You are on page 1of 50

S GIÁO D C ÀO T O LÂM NG Tr ng THPT Chuyên Th ng Long ± à L t

TUY N T P

THI H C SINH GI I QU C GIA

MÔ HÓA H C

Biên So n: Th y Nguy n Thành Anh T tr ng b môn Hóa H c

àL t

Tháng 5/2005

*********************************************************************************************************************************

Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:1

Bé Gi¸o Dôc Vµ §µo T¹o

§Ò Thi Quèc Gia Chän HS Giái THPT M«n Thi: Ho¸ Häc Líp 12 - B¶ng A Ngµy thi: 2/3/1994 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) - - - - - o0o - - - - -

C©u 1:
1. Nªu ph-¬ng ph¸p ho¸ häc cã thÓ dïng ®Ó lo¹i c¸c chÊt ®éc sau: a. SO2, NO2, HF trong khÝ th¶i c«ng nghiÖp. b. L-îng lín clo trong phßng thÝ nghiÖm. c. Pb2+ hoÆc Cu2+ trong n-íc th¶i c¸c nhµ m¸y. ViÕt ®Çy ®ñ c¸c ph-¬ng tr×nh ph¶n øng x¶y ra. 2. Tõ 0,1 mol H2SO4 cã thÓ ®iÒu chÕ 1,12 lÝt; 2,24 lÝt; 3,36 lÝt SO2 ®-îc kh«ng? Gi¶i thÝch t¹i sao ®-îc hay kh«ng ®-îc. NÕu ®-îc, minh ho¹ b»ng c¸c vÝ dô cô thÓ. Tr×nh bµy ph-¬ng ph¸p thu SO2 tinh khiÕt ®iÒu chÕ ë trªn. C©u 2: 1. Lµm c¸c thÝ nghiÖm sau: o ThÝ nghiÖm 1: Cho vµo dung dÞch H2SO4 lo·ng ®ùng trong 3 cèc ®¸nh sè 1, 2, 3 mçi cèc mét miÕng s¾t. o ThÝ nghiÖm 2: Thªm vµo cèc 1 miÕng nh«m ®Æt tiÕp xóc víi miÕng s¾t. o ThÝ nghiÖm 3: Thªm vµ cèc 2 mét miÕng ®ång ®Æt tiÕp xóc víi miÕng s¾t. o ThÝ nghiÖm 4: Thªm vµo cèc 3 mét miÕng b¹c ®Æt tiÕp xóc víi miÕng s¾t. Tr×nh bµy vµ so s¸nh c¸c hiÖn t-îng x¶y ra trong c¸c thÝ nghiÖm trªn. ViÕt ph-¬ng tr×nh vÒ c¸c hiÖn t-îng ®ã. Gi¶i thÝch sù kh¸c nhau vÒ c¸c hiÖn t-îng x¶y ra trong c¸c thÝ nghiÖm. 2. a. H·y viÕt s¬ ®å vµ ph-¬ng tr×nh x¶y ra khi ®iÖn ph©n dung dÞch CuSO4 víi hai ®iÖn cùc b»ng Platin. b. Sau khi ®iÖn ph©n ®-îc mét thêi gian, ng¾t nguån ®iÖn ngoµi vµ nèi hai ®iÖn cùc trªn b»ng d©y dÉn, cã hiÖn t-îng g× x¶y ra? Gi¶i thÝch vµ minh ho¹ b»ng ph-¬ng ph¸p ho¸ häc. C©u 3: 1. a. Nªu ý nghÜa vÒ cÊu t¹o cña cÊu h×nh electron 1s22s22p63s23p6. b. CÊu h×nh nµy cã thÓ gÆp ë lo¹i chÊt nµo? Minh ho¹ b»ng tÝnh chÊt cô thÓ. c. Nªu tÝnh chÊt cña chÊt trong thÝ dô trªn. 2. Dùa vµo ®é ©m ®iÖn cña nguyªn tè trong b¶ng sau: Nguyeân toá O Na Mg Al Si P S Cl §é ©m ®iÖn 3,5 0,9 1,2 1,5 1,8 2,1 2,5 3,0 a. Nªu b¶n chÊt liªn kÕt ho¸ häc trong oxit cña mçi nguyªn tè ë møc oxi ho¸ cao nhÊt. b. Ph©n lo¹i c¸c oxit trªn. ViÕt ph-¬ng tr×nh ph¶n øng nªu râ tÝnh chÊt ho¸ häc cña mçi lo¹i oxit. 3. Tr×nh bµy cã gi¶i thÝch nh÷ng yÕu tè quan trong nhÊt lµm t¨ng tèc ®é ë giai ®o¹n oxi ho¸ SO2 thµnh SO3 trong qu¸ tr×nh s¶n xuÊt H2SO4. Caâu 4:

*********************************************************************************************************************************

Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:2

1. KhuÊy a gam mét chÊt trong b cm3 chÊt láng cã khèi l-îng riªng D1 ®Ó t¹o thµnh mét dung dÞch cã khèi l-îng riªng D2. a. ThiÕt lËp c«ng thøc dïng ®Ó tÝnh nång ®é % theo khèi l-îng vµ nång ®é mol/lit cña dung dÞch trªn. b. Nªu nh÷ng ®iÒu kiÖn ®Ó cã thÓ ¸p dông ®-îc c«ng thøc thiÕt lËp ra. Caâu 5: Bµi to¸n Hçn hîp A gåm hai oxit s¾t. DÉn tõ tõ khÝ hidr« ®i qua m gam A ®ùng trong èng sø ®· nung nãng ®Õn nhiÖt ®é thÝch hîp. S¶n phÈm t¹o nªn lµ 2,07 gam n-íc vµ 8,48 gam hçn hìp B gåm hai chÊt r¾n. Hoµ tan B trong 200 ml dung dÞch H2SO4 1M thu ®-îc mét dung dÞch D vµ 1971,2 ml H2 ®kc ë 27,30C vµ 1atm. Cho D t¸c dông víi dung dÞch NaOH d- sÏ ®-îc kÕt tña E. Cho E tiÕp xóc víi kh«ng khÝ ®Ó chuyÓn E hoµn toµn thµnh chÊt r¾n F. Khèi l-îng cña E vµ F kh¸c nhau 1,36 gam. 1. TÝnh m. 2. T×m nång ®é cña hîp chÊt vµ ion trong dung dÞch D, cho r»ng thÓ tÝch dung dÞch D thay ®æi kh«ng ®¸ng kÓ so víi thÓ tÝch dung dÞch H2SO4 ®· dïng. 3. Thµnh lËp c«ng thøc vµ tÝnh thµnh phÇn % theo khèi l-îng cña mçi chÊt trong A.

-----o

o-----

Cho H = 1, O = 16, Fe = 56 Häc sinh ®-îc sö dông b¶ng HTTH c¸c nguyªn tè ho¸ häc.

Bé Gi¸o Dôc Vµ §µo T¹o

§Ò Thi Quèc Gia Chän HS Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 2/3/1995 (180 phót, kh«ng kÓ thêi gian giao ®Ò ) Lµm tÊt c¶ c¸c C©u hái lý thuyÕt vµ Bµi to¸n. Bá 2, trong C©u II: 2, trong C©u III: 4, trong Bµi to¸n. - - - - - o0o - - - - -

B¶ng A: B¶ng B: A. C©u hái lý thuyÕt.

C©u I: 1. Trong phßng thÝ nghiÖm cã dd NaOH (dung m«i lµ n-íc). a/ H·y tr×nh bµy nguyªn t¾c ®Ó x¸c ®Þnh nång ®é mol/lit cña dd NaOH ®· cho. b/ H·y tù cho c¸c sè liÖu cô thÓ vµ tÝnh nång ®é mol/lit cña dd NaOH ®ã. 2. Cã 3 lä ®-îc ®¸nh sè, mçi lä cã chøa mét trong c¸c dd sau: natri sunfat, canxi axetat, nh«m sunfat, natri hi®roxit, bari clorua. ChÊt nµo ®-îc chøa trong lä sè mÊy, nÕu: o Rãt dd tõ lä 4 vµo lä 3, cã kÕt tña tr¾ng. o Rãt dd tõ lä 2 vµo lä 1, cã kÕt tña keo, tiÕp tôc rãt thªm kÕt tña ®ã bÞ tan. o Rãt dd tõ lä 4 vµo lä 5, ban ®Çu ch-a cã kÕt tña, rãt thªm th× cã l-îng nhá kÕt tña xuÊt hiÖn. Trong mçi tr-êng hîp gi¶i thÝch ®Òu cã viÕt ph-¬ng tr×nh ph¶n øng. 3. H·y ®Ò nghÞ c¸ch t¸ch lÊy tõng muèi trong hçn hîp r¾n gåm : clorua cña amoni, bari, magie (cã viÕt ®Çy ®ñ ph-¬ng tr×nh ph¶n øng). C©u II:

*********************************************************************************************************************************

Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:3

1. Thùc nghiÖm cho biÕt: sau 0,75 gi©y th× 30ml KOH 1M trung hoµ võa hÕt 30ml H2SO4 0,5M . H·y x¸c ®Þnh tèc ®é cña ph¶n øng ®ã theo l-îng KOH: theo l-äng H2SO4. KÕt qu¶ thu ®-îc ë mçi tr-êng hîp ®ã cã hîp lÝ kh«ng? T¹i sao? 2. H·y ®-a ra c¸c biÓu thøc cÇn thiÕt ®Ó chøng minh vai trß cña hÖ sè c¸c chÊt trong ph-¬ng tr×nh ph¶n øng khi x¸c ®Þnh tèc ®é ph¶n øng. (dïng ph-¬ng tr×nh aA + bB p d D + eE víi gi¶ thiÕt ph-¬ng tr×nh ®ã ®ñ ®¬n gi¶n ®Ó dïng trong tr-êng hîp nµy). C©u III: 1. CÇn 2 lÝt dd CuSO4 0,01M cã pH = 2.00 ®Ó m¹ ®iÖn: a. T¹i sao dd cÇn pH thÊp nh- vËy. b. Trong phßng thÝ nghiÖm cã muèi CuSO4.5H2O, n-íc nguyªn chÊt, H2SO4 98% (D = 1,84 g/ml). H·y tr×nh bµy c¸ch chuÈn bÞ dung dÞch trªn (bá qua chÊt phô). 2. Cã vËt cÇn m¹, b¶n ®ång, dd võa ®-îc chuÈn bÞ trªn vµ nguån ®iÖn thÝch hîp: a. H·y tr×nh bµy s¬ ®å cña hÖ thèng ®Ó thùc hiÖn sù m¹ ®iÖn nµy (cã vÏ h×nh). ViÕt ph-¬ng tr×nh ph¶n øng x¶y ra trªn ®iÖn cùc. b. TÝnh thêi gian thùc hiÖn sù m¹ ®iÖn nÕu biÕt: I = 0,5 Ampe; líp m¹ cã ®iÖn tÝch 10 cm2, bÒ dµy 0,17 mm; khèi l-îng riªng cña ®ång lµ 8,89 g/cm3; hiÖu suÊt sù ®iÖn ph©n nµy ®¹t 80%. C©u IV: H·y viÕt ph-¬ng tr×nh ph¶n øng ho¸ häc x¶y ra ë mçi tr-êng hîp sau ®©y: 1. §iÒu chÕ H2SO4 theo ph-¬ng ph¸p nitro : oxi ho¸ SO2 b»ng NO2 trong dd n-íc (cã th¨ng b»ng electron). 2. §iÒu chÕ mét chÊt trong thµnh phÇn cña nhiªn liÖu tªn löa b»ng c¸ch cho khÝ F2 ®i chËm qua muèi r¾n KNO3 hoÆc KClO4 (trong mçi tr-êng hîp ®Òu t¹o ra 2 s¶n phÈm, trong ®ã lu«n cã KF). 3. FeS hoÆc FeCO3 bÞ oxi ho¸ b»ng oxi trong kh«ng khÝ Èm t¹o thµnh Fe(OH)3 (cã th¨ng b»ng electron). 4. Fe2O3, Fe2S3, Fe(OH)3 bÞ hoµ tan trong dd axit m¹nh (d-) ®Òu t¹o ra ion [Fe(H2O)6]3+

B. Bµi to¸n:
Hçn hîp A gåm bét Al vµ S. Cho 13,275 gam A t¸c dông víi 400 ml HCl 2M thu ®-îc 8,316 lÝt khÝ H2 t¹i 27,3oC vµ 1 atm; trong b×nh sau ph¶n øng cã dd B. NÕu nung nãng 6,6375 gam A trong b×nh kÝn kh«ng cã oxi tíi nhiÖt ®é thÝch hîp, ®-îc chÊt D. Hoµ tan D trong 200 ml HCl 2M ®-îc khÝ E vµ dd F. 1. H·y tÝnh nång ®é c¸c chÊt vµ c¸c ion trong dd B, dd F. 2. TÝnh pH cña mçi dd ®ã vµ nªu râ nguyªn nh©n ph¶i t¹o pH thÊp nh- vËy. 3. DÉn khÝ E (®· ®-îc lµm kh«) qua èng sø chøa 31,5 gam bét CuO nung nãng tíi nhiÖt ®é thÝch hîp (kh«ng cã oxi cña kh«ng khÝ). Ph¶n øng xong ta thu ®-îc nh÷ng chÊt nµo? TÝnh l-îng mçi chÊt ®ã. (BiÕt trong s¶n phÈm : chÊt r¾n lµ nguyªn chÊt, tÝnh theo gam ; chÊt khÝ hay h¬i ®o t¹i 100oC, 1atm; khi tÝnh sè mol ®-îc lÊy tíi ch÷ sè thø 5 sau dÊu phÈy). 4. Rãt tõ tõ (cã khuÊy ®Òu) cho ®Õn hÕt 198 ml NaOH 10% (D = 1,10 g/ml) vµo dd F: a. H·y nªu vµ gi¶i thÝch hiÖn t-îng x¶y ra. b. TÝnh l-îng kÕt tña thu ®-îc (nhiÒu nhÊt; Ýt nhÊt).

-----o

o-----

*********************************************************************************************************************************

Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:4

Cho Cu = 64; S = 32; Al = 27; O = 16; H = 1.
Ghi chó: ThÝ sinh ®-îc dïng lo¹i m¸y tÝnh c¸ nh©n bá tói, b¶ng sè logarit

Bé Gi¸o Dôc Vµ §µo T¹o THPT

§Ò Thi Quèc Gia Chän HäC SINH Giái M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 3/3/1995 (180 phót, kh«ng kÓ thêi gian giao

®Ò ) B¶ng A: Lµm tÊt c¶ c¸c C©u hái lý thuyÕt vµ Bµi to¸n B¶ng B: Bá 2. trong C©u IV: 2. trong Bµi to¸n

A. C©u hái lý thuyÕt:
C©u I: 1. H·y s¾p xÕp c¸c hîp chÊt trong d·y sau ®©y theo thø tù t¨ng dÇn møc ®é linh ®éng cña nguyªn tö H trong nhãm chøc (cã vÝ dô vÒ ph¶n øng kÌm theo): axit axetic, r-îu etylic, phenol, n-íc. 2. §é ©m ®iÖn cña C trong C2H6, C2H4, C2H2 t-¬ng øng b»ng 2,48; 2,75; 3,29. H·y s¾p xÕp ba chÊt trªn theo thø tù gi¶m dÇn ®é ph©n cùc cña liªn kÕt C-H; lÊy vÝ dô ph¶n øng ho¸ häc ®Ó minh ho¹ vµ dïng c¸c sè liÖu trªn ®Ó gi¶i thÝch sù s¾p xÕp ®ã. C©u II: 1. H·y gäi tªn (CH3)2CH-CH =CH-C(CH3)3
(CH3)2CH CH CH CH2 C(CH3)3

Nh÷ng hi®rocacbon nµy cã ®ång ph©n cis-trans hay kh«ng? ViÕt c«ng thøc c¸c ®ång ph©n ®ã (nÕu cã). §iÒu kiÖn vÒ cÊu t¹o ®Ó cho mét hîp chÊt h÷u c¬ cã ®ång ph©n cis-trans lµ g×? 2. Axit elai®ic lµ ®ång ph©n cña axit oleic. Khi oxi ho¸ m¹nh axit elai®ic b»ng KMnO4 trong H2SO4 ®Ó c¾t nhãm - CH = CH - thµnh hai nhãm - COOH, thu ®-îc hai axit cacboxylic cã m¹ch kh«ng ph©n nh¸nh lµ C9H18O2 (A) vµ C9H16O4 (B) ViÕt c«ng thøc cÊu t¹o cña A vµ B, tõ ®ã suy ra c«ng thøc cÊu t¹o cña axit elai®ic. ViÕt ph-¬ng tr×nh ph¶n øng oxi ho¸ ë trªn. Axit elai®ic vµ axit oleic lµ nh÷ng chÊt ®ång ph©n lo¹i g×? C©u III: 1. Polime cao su thiªn nhiªn vµ polime lÊy tõ nhùa c©y gut-ta-pec-cha ®Òu cã c«ng thøc (C5H8)n: lo¹i thø nhÊt cã cÊu tróc cis, lo¹i thø hai cã cÊu tróc trans. ViÕt c«ng thøc cÊu t¹o mét ®o¹n m¹ch polime cho mçi lo¹i. 2. Cho HCl t¸c dông víi cao su thiªn nhiªn sinh ra cao su hi®roclo chøa 20,6% Cl trong ph©n tö. ViÕt ph-¬ng tr×nh ph¶n øng ®ã vµ cho biÕt trong ph©n tö cao su hi®rocio cã cßn cÊu tróc cis hay kh«ng? Gi¶i thÝch. C©u IV:

Br. 2. F cßn B t¹o ra 2 chÊt G.85 gam CO2.Khi hoµ tan SO2 vµo H2O. 90 gam chÊt D. Mçi cÊu h×nh ®óng ®ã lµ cÊu h×nh cña h¹t nµo? H·y viÕt mét ph-¬ng tr×nh ph¶n øng chøng minh tÝnh chÊt ho¸ häc ®iÓn h×nh ( nÕu cã ) cña h¹t ®ã? 2.Bµi to¸n: Hai hîp chÊt h÷u c¬ A. §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 2/3/1996 (180 phót. 40 gam chÊt E vµ 30 gam chÊt F. b¸n kÝnh nguyªn tö cña c¸c nguyªn tè ®ã. H¬i cña C ph¶n øng víi H2 nhê chÊt xóc t¸c Ni cho chÊt D (C10H13O(OCH3)). 5. F. Y.sau: (1) 1s22s12p5 (2) 1s22s22p53s23p64s23d6 (3) 1s22s22p64p64s2 b) ViÕt l¹i cho ®óng mçi cÊu h×nh trªn. E. Sè hiÖu cña nguyªn tö Y b»ng trung b×nh céng sè hiÖu cña nguyªn tö X vµ Z. D ph¶n øng víi dd KMnO4 trong H2SO4 t¹o thµnh axit 3. H. b) So s¸nh ®é ©m ®iÖn. c¸c c«ng thøc trong ngoÆc ®¬n ë trªn vµ c«ng thøc ph©n tö. B cã cïng c«ng thøc ph©n tö vµ ®Òu chøa C. §èt ch¸y hoµn toµn 1.6 gam br«m benzen. B. 1.3oC vµ 1atm. O = 16. C©u II: 1. E. B. d) T×m c¸ch t¸ch tõng oxit ra khái hçn hîp oxit cña 3 nguyªn tè ®ã. Sau ph¶n øng thu ®-îc 125. 2. C vµ c¸c c«ng thøc cÊu t¹o cã thÓ cã cña D. cã c¸c c©n b»ng sau: SO2 + H2O H2SO3 (1) + (2) H2SO3 H + HSO3 . khi ®un nãng víi dd NaOH lo·ng chÊt A t¹o ra chÊt C cã chøa mét nhãm chøc. a) H·y x¸c ®Þnh vÞ trÝ c¸c nguyªn tè ®ã trong b¶ng tuÇn hoµn c¸c nguyªn tè ho¸ häc.35 gam chÊt C thu ®-îc 3. ChÊt B kh«ng t¸c dông víi dd NaOH nh®iÒu kiÖn ë trªn. ViÕt c«ng thøc cÊu t¹o cña A. Khi cho A hoÆc B ph¶n øng víi Br2 (cã mÆt bét Fe) ®Òu thÊy khi HBr tho¸t ra: sau ph¶n øng A t¹o ra 3 chÊt D. H = 1. A ph¶n øng víi dd NaOH t¹o thµnh chÊt B (C10H11O2Na). 1.4-(CH3O)2C6H2COOH vµ axit axetic. Ba nguyªn tè X. c) So s¸nh tÝnh baz¬ cña c¸c hi®roxit.4-®imetoxibenzoic cã c«ng thøc 3. H·y cho biÕt chÊt A ph¶n øng víi Br2 khã (hoÆc dÔ) h¬n benzen bao nhiªu lÇn? -----o Bé Gi¸o Dôc Vµ §µo T¹o o----- Cho Br = 80. ViÕt cÊu h×nh e cña nguyªn tö vµ gäi tªn tõng nguyªn tè. C kh«ng cã ®ång ph©n cis-trans.4 gam chÊt C ph¶n øng hoµn toµn víi Na cho 0. F.kh«ng ph¶n øng víi H2O ë ®iÒu kiÖn th-êng. B. Nguyªn tö cña 3 nguyªn tè nµy hÇu nh. G. Cho hçn hîp gåm 171gam chÊt A vµ 78 gam benzen ph¶n øng víi Br2 cã mÆt bét Fe. E. H.616 lÝt H2 ë 27. kh«ng kÓ thêi gian giao ®Ò ) C©u I: 1. BiÕt r»ng ph©n tö cña D. H ®Òu chøa 64% Br.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:5 Tõ mét loµi thùc vËt ng-êi ta t¸ch ®-îc chÊt A (C10H12O2). B ph¶n øng víi CH3I cho chÊt C (C10H11O(OCH3)) vµ NaI. Z trong cïng mét chu kú cã tæng sè hiÖu nguyªn tö lµ 39. B. G. C: biÕt r»ng A. ViÕt ph-¬ng tr×nh c¸c ph¶n øng x¶y ra. a) H·y chØ ra ®iÓm sai ë mçi cÊu h×nh e. ViÕt c«ng thøc cÊu t¹o cña A. H.

ng-êi ta lµm hai thÝ nghiÖm sau: ThÝ nghiÖm 1: ®èt phèt pho trong luång khÝ NO. B»ng c¸ch nµo lo¹i bá mçi khÝ trong hçn hîp khÝ sau: a) SO2 trong hçn hîp SO2 vµ CO2 b) SO3 trong hçn hîp SO3 vµ SO2 c) CO2 trong hçn hîp H2 vµ CO2 d) HCl trong hçn hîp HCl vµ CO2 C©u III: 1.qua dd ®ã. .123 gam H3PO4 a) H·y viÕt ph-¬ng tr×nh ph¶n øng x¶y ra (trong b×nh nhiÖt l-îng kÕ cã H2O) b) TÝnh tèc ®é trung b×nh cña qu¸ tr×nh t¹o ra H3PO4 ë mçi thÝ nghiÖm trªn.0549 atm. sôc CO2 d. sau 12¶thu ®-îc 1. K[Al(OH)4(H2O)2] vµ bïn quÆng CaSiO3 . b/ Thªm HCl c/ Thªm NaOH d/ Thªm KMnO4 2. O2. khi ®¹t tíi c©n b»ng ho¸ häc th× cã PNH3 = 0.Tõ thùc nghiÖm ng-êi ta x¸c ®Þnh ®-îc: khi ph¶n øng NH3(khÝ) + H2S(khÝ) (1) NH4HS (r¾n) ®¹t tíi c©n b»ng th× tÝch sè PNH3. §Ó x¸c ®Þnh nhiÖt sinh cña NO b»ng ph-¬ng ph¸p nhiÖt l-îng kÕ. Na[Al(OH)4(H2O)2]. H·y viÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:6 (3) H+ + SO32HSO3Nång ®é cña SO2 ë c©n b¨ng thay ®æi ra sao (cã gi¶i thÝch) ë mçi tr-êng hîp sau: a/ ®un nãng dd.Nung Nefelin (NaKAl2Si2O8) víi CaCO3 trong lß ë 1200oC .Mét trong nh÷ng ph-¬ng ph¸p ®iÒu chÕ Al2O3 trong c«ng nghiÖp tr¶i qua mét sè giai ®o¹n chÝnh sau ®©y: . C©u IV: 1.Ng©m n-íc s¶n phÈm t¹o thµnh ®-îc dd muèi aluminat. b) NÕu ban ®Çu ®-a vµo b×nh ®ã (ch©n kh«ng) mét l-îng NH4HS r¾n vµ khÝ NH3. ThÝ nghiÖm 2: ®èt phèt pho trong hçn hîp ®ång thÓ tÝch N2. Ph¶n øng nµo x¶y ra khi lµm b·o hoµ dd Na2CO3 (bá qua sù thuû ph©n) b»ng: a/ KhÝ Cl2 b/ KhÝ NO2 2.ChiÕt lÊy dd. MnO4-/Mn2+ H·y hoµn thµnh ph-¬ng tr×nh ph¶n øng sau (nÕu cã) a) K2Cr2O7 + HCl p ? b) Cl2 + FeCl2 p ? c) FeCl3 + HCl p ? d) Cl2 + MnSO4 p ? e) KMnO4 + FeCl3 p ? f) KMnO4 + HCl p ? . Sau 10¶ thu ®-îc 2. H·y tÝnh ¸p suÊt khÝ NH3 trong b×nh tr-íc khi ph¶n øng (1) x¶y ra t¹i 25oC 2. T¹i sao cã sù kh¸c nhau vÒ trÞ sè ®ã? 3. PH2S = 0.109 (trÞ sè nµy lµ h»ng sè ë nhiÖt ®é 25oC) a) H·y x¸c ®Þnh ¸p suÊt chung cña khÝ t¸c dông lªn hÖ (1) nÕu ban ®Çu b×nh ch©n kh«ng vµ chØ ®-a vµo ®ã NH4HS r¾n. Cl2/2Cl-. Cã c¸c cÆp: Cr2O72-/2Cr3+.Nung kÕt tña Al(OH)3 ®-îc Al2O3. Fe3+/Fe2+.508 gam H3PO4.

2. b»ng c¸ch nµo cã thÓ nhËn ra chÊt trong mçi dd (cã gi¶i thÝch). Cho hçn hîp sau ph¶n øng t¸c dông víi dd axit v« c¬ lo·ng.sau: 2-Clo2Metyl-Butan: 28. CH3COOH. M« t¶ hiÖn t-îng nµy b»ng c«ng thøc vµ gi¶i thÝch.NÕu a = 1mol vµ b t¨ng gÊp 5 lÇn th× l-îng este t¨ng gÊp bao nhiªu lÇn? C©u IV: 1. 3. Hîp chÊt A (C18H18O2Br2) ph¶n øng ®-îc víi dd NaOH nãng. 2. SO42-. E.> Cr2O72. H vµ viÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra. b) Trong 5 dd. Nªu c¸c biÖn ph¸p ®Ó ph¶n øng nhanh ®¹t tíi tr¹ng th¸i c©n b»ng. a) H·y cho biÕt c«ng thøc chÊt tan hoÆc chÊt Ýt tan t¹o thµnh. n-C10H21OH.TÝnh gi¸ trÞ cña K khi a =b =1mol vµ c = 0. NO3-. Cl-. Tõ B thùc hiÖn chuyÓn ho¸ theo s¬ ®å sau: Cl2 .655 mol . C6H5OH. nh÷ng chÊt tan kÐm trong n-íc? Gi¶i thÝch. C6H5NH2. H cã ®ång ph©n Cis-trans.t o B €€€ D €€€€ E €€€ G €€€€€ H p p p p (D chøa 1 nguyªn tö Clo trong ph©n tö. b) NÕu nh×n ph©n tö n-Butan theo däc trôc liªn kÕt C2-C3 ta sÏ thÊy cã bao nhiªu d¹ng xen kÏ nhvËy? D¹ng nµo chiÕm -u thÕ h¬n? V× sao? C©u III: §Æc ®iÓm cña ph¶n øng este ho¸ lµ thuËn nghÞch? 1.0% 4-Clo-2Metyl-Butan: 12.4% 1-Clo-2Metyl-Butan: 24. Oxi ho¸ B hoÆc C ®Òu thu ®-îc axit para-brom-benzoic.170o C ddHCl ddNaOH. NÕu thay Clo b»ng Brom th× c¸c tØ lÖ % trªn biÕn ®æi thÕ nµo? Gi¶i thÝch. G. . kh«ng kÓ thêi gian giao ®Ò ) C©u I: Khi clo ho¸ C5H12 ë 100oC cã chiÕu s¸ng thu ®-îc c¸c s¶n phÈm víi tØ lÖ % nh. HOCH2CHOHCH2OH. Cã c¸c ion sau: Ba2+. NÕu kh«ng dïng thªm chÊt kh¸c. n-C6H14. H+(H3O+).2% 1. C.4% 3-Clo-2Metyl-Butan: 35.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:7 (BiÕt tÝnh oxi ho¸ gi¶m dÇn theo thø tù: MnO4. 2. Nªu c¸c biÖn ph¸p chuyÓn dÞch c©n b»ng ho¸ häc vÒ phÝa t¹o thµnh este. mçi dd chØ chøa mét trong c¸c chÊt ë phÇn (a). a) Khi nh×n Etan theo trôc däc liªn kÕt C-C ta thÊy r»ng c¸c nguyªn tö H nèi víi 2 nguyªn tö C kh«ng che khuÊt nhau tõng cÆp mét mµ xen kÏ nhau. C5H6 vµ C6H12O6 (glucoz¬) a) Cho biÕt nh÷ng chÊt tan tèt. E. Ag+. b) H·y viÕt c«ng thøc c¸c d¹ng liªn kÕt hi®ro gi÷a c¸c ph©n tö C6H5OH vµ C2H5OH. Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 3/3/1996 (180 phót. B. Cã c¸c hîp chÊt sau: C2H5OH. . ViÕt ph-¬ng tr×nh ph¶n øng (dïng c«ng thøc cÊu t¹o) vµ c¬ chÕ ph¶n øng. D¹ng nµo bÒn nhÊt.} Cl2 > Fe3+) 3. Oxi ho¸ trong ®iÒu kiÖn thÝch hîp C chuyÓn thµnh B. gi¶ sö cho a mol axit axetic ph¶n øng víi b mol r-îu etylic vµ sau khi ph¶n øng ®¹t tíi tr¹ng th¸i c©n b»ng ®· thu ®-îc c mol este. G. C6H5CH2OH.as H 2SO 4 . H ®Òu lµ s¶n phÈm chÝnh) a) ViÕt c«ng thøc cÊu t¹o cña A. H·y dù ®o¸n tØ lÖ % s¶n phÈm monoclo ho¸ Propan vµ IsoButan. ThiÕt lËp biÓu thøc tÝnh h»ng sè c©n b»ng K. D. C¸c s¶n phÈm D. d¹ng nµo kÐm bÒn nhÊt? Gi¶i thÝch. thu ®-îc B (C9H9O2Br) vµ C (C9H11OBr). C©u II: 1.

ViÕt c«ng thøc cÊu t¹o cña Heliotropin.4metylen dioxiBenzoic vµ isosafrol cã ®ång ph©n cis-trans COOH 3. ViÕt c«ng thøc cÊu t¹o A. Thùc hiÖn ph¶n øng t¸ch Hi®ro tõ A thu ®-îc hçn hîp s¶n phÈm B. ÔÛ tÇng trªn cña khÝ quyÓn cã líp ozon lµm l¸ ch¾n b¶o vÖ tr¸i ®Êt khái t¸c h¹i cña tia cùc tÝm do mÆt trêi räi xuèng nhê duy tr× c©n b»ng ho¸ häc. NO2. < 7 hoÆc } 7 ?). 2. NH3. c) (NH4)2SO4. Gi¶ sö chØ x¶y ra sù t¸ch Hi®ro. HiÖn t-îng g× x¶y ra ®ång thêi víi hiÖn t-îng ³lç thñng ozon´? Gi¶i thÝch. hv O2 + O O3 GÇn ®©y c©n b»ng nµy bÞ ph¸ vì. NO. Cho biÕt gi¸ trÞ -íc l-îng pH cña c¸c dd ®ã (pH > 7. H·y xÕp c¸c c«ng thøc sau ®©y theo thø tù t¨ng dÇn sè oxi ho¸ cña N: N2. sau ®ã oxi ho¸ isosafrol nhê chÊt oxi ho¸ thÝch hîp. d) BaCl2. safrol vµ isosafrol. C¸c thÓ tÝch ®Òu ®o ë cïng ¸p suÊt. H·y chØ râ nguyªn nh©n vÒ cÊu t¹o nguyªn tö ®Ó N cã sè c¸c oxi ho¸ ®ã. 3. Cho c¸c chÊt sau: a) Na2CO3. C¸c khÝ nµy lµm xóc t¸c cho qu¸ tr×nh biÕn ®æi O3 thµnh O2. C¬ chÕ ph©n huû «zon bëi Freon (thÝ dô CF2Cl2) viÕt nh. HNO3. TÝnh thµnh phÇn % thÓ tÝch cña hçn hîp B. 2. §èt ch¸y hoµn toµn 4. Mét trong c¸c nguyªn nh©n lµ con ng-êi th¶i vµo khÝ quyÓn mét l-îng ®¸ng kÓ NO vµ Cl (Cl do clo-flo cacbon tõ c¸c m¸y l¹nh tho¸t vµo kh«ng khÝ t¹o ra hv CF2Cl2 p CF2Cl + Cl ). b) KNO3.252 lÝt B (®ktc) qua dd Br2 lµm cho khèi l-îng dd nÆng thªm 0. HNO2.72 lÝt CO2 (®ktc). BiÕt r»ng heliotropin ph¶n øng ®-îc víi AgNO3 trong dd NH3 cho muèi cña axit 3. C¸c chÊt Freon g©y ra hiÖn t-îng ³lç thñng «zon´. Heliotropin C8H6O3 (chÊt ®Þnh h-íng trong c«ng nghiÖp h-¬ng liÖu) ®-îc ®iÒu chÕ tõ chÊt safrol C10H10O2 (trong tinh dÇu x¸ xÞ) b»ng c¸ch ®ång ph©n ho¸ safrol thµnh Isosafrol C10H10O2.032 lÝt B (®ktc) thu ®-îc 6. Gi¶i thÝch.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:8 b) So s¸nh nhiÖt ®é nãng ch¶y cña B vµ C. kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: Lµm tÊt c¶ c¸c c©u B¶ng B: Kh«ng lµm phÇn V C©u I: 1. N2H4. DÉn 0. N2O. 1. NH2OH. lµ mét trong nh÷ng hØÓm ho¹ vÒ m«i tr-êng trªn tr¸i ®Êt. Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 14/3/1997 (180 phót. e) KHSO4 Gi¶i thÝch tÝnh chÊt axit-baz¬ cña c¸c dd n-íc cña c¸c chÊt trªn.21 gam. 2. C©u V: Tæng thÓ tÝch (ë 0oC) cña Hi®rocacbon A (khÝ) vµ thÓ tÝch võa ®ñ O2 ®Ó ®èt ch¸y hoµn toµn A b»ng 1/2 thÓ tÝch cña c¸c s¶n phÈm ch¸y ë 195oC. O .sau: hR p CF Cl €€€ Cly + CF Cly (a) 2 2 2 (b) p O3 + Cly €€ O2 + ClO O CH2 y O + ClO €€ O2 + Cl (c) p a) Gi¶i thÝch v× sao 1 ph©n tö CF2Cl2 cã thÓ ph©n huû hµng chôc ngµn ph©n tö Ozon? b) Trong khÝ quyÓn cã 1 l-îng nhá khÝ Metan. Sau khi lµm l¹nh ®Õn 0oC thÓ tÝch cña c¸c s¶n phÈm ch¸y cßn b»ng 1/2 thÓ tÝch ban ®Çu cña hçn hîp A vµ O2.

********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:9 H·y viÕt pt pø (riªng rÏ vµ tæng céng) ®Ó chøng minh vai trß xóc t¸c ®ã cña Cl vµ NO. b) Röa kÕt tña a b»ng n-íc råi cho t¸c dông tiÕp víi dd NH3 6M.77V. h·y thiÕt lËp biÓu thøc h»ng sè c©n b»ng cña ph¶n øng dùa vµo (2) theo nång ®é c©n b»ng cña c¸c chÊt. Ag+. 5. Al3+. h·y ph©n tÝch mét vÝ dô ®Ó minh ho¹. Läc lÊy kÕt tña (kÝ hiÖu a). H·y viÕt ph-¬ng tr×nh ph¶n øng x¶y ra khi dÉn l-îng d. 2. Cr3+. n lµ sè electron tham gia vµo qu¸ tr×nh oxi ho¸ hoÆc khö trong ph¶n øng).059 ((E0 lµ hiÖu thÕ ®iÖn cùc tiªu chuÈn cña c¸c cÆp chÊt ph¶n øng.005M.500M. Ra226 d-îc t¹o ra tõ ®ång vÞ nµo trong hai ®ång vÞ trªn? C©u IV: 1. C©u III: 1.72% U235 (cã thêi gian b¸n huû lµ 7. Trong mét hçn hîp gåm cã KMnO4 0. råi thªm tiÕp NH3 6M tíi pH } 9.28% U238 (cã thêi gian b¸n huû lµ 4. H·y tÝnh nång ®é c¸c ion khi ph¶n øng kÕt thóc. c) §un c¸ch thuû tíi nãng dd 2. 2. b) Mari vµ Pie Curi diÒu chÕ Ra226 tõ quÆng Uran trong thiªn nhiªn. Cr2O72-. Ba2+. C©u II: KMnO4 lµ thuèc thö ®-îc dïng ®Ó x¸c ®Þnh nång ®é c¸c muèi s¾t (II). FÐO4 0.a) Uran trong thiªn nhiªn chøa 99. Co2+. ECl /2Cl. Ba2+. Cu2+.51V.= 1. b) Thay H2SO4 b»ng HCl c) Thªm l-îng nhá KSCN vµo dung dÞch. d) Cho kÕt tña thu d-îc ë c) t¸c dông víi NaOH 2M cã mét Ýt dd H2O2. 2.5) chøa c¸c ion Ag+. 3. Hg22+ (kÝ hiÖu lµ dd 1).0. TÝnh tèc ®é ph©n r· mçi ®ång vÞ trªn trong 10gam U3O5 míi ®iÒu chÕ. dd cßn l¹i (kÝ hiÖu lµ dd2).010M. 0 Cho E0 . Cã dd muèi nitrat cña Mg2+.108n¨m). Mçi yÕu tè sau ®©y ¶nh h-ëng nh.36V MnO Fe 4 2 4. Fe3+. thªm vµo ®ã NH4Cl r¾n.khÝ H2S sôc qua dung dÞch (cã pH } 0.thÕ nµo ®Õn (2): a) T¨ng pH cña dung dÞch.020M vµ Fe2(SO4)3 0. H·y tÝnh h»ng sè c©n b»ng cña ph¶n øng theo (2).5. Ph¶n øng gi÷a KMnO4 vµ FeSO4 trong dung dÞch H2SO4 diÔn ra theo s¬ ®å: KMnO4 + FeSO4 + H2SO4 €€ K2SO4 + MnO4 + Fe2(SO4)3 + H2O (1) p 1. H·y viÕt ph-¬ng tr×nh ph¶n øng x¶y ra trong mçi tr-êng hîp sau ®©y: a) Thªm dd NaCl vµo dd 1 tíi khi kÕt tña ®-îc hoµn toµn. Gi¸ trÞ logarit h»ng sè c©n b»ng cña ph¶n øng oxi ho¸-khö ë 25oC d-îc tÝnh theo biÓu thøc: lgK = n(E0 0.1. H2SO4 0. Gi¶ thiÕt ph¶n øng ®ã lµ thuËn nghÞch./Mn 2+ = 1. H·y viÕt ph-¬ng tr×nh ph¶n øng (1) d-íi d¹ng ph-¬ng tr×nh ion (kÝ hiÖu ph-¬ng tr×nh ion lµ (2)). Eo 3+ /Fe2+ = 0. C©u V: . Hoµn thµnh c¸c ph-¬ng tr×nh ph¶n øng h¹t nh©n sau: a) ? €€ 82Pb206 + 2He4 p 17 b) €€ 8O17 + ? p 9F 239 c) €€ ? + 2He4 p 94Pu 1 d) + ? €€ 2He4 p 1H 2 e) ? + 1D €€ 2 2He4 p §èi víi mçi ®Þnh luËt b¶o toµn d-îc ¸p dông ®Ó lËp ph-¬ng tr×nh trªn.109n¨m) vµ 0. Ni2+.

biÕt MY = 174 ®vC. gi¶i thÝch møc ®é x¶y ra ph¶n øng (I) ë hai tr-êng hîp 1) vµ 2). X¸c ®Þnh c«ng thøc cÊu t¹o cña A. H·y cho biÕt kiÓu lai ho¸ cña c¸c nguyªn tè vµ lo¹i liªn kÕt (W. 3. Y bÞ thuû ph©n c¶ trong m«i tr-êng axit còng nh. ViÕt c«ng thøc c¸c ®ång ph©n cis-trans cña A. (Ho = -91. CH2=CH . 3. X¸c ®Þnh c«ng thøc cÊu t¹o cña Y. §un nãng A víi H2SO4 ®Æc thu ®-îc hai chÊt cã cïng c«ng thøc ph©n tö C10H18. b) Dùa vµo c¸c sè liÖu tÝnh ®-îc ë trªn. a) TÝnh (G = (Go + 2. 4. Oxi ho¸ mannoz¬ b»ng dd HNO3 ë 100oC thu ®-îc s¶n phÈm Y chøa 41. Hîp chÊt X chøa 60% C. 2) Còng t¹i 298K. T) trong c¸c hîp chÊt sau: Cl-CH2-CH =O.44%H vµ 35. biÕt MX = 180®vC.56%O trong ph©n tö. A cßn ®-îc ®iÒu chÕ b»ng c¸ch hi®ro ho¸ xóc t¸c chÊt 2-isopropyl-5-metylphenol (B).baz¬ t¹o ra axit polihi®roxi®icacboxylic hoÆc muèi t-¬ng øng.17%O. C©u IV: Thuû ph©n hoµn toµn 1 mol polipeptit X cho ta: . 2. 2.31 J. kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: Lµm tÊt c¶ c¸c c©u B¶ng B: Kh«ng lµm c©u VI C©u I: 1.0atm. MA = 156 ®vC. H·y s¾p xÕp c¸c hîp chÊt cho d-íi ®©y theo thø tù t¨ng dÇn nhiÖt ®é s«i.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:10 2NH3(khÝ) (I) XÐt ph¶n øng N2(khÝ) + 3H2(khÝ) 1) T¹i ®iÒu kiÖn tiªu chuÈn ®èi víi c¸c chÊt.38%C. C©u III: Tõ mét lo¹i tinh dÇu ng-êi ta t¸ch ®-îc chÊt A chøa 76. (CH3)3CH (D). 1. a) X¸c ®Þnh c«ng thøc cÊu t¹o cña X. ë d¹ng vßng 6 c¹nh mannoz¬ chØ kh¸c glucoz¬ ë chç nhãm OH ë nguyªn tö C2 n»m cïng phÝa víi OH ë nguyªn tö C3. TÝnh (Go vµ kÕt luËn vÒ kh¶ n¨ng x¶y ra ph¶n øng (I). Cã thÓ thùc hiÖn ®-îc c¸c ph¶n øng sau hay kh«ng.45%H vµ 55.303RTlg Kdp víi Kdp = P2NH3/P3H2PN2 vµ R = 8. 4.C|N.K-1. 3.92%C. PNH3 = 1. cã: (So = -197.K-1. KÕt qu¶ ®ã cã phï hîp víi nguyªn lý L¬ Sat¬liª hay kh«ng? T¹i sao? Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 15/3/1997 (180 phót. So s¸nh tÝnh chÊt axit cña A víi B.26%O trong ph©n tö. Thuû ph©n X thu ®-îc axit axetic vµ axit o-hi®roxibenzoic.8kJ. (CH3)3N (E). 12.5M ®Ó ph¶n øng hoµn toµn víi 5. CH3-CH2-CH2NH2 (C).82%H vµ 10.0atm. ViÕt c«ng thøc cÊu t¹o cña hai chÊt ®ã vµ viÕt c¬ chÕ ph¶n øng. cã PN2 = PH2 = 10.9J. dd n-íc cña X lµm hång quú tÝm. CH3-CH2-CH2-CH3 (A). CH2 = C = O 2.4g X. Mannoz¬ (monosaccarit) HOCH2-(CHOH)4-CH=O lµ ®ång ph©n cña glucoz¬. v× sao? C2H5ONa + CH3COOH p C2H5OH + CH3COONa (1) NaNH2 + CH4 p CH3Na + NH3 (2) C©u II: 1. Gi¶i thÝch. CH3-CH2-CH2OH (B). T = 298K. b) TÝnh thÓ tÝch võa ®ñ dd NaOH 0.

Ala-Ala vµ His-Ala. Lys vµ hîp chÊt N CH2 CH COOH Ar N H NH MÆt kh¸c nÕu thuû ph©n X nhê enzim cacboxipepti®aza th× thu ®-îc Lys vµ mét tetrapeptit. C6H5-CH2-CH2-C(CH3)2OH (A2) vµ tiÕn hµnh ph¶n øng trong ®iÒu kiÖn t-¬ng tù nh.COOH (axit glutamic hay Glu) 1 mol H2N -(CH2)4 . 10 C 0 + H 2O (B) h = 55% (A) 1.CH(NH2) .CH2 . X¸c ®Þnh c«ng thøc cÊu t¹o vµ tªn cña polipeptit X.CH(NH2) .22. B2. 7. So s¸nh tÝnh baz¬ cña c¸c nguyªn tö nit¬ trong ph©n tö gi÷a hai s¶n phÈm ®ã. 3. 6.CH(NH2) . Axit E-vinylacrilic. Glu. Axit metylmaloic CH3CH(COOH)2 2. C©u VI: Cã ph-¬ng tr×nh ph¶n øng sau: OH H2SO4 85 % .Thay A b»ng C6H5-CH(CH3)-CH2-CH2-C(CH3)2OH (A1). ViÕt c«ng thøc cÊu t¹o cña c¸c s¶n phÈm ®ecacboxyl ho¸ Ala vµ His.74.COOH (Alanin hay viÕt t¾t lµ Ala) 1 mol HOOC .59 vµ 9. C©u V: Tõ dÉn xuÊt halogen cã thÓ ®iÒu chÕ axit cacboxylic theo s¬ ®å sau:  CO Mg  HX 2 p p RX €€€€€ RMgX €€€€€ RCOOMgX €€€€p RCOOH -MgX ete khan ete khan 2 Tõ CH4 vµ c¸c chÊt v« c¬ cÇn thiÕt h·y viÕt ph-¬ng tr×nh c¸c ph¶n øng ®iÒu chÕ: 1. Ngoµi ra khi thuû ph©n kh«ng hoµn toµn X cho ta c¸c ®ipeptit Ala-Glu.4-(NO2)2C6H3F (kÝ hiÖu ArF) råi míi thuû ph©n th× thu ®-îc Ala. biÕt c¸c gi¸ trÞ pH1 lµ 3. B2 cao h¬n t¹o ra B? Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 13/3/1998 . b) T¹i sao hiÖu suÊt ph¶n øng t¹o ra B1.ViÕt c¬ chÕ ph¶n øng.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:11 2 mol CH3. 2. a) ViÕt c«ng thøc cÊu t¹o cña B1.trªn thu ®-îc s¶n phÈm h÷u c¬ t-¬ng øng B1 (hiÖu suÊt 86%). B2 (hiÖu suÊt 65%). 1. S¾p xÕp c¸c aminoaxit ë trªn theo thø tù t¨ng dÇn pH1 (pH1 ®-îc gäi lµ ®iÓm ®¼ng ®iÖn.00. t¹i pH ®ã aminoaxit tån t¹i ë d¹ng ion l-ìng cùc trung hoµ vÒ ®iÖn tÝch vµ kh«ng di chuyÓn vÒ mét ®iÖn cùc nµo c¶). 2.COOH (Lizin hay Lys) 1 mol N N H CH2 CH NH2 COOH Histidin hay His NÕu cho X t¸c dông víi 2. D-íi t¸c dông cña enzim thÝch hîp aminoaxit cã thÓ bÞ ®ecacboxyl ho¸ (t¸ch nhãm cacboxyl).CH2 . Gi¶i thÝch. 4. ViÕt c«ng thøc cÊu t¹o d¹ng chñ yÕu cña mçi aminoaxit trªn ë c¸c pH b»ng 1 vµ 13.

Fe / Fe3+ -0. 2. Y. thu h¬i Brom råi ho¸ láng. H·y cho biÕt chÊt oxi ho¸ trong mçi ph¶n øng trªn. Dùa vµo cÊu h×nh electron cña nguyªn tö. H·y ®Æt x vµo vÞ trÝ thÝch hîp trong d·y sè liÖu mµ ®Çu bµi ®· ®-a ra. 2*). NaOH. thu ®-îc muèi Y vµ chÊt Z.036.80 g chÊt X.60 g muèi Y th× sÏ ®-îc bao nhiªu chÊt Z? BiÕt r»ng X cã thÓ lµ mét trong c¸c chÊt: CaO. 3*). H·y ®Ò nghÞ s¬ ®å trong ®ã cã chØ râ liªn hÖ gi÷a c¸c chÊt b»ng mòi tªn (p) ®Ó dùa vµo ®ã vµ dïng sè liÖu trªn tÝnh ®-îc thÕ ®iÖn cùc tiªu chuÈn cña qu¸ tr×nh Fe3+ p Fe2+. Bµi III: 1. 1. Fe. 2.T×m ph-¬ng tr×nh cho mçi ph¶n øng ho¸ häc sau ®©y: a) K2Cr2O7 + ? + H2O p Cr(OH)3 + S + NH3 + KOH b) K2Cr2O7 + Na2SO3 + H2SO4 p ? + Na2SO4 + K2SO4 + H2O c) K2Cr2O7 + (NH4)2S + ? + H2O p K3[Cr(OH)6] + S + ? 2. 1. H2.440. X. NÕu sau qu¸ tr×nh trªn thu ®-îc 7. H·y so s¸nh ®é tan cña SO2 trong dd n-íc cã cïng nång ®é cña c¸c chÊt sau: a) NaCl. Zn. . Läc lÊy kÕt tña råi lµm kh« c©n nÆng 1. DÉn tõ tõ SO2 qua mét lÝt dd Ca(OH)2 (dd A). Bµi II: Dïng 94. Sau ph¶n øng thu ®-îc dd cã pH = 12. H·y viÕt ph-¬ng tr×nh c¸c ph¶n øng ho¸ häc chñ yÕu x¶y ra trong qu¸ tr×nh ®ã vµ cho biÕt vai trß cña H2SO4. 2. Z cã thÓ lµ nh÷ng chÊt nµo? H·y gi¶i thÝch cô thÓ vµ viÕt ph-¬ng tr×nh ph¶n øng ho¸ häc ®Ó minh ho¹. tiÕp ®Õn sôc khÝ Clo vµo dd míi thu ®-îc. sau ®ã dïng kh«ng khÝ l«i cuèn h¬i Brom vµo dd Na2CO3 tíi b·o hoµ Brom. kÝ hiÖu trÞ sè ®ã lµ x.200 gam.0 vµ kÕt tña CaSO3. Bµi IV: Cã sè liÖu: §iÖn cùc ThÕ ®iÖn cùc tiªu chuÈn (V) ë 25oC + H/H -2. h·y gi¶i thÝch tÝnh chÊt oxi ho¸ cña chÊt ®ã. 3*). Bµi V: 1. KOH.035g/ml) võa ®ñ t¸c dông hÕt víi 2.000. H·y viÕt ph-¬ng tr×nh ph¶n øng ho¸ häc x¶y ra khi dïng mét ho¸ chÊt th«ng th-êng dÔ kiÕm ®Ó huû hÕt l-îng Brom láng ch¼ng may bÞ lµm ®æ.96ml H2SO4 5% (D = 1. + H2 / 2H 0. 2+ Fe / Fe -0. Thùc tÕ ®· dïng t¸c nh©n nµo trong sè c¸c t¸c nh©n: Fe. ®Ó khö nitrobenzen thµnh anilin? ViÕt ph-¬ng tr×nh ph¶n øng vµ dïng sè liÖu trªn ®Ó gi¶i thÝch. MgO.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:12 (180 phót. c) NH4Cl. Trong thiªn nhiªn Brom cã chñ yÕu ë n-íc biÓn d-íi d¹ng NaBr.106. b) HCl. H·y viÕt ph-¬ng tr×nh ph¶n øng gi÷a Fe víi axit HCl vµ dïng sè liÖu trªn ®Ó gi¶i thÝch kÕt qu¶ cña ph¶n øng ®ã. Cuèi cïng cho H2SO4 vµo dd ®· b·o hoµ Brom.sau: Cho mét l-îng dd H2SO4 vµo mét l-îng n-íc biÓn. kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: Lµm tÊt c¶ c¸c bµi B¶ng B: Kh«ng lµm nh÷ng c©u cã dÊu * Bµi I: 1. H·y cho biÕt vai trß cña pH ®èi víi c¸c ph¶n øng ho¸ häc trªn trong sù t¹o thµnh c¸c s¶n phÈm chøa crom. d) Na2S. H. C«ng nghiÖp ho¸ häc ®iÒu chÕ Brom tõ n-íc biÓn theo qui tr×nh nh. b¶o vÖ m«i tr-êng. Brom láng hay h¬i ®Òu rÊt ®éc.

Tr×nh bµy c¬ chÕ cña ph¶n øng. Cho 4 dÉn xuÊt clo cña hi®rocacbon.. S¾p xÕp chóng theo tr×nh tù t¨ng dÇn nhiÖt ®é s«i. Ba2+. c) KMnO4®Æc. NH4+. b*) Cho dÉn xuÊt clo m¹ch kh«ng nh¸nh ë trªn t¸c dông víi clo (chiÕu s¸ng) theo tû lÖ mol 1:1.t dd HClp 4 b. Pd. H. I. ViÕt c¸c ph-¬ng tr×nh ph¶n øng ®Ó gi¶i thÝch c¸c hiÖn t-îng. B. Ni. 3. 2. 3.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:13 a) H·y tÝnh thÓ tÝch SO2 ë 27. Cho biÕt s¶n phÈm nµo chiÕm tØ lÖ cao nhÊt. Läc kÕt tña. Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc Líp 12 Ngµy thi: 14/3/1998 (180 phót. K.d-(®un nãng). d*) Tr×nh bµy giai ®o¹n quyÕt ®Þnh tèc ®é chung cña mçi ph¶n øng a)vµ b). råi cho t¸c dông víi dd HCl. E. D. ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra trong c¸c tr-êng hîp sau(A. chóng ®Òu cã c«ng thøc ph©n tö C4H9Cl. Cr2O72-.3oC. Iotbenzen ®-îc ®iÒu chÕ víi hiÖu suÊt cao theo s¬ ®å ph¶n øng sau: 300 C p C H + I + HNO €€€€ NO + NO + AgI 6 6 2 3 2 Cho biÕt vai trß cña HNO3? Nªu tªn c¬ chÕ ph¶n øng. ViÕt c¸c ph-¬ng tr×nh ph¶n øng t¹o thµnh s¶n phÈm chÝnh khi cho 1mol hi®rocacbon A t¸c dông víi c¸c chÊt sau: a) 1mol HNO3(cã H2SO4®Æc). 2. C. Bµi III: 1. L viÕt d¹ng c«ng thøc cÊu tróc ): H2. gi¶i thÝch. ViÕt c«ng thøc cÊu tróc c¸c ®ång ph©n cña: a) C3H5Cl b) ClCH =(C=)nCHCl. b) 1mol Br2(cã chiÕu s¸ng). Pb2+. to 2 2 D €€€€€€€€€p € 0 A E .vµo dd X chøa c¸c ion H+. b) p-CH3C6H4CH3 €€€€€€€€€ C €€€€ € p H2. kh«ng kÓ thêi gian giao ®Ò ) B¶ng A: lµm tÊt c¶ c¸c bµi B¶ng B: kh«ng lµm nh÷ng c©u cã dÊu* Bµi I: 1. t C a) C 6H5 C C COOCH3 B o dd KMnO d. b) TÝnh nång ®é mol/lÝt cña Ca(OH)2 trong dd A. 2*. §un nãng dd ta sÏ ®-îc khÝ mïi khai bay ra vµ cã kÕt tña vµng. G. Gi¶i thÝch. Cho NaOH d. 1atm ®· tan ®-îc vµo dd A. Khi Êy ta ®-îc dd mµu da cam vµ mét kÕt tña mµu tr¾ng. PbCO3 HOCH -CH OH. Bµi II: 1. víi n = 1. a) ViÕt c«ng thøc cÊu t¹o thu gän vµ gäi tªn 4 chÊt ®ã theo danh ph¸p th«ng dông vµ IUPAC.

. ddNaOH. T¹i sao? . Gi¶i thÝch. C2H5OH vµ c¸c dông cô cÇn thiÕt.) dd HClp 4 2 € p c) o-CH3C6H4CH3 €€€€€€€€€ G €€€€ H €€€€€€€ I p H SO ® c. 2. N H COOH (Pro) Bµi IV: 1. 1400C Æ dd NaOH.to C H5OH(d. b) Trong sè 3 hîp chÊt trªn. to p K €€€€€€€€€ 2 4 p d) o-BrCH2C6H4CH2Br €€€€€€€ L Cho biÕt øng dông cña E vµ I. c) Vitamin PP nãng ch¶y ë nhiÖt ®é cao h¬n co®iamin. S¾p xÕp chóng theo tr×nh tù t¨ng dÇn kh¶ n¨ng ph¶n øng ®ã. Gi¶i thÝch. mÆc dï cã ph©n tö khèi nhá h¬n. 2.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:14 dd KMnO d. biÕt r»ng phßng thÝ nghiÖm cã c¸c lo¹i giÊy quú. a) CH3-CH-COOH (Ala) b) H2N-(CH2)4-CH-COOH (Lys) NH2 NH2 c) HOOC-(CH2)2-CH-COOH (Glu) d. chÊt nµo cã nhiÖt ®é s«i cao nhÊt? Gi¶i thÝch. Ngoµi ra ng-êi ta cßn tæng hîp ®-îc chÊt nicotirin cã cÊu t¹o t-¬ng tù nicotin: CH3 N N N Nicotin CH3 N Anabazin N H Nicotirin a) ViÕt ph-¬ng tr×nh ph¶n øng x¶y ra khi cho mçi hîp chÊt trªn t¸c dông víi HCl theo tØ lÖ mol 1:1. Trong thuèc l¸ cã chÊt anabazin vµ mét ®ång ph©n cÊu t¹o cña nã lµ nicotin (rÊt ®éc). H·y ph©n biÖt 4 aminoaxit sau (cã gi¶i thÝch). Oxi ho¸ nicotin b»ng K2Cr2O7 trong dd H2SO4 thu ®-îc axit nicotinic dïng ®Ó ®iÒu chÕ c¸c amit cña nã lµ vitamin PP vµ co®iamin (thuèc ch÷a bÖnh tim): CONH2 N Nicotiamit Vitamin PP C N(C2H5)2 O Codiamin ViÕt c«ng thøc cÊu t¹o cña axit nicotinic vµ so s¸nh nhiÖt ®é nãng ch¶y cña nã víi axit benzoic. So s¸nh tÝnh baz¬ cña c¸c nguyªn tö nit¬ ®ã: gi¶i thÝch. dd NaNO2+ dd HCl. b*) Cho biÕt tr¹ng th¸i lai ho¸ cña c¸c nguyªn tö nit¬ trong ph©n tö vitamin PP. to Æ 2 4 H SO ® c.

Gi¶i thÝch vµ viÕt c¸c ph-¬ng tr×nh ph¶n øng.O .glicozit.3. 1.6-tetra-Ometyl cña C.10-3 mol 2.4.metylglucoz¬ vµ 1.tri O . Metyl ho¸ hoµn toµn c¸c nhãm OH cña 3.3. Thuû ph©n A (nhê chÊt xóc t¸c axit) sinh ra B vµ C: CHO H HO H H OH H OH OH CH2OH (B) H HO HO H CHO OH H H OH CH2OH (C) Cho A t¸c dông víi mét l-îng d. §un nãng D víi dd axit lo·ng thu ®-îc dÉn xuÊt 2.metylglucoz¬.6-tri-O-metyl cña B vµ dÉn xuÊt 2. C.O .6o vµ +34o. . c) TÝnh sè mol 2.6 .10-3 mol 2. b) V× sao dd mçi ®ång ph©n cña A tù biÕn ®æi vÒ [E]25D vµ cuèi cïng ®Òu ®¹t gi¸ trÞ 52o? TÝnh thµnh phÇn phÇn tr¨m c¸c chÊt trong dd ë gi¸ trÞ [E]25D = 525 vµ viÕt c«ng thøc cÊu tróc cña c¸c chÊt thµnh phÇn ®ã. 2. Cho H2S léi chËm qua dung dÞch A cho ®Õn b·o hoµ th× thu ®-îc kÕt tña vµ dung dÞch B. Dung dÞch A cã ph¶n øng axit. cßn l¹i lµ 2. AlCl3.6 . gåm hai ®ång ph©n cã kh¶ n¨ng lµm quay mÆt ph¼ng ¸nh s¸ng ph©n cùc trong nh÷ng ®iÒu kiÖn thèng nhÊt biÓu thÞ b»ng [E]25D lµ +92.Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:15 ********************************************************************************************************************************* Bµi V: 1*) A lµ mét ®isaccarit khö ®-îc AgNO3 trong dd NH3.3.CH3I trong m«i tr-êng baz¬ thu ®-îc s¶n phÈm D kh«ng cã tÝnh khö. trung tÝnh ? T¹i sao ? 2. H·y cho biÕt thµnh phÇn c¸c chÊt trong kÕt tña vµ trong dung dÞch B.1.4. b) Cho biÕt tØ lÖ phÇn tr¨m c¸c gèc glucoz¬ ë nh÷ng chç cã nh¸nh cña ph©n tö amilopectin.B¶ng A Ngµy thi: 12/3/1999 (180 phót.metylglucoz¬ sinh ra trong phßng thÝ nghiÖm trªn.24 gam amilopectin b»ng c¸ch cho t¸c dông víi CH3I trong m«i tr-êng baz¬. råi ®em thuû ph©n hoµn toµn (xóc t¸c axit) th× thu ®-îc 1.3 .4 . kh«ng kÓ thêi gian giao ®Ò ) C©u 1: Dung dÞch A gåm c¸c chÊt tan FeCl3.6 .metylglucoz¬. a) ViÕt c«ng thøc cÊu tróc (d¹ng vßng 6 c¹nh ph¼ng) cña B.O . D.tri . a)ViÕt c«ng thøc cÊu tróc (d¹ng vßng 6 c¹nh ph¼ng) cña 3 s¶n phÈm trªn vµ cho biÕt xuÊt xø cña chóng.66.1M). Dung dÞch cña mçi ®ång ph©n nµy tù biÕn ®æi vÒ [E]25D cho tíi khi cïng ®¹t gi¸ trÞ æn ®Þnh lµ + 52o. Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc .66. A. baz¬.3.3.tetra . NH4Cl vµ CuCl2 (nång ®é mçi chÊt xÊp xØ 0. biÕt r»ng trong ph©n tö A cã liªn kÕt F .®i .

b/ Trong dung dÞch kiÒm (nh. h·y: 1. C©u 5: TrÞ sè thÕ ®iÖn cùc tiªu chuÈn cña mét sè diÖn cùc cho trong b¶ng sau ®©y: §iÖn cùc Sè thø tù cña ®iÖn cùc ThÕ ®iÖn cùc chuÈn (V) Fe2+/Fe3+ 1 0. ®-îc ®iÒu chÕ theo ph-¬ng tr×nh: CO(k) + Cl2(k) COCl2(k) . Cã mét thÝ nghiÖm sau ®©y (lµm trong tñ hót khÝ ®éc): lÊy vµo èng nghiÖm 1ml axit sunfuric ®Æc. a) Cã hiÖn t-îng g× x¶y ra? B»ng c¸ch nµo nhËn biÕt s¶n phÈm khÝ cña ph¶n øng ? ViÕt ph-¬ng tr×nh ph¶n øng x¶y ra. Ho = 491. b) T¹i sao ph¶i ®un nãng nhÑ ? 2. H·y viÕt ph-¬ng tr×nh ph¶n øng vµ nãi râ ®ã lµ ph¶n øng oxi ho¸.96 NO2 .H+ 3 0. thµnh b¶ng nh.0 kJ.5. Ph«tgen ®-îc dïng lµm chÊt clo ho¸ rÊt tèt cho ph¶n øng tæng hîp h÷u c¬. C©u 2: 1. H·y chän 5 thuèc thö ®-îc dïng ®Ó ph©n biÖt ®-îc 3 dung dÞch trªn.mol-1 Magiª ®-îc ®iÒu chÕ theo ph-¬ng tr×nh: Mg(r) + CO(k) .3 kJ.NaOH) ClO2 nhanh chãng t¹o ra hçn hîp muèi clorit vµ clorat natri. Thùc nghiÖm cho biÕt: 1.mol-1 MgO(r) + C(r) CÇn t¸c ®éng nh. MgSO4 bÞ mÊt nh·n hiÖu.vËy ? 2. b. Thªm dÇn NH3 vµo dung dÞch B cho ®Õn d-. H2O/NO3-. OH /NO3 . bá mét m¶nh ®ång vµo èng nghiÖm vµ ®un nãng nhÑ.thÕ nµo vµo nhiÖt ®é vµ ¸p suÊt riªng phÇn cña khÝ ®Ó mçi ph¶n øng trªn thu ®-îc nhiÒu s¶n phÈm h¬n? T¹i sao ph¶i t¸c ®éng nh. . LËp c¸c pin.c/ ClO2 ®-îc ®iÒu chÕ nhanh chãng b»ng c¸ch cho hçn hîp KClO3. Cã 3 dung dÞch Ba(OH)2. d).10 3+ Al/Al 5 -1.77 34[Fe(CN)6 /[Fe(CN)6 2 0. HClO3. c.sau). d/ Trong c«ng nghiÖp ClO2 ®-îc ®iÒu chÕ b»ng c¸ch cho NaClO3 t¸c dông víi SO2 cã mÆt H2SO4 4M.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:16 3. ViÕt c¸c ph-¬ng tr×nh ph¶n øng vµ gi¶i thÝch. 2.36 NO. C©u 4: 1. Cã hiÖn t-îng g× x¶y ra ? ViÕt c¸c ph-¬ng tr×nh ph¶n øng ion ®Ó gi¶i thÝch. tÝnh hiÖu thÕ cña tõng pin (ghi kÕt qu¶ ®o ®-îc theo thø tù gi¶m dÇn. Pb(CH3COO)2.Thùc nghiÖm cho biÕt t¹i 25oC tèc ®é tiªu thô khÝ NO trong ph¶n øng ®iÒu chÕ nitrozoni clorua khÝ : 2NO (k) + Cl2 (k) 2NOCl (k) (1) -4 -1 -1 o b»ng 3.10 mol.l s . H2C2O4 t¸c dông víi H2SO4 lo·ng.H2O 4 0.66 Dùa vµo sè liÖu trªn. Ho = -111.a/ Dung dÞch lo·ng ClO2 trong n-íc khi gÆp ¸nh s¸ng sÏ t¹o ra HCl. H·y tÝnh tèc ®é (t¹i 298 K): a) Cña ph¶n øng (1) b) Tiªu thô khÝ Cl2 c) T¹o thµnh NOCl (k) C©u 3: ClO2 lµ chÊt ho¸ chÊt ®-îc dïng phæ biÕn trong c«ng nghiÖp.khö hay ph¶n øng trao ®æi ? T¹i sao ? (ph©n tÝch tõng ph¶n øng a.

khö hoÆc ph¶n øng kh¸c)? 3 2 4 p a.3. B. kh«ng kÓ thêi gian giao ®Ò ) - C©u I: 1. H·y gäi tªn vµ s¾p xÕp c¸c hîp chÊt sau theo thø tù t¨ng dÇn nhiÖt ®é s«i. Gi¶i thÝch c¸ch s¾p xÕp ®ã: (CH3)4C .piridin H CrO CH3COOH (2) (2) (3) (4) b. N (viÕt ë d¹ng c«ng thøc cÊu t¹o) theo s¬ ®å sau: dd NaOH. CH4 €€ CH3OH €€ H-COOH €€ H-CH=O €€ H2CO3 p p p p 4 c. CH3(CH2)4CH3 .5-triaminobenzen tõ toluen vµ c¸c hîp chÊt v« c¬ thÝch hîp.t 2 2 p p c) HOCH2(CHOH)4CH =O €€€€ M €€€ N 2. ViÕt ph-¬ng tr×nh ph¶n øng ®iÒu chÕ 1. H+ + Br 2 f. (CH3)2CHCH(CH3)2 CH3(CH2)3CH2OH . + HBr Br C©u II: 1.t p b) BrCH2CH2CH2COOH €€€€€€€ C €€€ D 2) dd HCl p H . H·y cho biÕt c¸c ph¶n øng d-íi ®©y thuéc lo¹i ph¶n øng nµo (oxi ho¸. Thø tù Pin gåm HiÖu thÕ cña pin (theo V) §iÖn cùc §iÖn cùc 3. CH3CH2OH €€€€€ CH3CH=O €€€€ (1) (2) p (1) CrO . C. D. CH3CH2OH €€€€ TiCl p 4 LiAlH CH3CH3 CH(OCH3)2 + H2O Br Br d. ViÕt ph-¬ng tr×nh ph¶n øng x¶y ra trªn mçi ®iÖn cùc vµ ph¶n øng x¶y ra trong mçi pin ®-îc t¹o ra: a) Tõ ®iÖn cùc 2 víi ®iÖn cùc 5 b) Tõ diÖn cùc 3 víi ®iÖn cùc 5 c) Tõ ®iÖn cùc 3 víi ®iÖn cùc 4 Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc . CHO CH3OH. ChØ râ ¶nh h-ëng cña pH ®Õn møc dé oxi hãa cña NO3 .B¶ng A Ngµy thi: 13/3/1999 (180 phót. H O + o .Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:17 ********************************************************************************************************************************* 2.t a) BrCH2CH2CH2CH =O €€€€€ p o o 3 € A €€€€€€€p B + o CH OH. (CH3)2C(OH)CH2CH3 2. e. C©u III: Tõ mét lo¹i thùc vËt ng-ßi ta CH=O Br . t H . HCl khan 1) dd NaOH. M. ViÕt c¸c ph-¬ng tr×nh ph¶n øng t¹o thµnh A.

3. sau ®è thuû ph©n s¶n phÈm metyl ho¸ thu ®-îc 2. gäi tªn chÊt ®Çu vµ c¸c s¶n phÈm. ViÕt c«ng thøc cÊu tróc cña (E). 2. C©u IV: 1. 2.5oC) ®-îc ®Ëy b»ng nót cao su cã l¾p èng thuû tinh.5-T. fructoz¬ (C) vµ H OH glucoz¬ (D): CH2OH (D) 1.trªn nÕu xuÊt ph¸t tõ 2. b) Trong qu¸ tr×nh tæng hîp 2.sau: cho dd KMnO4 ®Æc vµo hçn hîp ph¶n øng ®Ó lo¹i benzan®ehit d-. C¸ch lµm nµy ®óng hay sai? Nªu mét ph-¬ng ph¸p kh¸c ®Ó t¸ch ®-îc axit xinamic tõ hçn hîp s¶n phÈm. 3.4. (G). Axit xinamic ®-îc ®iÒu chÕ theo s¬ ®å ph¶n øng sau: 2 3 C6H5CH=CHCOOH + CH3COOH C6H5CH=O + (CH3CO)2O €€€€€ p Khi kÕt thóc ph¶n øng ph¶i tiÕn hµnh t¸ch benzan®ehit d.3. C©u V: 1. Metyl ho¸ hoµn toµn (A) nhê hçn hîp CH3I vµ Ag2O. B×nh cÇu A chøa ®Çy metylamin (tos = . ViÕt c«ng thøc cÊu tróc vµ gäi tªn c¸c hi®rocacbon ®ã.4. nªu tªn c¬ chÕ c¸c ph¶n øng ®ã. a)Khi chÕ ho¸ hçn hîp c¸c ®ång ph©n kh«ng gian cña 2. K CO . t o Bé Gi¸o Dôc Vµ §µo T¹o §Ò Thi Quèc Gia Chän HäC SINH Giái THPT .ra khái hçn hîp.6. ®ã lµ chÊt ®éc t®ioxint: Cl O Cl Cl Cl O H·y tr×nh bµy s¬ ®å ph¶n øng t¹o thµnh ®ioxin. Thuû ph©n kh«ng hoµn toµn (A) nhê enzim E-galactozidaza (enzim xóc t¸c cho ph¶n øng thuû ph©n c¸c E-galactozit) thu ®-îc galactoz¬ vµ saccaroz¬.5-T nªu trªn ®· sinh ra mét s¶n phÈm phô cã ®éc tÝnh cùc m¹nh vµ lµ thµnh phÇn g©y ®éc m¹nh nhÊt cña tchÊt ®éc mµu da cam t.3.3-®ibrom-3-metylpentan víi kÏm thu ®-îc c¸c hi®rocacbon kh«ng no vµ kÏm bromua. sau ®ã axit ho¸ hçn hîp ®Õn m«i tr-êng axit ®Ó thu lÊy axit xinamic. Trong phßng thÝ nghiÖm ng-ßi ta ®iÒu chÕ etilen b»ng c¸ch ®un nãng etanol víi H2SO4 ®Æc ë kho¶ng 170oC. b)SÏ thu ®-îc s¶n phÈm nµo b»ng ph¶n øng t-¬ng tù nh. ViÕt c«ng thøc cÊu tróc d¹ng vßng ph¼ng 5 c¹nh vµ 6 c¹nh cña galactoz¬. 3.4-tri-O-metyl glucoz¬ (G) vµ 1.6-tetra-O-metyl fructoz¬ (H). Gi¶i thÝch t¹i sao cÇn dÉn s¶n phÈm léi qua dd NaOH lo·ng.4-®ibrom-2metylpentan. ViÕt c«ng thøc cÊu tróc cña c¸c poliancol t-¬ng øng víi (B). (H) vµ (A). Hi®ro ho¸ glucoz¬. Gi¶i thÝch.4.4. Cã mét häc sinh ®· thùc hiÖn nh.Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:18 ********************************************************************************************************************************* t¸ch ®-îc hîp chÊt (A) cã c«ng H OH thøc ph©n tö C18H32O16.6-tetra-O-metyl galactoz¬ (E) vµ 2. ViÕt s¬ ®å c¸c ph¶n øng ®· x¶y ra. 2. Nªu c¸c hiÖn t-îng x¶y ra. a) §un nãng mét dÉn xuÊt tetraclo cña benzen víi dd NaOH (theo tØ lÖ mol 1:1) trong metanol. fructoz¬ vµ galactoz¬ thu ®-îc c¸c poliancol (r-îu ®a chøc). (C) vµ (D). råi cho s¶n phÈm thu ®-îc t¸c dông víi natri monocloaxetat vµ sau cïng lµ axit ho¸ th× thu ®-îc chÊt diÖt cá 2. Thuû HO H ph©n hoµn toµn (A) thu ®-îc HO H glucoz¬ (B). óp b×nh cÇu vµo chËu B chøa n-íc cã thªm phenolphtalein(xem h×nh bªn).

1 587. b. Dung dÞch NaOH (ë nhiÖt ®é th-êng. Sau khi l¾c kÜ (kh«ng cho tiÕp xóc víi kh«ng khÝ) Mn(OH)2 bÞ oxi ho¸ thµnh MnO(OH)2. ChuÈn ®é I3. khi lÊy MnO(OH)2 bÞ Mn2+ khö thµnh Mn3+. Hgo (z=80) nh-êng bít 2e . a.16 lÝt khÝ Z t¹i 27. Cu2+ (z=29) nhËn thªm 2e b. B»ng ph-¬ng ph¸p ho¸ häc. C©u IV: 1. Dung dÞch NH3. ViÕt c¸c ph-¬ng tr×nh ion cña c¸c ph¶n øng ®· x¶y ra trong thÝ nghiÖm. E theo kJ. b. Na. NH4NO3. S t¹o ra ®-îc c¸c muèi A.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:19 ®Ò thi chÝnh thøc M«n Thi: Ho¸ Häc . Na. cña c¸c liªn kÕt nh. 2) Tõ c¸c nguyªn tè O. Trong mét thÝ nghiÖm ho¸ häc ng-êi ta cho m1 gam muèi A biÕn ®æi thµnh m2 gam muèi B vµ 6. Cu.800. Cho Kl (d-) vµo hçn hîp. b.3 409. NaNO3..00ml n-íc råi cho ngay MnSO4 (d-) vµ NaOH vµo n-íc. khi ®un nãng) b. theo kJ. C©u III: 1) ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra (nÕu cã) cña khÝ clo. Fe. Mg(NO3)2. (Ho2 (2) BiÕt n¨ng l-îng liªn kÕt. CrCl3..3 Liªn kÕt H-H C-H C-C C=C (Víi c¸c liªn kÕt C-H. 92U238 p 90Th230 + . 1atm. 3) Trong phßng thÝ nghiÖm ho¸ häc cã 8 lä ho¸ chÊt mÊt nh·n ®ùng riªng biÖt c¸c dd: NaCl. 2) Muèi amoni vµ muèi kim lo¹i kiÒm gièng vµ kh¸c nhau c¬ b¶n ë nh÷ng ®iÓm nµo? Nªu ra mét vµi thÝ dô cô thÓ.0 gam. NaNO3. ghi râ ®iÒu kiÖn ph¶n øng (nÕu cã). H·y viÕt ph-¬ng tr×nh ho¸ häc vµ cÊu h×nh electron t-¬ng øng cña chÊt ®Çu. B. m2. Al(NO3)3. H·y viÕt tÊt c¶ c¸c ph-¬ng tr×nh ph¶n øng cã thÓ t¹o ra khÝ NO2. C-C. B ®Òu cã 2 nguyªn tö Na trong ph©n tö. C©u II: 1) §Ó x¸c ®Þnh hµm l-îng oxi tan trong n-íc ng-êi ta lÊy 100.thµnh I3-..10-3M a. AlCl3. tinh thÓ iot t¸c dông víi: a. S. lµm thÕ nµo nhËn biÕt ®-îc mçi dd? ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra vµ ghi ®iÒu kiÖn (nÕu cã) 4) H·y hoµn thµnh c¸c ph-¬ng tr×nh ph¶n øng h¹t nh©n sau ®©y (cã ®Þnh luËt b¶o toµn nµo ®-îc dïng khi hoµn thµnh ph-¬ng tr×nh trªn ?) a. c¸c trÞ sè ë trªn lµ trung b×nh trong c¸c hîp chÊt hi®rocacbon kh¸c nhau). 2) Trong c«ng nghÖ ho¸ dÇu. H·y viÕt ph-¬ng tr×nh ph¶n øng x¶y ra víi c«ng thøc cô thÓ cña A. Thªm axit (d-). s¶n phÈm trong mçi tr-êng hîp sau ®©y: a.. C. TÝnh hµm l-îng (mol/l) cña oxi tan trong n-íc.mol-1.sau: E. BiÕt r»ng hai khèi l-îng ®ã kh¸c nhau 16. (Ho1 (1) CH4 p C6H6 + H2 .Cr(NO3)3.3oC. Fe2+ (z=26) nh-êng bít 1e c. MgCl2. 92U235 p 82Pb206 + . kh«ng kÓ thêi gian giao ®Ò ) C©u I: 1) Cho c¸c chÊt sau: HNO3. H·y tÝnh nhiÖt cña mçi ph¶n øng sau ®©y: C4H10 p C4H6 + H2 .9 416. Mn3+ oxi ho¸ I.B¶ng A Ngµy thi: 13/3/2000 (180 phót.50ml Na2S2O3 9. Bro (z=35) nhËn thªm 1e d. Cu(NO3)2. c¸c ankan ®-îc lo¹i hi®ro ®Ó chuyÓn thµnh hi®rocacbon kh«ng no cã nhiÒu øng d¹ng h¬n.hÕt 10. TÝnh m1.mol-1 435.

h·y gi¶i thÝch sù lín h¬n n¨ng l-îng ion ho¸ thø nhÊt (I1) cña Mg so víi Al (Mg cã I1 = 7. I ®Òu chøa 35.50 ml dd KMnO4 0. LÊy 25ml dd ®ã råi thªm dÇn 12. C©u II: 1) T¸m hîp chÊt h÷u c¬ A. A1.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:20 2.822.. kh«ng kÓ thêi gian giao ®Ò ) C©u I: Cho s¬ ®å sau: C A n . H vµ I. a. G. Dùa vµo cÊu h×nh electron. B. D2 lµ c¸c hîp chÊt h÷u c¬. E. X¸c ®Þnh hµm l-îng (phÇn tr¨m vÒ khèi l-îng) cña Fe tinh khiÕt trong s¾t côc. Al cã I1 = 5. . b.56%C.984 eV).800V. H.4-® ibrom-2-buten D1 CH2 D2 isoamylaxetat glixerin trinitrat D axeton O 2) H3O + A. ViÕt c«ng thøc cÊu tróc cña A.Butan 550-6000C B1 A1 B2 Mg ete khan B G C1 1) CH2 C2 1. H·y cho biÕt ph¶n øng x¶y ra khi pin ®-îc lËp tõ hai cÆp ®ã ho¹t ®éng. D. §un nãng A hoÆc B víi dd NaOH ®Òu thu ®-îc an®chit n-butiric.096M th× xuÊt hiÖn mµu hång tÝm trong dd. Hoµ tan 7. 5. a. G. E.644 eV. H vµ I ®Òu cã c¸c nguyªn tö C* trong ph©n tö. a. 3) ViÕt c¸c ph-¬ng tr×nh ph¶n øng t¹o thµnh glixerin trinitrat tõ n-butan theo s¬ ®å trªn.trªn th× l-¬ng dd KMnO4 0.440V vµ 0. B2 . E bÒn h¬n G. Liti lïi theo thø tù gi¶m trÞ sè n¨ng l-îng ion ho¸ thø nhÊt (I1). B. 2. 59. H·y s¾p xÕp c¸c nguyªn tè Natri.. 1) H·y ghi c¸c chÊt cÇn thiÕt vµ ®iÒu kiÖn ph¶n øng trªn c¸c mòi tªn. Kali.19%H. NÕu lÊy cïng mét khèi l-îng s¾t côc cã cïng hµm l-îng cña Fe tinh khiÕt nh-ng chøa t¹p chÊt FeO vµ lµm l¹i thÝ nghiÖm gièng nh.dd H2SO4 lo·ng råi thªm n-íc cÊt ®Õn thÓ tÝch ®óng 500ml. Cho: Eo ë 25oC cña c¸c cÆp Fe2+ / Fe vµ Ag+ / Ag t-¬ng øng b»ng -0. -----o o----- Bé Gi¸o Dôc Vµ §µo T¹o THPT ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái M«n Thi: Ho¸ Häc . C. C.B¶ng A Ngµy thi: 14/3/2000 (180 phót. C bÒn h¬n D.180 gam s¾t côc chøa Fe2O3 vµo mét l-îng rÊt d. B1. ®un nãng C hoÆc D víi dd NaOH ®Òu thu ®-îc etylmetylxeton. B. D. viÕt s¬ ®å cña pin ®-îc dïng ®Ó x¸c ®Þnh c¸c thÕ ®iÖn cùc ®· cho. A bÒn h¬n B. Dïng thªm ®iÖn cùc hi®ro tiªu chuÈn. 2) ViÕt c«ng thøc cÊu t¹o cña tÊt c¶ c¸c hîp chÊt h÷u c¬ ë s¬ ®å trªn.096M cÇn dïng lµ bao nhiªu? C©u V: 1.26%Br trong ph©n tö vµ ®Òu cã tØ khèi h¬i so víi nit¬ lµ 4. Dùa vµo c¨n cø nµo vÒ cÊu t¹o nguyªn tö ®Ó ®-a ra qui luËt s¾p xÕp ®ã? b.

2 p 3 3p M €€€ N €€€ Q €€€ dÉn xuÊt 2. BiÕt (A). Khö axit aconitic sinh ra axit tricacbalylic (hay lµ axit propan-1. benzan®ehit (D) vµ axit benzoic (E). b. 3. (D) lµ c¸c chÊt láng.2 gam khÝ CO2.2. Khi ®un nãng A chuyÓn thµnh hîp chÊt vßng cã c«ng thøc C6H10N2O2. cã c«ng thøc vßng ë d¹ng E). A cã ®ång ph©n lo¹i g×? C©u V: 1) Cã 5 lä ®ùng riªng biÖt c¸c chÊt: cumen hay lµ isopropylbenzen (A). ph¶n øng víi axit nit¬ gi¶i phãng nit¬. cã 1 lä ®ùng chÊt láng thÊy xuÊt hiÖn tinh thÓ. gi¶i thÝch. ng-êi ta thu ®-îc thªm 2 s¶n phÈm kh¸c.CH2 . H·y viÕt ®Çy ®ñ c¸c ph-¬ng tr×nh ph¶n øng x¶y ra vµ ghi ®iÒu kiÖn (nÕu cã). a.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:21 b. b. a.6 gam h¬i H2O vµ 2. ViÕt c¸c ph-¬ng tr×nh ph¶n øng vµ ghi ®iÒu kiÖn (nÕu cã).H·y x¸c ®Þnh c«ng thøc cÊu t¹o cña M vµ N.75 mol O2. Gäi tªn c¸c s¶n phÈm t¹o thµnh theo danh ph¸p IUPAC. 2) §un nãng axit xitric tíi 176oC thu ®-îc axit aconitic (C6H6O6). H·y gi¶i thÝch hiÖn t-îng ®ã b»ng ph-¬ng tr×nh ph¶n øng ho¸ häc. gi¶i thÝch. H·y viÕt s¬ ®å c¸c ph¶n øng ®· x¶y ra.2 mol hîp chÊt A thuéc lo¹i t¹p chøc thu ®-îc 26. X¸c ®Þnh c«ng thøc cÊu t¹o vµ tªn cña A. N. Cho biÕt cÊu d¹ng bÒn nhÊt cña hîp chÊt t¹o thµnh tõ N. 2) Trong qu¸ tr×nh ®iÒu chÕ metyl tert-butyl ete (MTBE) tõ ancol. H·y cho biÕt c¸c cÆp chÊt nµo nãi trªn cã thÓ ph¶n øng víi nhau. ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra.4-tri-O-metyl cña M HCl xtp baz xt xt H + CH OH CH I H O a. H·y s¾p xÕp thø tù t¨ng dÇn nhiÖt ®é s«i. M chØ kh¸c D-riboz¬ ë cÊu h×nh nguyªn tö C2. (C). ViÕt ph-¬ng tr×nh ph¶n øng ®iÒu chÕ MTBE tõ hi®rocacbon. c. a. Q vµ X (d¹ng vßng ph¼ng). anisol hay lµ metyl phenyl ete (C). H·y viÕt s¬ ®å c¸c ph¶n øng ®· x¶y ra. N chØ cho 1 hîp chÊt duy nhÊt.C . NÕu ®èt ch¸y 1 mol A cÇn 3. kh«ng cã ®ång ph©n h×nh häc) vµ axit xitraconic (C5H6O4 cã ®ång ph©n h×nh häc).COOH cã c¸c gi¸ trÞ pKa lµ 4. .3-tricacboxylic). NÕu tiÕp tôc ®un nãng axit aconitic sÏ thu ®-îc hçn hîp gåm axit itaconic (C5H6O4. Trong qu¸ tr×nh b¶o qu¶n c¸c chÊt trªn. C©u III: 1) Axit xitric hay lµ axit limonic COOH HOOC . b. Khi monoclo ho¸ (cã chiÕu s¸ng) th× M cho 4 hîp chÊt.24 lÝt khÝ N2 (®ktc). hai axit nµy chuyÓn ho¸ ngay thµnh c¸c hîp chÊt m¹ch vßng cïng cã c«ng thøc ph©n tö C5H4O3. 2) §èt ch¸y 0. b. X¸c ®Þnh c«ng thøc cña M.13 OH COOH vµ 6.CH2 . C©u IV: 1) X lµ mét ®isaccarit kh«ng khö ®-îc AgNO3 trong dd amoniac. b.25. H·y viÕt s¬ ®å c¸c ph¶n øng x¶y ra d-íi d¹ng c¸c c«ng thøc cÊu t¹o vµ cho biÕt axit aconitic cã ®ång ph©n h×nh häc hay kh«ng? 3)Ng-êi ta cã thÓ tæng hîp axit xitric xuÊt ph¸t tõ axeton vµ c¸c ho¸ chÊt v« c¬ cÇn thiÕt.40. Khi thuû ph©n X sinh ra s¶n phÈm duy nhÊt lµ M (D-andoz¬. (B). X¸c ®Þnh c«ng thøc ph©n tö cña A. víi ancol etylic cã axit lµm xóc t¸c t¹o thµnh hîp chÊt cã c«ng thøc C5H11O2N. ViÕt c«ng thøc cÊu t¹o 2 s¶n phÈm nãi trªn. a. 2) Hai xicloankan M vµ N ®Òu cã tØ khèi h¬i so víi metan b»ng 5.3.76. BiÕt r»ng A cã tÝnh chÊt l-ìng tÝnh. H·y gäi tªn axit nµy theo danh ph¸p IUPAC vµ ghi (cã gi¶i thÝch) tõng gi¸ trÞ pKa vµo nhãm chøc thÝch hîp. ancol benzylic (B). c. 12.

sè h¹t mang ®iÖn nhiÒu h¬n sè h¹t kh«ng mang ®iÖn lµ 60. sè h¹t mang ®iÖn cña X Ýt h¬n sè h¹t mang ®iÖn cña Y lµ 76. H·y nhËn biÕt mçi dung dÞch trªn. yÕu h¬n axit cacbonic. H·y viÕt c¸c ph-¬ng tr×nh ph¶n øng ®Ó minh ho¹ c¸c tÝnh chÊt ®ã. dung dÞch Z. Khèi l-îng kÕt tña ®ã (®· ®-îc sÊy kh«) kh¸c khèi l-îng M(NO3)2 ban ®Çu lµ 6. c) HCl cã trong H2S . ICl + SO42. Trong d·y oxiaxit cña clo. Cho biÕt c¸c gÇn ®óng ph¶i chÊp nhËn khi tÝnh nång ®é dung dÞch Y.4. kh«ng kÓ thêi gian giao ®Ò ) C©u I (4 ®iÓm): 1. e) MgSO4 . electron b»ng 196.5 ®iÓm): 1. T×m c¸ch lo¹i s¹ch t¹p chÊt khÝ cã trong khÝ kh¸c vµ viÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra: a) CO cã trong CO2 . g) KCl . Gi¶ thiÕt sù ®iÖn ph©n cã hiÖu suÊt 100%. axit hipoclor¬ lµ quan träng nhÊt. e) SO3 cã trong SO2 . d) HCl cã trong SO2 . 3. ®-îc dung dÞch Z.+ CNO. Mçi ph©n tö XY3 cã tæng c¸c h¹t proton. b) Cã tÝnh oxi ho¸ m·nh liÖt. a) H·y t×m nång ®é ion cña dung dÞch X.Y. Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc . c) Dùa vµo ph¶n øng oxi ho¸ . 2. Ng-êi ta dïng 200ml dung dÞch K3PO4 võa ®ñ ph¶n øng víi 200ml dung dÞch X. §iÖn ph©n 400 ml dung dÞch X b»ng dßng ®iÖn I = 2 ampe tíi khi thÊy khèi l-îng catèt kh«ng t¨ng thªm n÷a th× dõng. 4. 2. ViÕt c«ng thøc cÊu t¹o c¸c s¶n phÈm sinh ra vµ ph-¬ng tr×nh ph¶n øng khi cho MTBE t¸c dông víi HI. b) ViÕt cÊu h×nh electron cña nguyªn tö X. . C©u III (5 ®iÓm): 1.4). Cho biÕt c¸c cÆp oxi ho¸ .B¶ng A Ngµy thi: 14/3/2001 (180 phót. Ph-¬ng ph¸p sunfat cã thÓ ®iÒu chÕ ®-îc chÊt nµo: HF .khö liªn quan ®Õn ph¶n øng vµ so s¸nh c¸c gi¸ trÞ Eo cña chóng. d) Al2(SO4)3 . HI ? NÕu cã chÊt kh«ng ®iÒu chÕ ®-îc b»ng ph-¬ng ph¸p nµy. axit hipoclor¬ cã c¸c tÝnh chÊt: a) TÝnh axit rÊt yÕu. C©u II (3. h·y gi¶i thÝch t¹i sao? ViÕt c¸c ph-¬ng tr×nh ph¶n øng vµ ghi râ ®iÒu kiÖn (nÕu cã) ®Ó minh ho¹. Hoµn thµnh ph-¬ng tr×nh ph¶n øng a) . n¬tron. naphtalen. dung dÞch Z. h) ZnCl2 . HCl .825 gam. H·y dïng kÝ hiÖu « l-îng tö biÓu diÔn c¸c tr-êng hîp sè l-îng electron trong mét obitan nguyªn tö.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:22 c.+ b) Cu(NH3)m + CN + OH 2. Dung dÞch X cã chÊt tan lµ muèi M(NO3)2 . Tr×nh bµy ng¾n gän ph-¬ng ph¸p ho¸ häc ®Ó t¸ch riªng tõng chÊt.+ Cl2+ H2O Cu(CN)2. Cã c¸c dung dÞch (bÞ mÊt nh·n) : a) BaCl2 . khi ®un nãng. c) RÊt dÔ bÞ ph©n tÝch khi cã ¸nh s¸ng mÆt trêi. viÕt c¸c ph-¬ng tr×nh ion (nÕu cã) ®Ó gi¶i thÝch. trong ®ã. HBr .10) hoÆc metyl da cam (kho¶ng pH chuyÓn mµu tõ 3. a) H·y x¸c ®Þnh kÝ hiÖu ho¸ häc cña X.khö vµ ph¶n øng trao ®æi. nÕu cã) c¸c tr-êng hîp x¶y ra t¹o thµnh XY3. 3) Cã 1 hçn hîp c¸c chÊt r¾n gåm: p-tolui®in (p-metylanilin). axit benzoic. c) K2S . dung dÞch Y. h·y viÕt ph-¬ng tr×nh ph¶n øng (ghi râ ®iÒu kiÖn. §-îc dïng thªm dung dÞch phenolphtalein (kho¶ng pH chuyÓn mµu tõ 8 .1 . b) sau ®©y. thu ®-îc kÕt tña M3(PO4)2 vµ dung dÞch Y. b) NH4Cl .Y vµ XY3 .+ HCN + Zn2+ + Hg2+ a) Zn[Hg(SCN)4] + IO3. b) H2S cã trong HCl .

3oC . . 2 atm ph¶n øng SO2Cl2 (khÝ) SO2 (khÝ) + Cl2 (khÝ) (1) Cã Kp = 50 .400 80 0. h·y tÝnh tèc ®é trung b×nh cña ph¶n øng (1).€€ 2 SO42.64 CH3NH3+ BiÕt: CH3NH2 + H+ CH3COOH CH3COO.76 C©u V(3.00M.vµo dung dÞch trªn. XuÊt ph¸t tõ brombenzen chøa 14 C ë vÞ trÝ 1 vµ c¸c ho¸ chÊt v« c¬ cÇn thiÕt kh«ng chøa 14 C.Khi cã mÆt NaOH 0. c) TÝnh thÓ tÝch khÝ thu ®-îc ë 27. l -1) 0 1.+ I2 p ®-îc kh¶o s¸t b»ng thùc nghiÖm nh.+ H+ .Khi cã mÆt CH3COOH 0. c) Ban ®Çu dïng 150 mol SO2Cl2(khÝ). kh«ng kÓ thêi gian giao ®Ò ) C©u I (5 ®iÓm): 1. T¹i 350oC. . b) §é ®iÖn li thay ®æi ra sao khi . h·y ®iÒu chÕ c¸c hîp chÊt th¬m chøa 14 C ë vÞ trÝ 3 : a) Anilin . 2. a) TÝnh ®é ®iÖn li cña dung dÞch CH3NH2 0. K = 1010. ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra.752 50 0. .vËy. Hoµn thµnh s¬ ®å c¸c ph¶n øng sau vµ gäi tªn c¸c s¶n phÈm tõ A ®Õn F : .sau: Trén dung dÞch KI víi dung dÞch hå tinh bét. b) TÝnh phÇn tr¨m theo thÓ tÝch SO2Cl2(khÝ) cßn l¹i khi (1) ®¹t tíi c©n b»ng ë ®iÒu kiÖn ®· cho. C©u IV (4 ®iÓm): 1.5 ®iÓm): (1) Ph¶n øng S2O82. Sunfuryl ®iclorua SO2Cl2 lµ ho¸ chÊt phæ biÕn trong ph¶n øng clo ho¸.. dung dÞch S2O32. sau ®ã thªm dung dÞch S2O82.+ 2 I .0010M. a) H·y cho biÕt ®¬n vÞ cña trÞ sè ®ã vµ gi¶i thÝch: h»ng sè c©n b»ng Kp nµy ph¶i cã ®¬n vÞ nh. tÝnh sè mol Cl2(khÝ) thu ®-îc khi (1) ®¹t tíi c©n b»ng. Ng-êi ta thu ®-îc sè liÖu sau ®©y: Thêi gian thÝ nghiÖm(theo gi©y) Nång ®é I. b) Iotbenzen . 1. Bé Gi¸o Dôc Vµ §µo T¹o ®Ò thi chÝnh thøc §Ò Thi Quèc Gia Chän HäC SINH Giái THPT M«n Thi: Ho¸ Häc .(theo mol . C¸c dung dÞch ®Òu cã nång ®é ban ®Çu thÝch hîp.Khi cã mÆt HCOONa 1. c) Axit benzoic.010 Dïng sè liÖu ®ã. K = 10-4.0010M.B¶ng A Ngµy thi: 15/3/2001 (180 phót.Pha lo·ng dung dÞch ra 50 lÇn. . 1atm trong sù ®iÖn ph©n. C¸c khÝ ®-îc coi lµ khÝ lý t-ëng. 2.010M. t¹i sao dung dÞch tõ kh«ng mµu chuyÓn sang mµu xanh lam? 2.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:23 b) TÝnh thêi gian (theo gi©y) ®· ®iÖn ph©n.000 20 0.

B (C19H24Br2ON2) . Cho tõ tõ dung dÞch HBr vµo X ë nhiÖt ®é phßng råi ®un nãng nhÑ.1). cã trong mËt ong. Thuû ph©n X nhê enzim cacboxipepti®aza thu ®-îc alanin vµ mét ®ipeptit Y. Cho C6H5COCl vµo X vµ Y thu ®-îc s¶n phÈm ®Òu cã c«ng thøc C26H26N2O2 (®Æt lµ F vµ G).5 ®iÓm): Melexitoz¬ (C18H32O16) lµ ®-êng kh«ng khö. viÖc kh«ng h×nh thµnh foman®ehit trong s¶n phÈm oxi ho¸ b»ng HIO4 chøng tá cã cÊu tróc furanoz¬ hoÆc piranoz¬ ®èi víi m¾t xÝch fructoz¬ vµ piranoz¬ hoÆc heptanoz¬ (vßng 7 c¹nh) ®èi víi m¾t xÝch glucoz¬. H·y viÕt c«ng thøc cÊu tróc cña melexitoz¬. C (C19H25Br3ON2) . HCl F E 3. ViÕt c«ng thøc cÊu tróc vµ gäi tªn hÖ thèng cña turanoz¬. 9 C HOH 1. Khi thuû ph©n kh«ng hoµn toµn sÏ nhËn ®-îc D-glucoz¬ vµ ®isaccarit turanoz¬. cßn khi thuû ph©n nhê enzim kh¸c sÏ nhËn ®-îc saccaroz¬.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:24 Na2Cr2O4 Cl2 (1 mol) Benzen (1mol) FeCl3 A H2O t0C. E. Khi thuû ph©n hoµn toµn 1 mol tripeptit X thu ®-îc 2 mol axit glutamic ( HOOC(CH2)2CH(NH2)COOH ).4.3. 3.8) vµ prolamin (pHI = 12.0 th× thu ®-îc 3 vÕt chÊt (xem h×nh): XuÊt ph¸t Cùc ‡ ‡ ‡ Cùc A B C HNO3 Cho biÕt mçi vÕt chÊt ®Æc tr-ng cho protit nµo ? Gi¶i thÝch. 2. X kh«ng ph¶n øng víi 2. vµ D (C19H24Br4N2). hemoglobin (pHI = 6. 1 mol alanin ( CH3CH(NH2)COOH ) vµ 1 mol NH3. CÇn bao nhiªu mol HIO4 ®Ó ph©n huû hai m¾t xÝch glucoz¬ cã cÊu tróc heptanoz¬ vµ sÏ nhËn ®-îc bao nhiªu mol axit fomic? .4. C©u IV (4.Cã mét hçn hîp protit gåm pepsin (pHI = 1.4-®initroflobenzen vµ X chØ cã mét nhãm cacboxyl tù do. H·y viÕt c«ng thøc cÊu t¹o ph©n tö cña 5 chÊt ®ã vµ s¾p xÕp theo trËt tù gi¶m dÇn nhiÖt ®é s«i cña chóng (cã gi¶i thÝch). Khi thuû ph©n nhê enzim mantaza sÏ t¹o thµnh D-glucoz¬ vµ D-fructoz¬. D . Khi oxi ho¸ etylenglicol b»ng HNO3 th× t¹o thµnh mét hçn hîp 5 chÊt.fructoz¬. Ghi dÊu * vµo mçi nguyªn tö cacbon bÊt ®èi trong ph©n tö D vµ E. Y vµ gäi tªn chóng. F vµ G cã ®ång nhÊt (cïng lµ mét chÊt) hay kh«ng? Chóng cã nhiÖt ®é nãng ch¶y gièng hay kh¸c nhau? t¹i sao? C©u III (4 ®iÓm): 1. p B C 2H D Fe.6-tri-O-metyl-D-fructoz¬ vµ 2 mol 2. Metyl ho¸ 1 mol melexitoz¬ råi thuû ph©n sÏ nhËn ®-îc 1 mol 1. N C©u II (4 ®iÓm): Xinconi®in (X) cã c«ng thøc cÊu t¹o : CH = CH2 §ã lµ ®ång ph©n lËp thÓ ë C9 cña xinconin (Y). H·y chØ ra r»ng. 3. B . H·y ghi dÊu * vµo mçi nguyªn tö cacbon bÊt ®èi vµ khoanh vßng trßn nguyªn tö nit¬ cã tÝnh baz¬ m¹nh nhÊt trong ph©n tö X. C . 2.6-tetra-O-metyl-D-glucoz¬. 1. sinh ra c¸c s¶n phÈm chÝnh lµ A (C19H23BrON2) . Khi tiÕn hµnh ®iÖn di dung dÞch protit nªu trªn ë pH = 7. Khi thuû ph©n hoµn toµn 1 mol melexitoz¬ b»ng axit sÏ nhËn ®-îc 2 mol D-glucoz¬ vµ 1 mol D. 2. ViÕt c«ng thøc cÊu t¹o cña X . ChÕ ho¸ D víi dung dÞch KOH trong r-îu 90o thu ®-îc E (C19H20N2) H·y viÕt c«ng thøc cÊu t¹o cña A .0).

. sau ®ã nhá thªm vµi giät dung dÞch KMnO4 thÊy hçn hîp xuÊt hiÖn mµu xanh. Hoµn thµnh s¬ ®å c¸c ph¶n øng sau vµ gäi tªn c¸c s¶n phÈm tõ A ®Õn F : Na2Cr2O4 2H Cl2 (1 mol) H2O C D Benzen (1 mol) A B 14 k× thi chän häc sinh giái M«n : ho¸ C. ViÕt ph-¬ng tr×nh ph¶n øng oxi hãa clorofom b»ng oxi kh«ng khÝ thµnh photgen.lµ dÉn xuÊt cña xenluloz¬. H2N-CO-NH2 (C) . H2NCH2CONH2 (B) .Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:25 ********************************************************************************************************************************* C©u V (2. Chitin (t¸ch tõ vá t«m. a) ViÕt c«ng thøc cÊu t¹o mét ®o¹n m¹ch cña ph©n tö chitin. b) Iotbenzen . Cho biÕt tõng hîp chÊt trªn thuéc lo¹i hîp chÊt cã chøc h÷u c¬ nµo? ViÕt ph-¬ng tr×nh ph¶n øng cña tõng hîp chÊt trªn víi: a) Dung dÞch HCl (d-. C©u III (5 ®iÓm): (thay c©u III b¶ng A. 2. ®un nãng chitin víi dung dÞch NaOH ®Æc (d-). b) Dung dÞch NaOH (d-. b) Gäi tªn mét m¾t xÝch cña chitin. ViÕt c«ng thøc cÊu t¹o hai s¶n phÈm mononitro chÝnh vµ cho biÕt chÊt nµo t¹o thµnh víi sè mol nhiÒu h¬n? H·y so s¸nh tÝnh axit cña c¸c chÊt gåm hai axit ®Çu vµ hai s¶n phÈm.. ViÕt c¸c ph-¬ng tr×nh ph¶n øng vµ gi¶i thÝch sù xuÊt hiÖn mµu xanh. biÕt r»ng D-glucozazon khi t¸c dông víi benzandehit t¹o thµnh ozon cña D-glucoz¬ (HOCH2(CHOH)3COCHO). CH3CHOHCOOH (D). c) Axit benzoic. 2. 3. bé gi¸o dôc vµ ®µo t¹o quèc gia líp 12 thpt n¨m häc 2000-2001 ®Ò thi chÝnh thøc häc B¶ng B Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 13 / 3 / 2001 C©u I (5 ®iÓm): 1. Cho hçn hîp ®¼ng ph©n tö gåm axit benzoic vµ axit p-metoxibenzoic t¸c dông víi hçn hîp HNO3 ®Æc vµ H2SO4 ®Æc. gi¶i thÝch. Khi tiÕn hµnh ®iÒu chÕ axit lactic tõ an®ehit axetic vµ axit xianhi®ric. cua. ph¶n øng cña photgen víi ancol etylic vµ gäi tªn s¶n phÈm. Clorofom tiÕp xóc víi kh«ng khÝ ngoµi ¸nh s¸ng sÏ bÞ oxi hãa thµnh photgen rÊt ®éc. dïng cho b¶ng B) 1. Cã c¸c hîp chÊt sau: H3NCH2COO (A) . 2. §Ó ngõa ®éc ng-êi ta b¶o qu¶n clorofom b»ng c¸ch cho thªm mét l-îng nhá ancol etylic ®Ó chuyÓn photgen thµnh chÊt kh«ng ®éc. ngoµi s¶n phÈm mong muèn ta cßn thu ®-îc hîp chÊt X (C6H8O4). c) ViÕt ph-¬ng tr×nh ph¶n øng x¶y ra khi ®un nãng chitin víi dung dÞch HCl ®Æc (d-). ViÕt c«ng thøc cÊu t¹o cña X vµ c¸c ph-¬ng tr×nh ph¶n øng x¶y ra. nãng) . nãng). 2. trong ®ã c¸c nhãm hidroxyl ë c¸c nguyªn tö C2 ®-îc thay thÕ b»ng c¸c nhãm axetylamino ( -NH-CO-CH3 ). §un nãng vµi giät clorofom víi l-îng d. 1. XuÊt ph¸t tõ brombenzen chøa 14 C ë vÞ trÝ 1 vµ c¸c ho¸ chÊt v« c¬ cÇn thiÕt kh«ng chøa h·y ®iÒu chÕ c¸c hîp chÊt th¬m chøa 14 C ë vÞ trÝ 3 : a) Anilin .) ®-îc coi nh.dung dÞch NaOH. ViÕt ph-¬ng tr×nh ph¶n øng ®iÒu chÕ D-fructoz¬ tõ D-glucoz¬.5 ®iÓm): 1. .

Khi oxi ho¸ etylenglicol b»ng HNO3 th× t¹o thµnh mét hçn hîp 5 chÊt.lµ dÉn xuÊt cña xenluloz¬. cua. Cho tõ tõ dung dÞch HBr vµo X ë nhiÖt ®é phßng råi ®un nãng nhÑ. HCl E F 3. Clorofom tiÕp xóc víi kh«ng khÝ ngoµi ¸nh s¸ng sÏ bÞ oxi hãa thµnh photgen rÊt ®éc. C©u V (2 ®iÓm): 1. Chitin (t¸ch tõ vá t«m.dung dÞch NaOH. c) ViÕt ph-¬ng tr×nh ph¶n øng x¶y ra khi ®un nãng chitin víi dung dÞch HCl ®Æc (d-). sinh ra c¸c s¶n phÈm chÝnh lµ A (C19H23BrON2) . §un nãng vµi giät clorofom víi l-îng d. CH=CH2 C©u IV (4. H2NCH2CONH2(B) . e) Gäi tªn mét m¾t xÝch cña chitin.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:26 FeCl3 tO .5 ®iÓm): Xinconi®in (X) cã c«ng thøc cÊu t¹o : N 9 HNO3 (1 mol) C HOH §ã lµ ®ång ph©n lËp thÓ ë C9 cña xinconin (Y). Ghi dÊu  vµo mçi nguyªn tö cacbon bÊt ®èi trong ph©n tö D vµ E. Cã c¸c hîp chÊt sau: H3NCH2COO (A) . Cho hçn hîp ®¼ng ph©n tö gåm axit benzoic vµ axit p-metoxibenzoic t¸c dông víi hçn hîp HNO3 ®Æc vµ H2SO4 ®Æc. E. nãng). 2. H·y ghi dÊu  vµo mçi nguyªn tö cacbon bÊt ®èi vµ khoanh vßng trßn nguyªn tö nit¬ cã tÝnh baz¬ m¹nh nhÊt trong ph©n tö X. p Fe. trong ®ã c¸c nhãm hi®roxyl ë c¸c nguyªn tö C2 ®-îc thay thÕ b»ng c¸c nhãm axetylamino ( -NH-CO-CH3 ). C . 2. ®un nãng chitin víi dung dÞch NaOH ®Æc (d-). biÕt r»ng D-glucozazon khi t¸c dông víi benzan®ehit t¹o thµnh ozon cña D-glucoz¬ (HOCH2(CHOH)3COCHO). H·y viÕt c«ng thøc cÊu t¹o ph©n tö cña 5 chÊt ®ã vµ s¾p xÕp theo trËt tù gi¶m dÇn nhiÖt ®é s«i cña chóng (cã gi¶i thÝch). b) Dung dÞch NaOH (d-. H2N-CO-NH2 (C) . B . gi¶i thÝch.. 2.) ®-îc coi nh. nãng) . D . vµ D (C19H24Br4N2). C©u III (5 ®iÓm): 1. sau ®ã nhá thªm vµi giät dung dÞch KMnO4 thÊy hçn hîp xuÊt hiÖn mµu xanh. §Ó ngõa ®éc ng-êi ta b¶o qu¶n clorofom b»ng c¸ch cho thªm mét l-îng nhá ancol etylic ®Ó chuyÓn photgen thµnh chÊt kh«ng ®éc. 2. ViÕt c«ng thøc cÊu t¹o hai s¶n phÈm mononitro chÝnh vµ cho biÕt chÊt nµo t¹o thµnh víi sè mol nhiÒu h¬n? H·y so s¸nh tÝnh axit cña c¸c chÊt gåm hai axit ®Çu vµ hai s¶n phÈm. ViÕt ph-¬ng tr×nh ph¶n øng ®iÒu chÕ D-fructoz¬ tõ D-glucoz¬. CH3CHOHCOOH (D). C (C19H25Br3ON2) .5 ®iÓm): 1. d) ViÕt c«ng thøc cÊu t¹o mét ®o¹n m¹ch cña ph©n tö chitin. ChÕ ho¸ D víi dung dÞch KOH trong r-îu 90o thu ®-îc E (C19H20N2) H·y viÕt c«ng thøc cÊu t¹o cña A .. N 1. C©u II (3. . ViÕt ph-¬ng tr×nh ph¶n øng oxi hãa clorofom b»ng oxi kh«ng khÝ thµnh photgen. B (C19H24Br2ON2) . ViÕt c¸c ph-¬ng tr×nh ph¶n øng vµ gi¶i thÝch sù xuÊt hiÖn mµu xanh. ph¶n øng cña photgen víi ancol etylic vµ gäi tªn s¶n phÈm. Cho biÕt tõng hîp chÊt trªn thuéc lo¹i hîp chÊt cã chøc h÷u c¬ nµo? ViÕt ph-¬ng tr×nh ph¶n øng cña tõng hîp chÊt trªn víi : a) Dung dÞch HCl (d-.

2030 M. Pb2+ . CrO2Cl2 (cromyl clorua) lµ mét ho¸ chÊt quan träng.0. 2. b) Cho K2Cr2O7 t¸c dông víi KCl tronh H2SO4 ®Æc.5. d) NaHSO3 2. b) Nªu dÉn chøng cô thÓ cho thÊy ë trong n-íc CuCl kÐm bÒn h¬n CuCl2 . cña cÆp I2/ 2I. Thªm chÊt thÝch hîp vµ hoµn thµnh ph-¬ng tr×nh ho¸ häc sau: a) KNO2 + KNO3 + ? K2CrO4 + NO b) NaNO2 + ? + NaI I2 + NaHSO4 + NO + H2O c) HNO3 + P2O5 ? + N2O5 C©u II : 1. Gi¶ sö tæng nång ®é NaOH ®· cho vµo lµ 0. Fe3+ 1. 2. Mg2+ . nãng. H·y tÝnh nång ®é c¸c ion trong dung dÞch (khi tÝnh kh«ng kÓ sù t¹o phøc hi®roxo cña c¸c ion kim lo¹i). H·y nªu ph-¬ng ph¸p ho¸ häc ®Ó x¸c nhËn c¸c chÊt cã mÆt trong kÕt tña A vµ dung dÞch B(nªu râ ®Ó nhËn biÕt) ViÕt ph-¬ng tr×nh ion cña c¸c ph¶n øng x¶y ra. C©u III : 1. Cho biÕt cã hiÖn t-îng g× x¶y ra? 2. Hai muèi cña cïng mét axit lµm ®æi mµu kh¸c nhau ®èi víi giÊy quú tÝm. Cu2+ . b) K2S . gi¶i thÝch nguyªn nh©n. Cho: TÝch sè tan Mg(OH)2: 10 ± 10. 3.100M . VËn dông lÝ thuyÕt Bronstet vÒ axit ± baz¬ h·y gi¶i thÝch tÝnh axit ± baz¬ trong dung dÞch n-íc cña c¸c ch©t sau: a) BaCl2 .lµ 0. C©u IV : 1. b) Na2CO3 (m« t¶ c¸ch thÝ nghiÖm vµ gi¶i thÝch). 3. t¹o kÕt tña tr¾ng víi n-íc v«i trong vµ t¹o kÕt tña vµng víi dung dÞch AgNO3 lµ nh÷ng muèi nµo? ViÕt c¸c ph-¬ng tr×nh ph¶n øng ®Ó chøng minh.Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:27 ********************************************************************************************************************************* bé gi¸o dôc vµ ®µo t¹o quèc gia k× thi chän häc sinh giái líp 12 thpt n¨m häc 2000-2001 ®Ò thi dù bÞ ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi thø nhÊt : ( theo quyÕt ®Þnh vµ th«ng b¸o cña Bé) M«n : C©u I : 1.15V. H·y tr×nh bµy 3 thÝ nghiÖm minh ho¹ tÝnh chÊt axit ± baz¬ trong mçi dung dÞch : a) NH4HSO4 . Thªm dÇn dung dÞch NaOH vµo dung dÞch chøa H+ 0.100M cho ®Õn d-. H·y viÕt c¸c ph-¬ng tr×nh ho¸ häc t¹o ra CrO2Cl2 tõ: a) CrO3 t¸c dông víi axit HCl. . Cho NaOH (d-) vµo hçn hîp X gåm cã Zn2+ . a) Nªu dÉn chøng cô thÓ cho thÊy Cu2O bÒn víi nhiÖt h¬n CuO vµ CuCl bÒn víi nhiÖt h¬n CuCl2 . ViÕt c¸c ph-¬ng tr×nh ho¸ häc tõ Na2Cr2O7 . c) ThÕ ®iÖn cùc chuÈn cña cÆp Cu2+/ Cu+ lµ 0.10-3M vµ Mg2+ 0. C (than ®¸). Al (bét nh«m) vµ c¸c ®iÒu kiÖn cÇn thiÕt ®Ó thu ®-îc Cr. NO3. Fe3+ . gi¶i thÝch nguyªn nh©n. c) NH4HS .sÏ ®-îc kÕt tña A vµ dung dÞch B.95 Fe(OH)3 : 10 ± 37.54V nh-ng t¹i sao ng-êi ta cã thÓ ®Þnh l-îng ion Cu2+ trong dung dÞch n-íc th«ng qua t¸c dông cña ion ®ã víi dung dÞch KI? Cho biÕt dung dÞch b·o hoµ cña CuI trong n-íc ë nhiÖt ®é th-êng cã nång ®é lµ10-6M.

3. Søc ®iÖn ®éng cña pin sÏ t¨ng hay gi¶m nÕu: . Eo Cu+/ Cu = 0. H·y thiÕt lËp s¬ ®å pin sao cho khi pin phãng ®iÖn th× x¶y ra ph¶n øng khö ion Fe3+ bëi Cu . c) NH4HS . NO3. Thªm chÊt thÝch hîp vµ hoµn thµnh ph-¬ng tr×nh ho¸ häc sau: a) KNO2 + KNO3 + ? K2CrO4 + NO b) NaNO2 + ? + NaI I2 + NaHSO4 + NO + H2O c) HNO3 + P2O5 ? + N2O5 C©u II : 1. 2. Pb2+ . TÝnh nång ®é c¸c chÊt cßn l¹i trong c¸c dung dÞch khi pin phãng ®iÖn hoµn toµn (gi¶ sö nång ®é c¸c chÊt tr-íc ph¶n øng ®Òu b»ng 0.77V . C©u III : . Mg2+ . H·y nªu ph-¬ng ph¸p ho¸ häc ®Ó x¸c nhËn c¸c chÊt cã mÆt trong kÕt tña A vµ dung dÞch B (nªu râ ®Ó nhËn biÕt) ViÕt ph-¬ng tr×nh ion cña c¸c ph¶n øng x¶y ra.010M).Thªm Ýt NaOH vµo dung dÞch cña cùc chøa Fe3+ (dung dÞch B).Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:28 ********************************************************************************************************************************* C©u V : 1. nãng. d) NaHSO3 2. b) Cho K2Cr2O7 t¸c dông víi KCl tronh H2SO4 ®Æc. 3. 2. b) K2S . Eo Fe2+/ Fe = . ViÕt c¸c ph-¬ng tr×nh ho¸ häc tõ Na2Cr2O7 .Thªm mét Ýt KMnO4 (m«i tr-êng axit) . TÝnh søc ®iÖn ®éng tiªu chuÈn cña pin (Eopin) khi pin míi b¾t ®Çu ho¹t ®éng. ViÕt ph-¬ng tr×nh c¸c nöa ph¶n øng x¶y ra t¹i c¸c ®iÖn cùc. H·y tr×nh bµy 3 thÝ nghiÖm minh ho¹ tÝnh chÊt axit ± baz¬ trong mçi dung dÞch : a) NH4HSO4 .34V .sÏ ®-îc kÕt tña A vµ dung dÞch B.0. C (than ®¸). Fe3+ .52V Eo Fe3+/ Fe2+ = 0. Cho NaOH (d-) vµo hçn hîp X gåm cã Zn2+ . Cu2+ .Thªm Ýt NaF .Thªm Ýt NH3 vµo dung dÞch ë cùc ®ång (dung dÞch A). Al (bét nh«m) vµ c¸c ®iÒu kiÖn cÇn thiÕt ®Ó thu ®-îc Cr. CrO2Cl2 (cromyl clorua) lµ mét ho¸ chÊt quan träng. 4. Cho Eo Cu2+/ Cu+ = 0. VËn dông lÝ thuyÕt Bronstet vÒ axit-baz¬ h·y gi¶i thÝch tÝnh axit-baz¬ trong dung dÞch n-íc cña c¸c ch©t sau: a) BaCl2 . 3. H·y viÕt c¸c ph-¬ng tr×nh ho¸ häc t¹o ra CrO2Cl2 tõ: a) CrO3 t¸c dông víi axit HCl. .Thªm mét Ýt KI . b) Na2CO3 (m« t¶ c¸ch thÝ nghiÖm vµ gi¶i thÝch).40V bé gi¸o dôc vµ ®µo t¹o quèc gia k× thi chän häc sinh giái líp 12 thpt n¨m häc 2000-2001 ®Ò thi dù bÞ ho¸ häc B¶ng B Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi thø nhÊt : ( theo quyÕt ®Þnh vµ th«ng b¸o cña Bé) M«n : C©u I : 1.

Hai muèi cña cïng mét axit lµm ®æi mµu kh¸c nhau ®èi víi giÊy quú tÝm. cßn l¹i lµ oxi. C©u IV : 1. 6.67% cacbon.0. cña cÆp I2/ 2I. b) Nªu dÉn chøng cô thÓ cho thÊy ë trong n-íc CuCl kÐm bÒn h¬n CuCl2 . dung dÞch C6H5ONa víi CO2 2. phenol (pKa = 10) víi : .100M cho ®Õn d-. . bé gi¸o dôc vµ ®µo t¹o k× thi chän häc sinh giái quèc gia líp 12 thpt n¨m häc 2000-2001 ®Ò thi dù bÞ M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi thø hai : ( theo quyÕt ®Þnh vµ th«ng b¸o cña Bé) C©u I : 1. Cho: TÝch sè tan Mg(OH)2: 10 ± 10. H·y tÝnh nång ®é c¸c ion trong dung dÞch (khi tÝnh kh«ng kÓ sù t¹o phøc hi®roxo cña c¸c ion kim lo¹i).5. Thªm dÇn dung dÞch NaOH vµo dung dÞch chøa H+ 0. Hoµn thµnh c¸c ph-¬ng tr×nh ph¶n øng (c¸c s¶n phÈm viÕt ë d¹ng c«ng thøc cÊu t¹o) theo c¸c s¬ ®å chuyÓn ho¸ sau: CH3OH(dung m«i) a) C6H5CH=CH2 + Br2 A + B H2SO4 .3 b) Dung dÞch CH3COONa . BiÕt ph©n tö khèi cña X lµ 180. Fe3+ 1.ViÕt c¸c ph-¬ng tr×nh ph¶n øng (nÕu cã) cña: a) Axit axetic (pKa = 4.lµ 0.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:29 1. gi¶i thÝch nguyªn nh©n.67% hi®ro.2030 M.100M . 125oC (Aspirin) C©u II : Hîp chÊt thiªn nhiªn X chøa 66.95 Fe(OH)3 : 10 ± 37. Cho biÕt cã hiÖn t-îng g× x¶y ra? 2. a) Nªu dÉn chøng cô thÓ cho thÊy Cu2O bÒn víi nhiÖt h¬n CuO vµ CuCl bÒn víi nhiÖt h¬n CuCl2 .Dung dÞch NaHCO3 . to b) C6H5CH=CH2 C(C16H16) Nªu tªn c¸c c¬ chÕ cña ph¶n øng a) vµ b). gi¶i thÝch nguyªn nh©n. COOH + CO2 H (CH3CO)2O OCOCH3 f) C6H5ONa M N 6 at.4 vµ pKa2 = 10.54V nh-ng t¹i sao ng-êi ta cã thÓ ®Þnh l-îng ion Cu2+ trong dung dÞch n-íc th«ng qua t¸c dông cña ion ®ã víi dung dÞch KI? Cho biÕt dung dÞch b·o hoµ cña CuI trong n-íc ë nhiÖt ®é th-êng cã nång ®é lµ10 -6M. 2.76) . c) ThÕ ®iÖn cùc chuÈn cña cÆp Cu2+/ Cu+ lµ 0. Gi¶ sö tæng nång ®é NaOH ®· cho vµo lµ 0. t¹o kÕt tña tr¾ng víi n-íc v«i trong vµ t¹o kÕt tña vµng víi dung dÞch AgNO3 lµ nh÷ng muèi nµo? ViÕt c¸c ph-¬ng tr×nh ph¶n øng ®Ó chøng minh.Dung dÞch Na2CO3 BiÕt H2CO3 cã pKa1 = 6.10-3M vµ Mg2+ 0.15V.

C©u III : 1. X¸c ®Þnh c«ng thøc ph©n tö vµ c¸c nhãm chøc cã trong ph©n tö X.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:30 X t¸c dông víi (CH3CO)2O cho A(C14H16O5). X¸c ®Þnh c«ng thøc cÊu t¹o cña anetol.víi HI nãng cho CH3I . 2. ViÕt ph-¬ng tr×nh ph¶n øng monoclo ho¸ sec-butyl clorua. vµ víi O3 råi Zn / HCl (dung dÞch) cho E (C8H8O3). X . gäi tªn c¸c s¶n phÈm t¹o thµnh. Khi ®un nãng víi xóc t¸c. Dïng c«ng thøc cÊu t¹o. 3. biÕt r»ng E lµ ®ång ph©n cã pKa gÇn thÊp nhÊt. víi CH3I (cã mÆt baz¬) cho D (C11H14O3). anetol th-êng bÞ ho¸ nhùa. kali p-metoxi benzoat vµ MnO2. 1. 2. 3. vµ E tan trong dung dÞch NaOH nh-ng kh«ng tan trong dung dÞch NaHCO3. D vµ E . Dïng c¸c c«ng thøc cÊu t¹o thu gän viÕt c¸c ph-¬ng tr×nh ph¶n øng ®· x¶y ra. NÕu xuÊt ph¸t tõ (S)-sec-butyl clorua th× sÏ nhËn ®-îc bao nhiªu hîp chÊt quang ho¹t? ViÕt c«ng thøc cÊu t¹o vµ gäi tªn theo danh ph¸p R . Gäi tªn X . Hoµn thµnh s¬ ®å c¸c ph¶n øng sau vµ gäi tªn c¸c s¶n phÈm : Cl2 (1 mol) HNO3 (1 mol) HN(C2H5)2 Fe. E. ngoµi ra E cßn khö ®-îc AgNO3. Gi¶i thÝch t¹i sao sinh ra hai ®ång ph©n cña B. 3. bé gi¸o dôc vµ ®µo t¹o giái quèc gia k× thi chän häc sinh líp 12 thpt n¨m häc 2000-2001 ®Ò thi dù M«n : ho¸ häc B¶ng B Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi thø hai : ( theo quyÕt ®Þnh vµ th«ng b¸o cña Bé) bÞ . 4. b) HCl . A vµ D kh«ng tan trong dung dÞch NaOH nh-ng dÔ lµm mÊt mµu KMnO4 lo·ng nguéi vµ brom lo·ng. E t¸c dông víi HI nãng còng cho CH3I. HCl a) Benzen (1 mol) A B C D AlCl3 H2SO4 CH3I (1 mol) HNO3 (1 mol) Fe. HCl G b) Phenol (1 mol) E F ClCH2COOH H C©u IV : Thµnh phÇn chÝnh cña tinh dÇu håi lµ anetol (C10H12O). h·y viÕt c¸c ph-¬ng tr×nh ph¶n øng cña anetol víi: a) Br2/ CCl4 . víi HBr ë l¹nh cho B (C10H11BrO2. ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra vµ ®Ò nghÞ c¸ch t¸ch lÊy axit p-metoxi benzoic tõ hçn hîp sau ph¶n øng. c) Cl2 + H2O 4. B . A . S. 1. B . B1 . 2. Cho anetol ph¶n øng víi dung dÞch KMnO4 trong n-íc th× t¹o thµnh kali axetat. gåm hai ®ång ph©n c©ó t¹o B1 vµ B2). H·y gi¶i thÝch. viÕt c«ng thøc cÊu tróc c¸c ®ång ph©n kh«ng gian cã thÓ cã vµ gäi tªn IUPAC cña chóng. X¸c ®Þnh c«ng thøc cÊu t¹o cña X .

1. X t¸c dông víi (CH3CO)2O cho A(C14H16O5). ngoµi ra E cßn khö ®-îc AgNO3. Cho anetol ph¶n øng víi dung dÞch KMnO4 trong n-íc th× t¹o thµnh kali axetat. biÕt r»ng E lµ ®ång ph©n cã pKa gÇn thÊp nhÊt. phenol (pKa = 10) víi : .76) . vµ E tan trong dung dÞch NaOH nh-ng kh«ng tan trong dung dÞch NaHCO3.ViÕt c¸c ph-¬ng tr×nh ph¶n øng (nÕu cã) cña: a) Axit axetic (pKa = 4.Dung dÞch Na2CO3 BiÕt H2CO3 cã pKa1 = 6. X¸c ®Þnh c«ng thøc cÊu t¹o cña X . 6.67% hi®ro. víi CH3I (cã mÆt baz¬) cho D (C11H14O3).4 vµ pKa2 = 10. HCl E F ClCH2COOH H C©u IV : Thµnh phÇn chÝnh cña tinh dÇu håi lµ anetol (C10H12O). dung dÞch C6H5ONa víi CO2 2.3 b) Dung dÞch CH3COONa . gäi tªn c¸c s¶n phÈm t¹o thµnh. HCl a) Benzen (1 mol) A B C D AlCl3 H2SO4 HNO3 (1 mol) b) Phenol (1 mol) Fe. CH3I (1 mol) G . BiÕt ph©n tö khèi cña X lµ 180. COOH + CO2 H (CH3CO)2O OCOCH3 g) C6H5ONa 6 at. cßn l¹i lµ oxi.67% cacbon. gåm hai ®ång ph©n c©ó t¹o B1 vµ B2). X¸c ®Þnh c«ng thøc ph©n tö vµ c¸c nhãm chøc cã trong ph©n tö X. 125oC M N (Aspirin) C©u II : Hîp chÊt thiªn nhiªn X chøa 66. Hoµn thµnh s¬ ®å c¸c ph¶n øng sau vµ gäi tªn c¸c s¶n phÈm : Cl2 (1 mol) HNO3 (1 mol) HN(C2H5)2 Fe. A vµ D kh«ng tan trong dung dÞch NaOH nh-ng dÔ lµm mÊt mµu KMnO4 lo·ng nguéi vµ bom lo·ng. X . ViÕt ph-¬ng tr×nh ph¶n øng monoclo ho¸ sec-butyl clorua. vµ víi O3 råi Zn / HCl (dung dÞch) cho E (C8H8O3). Hoµn thµnh c¸c ph-¬ng tr×nh ph¶n øng (c¸c s¶n phÈm viÕt ë d¹ng c«ng thøc cÊu t¹o) theo c¸c s¬ ®å chuyÓn ho¸ sau: CH3OH(dung m«i) a) C6H5CH=CH2 + Br2 A + B o H2SO4 . t b) C6H5CH=CH2 C(C16H16) Nªu tªn c¸c c¬ chÕ cña ph¶n øng a) vµ b). 2. C©u III : 1. A . 2.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:31 C©u I : 1. D vµ E .Dung dÞch NaHCO3 .víi HI nãng cho CH3I . víi HBr ë l¹nh cho B (C10H11BrO2. B . kali p-metoxi benzoat vµ MnO2. B . E t¸c dông víi HI nãng còng cho CH3I.

9-xiclo®o®ecatrien. Z. sau khi chÕ ho¸ D víi NaOH ë 300oC råi víi HCl sÏ cho s¶n phÈm E (E cã . H·y gi¶i thÝch. C6H5-CH2-NH2. 3. ghi râ c¸c ®iÒu kiÖn ph¶n øng (nÕu cã): a) Tõ etanol vµ c¸c ho¸ chÊt v« c¬ cÇn thiÕt.5 ®iÓm). 2.3-buta®ien víi sù cã mÆt cña chÊt xóc t¸c c¬ kim.5. anetol th-êng bÞ ho¸ nhùa. Khi dïng chÊt xóc t¸c thÝch hîp lµ c¸c phøc T-alyl cña kim lo¹i chuyÓn tiÕp ng-êi ta ®iÒu chÕ ®-îc (E.9-xiclododecatrien vµ (Z. ete khan 2) H2O/H+ 15OC (1 mol) a.5. (B) 1. G1 + G2 2.s. X¸c ®Þnh c«ng thøc cÊu t¹o cña anetol. h·y viÕt c¸c ph-¬ng tr×nh ph¶n øng cña anetol víi: a) Br2/ CCl4 . G2 lµ c¸c hîp chÊt h÷u c¬. NÕu còng cho A ph¶n øng víi C2H5Br nh-ng cã xóc t¸c AlCl3 (khan) th× t¹o ra hîp chÊt C cã cïng c«ng thøc ph©n tö víi B (C11H17N).. CH2=CH-CH2-NH2.5.5 ®iÓm) Hîp chÊt h÷u c¬ A cã c«ng thøc ph©n tö C7H9N. (b) -NH-CH3 . ®iÒu chÕ: (C) (D) C©u III: (2. Dïng c«ng thøc cÊu t¹o. S¾p xÕp sù t¨ng dÇn tÝnh baz¬ (cã gi¶i thÝch) cña c¸c chÊt trong tõng d·y sau: (a) CH3-CH(NH2)-COOH. E. (3. E)-1. ®iÒu chÕ: (A) Propin (kh«ng qu¸ 8 giai ®o¹n)..s. c) Cl2 + H2O 4. ViÕt s¬ ®å ph¶n øng ®iÒu chÕ c¸c hîp chÊt sau ®©y. viÕt ë d¹ng c«ng thøc cÊu t¹o): Fe Cl2 (1 mol) Mg 1) Etilen oxit H2SO4 Br2 (1 mol) E1 + E2 C6H5-CH3 A B C D (1 mol) a. sau ®ã víi NaOH thu ®-îc hîp chÊt B cã c«ng thøc ph©n tö C11H17N. Khi xiclotrime ho¸ 1. Cho A ph¶n øng víi H2SO4 (®Æc) ë 180oC t¹o hîp chÊt D cã c«ng thøc ph©n tö C7H9O6S2N. CH|C-CH2-NH2 . E. §©y lµ mét ph-¬ng ph¸p ®¬n gi¶n ®Ó ®iÒu chÕ hidrocacbon vßng lín.1-§icloetan (qua 4 giai ®o¹n). CH3-CH2-CH2-NH2. E)-1. ng-êi ta ®· ®iÒu chÕ ®-îc (Z. p-O2N-C6H4-NH2. bé gi¸o dôc vµ ®µo t¹o quèc gia líp 12 thpt n¨m häc 2001-2002 ÑEÀ THI CHÍNH THÖÙC k× thi chän häc sinh giái M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 13 / 3 / 2002 C©u I:(4 ®iÓm) 1. ViÕt c¸c ph-¬ng tr×nh ph¶n øng theo s¬ ®å chuyÓn ho¸ sau (c¸c chÊt tõ A. ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra vµ ®Ò nghÞ c¸ch t¸ch lÊy axit p-metoxi benzoic tõ hçn hîp sau ph¶n øng. E)-1. Cho A ph¶n øng víi C2H5Br (d-). -CH2-NH2 .5 ®iÓm) 1. H·y viÕt c«ng thøc cÊu t¹o cña 3 hîp chÊt trªn. viÕt c«ng thøc cÊu tróc c¸c ®ång ph©n kh«ng gian cã thÓ cã vµ gäi tªn IUPAC cña chóng. b) HCl . . h÷u c¬ (chøa kh«ng qu¸ 3 nguyªn tö cacbon). 2. b) Tõ benzen vµ c¸c chÊt v« c¬. Khi ®un nãng víi xóc t¸c. C©u II: (5.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:32 1.9-xiclododecatrien.

2. nÕu cho A ph¶n øng víi NaNO2 trong HCl ë 5oC. 9.25 MeV (2) 12 H . Pro-Gly-Phe .. Oxi ho¸ 150 mg amiloz¬ bëi NaIO4 thu ®-îc 0. råi cho ph¶n øng víi F-naphtol trong dung dÞch NaOH th× thu ®-îc s¶n phÈm cã mµu G. ViÕt s¬ ®å c¸c ph-¬ng tr×nh ph¶n øng chuyÓn D-glucoz¬ thµnh L-guloz¬ CH 2OH cã c«ng thøc bªn. Arg-Pro-Pro .0045 mmol axit fomic. Trªn mçi c«ng thøc ®ã h·y ghi (trong ngoÆc) gi¸ trÞ pKa bªn c¹nh nhãm chøc thÝch hîp.21.4-®initroflobenzen råi thuû ph©n th× ®-îc dÉn xuÊt 2. biÕt CHO H OH r»ng khi oxi ho¸ 1 mol amiloz¬ b»ng NaIO4. biÕt r»ng nhãm E-COOH cña Asp kh«ng cßn tù do. 9.34. 10.10. 1. ViÕt tªn IUPAC vµ c«ng thøc Fis¬ ë pHI cña Arg. sè gèc glucoz¬ ®Çu m¹ch HO H t¹o ra 1 mol axit fomic. sè gèc glucoz¬ cuèi m¹ch t¹o ra 2 mol axit fomic. X¸c ®Þnh c«ng thøc cÊu t¹o cña A.5 ®iÓm) 1. 12. PheSer-Pro. L-galuz¬ bé gi¸o dôc vµ ®µo t¹o k× thi chän häc sinh giái quèc gia líp thpt n¨m häc 2001-2002 ®Ò thi chÝnh thøc M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 12 / 3 / 2002 C©u I: (5 ®iÓm).60). C©u V: (2. Orn. > 6. Ser-Pro-Phe . H OH (b) ViÕt s¬ ®å c¸c ph-¬ng tr×nh ph¶n øng x¶y ra. 9. Arg H2NC(=NH)NH?CH2A3CH(NH2)COOH (2. 10. 59 + 0n1 p X? (1) 27Co 60 X? p 28Ni + . G vµ viÕt c¸c ph-¬ng tr×nh ph¶n øng (nÕu cã) ®Ó minh ho¹. BiÕt nhãm -NHC(=NH)NH2 cã tªn lµ guani®ino.. Pro vµ Ser cã trong thµnh phÇn cÊu t¹o cña nonapeptit bra®ikinin. a) Dïng kÝ hiÖu 3 ch÷ c¸i (Arg. E. Thuû ph©n bra®ikinin sinh ra Pro-Pro-Gly . b) ViÕt c«ng thøc Fis¬ vµ cho biÕt nonapeptit nµy cã gi¸ trÞ pHI trong kho¶ng nµo? (} 6.69).48). hR = 1.4-®initrophenyl cña Asp vµ mét s¶n phÈm cã c«ng thøc C4H9NO2.50). Gly. 1.04. MÆt kh¸c. N Ser HOCH2CH(NH2)COOH (2. C¬ së cña liÖu ph¸p ®ã lµ sù biÕn ®æi h¹t nh©n. LiÖu ph¸p phãng x¹ ®-îc øng dông réng r·i ®Ó ch÷a ung th-. Orn H2N?CH2A3CH(NH2)COOH (2. B. D. 3.60). . Asp HOOCCH2CH(NH2)COOH (1.99.17. (a) TÝnh sè l-îng trung b×nh c¸c gèc glucoz¬ trong ph©n tö amiloz¬. Pro-Phe-Arg .15). ViÕt c«ng thøc Fis¬ vµ tªn ®Çy ®ñ cña aspactam.sau: Ala CH3CH(NH2)COOH (2. <6.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:33 ph¶n øng mµu víi FeCl3). Gly-Phe-Ser .. HO H 2.5 ®iÓm) Thuû ph©n mét protein (protit) thu ®-îc mét sè aminoaxit cã c«ng thøc vµ pKa nh. 3. << 6. Asp.90. cho biÕt tr×nh tù c¸c aminoaxit trong ph©n tö bra®ikinin. Asp vµ CH3OH. >> 6). Ala vµ Asp cã trong thµnh phÇn cÊu t¹o cña aspactam (mét chÊt cã ®é ngät cao h¬n saccaroz¬ tíi 160 lÇn).. C. Thuû ph©n hoµn toµn aspactam thu ®-îc Ala.9.65. Pro. Cho aspactam t¸c dông víi 2. C©u IV: (5. Pro COOH (1.88. Arg.).. 8.

i TÝnh thÕ cña cùc platin nhóng trong dung dÞch thu ®-îc so víi cùc calomen b·o hoµ (Hg2Cl2/2Hg.= 0. Cho biÕt muèi cña axit h÷u c¬ nµo bÞ ®iÖn ph©n? 3.6.16V. 2.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:34 (a) H·y hoµn thµnh ph-¬ng tr×nh cña sù biÕn ®æi h¹t nh©n trªn vµ nªu râ ®Þnh luËt nµo ®-îc ¸p dông ®Ó hoµn thµnh ph-¬ng tr×nh. iii NhËn biÕt c¸c chÊt cã trong kÕt tña A b»ng ph-¬ng ph¸p ho¸ häc.060M.59 gam Cu tõ dung dÞch ®ång sunfat. Thªm FeCl3 cho ®Õn nång ®é 0. (c) Axit ho¸ chËm dung dÞch X ®Õn pH = 0. EoCu+/Cu = +0. PbI2 = 10-7.050M. Eo Fe3+/Fe2+ = +0. Ecal b·o hoµ = 0. Na2SO4 0. (a) TÝnh pH cña dung dÞch X. TÝch sè tan cña PbS = 10-26 . (b) Cho bét ®ång vµo dung dÞch CuSO4 1M. HSO4.44V H·y cho biÕt hiÖn t-îng g× x¶y ra trong c¸c tr-êng hîp sau: (a) Cho bét s¾t vµo dung dÞch Fe2(SO4)3 0. PbSO4 = 10-7.77 V .10M. (b) H·y cho biÕt ®iÓm kh¸c nhau gi÷a ph¶n øng h¹t nh©n víi ph¶n øng oxi ho¸-khö (lÊy thÝ dô tõ ph¶n øng (2) vµ ph¶n øng Co + Cl2 p CoCl2). Cho biÕt muèi cña kim lo¹i nµo bÞ ®iÖn ph©n? BiÕt r»ng 5. Cã cÊu h×nh electron 1s22s22p63s23p63d54s1 (1) (a) Dïng kÝ hiÖu « l-îng tö biÓu diÔn cÊu h×nh electron (1). C©u II: (6 ®iÓm).5M. Eo I2/2I. 2. 1. ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra trªn c¸c ®iÖn cùc. viÕt ph-¬ng tr×nh ph¶n øng x¶y ra t¹i c¸c ®iÖn cùc vµ ph¶n øng tæng qu¸t khi pin ho¹t ®éng. (b) Qui luËt liªn hÖ gi÷a En víi Z tÝnh ®-îc ë trªn ph¶n ¸nh mèi liªn hÖ nµo gi÷a h¹t nh©n víi electron trong c¸c hÖ ®ã ? (c) TrÞ sè n¨ng l-îng tÝnh ®-îc cã quan hÖ víi n¨ng l-îng ion ho¸ cña mçi hÖ trªn hay kh«ng ? TÝnh n¨ng l-îng ion ho¸ cña mçi hÖ. ii TÝnh nång ®é c¸c ion trong dung dÞch B (kh«ng kÓ sù thuû ph©n cña c¸c ion.8 . i Cho biÕt thµnh phÇn ho¸ häc cña kÕt tña A vµ dung dÞch B. Eo Fe3+/Fe2+ = 0. 2 (n: sè l-îng tö chÝnh.cã pK = 2.52V. pK2 = 12. (b) CÊu h×nh electron (1) lµ cÊu h×nh electron cña nguyªn tö hay ion ? T¹i sao ? (c) Cho biÕt tÝnh chÊt ho¸ häc ®Æc tr-ng cña ion hay nguyªn tö øng víi cÊu h×nh electron (1). Z2 3. coi thÓ tÝch dung dÞch kh«ng thay ®æi khi thªm Pb(NO3)2). n (a) TÝnh n¨ng l-îng1e trong tr-êng lùc mét h¹t nh©n cña mçi hÖ N6+.18 gam cña kim lo¹i ®ã ®Èy ®-îc 1. BiÕt En = -13.010M. (b) Thªm dÇn Pb(NO3)2 vµo dung dÞch X cho ®Õn nång ®é 0.865 gam mét kim lo¹i vµ trªn an«t cã khÝ etan vµ khÝ cacbonic tho¸t ra. ¸p dông thuyÕt lai ho¸ gi¶i thÝch kÕt qu¶ cña thùc nghiÖm x¸c ®Þnh ®-îc BeH2.90. Dung dÞch X gåm Na2S 0. ii BiÓu diÔn s¬ ®å pin.244V C©u III: (3 ®iÓm).77V. EoFe2+/Fe = -0. CO2 ®Òu lµ ph©n tö th¼ng. Cho : axit cã H2S pK1 = 7. 1.00. Eo S/H2S = 0. O7+.6.2Cl-). 2.54V .14V . Z: sè ®¬n vÞ ®iÖn tÝch h¹t nh©n). KÕt qu¶ sau qu¸ tr×nh ®iÖn ph©n lµ trªn cat«t t¹o ra 3. viÕt c¸c ph-¬ng tr×nh ph¶n øng (nÕu cã). . BiÕt thÕ oxi ho¸-khö tiªu chuÈn : EoCu2+/Cu+ = +0.00. 4. C5+. h·y viÕt mét ph-¬ng tr×nh ph¶n øng ®Ó minh häa.090M th× thu ®-îc kÕt tña A vµ dung dÞch B.5A ®i qua dung dÞch muèi cña mét axit h÷u c¬ trong 2 giê. Cho dßng ®iÖn 0. KI 0.

NaCl.91 Debye. ph©n tö khèi gÇn b»ng nhau (HF 1. 3.100 M khi ®iÒu chØnh pH = 2.¸p suÊt chung cña hÖ kh«ng ®æi (P = const).10-5.8. nh-ng nhiÖt ®é nãng ch¶y cña hi®roflorua lµ ± 830C thÊp h¬n nhiÒu so víi nhiÖt ®é nãng ch¶y cña n-íc ®¸ lµ 00C. C©u V: (3. Ban ®Çu l-îng N2O5 cho võa ®Çy b×nh. s-1 . 1.thÕ nµo? NÕu: a) T¨ng l-îng khÝ NO. 2. ë nhiÖt ®é cao (7000C) ®ime bÞ ph©n li thµnh monome (AlCl3). ¸p suÊt riªng cña N2O5 lµ 0. biÓu thøc tÝnh tèc ®é ph¶n øng v = k. O2. c) Gi¶m nhiÖt ®é. Zn(NO3)2. 3. H·y tÝnh Kp (ghi râ ®¬n vÞ) t¹i 0oC . b) h×nh thµnh NO2 .0 x 10-7 vµ K2 = 1. bé gi¸o dôc vµ ®µo t¹o thpt n¨m häc 2002-2003 ®Ò thi chÝnh thøc M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 12 / 3 / 2003 C©u I: 1. d) Thªm khÝ N2 vµo hÖ mµ: . ë thêi ®iÓm kh¶o s¸t. Gi¶ thiÕt c¸c khÝ ®Òu lµ khÝ lÝ t-ëng.84 Debye. M H 2O 18). Trong phßng thÝ nghiÖm cã c¸c dung dÞch bÞ mÊt nh·n: AlCl3.010 M. 2.54. 2. Co2+. M« t¶ cÊu tróc h×nh häc cña c¸c ph©n tö ®ã. NÕu ph¶n øng trªn cã ph-¬ng tr×nh N2O5 (k) 2 NO2 (k) + 1/2 O2 (k) th× trÞ sè tèc ®é ph¶n øng. Dïng thªm mét thuèc thö. H»ng sè axit cña H2S: K1 = 1. Gi¶ thiÕt r»ng tØ sè gi÷a hai trÞ sè h»ng sè c©n b»ng t¹i 0oC víi 25oC hay 25oC víi 50oC ®Òu b»ng 1. 1. Ph©n tö HF vµ ph©n tö H2O cã momen l-ìng cùc. Cho biÕt kiÓu lai ho¸ cña nguyªn tö nh«m. TÝnh tèc ®é: a) tiªu thô N2O5 . Nh«m clorua khi hoµ tan vµo mét sè dung m«i hoÆc khi bay h¬i ë nhiÖt ®é kh«ng qu¸ cao th× tån t¹i ë d¹ng ®ime (Al2Cl6). Dung dÞch b·o hßa H2S cã nång ®é 0. c©n b»ng ho¸ häc ®· ®-îc thiÕt lËp.ThÓ tÝch b×nh ph¶n øng kh«ng ®æi (V = const) .0.070 atm . h»ng sè tèc ®é ph¶n øng cã thay ®æi kh«ng? Gi¶i thÝch. MHF 20. KOH. 2. ViÕt ph-¬ng tr×nh ph¶n øng x¶y ra. kiÓu liªn kÕt trong mçi ph©n tö .CN2O5.100 M. vµ Ag+ víi nång ®é ban ®Çu cña mçi ion ®Òu b»ng 0. h·y nhËn biÕt mçi dung dÞch. b) Gi¶m l-îng h¬i Br2. Pb(NO3)2. Hoµ tan H2S vµo A ®Õn b·o hoµ vµ ®iÒu chØnh pH = 2. h·y gi¶i thÝch v× sao? C©u II: 1. H2O 1.5 ®iÓm). ViÕt c¸c ph-¬ng tr×nh ph¶n øng (nÕu cã). KhÝ NO kÕt hîp víi h¬i Br2 t¹o ra mét khÝ duy nhÊt trong ph©n tö cã 3 nguyªn tö. T¹i 25oC ph¶n øng 2 N2O5 (k) 4 NO2 (k) + O2 (k) cã h»ng sè tèc ®é k = 1. b) Mét dung dÞch A chøa c¸c cation Mn2+. C©n b»ng ®ã sÏ chuyÓn dÞch nh.3 x 10-13. AgNO3. t¹i 25oC cã Kp = 116.0 th× ion nµo t¹o k× thi chän häc sinh giái quèc gia líp 12 . 50oC. Ph¶n øng trªn x¶y ra trong b×nh kÝn thÓ tÝch 20.6. XÐt t¹i 25oC.5 ®iÓm).0 lit kh«ng ®æi. a) TÝnh nång ®é ion sunfua trong dung dÞch H2S 0. Mg(NO3)2. ViÕt c«ng thøc cÊu t¹o Lewis cña ph©n tö ®ime vµ monome. BiÕt ph¶n øng trªn thu nhiÖt. TÝnh sè ph©n tö N2O5 ®· bÞ ph©n tÝch sau 30 gi©y.Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:35 ********************************************************************************************************************************* C©u IV: (2.

Cho: TMnS = 2.0 víi ®iÖn cùc than ch× trong 30 giê. (F) c) ViÕt ph-¬ng tr×nh biÓu diÔn 3 giai ®o¹n cña ph¶n øng. Sau 30 phót. 298 298 0 ±10 Cho: TAgCl ë 25 C b»ng 1. d) Mét thÝ nghiÖm. H·y x¸c ®Þnh A. hîp chÊt D kh«ng bÞ ph©n tÝch khi nãng ch¶y. C©u III: Ph-¬ng tr×nh ph¶n øng iot ho¸ axeton trong dung dÞch cã xóc t¸c axit: CH3 ± C ± CH3 + I2 €€p CH3 ± C ± CH2I + HI (A) (B) CH3 ± C ± CH3 vµ CH3 ± C = CH2 + OH OH O O (E) (F) H Thùc nghiÖm cho thÊy ph¶n øng lµ bËc nhÊt ®èi víi axeton vµ bËc nhÊt ®èi víi H+. b) ViÕt biÓu thøc biÓu diÔn tèc ®é ph¶n øng qua: tèc ®é tiªu hao (A). Ph¶n øng gi÷a AgNO3 víi KCl trong dung dÞch t¹o thµnh kÕt tña AgCl vµ gi¶i phãng n¨ng l-îng. ®un nãng b×nh ®Õn nhiÖt ®é T (K) ®Ó x¶y ra ph¶n øng ph©n li PCl5. Cho 0. H·y tÝnh h»ng sè tèc ®é ph¶n øng. tèc ®é t¹o thµnh (E). nång ®é axeton gi¶m bít 15% so víi nång ®é ban ®Çu.07 % B theo khèi l-îng. d) H·y cho biÕt nªn dïng chÊt chØ thÞ nµo ®Ó x¸c ®Þnh ®iÓm dõng cña ph¶n øng trung hßa. 2.6.12 l khÝ CO2 (®ktc). ng-êi ta lÊy nång ®é ban ®Çu cña axeton. §iÖn ph©n 50 ml dung dÞch HNO3 cã pH = 5. TAg2S = 6. b) TÝnh (G0 cña ph¶n øng kÕt tña AgCl vµ E 0 cña tÕ bµo ®iÖn ho¸.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:36 kÕt tña.1 mol hîp chÊt C ph¶n øng víi CO2 (d-) t¹o thµnh hîp chÊt D vµ 2. iot vµ ion H+ ®Òu b»ng 0. C. Ta cã thÓ t¹o ra mét tÕ bµo ®iÖn ho¸ (pin) sinh c«ng ®iÖn nhê ph¶n øng ®ã. TCoS = 4. D vµ viÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra.1M. b) TÝnh pH cña dung dÞch sau khi ®iÖn ph©n. Giai ®o¹n nµo quyÕt ®Þnh tèc ®é ph¶n øng. BiÕt hîp chÊt C chøa 45. a) ViÕt ph-¬ng tr×nh biÓu diÔn ®Þnh luËt tèc ®é cña ph¶n øng vµ cho biÕt ®¬n vÞ (thø nguyªn) cña h»ng sè tèc ®é ph¶n øng. L-1. dung dÞch D ph¶n øng hÕt 100 ml dung dÞch HCl 1 M gi¶i phãng 1. B. 10 . a) ViÕt c«ng thøc cña tÕ bµo ®iÖn ho¸ theo quy t¾c IUPAC vµ c¸c nöa ph¶n øng ®iÖn cùc t¹i anot vµ catot.4 gam B.3 x 10-50 3. Hßa tan hoµn toµn D vµo n-íc. phót-1. H·y chøng minh c¬ chÕ anh (chÞ) nªu ra phï hîp víi ph-¬ng tr×nh ®· viÕt ë (a). Cho m gam PCl5 vµo mét b×nh dung tÝch V. H·y thiÕt . MÆt kh¸c. a) ViÕt nöa ph¶n øng t¹i c¸c ®iÖn cùc vµ ph-¬ng tr×nh ph¶n øng chung.0001 mol/L cÇn ®Ó trung hßa dung dÞch sau khi ®iÖn ph©n.0 x 10 ± 21 . dßng ®iÖn 1A. C©u IV: 1. Kim lo¹i A ph¶n øng víi phi kim B t¹o hîp chÊt C mµu vµng cam.47. c) TÝnh thÓ tÝch dung dÞch NaOH 0. Tèc ®é t¹o thµnh HI t¹i thêi ®iÓm 30 phót lµ 3.5 x 10-10 . (B). Coi khèi l-îng riªng cña dung dÞch HNO3 lo·ng lµ 1 g/ml C©u V : Khi nung nãng ®Õn nhiÖt ®é cao PCl5 bÞ ph©n li theo ph-¬ng tr×nh PCl5 (k)  PCl3 (k) + Cl2 (k) 1. thùc nghiÖm còng cho thÊy trong qu¸ tr×nh ph¶n øng cã t¹o ra c¸c chÊt trung gian Tõ ®ã ng-êi ta nªu gi¶ thiÕt ph¶n øng trªn x¶y ra qua 3 giai ®o¹n. Sau khi ®¹t tíi c©n b»ng ¸p suÊt khÝ trong b×nh b»ng p.10-5 mol.

TÝnh tØ sè 2 .ë thÝ nghiÖm 1 nh-ng h¹ nhiÖt ®é cña b×nh ®Õn T3 = 0. . Cho: Cl = 35. Cho B t¸c dông víi axit HNO2 thu ®-îc hçn hîp gåm ancol C quang ho¹t vµ ancol tert-amylic (2-metyl-2-butanol). ThiÕt lËp biÓu thøc cña kc theo E. TÝnh E vµ Kp.944 atm.862. X¸c ®Þnh c«ng thøc cÊu t¹o cña A.sau: . Trong thÝ nghiÖm 2 gi÷ nguyªn l-îng PCl5 vµ nhiÖt ®é nh.Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:37 ********************************************************************************************************************************* lËp biÓu thøc cña Kp theo ®é ph©n li E vµ ¸p suÊt p. Dïng c«ng thøc cÊu t¹o. Sau khi ®¹t tíi c©n b»ng ®o ®-îc p b»ng 2. V1 4. C©u II: 1. Hçn hîp khÝ trong b×nh cã tØ khèi so víi hi®ro b»ng 68.500 atm. 2. Hîp chÊt A (C5H9OBr) khi t¸c dông víi dung dÞch ièt trong kiÒm t¹o kÕt tña mµu vµng.700 atm. Khö A b»ng H2 cã xóc t¸c Ni sÏ ®-îc B (C5H13N) quang ho¹t. axit aconitic bÞ hidrat hãa t¹o thµnh axit A kh«ng quang ho¹t vµ axit B quang ho¹t theo mét c©n b»ng: H2O COOH HOOC H2O A B C C (C6H8O7) (C6H8O7) CH2COOH H 6% 90% Axit aconitic 4% a) ViÕt c«ng thøc cÊu t¹o cña A vµ B.300 gam PCl5 vµo b×nh dung tÝch V1. Tõ ®ã cho biÕt ph¶n øng ph©n li PCl5 thu nhiÖt hay ph¸t nhiÖt. 4. H = 1. b) ViÕt c«ng thøc c¸c ®ång ph©n cÊu t¹o trong hçn hîp X. Hîp chÊt A (C5H11O2N) lµ mét chÊt láng quang ho¹t. Trong thÝ nghiÖm 1 thùc hiÖn ë nhiÖt ®é T1 ng-êi ta cho 83. Khi cã mÆt enzim aconitaza. P : 30. 3. a) X¸c ®Þnh c«ng thøc cÊu t¹o cña A. 2. C vµ ancol tert-amylic tõ A. Ghi c¸c gi¸ trÞ pKa bªn c¹nh nhãm chøc thÝch hîp. bé gi¸o dôc vµ ®µo t¹o thpt n¨m häc 2002-2003 ®Ò thi chÝnh thøc M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 13 / 3 / 2003 C©u I: 1. m. Axit A cã pKa: 3. Trong thÝ nghiÖm 3 gi÷ nguyªn l-îng PCl5 vµ dung tÝch b×nh V1 nh. TÝnh Kp vµ E. b) ViÕt s¬ ®å ®iÒu chÕ A tõ axeton vµ c¸c chÊt v« c¬ cÇn thiÕt.453 . C¸c khÝ ®Òu lµ khÝ lÝ t-ëng. V. c) ViÕt c«ng thøc lËp thÓ d¹ng bÒn cña c¸c ®ång ph©n trong hçn hîp X. viÕt ph-¬ng tr×nh c¸c ph¶n øng t¹o thµnh B.974 .9 T1 th× ®o ®-îc ¸p suÊt c©n b»ng lµ 1. 2. CH CH2 CH O CH3 C CH2 CH k× thi chän häc sinh giái quèc gia líp 12 O H3C C CH3 Hidro hãa A víi xóc t¸c kim lo¹i t¹o ra hçn hîp s¶n phÈm X gåm c¸c ®ång ph©n cã c«ng thøc ph©n tö C10H20.8 .1 . 6.ë thÝ nghiÖm 1 nh-ng thay V dung tÝch lµ V2 th× ®o ®-îc ¸p suÊt c©n b»ng lµ 0. ghi tªn ®Çy ®ñ cña chóng vµ cña axit aconitic theo danh ph¸p IUPAC.4. Ozon ph©n mét tecpen A (C10H16) thu ®-îc B cã cÊu t¹o nh.008 .

C©u V: §isaccarit X (C12H22O11) kh«ng tham gia ph¶n øng tr¸ng b¹c. Ph©n tö TRF kh«ng chøa vßng lín h¬n 5 c¹nh. C©u IV: TRF lµ tªn viÕt t¾t mét homon ®iÒu khiÓn ho¹t ®éng cña tuyÕn gi¸p.3. 2. Deoxi.6-tetra-O-metyl-D-guloz¬. a) Dïng c«ng thøc cÊu t¹o. p  b) Gi¶i thÝch h-íng cña ph¶n øng t¹o thµnh C8H8O4NSCl vµ C6H8O2N2S. H·y ®Ò nghÞ s¬ ®å ph¶n øng víi ®Çy ®ñ ®iÒu kiÖn ®Ó: a) tõ etylen vµ c¸c chÊt v« c¬ tæng hîp c¸c hîp chÊt sau vµ s¾p xÕp chóng theo thø tù t¨ng dÇn nhiÖt ®é s«i: C2H5OCH2CH2OCH2CH2OH (Etylcacbitol) . Cho 3 biÓu thøc: pHI = (pKa1+pKa2+pKa3) : 3 . H·y ®Ò nghÞ s¬ ®å ph¶n øng víi ®Çy ®ñ ®iÒu kiÖn ®Ó tæng hîp axit (D. h·y hoµn thµnh s¬ ®å tæng hîp sau ®©y: C6 H 5 NH 2 2 p p COCl2 + CH3OH €€ C2H3O2Cl €€€€ B €€€€ C8H8O4NSCl p HOSO Cl NH3 €€€ D p H 3O €€€ C6H8O2N2S. Thñy ph©n hoµn toµn 1 mol TRF thu ®-îc 1 mol mçi chÊt sau: N CH2-CH-COOH NH3 . D. axit 5-amino ± 2. 2. pHI = (pKa1+pKa2) : 2 . Cho B t¸c dông víi CH3MgBr råi víi H2O th× ®-îc D (C6H12O). kh«ng bÞ thñy ph©n bëi enzim mantaza nh-ng bÞ thñy ph©n bëi enzim emulsin. L) ± glutamic tõ hidrocacbon chøa kh«ng qu¸ 2 nguyªn tö cacbon trong ph©n tö. §èi víi His ng-êi ta cho pKa1 = 1. v× sao? 3. ViÕt tªn A vµ D theo danh ph¸p IUPAC. Cho X ph¶n øng víi CH3I råi thñy ph©n th× chØ ®-îc 2. chØ cã B t¹o kÕt tña mµu vµng víi dung dÞch ièt trong kiÒm. Dïng c«ng thøc cÊu t¹o.Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:38 ********************************************************************************************************************************* A t¸c dông víi dung dÞch NaOH t¹o ra 2 xeton B vµ C cïng cã c«ng thøc ph©n tö C5H8O. O O O NH b) Tõ benzen hoÆc toluen vµ c¸c chÊt v« c¬ tæng Dioxan Mopholin hîp ®-îc c¸c d-îc chÊt sau: Axit 4-amino-2hidroxibenzoic. B. E.2. F.8 . HOOC-CH -CH2-CH-COOH .0 . 2. C. H·y viÕt c¸c c©n b»ng ®iÖn ly vµ ghi cho mçi c©n b»ng ®ã mét gi¸ trÞ pKa thÝch hîp. 1.D-guloz¬ A (C6H12O5) ®-îc chuyÓn hãa theo 2 h-íng sau: . mantaza xóc t¸c cho sù thñy ph©n chØ liªn kÕt E -glicozit. pHI = (pKa2+pKa3) : 2 . viÕt s¬ ®å ph¶n øng tõ A t¹o thµnh B. H·y x¸c ®Þnh c«ng thøc cÊu t¹o vµ viÕt c«ng thøc Fis¬ cña TRF. D t¸c dông víi HBr t¹o ra hai ®ång ph©n cÊu t¹o E vµ F cã c«ng thøc ph©n tö C6H11Br trong ®ã chØ cã E lµm mÊt mµu dung dÞch kali pemanganat ë l¹nh. ViÕt c«ng thøc lËp thÓ cña X. C ®Òu kh«ng lµm mÊt mµu dung dÞch kalipemanganat ë l¹nh. cßn emulsin xóc t¸c cho sù thñy ph©n chØ liªn kÕt F -glicozit. pKa3 = 9. biÓu thøc nµo ®óng víi His. 1. . C©u III: 1.4 ± dihidroxibenzoic. BiÕt r»ng: D-guloz¬ lµ ®ång ph©n cÊu h×nh ë C3 vµ C4 cña D-glucoz¬. 2 NH2 COOH NH2 N N (Pro) (His) (Glu) H H Trong hçn hîp s¶n phÈm thñy ph©n kh«ng hoµn toµn TRF cã dipeptit His-Pro. pKa2 = 6. Phæ khèi l-îng cho biÕt ph©n tö khèi cña TRF lµ 362 ®vC.4.

Ca2+.637. H+ Glixerin. biÕt ph©n tö khèi cña chóng ®Òu lín h¬n 160 vµ nhá h¬n 170 ®vC. H2O2 oxi ho¸ Mn2+ thµnh MnO2. Do ®ã mçi tr¹ng th¸i cña mét cÊu h×nh electron cã mét trÞ sè n¨ng l-îng. 3.874 CÊu h×nh electron 1s22s2 1s22s22p1 N¨ng l-îng (theo eV) . C.669. 3-hidroxipropanal B HBr C6H11BrO4 (E) KOH C6H10O4 (F) H2O/ DCl hçn hîp G a) X¸c ®Þnh c«ng thøc cÊu t¹o cña A. b) ViÕt c«ng thøc cÊu t¹o cña B. Víi nguyªn tè Bo (sè ®¬n vÞ ®iÖn tÝch h¹t nh©n Z = 5) ë tr¹ng th¸i c¬ b¶n cã sè liÖu nh.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:39 HIO 4 C 1) LiAlH 4 2) H2O D H3O+ A CH3OH. D. Trong sè c¸c ph©n tö vµ ion: CH2Br2.660. H·y viÕt ph-¬ng tr×nh ph¶n øng cã UF6 ®-îc t¹o thµnh khi cho UF4 t¸c dông víi ClF3. c) Trong m«i tr-êng axit.800 .848 . ph©n tö vµ ion nµo cã thÓ t¹o liªn kÕt hi®ro víi ph©n tö n-íc? H·y gi¶i thÝch vµ viÕt s¬ ®å m« t¶ sù h×nh thµnh liªn kÕt ®ã. C©u II 1. E.025 . Trong nguyªn tö hoÆc ion d-¬ng t-¬ng øng cã tõ 2 electron trë lªn.600.5H2 O. H2O2 khö MnO4. 2. H·y gi¶i thÝch vµ viÕt ph-¬ng tr×nh ph¶n øng chung cña qu¸ tr×nh nµy. H3As. ViÕt ph-¬ng tr×nh ho¸ häc cho mçi tr-êng hîp sau: a) Cho khÝ amoniac (d-) t¸c dông víi CuSO4. CH2O. a) U238 tù ph©n r· liªn tôc thµnh mét ®ång vÞ bÒn cña ch×.000 .340. Tæng céng cã 8 h¹t E ®-îc phãng ra trong qu¸ tr×nh ®ã. F. electron chuyÓn ®éng trong tr-êng lùc ®-îc t¹o ra tõ h¹t nh©n nguyªn tö vµ c¸c electron kh¸c. bé gi¸o dôc vµ ®µo t¹o sinh giái quèc gia líp 12 thpt n¨m häc 2003-2004 ®Ò thi chÝnh thøc k× thi chän häc M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 11 / 3 / 2004 C©u I 1. Nguyªn tö nµy cã bao nhiªu electron ®éc th©n? Cã thÓ cã møc oxi ho¸ cao nhÊt lµ bao nhiªu? c) UF6 lµ chÊt láng dÔ bay h¬i ®-îc øng dông phæ biÕn ®Ó t¸ch c¸c ®ång vÞ uran. c) X¸c ®Þnh c«ng thøc cÊu t¹o c¸c chÊt cã trong hçn hîp G.sau: CÊu h×nh electron 1s1 1s2 1s22s1 N¨ng l-îng (theo eV) . (C2 H5 )2O ..thµnh Mn2+. F . b) Uran cã cÊu h×nh electron [Rn]5f36d17s2. b) Trong m«i tr-êng baz¬.

799 V F /Ag 3.200 M vµo 10. KhÝ CO g©y ®éc v× t¸c dông víi hemoglobin (Hb) cña m¸u theo ph-¬ng tr×nh 3 CO + 4 Hb p Hb4 (CO)3 Sè liÖu thùc nghiÖm t¹i 200C vÒ ®éng häc ph¶n øng nµy nh. Epin sÏ thay ®æi ra sao nÕu: a) thªm mét l-îng nhá NaOH vµo dung dÞch B . b) thªm mét l-îng nhá Fe(NO3)3 vµo dung dÞch X? C©u IV 1. 1. K1= 10 ±11.mol±1.05 2. cña N|N b»ng 945 kJ.30. ph¶n øng: H2 (k) + Br2 (láng) 2 HBr (k) (1) cã h»ng sè c©n b»ng Kp = 9. l-1) Tèc ®é ph©n huû Hb ( Qmol. 3. .75 2. d) TÝnh h»ng sè c©n b»ng cña ph¶n øng . 2.20 (®Òu theo Qmol. t 2 b) H·y cho biÕt sù chuyÓn dÞch c©n b»ng ho¸ häc cña ph¶n øng (2) nÕu gi¶m thÓ tÝch b×nh ph¶n øng ë hai tr-êng hîp: *) Trongb×nh kh«ng cã Br2 (láng) .0 gam canxi cacbonat vµ 5.70 Cho biÕt : Ag+ + H2O Pb2+ + H2O PbOH+ + H+ (2) . KÝ hiÖu (k) chØ tr¹ng th¸i khÝ. Sau ph¶n øng ng-êi ta nhóng mét ®iÖn cùc Ag vµo dung dÞch B võa thu ®-îc vµ ghÐp thµnh pin (cã cÇu muèi tiÕp xóc hai dung dÞch) víi mét ®iÖn cùc cã Ag nhóng vµo dung dÞch X gåm AgNO3 0. Tõ 4 nguyªn tö N cã thÓ t¹o ra 1 ph©n tö N4 tø diÖn ®Òu hoÆc 2 ph©n tö N2 th«ng th-êng.25 atm.050 M vµ Pb(NO3)2 0. K2= 10 ±7. C©u III Dung dÞch A gåm AgNO3 0.250 M vµ HNO3 0. a) H·y tÝnh Kp cña ph¶n øng: H2 (k) + Br2 (k) 2 HBr (k) (2) 0 t¹ i 20 C vµ ¸ p suÊ pBr (k) = 0.80 ChØ sè tÝch sè tan pKs : AgI lµ 16. dÊu .100 M. Ng-êi ta nung nãng ®Õn 8000C mét b×nh ch©n kh«ng thÓ tÝch 1 lÝt chøa 10.903 atm . l-1 . Thªm 10.010 M vµ KSCN 0. 2. 2. = 0 . b) H·y nªu néi dung vµ gi¶i thÝch qui luËt liªn hÖ gi÷a c¸c n¨ng l-îng ion ho¸ ®ã. T¹i 200C.1016 .6 gam canxi oxit. AgSCN lµ 12.0 . AgOH + H+ (1) .********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:40 Trong ®ã: eV lµ ®¬n vÞ n¨ng l-îng.86 .biÓu thÞ n¨ng l-îng tÝnh ®-îc khi electron cßn chÞu lùc hót h¹t nh©n.00 ml KI 0.l-1) t¹i 200C . **) Trongb×nh cã Br2 (láng).50 1. N¨ng l-îng liªn kÕt cña N-N b»ng 163 kJ.50 2.040 M.50 4. Hb lµ 3. TÝnh pH cña dung dÞch A.0 .80 H·y tÝnh tèc ®é ph¶n øng khi nång ®é CO lµ 1.0 . H·y tÝnh sè mol khÝ cacbonic cã trong b×nh.00 ml dung dÞch A.sau: Nång ®é (Qmol. RT 0 ln = 0.s-1 ) Hb CO 1.mol±1.50 1.0592 lg EAg+ . Muèn cho l-îng canxi cacbonat ban ®Çu ph©n huû hÕt th× thÓ tÝch tèi thiÓu cña b×nh ph¶i b»ng bao nhiªu? BiÕt t¹i nhiÖt ®é ®ã khÝ CO2 trong b×nh cã ¸p suÊt lµ 0. a) H·y tr×nh bµy chi tiÕt vµ kÕt qña tÝnh c¸c trÞ sè n¨ng l-îng ion ho¸ cã thÓ cã cña nguyªn tè Bo theo eV khi dïng d÷ kiÖn cho trong b¶ng trªn. a) ViÕt s¬ ®å pin .00 2. c) ViÕt ph-¬ng tr×nh ph¶n øng x¶y ra khi pin ho¹t ®éng. b) TÝnh søc ®iÖn ®éng Epin t¹i 250C . PbI2 lµ 7. Tr-êng hîp nµo thuËn lîi h¬n? H·y gi¶i thÝch.50 2.

kh¶ n¨ng ph¶n øng t-¬ng ®èi ë c¸c vÞ trÝ kh¸c nhau trong c¸c ph©n tö biphenyl vµ benzen nh. h·y gi¶i thÝch sù t¹o thµnh hai s¶n phÈm A vµ B. 3.6±anhi®roglicopiranoz¬.4.3. 2-metylbuten-2 ph¶n øng víi axit clohidric. h·y viÕt c¸c ph-¬ng tr×nh ph¶n øng t¹o ra p(®imetylamino)azobenzen: CH3 N N N CH3 C©u III Monosaccarit A (®Æt lµ glicoz¬ A) cã tªn lµ (2S.6-pentahi®roxihexanal.sau: 0 790 0 250 250 0 250 250 0 790 1 1 1 1 1 1 a) Tr×nh bµy c¬ chÕ ph¶n øng clo ho¸ biphenyl theo h-íng -u tiªn nhÊt. Trong ph¶n øng clo ho¸ nhê chÊt xóc t¸c FeCl3 . Tõ etilen vµ propilen cã xóc t¸c axit. 2. Khi ®un nãng tíi 1000C. 5R)-2. CuI Br CH2 O N H /O B (NBS) C 2 4 2 D KOH C2H5OH ViÕt c«ng thøc c¸c s¶n phÈm h÷u c¬ A. D± glucoz¬ kh«ng tham gia ph¶n øng nµy. B. Li 2. B»ng c¬ chÕ ph¶n øng. sÏ thu ®-îc bao nhiªu gam 4-clobiphenyl? C©u II 1. C vµ D.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:41 bé gi¸o dôc vµ ®µo t¹o k× thi chän häc sinh giái quèc gia ®Ò thi chÝnh thøc líp 12 thpt n¨m häc 2003-2004 M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 12 / 3 / 2004 C©u I 1. trong ®ã cã A lµ 2-clo-3metylbutan vµ B lµ 2-clo-2-metylbutan. 1. A bÞ t¸ch n-íc sinh ra s¶n phÈm B cã tªn lµ 1. a) 2. cho biÕt s¶n phÈm chÝnh vµ gi¶i thÝch? 3. Tõ A cã thÓ nhËn ®-îc c¸c s¶n phÈm E (C5H10O5) vµ G (C5H8O7) theo s¬ ®å ph¶n øng: . b) Tèc ®é monoclo ho¸ biphenyl vµ benzen h¬n kÐm nhau bao nhiªu lÇn? c) Trong mét ph¶n øng clo ho¸ biphenyl thu ®-îc 10 gam 2-clobiphenyl. Tõ axetilen vµ c¸c ho¸ chÊt v« c¬ cÇn thiÕt.3R . 3-metylbuten-1 t¸c dông víi axit clohidric t¹o ra c¸c s¶n phÈm. Tr×nh bµy c¬ chÕ cña ph¶n øng. Cho s¬ ®å sau: O CH2 C NBr C Xiclohexanol HBr A 3. platin vµ ®iÒu kiÖn cÇn thiÕt. 4S .5. h·y viÕt s¬ ®å tæng hîp isopren.

lµm kh« råi c©n l¹i. b) VÕt alanin chuyÓn vÒ cùc nµo khi pH < 5 vµ pH > 8? c) X¸c ®Þnh hµm l-îng t-¬ng ®èi cña ion l-ìng cùc X cña alanin ë ®iÓm ®¼ng ®iÖn. baz¬ Histidin H t-¬ng øng vµ X lµ ion l-ìng cùc. röa s¹ch.105. nh-ng chØ lµm kÕt tña ®-îc mét phÇn ion Mg2+ trong dung dÞch n-íc ë d¹ng hi®roxit. l-îng kÏm tham gia ph¶n øng ë hai dung dÞch lµ nh. 2.1012. Gäi A. H·y lµm s¸ng tá ®iÒu nãi trªn b»ng c¸c phÐp tÝnh cô thÓ. Sau mét thêi gian x¸c ®Þnh.1033. V× sao D±glucoz¬ kh«ng tham gia ph¶n øng t¸ch n-íc nh. H·y cho biÕt chóng cã tÝnh quang ho¹t hay kh«ng? C©u V NH2 1. tÊm kia cã khèi l-îng 17. b) A tån t¹i ë 4 d¹ng ghÕ (D-glicopiranoz¬). C¸c aminoaxit ph¶n øng víi nhau t¹o thµnh polipeptit. Gi¶i thÝch hiÖn t-îng x¶y ra ë mçi dung dÞch. pK2 = 9. ng-êi ta cã thÓ lµm kÕt tña hoµn toµn ion Al3+ trong dung dÞch n-íc ë d¹ng hi®roxit. mçi tÊm cã khèi l-îng 10 gam vµo hai dung dÞch muèi kim lo¹i ho¸ trÞ hai.5235 gam. . C©u 2 (2 ®iÓm): Nhóng hai tÊm kÏm.A? d) ViÕt c«ng thøc cÊu tróc cña E vµ G.8. tÝch sè tan cña Mg(OH)2 lµ 4.091 gam. Cho biÕt: Mét trong hai dung dÞch muèi kim lo¹i ho¸ trÞ hai lµ muèi s¾t (II). lÊy hai tÊm kÏm ra khái dung dÞch. biÕt r»ng h»ng sè axit cña alanin: pK1 = 2. B lµ c¸c E-aminoaxit ë m«i tr-êng axit.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:42 A Br2 H2O C CaCO3 D H2O2 E HNO3 G a) ViÕt c«ng thøc Fis¬ cña A vµ B. h»ng sè ph©n ly baz¬ cña NH3 lµ 1. Cho biÕt kim lo¹i nµo tham gia vµo thµnh phÇn dung dÞch muèi thø hai. ViÕt c«ng thøc cña c¸c d¹ng ®ã vµ cho biÕt d¹ng nµo bÒn h¬n c¶? c) Dïng c«ng thøc cÊu d¹ng biÓu diÔn ph¶n øng chuyÓn ho¸ A thµnh B.35 ®èi víi c©n b»ng A X + H+ B + H+ . 1.nhau. a) X¸c ®Þnh tØ sè nång ®é cña A vµ B ë ®iÓm ®¼ng ®iÖn.69 ®èi víi c©n b»ng X bé gi¸o dôc vµ ®µo t¹o giái quèc gia k× thi chän häc sinh líp 12 thpt n¨m häc 2004-2005 ®Ò thi chÝnh thøc M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 10 / 3 / 2005 C©u 1 (2 ®iÓm): B»ng dung dÞch NH3. Cho biÕt: TÝch sè tan cña Al(OH)3 lµ 5. N H·y cho biÕt cÊu tróc cña c¸c ®ipeptit t¹o thµnh tõ leuxin CH2 CH COOH (CH3)2CHCH2CH(NH2)COOH vµ histi®in (h×nh bªn). KÕt qu¶ cho thÊy mét tÊm cã khèi l-îng 9. N 2.

3.4 V . Ng-êi ta muèn gi¶m pH cña dung dÞch NaOH xuèng cßn 11. FeSO4 + H2SO4 + HNO2 5. lnRT = 0. Khi t¨ng hiÖu ®iÖn thÕ tõ tõ ë hai cùc mçi b×nh ng-êi ta thÊy cã khÝ gièng nhau tho¸t ra ë c¶ hai b×nh t¹i cïng ®iÖn thÕ. Gi¶i thÝch hiÖn t-îng trªn. 4.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:43 C©u 3 (1. NaNO2 + H2SO4 lo·ng C©u 4 (4. ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra ë mçi b×nh (kh«ng xÐt sù t¹o thµnh H2O2 vµ H2S2O8).75 2H 2 2 2 2 .10 4 M. 1. 1.45 V .40 mol KI vµo 1 lÝt dung dÞch KMnO4 0. Cã thÓ dïng NH4Cl ®-îc kh«ng? NÕu ®-îc. c¸c d¹ng nµo lµ kh«ng bÒn? T¹i sao? 4. C©u 6 (3. nãng 3.51 V .24 M ë pH = 0 a) TÝnh thµnh phÇn cña hçn hîp sau ph¶n øng.. ViÕt ph-¬ng tr×nh nöa ph¶n øng oxi ho¸ . 3s2. VÒ ph-¬ng diÖn nhiÖt ®éng häc th× c¸c d¹ng oxi ho¸ . NaBr + H2SO4 ®Æc. I2 (r)/ 2I 0. TÝnh Eo cña c¸c cÆp IO4/ IO3 vµ IO3/ HIO 3. 3p6 lµ nguyªn tö hay ion? T¹i sao? H·y dÉn ra mét ph¶n øng ho¸ häc (nÕu cã) ®Ó minh ho¹ tÝnh chÊt ho¸ häc ®Æc tr-ng cña mçi vi h¹t. ë 25oC. h·y gi¶i thÝch vµ tÝnh khèi l-îng NH4Cl ph¶i dïng ®Ó gi¶m pH cña 1 lÝt dung dÞch NaOH tõ 14 xuèng cßn 11. 2. NaClO + PbS 4.31 V .khö nµo lµ bÒn. 2.0592 lg . §é tan cña ièt trong n-íc b»ng 5. 1/2 O / 2OH = 0.khö ®-îc cho nhsau: 2IO4/ I2 (r) 1. pKb (NH3) = 4.0. 2IO3/ I2 (r) 1. TÝnh hiÖu ®iÖn thÕ tèi thiÓu ph¶i ®Æt vµo hai cùc mçi b×nh ®Ó cho qu¸ tr×nh ®iÖn ph©n x¶y ra. b) TÝnh thÕ cña ®iÖn cùc platin nhóng trong hçn hîp thu ®-îc so víi ®iÖn cùc calomen b·o hoµ. E cña ®iÖn cùc calomen b·o hoµ b»ng 0. th× hiÖu ®iÖn thÕ tèi thiÓu ph¶i ®Æt vµo hai cùc cña b×nh ®iÖn ph©n ®Ó cho qu¸ tr×nh ®iÖn ph©n x¶y ra lµ bao nhiªu? o + E Cho biÕt: EH O. Thªm 0. KMnO4 + H2SO4 + HNO2 6. Khi pH cña dung dÞch NaOH b»ng 11. (r) chØ chÊt ë tr¹ng th¸i r¾n.19 V .54 V. nãng 2.23 V .5 ®iÓm): ë pH = 0 vµ ë 25oC thÕ ®iÖn cùc tiªu chuÈn Eo cña mét sè cÆp oxi ho¸ . Cho biÕt: C¸c vi h¹t nµy lµ ion hoÆc nguyªn tö cña nguyªn tè thuéc nhãm A vµ nhãm VIII(0). TÝnh Eo cña cÆp IO3/ I2(H2O).5 ®iÓm): Hoµn thµnh c¸c ph-¬ng tr×nh ph¶n øng sau ®©y: 1.244 V . 2HIO/ I2 (r) 1.khö cña c¸c cÆp ®· cho. NaCl + H2SO4 ®Æc.5 ®iÓm): C¸c vi h¹t cã cÊu h×nh electron ph©n líp ngoµi cïng: 3s1. F C©u 5 (2. 1/2oO / H O = 1.5 ®iÓm): Mét b×nh ®iÖn ph©n chøa dung dÞch NaOH (pH=14) vµ mét b×nh ®iÖn ph©n kh¸c chøa dung dÞch H2SO4 (pH = 0) ë 298K. 5. o Cho biÕt: EMnO4/ Mn 2+ = 1. I2(H2O) chØ ièt tan trong n-íc. 3p3.

nãng 2.091 gam.nhau. 103 mol. 2. tÊm kia cã khèi l-îng 17. FeSO4 + H2SO4 + HNO2 5. KÕt qu¶ nµy cho phÐp kÕt luËn nh. cßn ¸p suÊt tæng qu¸t vÉn b»ng 2 atm. lµm kh« råi c©n l¹i.L1. nãng 3. 1. KÕt qu¶ nµy cã cho phÐp thiÕt lËp ph-¬ng tr×nh ®éng häc (biÓu thøc tèc ®é) cña ph¶n øng hay kh«ng? 2.ë (1) nh-ng gi¶m thÓ tÝch xuèng b»ng . Gi¶i thÝch hiÖn t-îng x¶y ra ë mçi dung dÞch.s1.thÕ nµo vÒ ph-¬ng tr×nh ®éng häc cña ph¶n øng? 4.s1. H·y viÕt c¸c ph-¬ng tr×nh ph¶n øng ®· x¶y ra trong thÝ nghiÖm trªn vµ cho biÕt cã nh÷ng chÊt g× trong s¶n phÈm ®· ng-ng tô ®-îc. Sau mét thêi gian x¸c ®Þnh. Trong c¸c ®iÒu kiÖn ®ã tèc ®é ®Çu vo = 3. röa s¹ch.5 ®iÓm): Hoµn thµnh c¸c ph-¬ng tr×nh ph¶n øng sau ®©y: 1.s1.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:44 C©u 7 (4 ®iÓm): Ng-êi ta thùc hiÖn ph¶n øng 2 NO2 (k) + F2 (k) 2 NO2F (k) trong mét b×nh kÝn cã thÓ tÝch V (cã thÓ thay ®æi thÓ tÝch cña b×nh b»ng mét pÝtt«ng). Cho biÕt: Mét trong hai dung dÞch muèi kim lo¹i ho¸ trÞ hai lµ muèi s¾t (II). 3. C©u 2 (2 ®iÓm): Nhóng hai tÊm kÏm. KMnO4 + H2SO4 + HNO2 6. NaCl + H2SO4 ®Æc. 1.5 atm. NÕu thùc hiÖn ph¶n øng trªn ë cïng nhiÖt ®é víi cïng nh÷ng l-îng ban ®Çu cña chÊt ph¶n øng nh-ng thªm mét khÝ tr¬ vµo b×nh ®Ó cho thÓ tÝch thµnh 2 V. ®un nãng råi c« dung dÞch ®Õn c¹n kh«.2. l-îng kÏm tham gia ph¶n øng ë hai dung dÞch lµ nh. KÕt qu¶ cho thÊy mét tÊm cã khèi l-îng 9. F2 vµ V khÝ tr¬ nh. NaNO2 + H2SO4 lo·ng k× thi chän häc . NÕu thay cho viÖc thªm khÝ tr¬. Dù ®o¸n c¬ chÕ cña ph¶n øng. cßn cña F2 b»ng 1. bé gi¸o dôc vµ ®µo t¹o sinh giái quèc gia líp 12 thpt n¨m häc 2004-2005 ®Ò thi chÝnh thøc M«n : ho¸ häc B¶ng B Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 10 / 3 / 2005 C©u 1 (2 ®iÓm): §èt ch¸y kim lo¹i magiª trong kh«ng khÝ. Cho s¶n phÈm thu ®-îc t¸c dông víi mét l-îng ddung dÞch axit clohi®ric. ¸p suÊt ban ®Çu cña NO2 b»ng 0. NaBr + H2SO4 ®Æc. C©u 3 (1.5235 gam. Ng-êi ta l¹i thùc hiÖn ph¶n øng trªn ë cïng ®iÒu kiÖn nhiÖt ®é víi cïng nh÷ng l-îng NO2.5 atm. NaClO + PbS 4. mçi tÊm cã khèi l-îng 10 gam vµo hai dung dÞch muèi kim lo¹i ho¸ trÞ hai. lÊy hai tÊm kÏm ra khái dung dÞch.6. Cho biÕt kim lo¹i nµo tham gia vµo thµnh phÇn dung dÞch muèi thø hai. TÝnh gi¸ trÞ cña tèc ®é ®Çu vo .L1. ng-êi ta thªm NO2 vµo ®Ó2cho ¸p suÊt tæng qu¸t b»ng 4 atm vµ thÓ tÝch b»ng V th× tèc ®é ®Çu vo = 1. Nung nãng s¶n phÈm míi nµy vµ lµm ng-ng tô nh÷ng chÊt bay h¬i sinh ra trong qu¸ tr×nh nung.104 mol. th× tèc ®é ®Çu b»ng 8.102 mol.L1.

5 ®iÓm): Mét b×nh ®iÖn ph©n chøa dung dÞch NaOH (pH=14) vµ mét b×nh ®iÖn ph©n kh¸c chøa dung dÞch H2SO4 (pH = 0) ë 298K. 4.00 ml dung dÞch A. TÝnh gi¸ trÞ cña tèc ®é ®Çu vo . 1/2 O / 2OH = 0. 1.5 atm.75 2 2 2H .s1. 3.s .thÕ nµo vÒ ph-¬ng tr×nh ®éng häc cña ph¶n øng? 4. ng-êi ta thªm NO2 vµo ®Ó cho ¸p suÊt tæng qu¸t b»ng 4 atm vµ 2 1 1 thÓ tÝch b»ng V th× tèc ®é ®Çu vo = 1. Ng-êi ta l¹i thùc hiÖn ph¶n øng trªn ë cïng ®iÒu kiÖn nhiÖt ®é víi cïng nh÷ng l-îng NO2. KÕt qu¶ nµy cã cho phÐp thiÕt lËp ph-¬ng tr×nh ®éng häc (biÓu thøc tèc ®é) cña ph¶n øng hay kh«ng? 2.0. ¸p suÊt ban ®Çu cña NO2 b»ng 0. pKb (NH3) = 4. 2. cßn ¸p suÊt tæng qu¸t vÉn b»ng 2 atm.23 V . Trong c¸c ®iÒu kiÖn ®ã tèc ®é ®Çu vo = 3. Gi¶i thÝch hiÖn t-îng trªn.6. Dù ®o¸n c¬ chÕ cña ph¶n øng. K a2 = 1010.160 M vµo 10. Ng-êi ta muèn gi¶m pH cña dung dÞch NaOH xuèng cßn 11.s1. 3s2.04. Cã thÓ dïng NH4Cl ®-îc kh«ng? NÕu ®-îc. K a1 = 106.5 ®iÓm): C¸c vi h¹t cã cÊu h×nh electron ph©n líp ngoµi cïng: 3s1. TÝnh pH cña hçn hîp thu ®-îc. th× tèc ®é ®Çu b»ng 8.35 C©u 5 (2. th× hiÖu ®iÖn thÕ tèi thiÓu ph¶i ®Æt vµo hai cùc cña b×nh ®iÖn ph©n ®Ó cho qu¸ tr×nh ®iÖn ph©n x¶y ra lµ bao nhiªu? o Cho biÕt: EH O. 3p3.ë (1) nh-ng gi¶m thÓ tÝch xuèng b»ng . 2. F2 vµ V khÝ tr¬ nh. cña CaCO3 b»ng 108. 1. NÕu thùc hiÖn ph¶n øng trªn ë cïng nhiÖt ®é víi cïng nh÷ng l-îng ban ®Çu cña chÊt ph¶n øng nh-ng thªm mét khÝ tr¬ vµo b×nh ®Ó cho thÓ tÝch thµnh 2 V. 3p6 lµ nguyªn tö hay ion? T¹i sao? H·y dÉn ra mét ph¶n øng ho¸ häc (nÕu cã) ®Ó minh ho¹ tÝnh chÊt ho¸ häc ®Æc tr-ng cña mçi vi h¹t.33 §é tan cña CO2 trong n-íc b»ng 3. HCO3 + H+ .Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:45 ********************************************************************************************************************************* C©u 4 (4 ®iÓm): 1.35 Cho: CO2 + H2O HCO3 H+ + CO32 . Cã hiÖn t-îng g× x¶y ra khi thªm 1 ml dung dÞch b·o hoµ CaSO4 vµo 1 ml dung dÞch A. h·y gi¶i thÝch vµ tÝnh khèi l-îng NH4Cl ph¶i dïng ®Ó gi¶m pH cña 1 lÝt dung dÞch NaOH tõ 14 xuèng cßn 11. bé gi¸o dôc vµ ®µo t¹o sinh giái quèc gia k× thi chän häc .60 (dung dÞch A). TÝnh hiÖu ®iÖn thÕ tèi thiÓu ph¶i ®Æt vµo hai cùc mçi b×nh ®Ó cho qu¸ tr×nh ®iÖn ph©n x¶y ra.10 mol. 3. Cho biÕt: C¸c vi h¹t nµy lµ ion hoÆc nguyªn tö cña nguyªn tè thuéc nhãm A vµ nhãm VIII(0). ViÕt c¸c ph-¬ng tr×nh ph¶n øng x¶y ra ë mçi b×nh (kh«ng xÐt sù t¹o thµnh H2O2 vµ H2S2O8).104 mol. C©u 6 (3. cßn cña F2 b»ng 1.00 ml HCl 0.L . KÕt qu¶ nµy cho phÐp kÕt luËn nh. TÝnh ®é ®iÖn li cña ion CO32 trong dung dÞch Na2CO3 cã pH =11.4 + . Khi pH cña dung dÞch NaOH b»ng 11. NÕu thay cho viÖc thªm khÝ tr¬.102 M. Eo V = 1. TÝch sè tan cña CaSO4 b»ng 105.2. Khi t¨ng hiÖu ®iÖn thÕ tõ tõ ë hai cùc mçi b×nh ng-êi ta thÊy cã khÝ gièng nhau tho¸t ra ë c¶ hai b×nh t¹i cïng ®iÖn thÕ.L1. Thªm 10.L1. 103 mol. 1/2 O2 / H2O C©u 7 (4 ®iÓm): Ng-êi ta thùc hiÖn ph¶n øng 2 NO2 (k) + F2 (k) 2 NO2F (k) trong mét b×nh kÝn cã thÓ tÝch V (cã thÓ thay ®æi thÓ tÝch cña b×nh b»ng mét pÝtt«ng). 2 3.5 atm.

2. 3-phenylpropanoic tõ benzen vµ c¸c ho¸ chÊt cÇn thiÕt kh¸c.60. . ViÕt s¬ ®å ®iÒu chÕ c¸c axit sau ®©y: a) Axit: benzoic. 1. TÝnh gÇn ®óng tØ lÖ d¹ng proton ho¸ H2A+ vµ d¹ng trung hoµ HA cña prolin ë pH = 2. N . xiclohexyletanoic. 1. natri etylat vµ c¸c chÊt v« c¬). S¾p xÕp (cã gi¶i thÝch) theo tr×nh tù t¨ng dÇn tÝnh axit cña c¸c chÊt trong tõng d·y sau: a) Axit: benzoic. phenyletanoic. NÕu cho A t¸c dông víi brom theo tØ lÖ mol 1:1 råi míi ozon ph©n s¶n phÈm chÝnh sinh ra th× chØ thu ®-îc hai s¶n phÈm h÷u c¬. §un nãng A víi dung dÞch axit dÔ dµng thu ®-îc s¶n phÈm B cã cïng c«ng thøc ph©n tö nh. . TÝnh gÇn ®óng tØ lÖ d¹ng ®eproton ho¸ A vµ d¹ng trung hoµ HA cña prolin ë pH = 9. S¾p xÕp (cã gi¶i thÝch) theo tr×nh tù t¨ng dÇn nhiÖt ®é nãng ch¶y cña c¸c chÊt sau: COOH . song khi ozon ph©n B chØ cho mét s¶n phÈm h÷u c¬ duy nhÊt.A. Tõ metylamin vµ c¸c ho¸ chÊt cÇn thiÕt kh¸c (benzen. TÝnh pHI cña hîp chÊt nµy. (A) (B) (C) (D) 3. Ozon ph©n A thu ®-îc HOCH2CH=O . 1-metylxiclohexan-cacboxylic. 3. C©u 3 (3 ®iÓm): Hîp chÊt h÷u c¬ A chøa 79. N COOH COOH S . etyl acrilat. 3-phenylpropanoic. T×m c«ng thøc cÊu t¹o cña B vµ viÕt c¬ chÕ ph¶n øng chuyÓn ho¸ A thµnh B. Piroli®in (C4H9N) lµ amin vßng no n¨m c¹nh. 12. ViÕt c«ng thøc Fis¬ vµ c«ng thøc phèi c¶nh cña L-prolin.99 vµ pK2 = 10. cßn l¹i lµ O chØ chiÕm mét nguyªn tö trong ph©n tö.50. X¸c ®Þnh c«ng thøc cÊu t¹o vµ gäi tªn A. 1-metylxiclohexan-cacboxylic tõ metylenxiclohexan vµ c¸c ho¸ chÊt cÇn thiÕt kh¸c. b) Axit: xiclohexyletanoic. trong sè ®ã cã mét xeton. 2. phenyletanoic.70. CH3[CH2]2COCH3 vµ CH3CH2CO[CH2]2CH=0. h·y viÕt s¬ ®å ®iÒu chÕ N-metyl-4-phenylpiperi®in.********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:46 líp 12 thpt n¨m häc 2004-2005 ®Ò thi chÝnh thøc M«n : ho¸ häc B¶ng A Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 11 / 3 / 2005 C©u 1 (5. (C) (A) (B) C©u 2 (4 ®iÓm): L-Prolin hay axit (S)-piroli®in-2-cacboxylic cã pK1 = 1.25 ®iÓm): 1. 2.25 % H. 4.59 % C. COOH CH2COOH COOH b) N COOH .

1-metylxiclohexan-cacboxylic.25 ®iÓm): 1. §un nãng D-galactoz¬ tíi 165oC sinh ra mét hçn hîp s¶n phÈm. A kh«ng khö ®-îc dung dÞch Fehling.3. song t¸c dông ®-îc víi CH3I trong m«i tr-êng baz¬ cho s¶n phÈm råi ®em thuû ph©n th× chØ thu ®-îc 2. ViÕt c«ng thøc cÊu t¹o cña A vµ s¬ ®å c¸c ph¶n øng tæng hîp A tõ axit a®ipic (hay axit hexan®ioic) víi c¸c chÊt kh«ng vßng vµ c¸c chÊt v« c¬ kh¸c. D-Galactoz¬ lµ s¶n phÈm duy nhÊt sinh ra khi thuû ph©n hîp chÊt A (C12H22O11). B cã tÊt c¶ bao nhiªu ®ång ph©n cÊu h×nh? H·y viÕt c«ng thøc lËp thÓ cña ®ång ph©n cã cÊu h×nh toµn lµ R. N . H·y gi¶i thÝch qu¸ tr×nh h×nh thµnh B vµ viÕt c«ng thøc Fis¬ cña C. viÕt c«ng thøc vßng ph¼ng vµ c«ng thøc cÊu d¹ng cña nã. ViÕt s¬ ®å ®iÒu chÕ c¸c axit sau ®©y: a) Axit: benzoic.4. 1. §Ó thùc hiÖn ph¶n øng nµy chØ cã thÓ dïng chÊt xóc t¸c lµ axit hoÆc enzim F-galactozi®aza. 3-phenylpropanoic tõ benzen vµ c¸c ho¸ chÊt cÇn thiÕt kh¸c. Cho B t¸c dông víi CH3I (cã baz¬ xóc t¸c) råi thuû ph©n s¶n phÈm sinh ra th× thu ®-îc hîp chÊt C lµ mét dÉn xuÊt tri-O-metyl cña D-galactoz¬. 3. ViÕt c«ng thøc cÊu t¹o cña B vµ s¬ ®å c¸c ph¶n øng tæng hîp B tõ A vµ c¸c ho¸ chÊt cÇn thiÕt kh¸c.6-tetra-O-metyl-D-galactoz¬. 3-phenylpropanoic. 2. S¾p xÕp (cã gi¶i thÝch) theo tr×nh tù t¨ng dÇn nhiÖt ®é nãng ch¶y cña c¸c chÊt sau: . k× thi chän häc sinh giái quèc gia líp 12 b COOH . b) Axit: xiclohexyletanoic. 3. trong ®ã cã mét l-îng nhá hîp chÊt B. phenyletanoic. 2.75 ®iÓm): 2-(1-Hi®roxipentyl)xiclopentanon (A) lµ chÊt trung gian trong qu¸ tr×nh tæng hîp mét chÊt dïng lµm h-¬ng liÖu lµ metyl (3-oxo-2-pentylxiclopentyl)axetat (B). O O HO OH OH B C©u 5 (3. 2. Trong dung dÞch n-íc Dgalactoz¬ tån t¹i ë 5 d¹ng cÊu tróc kh¸c nhau trong mét hÖ c©n b»ng. H·y t×m cÊu tróc cña A. phenyletanoic. CH2COOH ) N COOH (A) (B) (C) (D) 3. COOH . D-Galactoz¬ lµ ®ång ph©n cÊu h×nh ë vÞ trÝ sè 4 cña D-glucoz¬. 1-metylxiclohexan-cacboxylic tõ metylenxiclohexan vµ c¸c ho¸ chÊt cÇn thiÕt kh¸c.Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:47 ********************************************************************************************************************************* C©u 4 (4 ®iÓm): 1. S¾p xÕp (cã gi¶i thÝch) theo tr×nh tù t¨ng dÇn tÝnh axit cña c¸c chÊt trong tõng d·y sau: a) Axit: benzoic. xiclohexyletanoic. H·y dïng c«ng thøc cÊu h×nh biÓu diÔn hÖ c©n b»ng ®ã vµ cho biÕt d¹ng nµo chiÕm tØ lÖ cao nhÊt. bé gi¸o dôc vµ ®µo t¹o thpt n¨m häc 2004-2005 ®Ò thi chÝnh thøc M«n : ho¸ häc B¶ng B Thêi gian : 180 phót ( kh«ng kÓ thêi gian giao ®Ò ) Ngµy thi : 11 / 3 / 2005 C©u 1 (5.

CH3[CH2]2COCH3 vµ CH3CH2CO[CH2]2CH=0. 2. b) Sau khi hoµ tan but-3-en-2-ol trong dung dÞch axit sunfuric råi ®Ó yªn mét tuÇn th× thu ®-îc c¶ but-3-en-2-ol vµ but-2-en-1-ol. 12. Tõ metylamin vµ c¸c ho¸ chÊt cÇn thiÕt kh¸c (benzen. 4. Dïng c¬ chÕ ph¶n øng ®Ó gi¶i thÝch c¸c kÕt qu¶ thùc nghiÖm sau: a) H»ng sè tèc ®é dung m«i ph©n 3-metylbut-2-enyl clorua trong etanol lín h¬n dung m«i ph©n anlyl clorua 6000 lÇn. Ozon ph©n A thu ®-îc HOCH2CH=O . 2. natri etylat vµ c¸c chÊt v« c¬).70. d) Xö lÝ but-3-en-2-ol víi hi®ro bromua còng thu ®-îc hçn hîp 1-brombut-2-en vµ 3-brombut-1-en. ViÕt c«ng thøc chiÕu Fis¬ cña d¹ng m¹ch hë c¸c chÊt sau: OH HOCH2 CH2 OH OH OH H2 C OH OH H3C OH OH OH HO OH OH O O O HO O OH HO OH CH2OH OH (A) (B) (C) (D) 2. 1.60. song khi ozon ph©n B chØ cho mét s¶n phÈm h÷u c¬ duy nhÊt.A. TÝnh gÇn ®óng tØ lÖ d¹ng proton ho¸ H2A+ vµ d¹ng trung hoµ HA cña prolin ë pH = 2. §un nãng A víi dung dÞch axit dÔ dµng thu ®-îc s¶n phÈm B cã cïng c«ng thøc ph©n tö nh.50. but-3en-2-ol víi hi®ro bromua ë trªn? V× sao? C©u 5 (3. T×m c«ng thøc cÊu t¹o cña B vµ viÕt c¬ chÕ ph¶n øng chuyÓn ho¸ A thµnh B.Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:48 COOH . etyl acrilat. ********************************************************************************************************************************* COOH COOH S N .59 % C. cßn l¹i lµ O chØ chiÕm mét nguyªn tö trong ph©n tö.99 vµ pK2 = 10. trong sè ®ã cã mét xeton. TÝnh pHI cña hîp chÊt nµy. (C). ViÕt c«ng thøc Fis¬ vµ c«ng thøc phèi c¶nh cña L-prolin. C©u 4 (4 ®iÓm): 1. 1. NÕu cho A t¸c dông víi brom theo tØ lÖ mol 1:1 råi míi ozon ph©n s¶n phÈm chÝnh sinh ra th× chØ thu ®-îc hai s¶n phÈm h÷u c¬. Piroli®in (C4H9N) lµ amin vßng no n¨m c¹nh. 2. X¸c ®Þnh c«ng thøc cÊu t¹o vµ gäi tªn A.75 ®iÓm): 1. Trong c¸c chÊt (A). (B). 3. Cho biÕt s¶n phÈm nµo lµ s¶n phÈm chÝnh trong mçi hçn hîp sau khi xö lÝ but-2-en-1-ol. C©u 3 (3 ®iÓm): Hîp chÊt h÷u c¬ A chøa 79. h·y viÕt s¬ ®å ®iÒu chÕ N-metyl-4-phenylpiperi®in. c) Xö lÝ but-2-en-1-ol víi hi®ro bromua th× thu ®-îc hçn hîp 1-brombut-2-en vµ 3-brombut-1-en.25 % H. (D) trªn. (C) (A) (B) L-Prolin hay axit (S)-piroli®in-2-cacboxylic cã pK1 = 1. chÊt nµo: a) thuéc d·y L? b) lµ ®-êng ®eoxi? c) lµ ®-êng cã m¹ch nh¸nh? d) thuéc lo¹i xetoz¬? e) cã d¹ng furanoz¬? g) cã cÊu h×nh E ë nhãm anomeric? . TÝnh gÇn ®óng tØ lÖ d¹ng ®eproton ho¸ A vµ d¹ng trung hoµ HA cña prolin ë pH = 9.

********************************************************************************************************************************* Tuyeån taäp ñeà thi hoïc sinh gioûi Quoác Gia Trang:49 ----------------------------------------------------------o o--------------------------------------------------------- .