bài 1: Cho 14,8g một hỗn hợp gồm 2 este đồng phân của nhau bay hơi ở điều
TR
kiện thích hợp. Kết quả thu được một thể tích hơi đúng bằng thể tích của 6,4g oxi
B
00

trong cùng điều kiện như trên. Khi đốt cháy hoàn toàn hỗn hợp hai este trên, thu được
sản phẩm phản ứng là CO2 và H2O , tỉ lệ thể tích khí CO2 và hơi H2O là 1:1. Xác định
10

CTCT của 2 este.
3
2+

Lời giải:
ẤP

Theo bài ra: nCO2 : nH2O = 1:1 => 2 este là no, đơn chức, mạch hở
C

Đặt CTTQ của 2 este đồng phân là CnH2nO2, n>=2
A
Ó

Có: thể tích hơi của 14,8g este bằng thể tích hơi của 6,4g O2
H
Í-

=>neste = nO2 = 0,2 mol
-L

=> Meste = 74
ÁN

=> 14n+32 =74 => n=3=>CTPT: C3H6O2
TO

CTCT của 2 este là CH3COOCH3 và HCOOC2H5.
G
N

Bài 2:Đốt cháy hoàn toàn một lượng hỗn hợp hai este no, đơn chức cần 3,976 lit

O2 (đktc) thu được 6,38g CO2. Cho lượng este này tác dụng vừa đủ với KOH thu được
Ư

hỗn hợp 2 ancol kế tiếp và 3,92g muối của một axit hữu cơ. Tìm CTCT 2 este đó.
ID

Lời giải:
BỒ

nO2 = 0,1775 mol

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

nCO2 = 0,145 mol
2 este + KOH => hỗn hợp 2 ancol kế tiếp và muối của 1 axit hữu cơ => Bài toán 2

N
este tạo bởi cùng 1 axit hữu cơ và 2 ancol là đồng đẳng liên tiếp.

Ơ
Đặt CTPT trung bình của 2 este là Cn H 2 nO2

H
N
Phản ứng cháy:

Y
U
.Q
3n − 2 t 0C
Cn H 2 nO2 + O2  → nCO2 + nH 2O

TP
2

ẠO
0,1775 0,145

Đ
=> = 3,625

G
=>CTCT của 2 este là :C3H6O2 và C4H8O2

N
Ư
3

H
số mol este : neste = nCO2- nO2 = 0,04 mol
2

ẦN
Phản ứng thủy phân: Đặt CTTQ của 2 este là
TR
=> Thủy phân thu được muối RCOOK
B
00

nRCOOK = neste = 0,04 mol
10

3,92
3

=> MRCOOK = = 98
2+

0, 04
ẤP

=> R =15: CH3-
C

Vậy: CTCT của 2 este là: CH3COOCH3 và CH3COOC2H5.
A
Ó
H

Bài 3:Cho hỗn hợp X gồm hai hợp chất hữu cơ no, đơn chức tác dụng vừa đủ
Í-

với 100 ml dung dịch KOH 0,4M, thu được một muối và 336 ml hơi một ancol (ở đktc).
-L

Nếu đốt cháy hoàn toàn lượng hỗn hợp X trên, sau đó hấp thụ hết sản phẩm cháy vào
ÁN

bình đựng dung dịch Ca(OH)2 (dư) thì khối lượng bình tăng 6,82 gam. Tìm công thức
TO

cấu của hai hợp chất hữu cơ trong X ?
(Trích đề thi TS ĐH khối B năm
G

2009)
N

Bài giải

Ư
ID

Số mol ancol = 0,015mol < số mol KOH = 0,04 mol
BỒ

=>Hỗn hợp gồm 1 esteno đơn chức và 1 axit no đơn chức
Số mol este = 0,015mol
Số mol axit = 0,025mol

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

6,82
Vì X gồm 2 chất hữu cơ no, đơn chức nên số mol CO2 = số mol H2O = =
(44 + 18)
0,11mol

N
0,11

Ơ
 n= = 2.75 một chất trong hỗn hợp X có CTPT : C2H4O2

H
0, 04

N
Khối lượng X = mC + mH + mO = 0,11.12 + 0,22.1 + 16.2.0,04 = 2,82

Y
gam

U
.Q
 TH1: Axit có CTPT là C2H4O2

TP
2,82 − 0, 025.60
 M este = = 88
0, 015

ẠO
 CTPT của este là C4H8O2

Đ
 TH2: Este có CTPT là C2H4O2

G
2,82 − 0, 015.60
M ax = = 76,8 => loại.

N
0, 025

Ư
Vậy: CTCT của các chất trong X là: axit CH3COOH

H
Este: HCOOCH2CH2CH3 ; HCOOCH(CH3 )CH3 ;

ẦN
CH3COOC2H5; C2H5COOCH3.
TR
B
Bài 4:Đốt cháy hoàn toàn m gam hỗn hợp gồm hai este X1, X2 là đồng phân của
00

nhau cần dùng 19,6 gam O2, thu được 11,76 lit CO2 (đktc) và 9,45 gam H2O. Mặt khác,
10

nếu cho m gam hỗn hợp trên tác dụng hết với 200ml dung dịch NaOH 1M rồi cô cạn
3

dung dịch sau phản ứng thì còn lại 13,95 gam chất rắn khan. Xác định Tỷ lệ mol của
2+

X1 , X2 .
ẤP

Bài giải:
Bảo toàn khối lượng :
C

m + 19, 6 = 0, 525.44 + 9, 45 → m = 12, 95
A
Ó

nH 2O = nCO2 = 0, 525 → no ,đơn chức
H

Bảo toàn nguyên tố oxi :
Í-

19, 6
-L

2nX + .2 = 0,525.3 → nX = 0,175 → n = 3
32
ÁN

CH 3COONa : a

TO

→ 13,95  HCOONa : 0,175 − a → 13,95 = 82a + 68.(0,175 − a) + 40(0, 2 − 0,175)
 NaOH : 0, 2 − 0,175
G


N

→ a = 0, 075 → n(CH 3COOCH 3 ) : nHCOOC2 H 5 = 3 : 4

3. Dạng 3:Bài toán về phản ứng este hoá.
Ư

3.1. Phương pháp giải
ID

H2SO4, t0
BỒ

RCOOH + R'-OH RCOOR' + H2O
Đặc điểm của phản ứng este hoá là thuận nghịch nên có thể gắn với các dạng bài toán:

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Tính hằng số cân bằng K:
RCOOR' H2O
Kcb =
RCOOH R'OH

N
Ơ
Tính hiệu suất phản ứng este hoá:

H
l−îng este thu ®−îc theo thùc tÕ . 100%

N
H=
l−îng este thu ®−îc theo lÝ thuyÕt

Y
U
Tính lượng este tạo thành hoặc axit cacboxylic cần dùng, lượng ancol …

.Q
* Chú ý: Nếu tiến hành phản ứng este hóa giữa một ancol n chức với m axit cacboxylic

TP
 n(n − 1) n(n + 1)
 n+ = , m=n
đơn chức thì số este tối đa có thể thu được là:  2 2 (Có thể chứng

ẠO
m + 2(m − 1)(n − 1) , m < n

Đ
minh các công thức này về mặt toán học)

G
3.2. Một số bài tập minh họa

N
Ư
Bài 1:Hỗn hợp A gồm axit axetic và etanol. Chia A thành ba phần bằng nhau.

H
+ Phần 1 tác dụng với Kali dư thấy có 3,36 lít khí thoát ra.

ẦN
+ Phần 2 tác dụng với Na2CO3 dư thấy có 1,12 lít khí CO2 thoát ra. Các thể tích khí
đo ở đktc.
TR
+ Phần 3 được thêm vào vài giọt dung dịch H2SO4, sau đó đun sôi hỗn hợp một thời
B
gian. Biết hiệu suất của phản ứng este hoá bằng 60%. Khối lượng este tạo thành là
00

bao nhiêu?
10

Bài giải:
3

n A = a + b = 2 n H 2 = 0,3 mol a = 0,1 mol
2+

Hỗn hợp A CH 3 COOH : a mol
⇒  ⇒
C 2 H 5 OH : b mol a = 2 n CO 2 = 0,1 mol b = 0,2 mol
ẤP

Vì a < b (⇒ hiệu suất tính theo axit) ⇒ số mol este thực tế thu được: n = 0,1.60% =
C

0,06 mol
A
Ó

⇒ Khối lượng este thực tế thu được: m = 0,06.88 = 5,28 gam
H

Bài 2:Để đốt cháy hoàn toàn 1 mol axit cacboxylic đơn chức X cần đủ 3,5 mol O2.
Í-

Trộn 7,4 gam X với lượng đủ ancol no Y (biết tỉ khối hơi của Y so với O2 nhỏ hơn 2).
-L

Đun nóng hỗn hợp với H2SO4 làm xúc tác. Sau khi phản ứng hoàn toàn thu được 8,7
ÁN

gam este Z (trong Z không còn nhóm chức nào khác). Xác định công thức cấu tạo của
TO

Z
Bài giải:
G

y
Phản ứng cháy: CXHyO2 + (x + -1)O2→ xCO2 + y H2O (1)
N

4

2
Ư

y y
Theo (1), ta có : x + -1= 3,5
x + = 4,5 ⇒  x = 3 ⇒ X : C2H5COOH
ID

4 4 y = 6
BỒ

Ancol no Y : CnH2n+2-m (OH)m (1 ≤ m ≤ n) ⇒ este Z : (C2H5COO)mCnH2n+2-m
8,7
⇒ Meste = 73m + 14n + 2 – m = .m hay 14n + 2 = 15m (2)
0,1

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Mặt khác d Y O < 2 hay 14n + 2 + 16m < 64 ⇒ 30m + 2 < 64 (vì m ≤ n)
m < 2,1
2

Từ (2) ⇒ n = 2 → ancol Y : C2H4(OH)2
m = 2

N
Ơ
⇒CTCT Z : C2H5COOCH2CH2OCOC2H5

H
N
Y
Bài 3: Thực hiện phản ứng este hóa 9,2g glixerol với 60g axit axetic. Giả sử chỉ

U
.Q
thu được glixerol triaxetat có khối lượng 17,44g. Tính hiệu suất của phản ứng este
hóa:

TP
Lời giải:

ẠO
nglixerol = 0,1 mol

Đ
G
naxit axetic = 1 mol

N
Ư
C3H5(OH)3 + 3CH3COOH C3H5(OOCCH3)3 + 3H2O

H
ẦN
0,1 0,3 0,1
Từ PT: meste= 0,1. 218 = 21,8g TR
B
Thực tế: meste=17,44g
00

17, 44
10

Hiệu suất: H%= .100 = 80%
21,8
3
2+

Bài 4:Thực hiện phản ứng este hóa m gam CH3COOH bằng 1 lượng vừa đủ
ẤP

C2H5OH thu được 0,02 mol este. Hiệu suất phản ứng H = 60%. Giá trị của m?
C

Lời giải:
A
Ó

CH3COOH + C2H5OH CH3COOC2H5 + H2O
H

1 mol 1 mol
Í-
-L

0,02 mol 0,02 mol
ÁN

Theo lí thuyết: khối lượng CH3COOH cần dùng là: 60.0,02=1,2 g
TO

1, 2
Hiệu suất H= 60% => thực tế khối lượng axit đã dùng: m = .100 = 2 gam
G

60
N

Bài 5:Từ 1 kg đất đèn( trong đó có 96% canxi cacbua) điều chế ra axit axetic,

Ư

hiệu suất toàn quá trình điều chế axit đạt 80%. Toàn bộ lượng axit thu được cho tham
ID

gia phản ứng este hóa với lượng dư ancol etylic. Hiệu suất phản ứng este hóa là 90%.
BỒ

Tính khối lượng este etyl axetat thu được.
Lời giải:

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

mCaC2= 0,96 kg
Sơ đồ bài toán:

N
CaC2 ---> C2H2 ---->C2H5COOH ( H= 80%) -----> CH3COOC2H5(H=90%)

Ơ
H
64 kg ----> 88 kg

N
Y
9, 66.88
0,96 kg ----->

U
= 1,32kg
64

.Q
TP
Theo lí thuyết: thu được 1,32 kg este

ẠO
=>Hiệu suất các giai đoạn là 80% và 90%

Đ
1,32.80.90
=> Khối lượng este thực tế thu được: meste = = 0,9504kg

G
100.100

N
Ư
4.Dạng 4:Bài toán hỗn hợp este và các chất hữu cơ khác ( ancol, axit cacboxylic, ...)

H
4.1. Phương pháp giải

ẦN
TR
Khi đầu bài cho 2 chất hữu cơ khi tác dụng với NaOH hoặc KOH mà tạo ra:
+ 2 muối và 1 ancol thì có khả năng 2 chất hữu cơ đó là
B
♣ RCOOR’ và R’’COOR’ có nNaOH = nR’OH
00

♣Hoặc: RCOOR’ và R’’COOH có nNaOH > nR’OH
10

+ 1 muối và 1 ancol có những khả năng sau
3
2+

♣ RCOOR’ và ROH
♣Hoặc: RCOOR’ và RCOOH
ẤP

♣Hoặc: RCOOH và R’OH
C

+ 1 muối và 2 ancol thì có những khả năng sau
A
Ó

♣ RCOOR’ và RCOOR’’
H

♣Hoặc: RCOOR’ và R’’OH
Í-

* Đặc biệt chú ý: Nếu đề nói chất hữu cơ đó chỉ có chức este thì không sao, nhưng
-L

nếu nói có chức este thì chúng ta cần chú ý ngoài chức este trong phân tử có thể có thêm
ÁN

chức axit hoặc ancol!
TO

4.2. Bài tập minh họa
G
N

Bài 1:Hỗn hợp A gồm ba chất hữu cơ X, Y, Z đơn chức đồng phân của nhau, đều

Ư

tác dụng được với NaOH. Đun nóng 13,875 gam hỗn hợp A với dung dịch NaOH vừa
ID

đủ thu được 15,375 gam hỗn hợp muối và hỗn hợp ancol có tỉ khối hơi so với H2 bằng
20,67. Ở 136,50C, 1 atm thể tích hơi của 4,625 gam X bằng 2,1 lít. Xác định Phần trăm
BỒ

khối lượng của X, Y, Z (theo thứ tự KLPT gốc axit tăng dần)

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Bài giải :
1.2,1 4,625
Ta có : n X = = 0,0625mol ⇒ MX = = 74
0,082(273 + 136,5) 0,0625

N
Mặt khác: X, Y, Z đơn chức, tác dụng được với NaOH ⇒ X, Y, Z là axit hoặc este

Ơ
H
x = 3
⇒ CTPT dạng: CxHyO2, dễ dàng ⇒ 

N
y = 6

Y
U
X : C 2 H 5 COOH : a mol n A = a + b + c = 0,1875mol a = 0,075

.Q

Vậy  
A Y : CH 3 COOCH 3 : b mol ⇒ d ancol / H = 32 b + 46 c
= 20,67 ⇒ b = 0,0375

TP
 Z : HCOOC H : c mol 
2
2( b + c) c = 0,075
 2 5
m muèi = 96a + 82 b + 68c = 15,375gam 

ẠO
→ Phần tram khối lượng của X, Y, Z lần lượt là: 40%; 20%; 40%.

Đ
G
Bài 2*:Hỗn hợp X gồm 3 este đơn chức được tạo từ cùng 1 một ancol Y với 3 axit

N
Ư
cacboxylic (phân tử chỉ có nhóm COOH); trong đó có 2 axit no là đồng đẳng kế tiếp

H
nhau và 1 axit không no có đồng phân hình học chứa liên kết đôi C=C trong phân tử).

ẦN
Thủy phân hoàn toàn 5,88 gam X bằng dung dịch NaOH , thu được hỗn hợp muối m
TR
và acol Y. Cho m gam Y vào bình được Na dư , sau phản ưng thu được 896 ml khí
(đktc) và khối lượng bình tăng 2,48 gam. Măt khác, nếu đốt cháy hoàn toàn 5,88 gam
B
X thì thu được CO2 và 3,96 gam nước. Xác định Phần trăm khối lượng của este không
00

no trong X?
10
3

Bài giải:
2+
ẤP

Số mol ancol = 2(số mol H2) = 0.08 mol
C
A

Khối lượng ancol là 2.48 + 0.04*2 = 2.56 => 3.56/0.08 = 32 => Rượu là:
Ó

CH3OH
H
Í-
-L

Ta có thể suy ra thêm:
ÁN

Trong 5.88g (0.08mol) hỗn hợp có 0.08 mol O (vì có có 2O trong tất cả các este
TO

đơn chất)
G
N

sốmol H2O = 0.22 nên số mol H = 0,44 mol

Ư
ID

Bảo toàn khối lượng được số mol C = 0,24mol
BỒ

C trung bình = 3 =>phải có 1 chất là C2H4O2, chất đồng đẳng là C3H6O3, chất còn
lại là este của C4H6O2 và metanol nên là C5H8O2.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

lập hệ 3 phương trình:

x + y + z = 0.08

N
Ơ
H
(2*14+32)x + (3*14 + 32)y + (5*14+ 32)z = 5.88

N
Y
U
2x + 3y + 5z = 0.24

.Q
TP
=>x=0.04, y = 0.02, z=0.02

ẠO
tính khối lượng rồi tính phần tram khối lượng %m este = 34,01%.

Đ
Bài 3:Hỗn hợp X gồm một anđehit, một axit cacboxylic và một este (trong đó axit

G
N
và este là đồng phân của nhau). Đốt cháy hoàn toàn 0,2 mol X cần 0,625 mol O2, thu

Ư
được 0,525 mol CO2 và 0,525 mol nước. Nếu đem toàn bộ lượng anđehit trong X cho

H
phản ứng hoàn toàn với một lượng dư dung dịch AgNO3 trong NH3 thì khối lượng Ag

ẦN
tạo ra là
Bài giải: TR
CO2 : 0,525
B
 
BTKL
 → m X = 0,525.44 + 0,525.18 − 0,625.32 = 12, 55
00

H 2 O : 0,525 →  BTNT.oxi
  → n trong X
= 0,525.3 − 0,625.2 = 0,325
10

O : 0,625 O
 2
3

C H O : a a + b = 0,2 a = 0,075
2+

nCO2 = nH 2 O
 →  n 2n → →
C m H 2 m O2 : b a + 2b = 0,325 b = 0,125
ẤP

→ 0, 075.CH 3CHO + 0,125.C 3H 6 O 2 = 12, 55 → n Ag = 0,075.2 = 0,15
C

 mAg = 0,15.108 = 16,2 gam
A
Ó
H
Í-
-L
ÁN
TO
G
N

Ư
ID
BỒ

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Chương III. BÀI TẬP TỰ GIẢI

N
Ơ
H
I.Bài tập lý thuyết

N
Câu1. Viết các phương trình phản ứng dưới dạng tổng quát và lấy VD hoàn thành các

Y
phản ứng sau:

U
.Q
1. Este + KOH → 1 muối + 1 ancol 2. Este + KOH → 1 muối + 2 ancol

TP
3. Este + KOH → 2 muối + 1 ancol 4. Este + KOH →n (phân tử) muối + m (phân tử)
ancol

ẠO
5. Este + KOH → 1 muối + 1 andehit6. Este + KOH → 1 muối + 1 xeton

Đ
7. Este + KOH → 2 muối + nước.8. Este + KOH → 2 muối + 1 ancol + nước

G
9. Este + KOH → 1 sản phẩm duy nhất

N
Ư
H
Câu 2. Hoàn thành các sơ đồ phản ứng sau:

ẦN
TR
B
00
10
3
2+

Câu 3. Các công thức C2H6O, C3H8O và C3H6O2 là công thức phân tử của 5 chất hữu cơ
ẤP

A, B, C, D, E. Trong đó chỉ A và E tác dụng với Na, B, D và E tác dụng được với NaOH.
C

D tác dụng với NaOH thì được F.Mặt khác, khi đun nóng hỗn hợp hai chất hữu cơ A và F
A

với dung dịch H2SO4 đặc nóng ở 1400C, thu được C. Hãy xác định A, B, C, D, E và viết
Ó

phương trình phản ứng xảy ra.
H
Í-
-L

II. Bài tập tự luận
Dạng 1: Thủy phân este
ÁN
TO

Bài 1: Thủy phân hoàn toàn 19 gam hợp chất hữu cơ A (mạch hở tác dụng được với Na)
thu được m1 gam B và m2 gam D chứa 2 loại nhóm chức.
G
N

Đốt cháy hoàn toàn m1 gam B cần 9,6 gam O2 thu được 4,48 lít CO2 và 5,4 gam H2O.

Ư

Đốt cháy hoàn toàn m2 gam D cần 19,2 gam O2 thu được 13,44 lít CO2 và 10,8 gam
ID

H2O
BỒ

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Xác định CTPT và CTCT của A, B, D. Biết A có CTPT trùng CTĐG và các thể tích khí
đo ở ĐKTC

N
(Trích đề thi chuyên Hóa THPT Chuyên Nguyễn Trãi Hải Dương 2012-2013)

Ơ
H
Đáp số: CTPT (B)C2H6O; CTCT

N
Y
(B)CH3CH2OH ;

U
.Q
CTPT (D): C3H6O3 ; CTCT (D): HO-CH2-CH2COOH hoặc CH3-CH(OH)-

TP
COOH.

ẠO
CTPT (A): C8H14O5; CTCT (A): HO-CH2-CH2COOCH2-CH2COOC2H5

Đ
G
hoặc CH3-CH(OH)COOCH(CH3)COOC2H5.....

N
Ư
Bài 2: Hợp chất X có thành phần gồm C, H, O, chứa vòng benzen. Cho 6,9 gam X

H
vào 360 ml dung dịch NaOH 0,5M (dư 20% so với lượng cần phản ứng) đến phản ứng

ẦN
hoàn toàn, thu được dung dịch Y. Cô cạn Y thu được m gam chất rắn khan. Mặt khác, đốt
TR
cháy hoàn toàn 6,9 gam X cần vừa đủ 7,84 lít O2 (đktc), thu được 15,4 gam CO2. Biết X
B
có công thức phân tử trùng với công thức đơn giản nhất. Tìm m
00

(Trích đề thi ĐH khối A - 2013)
10

Đáp số: m = 13,2gam
3
2+

Bài 3:Hợp chất hữu cơ E là este của glixerol. Trong E ngoài chức este không còn
nhóm chức nào khác. Đun nóng 8,64 gam E với lượng dư dung dịch NaOH. Sau khi phản
ẤP

ứng kết thúc, cô cạn hỗn hợp thu được 9,48 gam muối của 2 axit no đơn chức kế tiếp
C

nhau trong dãy đồng đẳng. Xác định CTPT, CTCT của E.
A
Ó

(121 bài tập hóa học – BDHSG – Đào Hữu Vinh)
H
Í-

Đáp số: CTPT E: (C2H5COO)2C3H5(OOC-C3H7) có 4 đồng phân.
-L
ÁN

Bài 4: Cho m gam chất X chứa C, H, O tác dụng với 152,5ml NaOH 25% có d =
1,28 g/ml. Sau khi phản ứng xảy ra hoàn toàn, thu được dung dịch A chứa muối một axit
TO

hữu cơ, hai rượu đơn chức và xút dư. Trung hòa A bằng 255ml HCl 4M. Cô cạn dung
G

dịch sau khi trung hòa thu được hỗn hợp hơi 2 rượu có tỉ khối hơi so với hiđro là 26,5 và
N

78,67 gam hỗn hợp muối khan. Xác định CTCT của X và tính m. Biết X có cấu tạo mạch

thẳng.
Ư
ID

(121 bài tập hóa học – BDHSG – Đào Hữu Vinh)
BỒ

Đáp số: CTCT của X: n-C3H7OOC-(CH2)4-OOCH2-CH3

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

CH3-OOC-(CH2)4COOCH2-CH2-CH2-CH3; m= 21,6 gam

Bài 5:Hợp chất X phân tử chỉ chứa 2 nguyên tử oxi. Khi cho X tác dụng vừa đủ với

N
dung dịch NaOH thì chỉ thu được 1 sản phẩm duy nhất. Đốt cháy hoàn toàn 0,36 gam X

Ơ
trong khí oxi thu được CO2 và hơi nước. Nếu dẫn sản phẩm cháy qua bình đựng KOH dư

H
N
thấy khối lượng bình này tăng 0,84 gam, mặt khác nếu dẫn sản phẩm cháy đó qua bình

Y
đựng H2SO4đặc, dư thì thấy bình axit tăng 0,18 gam. Xác định CTPT và viết CTCT thích

U
hợp của X.

.Q
TP
Đáp sô: CTPT của X: C3H4O2 là este mạch vòng.

ẠO
Bài 6:Hỗn hợp X gồm một axit hữu cơ đơn chức (A), một este tạo bởi một axit đơn

Đ
chức (B) và một muối. Mặt khác, cho a gam hỗn hợp X tác dụng với 1 lượng vừa đủ với

G
NaOH đun nóng, thu được 4,38 gam hỗn hợp Y gồm 2 muối và 0,03mol rượu, rượu này

N
có tỉ khối hơi so với H2 bằng 23. Đốt cháy hỗn hợp Y bằng một lượng oxi dư thu được

Ư
H
muối Na2CO3 hơi nước và 2,128 lít CO2 (đktc). Giả thiết các phản ứng đều xảy ra hoàn

ẦN
toàn. Xác định CTCT của các chất trong hỗn hợp X.
TR
Đáp số: CTCT: (A) C2H5COOH; (B)CH3COOC2H5 ; (C)
B
C2H5OH.
00

Bài 7:Đun nóng 0,1 mol este đơn chức X với 30 ml dung dịch 20% (d = 1,2 g/ml)
10

của một hiđroxit kim loại kiềm M. Sau khi kết thúc phản ứng, được dung dịch đem cô
cạn cho chất rắn A và 3,2 gam ancol B. Đốt cháy hoàn toàn chất rắn A được 9,54 gam
3
2+

muối cacbonat; 8,26 gam hỗn hợp gồm CO2 và hơi nước. Biết rằng, khi nung A trong
NaOH đặc có CaO thu được hiđrocacbon Z, đem đốt cháy Z cho số mol nước lớn hơn số
ẤP

mol CO2. Xác định kim loại M, tìm công thức cấu tạo của X.
C

Đáp số: CTCTX là CH3COOCH3
A
Ó
H

Bài 8: Cho m gam este X thuần chức tạo bởi axit hữu cơ đơn chức và ancol đơn chức
Í-

tác dụng hết với dung dịch NaOH. Sau phản ứng cho toàn bộ lượng ancol thu được qua
-L

bình đựng Na dư thu được khí Y có thể khử được 8/3 gam Fe2O3 ở nhiệt độ cao tạo ra Fe
ÁN

và bình đựng Na khối lượng tăng thêm 3,1 gam. Mặt khác m/2 gam X làm mất màu vừa
hết 8gam Br2 trong CCl4 và thu được sản phẩm chứa 61,54% brom theo khối lượng.
TO

a) Xác định giá trị của m
G

b) Xác định công thức phân tử, viết công thức cấu tạo có thể có của X
N

Đáp số:a) m = 10 gam

Ư

b) CTCT có thể có của X: CH3-CH=CH-COOCH3;
ID

CH2=C(CH3)-COO-CH3; CH2=CH-CH2-COO-CH3.
BỒ

Bài 9: Hai este X, Y có cùng công thức phân tử C8H8O2và chứa vòng benzen
trong phân tử.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Cho6,8gamhỗnhợpgồmXvàYtácdụngvớidungdịchNaOHdư,đunnóng,lượngNaOHphản
ứng tối đa là 0,06 mol, thu được dung dịch Z chứa 4,7 gam ba muối. Xác địnhkhối
lượngmuối của axit cacboxylic có phân tử khối lớn hơn trong Z.

N
(Trích đề thi ĐH khối B – 2014)

Ơ
H
Đáp số: m=0,82gam

N
Bài 10:Đun hỗn hợp etylenglycol và axit cacboxylic X (phân tử chỉ có nhóm

Y
COOH) với xúc tác axit H2SO4 đậm đặc, thu được hỗn hợp sản phẩm chất hữu cơ trong

U
.Q
đó có chất hữu cơ Y mạch hở. Đốt cháy hoàn toàn 3,95 gam Y cần 4,00 gam oxi, thu
được CO2 và H2O theo tỉ lệ mol 2: 1. Biết Y có CTPT trùng với CTĐGN, Y phản ứng với

TP
NaOH theo tỉ lệ mol tương ứng 1: 2. Xác định CTCT của X và Y

ẠO
(Trích đề thi THPT QG - 2015)

Đ
Đáp số: CTCT X, Y lần lượt là: HOOC-C≡C-COOH;

G
HOOC-C≡C-COOCH2CH2-OH

N
Ư
Bài 11:Hai este X, Y có cùng công thức phân tử C8H8O2và chứa vòng benzen trong

H
phân tử.

ẦN
Cho6,8gamhỗnhợpgồmXvàYtácdụngvớidungdịchNaOHdư,đunnóng,lượngNaOHphản
TR
ứng tối đa là 0,06 mol, thu được dung dịch Z chứa 4,7 gam ba muối. Tính khốilượng
muối của axit cacboxylic có phân tử khối lớn hơn trong Z (Trích đề thi ĐH khối A –
B
00

2014)
10

Đáp số: m =0,82 gam.
3

Bài 12:Xµ phßng ho¸ mét este A no ®¬n chøc b»ng mét l−îng võa ®ñ dung dÞch
2+

NaOH chØ thu ®−îc mét s¶n phÈm duy nhÊt B. C« c¹n dung dÞch sau ph¶n øng, nung B
ẤP

víi v«i t«i trén xót thu ®−îc r−îu Z vµ mét muèi v« c¬. §èt ch¸y hoµn toµn Z thu ®−îc
C

CO2 vµ h¬i H2O cã tû lÖ vÒ thÓ tÝch lµ 3 : 4 (trong cïng ®iÒu kiÖn). ViÕt ph−¬ng tr×nh ph¶n
A

øng vµ x¸c ®Þnh c«ng thøc cÊu t¹o cã thÓ cã cña este A.
Ó

Đáp số: CTPT (A): C4H6O2 ; A có 3 đồng phân cấu tạo mạch vòng
H
Í-

Dạng 2: Phản ứng đốt cháy este
-L

Bài 1: Để đốt cháy hoàn toàn 1 mol axit cacboxylic đơn chức X cần đủ 3,5 mol O2.
ÁN

Trộn 7,4 gam X với lượng đủ ancol no Y (biết tỉ khối hơi của Y so với O2 nhỏ hơn 2).
TO

Đun nóng hỗn hợp với H2SO4 làm xúc tác. Sau khi phản ứng hoàn toàn thu được 8,7 gam
este Z (trong Z không còn nhóm chức nào khác). Xác định công thức cấu tạo của Z
G

Đáp án : CTCT (Z) : C2H5COOCH2CH2OCOC2H5
N

Bài 2:Đốt cháy hoàn toàn 3,74 gam hỗn hợp CH3COOH, CH3COOCxHy, CxHyOH
Ư
ID

thu được 3,584 lít khí CO2 (đktc) và 3,42 gam H2O. Mặt khác, cho 3,74 gam X phản ứng
hết với 40ml dung dịch NaOH 1M thu được dung dịch Y và 0,05mol CxHyOH. Cô cạn
BỒ

dung dịch Y, thu được 2,86 gam chất rắn khan.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

a) Xác định CTPT của các chất trong X?
b) Tính % theo khối lượng của các chất trong X

N
(Trích đề thi chuyên Hóa Lê Quí Đôn Đà Nẵng 2012-2013)

Ơ
H
Đáp số: CTPT của rượu C2H5OH; % m CH3COOH =

N
Y
16,04%; CH3COOC2H5 = 36,9%; CxHyOH = 36,9%

U
.Q
Bài 3: Đốt cháy hoàn toàn m gam hỗn hợp X gồm hai chất hữu cơ có cùng CTPT

TP
cần dùng 54,88 lít khí oxi, thu được 47,04 lít khí CO2 và 37,8 gam H2O. Nếu cho m gam
X tác dụng hết với 800ml dung dịch NaOH 1M, thu được 16 gam ancol Y và dung dịch

ẠO
Z. Cô cạn dung dịch Z thu được 64,2 gam chất rắn khan. Các chất khí đều đo ở điều kiện

Đ
tiêu chuẩn. Xác định CTCT của 2 chất hữu cơ này và tính phần trăm khối lượng của

G
chúng. (Trích đề thi chuyên Hóa trường THPT Chuyên Lê Quí Đôn Đà Nẵng 2013-

N
2014)

Ư
H
ẦN
Đáp số: CTCT của este : CH3COOCH3 ; % m= 71,43%

TR
CTCT của axit: CH3CH2COOH ; %m =28,57%
Bài 4:Cho 44,8 gam chất hữu cơ A (chứa C, H, O và A tác dụng được với Na) tác
B
00

dụng vừa đủ với dung dịch NaOH, dung dịch thu được chỉ chứa hai chất hữu cơ B, D. Cô
cạn dung dịch thu được 39,2 gam chất B và 26 gam chất D.
10

- Đốt cháy 39,2 gam B thu được 13,44 lít CO2; 10,8 gam H2Ovà 21,2 gam Na2CO3.
3
2+

- Đốt cháy 26 gam D thu được 29,12 lít CO2; 12,6 gam H2Ovà 10,6 gam Na2CO3.
Biết các phản ứng xảy ra hoàn toàn, các khí đo ở đktc.
ẤP

1. Xác định công thức phân tử, công thức cấu tạo B, D. Biết công thức phân tử A,
C

B, D đều trùng công thức đơn giản nhất.
A

2. Xác định công thức cấu tạo A.
Ó
H
Í-

Đáp số: 1) CTPT B là: C2H3O3Na; CTCT B là: HOCH2COONa ; CTPT D là: C7H7ONa;
-L

Có 3 CTCT D: CH3-C6H4-ONa (0-; m-; p-)
ÁN

2) CTPT A: C11H12O5 ; Có 3 CTCT A: HO-CH2-COO-C6H4-CH3 (0-; m-; p-)
TO
G

Dạng 3: Phản ứng este hóa.
N

Bài 1: Axít no X tiến hành phản ứng este hóa giữa X và rượu etylic thu được este Z.
Ư
ID

Sau phản ứng tách hỗn hợp Y gồm este, axit và ancol. Chia 29,6gam Y thành hai phần
bằng nhau. Phần 1 phản ứng với 125ml dung dịch NaOH 1M thu được dung dịch chứa m
BỒ

gam muối và 6,9 gam rượu. Đốt cháy hoàn toàn phần 2 bằng khí oxi dư thu được 29,7
gam CO2 và 13,5 gam H2O

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

a) Viết CTCT của X và Z
b) Tìm m và tính hiệu suất phản ứng este hóa.
(Trích đề thi vào lớp 10 chuyên Hóa Amstedam Hà Nội 2012-2013)

N
Ơ
Đáp số: X là C2H5COOH ; CTCT CH3-CH2-COOH

H
;

N
m = 12gam; H% = 60%

Y
Z là C2H5COOC2H5 ; CH3CH2COOC2H5

U
.Q
TP
Bài 2*:Đun nóng hỗn hợp gồm 1 mol HCOOH; 1 mol CH3COOH và 2 mol C2H5OH

ẠO
có H2SO4 đặc xúc tác ở toC (trong bình kín dung tích không đổi) đến trạng thái cân bằng
thì thu được 0,6 mol HCOOC2H5 và 0,4 mol CH3COOC2H5. Nếu đun nóng hỗn hợp gồm

Đ
1 mol HCOOH, 3 mol CH3COOH và a mol C2H5OH ở điều kiện như trên đến trạng thái

G
N
cân bằng thì thu được 0,8 mol HCOOC2H5. Tính a?

Ư
Đáp số: a = 9,97mol

H
ẦN
Dạng 4: Hỗn hợp este và các chất hữu cơ khác

Bài
TR
B
1:ChoX,YlàhaichấtthuộcdãyđồngđẳngcủaaxitacrylicvàMX<MY;Zlàancolcócùngsố
00

nguyêntửcacbonvớiX;TlàestehaichứctạobởiX,YvàZ.Đốtcháyhoàntoàn11,16gamhỗnhợp
10

EgồmX,Y,Z,Tcầnvừađủ13,216lítkhíO2 (đktc),thuđượckhíCO2 và9,36gamnước.Mặtkhác
3

11,16gamEtácdụngtối đavớidungdịchchứa0,04molBr2. Tính khốilượngmuốithu
2+

đượckhichocùng lượng E trêntác dụng hết với dung dịch KOH dư.(Trích đề thi ĐH khối
ẤP

A – 2014)
C
A

Đáp số: m =4,68 gam.
Ó

Bài 2:Đốt cháy hoàn toàn 3,42 gam hỗn hợp gồm axit acrylic, vinyl axetat, metyl
H

acrylat và axit oleic, rồi hấp thụ toàn bộ sản phẩm cháy vào dung dịch Ca(OH)2 (dư). Sau
Í-
-L

phản ứng thu được 18 gam kết tủa và dung dịch X. Khối lượng X so với khối lượng dung
dịch Ca(OH)2 ban đầu đã thay đổi như thế nào?
ÁN

(Trích đề thi ĐH khối A – 2010 )Đáp số: Giảm 7,38 gam.
TO

Bài 3: P và Q có khối lượng hơn kém nhau 28 gam, phân tử mỗi chất đều chứa C, H
G

và 2 nguyên tử oxi. Cho 32,4 gam hỗn hợp Z gồm P và Q tác dụng với dung dịch NaOH
N

vừa đủ sau đó cô cạn dung dịch thì thu được 32,8 gam chất rắn khan. Phần bay hơi gồm

Ư

nước và hai rượu trong đó phần hơi của hai rượu chiếm thể tích bằng thể tích của 11,2
ID

gam khí nitơ đo ở cùng điều kiện. Khi đốt cháy hoàn toàn một lượng mol như nhau của
BỒ

hai rượu thì số mol CO2 tạo ra từ hai rượu hơn kém nhau 3 lần. Xác định CTCT các este
và phần trăm khối lượng của các chất trong Z.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

(Trích đề thi vào lớp 10 chuyên ĐH KHTN Hà nội năm 2008)
Đáp số: CTCT: (P) CH3COOCH3 ; (Q) CH3COOCH(CH3)CH3 hoặc

N
CH3COOCH2CH2CH3 %m : 68,52% và 31,48%

Ơ
Bài 4: X, Y là 2 axit cacboxylic đơn chức no mạch hở (MX< MY). T là este tạo bởi X, Y

H
N
và ancol no mạch hở Z. Đốt cháy hoàn toàn 8,58 gam E gồm X, Y, T bằng một lượng oxi

Y
vừa đủ thu được 7,168 lít CO2 và 5,22 gam nước. Mặt khác 8,58 gam E tác dụng với

U
dung dịch AgNO3 dư thu được 17,28 gam Ag. Cho cùng một lượng E ở trên tác dụng với

.Q
150ml NaOH 1M. Tính khối lượng chất rắn thu được sau phản ứng?

TP
Đáp số: m = 11,04gam

ẠO
Đ
Chương IV. THỰC NGHIỆM SƯ PHẠM

G
N
I. Mục đích thực nghiệm.

Ư
H
Đánh giá khả năng tiếp thu kiến thức mới, khả năng vận dụng kiến thức và khả

ẦN
năng tư duy sáng tạo của học sinh.
TR
Tìm kiếm học sinh có tố chất trở thành học sinh giỏi.
B
II. Phương pháp thực nghiệm.
00

1.Đối tượng:
10

- Chọn học sinh lớp 9 làm đối tượng thực nghiệm.
3
2+

- Chọn 16 học sinh lực học khá tương đương nhau .
ẤP

- Chia làm 2 nhóm thực nghiệm: Nhóm I và nhóm II
C
A

2. Cách tiến hành thực nghiệm :
Ó
H

Thực nghiệm theo kiểu đối chứng .
Í-

-Giáo viên cung cấp tài liệu về este và cung cấp đầy đủ cho học sinh nhóm I kiến
-L

thức từ cơ bản đến nâng cao về este. Ở nhóm II Giáo viên cung cấp tài liệu rất cơ bản về
ÁN

este và chỉ hướng dẫn các em tự đọc tài liệu.
TO

-Tiến hành thực nghiệm :
G

* Thực nghiệm lần 1 ( kiểm tra khả năng nhận thức ): Cho học sinh 2 nhóm làm các bài
N

tập cơ bản (các bài tập có trong sách giáo khoa, hệ thông các bài tập cơ bản…).

Ư

Chấm điểm : - Phân loại giỏi ,khá trung bình , kém.
ID

* Thực nghiệm lần 2 (kiểm tra độ nhuần nhuyễn về kiến thức và sự sáng tạo ): cho học
BỒ

sinh 2 nhóm làm các bài tập có trong các đề thi chọn học sinh giỏi, đề thi tuyển sinh các
cấp.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Chấm điểm :- Phân loại giỏi ,khá , TB , kém.
III. Kết quả thực nghiệm.

N
Sau khi tiến hành thực nghiệm tôi thu được kết qủa theo bảng sau :

Ơ
H
*Kết quả thực nghiệm lần 1:

N
Y
U
.Q
Kết quả Giỏi Khá Trung bình Yếu

TP
ẠO
Đối tượng

Đ
thực nghiệm

G
N
Ư
Nhóm I 87,5% 12,5% 0% 0%

H
ẦN
Nhóm II 75% 12,5% TR
12,5% 0%
B
00
10
3
2+

*Kết quả thực nghiệm lần 2:
ẤP
C

Kết quả Giỏi Khá Trung bình Yếu
A
Ó
H
Í-

Đối tượng
-L

thực nghiệm
ÁN

Nhóm I 50% 37,5% 12,5% 0%
TO
G
N

Nhóm II 12,5% 25% 25% 12,5%
Ư
ID
BỒ

IV. Đánh giá kết quả thực nghiệm.

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

Với nhóm I, học sinh đã được cung cấp tài liệu đồng thời được giáo viên truyền đạt
đầy đủ kiến thức về este và được giải đáp những vướng mắc về các vấn đề liên quan đến
este nên các em có kiến thức chắc và sắc hơn, từ đó vận dụng lí thuyết, kĩ năng bài tập

N
hiệu quả hơn, đồng thời phát huy được sự sáng tạo, khả năng phát hiện cũng như khả

Ơ
H
năng giải quyết vấn đề tốt hơn, nên nhóm I tiếp cận với các bài tập có trong các đề thi

N
học sinh giỏi chủ động hơn và kết quả đạt điểm khá giỏi cao hơn hẳn so với các học sinh

Y
ở nhóm II (đặc biệt phần bài tập nâng cao).

U
.Q
Với nền tảng kiến thức về este vững vàng sẽ tạo cho học sinh sự tự tin khi tiếp cận

TP
với những kiến thức mới, từ đó các em có thể áp dụng kiến thức này một cách thuần
thục, sáng tạo, hiệu quả và độ khắc sâu kiến thức của các em sẽ tốt hơn, tạo hứng thú cho

ẠO
các em muốn khám phá nhiều hơn nữa về môn Hóa học ./.

Đ
G
N
Ư
H
ẦN
TR
B
00
10
3
2+
ẤP
C
A
Ó
H
Í-
-L
ÁN
TO
G
N

Ư
ID
BỒ

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial
www.twitter.com/daykemquynhon www.facebook.com/daykem.quynhon
www.google.com/+DạyKèmQuyNhơn www.daykemquynhon.blogspot.com

PHẦN III: KẾT LUẬN.

N
Ơ
Trên đây tôi đã trình bày chuyên đề giảng dạy về “Este” mà tôi đã học hỏi và tích

H
N
lũy được trong quá trình giảng dạy của mình. Trong chuyên đề này tôi muốn chia sẻ kinh

Y
nghiệm, kiến thức ít ỏi mà tôi đã học hỏi và tích lũy được trong quá trình học tập và

U
giảng dạy của mình tới các thầy cô cũng như những học sinh nào đang có nhu cầu tìm

.Q
hiểu sâu về “ Este”, nó tương đối phù hợp với yêu cầu và mục đích giảng dạy, bồi dưỡng

TP
học sinh khá, giỏi chuẩn bị tham dự các kì thi THPT QG, học sinh giỏi các cấp THCS .

ẠO
Chuyên đề này có thể dùng làm tài liệu học tập cho học sinh các đội tuyển thi HSG môn
Hoá học cấp THCS và tài liệu tham khảo cho các thầy cô giáo trong giảng dạy và bồi

Đ
dưỡng học sinh giỏi Hoá học ở bậc THCS, tài liệu học tập cho học sinh THPT chuẩn bị

G
N
thi THPT Quốc Gia và tài liệu tham khảo cho các thầy cô giáo đang giảng dạy môn Hóa

Ư
học cấp THPT…

H
Trong quá trình viết chuyên đề có thể còn có nhiều thiếu sót, tôi rất mong nhận

ẦN
được được sự góp ý, bổ xung của các thầy cô, các đồng nghiệp và các em học sinh ... sao
TR
cho chuyên đề này ngày càng có chất lượng tốt hơn!
B
00
10
3
2+
ẤP
C
A
Ó
H
Í-
-L
ÁN
TO
G
N

Ư
ID
BỒ

www.facebook.com/daykemquynhonofficial
Sưu tầm bởi GV. Nguyễn Thanh Tú www.facebook.com/boiduonghoahocquynhonofficial