You are on page 1of 2

UNIVERSIDAD PRIVADA ANTENOR ORREGO QUIMICA GENERAL

PRACTICA DE REACCIIONES DE OXIDOREDUCCION

I.- Balancee las siguientes semirreacciones y especifique si corresponde a un proceso de
oxidación o reducción:

a) Fe2+ Fe3+ b) MnO4 Mn2+ c) ClO- Cl-

d) I- IO3- e) PbO2 Pb2+ f) Cr2+ CrO42-

II.- En las siguientes reacciones químicas Redox, identifique las semirreacciones e identificar
cual es la sustancia que experimenta reducción u oxidación e identifique quien es el agente
reductor y agente oxidante:

a) Na + H2O ------> NaOH + H2

b) Mg + N2 ------> Mg3N2

c) Mg + O2 ------> MgO

d) C2H6O + O2 -------> CO2 + H2O

e) MnO2 + Al ------> Al2O3 + Mn

f) Zn + HCl ------> ZnCl2 + H2

g) Al + H2SO4 ------> Al2(SO4)3 + H2

h) Al + NaOH ------> Na3AlO3 + H2

i) CuS + HNO3 ------> Cu(NO3)2 + 3S + NO + H2O

III.- Balancee por el método ion electrón las siguientes reacciones Redox e identifique la
sustancia que se oxida o reduce.

a) ZnS + HNO3 S + NO + Zn(NO3)2 + H2O

b) CH3 – CH2 –OH + H2SO4 + K2Cr2O7 CH3-CHO + Cr2(SO4) + K2SO4 + H2O

c) KMnO4 + H2O2 + H2SO4 O2 + MnSO4 + K2SO4 + H2O

d) KI + H2SO4 H2S + H2O + I2 + K2SO4

e) KBr + K2Cr2O7 + H2SO4 Br2 + K2SO4 + Cr2(NO3)3 + H2O

f) HNO3 + HI NO + I2 + H2O

g) H2S + HNO3 S + NO + H2O

h) NaI + Fe2(SO4)3 I2 + Fe2SO4 + Na2SO4 + MnSO4 +

i) KMnO4 + Fe2SO4 + H2SO4 MnSO4 + Fe2(SO4)3 + K2SO4 + H2O

j) Ca(ClO)2 + KI + HCl I2 + CaCl2 + KCl + H2O

K) NaClO + NaI + HCl NaCl + I2 + H2O

l) K2Cr2O7 + FeCl2 + HCl CrCl3 + FeCl3 + KCl + H2O
UNIVERSIDAD PRIVADA ANTENOR ORREGO QUIMICA GENERAL

IV.-Balancear las siguientes ecuaciones iónicas netas por el método ion-electrón. La presencia
de H+ indica medio ácido y OH- medio básico.

a) MnO4-(ac) + H+(ac)+ Br-(ac) ------> Mn2+(ac) + Br2(l) + H2O(l)

b) Cr2O72-(ac) + H+(ac) + I-(ac) ------> Cr3+(ac) + I2(s) + H2O(l)

c) MnO4-(ac) + SO32-(ac) + H+(ac) ------> Mn2+(ac) + SO42-(ac) + H2O(l)

d) Cr2O72-(ac) + Fe2+(ac) + H+(ac) ------> Cr3+(ac) + Fe3+(ac) + H2O(l)

e) Cr(OH)4-(ac) + OH-(ac) + H2O2(ac) ------> CrO42-(ac) + H2O(l)

f) MnO2(s) + H+(ac) + NO2-(ac) ------> NO3-(ac) + Mn2+(ac) + H2O(l)

g) Sn(OH)3-(ac) + Bi(OH)3(s) + OH-(ac) ------> Sn(OH)62-(ac) + Bi(s)

h) Al(s) + NO3-(ac) + OH-(ac) + H2O ------> Al(OH)4-(ac) + NH3(g)

i) NO2(g) + OH-(ac) ------> NO3-(ac) + NO2-(ac) + H2O(l)

j) MnO4-(ac) + H2O(l) + NO2-(ac) ------> MnO2(s) + NO3-(ac) + OH-(ac)

k) I-(ac) + H+(ac) + NO2-(ac) ------> NO(g) + H2O(l) + I2(s)

l) Hg2Cl2(s) + NH3(ac) ------> Hg(l) + HgNH2Cl(s) + NH4+(ac) + Cl-(ac)

m) CrO42-(ac) + H2O(l) + HSnO2-(ac) ------> CrO2-(ac)+OH-(ac)+HSnO3-(ac)

n) C2H4(g) + MnO4-(ac) + H+(ac) ------> CO2(g) + Mn2+(ac) + H2O(l)

o) H2S(ac) + H+(ac) + Cr2O72-(ac) ------> Cr3+(ac) + S(s) + H2O(l)

p) ClO3-(ac) + H2O(l) + I2(s) ------> IO3-(ac) + Cl-(ac) + H+(ac)

q) Cu(s) + H+(ac) + SO42-(ac) ------> Cu2+(ac) + H2O(l) + SO2(g)

r) Fe2+(ac) + MnO4-(ac) ------> Fe3+(ac) + Mn2+(ac) (Medio ácido)

s) Br2(l) + SO2(g) ------> Br-(ac) + SO42-(ac) (Medio ácido)

t) Cu(s) + NO3-(ac) ------> Cu2+(ac) + NO2(g) (Medio ácido)

u) PbO2(s) + Cl-(ac) ------> PbCl2(s) + Cl2(g) (Medio ácido)