SET 1:

 Nitrogen triiodide is also notable for being the only known chemical
explosive that detonates when exposed to alpha particles and
nuclear fission products. With this, answer the following:
A. Illustrate the VSEPR diagram and Lewis Dot Structure of the
molecule (N=5 e-; I=7 e-) (4 points)
B. Identify the total electron domains and its bond angle (3 points)
C. What is the electron geometry and molecular shape? (3points)

SET 2:
 Germanium Tetrafluoride is a colorless non-flammable gas. With
this, answer the following:
A. Illustrate the VSEPR diagram and Lewis Dot Structure of the
molecule (Ge=4 e-; F=7 e-) (4 points)
B. Identify the total electron domains and its bond angle (3 points)
C. What is the electron geometry and molecular shape? (3 points)

SET 3:
 Briefly explain why the value of the bond angle is decreased in the
presences of a lone pair (10 points)

SET 4:
 Transcribe the condensed formula into a skeletal or line formula (10
points
a. CH2=CH(CH2)2CH3
b. (CH3)3COH
c. CH3CH2CH2(CH2CH3)CH2CH2CH2CH3
 SET 5:
 Identify the polarity of each element to the central atom. (10 pts)

SET 6:
 Determine the IUPAC name (systematic names) of the following
structures. (10 points)

a.

b.
c.