PUNJAB GROUP OF COLLEGES (GOJRA CAMPUS)

Total Marks: 17 Chemistry Intermediate Part-II Time: 20 min.

Test Series: T-III April 2021 (Objective Part)
Name:- ____________ Roll No:- __________ Section:- ________
You have four choices for each objective type question as A, B, C and D. The choice which you think is correct, fill the relevant circle in front
ofthat question number on computerized answer sheet. Use marker or pen to fill the circles. Cutting or filling two or more circles will result in zero marks
in that question. Attempt as many questions as given in objective type question paper and leave other circles blank.
Q. No # - 1 Tick () the correct option from the columns A, B, C, D. 17x1=17
NO STATEMENT A B C D

1 The formula of marsh gas is C2H4 CH4 C2H6 C2H2

The order of reactivity of halogens with F2> Br2> F2> Cl2> I2> F2> Cl2> Br2>
2 I2> Br2> Cl2> F2
alkane is Cl2> I2 Br2 I2
When methane reacts with Cl2 in the Carbon Chloromethane Mixture of
Chloroform
3 presence of Diffused light the products tetrachloride and
only A,B, C
obtained are: only dichloromethane
4 The characteristics reactions of alkanes are Addition Substitution Polymerization Condensation
How many sigma bonds are there in
5 12 9 6 3
CH2=CH-CH=CH2?
Divinyl
6 Vinyl acetylene combines with HCl to form Benzene Chloroprene Polyacetylene
acetylene

7 The terminal hydrogen atom of alkyne is Acidic Basic Amphoteric All of these

Which one of the following gases is used

8 Ethyne Ethene Methane Propane
for artificial ripening of fruits?

9 Addition of HCN to ethyne yields Acrylonitrile Methyl nitrile Ethyl nitrile Formaldehyde

delocalized π-
Two double three double one double electron
10 The benzene molecule contains
bond bond bond charge

Substitution
Oxidation Addition Elimination
11 Benzene cannot undergo reaction
reactions reaction reaction

12 Total number of π-electrons in benzene are 3 12 6 18

Weak
Strong Weak Strong
13 The nitronium ion (NO2+) is a nucleophile
nucleophile electrophile electrophile

Ammonium
14 The fertilizer which contains 46 % N is Ammonia Urea None of these
nitrate

Which is not a calcarious material?

15 Clay Marble Marine shell Lime

Which substance in cement has greater

Alumina Iron oxide
16 percentage? Silica ( ) Lime (CaO)
( ) ( )
During manufacturing process of cement
17 the temperature of the decomposition zone 600 OC 1200 OC 900 OC 1000 OC
goes upto
PUNJAB GROUP OF COLLEGES (GOJRA CAMPUS)
Total Marks: 68 Chemistry intermediate Part-II Time: 2:40 Hrs.
Test Series: T-III April 2021 (Subjective Part) Roll No. ______
Q. No # - 2 Write short answer of the questions. PART-I (8×2=16)
1. How will you convert Ethane to Methane?
2. Why alkanes are less reactive than alkenes and alkynes?
3. What do you mean by decarboxylation of carboxylic acid?
4. How alkanes are prepared by the reduction of aldehyde and ketone?
5. Give IUPAC names of following
i) (CH3)3C-CH2-C(CH3)3
ii) CH3CH2C(CH3)2CH(CH2CH3)CH3
6. What is Markownikov’s rule? Illustrate with an example.
7. What is ozonolysis of ethene?
8. What is Baeyer’s test? Give its use.

Q. No # - 3 Write short answer of the questions. PART-II (8×2=16)

1. How mustard gas is prepared? Where is it used?
2. Why π- bond is more reactive than - bond?
3. Mention two isomers of Xylene and write their IUPAC names.
4. What information’s are obtained by the X-ray analysis of benzene?
5. Why benzene does not give addition reactions frequently?
6. Define sulphonation. Give its example.
7. Define aromatization. How benzene is obtained from n-hexane?
8. Write the general mechanism of the electrophilic aromatic substitution reaction.

Q. No # - 4 Write short answer of the questions. PART-III (6×2=12)

1. Write down essential qualities of good fertilizers.
2. What do you mean by prilling of urea?
3. Ammonium nitrate is a good fertilizer for many crops except paddy rice. Comment upon the
statement.
4. Give reactions taking place in first 24 hours in setting of cement.
5. Give an idea about clinkers. How are they converted to cement?
6. Describe the composition of good Portland cement.
Long Questions (8×3=24)
Question no 5
a) How ethene is prepared by Kolbe’s electrolytic method?
b) Prepare Oxalic acid and Chloroprene from acetylene.

Question no 6
a) Write a note on acidity of ethyne.
b) What is nitration of benzene? Explain it with mechanism.
Question no 7
a) Describe the stability of benzene on the basis of heat of hydrogenation.
b) Draw structural formulas for the following compounds
i) p-dibenzylbenzene
ii) o-ethyltoluene
iii) p-hydroxybenzoicacid
iv) p-nitroaniline