CHEMISTRY, DELHI PUBLIC SCHOOL GUWAHATI

ALDEHYDES KETONES AND CARBOXYLIC ACIDS

Class 12 - Chemistry
Time Allowed: 1 hour and 10 minutes Maximum Marks: 75

General Instructions:
All the questions are compulsory 

1. Mention a chemical property in which methanoic acid differs from acetic acid. [1]
2. Write the structure of 2-hydroxybenzoic acid. [1]
3. Give the IUPAC name of the compound [1]
CH3-CH=CH-CHO

4. Write the IUPAC name of the following compound: [1]

3 2 1

C H3 − C H − C HO
|

C H3

5. Name the following compound according to IUPAC system of nomenclature. [1]

CH3CH(CH3)CH2C(CH3)2COCH3
6. Write the IUPAC name of the compound. [1]
C H3 − C H − C H2 − COOH
|

OH

7. How would you complete the following conversion? Write the complete equation. [1]
Benzoic acid to m-nitrobenzyl alcohol
8. What is the Hofmann bromamide reaction? Illustrate with one example. [1]
9. Arrange the following in increasing order of their acidic character: [1]
Benzoic acid, Phenol, Cresol
10. Predict the products formed when cyclohexanecarbaldehyde reacts with PhMgBr and then [1]

H3O+.
11. Can Gatterman-Koch reaction be considered similar to Friedel Craft’s acylation? Discuss. [2]
12. Write IUPAC names of the following: [2]
i. HOOC − CH2 − C = CHCOOH
|

C H3

ii.

13. Arrange the following compounds in the increasing order of their property as indicated: [2]
i. CH3COCH3, C6H5COCH3, CH3CHO (reactivity towards nucleophilic addition reaction)

ii. Cl-CH2-COOH, F-CH2-COOH, CH3-COOH (acidic character)

14. Define carbonyl group. [2]

1/4
15. Using IUPAC norms write the formulae for the following : [2]
i. Hexaamminecobalt (III) sulphate
ii. Potassium trioxalatochromate (III)
16. Suggest a method for the preparation of phenyl acetic acid using a suitable Grignard reagent. [2]
17. Complete the synthesis by giving missing starting material, reagent and products:- [2]

18. Complete the following reactions: [2]

zn

i. R-CHO −−→
HC l

ii. + HNO2 ⟶

19. Write the IUPAC names for the following: [2]

i.

ii.

C H3 C H2  -  C H - COOH
|
Br

20. State the sequence of steps to obtain: [2]

i. Acetophenone from benzene.
ii. Acetone from acetyl chloride.
21. Write balanced chemical equations for the following reactions. [3]
i. Thionyl chloride reacts with benzoic acid.
ii. Acetic acid is reacted with red phosphorus and HI.
iii. Acetic acid is treated with Zn metal.
22. What happens when [3]

a. Salicylic acid is treated with (CH3CO)2O /H+?

b. Anisole is treated with CH3Cl/anhydrous AlCl3?

c. Phenol is oxidised with Na2Cr2O7/H+?

23. An organic compound (A) which has characteristic odour, on treatment with NaOH forms two [3]
compounds (B) and (C). Compound (B)has the molecular formula C7H8O which on oxidation

with CrO3 gives back compound (A). Compound (C) is the sodium salt of the acid. Compound
(C) when heated with soda lime yields an aromatic hydrocarbon (D). Deduce the structures of
(A),(B),(C) and (D). Write chemical equations for all reaction taking place.
24. Suggest the reagent to bring about the following conversions: [3]
1. Hexan-1-ol to hexanal
2. Cyclohexanol to cyclohexanone
3. 4-Fluorotoluene to 4-fluorobenzaldehyde

2/4
 4. Ethanenitrile to ethanal
25. An aromatic compound A (Molecular formula C8H8O) gives positive 2, 4-DNP test. It gives a [3]
yellow precipitate of compound B on treatment with iodine and sodium hydroxide solution.
Compound A does not give Tollen’s or Fehling’s test. On drastic oxidation with potassium
permanganate it forms a carboxylic acid C (Molecular formula C7H6O2), which is also formed
along with the yellow compound in the above reaction. Identify A, B and C and write all the
reactions involved.
26. Complete the following reaction: [3]
(i) dil N aOH

C H3 CHO + C H3 C H2 CHO −−−−−−−−→

(ii) Heat

27. PCl5 reacts with ethanol to form chloroethane. However, with phenol, it does not give [3]

chlorobenzene but gives triphenylphosphate. Explain.

28. Write reactions for obtaining: [3]
i. Acetone from acetic acid
ii. Benzene from toluene
29. How will you prepare: [3]
a. Acetic anhydride and
b. Acetyl chloride from acetic acid?
Write the reaction involved in each case.
30. Two moles of compound (A) on treatment with a strong base gives two compounds (B) and (C). [3]
The compound (B) on dehydrogenation with Cu gives (A) while acidification of (C) gives
carboxylic acid (D) having molecular formula CH2O2. Identify (A) to (D).
31. Write the IUPAC names of the following ketones and aldehydes. Wherever possible, give also [5]
common names.
i. CH3CO(CH2)4CH3

ii. CH3CH2CHBrCH2(CH3)CHO
iii. CH3(CH2)5CHO

iv. Ph - CH = CH - CHO

v.

32. Arrange the following compounds in increasing order of their reactivity in nucleophilic [5]
addition reactions.
i. Ethanal, Propanal, Propanone, Butanone.
ii. Benzaldehyde, p-Tolualdehyde, p-Nitrobenzaldehyde, Acetophenone.
Hint: Consider steric effect and electronic effect.
33. An organic compound 'A' with molecular formula C8H8O gives positive DNP test and iodoform [5]
test. It does not reduce Tollen's or Fehling's reagent and does not decolourise bromine water.
On oxidation with chromic acid (H2CrO4) it gives a carboxylic acid (B) with molecular formula
C7H6O2. Deduce the structures of A and B.

3/4
4/4