ESTEQUIOMETRIA

++
1.! El+paso+final++de+la+fabricación+de+platino+metálico+(para+usarse+en+convertidores+catalíticos+
de+automóviles)+está+representado+por+la+siguiente+ecuación:++
+
3(NH4)2PtCl6(s)+!+3Pt+(s)+++2+NH4+Cl+(s)+++16+HCl+(g)+
Completar++la+siguiente+tabla+para+la+reacción+de+12.35+gramos+de+(NH4)2PtCl6+
Sustancia++ Masa+molar+(g/mol)+ Masa+(gramos)++ Cantidad+de+sustancia+(mol)+
(NH4)2PtCl6+ + + +
Pt+ + + +
HCl+ + + +
N 2+ + + +
+
2.! Se+ desean+ obtener+ 10L+ de+ H2S+ en+ condiciones+ ambientales+ (22+ °C+ y+ 586+ mm+ de+ Hg)+ de+
acuerdo+a+la+siguiente+reacción:++
+
Sb2S5+++6HCl+!+2SbCl3+++2S+++3H2S+
Para+ ello+ se+ utiliza+ el+ HCl+ con+ densidad+ de+ 1.18+ g/mL+ y+ una+ pureza+ del+ 36+ %+ en+ peso.+ La+
pureza+del+Sb2S5+es+del+85%++
a)! ¿Qué+volumen+del+HCl+es+necesario?+
b)! ¿Cuántos+gramos+de+Sb2S5+se+requieren?+
+
3.! Se+tiene+150g+de+nitrato+de+plata+que+reaccionan+con+HCl+para+formar+cloruro+de+plata+que+
precipita+y+ácido+nítrico.+Si+se+obtienen+122g+de+cloruro+de+plata,+
a)! ¿Cuál+es+el+rendimiento+de+la+reacción?++
b)! Tomando+ en+ cuenta+ el+ rendimiento+ anterior,+ cuántos+ kg+ de+ nitrato+ de+ plata+ deben+
utilizarse+como+sustrato+para+obtener+10kg+de+cloruro+de+plata?+
+
4.! El+ material+ cerámico+ llamado+ nitruro+ de+ silicio,+ SI3N4,+ se+ elabora+ calentando+ silicio+ y+
nitrógeno+a+temperaturas+elevadas:++
3Si+(s)+++2N2+(g)+!+Si3N4+(s)+
¿Qué+masa+de+silicio+deberá+combinarse+con+un+exceso+de+N2+para+producir+1.0kg+de+Si3N4,+
si+en+este+proceso+tiene+una+eficiencia+del+92%?+
5.! El+ dicloruro+ de+ azufre+ puede+ obtenerse+ por+ un+ proceso+ representado+ por+ la+ siguiente+
ecuación:+
3SCl2+(l)++++4NaF+(s)++!+SF4+(g)+++S2Cl2+(l)+++4NaCl+(s)+
¿Qué+masa+de+SCl2+debe+reaccionar+con+floruro+de+sodio+para+preparar+1.2+gramos+de+S2Cl2+
si+el+rendimiento+de+la+reacción+es+del+51%?++
+
6.! Muchos+metales+reaccionan+con+halógenos,+para+dar+halogenuros+metálicos,+como+se+indica+
en+la+siguiente+reacción:++
Fe+(s)++++Cl2+(g)++!+FeCl2+(S)++
a)! Si+se+tienen+10+gramos+de+hierro,+¿Qué+masa+de+cloro+se+requiere+para+que+reaccione+
con+todo+el+hierro?++
b)! ¿Qué+cantidad+de+cloruro+de+hierro+(ll)+se+obtiene,+expresado+en+masa+y+en+cantidad+de+
sustancia?++

15+mol/L.+Las+reacciones+ consecutivas+son:+ ZnS+++3O2+!2SO2+2ZnO+ 2SO2+O2!2SO3+ SO3+H2O!H2SO4+ 11. c)! Si+el+hierro+tiene+una+pureza+del+80%.! El+volumen+de+disolución+de+ácido+5+M+necesario+para+la+reacción.3+%+de+óxido+de+hierro+negro.++ b.! Calcular+ la+ cantidad+ de+ blenda+ (ZnS)+ de+ riqueza+ 67%+ que+ se+ necesita+ para+ obtener+ una+ tonelada+de+ácido+sulfúrico+si+el+rendimiento+de+cada+reacción+es+del+75%.+llamado+magnetita.2+gramos+de+S2Cl2+ si+el+rendimiento+de+la+reacción+es+del+51%?++ + 9.! El+ dicloruro+ de+ azufre+ puede+ obtenerse+ por+ un+ proceso+ representado+ por+ la+ siguiente+ ecuación:+ 3SCl2+(l)++++4NaF+(s)++!+SF4+(g)+++S2Cl2+(l)+++4NaCl+(s)+ ¿Qué+masa+de+SCl2+debe+reaccionar+con+floruro+de+sodio+para+preparar+1.+ Si+ la+ masa+ de+ este+ precipitado+ es+ de+ 444+ g.+ ¿Cuántos+ moles+ de+ Fe+ (80%+ de+ pureza)+ deben+reaccionar+con+el+exceso+de+cloro+para+obtener+635+g+de+FeCl2?+ + 7.+ ¿Cuánto+ mineral+ deberá+ procesarse+para+obtener+100+toneladas+de+lingotes+de+hierro?++ + 8.! El+ aceite+ de+ canela+ (cinamon).+El+mineral+ se+tritura+en+pequeñas+partículas+y+se+mete+a+un+horno+de+fundición+en+el+que+sólo+el+78%+ del+ contenido+ de+ hierro+ se+ recupera+ en+ forma+ de+ lingote.+ obtenido+ de+ las+ ramas+ y+ hojas+ de+ árboles+ de+ canela+ que+ .! El+ aluminio+ reacciona+ con+ el+ ácido+ clorhídrico+ dando+ cloruro+ de+ aluminio+ e+ hidrógeno.+¿Cuánto+cloruro+de+hierro+(ll)+se+obtiene?++ d)! Si+ el+ rendimiento+ de+ la+ reacción+ es+ del+ 87%.+medido+a+27+ºC+y+740+mmHg.+ Se+ hacen+ reaccionar+ 100+ g+ de+ una+ muestra+ de+ aluminio+ del+ 81+ %+ de+ pureza+ con+ ácido+ clorhídrico.! ¿Cuántos+kg+de+ácido+sulfúrico+se+pueden+obtener+a+partir+de+un+kg+de+pirita+de++hierro+pura+ (FeS2).+ ¿qué+ cantidad+ de+ carbonato+ de+ férrico+ habría+reaccionado+en+la+primera+reacción?+ + 10.+ da+ lugar+ a+ un+ precipitado+ de+ hidróxido+ de+ hierro+ (III).! Al+tratar+ácido+sulfúrico+con+carbonato+de+hierro(III)+se+obtiene+un+producto+que+conyiene+ Fe+3.! Plantea+la+reacción+ b.! Un+mineral+contiene+21.! El+volumen+de+hidrógeno+gaseoso+obtenido.+si+se+llevan+a+cabo+las+reacciones+representadas+por+las+siguientes+ecuaciones:++ 4FeS2++++11O2+!+2Fe2O3+++8SO2+ 2SO2+++O2+!+2SO3++ SO3+++H2O+!+H2SO4++ + 12.+ al+ reaccionar+ con+ hidróxido+ sódico.+Fe3O4.+ Sabiendo+que+la+reacción+es+de+sustiticuón:+ a. + c.++ + 13.+Calcular:+ a.! Se+tratan+6+g+de+aluminio+con+50+cm3+de+disolución+acuosa+de+ácido+sulfúrico+0.! Calcula+el+volumen+de+hidrógeno+que+se+obtendrá+a+partir+de+la+reacción.+medido+a+ 20+ºC+y+745+mmHg.! El+peso+de+sulfato+de+aluminio+(III)+que+se+obtendrá+como+resultado+de+la+reacción+ + 14.

+ Éste+ se+ prepara+ haciendo+ reaccionar+ aldehído+ cinámico.+ a+ partir+ de+ la+ disolución+ anterior?+Cuentas+con+matraces+volumétricos+de+100+mL+y+una+pipeta+graduada+de+10+ mL.+considerando+un+ rendimiento+del+95+%.+ sin+ embargo+una+ concentración+ elevada+ de+ éste+ ocasiona+ severas+ irritaciones+ en+ la+ piel.! Si+el+rendimiento+de+la+reacción+es+del+80%.+C9H8O.+¿cuánto+sulfato+de+potasio+se+forma?+ + 17.5+%.! El+derivado+se+utiliza+en+soluciones+acuosas+al+3.+El+aire+contiene+el+21+%+en+volumen+ de+oxígeno.+ con+propiedades+similares.+ se+ utiliza+ en+ la+ producción+ de+ perfumes+ y+ cosméticos.89+g+de+cloruro+de+hierro+III+hexahidratado+en+agua+hasta+un+volumen+final+ de+250+mL.+H2.1+mol/L+del+derivado. crecen+ en+ las+ zonas+ tropicales.7+mol+de+hidrógeno+gaseoso.+ a.+medido+a+298+K+y+a+1+atm+de+presión+que+se+necesita+ para+tostar+dicha+cantidad+de+mineral.+si+el+resto+es+ganga+silícica.+ C9H8O.+¿qué+volumen+de+la+solución+se+requerirá?+ + 15.+ b.+C9H10O.+según+la+reacción:+ C9H8O(ac)+++++++H2(g)+++++→+++++C9H10O(ac)+ Para+obtener+el+derivado.+Determina+lo+siguiente:+ a.+de+fórmula+C9H10O.08+g/mL.3028g/mL+y+40+%+de+pureza.+A+partir+de+esta+disolución++ a)! ¿Cuál+es+la+concentración+inicial+del+compuesto?+ b)! ¿Cómo+ prepararías+ 100+ mL+ de+ una+ disolución+ 1+ X+ 10m6+ mol/L.+La+densidad+de+la+solución+es+ 1.+con+hidrógeno+gaseoso.+en+condiciones+normales+de+presión+y+temperatura++ De+acuerdo+con+la+siguiente+ecuación:+ .+se+hacen+reaccionar+15+L+de+solución+de+aldehído+ cinámico+3.5+mol/L+con++30.+ por+ lo+ que+ las+ concentraciones+ presentes+en+los+perfumes+deben+ser+bajas.! Se+disuelven+16.+qué+se+obtendrán+del+derivado+C9H10O.! La+cantidad+de+dióxido+de+azufre+que+se+obtiene+al+tostar+dos+toneladas+de+ pirita+de+un+90+%+de+riqueza.! Se+quiere+obtener+200+mL+de+CO2(g).5+%)+se+quiere+preparar+2+L+de+una+solución+de+ 0.+ b.! El+volumen+de+aire.++ + 16.+ pero+ que+ no+ causa+ irritaciones+ a+ la+ piel.+¿cómo+prepararías+1+L+de+esta+ solución?+Indica+los+pasos+y+las+cantidades+requeridas.+ + 18.+Con+la+finalidad+de+evitar+irritaciones+en+la+piel+ se+buscó+un+derivado+del+aldehído+cinámico.! El+sulfato+de+potasio+se+obtiene+mediante+la+reacción+representada+por+la+siguiente+ ecuación:+ 2KCl+++H2SO4+!+K2SO4+++2HCl+ Si+ se+ utilizan+ 25Kg+ de+ cloruro+ de+ potasio+ con+ una+ pureza+ del+ 90%+ y+ 25L+ de+ ácido+ sulfúrico+ con+una+densidad+de+1.! ¿Cuál+es+el+reactivo+limitante?+ b.! La+masa+en+gramos.! A+partir+de+la+solución+anterior+(al+3.+ Su+ constituyente+ principal+ es+ el+ aldehído+ cinámico.++ c.! En+la+tostación+de+la+pirita+según+la+siguiente+reacción:+ FeS2+++O2+!+SO2+++Fe2O3+ Determina:+ a.

+si+el+rendimiento+de+la+reacción+es+del+68%?++ + 20.! En+el+laboratorio+se+ponen+a+reaccionar+hidróxido+de+sodio+0. NaHCO3+++++HCl+→+CO2+++NaCl+++H2O+ El+ bicarbonato+ de+ sodio+ (hidrogenm+ carbonato+ de+ sodio)+ tiene+ 76%+ de+ pureza+ y+ el+ HCl+ es+ 1.! ¿Qué+material+está+en+exceso+y+cuánto+queda+sin+reaccionar?+ + + 21.! Una+mezcla+de+una+tonelada+de+CS2+y+2+toneladas+de+Cl2+se+pasa+por+un+tubo+caliente.+si+el+rendimiento+de+la+reacción+es+del+68%?++ + 22.2mol/L+y+se+produce+hidróxido+de+níquel.2mol/L+con+sulfato+de+níquel+ hexahidratado+también+0.+ c.++ + 19.! ¿Cuántos+ mL+ de+ cada+ uno+ de+ los+ reactivos+ se+ tendrán+ que+ poner+ a+ reaccionar+ para+ obtener+75+mg+de+hidróxido+de+níquel?+ b.! ¿Cuántos+mililitros+de+cada+reactivo+deben+reaccionar+para+obtener+75+mg+de+hidróxido+ de+níquel.! Balancearla+por+el+método+de+ión+electrón++ b.+sulfato+de+sodio+y+agua.003+g/mL+es+ necesario+para+obtener+5g+de+yodo+sólido?+ + + + + .+en+ donde+se+realiza+la+siguiente+reacción:+ CS2+++3Cl2+!+CCl4++++S2Cl2+ a.+ el+ yoduro+de+potasio+y+el+ácido+clorhídrico:+ + PbCrO4+(s)+++KI+(ac)+++HCl+(ac)+!+PbCl2+(ac)+++CrCl3+(ac)+++KCl+(ac)+++H2O+(l)+++I2+(s)+ a.2M+con+sulfato+de+níquel+ hexahidratado+también+0.! ¿Cuántos+mililitros+de+cada+reactivo+deben+reaccionar+para+obtener+75+mg+de+hidróxido+ de+níquel.! Se+ tiene+ la+ siguiente+ ecuación+ que+ representa+ la+ reacción+ entre+ el+ cromato+ de+ cobre.! ¿Cuánto+tetracloruro+de+carbono+se+puede+obtener?+ b.! ¿Qué+volumen+de+ácido+clorhídrico+con+37%+de+pureza+y+una+densidad+de+1.! En+el+laboratorio+se+ponen+a+reaccionar+hidróxido+de+sodio+0.2M+y+se+produce+hidróxido+de+níquel.+ a.5mol/L.! ¿Cuántos+ mL+ de+ cada+ uno+ de+ los+ reactivos+ se+ tendrán+ que+ poner+ a+ reaccionar+ para+ obtener+75+mg+de+hidróxido+de+níquel?+ d.+sulfato+de+sodio+y+agua.