Session:2017-18

BASAVA INTERNATIONAL SCHOOL

ANNUAL EXAMINATION
SUBJECT: CHEMISTRY (043)
CLASS: XI M. Marks: 70
DATE : M.Time:3 hr
GENERAL INSTRUCTIONS:
 All questions are compulsory. There are 26 questions in all.
 This question paper has five sections. Section A, section B, section C, section D and
section E.
 Section A contains five questions of one mark each. Section B contains five questions
of two marks each. Section C contains twelve questions of three marks each. Section D
contains one value based questions of four marks and section E contains three
questions of five marks each.
 There is no overall choice. However, an internal choice has been provided in one
question of two marks, one question of three marks and all the three questions of five
marks.
 Use log tables, if necessary. Use of calculators is not allowed.

SECTION A
1. Reactivity of group 1 elements increases top to bottom, while that of group 17 elements 1
decreases top to bottom, Why?
2. How are the pressures of n moles of a gas under ideal and real behavior related to each other? 1
3. What is the second law of thermodynamics? 1
4. What are the conjugate acid and base of ammonia? 1
5. Calculate the energy of one mole of photons of frequency 5 x 1014 Hz. 1

SECTION B

6. Chlorine is prepared in laboratory by treating manganese dioxide (MnO 2) with aqueous 2

hydrochloric acid according to the reaction:

How many grams of HCl react with 5.0g of manganese dioxide? (Atomic mass of Mn = 55u)

7. What causes the temporary and permanent hardness of water? 2

8. The enthalpy change ∆H for the following reaction is -92.38 kJ at 298 K. What will be the 2
internal energy of the reaction at 298K?

9. Write the IUPAC name of the following: 2

(i) CH3-CH(OH)-CH(NH2)-CH=CH-CH2-COCH3
(ii) HOOC-CH2- CH2- CH2-COOH
10. (i) How many position isomers of n-hexyne are possible? 2

Page 1 of 4
 Session:2017-18
(ii)Draw the staggered and eclipsed conformations of ethane (Newmann Projections).
OR
(i) Write Friedel crafts alkylation reaction.
(ii)Draw the cis and trans isomers of 2-butene.

SECTION C

11. (i) Bond dissociation energies of H2, Cl2 and HCl are 434, 242 and 431 KJ mol -1 respectively. 3
Calculate the enthalpy of formation of HCl in KJmol-1.
(ii) Under what conditions, ∆H becomes equal to ∆E?
OR
Define the following:
(Statement and mathematical expression)
(i) First law of thermodynamics
(ii) Specific heat capacity
(iii) Enthalpy

12. Calculate the frequency, energy and wavelength of the radiation corresponding to the spectral 3
line of lowest frequency in Lyman series in the spectra of H atom. ( R H = 1.09678 x 107 m-1, c = 3
x 108 ms-1, h= 6.625 x 10-34 Js).

13. (i) What is the lowest value of n that allows g orbitals to exist? 3
2+
(ii) Write the electronic configuration of Cu and find out the number of unpaired electrons in it.
Atomic number of Cu is 29.
(iii) What is the atomic number of element whose outermost electrons are represented by 3d 6?

14. (i) Out of O and S, which has higher negative electron gain enthalpy and why? 3
(ii) A and B belong to the same group of periodic table, A has higher atomic number than B.
Which will have higher ionization energy and why?
(iii) Cationic radius is always less than that of neutral atom. Why?

15. (i) Why bond angle in NH 3 is 107° while in H2O, it is 104.5° although both have tetrahedral 3
geometry?
(ii) Why does He2 not exist?

16. (i) A Compound (C7H14) on ozonolysis gives ethanal and pentan-3-one. What is the structure of 3
alkene?
(ii) How will you convert benzene into bromobenzene?
(iii) Explain Markonikov rule using the hydration of 3-methyl but-1-ene.

17. (i) A cylinder contains 10 mL of a gas at -10°C temperature and 2x10 -5 mm Hg pressure. Calculate 3
the number of moles and molecules of the gas. (R= 0.082 L atm /degree mol )
(ii) In terms of charle’s law explain why -273° C is the lowest temperature.
18. (i) Balance the following redox reaction using any method in basic medium: 3

Page 2 of 4
 Session:2017-18

(ii)Calculate the oxidation number of P in Mg2P2O7.

19. (i) Metal X is present in chlorophyll. Identify the metal X and how does this metal react with N 2 3
and O2?
(ii) Why lithium gives hydrated salts?
(iii) A solution of Na2CO3 is alkaline. Why?

20. Draw the resonating structures of the following compound. Show the electron shift using curved 3
arrow notation.
(i) C6H5NH2 (Aniline)
(ii) C6H5CHO (Benzaldehyde)
(iii) C6H5OCH3
OR
Using curved arrow notation, show the formation of reactive intermediates when the following
covalent bonds undergo heterolytic cleavage.
(i) CH3-CN
(ii) CH3-Cu
(iii) CH3-NH2

21. (i) Write the total no of hyperconjugative structure for (CH 3)3C+ , CH3CH2+ and CH3+. 3
(ii) Why the stability of carbanion follows the order 123?
(iii) Write the correct order of acidity for
CHCl2COOH, CClH2COOH and CCl3COOH

22. Write a brief note on: 3

(i) Green House effect
(ii) Ozone layer depletion
(iii) Acid rain

SECTION D

23. Enamel has calcium phosphate [Ca3(PO4)2]. When we eat sweets, they form acid in our mouth 4
which reacts with calcium phosphate and tooth decay starts. To avoid tooth decay, we should
brush our teeth after every meal. Mohan brushes his teeth twice daily whereas Sonu brushes
once only.
(i) Is calcium phosphate basic, acidic or neutral ? Why?
(ii) Is tooth paste acidic, basic or neutral?
(iii) What values are possessed by Mohan who brushes his teeth twice?
(iv) What is the expression for Ksp of Ca3(PO4)2?

SECTION E

Page 3 of 4
 Session:2017-18
24. Complete the following reactions: 5
(i)

(ii)
(iii)2

(iv)

(v)
OR
(i) Out of benzene and toluene which will undergo nitration more easily and why?
(ii) Which is more acidic ethane or ethyne ? Why?
(iii) Suggest the suitable reason for the following pattern of boiling point:
n-pentane  2-methyl butane  2,2-dimethyl propane  n-butane
(iv) What are the four necessary conditions for a system to be aromatic?
(v) Covert benzene into p-nitrotoluene.

25. (i) Explain why there is a decrease in ionization enthalpy from carbon to silicon. 5
(ii) Concentrated HNO3 can be transported in aluminium container. Give reason.
(iii) Pb(IV) is less stable than Pb(II). Why?
(iv) BCl3 has zero dipole moment. Why?
(v) What is the state of hybridization of carbon in graphite and diamond?
OR
(i) Why elements of group 14 exhibit oxidation state of +2 and +4?
(ii) Why graphite is used as lubricant?
(iii) AlCl3 acts as a lewis acid. Why?
(iv) Why CCl4 is resistant to hydrolysis but SiCl4 is readily hydrolysed?
(v) What is catenation?

26. .(i) What is the Kc for the following reaction in a state of equilibrium: 5

Given [ = 0.6M; [ 0.82M and [ 1.90M

(ii) Which of the following are Arrhenius as well as Bronsted acids?

(iii) What is the effect of adding catalyst at equilibrium in reaction?

OR
(i) Calculate the pH of M/1000HCl and 0.1M KOH.
(ii)For the following equilibrium reaction

the equilibrium constant Kc is 3.5x10-6 at 1069K. Calculate the Kp for the reaction at this
temperature?
(iii) What is buffer solution?

Page 4 of 4